{"version":3,"file":"main.0d0e6160bb8a0fb5.js","sources":["webpack:///cs.js","webpack:///./src/app/app/app.routes.misc.ts","webpack:///./src/app/app/services/auth-guard.service.ts","webpack:///./src/app/app/utils/load-external-script.ts","webpack:///./src/app/app/services/gopay-payment.service.ts","webpack:///./src/app/app/services/upload.service.ts","webpack:///./src/app/app/states/actions/credit-bundle-choice.actions.ts","webpack:///./src/app/app/states/actions/file.action.ts","webpack:///./src/app/app/states/actions/order-credit.actions.ts","webpack:///./src/app/app/states/actions/order-file.actions.ts","webpack:///./src/app/app/states/actions/payment.actions.ts","webpack:///./src/app/app/states/actions/upload-folder.actions.ts","webpack:///./src/app/app/states/actions/voucher.actions.ts","webpack:///./src/app/app/states/reducers/order-file.reducers.ts","webpack:///./src/app/app/states/reducers/upload-folder.reducer.ts","webpack:///./src/app/app/states/selectors/credit-bundle-choice.selectors.ts","webpack:///./src/app/app/states/selectors/file.selectors.ts","webpack:///./src/app/app/states/selectors/router.selectors.ts","webpack:///./src/app/app/states/selectors/upload-folder.selectors.ts","webpack:///./src/app/app/states/selectors/voucher.selectors.ts","webpack:///./src/app/app/utils/get-http-params.ts","webpack:///./src/app/app/utils/get-payment-gateway.ts","webpack:///./src/app/auth/auth.models.ts","webpack:///./src/app/client/client.module.ts","webpack:///./src/app/auth/interceptors/auth.interceptor.ts","webpack:///./src/app/auth/services/persistence.service.ts","webpack:///./src/app/auth/store/effects/file-limit.effects.ts","webpack:///./src/app/auth/store/effects/getCreditBalance.effect.ts","webpack:///./src/app/auth/store/effects/getGeoIP.effect.ts","webpack:///./src/app/partials/video-dialog/video-dialog.component.ts","webpack:///./src/app/partials/video-dialog/video-dialog.component.html","webpack:///./src/app/auth/store/effects/getUserInfo.effect.ts","webpack:///./src/app/auth/store/effects/google-auth.effects.ts","webpack:///./src/app/auth/store/effects/login.effect.ts","webpack:///./src/app/auth/store/effects/persistence.effect.ts","webpack:///./src/app/auth/store/effects/refreshToken.effect.ts","webpack:///./src/app/auth/store/effects/register.effect.ts","webpack:///./src/app/auth/store/effects/reset-password-confirm.effects.ts","webpack:///./src/app/auth/store/effects/reset-password.effects.ts","webpack:///./src/app/auth/store/auth.effects.ts","webpack:///./src/app/auth/store/effects/verifyEmail.effect.ts","webpack:///./src/app/auth/auth.module.ts","webpack:///./src/app/auth/store/actions/file-limit.action.ts","webpack:///./src/app/auth/store/actions/getCreditBalance.actions.ts","webpack:///./src/app/auth/store/actions/getGeoIP.action.ts","webpack:///./src/app/auth/store/actions/getUserInfo.action.ts","webpack:///./src/app/auth/store/actions/google-auth.action.ts","webpack:///./src/app/auth/store/actions/loadToken.action.ts","webpack:///./src/app/auth/store/actions/locationVerify.ts","webpack:///./src/app/auth/store/actions/login.action.ts","webpack:///./src/app/auth/store/actions/logout.action.ts","webpack:///./src/app/auth/store/actions/refreshToken.action.ts","webpack:///./src/app/auth/store/actions/register.action.ts","webpack:///./src/app/auth/store/actions/reset-password-confirm.actions.ts","webpack:///./src/app/auth/store/actions/reset-password.actions.ts","webpack:///./src/app/auth/store/actions/verifyEmail.action.ts","webpack:///./src/app/auth/store/reducers/google-auth.reducer.ts","webpack:///./src/app/auth/store/reducers/register.reducer.ts","webpack:///./src/app/auth/store/reducers/reset-password.reducer.ts","webpack:///./src/app/auth/store/reducers/user.reducer.ts","webpack:///./src/app/auth/store/reducers/verifyEmail.reducer.ts","webpack:///./src/app/auth/store/auth.reducers.ts","webpack:///./src/app/auth/store/auth.utils.ts","webpack:///./src/app/auth/store/models/user.ts","webpack:///./src/app/auth/store/selectors/google-auth.selector.ts","webpack:///./src/app/auth/store/selectors/register.selector.ts","webpack:///./src/app/auth/store/selectors/user.selector.ts","webpack:///./src/app/client/models/payment.models.ts","webpack:///./src/app/client/services/billing-service.client.ts","webpack:///./src/app/client/services/mytitle-service.client.ts","webpack:///./src/app/client/services/render-service.client.ts","webpack:///./src/app/client/services/users-service.client.ts","webpack:///./src/app/pages/about/about.routes.misc.ts","webpack:///./src/app/pages/credit-bundle-choice/credit-bundle-choice.utils.ts","webpack:///./src/app/pages/error/error.routes.misc.ts","webpack:///./src/app/pages/login/login.routes.misc.ts","webpack:///./src/app/pages/login/store/login.reducer.ts","webpack:///./src/app/pages/login/store/login.selector.ts","webpack:///./src/app/pages/my-documents/store/actions/document-activity.actions.ts","webpack:///./src/app/pages/my-documents/store/actions/folder.actions.ts","webpack:///./src/app/pages/my-documents/store/actions/my-documents.actions.ts","webpack:///./src/app/pages/my-documents/store/actions/shared-document.actions.ts","webpack:///./src/app/pages/my-documents/store/actions/shared-folder.actions.ts","webpack:///./src/app/pages/my-documents/store/actions/sharing.actions.ts","webpack:///./src/app/pages/my-documents/store/reducers/document-activity.reducer.ts","webpack:///./src/app/pages/my-documents/store/reducers/folder.reducer.ts","webpack:///./src/app/pages/my-documents/store/reducers/my-documents.reducers.ts","webpack:///./src/app/pages/my-documents/store/reducers/shared-document.reducer.ts","webpack:///./src/app/pages/my-documents/store/reducers/shared-folder.reducer.ts","webpack:///./src/app/pages/my-documents/store/reducers/sharing.reducer.ts","webpack:///./src/app/pages/my-documents/store/my-documents.reducers.ts","webpack:///./src/app/pages/my-documents/store/selectors/folder.selectors.ts","webpack:///./src/app/pages/settings/store/actions/change-user-info.actions.ts","webpack:///./src/app/pages/settings/store/actions/two-factor-authentication.actions.ts","webpack:///./src/app/pages/sign-up/sign-up.routes.misc.ts","webpack:///./src/app/partials/confirmation-dialog/confirmation-dialog.module.ts","webpack:///./src/app/partials/confirmation-dialog/confirmation-dialog/confirmation-dialog.component.ts","webpack:///./src/app/partials/confirmation-dialog/confirmation-dialog/confirmation-dialog.component.html","webpack:///./src/app/partials/drop-zone/drop-zone.component.ts","webpack:///./src/app/partials/drop-zone/drop-zone.component.html","webpack:///./src/app/partials/drop-zone/drop-zone.module.ts","webpack:///./src/app/partials/folder-upload/folder-upload.component.ts","webpack:///./src/app/partials/folder-upload/folder-upload.component.html","webpack:///./src/app/partials/folder-upload/folder-upload.module.ts","webpack:///./src/app/partials/footer/footer.module.ts","webpack:///./src/app/partials/payment-options/payment-options.module.ts","webpack:///./src/app/partials/payment-options/payment-options/payment-options.component.ts","webpack:///./src/app/partials/payment-options/payment-options/payment-options.component.html","webpack:///./src/app/shared/models/notifications-cs.ts","webpack:///./src/app/shared/services/data-layer.service.ts","webpack:///./src/app/shared/services/environment.service.ts","webpack:///./src/app/shared/services/error-helper.service.ts","webpack:///./src/app/shared/services/snackbar.service.ts","webpack:///./src/app/shared/universal/transfer-state/browser-import-state/browser-import-ssr-state.module.ts","webpack:///./src/app/shared/universal/transfer-state/browser-import-state/import.actions.ts","webpack:///./node_modules/rxjs/_esm2015/internal/operators/skipWhile.js","webpack:///./src/app/shared/universal/universal.service.ts","webpack:///./src/app/shared/utils/get-file-credits-value.ts","webpack:///./src/environments/environment.prod-cs.ts","webpack:///./src/environments/models/language.models.ts","webpack:///./src/app/shared/services/data-layer.events.ts","webpack:///./src/app/app/states/actions/layout.actions.ts","webpack:///./src/app/app/states/reducers/layout.reducers.ts","webpack:///./src/app/app/states/selectors/layout.selectors.ts","webpack:///./src/app/app/services/meta-tag.service.ts","webpack:///./src/app/partials/user-indicator/user-indicator/user-indicator.component.ts","webpack:///./src/app/partials/user-indicator/user-indicator/user-indicator.component.html","webpack:///./src/app/app/directives/scroll/scroll-manager.directive.ts","webpack:///./src/app/app/directives/scroll/scroll-anchor.directive.ts","webpack:///./src/app/partials/navbar/navbar/navbar.component.html","webpack:///./src/app/partials/navbar/navbar/navbar.component.ts","webpack:///./src/app/partials/navbar/navbar-mobile/navbar-mobile.component.html","webpack:///./src/app/partials/navbar/navbar-mobile/navbar-mobile.component.ts","webpack:///./src/app/partials/footer/footer/footer.component.html","webpack:///./src/app/partials/footer/footer/footer.component.ts","webpack:///./src/app/app/app.component.ts","webpack:///./src/app/app/app.component.html","webpack:///./node_modules/@angular/common/locales/cs.mjs","webpack:///./node_modules/@sentry/core/esm/integrations/inboundfilters.js","webpack:///./node_modules/@sentry/core/esm/integrations/functiontostring.js","webpack:///./node_modules/@sentry/core/esm/integration.js","webpack:///./node_modules/@sentry/utils/esm/dsn.js","webpack:///./node_modules/@sentry/core/esm/api.js","webpack:///./node_modules/@sentry/utils/esm/stacktrace.js","webpack:///./node_modules/@sentry/utils/esm/supports.js","webpack:///./node_modules/@sentry/utils/esm/vendor/supportsHistory.js","webpack:///./node_modules/@sentry/utils/esm/instrument.js","webpack:///./node_modules/@sentry/utils/esm/normalize.js","webpack:///./node_modules/@sentry/utils/esm/memo.js","webpack:///./node_modules/@sentry/utils/esm/envelope.js","webpack:///./node_modules/@sentry/utils/esm/error.js","webpack:///./node_modules/@sentry/core/esm/utils/prepareEvent.js","webpack:///./node_modules/@sentry/core/esm/baseclient.js","webpack:///./node_modules/@sentry/core/esm/envelope.js","webpack:///./node_modules/@sentry/core/esm/tracing/dynamicSamplingContext.js","webpack:///./node_modules/@sentry/core/esm/version.js","webpack:///./node_modules/@sentry/browser/esm/eventbuilder.js","webpack:///./node_modules/@sentry/browser/esm/helpers.js","webpack:///./node_modules/@sentry/utils/esm/severity.js","webpack:///./node_modules/@sentry/utils/esm/url.js","webpack:///./node_modules/@sentry/browser/esm/integrations/breadcrumbs.js","webpack:///./node_modules/@sentry/browser/esm/client.js","webpack:///./node_modules/@sentry/browser/esm/userfeedback.js","webpack:///./node_modules/@sentry/utils/esm/clientreport.js","webpack:///./node_modules/@sentry/browser/esm/integrations/globalhandlers.js","webpack:///./node_modules/@sentry/browser/esm/integrations/trycatch.js","webpack:///./node_modules/@sentry/utils/esm/aggregate-errors.js","webpack:///./node_modules/@sentry/browser/esm/integrations/linkederrors.js","webpack:///./node_modules/@sentry/browser/esm/integrations/httpcontext.js","webpack:///./node_modules/@sentry/browser/esm/integrations/dedupe.js","webpack:///./node_modules/@sentry/browser/esm/stack-parsers.js","webpack:///./node_modules/@sentry/utils/esm/ratelimit.js","webpack:///./node_modules/@sentry/core/esm/transports/base.js","webpack:///./node_modules/@sentry/utils/esm/promisebuffer.js","webpack:///./node_modules/@sentry/browser/esm/transports/utils.js","webpack:///./node_modules/@sentry/browser/esm/transports/fetch.js","webpack:///./node_modules/@sentry/browser/esm/transports/xhr.js","webpack:///./node_modules/@sentry/browser/esm/sdk.js","webpack:///./node_modules/@sentry/angular-ivy/fesm2015/sentry-angular-ivy.js","webpack:///./src/app/partials/video-dialog/video-dialog.module.ts","webpack:///./src/app/app/directives/scroll/scroll.module.ts","webpack:///./src/app/partials/user-indicator/user-indicator.module.ts","webpack:///./src/app/partials/navbar/navbar.module.ts","webpack:///./src/app/pages/faq/faq.ts","webpack:///./src/app/pages/faq/faq.component.html","webpack:///./src/app/pages/faq/faq.component.ts","webpack:///./src/app/app/directives/scroll/scroll-section.directive.ts","webpack:///./node_modules/rxjs/_esm2015/internal/operators/repeatWhen.js","webpack:///./src/app/app/home/how-it-works/how-it-works.component.ts","webpack:///./src/app/app/home/how-it-works/how-it-works.component.html","webpack:///./src/app/app/home/pricing/pricing.component.html","webpack:///./src/app/app/home/pricing/pricing.component.ts","webpack:///./src/app/shared/utils/animation-on-scroll/animation-on-scroll.directive.ts","webpack:///./src/app/app/home/map/map.component.html","webpack:///./src/app/app/home/map/map.component.ts","webpack:///./src/app/app/home/blog-section/blog-section.component.ts","webpack:///./src/app/app/home/blog-section/blog-section.component.html","webpack:///./src/app/app/home/certificate/certificate.component.html","webpack:///./src/app/app/home/certificate/certificate.component.ts","webpack:///./src/app/app/home/quoted-header/quoted-header.component.html","webpack:///./src/app/app/home/quoted-header/quoted-header.component.ts","webpack:///./src/app/app/home/testimonials/testimonials.component.ts","webpack:///./src/app/app/home/testimonials/testimonials.component.html","webpack:///./src/app/app/home/home.component.ts","webpack:///./src/app/app/home/home.component.html","webpack:///./src/app/app/services/confirm-email-guard.service.ts","webpack:///./src/app/app/services/credit-file-guard.service.ts","webpack:///./src/app/app/services/document-guard.service.ts","webpack:///./src/app/app/services/prevent-authorized-visitor.service.ts","webpack:///./src/app/app/app.routes.ts","webpack:///./node_modules/@angular/animations/fesm2020/browser.mjs","webpack:///./node_modules/@angular/platform-browser/fesm2020/animations.mjs","webpack:///./src/app/shared/utils/animation-on-scroll/animation-on-scroll.module.ts","webpack:///./src/app/pages/faq/faq.module.ts","webpack:///./src/app/app/home/home.module.ts","webpack:///./src/app/app/states/effects/credit-bundle-choice.effects.ts","webpack:///./src/app/app/utils/file-extensions.ts","webpack:///./src/app/app/states/effects/file-routing.effects.ts","webpack:///./src/app/app/states/effects/file.effects.ts","webpack:///./src/app/app/states/effects/order-credit.effects.ts","webpack:///./src/app/app/states/effects/order-file.effects.ts","webpack:///./src/app/app/states/effects/payment.effects.ts","webpack:///./src/app/app/states/models/file.models.ts","webpack:///./src/app/app/states/effects/router.effects.ts","webpack:///./src/app/shared/utils/folder-parser.ts","webpack:///./src/app/app/states/effects/upload-folder.effects.ts","webpack:///./src/app/app/states/app.effects.ts","webpack:///./src/app/app/states/effects/voucher.effects.ts","webpack:///./src/app/app/states/reducers/credit-bundle-choice.reducer.ts","webpack:///./src/app/app/states/reducers/file.reducers.ts","webpack:///./src/app/app/states/reducers/payment.reducers.ts","webpack:///./src/app/app/states/reducers/voucher.reducer.ts","webpack:///./src/app/app/states/app.reducers.ts","webpack:///./src/app/shared/universal/transfer-state/browser-import-state/import.reducers.ts","webpack:///./src/app/shared/universal/validate-state/validate-state.reducer.ts","webpack:///./src/app/app/states/router.serializer.ts","webpack:///./src/app/app/app.module.ts","webpack:///./node_modules/@sentry/core/esm/sdk.js","webpack:///./src/app/app/app.browser.module.ts","webpack:///./src/main.ts","webpack:///./node_modules/@sentry/core/esm/constants.js","webpack:///./node_modules/@sentry/core/esm/exports.js","webpack:///./node_modules/@sentry/core/esm/hub.js","webpack:///./node_modules/@sentry/core/esm/scope.js","webpack:///./node_modules/@sentry/core/esm/session.js","webpack:///./node_modules/@sentry/utils/esm/browser.js","webpack:///./node_modules/@sentry/utils/esm/env.js","webpack:///./node_modules/@sentry/utils/esm/is.js","webpack:///./node_modules/@sentry/utils/esm/logger.js","webpack:///./node_modules/@sentry/utils/esm/misc.js","webpack:///./node_modules/@sentry/utils/esm/node.js","webpack:///./node_modules/@sentry/utils/esm/object.js","webpack:///./node_modules/@sentry/utils/esm/string.js","webpack:///./node_modules/@sentry/utils/esm/syncpromise.js","webpack:///./node_modules/@sentry/utils/esm/time.js","webpack:///./node_modules/@sentry/utils/esm/worldwide.js","webpack:///./node_modules/jwt-decode/lib/atob.js","webpack:///./node_modules/jwt-decode/lib/base64_url_decode.js","webpack:///./node_modules/jwt-decode/lib/index.js","webpack:///./node_modules/rxjs/_esm2015/internal/BehaviorSubject.js","webpack:///./node_modules/rxjs/_esm2015/internal/Notification.js","webpack:///./node_modules/rxjs/_esm2015/internal/Observable.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/toSubscriber.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/canReportError.js","webpack:///./node_modules/rxjs/_esm2015/internal/Observer.js","webpack:///./node_modules/rxjs/_esm2015/internal/OuterSubscriber.js","webpack:///./node_modules/rxjs/_esm2015/internal/ReplaySubject.js","webpack:///./node_modules/rxjs/_esm2015/internal/Subject.js","webpack:///./node_modules/rxjs/_esm2015/internal/SubjectSubscription.js","webpack:///./node_modules/rxjs/_esm2015/internal/Subscriber.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/UnsubscriptionError.js","webpack:///./node_modules/rxjs/_esm2015/internal/Subscription.js","webpack:///./node_modules/rxjs/_esm2015/internal/config.js","webpack:///./node_modules/rxjs/_esm2015/internal/innerSubscribe.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/ConnectableObservable.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/combineLatest.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/concat.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/concatAll.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/defer.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/empty.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/forkJoin.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/from.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/fromArray.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/fromEvent.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/merge.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/of.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/throwError.js","webpack:///./node_modules/rxjs/_esm2015/internal/observable/timer.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/catchError.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/concatMap.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/debounceTime.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/defaultIfEmpty.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/delay.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/distinctUntilChanged.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/filter.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/finalize.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/first.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/map.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/mapTo.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/mergeAll.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/mergeMap.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/mergeMapTo.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/observeOn.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/refCount.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/scan.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/multicast.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/share.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/skip.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/startWith.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/switchMap.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/switchMapTo.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/take.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/takeUntil.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/takeWhile.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/noop.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/tap.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/throwIfEmpty.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/TimeoutError.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/timeoutWith.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/timeout.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/withLatestFrom.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduled/scheduleArray.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduled/scheduled.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isInteropObservable.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduled/scheduleObservable.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduled/schedulePromise.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isIterable.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduled/scheduleIterable.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/Action.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/AsyncAction.js","webpack:///./node_modules/rxjs/_esm2015/internal/Scheduler.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/AsyncScheduler.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/animationFrame.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/AnimationFrameScheduler.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/AnimationFrameAction.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/Immediate.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/asap.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/AsapScheduler.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/AsapAction.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/async.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/queue.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/QueueScheduler.js","webpack:///./node_modules/rxjs/_esm2015/internal/scheduler/QueueAction.js","webpack:///./node_modules/rxjs/_esm2015/internal/symbol/iterator.js","webpack:///./node_modules/rxjs/_esm2015/internal/symbol/observable.js","webpack:///./node_modules/rxjs/_esm2015/internal/symbol/rxSubscriber.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/ArgumentOutOfRangeError.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/EmptyError.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/ObjectUnsubscribedError.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/hostReportError.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/identity.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isArray.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isArrayLike.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isDate.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isFunction.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isNumeric.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isObject.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isPromise.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/isScheduler.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/pipe.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/subscribeTo.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/subscribeToObservable.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/subscribeToPromise.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/subscribeToIterable.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/subscribeToArray.js","webpack:///./node_modules/rxjs/_esm2015/internal/InnerSubscriber.js","webpack:///./node_modules/rxjs/_esm2015/internal/util/subscribeToResult.js","webpack:///./node_modules/uuid/dist/esm-browser/native.js","webpack:///./node_modules/uuid/dist/esm-browser/rng.js","webpack:///./node_modules/uuid/dist/esm-browser/stringify.js","webpack:///./node_modules/uuid/dist/esm-browser/v4.js","webpack:///./node_modules/zone.js/fesm2015/zone.js","webpack:///./node_modules/@angular/animations/fesm2020/animations.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/a11y.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/bidi.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/coercion.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/collections.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/keycodes.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/layout.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/observers.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/overlay.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/platform.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/portal.mjs","webpack:///./node_modules/rxjs/_esm2015/internal/operators/audit.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/auditTime.js","webpack:///./node_modules/@angular/cdk/fesm2020/scrolling.mjs","webpack:///./node_modules/@angular/common/fesm2020/common.mjs","webpack:///./node_modules/@angular/common/fesm2020/http.mjs","webpack:///./node_modules/@angular/core/fesm2020/core.mjs","webpack:///./node_modules/@angular/forms/fesm2020/forms.mjs","webpack:///./node_modules/@angular/material/fesm2020/core.mjs","webpack:///./node_modules/@angular/material/fesm2020/divider.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/accordion.mjs","webpack:///./node_modules/@angular/material/fesm2020/expansion.mjs","webpack:///./node_modules/@angular/material/fesm2020/icon.mjs","webpack:///./node_modules/@angular/material/fesm2020/legacy-button.mjs","webpack:///./node_modules/@angular/cdk/fesm2020/dialog.mjs","webpack:///./node_modules/@angular/material/fesm2020/dialog.mjs","webpack:///./node_modules/@angular/material/fesm2020/legacy-dialog.mjs","webpack:///./node_modules/@angular/material/fesm2020/menu.mjs","webpack:///./node_modules/@angular/material/fesm2020/legacy-menu.mjs","webpack:///./node_modules/@angular/material/fesm2020/snack-bar.mjs","webpack:///./node_modules/@angular/material/fesm2020/legacy-snack-bar.mjs","webpack:///./node_modules/@angular/material/fesm2020/tabs.mjs","webpack:///./node_modules/@angular/material/fesm2020/legacy-tabs.mjs","webpack:///./node_modules/@angular/platform-browser/fesm2020/platform-browser.mjs","webpack:///./node_modules/rxjs/_esm2015/internal/operators/takeLast.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/last.js","webpack:///./node_modules/@angular/router/fesm2020/router.mjs","webpack:///./node_modules/rxjs/_esm2015/internal/operators/ignoreElements.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/materialize.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/groupBy.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/exhaustMap.js","webpack:///./node_modules/rxjs/_esm2015/internal/operators/dematerialize.js","webpack:///./node_modules/@ngrx/effects/fesm2020/ngrx-effects.mjs","webpack:///./node_modules/@ngrx/router-store/fesm2020/ngrx-router-store.mjs","webpack:///./node_modules/@ngrx/store-devtools/fesm2020/ngrx-store-devtools.mjs","webpack:///./node_modules/@ngrx/store/fesm2020/ngrx-store.mjs","webpack:///./node_modules/rxjs/_esm2015/internal/operators/pluck.js"],"sourceRoot":"webpack:///","sourcesContent":["\"use strict\";(function(global){global.ng=global.ng||{};global.ng.common=global.ng.common||{};global.ng.common.locales=global.ng.common.locales||{};const u=undefined;function plural(val){const n=val,i=Math.floor(Math.abs(val)),v=val.toString().replace(/^[^.]*\\.?/,\"\").length;if(i===1&&v===0)return 1;if(i===Math.floor(i)&&i>=2&&i<=4&&v===0)return 3;if(!(v===0))return 4;return 5}global.ng.common.locales[\"cs\"]=[\"cs\",[[\"dop.\",\"odp.\"],u,u],u,[[\"N\",\"P\",\"\\xDA\",\"S\",\"\\u010C\",\"P\",\"S\"],[\"ne\",\"po\",\"\\xFAt\",\"st\",\"\\u010Dt\",\"p\\xE1\",\"so\"],[\"ned\\u011Ble\",\"pond\\u011Bl\\xED\",\"\\xFAter\\xFD\",\"st\\u0159eda\",\"\\u010Dtvrtek\",\"p\\xE1tek\",\"sobota\"],[\"ne\",\"po\",\"\\xFAt\",\"st\",\"\\u010Dt\",\"p\\xE1\",\"so\"]],u,[[\"1\",\"2\",\"3\",\"4\",\"5\",\"6\",\"7\",\"8\",\"9\",\"10\",\"11\",\"12\"],[\"led\",\"\\xFAno\",\"b\\u0159e\",\"dub\",\"kv\\u011B\",\"\\u010Dvn\",\"\\u010Dvc\",\"srp\",\"z\\xE1\\u0159\",\"\\u0159\\xEDj\",\"lis\",\"pro\"],[\"ledna\",\"\\xFAnora\",\"b\\u0159ezna\",\"dubna\",\"kv\\u011Btna\",\"\\u010Dervna\",\"\\u010Dervence\",\"srpna\",\"z\\xE1\\u0159\\xED\",\"\\u0159\\xEDjna\",\"listopadu\",\"prosince\"]],[[\"1\",\"2\",\"3\",\"4\",\"5\",\"6\",\"7\",\"8\",\"9\",\"10\",\"11\",\"12\"],[\"led\",\"\\xFAno\",\"b\\u0159e\",\"dub\",\"kv\\u011B\",\"\\u010Dvn\",\"\\u010Dvc\",\"srp\",\"z\\xE1\\u0159\",\"\\u0159\\xEDj\",\"lis\",\"pro\"],[\"leden\",\"\\xFAnor\",\"b\\u0159ezen\",\"duben\",\"kv\\u011Bten\",\"\\u010Derven\",\"\\u010Dervenec\",\"srpen\",\"z\\xE1\\u0159\\xED\",\"\\u0159\\xEDjen\",\"listopad\",\"prosinec\"]],[[\"p\\u0159.n.l.\",\"n.l.\"],[\"p\\u0159. n. l.\",\"n. l.\"],[\"p\\u0159ed na\\u0161\\xEDm letopo\\u010Dtem\",\"na\\u0161eho letopo\\u010Dtu\"]],1,[6,0],[\"dd.MM.yy\",\"d. M. y\",\"d. MMMM y\",\"EEEE d. MMMM y\"],[\"H:mm\",\"H:mm:ss\",\"H:mm:ss z\",\"H:mm:ss zzzz\"],[\"{1} {0}\",u,u,u],[\",\",\"\\xA0\",\";\",\"%\",\"+\",\"-\",\"E\",\"\\xD7\",\"\\u2030\",\"\\u221E\",\"NaN\",\":\"],[\"#,##0.###\",\"#,##0\\xA0%\",\"#,##0.00\\xA0\\xA4\",\"#E0\"],\"CZK\",\"K\\u010D\",\"\\u010Desk\\xE1 koruna\",{\"AUD\":[\"AU$\",\"$\"],\"BYN\":[u,\"\\u0440.\"],\"CSK\":[\"K\\u010Ds\"],\"CZK\":[\"K\\u010D\"],\"ILS\":[u,\"\\u20AA\"],\"INR\":[u,\"\\u20B9\"],\"JPY\":[\"JP\\xA5\",\"\\xA5\"],\"PHP\":[u,\"\\u20B1\"],\"RON\":[u,\"L\"],\"RUR\":[u,\"\\u0440.\"],\"TWD\":[\"NT$\"],\"USD\":[\"US$\",\"$\"],\"VND\":[u,\"\\u20AB\"],\"XEU\":[\"ECU\"],\"XXX\":[]},\"ltr\",plural,[[[\"p\\u016Fl.\",\"pol.\",\"r.\",\"d.\",\"o.\",\"v.\",\"n.\"],[\"p\\u016Fln.\",\"pol.\",\"r.\",\"dop.\",\"odp.\",\"ve\\u010D.\",\"v n.\"],[\"p\\u016Flnoc\",\"poledne\",\"r\\xE1no\",\"dopoledne\",\"odpoledne\",\"ve\\u010Der\",\"v noci\"]],[[\"p\\u016Fl.\",\"pol.\",\"r\\xE1no\",\"dop.\",\"odp.\",\"ve\\u010D.\",\"noc\"],[\"p\\u016Flnoc\",\"poledne\",\"r\\xE1no\",\"dopoledne\",\"odpoledne\",\"ve\\u010Der\",\"noc\"],u],[\"00:00\",\"12:00\",[\"04:00\",\"09:00\"],[\"09:00\",\"12:00\"],[\"12:00\",\"18:00\"],[\"18:00\",\"22:00\"],[\"22:00\",\"04:00\"]]]]})(typeof globalThis!==\"undefined\"&&globalThis||typeof global!==\"undefined\"&&global||typeof window!==\"undefined\"&&window);","/**\n * Enum of paths for app routes.\n */\nexport enum AppRoutes {\n About = 'about',\n CreditBundleChoice = 'security-pricing',\n DocumentCredentials = 'document-credentials',\n DocumentProgress = 'document-progress',\n FolderUploadConfirmation = 'folder-upload-confirmation',\n FolderUploadCredentials = 'folder-upload-credentials',\n FolderUploadProgress = 'folder-upload-progress',\n DeletionDocumentsConfirm = 'deletion',\n EmailConfirmation = 'email-confirmation',\n FAQ = 'faq',\n Error = 'error',\n Login = 'login',\n MyDocuments = 'my-documents',\n CreditOrderSummary = 'credit-order-summary',\n PaymentConfirmation = 'payment-confirmation',\n ResetPassword = 'reset-password-request',\n ResetPasswordSent = 'sent',\n ResetPasswordConfirm = 'reset-password',\n SignUp = 'sign-up',\n Verification = 'verification',\n Settings = 'settings',\n NotFound = '**',\n FolderCredentials = 'folder-credentials',\n WatermarkSelection = 'watermark',\n}\n","import { Injectable } from '@angular/core';\nimport { CanActivate, Router, UrlTree } from '@angular/router';\nimport { select, Store } from '@ngrx/store';\nimport { Observable } from 'rxjs';\nimport { map, take } from 'rxjs/operators';\nimport { getIsAuthorized } from '../../auth/store/selectors/user.selector';\nimport { AppRoutes } from '../app.routes.misc';\n\n@Injectable({\n providedIn: 'root',\n})\nexport class AuthGuardService implements CanActivate {\n\n constructor(\n private router: Router,\n private store: Store,\n ) { }\n\n public canActivate(): Observable {\n return this.store.pipe(\n select(getIsAuthorized),\n take(1),\n map(isAuthorized => {\n if (!isAuthorized) return this.router.createUrlTree(['/', AppRoutes.Login]);\n return isAuthorized;\n }),\n );\n }\n}\n","export function loadExternalScript(scriptUrl: string): Promise {\n return new Promise(resolve => {\n const scriptElement = document.createElement('script');\n scriptElement.src = scriptUrl;\n scriptElement.onload = resolve;\n document.body.appendChild(scriptElement);\n });\n}\n","import { Injectable } from '@angular/core';\n\nimport { loadExternalScript } from 'src/app/app/utils/load-external-script';\nimport { UniversalService } from 'src/app/shared/universal/universal.service';\nimport { AvailableLanguageMutations } from 'src/environments/models/language.models';\n\nexport const GOPAY_PAYMENT_COUNTRIES: string[] = [\n AvailableLanguageMutations.CZECH,\n AvailableLanguageMutations.ENGLISH,\n];\n\n@Injectable()\nexport class GopayPaymentService {\n\n constructor(private universalService: UniversalService) {\n\n if (!this.universalService.isPlatformServer()) {\n if (location.hostname !== 'localhost' && !location.hostname.includes('dev')) {\n loadExternalScript('https://gate.gopay.cz/gp-gw/js/embed.js');\n } else {\n loadExternalScript('https://gw.sandbox.gopay.com/gp-gw/js/embed.js');\n }\n }\n\n }\n\n public triggerPaygate(gw_url: string) {\n (window as any)._gopay.checkout({ gatewayUrl: gw_url, inline: true });\n }\n\n}\n","import { Injectable } from '@angular/core';\nimport { Store } from '@ngrx/store';\nimport { FileUpdated } from '../states/actions/file.action';\nimport { DisplayFolderCreditConfirmation } from '../states/actions/upload-folder.actions';\nimport { FileExt } from '../states/reducers/upload-folder.reducer';\n\n@Injectable({\n providedIn: 'root',\n})\nexport class UploadService {\n public parentFolder: string;\n\n constructor( private store: Store) {\n }\n\n public fileAdded(file: File, parentFolder: string = null) {\n this.store.dispatch(new FileUpdated({\n file,\n folder: parentFolder,\n is_free: false,\n uploadNow: true,\n }));\n }\n\n\n //TODO: check parent fodler functionality\n public folderUpload(files: FileExt[]) {\n this.store.dispatch(\n new DisplayFolderCreditConfirmation({\n parentGuid: this.parentFolder,\n files,\n }),\n );\n }\n\n}\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport {\n CreateCreditOrderParams,\n GetCreditOrderConfigResponse,\n} from 'src/app/client/models/credit.models';\n\nexport enum CreditBundleChoiceActions {\n USER_PRICING_CHANGED = '[credit] User pricing changed due to localization',\n REPEAT_CREDIT_CHOICE = '[credit] Redirecting back to credit bundle choice page',\n GET_PRICE_RANGE = '[credit] Requesting price range',\n GET_PRICE_RANGE_SUCCESS = '[credit] Successfully retreived price range',\n GET_CREDIT_BUNDLES = '[credit] Requesting credit bundles',\n GET_CREDIT_BUNDLES_SUCCESS = '[credit] Successfully retreived credit bundles',\n GET_CREDIT_ORDER_SUMMARY = '[credit] Successfully retreived credit order summary',\n}\n\nexport class UserPricingChanged implements Action {\n public readonly type = CreditBundleChoiceActions.USER_PRICING_CHANGED;\n}\n\nexport class RepeatCreditChoice implements Action {\n public readonly type = CreditBundleChoiceActions.REPEAT_CREDIT_CHOICE;\n}\n\nexport class GetPriceRange implements Action {\n public readonly type = CreditBundleChoiceActions.GET_PRICE_RANGE;\n}\n\nexport class GetPriceRangeSuccess implements Action {\n public readonly type = CreditBundleChoiceActions.GET_PRICE_RANGE_SUCCESS;\n constructor(public payload: string[]) {}\n}\n\nexport class GetCreditBundles implements Action {\n public readonly type = CreditBundleChoiceActions.GET_CREDIT_BUNDLES;\n}\n\nexport class GetCreditBundlesSuccess implements Action {\n public readonly type = CreditBundleChoiceActions.GET_CREDIT_BUNDLES_SUCCESS;\n constructor(public payload: GetCreditOrderConfigResponse) {}\n}\n\nexport class GetCreditOrderSummary implements Action {\n public readonly type = CreditBundleChoiceActions.GET_CREDIT_ORDER_SUMMARY;\n constructor(public payload: CreateCreditOrderParams) {\n }\n}\n\nexport type CreditBundleChoiceAction =\n GetCreditBundles |\n GetCreditBundlesSuccess |\n GetCreditOrderSummary |\n UserPricingChanged |\n RepeatCreditChoice |\n GetPriceRange |\n GetPriceRangeSuccess;\n","/* eslint-disable max-classes-per-file */\nimport { HttpErrorResponse } from '@angular/common/http';\nimport { Action } from '@ngrx/store';\nimport {\n Address,\n CreateDocumentParams,\n Document,\n IDCard,\n PatchDocumentRequest,\n} from 'src/app/client/models/mytitle-service.models';\nimport { FileOrderRequestParams, FileOrderResponse } from 'src/app/client/models/order.models';\n\nexport enum FileActions {\n FILE_UPDATED = '[file] file updated',\n ADDRESS_UPDATED = '[file] address updated',\n ID_CARD_UPDATED = '[file] id card updated',\n\n FILE_UPLOAD_START = '[file] upload start',\n FILE_UPLOAD_PROGRESS = '[file] upload progress',\n FILE_UPLOAD_SUCCESS = '[file] upload success',\n FILE_UPLOAD_ERROR = '[file] upload error',\n\n FILE_UPGRADE = '[file] upgrade',\n FILE_UPGRADE_START = '[file] upgrade start',\n FILE_UPGRADE_SUCCESS = '[file] upgrade success',\n\n NOT_ENOUGH_CREDITS = '[file] not enough credits',\n SELECT_DOCUMENT_PRICE = '[file] select document price',\n PATCH_DOCUMENT = '[file] patch document start',\n PATCH_DOCUMENT_SUCCESS = '[file] patch document success',\n PATCH_DOCUMENT_ERROR = '[file] patch document error',\n CLEAR_FILE_STATE = '[file] clear file state',\n}\n\nexport class FileUpdated implements Action {\n public readonly type = FileActions.FILE_UPDATED;\n constructor(public payload: {\n file: File;\n folder: string;\n is_free: boolean;\n uploadNow: boolean;\n }) { }\n}\n\nexport class AddressUpdated implements Action {\n public readonly type = FileActions.ADDRESS_UPDATED;\n constructor(public payload: Address) { }\n}\n\nexport class IDCardUpdated implements Action {\n public readonly type = FileActions.ID_CARD_UPDATED;\n constructor(public payload: IDCard) { }\n}\n\nexport class FileUploadStart implements Action {\n public readonly type = FileActions.FILE_UPLOAD_START;\n constructor(public payload: CreateDocumentParams) { }\n}\n\nexport class FileUploadProgress implements Action {\n public readonly type = FileActions.FILE_UPLOAD_PROGRESS;\n\n constructor(public payload: { percentDone: number }) { }\n}\n\nexport class FileUploadSuccess implements Action {\n public readonly type = FileActions.FILE_UPLOAD_SUCCESS;\n constructor(public payload: Document) { }\n}\n\nexport class FileUploadError implements Action {\n public readonly type = FileActions.FILE_UPLOAD_ERROR;\n constructor(public payload: HttpErrorResponse) { }\n}\n\nexport class FileUpgrade implements Action {\n public readonly type = FileActions.FILE_UPGRADE;\n constructor(public payload: FileOrderRequestParams) { }\n}\n\nexport class FileUpgradeStart implements Action {\n public readonly type = FileActions.FILE_UPGRADE_START;\n constructor(public payload: FileOrderRequestParams) { }\n}\n\nexport class FileUpgradeSuccess implements Action {\n public readonly type = FileActions.FILE_UPGRADE_SUCCESS;\n constructor(public payload: FileOrderResponse) { }\n}\n\nexport class SelectDocumentPrice implements Action {\n public readonly type = FileActions.SELECT_DOCUMENT_PRICE;\n constructor(public payload: { is_free: boolean }) { }\n}\n\nexport class PatchDocument implements Action {\n public readonly type = FileActions.PATCH_DOCUMENT;\n constructor(public payload: PatchDocumentRequest) { }\n}\n\nexport class PatchDocumentSuccess implements Action {\n public readonly type = FileActions.PATCH_DOCUMENT_SUCCESS;\n constructor(public payload: Document) { }\n}\n\nexport class PatchDocumentError implements Action {\n public readonly type = FileActions.PATCH_DOCUMENT_ERROR;\n constructor(public payload: HttpErrorResponse) { }\n}\n\nexport class ClearFileState implements Action {\n public readonly type = FileActions.CLEAR_FILE_STATE;\n}\n\nexport class NotEnoughCredits implements Action {\n public readonly type = FileActions.NOT_ENOUGH_CREDITS;\n}\n\nexport type FileAction = FileUpdated | AddressUpdated | IDCardUpdated |\n FileUploadStart | FileUploadSuccess | FileUploadError | FileUpgrade |\n FileUpgradeStart | FileUpgradeSuccess | SelectDocumentPrice | FileUploadProgress|\n PatchDocument | PatchDocumentSuccess |\n PatchDocumentError| ClearFileState | NotEnoughCredits;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport {\n CreateCreditOrderParams,\n CreateCreditOrderResponse,\n} from '../../../client/models/credit.models';\n\nexport enum OrderCreditActions {\n CREATE_CREDIT_ORDER = '[Credit order] Create',\n QUEUE_CREDIT_ORDER = '[Credit order] Queued',\n CREDIT_ORDER_UNAUTHORIZED = '[Credit order] Unauthorized',\n CREDIT_ORDER_AUTHORIZED = '[Credit order] Authorized',\n CREDIT_ORDER_SUCCESS = '[Credit order] Success',\n}\n\nexport class CreateCreditOrder implements Action {\n public readonly type = OrderCreditActions.CREATE_CREDIT_ORDER;\n constructor(public payload: CreateCreditOrderParams) {}\n}\nexport class QueueCreditOrder implements Action {\n public readonly type = OrderCreditActions.QUEUE_CREDIT_ORDER;\n constructor(public payload: CreateCreditOrderParams) {}\n}\n\nexport class CreditOrderSuccess implements Action {\n public readonly type = OrderCreditActions.CREDIT_ORDER_SUCCESS;\n constructor(public payload: CreateCreditOrderResponse) {\n }\n}\n\nexport class CreditOrderUnauthorized implements Action {\n public readonly type = OrderCreditActions.CREDIT_ORDER_UNAUTHORIZED;\n}\n\nexport class CreditOrderAuthorized implements Action {\n public readonly type = OrderCreditActions.CREDIT_ORDER_AUTHORIZED;\n constructor(public payload: CreateCreditOrderParams) {}\n}\n\nexport type OrderCreditAction =\n CreateCreditOrder |\n CreditOrderSuccess |\n CreditOrderUnauthorized |\n CreditOrderAuthorized |\n QueueCreditOrder;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport { CreateFolderOrderError, FileOrderResponse } from 'src/app/client/models/order.models';\n\nexport enum OrderFileActions {\n CREATE_FILE_ORDER = '[File order] Create',\n FILE_ORDER_SUCCESS = '[File order] Success',\n FILE_ORDER_ERROR = '[File order] Error',\n CLEAR_FILE_ORDER = '[File order] Clear',\n HIGHLIGHT_UPDATE = '[File order] Highlight update',\n}\n\nexport class CreateFileOrder implements Action {\n public readonly type = OrderFileActions.CREATE_FILE_ORDER;\n}\n\nexport class FileOrderSuccess implements Action {\n public readonly type = OrderFileActions.FILE_ORDER_SUCCESS;\n constructor(public payload: FileOrderResponse) {}\n}\n\nexport class FileOrderError implements Action {\n public readonly type = OrderFileActions.FILE_ORDER_ERROR;\n constructor(public payload: CreateFolderOrderError) {}\n}\n\nexport class ClearFileOrder implements Action {\n public readonly type = OrderFileActions.CLEAR_FILE_ORDER;\n}\n\nexport class HighlightUpdate implements Action {\n public readonly type = OrderFileActions.HIGHLIGHT_UPDATE;\n constructor(public payload: boolean) {}\n}\n\nexport type OrderFileAction = CreateFileOrder |\n FileOrderSuccess |\n FileOrderError |\n ClearFileOrder |\n HighlightUpdate;\n","/* eslint-disable max-len, max-classes-per-file */\nimport { HttpErrorResponse } from '@angular/common/http';\nimport { Action } from '@ngrx/store';\nimport { CreatePaymentRequest, CreatePaymentResponse } from '../../../client/models/payment.models';\n\nexport enum PaymentActions {\n CREATE_PAYMENT_START = '[Payment] Create Start',\n CREATE_PAYMENT_SUCCESS = '[Payment] Create Success',\n CREATE_PAYMENT_ERROR = '[Payment] Create Error',\n CREATE_ISIC_PAYMENT_ERROR = '[Payment] Create ISIC Error',\n CREATE_ISIC_BUYING_STANDARD_ERROR = '[Payment] Create ISIC buying Standard Error',\n}\n\nexport class CreatePaymentStart implements Action {\n public readonly type = PaymentActions.CREATE_PAYMENT_START;\n\n constructor(public payload: CreatePaymentRequest) {\n }\n}\n\nexport class CreatePaymentSuccess implements Action {\n public readonly type = PaymentActions.CREATE_PAYMENT_SUCCESS;\n\n constructor(public payload: CreatePaymentResponse) {\n }\n}\n\nexport class CreatePaymentError implements Action {\n public readonly type = PaymentActions.CREATE_PAYMENT_ERROR;\n\n constructor(public payload: HttpErrorResponse) {\n }\n}\n\nexport class CreateISICPaymentError implements Action {\n public readonly type = PaymentActions.CREATE_ISIC_PAYMENT_ERROR;\n\n constructor(public payload: HttpErrorResponse) {\n }\n}\n\nexport class CreateISICBuyingStandardError implements Action {\n public readonly type = PaymentActions.CREATE_ISIC_BUYING_STANDARD_ERROR;\n\n constructor(public payload: HttpErrorResponse) {\n }\n}\n\nexport type PaymentAction = CreatePaymentStart | CreatePaymentSuccess | CreatePaymentError;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\n\nimport { Document, PatchDocumentRequest } from 'src/app/client/models/mytitle-service.models';\nimport { FileOrderResponse } from 'src/app/client/models/order.models';\nimport {\n FileExt,\n FolderExt,\n ParsedFolderStructure,\n} from '../reducers/upload-folder.reducer';\n\nexport enum UploadFolderActions {\n DISPLAY_FOLDER_CREDIT_CONFIRMATION = '[Folder] Display folder credit confirmation',\n WAIT_UNTIL_FOLDER_STRUCTURE_IS_READY = '[Folder] Waiting until folder structure is ready',\n\n UPLOAD_FOLDER_START = '[Folder] Upload folder start',\n UPLOAD_FOLDER_FINISHED = '[Folder] Upload folder finished',\n\n CREATE_FOLDER_STRUCTURE_BUFFER = '[Folder] Create folder structure buffer',\n UPDATE_FOLDER_STRUCTURE_BUFFER = '[Folder] Update folder structure buffer',\n\n CREATE_FOLDER_STRUCTURE_START = '[Folder] Create folder structure start',\n CREATE_FOLDER_STRUCTURE_SUCCESS = '[Folder] Create folder structure success',\n\n UPLOAD_FILES_INTO_FOLDER_START = '[Folder] Upload files into folder start',\n UPLOAD_FILES_INTO_FOLDER_SUCCESS = '[Folder] Upload files into folder success',\n\n UPLOAD_FOLDER_FILE_START = '[Folder] Upload folder file start',\n UPLOAD_FOLDER_FILE_PROGRESS = '[Folder] Upload folder file progress',\n UPLOAD_FOLDER_FILE_SUCCESS = '[Folder] Upload folder file success',\n UPLOAD_FOLDER_FILE_ERROR = '[Folder] Upload folder file error',\n UPLOAD_FOLDER_FILE_RETRY = '[Folder] Upload folder file retry',\n UPLOAD_FOLDER_FILE_REMOVE = '[Folder] Upload folder file remove',\n\n PATCH_FOLDER_FILES = '[Folder] Patch folder files',\n PATCH_FOLDER_FILE_START = '[Folder] Patch folder file start',\n PATCH_FOLDER_FILE_SUCCESS = '[Folder] Patch folder file success',\n\n CREATE_FOLDER_FILE_ORDERS_START = '[Folder] Create folder file orders start',\n CREATE_FOLDER_FILE_ORDERS_SUCCESS = '[Folder] Create folder file orders success',\n\n RESET_STORE = '[Folder] Reset upload folder store',\n}\n\nexport class DisplayFolderCreditConfirmation implements Action {\n public readonly type = UploadFolderActions.DISPLAY_FOLDER_CREDIT_CONFIRMATION;\n constructor(public payload: { files: FileExt[]; parentGuid: string }) {}\n}\n\nexport class UploadFolderStart implements Action {\n public readonly type = UploadFolderActions.UPLOAD_FOLDER_START;\n constructor(public payload: PatchDocumentRequest) {}\n}\n\nexport class UploadFolderFinished implements Action {\n public readonly type = UploadFolderActions.UPLOAD_FOLDER_FINISHED;\n}\n\nexport class CreateFolderStructureBuffer implements Action {\n public readonly type = UploadFolderActions.CREATE_FOLDER_STRUCTURE_BUFFER;\n constructor(public payload: { structure: ParsedFolderStructure; parentGuid: string }) {}\n}\n\nexport class UpdateFolderStructureBuffer implements Action {\n public readonly type = UploadFolderActions.UPDATE_FOLDER_STRUCTURE_BUFFER;\n constructor(public payload: FolderExt[]) {}\n}\n\nexport class CreateFolderStructureStart implements Action {\n public readonly type = UploadFolderActions.CREATE_FOLDER_STRUCTURE_START;\n constructor(public payload: { folders: FolderExt[]; parentGuid: string }) {}\n}\n\nexport class CreateFolderStructureSuccess implements Action {\n public readonly type = UploadFolderActions.CREATE_FOLDER_STRUCTURE_SUCCESS;\n constructor(public payload: FolderExt[]) {}\n}\n\nexport class WaitUntilFolderStructureIsCreated {\n public readonly type = UploadFolderActions.WAIT_UNTIL_FOLDER_STRUCTURE_IS_READY;\n}\n\nexport class UploadFilesIntoFolderStart {\n public readonly type = UploadFolderActions.UPLOAD_FILES_INTO_FOLDER_START;\n}\n\nexport class UploadFilesIntoFolderSuccess {\n public readonly type = UploadFolderActions.UPLOAD_FILES_INTO_FOLDER_SUCCESS;\n}\n\nexport class UploadFolderFileStart {\n public readonly type = UploadFolderActions.UPLOAD_FOLDER_FILE_START;\n constructor(public payload: FileExt) {}\n}\n\nexport class UploadFolderFileProgress {\n public readonly type = UploadFolderActions.UPLOAD_FOLDER_FILE_PROGRESS;\n constructor(public payload: { percentDone: number; storeGuid: string }) {}\n}\n\nexport class UploadFolderFileSuccess {\n public readonly type = UploadFolderActions.UPLOAD_FOLDER_FILE_SUCCESS;\n constructor(public payload: { file: Document; storeGuid: string }) {}\n}\n\nexport class UploadFolderFileError {\n public readonly type = UploadFolderActions.UPLOAD_FOLDER_FILE_ERROR;\n constructor(public payload: { error: number; storeGuid: string }) {}\n}\n\nexport class UploadFolderFileRetry {\n public readonly type = UploadFolderActions.UPLOAD_FOLDER_FILE_RETRY;\n constructor(public payload: string) {}\n}\nexport class UploadFolderFileRemove {\n public readonly type = UploadFolderActions.UPLOAD_FOLDER_FILE_REMOVE;\n constructor(public payload: string) {}\n}\n\nexport class CreateFolderFileOrdersStart {\n public readonly type = UploadFolderActions.CREATE_FOLDER_FILE_ORDERS_START;\n}\n\nexport class CreateFolderFileOrdersSuccess {\n public readonly type = UploadFolderActions.CREATE_FOLDER_FILE_ORDERS_SUCCESS;\n constructor(public payload: FileOrderResponse) {}\n}\n\nexport class PatchFolderFiles {\n public readonly type = UploadFolderActions.PATCH_FOLDER_FILES;\n}\n\nexport class PatchFolderFileStart {\n public readonly type = UploadFolderActions.PATCH_FOLDER_FILE_START;\n constructor(public payload: { guid: string; params: PatchDocumentRequest }) {}\n}\n\nexport class PatchFolderFileSuccess {\n public readonly type = UploadFolderActions.PATCH_FOLDER_FILE_SUCCESS;\n}\n\nexport class UploadFolderReset {\n public readonly type = UploadFolderActions.RESET_STORE;\n}\n\nexport type UploadFolderAction =\n | DisplayFolderCreditConfirmation\n | UploadFolderStart\n | UploadFolderFinished\n | UploadFolderReset\n | CreateFolderStructureBuffer\n | UpdateFolderStructureBuffer\n | CreateFolderStructureStart\n | CreateFolderStructureSuccess\n | WaitUntilFolderStructureIsCreated\n | UploadFilesIntoFolderStart\n | UploadFilesIntoFolderSuccess\n | UploadFolderFileStart\n | UploadFolderFileProgress\n | UploadFolderFileSuccess\n | UploadFolderFileError\n | UploadFolderFileRetry\n | UploadFolderFileRemove\n | CreateFolderFileOrdersStart\n | CreateFolderFileOrdersSuccess\n | PatchFolderFiles\n | PatchFolderFileStart\n | PatchFolderFileSuccess;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport { VoucherError, VoucherRequest, VoucherResponse } from 'src/app/client/models/credit.models';\n\nexport enum VoucherActions {\n VALIDATE_VOUCHER = '[Voucher] Validate voucher',\n VALIDATE_VOUCHER_SUCCESS = '[Voucher] Validate voucher success',\n VALIDATE_VOUCHER_ERROR = '[Voucher] Validate voucher error',\n CLEAR_VOUCHER = '[Voucher] Clear voucher',\n}\n\nexport class ValidateVoucher implements Action {\n public readonly type = VoucherActions.VALIDATE_VOUCHER;\n constructor(public payload: VoucherRequest) {}\n}\n\nexport class ValidateVoucherSuccess implements Action {\n public readonly type = VoucherActions.VALIDATE_VOUCHER_SUCCESS;\n constructor(public payload: VoucherResponse) {}\n}\n\nexport class ValidateVoucherError implements Action {\n public readonly type = VoucherActions.VALIDATE_VOUCHER_ERROR;\n constructor(public payload: VoucherError) {}\n}\n\nexport class ClearVoucher implements Action {\n public readonly type = VoucherActions.CLEAR_VOUCHER;\n}\n\nexport type VoucherAction =\nValidateVoucher |\nValidateVoucherSuccess |\nValidateVoucherError |\nClearVoucher;\n","import { Action, createFeatureSelector } from '@ngrx/store';\n\nimport { CreateFolderOrderError, FileOrderResponse } from 'src/app/client/models/order.models';\nimport { OrderFileAction, OrderFileActions } from '../actions/order-file.actions';\n\nexport interface FileOrderState {\n data: FileOrderResponse;\n loading: boolean;\n error: CreateFolderOrderError;\n highlight: boolean;\n}\n\nexport const initialFileOrderState: FileOrderState = {\n data: null,\n loading: false,\n error: null,\n highlight: false,\n};\n\nexport const fileOrderSelectorName = 'fileOrder';\nexport const getFileOrderStateSelector =\n createFeatureSelector(fileOrderSelectorName);\n\nexport function fileOrderReducer(\n state: FileOrderState = initialFileOrderState,\n generic: Action,\n): FileOrderState {\n const action = generic as OrderFileAction;\n switch (action.type) {\n case OrderFileActions.CREATE_FILE_ORDER:\n return { ...state, loading: true, error: null };\n case OrderFileActions.FILE_ORDER_SUCCESS: {\n return { ...state, data: { ...state.data, ...action.payload }, loading: false };\n }\n case OrderFileActions.FILE_ORDER_ERROR:\n return { ...state, error: action.payload, loading: false };\n case OrderFileActions.HIGHLIGHT_UPDATE:\n return { ...state, highlight: action.payload };\n case OrderFileActions.CLEAR_FILE_ORDER:\n return initialFileOrderState;\n default:\n return state;\n }\n}\n","import { Action } from '@ngrx/store';\nimport * as uuid from 'uuid';\n\nimport { PatchDocumentRequest } from 'src/app/client/models/mytitle-service.models';\nimport { Document } from 'src/app/client/models/mytitle-service.models';\nimport { UploadFolderAction, UploadFolderActions } from './../actions/upload-folder.actions';\n\nexport enum FileUploadingStatus {\n WAITING = 'waiting',\n UPLOADING = 'uploading',\n ERROR = 'error',\n PAUSED = 'paused',\n SUCCESS = 'success',\n}\n\nexport interface ParsedFolderStructure {\n foldersInTotal: number;\n folders: FolderExt[];\n files: FileExt[];\n}\n\nexport interface FolderExt {\n storeGuid: string; // used only for manipulation and pairing in store before BE guid is created\n folderGuid: string; // guid from BE for this folder\n folderName: string;\n parentFolderGuid: string; // guid from BE for parent of this folder\n childFolders: FolderExt[];\n}\n\nexport interface FileExt extends File {\n webkitRelativePath: string;\n folderPath?: string;\n parentGuid?: string;\n storeGuid?: string;\n uploadingProgress?: number;\n uploadingStatus?: FileUploadingStatus;\n errorCode?: number;\n}\n\nexport interface UploadFolderState {\n // general\n uploadingProcessStarted: boolean;\n uploadingProcessFinished: boolean;\n credentials: PatchDocumentRequest;\n\n // 1. prep\n folders: FolderExt[];\n files: FileExt[];\n parentGuid: string;\n\n // 2. for folder creating purposes\n totalFolders: number;\n foldersCreated: number;\n\n // 3. for file uploading purposes\n fileUploadingStarted: boolean;\n currentlyUploading: number;\n uploadedFiles: Document[];\n\n // 4. for patching uploaded documents\n filePatchingStarted: boolean;\n filesPatched: number;\n\n // 5. for creating file orders\n creatingFileOrdersStarted: boolean;\n creatingFileOrdersFinished: boolean;\n}\n\nexport const initialUploadFolderState: UploadFolderState = {\n uploadingProcessStarted: false,\n uploadingProcessFinished: false,\n credentials: null,\n folders: null,\n files: null,\n parentGuid: null,\n totalFolders: null,\n foldersCreated: 0,\n fileUploadingStarted: false,\n currentlyUploading: 0,\n uploadedFiles: null,\n filePatchingStarted: false,\n filesPatched: 0,\n creatingFileOrdersStarted: false,\n creatingFileOrdersFinished: false,\n};\n\nexport function uploadFolderStateReducer(\n state: UploadFolderState = initialUploadFolderState,\n generic: Action): UploadFolderState {\n\n const action = generic as UploadFolderAction;\n switch (action.type) {\n\n case UploadFolderActions.CREATE_FOLDER_STRUCTURE_BUFFER: {\n return {\n ...state,\n folders: action.payload.structure.folders,\n files: action.payload.structure.files,\n totalFolders: action.payload.structure.foldersInTotal,\n parentGuid: action.payload.parentGuid,\n foldersCreated: 0,\n };\n }\n\n case UploadFolderActions.UPDATE_FOLDER_STRUCTURE_BUFFER: {\n return {\n ...state,\n folders: updateFolderStructure(state.folders, action.payload),\n foldersCreated: state.foldersCreated + action.payload.length,\n };\n }\n\n case UploadFolderActions.UPLOAD_FOLDER_START: {\n return {\n ...state,\n uploadingProcessStarted: true,\n credentials: action.payload,\n };\n }\n\n case UploadFolderActions.UPLOAD_FOLDER_FINISHED: {\n return {\n ...state,\n uploadingProcessFinished: true,\n };\n }\n\n case UploadFolderActions.UPLOAD_FILES_INTO_FOLDER_START: {\n return {\n ...state,\n currentlyUploading: 0,\n uploadedFiles: [],\n files: updateFolderGuidForEveryFile(state.files, state.folders),\n fileUploadingStarted: true,\n };\n }\n\n case UploadFolderActions.UPLOAD_FOLDER_FILE_START: {\n const files = state.files;\n const index = files.findIndex(x => x.storeGuid === action.payload.storeGuid);\n files[index].uploadingStatus = FileUploadingStatus.UPLOADING;\n\n return {\n ...state,\n files,\n currentlyUploading: state.currentlyUploading + 1,\n };\n }\n\n case UploadFolderActions.UPLOAD_FOLDER_FILE_PROGRESS: {\n const files = state.files;\n const index = files.findIndex(x => x.storeGuid === action.payload.storeGuid);\n files[index].uploadingProgress = action.payload.percentDone;\n\n return {\n ...state,\n files,\n };\n }\n\n case UploadFolderActions.UPLOAD_FOLDER_FILE_ERROR: {\n const files = state.files;\n const index = files.findIndex(x => x.storeGuid === action.payload.storeGuid);\n files[index].uploadingStatus = FileUploadingStatus.ERROR;\n files[index].uploadingProgress = 0;\n files[index].errorCode = action.payload.error;\n\n return {\n ...state,\n files,\n currentlyUploading: state.currentlyUploading - 1,\n };\n }\n\n case UploadFolderActions.UPLOAD_FOLDER_FILE_RETRY: {\n const files = state.files;\n const index = files.findIndex(x => x.storeGuid === action.payload);\n files[index].uploadingStatus = FileUploadingStatus.WAITING;\n files[index].uploadingProgress = 0;\n\n return {\n ...state,\n files,\n };\n }\n\n case UploadFolderActions.UPLOAD_FOLDER_FILE_REMOVE: {\n const files = state.files;\n const index = files.findIndex(x => x.storeGuid === action.payload);\n files.splice(index, 1);\n\n return {\n ...state,\n files,\n };\n }\n\n case UploadFolderActions.UPLOAD_FOLDER_FILE_SUCCESS: {\n const files = state.files;\n const index = files.findIndex(x => x.storeGuid === action.payload.storeGuid);\n const uploadedFiles = state.uploadedFiles || [];\n uploadedFiles.push(action.payload.file);\n files[index].uploadingStatus = FileUploadingStatus.SUCCESS;\n files[index].uploadingProgress = 100;\n\n return {\n ...state,\n files,\n uploadedFiles,\n currentlyUploading: state.currentlyUploading - 1,\n };\n }\n\n case UploadFolderActions.PATCH_FOLDER_FILES: {\n return {\n ...state,\n filePatchingStarted: true,\n };\n }\n\n case UploadFolderActions.PATCH_FOLDER_FILE_SUCCESS: {\n return {\n ...state,\n filesPatched: state.filesPatched + 1,\n };\n }\n\n case UploadFolderActions.CREATE_FOLDER_FILE_ORDERS_START: {\n return {\n ...state,\n creatingFileOrdersStarted: true,\n };\n }\n\n case UploadFolderActions.CREATE_FOLDER_FILE_ORDERS_SUCCESS: {\n return {\n ...state,\n creatingFileOrdersFinished: true,\n };\n }\n\n case UploadFolderActions.RESET_STORE: {\n return initialUploadFolderState;\n }\n\n default: return state;\n }\n}\n\nfunction updateFolderStructure(\n currentFolders: FolderExt[],\n updatedFolders: FolderExt[]): FolderExt[] {\n\n if (gotInitialFolderUpdated(currentFolders, updatedFolders)) {\n return replaceWholeStructure(currentFolders, updatedFolders);\n } else {\n const parentGuid = getFolderParentGuid(updatedFolders);\n return replaceFolderChildren(parentGuid, updatedFolders, currentFolders);\n }\n }\n\nfunction getFolderParentGuid(folders: FolderExt[]): string {\n if (folders && folders.length) return folders[0].parentFolderGuid;\n else return null;\n}\n\nfunction replaceFolderChildren(\n folderGuid: string,\n folders: FolderExt[],\n currentFolders: FolderExt[]) {\n\n const folder = searchInFoldersByGuid(folderGuid, currentFolders);\n\n if (folder) folder.childFolders = folders;\n\n return currentFolders;\n }\n\nfunction searchInFoldersByGuid(guid: string, folders: FolderExt[]): FolderExt {\n // try first level\n const folderIndex = folders.findIndex(x => x.folderGuid === guid);\n if (folderIndex !== -1) return folders[folderIndex];\n // search children if there is no appearance on the first level\n else {\n let result: FolderExt = null;\n\n for (const folder of folders) {\n if (folder.childFolders && folder.childFolders.length) {\n result = searchInFoldersByGuid(guid, folder.childFolders);\n if (result) return result;\n } else result = null;\n }\n\n return result;\n }\n}\n\nfunction gotInitialFolderUpdated(\n currentFolders: FolderExt[],\n updatedFolders: FolderExt[]): boolean {\n\n if (currentFolders &&\n currentFolders.length === 1 &&\n updatedFolders &&\n updatedFolders.length === 1) {\n return currentFolders[0].storeGuid === updatedFolders[0].storeGuid;\n } else return false;\n }\n\nfunction replaceWholeStructure(\n currentFolders: FolderExt[],\n updatedFolders: FolderExt[]): FolderExt[] {\n\n currentFolders[0] = updatedFolders[0];\n return currentFolders;\n }\n\nfunction updateFolderGuidForEveryFile(files: FileExt[], folders: FolderExt[]): FileExt[] {\n files.forEach(file => {\n file.storeGuid = uuid.v4();\n file.uploadingStatus = FileUploadingStatus.WAITING;\n file.uploadingProgress = 0;\n\n let folderLevel = folders;\n const absolutePathParsed = file.webkitRelativePath\n .replace(file.name, '')\n .split('/');\n absolutePathParsed.pop();\n\n for (let index = 0; index < absolutePathParsed.length; index++) {\n const folderIndex = folderLevel.findIndex(x => x.folderName === absolutePathParsed[index]);\n if (folderIndex === -1) continue;\n\n if ((index + 1) === absolutePathParsed.length) {\n file.parentGuid = folderLevel[folderIndex].folderGuid;\n } else {\n folderLevel = folderLevel[folderIndex].childFolders;\n }\n }\n });\n\n return files;\n}\n","import { createFeatureSelector, createSelector } from '@ngrx/store';\nimport { CreditBundleChoiceState } from '../reducers/credit-bundle-choice.reducer';\n\nexport const getCreditBundleState =\n createFeatureSelector('creditBundle');\n\nexport const getCreditBundles = createSelector(\n getCreditBundleState,\n state => state.bundles,\n);\n\nexport const getSelectedBundle = createSelector(\n getCreditBundleState,\n state => state.selectedBundle,\n);\n\nexport const getIsSelectedBundleAcademy = createSelector(\n getCreditBundleState,\n state => state.isBundleAcademy,\n);\n\nexport const isLoadingBundles = createSelector(\n getCreditBundleState,\n state => state.isLoadingBundles,\n);\n\nexport const isCreatingOrder = createSelector(\n getCreditBundleState,\n state => state.isCreatingOrder,\n);\n\nexport const getPriceRange = createSelector(\n getCreditBundleState,\n state => state.priceRange,\n);\n\nexport const hasPricingChanged = createSelector(\n getCreditBundleState,\n state => state.hasPricingChanged,\n);\n","import { createFeatureSelector, createSelector } from '@ngrx/store';\nimport { FileState } from '../models/file.models';\n\nexport const getFileState = createFeatureSelector('file');\nexport const getDocument = createSelector(getFileState, state => state.document);\nexport const isUpgradingFile = createSelector(getFileState, state => state.isFileUpgrading);\nexport const upgradedFile = createSelector(getFileState, state => state.upgradingDocument);\nexport const getFileParentGuid = createSelector(getFileState, state => state.fileParentGuid);\n\nexport const isDeletingDocuments = createSelector(\n getFileState,\n state => state && state.finishingDocumentsDeleting,\n);\n\nexport const getDeletedDocuments = createSelector(\n getFileState,\n state => state && state.deletedDocuments,\n);\n\nexport const getVerifyDeletionError = createSelector(\n getFileState,\n state => state && state.error,\n);\n\nexport const canBePatched = createSelector(\n getFileState,\n state => state && state.canBePatched,\n);\n\nexport const getFile = createSelector(\n getFileState,\n state => state && state.file,\n);\n","import { DEFAULT_ROUTER_FEATURENAME, RouterReducerState } from '@ngrx/router-store';\nimport { createFeatureSelector, createSelector } from '@ngrx/store';\nimport { RouterStateUrl } from '../models/app.models';\n\nexport const getRouterFeautureState\n = createFeatureSelector>(DEFAULT_ROUTER_FEATURENAME);\n\nexport const getRouterState = createSelector(\n getRouterFeautureState,\n ({ state }) => state,\n);\n","import { createFeatureSelector, createSelector } from '@ngrx/store';\n\nimport { FileUploadingStatus, UploadFolderState } from './../reducers/upload-folder.reducer';\n\nexport const uploadFolderStateSelectorName = 'uploadFolder';\n\nexport const uploadFolderState = createFeatureSelector(\n uploadFolderStateSelectorName);\n\nexport const areAllFoldersCreated = createSelector(\n uploadFolderState,\n state => {\n if (state.foldersCreated && state.totalFolders) {\n return state.foldersCreated === state.totalFolders;\n } else return false;\n },\n);\n\nexport const getFolderFiles = createSelector(\n uploadFolderState,\n state => state.files,\n);\n\nexport const areAllFilesUploaded = createSelector(\n uploadFolderState,\n state => {\n if (!state.files) return null;\n\n for (const file of state.files) {\n if (file.uploadingStatus !== FileUploadingStatus.SUCCESS) return false;\n }\n\n return true;\n },\n);\n\nexport const filesInErrorState = createSelector(\n uploadFolderState,\n state => {\n if (!state.files) return null;\n return state.files.filter(x => x.uploadingStatus === FileUploadingStatus.ERROR);\n },\n);\n\nexport const filesInWaitingState = createSelector(\n uploadFolderState,\n state => {\n if (!state.files) return null;\n return state.files.filter(x => x.uploadingStatus === FileUploadingStatus.WAITING);\n },\n);\n\nexport const numberOfCurrentlyUploadedFiles = createSelector(\n uploadFolderState,\n state => state.currentlyUploading,\n);\n\nexport const hasFileUploadingStarted = createSelector(\n uploadFolderState,\n state => state.fileUploadingStarted,\n);\n\nexport const getAllUploadedFiles = createSelector(\n uploadFolderState,\n state => state.uploadedFiles,\n);\n\nexport const hasCreatingFileOrdersStarted = createSelector(\n uploadFolderState,\n state => state.creatingFileOrdersStarted,\n);\n\nexport const hasFilePatchingStarted = createSelector(\n uploadFolderState,\n state => state.filePatchingStarted,\n);\n\nexport const allFileOrdersCreated = createSelector(\n uploadFolderState,\n state => state.creatingFileOrdersFinished,\n);\n\nexport const allFilesPatched = createSelector(\n uploadFolderState,\n state => state.uploadedFiles ? state.uploadedFiles.length === state.filesPatched : null,\n);\n\nexport const canUploadFolderRouteBeActivated = createSelector(\n uploadFolderState,\n state => !!state.files && !!state.folders,\n);\n\nexport const hasUploadingProcessStarted = createSelector(\n uploadFolderState,\n state => state.uploadingProcessStarted,\n);\n\nexport const hasUploadingProcessFinished = createSelector(\n uploadFolderState,\n state => state.uploadingProcessFinished,\n);\n\nexport const getParentFolderGuid = createSelector(\n uploadFolderState,\n state => state.parentGuid,\n);\n\nexport const getFolderCredentials = createSelector(\n uploadFolderState,\n state => state.credentials,\n);\n","import { createFeatureSelector, createSelector } from '@ngrx/store';\nimport { VoucherState } from '../reducers/voucher.reducer';\n\nexport const voucherState = createFeatureSelector('voucher');\n\nexport const getVoucherDiscount = createSelector(\n voucherState,\n state => state.discount_percentage,\n);\n\nexport const getIsValidatingVoucher = createSelector(\n voucherState,\n state => state.isValidating,\n);\n\nexport const getVoucherError = createSelector(\n voucherState,\n state => state.voucherError,\n);\n\nexport const getHasError = createSelector(\n voucherState,\n state => state.hasVoucherError,\n);\n\nexport const getSavedVoucher = createSelector(\n voucherState,\n state => state.code,\n);\n","import { HttpParams } from '@angular/common/http';\n\n/**\n * Helper function to get HttpParams used in GET requests\n * which have to be strictly in [key of string]: string shape.\n *\n * @param params any object having properties with values.\n */\nexport function getHttpParams(params: any): HttpParams {\n if (!params) return null;\n\n let queryParams = new HttpParams();\n Object.entries(params).forEach(([key, value]: [string, any]) => {\n if (value !== undefined) {\n if (typeof value === 'string') queryParams = queryParams.set(key, value);\n else queryParams = queryParams.set(key, JSON.stringify(value));\n }\n });\n\n return queryParams;\n}\n","import { GOPAY_PAYMENT_COUNTRIES } from 'src/app/app/services/gopay-payment.service';\nimport { PaymentGateways } from 'src/app/client/models/payment.models';\nimport { environment } from 'src/environments/environment';\n\nexport function getPaymentGateway(): PaymentGateways {\n const currentLanguage = environment.language;\n\n if (GOPAY_PAYMENT_COUNTRIES.includes(currentLanguage)) {\n return PaymentGateways.GOPAY;\n } else {\n throw new Error(`Language ${currentLanguage} is not part of any payment\n gateway country definition. Please add it.`);\n }\n}\n","export enum GoogleAuthErrorCodes {\n CLOSED = 'popup_closed_by_user',\n DENIED = 'access_denied',\n FAILED = 'immediate_failed', // it is not possible to get this one for us\n}\n\nexport enum GoogleRegistrationErrorCodes {\n ALREADY_REGISTRED = 'USER_ALREADY_FINISHED_REGISTRATION',\n GOOGLE_AUTH_FAILED = 'GOOGLE_AUTH_FAILED',\n}\n\nexport interface GoogleErrorResponse {\n error: GoogleAuthErrorCodes;\n}\n\nexport interface GoogleAuthParams {\n idToken: string;\n}\n","import { HttpClientModule } from '@angular/common/http';\nimport { NgModule } from '@angular/core';\nimport { BillingServiceClient } from './services/billing-service.client';\nimport { MytitleServiceClient } from './services/mytitle-service.client';\nimport { RenderServiceClient } from './services/render-service.client';\nimport { UsersServiceClient } from './services/users-service.client';\n\n@NgModule({\n imports: [\n HttpClientModule,\n ],\n providers: [\n BillingServiceClient,\n MytitleServiceClient,\n RenderServiceClient,\n UsersServiceClient,\n ],\n})\nexport class ClientModule {}\n","import {\n HttpErrorResponse,\n HttpEvent,\n HttpHandler,\n HttpInterceptor,\n HttpRequest,\n} from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { select, Store } from '@ngrx/store';\nimport { Observable, throwError } from 'rxjs';\nimport { catchError, finalize, first, map, mergeMap, tap } from 'rxjs/operators';\nimport { UsersServiceClient } from 'src/app/client/services/users-service.client';\nimport { RefreshTokenError, RefreshTokenSuccess } from '../store/actions/refreshToken.action';\nimport { TokenInfo } from '../store/models/tokenInfo';\nimport { UserState } from '../store/reducers/user.reducer';\nimport { getAuthToken } from '../store/selectors/user.selector';\n\n@Injectable()\nexport class AuthInterceptor implements HttpInterceptor {\n\n /**\n * Fires when once token is refreshed\n */\n public refreshedAccessToken$: Observable = null;\n\n constructor(\n private store: Store,\n private usersServiceClient: UsersServiceClient,\n ) { }\n\n public intercept(req: HttpRequest, next: HttpHandler) {\n\n return this.store.pipe(\n select(getAuthToken),\n first(),\n mergeMap(token =>\n // TODO: Filter based on our services to prevent token leaks\n this.handleRequest(req, next, token),\n ),\n );\n }\n\n private handleRequest(\n req: HttpRequest,\n next: HttpHandler,\n token: TokenInfo,\n ): Observable> {\n\n if (token && token.accessToken) req = this.getAuthorizedRequest(req, token.accessToken);\n\n return next.handle(req).pipe(\n catchError(err => {\n if (\n // prevent looping refresh token requests\n req.url !== '/api/v1/users/refresh_token'\n && err instanceof HttpErrorResponse\n && err.status === 401\n && token\n && token.refreshToken\n ) {\n // TODO - find cleaner typing solution\n return this.handle401Error(req, next, token) as Observable>;\n } else {\n return throwError(err);\n }\n }),\n );\n }\n\n private getAuthorizedRequest(req: HttpRequest, accessToken: string) {\n const authToken = 'Bearer ' + accessToken;\n return req.clone({\n headers: req.headers.set('Authorization', authToken),\n });\n }\n\n private handle401Error(req: HttpRequest, next: HttpHandler, token: TokenInfo) {\n if (!this.refreshedAccessToken$) {\n // Keep the ref to the current refresh token info\n this.refreshedAccessToken$ = this.usersServiceClient\n .refreshToken({ refresh: token.refreshToken })\n .pipe(\n map(({ access_token, expires_in, refresh_token }) => ({\n accessToken: access_token,\n expires: new Date(Date.now() + expires_in * 1000),\n refreshToken: refresh_token,\n }) as TokenInfo),\n // let our store know\n tap(\n tokenInfo => this.store.dispatch(new RefreshTokenSuccess({ token: tokenInfo })),\n refreshTokenError => this.store.dispatch(new RefreshTokenError(refreshTokenError)),\n ),\n finalize(() => {\n // once refreshing completes, remove the reference so we can refresh once again\n this.refreshedAccessToken$ = null;\n }),\n );\n }\n\n // once the token is returned, pass the original request\n return this.refreshedAccessToken$.pipe(\n mergeMap(tokenInfo => this.handleRequest(req, next, tokenInfo)),\n );\n }\n}\n","import { Injectable } from '@angular/core';\nimport * as jwtDecode from 'jwt-decode';\nimport { JWTTokenPayload } from '../store/models/jwt-token-payload';\nimport { TokenInfo } from '../store/models/tokenInfo';\n\nexport const PERSISTENCE_TOKEN_KEY = 'mytitle-auth-persistence-token';\n\n@Injectable()\nexport class PersistenceService {\n\n /**\n * Persists token across user session.\n *\n * @param token Token to persist\n */\n public persistToken(token: TokenInfo) {\n const serialized: SerializedToken = {\n accessToken: token.accessToken,\n expires: token.expires.toISOString(),\n refreshToken: token.refreshToken,\n };\n const tokenValue = JSON.stringify(serialized);\n localStorage.setItem(PERSISTENCE_TOKEN_KEY, tokenValue);\n }\n\n /**\n * Loads previously persisted token.\n *\n * @throws when token is empty.\n */\n public loadToken(): TokenInfo {\n const item = localStorage.getItem(PERSISTENCE_TOKEN_KEY);\n if (item) {\n const { accessToken, expires, refreshToken } = JSON.parse(item) as SerializedToken;\n\n const decodedToken: JWTTokenPayload = jwtDecode(refreshToken);\n if (decodedToken.exp < Date.now() / 1000) {\n this.removeToken();\n throw new Error('The refresh token has expired');\n }\n return { accessToken, expires: new Date(expires), refreshToken };\n }\n throw new Error('Token is empty');\n }\n\n /**\n * Removes previously persisted token\n */\n public removeToken() {\n localStorage.removeItem(PERSISTENCE_TOKEN_KEY);\n }\n}\n\ninterface SerializedToken {\n accessToken: string;\n expires: string;\n refreshToken: string;\n}\n","import { Injectable } from '@angular/core';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { map, switchMap } from 'rxjs/operators';\nimport { MytitleServiceClient } from 'src/app/client/services/mytitle-service.client';\nimport {\n CheckFreeLimit, CheckFreeLimitExceededSuccess, LimitActions,\n} from '../actions/file-limit.action';\n\n@Injectable()\nexport class FileLimitEffects {\n\n\n public readonly checkFreeLimit = createEffect(() => this.storeActions.pipe(\n ofType(LimitActions.CHECK_FREE_LIMIT),\n switchMap(() => this.mytitleServiceClient.checkLimit()\n .pipe(\n map(result => new CheckFreeLimitExceededSuccess(result)),\n ),\n ),\n ));\n\n constructor(\n private storeActions: Actions,\n private mytitleServiceClient: MytitleServiceClient,\n ) {\n }\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\n\nimport { of } from 'rxjs';\n\nimport { catchError, map, switchMap } from 'rxjs/operators';\nimport { BillingServiceClient } from 'src/app/client/services/billing-service.client';\nimport {\n GetCreditBalance,\n GetCreditBalanceActions,\n GetCreditBalanceError,\n GetCreditBalanceSuccess,\n} from '../actions/getCreditBalance.actions';\n\n@Injectable()\nexport class GetCreditBalanceEffects {\n\n\n public getUserInfo = createEffect(() => this.storeActions.pipe(\n ofType(GetCreditBalanceActions.GET_CREDIT_BALANCE),\n switchMap(() => this.billingServiceClient.getUserCreditBalance()\n .pipe(\n map(result => new GetCreditBalanceSuccess(result),\n catchError((error: HttpErrorResponse) => of(new GetCreditBalanceError(error))),\n )),\n ),\n ));\n\n constructor(\n private storeActions: Actions,\n private billingServiceClient: BillingServiceClient,\n ) { }\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { asyncScheduler, of, scheduled } from 'rxjs';\nimport { catchError, map, switchMap } from 'rxjs/operators';\n\nimport { UsersServiceClient } from 'src/app/client/services/users-service.client';\nimport {\n GetGeoIP,\n GetGeoIPActions,\n GetGeoIPError,\n GetGeoIPSuccess,\n} from '../actions/getGeoIP.action';\n\n@Injectable()\nexport class GetGeoIPEffects {\n\n\n public readonly triggerGeoIP = createEffect(() => scheduled(of(null), asyncScheduler).pipe(\n map(() => new GetGeoIP()),\n ));\n\n\n public getUserInfo = createEffect(() => this.storeActions.pipe(\n ofType(GetGeoIPActions.GET_GEO_IP),\n switchMap(() => this.usersServiceClient.getGeoIP()\n .pipe(\n map(result => new GetGeoIPSuccess(result),\n catchError((error: HttpErrorResponse) => of(new GetGeoIPError(error))),\n )),\n ),\n ));\n\n constructor(\n private storeActions: Actions,\n private usersServiceClient: UsersServiceClient,\n ) { }\n}\n","import { Component, Inject } from '@angular/core';\nimport { MatLegacyDialogRef as MatDialogRef, MAT_LEGACY_DIALOG_DATA as MAT_DIALOG_DATA } from '@angular/material/legacy-dialog';\n\n@Component({\n selector: 'mt-video-dialog',\n templateUrl: './video-dialog.component.html',\n styleUrls: ['./video-dialog.component.scss'],\n})\nexport class VideoDialogComponent {\n\n constructor(\n @Inject(MAT_DIALOG_DATA) public text: string,\n private matDialogRef: MatDialogRef,\n ) {}\n\n public close() {\n this.matDialogRef.close();\n }\n\n}\n","
\n
\n \n
\n
\n\n
\n \n Close\n \n
\n","import { Injectable } from '@angular/core';\nimport { MatLegacyDialog as MatDialog } from '@angular/material/legacy-dialog';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { Store } from '@ngrx/store';\n\nimport * as Sentry from '@sentry/angular-ivy';\nimport { forkJoin } from 'rxjs';\nimport { filter, first, map, mergeMap, switchMap, tap } from 'rxjs/operators';\n\nimport { UserPricingChanged } from 'src/app/app/states/actions/credit-bundle-choice.actions';\nimport { getGeoIPState, getUserState } from 'src/app/auth/store/selectors/user.selector';\nimport { UsersServiceClient } from 'src/app/client/services/users-service.client';\nimport { VideoDialogComponent } from 'src/app/partials/video-dialog/video-dialog.component';\nimport { ErrorHelperService } from 'src/app/shared/services/error-helper.service';\nimport { SnackbarService } from 'src/app/shared/services/snackbar.service';\nimport { CheckFreeLimit } from '../actions/file-limit.action';\nimport { GetUserInfo, GetUserInfoActions, GetUserInfoSuccess,\n OpenVideoDialog, VideoDialogClosed } from '../actions/getUserInfo.action';\nimport { LocationVerified } from '../actions/locationVerify';\nimport { UserCurrencyChange } from '../models/user';\nimport { UserState } from '../reducers/user.reducer';\n\n@Injectable()\nexport class GetUserInfoEffects {\n\n public getUserInfo = createEffect(() => this.storeActions.pipe(\n ofType(GetUserInfoActions.GET_USER_INFO),\n switchMap(() => this.usersServiceClient.getUserInfo()\n .pipe(\n map(({\n country,\n email,\n full_name: fullName,\n isic_number: isicNumber,\n isic_expiration: isicExpiration,\n is_valid_academy: isValidAcademy,\n is_eu,\n two_factor_auth,\n affiliate_code,\n }) => new GetUserInfoSuccess({\n country,\n email,\n fullName,\n isicNumber,\n isicExpiration,\n isValidAcademy,\n is_eu,\n two_factor_auth,\n affiliate_code,\n })),\n this.errorHelperService.raiseError(),\n ),\n ),\n ));\n\n /**\n * Effect which is being proccessed only when getUserInfo end-point\n * is called right after login operation\n */\n\n public readonly verifyUserLocalization = createEffect(() => this.storeActions.pipe(\n ofType(GetUserInfoActions.GET_USER_INFO_SUCCESS),\n switchMap(() => forkJoin([\n this.store.select(getUserState).pipe(first()),\n this.store.select(getGeoIPState).pipe(first()),\n ])),\n filter(([userState]) => userState.user.isInLoginProcess),\n tap( ([userState]) => {\n Sentry.configureScope(scope => {\n scope.setUser({ email: userState.user.email });\n });\n }),\n map(([userState, geoState]) => {\n let userPricingChanged = false;\n\n if (geoState.is_eu && !userState.user.is_eu) {\n userPricingChanged = true;\n this.snackbarService.queueSnackBar(UserCurrencyChange.FROM_EUR_TO_USD);\n }\n if (!geoState.is_eu && userState.user.is_eu) {\n userPricingChanged = true;\n this.snackbarService.queueSnackBar(UserCurrencyChange.FROM_USD_TO_EUR);\n }\n\n return userPricingChanged;\n }),\n // to clean-up store and isInLoginProcess property after login\n mergeMap(userPricingChanged => {\n if (userPricingChanged) {\n return [\n new UserPricingChanged(),\n new LocationVerified(),\n ];\n } else return [new LocationVerified()];\n }),\n ));\n\n\n public readonly getLimitCheck = createEffect(() => this.storeActions.pipe(\n ofType(GetUserInfoActions.GET_USER_INFO_SUCCESS),\n map(() => new CheckFreeLimit()),\n ));\n\n\n public readonly openVideoDialog = createEffect(() => this.storeActions.pipe(\n ofType(GetUserInfoActions.OPEN_VIDEO_DIALOG),\n switchMap(() => this.matDialog\n .open(VideoDialogComponent)\n .afterClosed()),\n map(() => new VideoDialogClosed()),\n ));\n\n constructor(\n private store: Store,\n private storeActions: Actions,\n private usersServiceClient: UsersServiceClient,\n private errorHelperService: ErrorHelperService,\n private snackbarService: SnackbarService,\n private matDialog: MatDialog,\n ) {\n }\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\n\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { select, Store } from '@ngrx/store';\nimport { forkJoin, of } from 'rxjs';\nimport { catchError, filter, first, map, mergeMap, switchMap, tap } from 'rxjs/operators';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { AppState } from 'src/app/app/states/models/app.models';\nimport { getRouterState } from 'src/app/app/states/selectors/router.selectors';\nimport { GoogleAuthErrorCodes } from 'src/app/auth/auth.models';\nimport { CheckFreeLimit } from 'src/app/auth/store/actions/file-limit.action';\nimport { GetCreditBalance } from 'src/app/auth/store/actions/getCreditBalance.actions';\nimport { GetUserInfo } from 'src/app/auth/store/actions/getUserInfo.action';\nimport {\n GoogleAuthActions,\n GoogleAuthCleanup,\n GoogleAuthError,\n GoogleAuthSuccess,\n GoogleLoginError,\n GoogleLoginStart,\n GoogleLoginSuccess,\n GoogleRegisterError,\n GoogleRegisterStart,\n GoogleRegisterSuccess,\n GoogleSignUp,\n GoogleSignUpCancel,\n} from 'src/app/auth/store/actions/google-auth.action';\nimport { LoginErrorsEnum } from 'src/app/auth/store/models/user';\nimport { getGoogleIdToken } from 'src/app/auth/store/selectors/google-auth.selector';\nimport { GoogleLoginParams } from 'src/app/client/models/users.modules';\nimport { UsersServiceClient } from 'src/app/client/services/users-service.client';\nimport { LoginRoutes } from 'src/app/pages/login/login.routes.misc';\nimport { getLoginParams } from 'src/app/pages/login/store/login.selector';\nimport { SignUpRoutes } from 'src/app/pages/sign-up/sign-up.routes.misc';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { SnackbarService } from 'src/app/shared/services/snackbar.service';\n\n@Injectable()\nexport class GoogleAuthEffects {\n\n\n public readonly handleGoogleAuthSuccess = createEffect(() => this.storeActions.pipe(\n ofType(GoogleAuthActions.GOOGLE_AUTH_SUCCESS),\n map(() => new GoogleLoginStart()),\n ));\n\n\n public readonly handleGoogleAuthError = createEffect(() => this.storeActions.pipe(\n ofType(GoogleAuthActions.GOOGLE_AUTH_ERROR),\n tap(action => {\n this.snackbarService.queueSnackBar(\n this.getErrorMessage(action.payload.error),\n { duration: 10000 },\n );\n }),\n ), { dispatch: false });\n\n\n public readonly redirectUserToGoogleSignUpPage = createEffect(() => this.storeActions.pipe(\n ofType(GoogleAuthActions.GOOGLE_SIGNUP),\n switchMap(() => this.store.pipe(\n select(getRouterState),\n first())),\n tap(router => {\n if (router.queryParams.fileFlow) {\n this.router.navigate(\n [AppRoutes.SignUp, SignUpRoutes.Country],\n { queryParams: { fileFlow: true } },\n );\n } else if (router.queryParams.creditFlow) {\n this.router.navigate(\n [AppRoutes.SignUp, SignUpRoutes.Country],\n { queryParams: { creditFlow: true } },\n );\n } else this.router.navigate([AppRoutes.SignUp, SignUpRoutes.Country]);\n }),\n ), { dispatch: false });\n\n\n public readonly registerUserWithGoogleAccount = createEffect(() => this.storeActions.pipe(\n ofType(GoogleAuthActions.GOOGLE_REGISTER_START),\n switchMap(action => this.store.pipe(\n select(getGoogleIdToken),\n first(),\n map(idToken => [\n idToken,\n action.payload.country,\n action.payload.campaign_code,\n action.payload.affiliate_code,\n ]),\n )),\n switchMap(([id_token, country, campaign_code, affiliate_code]) => this.usersServiceClient.googleRegister(\n { id_token, country, campaign_code, affiliate_code }).pipe(\n map(() => new GoogleRegisterSuccess()),\n catchError((error: HttpErrorResponse) => of(new GoogleRegisterError(error.error))),\n )),\n ));\n\n\n public readonly handleUserLogin = createEffect(() => this.storeActions.pipe(\n ofType(GoogleAuthActions.GOOGLE_LOGIN_START),\n switchMap(() => forkJoin([\n this.store.pipe(select(getGoogleIdToken), first()),\n this.store.pipe(select(getLoginParams), first()),\n ])),\n switchMap(([id_token, loginParams]) => {\n let params: GoogleLoginParams = { id_token };\n if (loginParams && loginParams.code) params = { ...params, code: loginParams.code };\n\n return this.usersServiceClient\n .googleLogin(params)\n .pipe(\n map(response => new GoogleLoginSuccess({\n token: {\n accessToken: response.access_token,\n expires: new Date(Date.now() + response.expires_in * 1000),\n refreshToken: response.refresh_token,\n },\n })),\n catchError((error: HttpErrorResponse) => of(new GoogleLoginError(error.error))),\n );\n }),\n ));\n\n\n public readonly storeTokenAndAuthUserOnLoginSuccess = createEffect(() => this.storeActions.pipe(\n ofType(GoogleAuthActions.GOOGLE_LOGIN_SUCCESS),\n mergeMap(() => [\n new GetUserInfo(),\n new GetCreditBalance(),\n new CheckFreeLimit(),\n ]),\n ));\n\n\n public readonly handleGoogleLoginError = createEffect(() => this.storeActions.pipe(\n ofType(GoogleAuthActions.GOOGLE_LOGIN_ERROR),\n map(action => action.payload[0]),\n switchMap(error => forkJoin([\n of(error),\n this.store.pipe(\n select(getRouterState),\n first(),\n ),\n ])),\n filter(([error, routerState]) => {\n if (error.code === LoginErrorsEnum.TWO_FA_CODE_MISSING) {\n if (routerState.queryParams.fileFlow) {\n this.router.navigate(\n [AppRoutes.Login, LoginRoutes.TwoFA],\n { queryParams: { fileFlow: true } },\n );\n } else if (routerState.queryParams.creditFlow) {\n this.router.navigate(\n [AppRoutes.Login, LoginRoutes.TwoFA],\n { queryParams: { creditFlow: true } },\n );\n } else this.router.navigate([AppRoutes.Login, LoginRoutes.TwoFA]);\n return false;\n } else if (error.code === LoginErrorsEnum.TWO_FA_CODE_INCORRECT) {\n this.snackbarService.queueSnackBar(\n Notifications.GoogleCodeIncorrect,\n { duration: 10000 },\n );\n return false;\n } else return true;\n }),\n map(([error, _]) => {\n if (error.code === LoginErrorsEnum.NO_ACTIVE_ACCOUNT) {\n return new GoogleSignUp();\n } else {\n this.snackbarService.queueSnackBar(\n error.message,\n { duration: 10000 },\n );\n return new GoogleAuthCleanup();\n }\n }),\n ));\n\n\n public readonly cancelRegistration = createEffect(() => this.storeActions.pipe(\n ofType(GoogleAuthActions.GOOGLE_SIGNUP_CANCEL),\n switchMap(() => this.store.pipe(\n select(getRouterState),\n first(),\n )),\n map(routerState => {\n if (routerState.queryParams.fileFlow) {\n this.router.navigate(\n [AppRoutes.Login],\n { queryParams: { fileFlow: true } },\n );\n } else if (routerState.queryParams.creditFlow) {\n this.router.navigate(\n [AppRoutes.Login],\n { queryParams: { creditFlow: true } },\n );\n } else this.router.navigate([AppRoutes.Login]);\n return new GoogleAuthCleanup();\n }),\n ));\n\n constructor(\n private store: Store,\n private storeActions: Actions,\n private router: Router,\n private usersServiceClient: UsersServiceClient,\n private snackbarService: SnackbarService,\n ) {}\n\n private getErrorMessage(error: GoogleAuthErrorCodes): string {\n switch (error) {\n case GoogleAuthErrorCodes.CLOSED: {\n return Notifications.GoogleWindowClosed;\n }\n\n case GoogleAuthErrorCodes.DENIED: {\n return Notifications.GoogleAccessDenied;\n }\n\n case GoogleAuthErrorCodes.FAILED:\n default: {\n return Notifications.GoogleError;\n }\n }\n }\n\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { select, Store } from '@ngrx/store';\n\nimport { forkJoin, of } from 'rxjs';\nimport { catchError, first, map, mergeMap, switchMap, switchMapTo } from 'rxjs/operators';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { UsersServiceClient } from 'src/app/client/services/users-service.client';\n\nimport { getRouterState } from 'src/app/app/states/selectors/router.selectors';\nimport { LoginRoutes } from 'src/app/pages/login/login.routes.misc';\nimport { getLoginParams } from 'src/app/pages/login/store/login.selector';\nimport { GetUserInfo } from '../actions/getUserInfo.action';\nimport { GetCreditBalance } from '../actions/getCreditBalance.actions';\nimport { GoogleLoginStart } from '../actions/google-auth.action';\nimport { Login, LoginActions, LoginError, LoginSuccess, LoginTwoFA } from '../actions/login.action';\nimport { RegisterClean } from '../actions/register.action';\nimport { LoginErrorsEnum } from '../models/user';\nimport { RegisterState } from '../reducers/register.reducer';\nimport { getGoogleIdToken } from '../selectors/google-auth.selector';\nimport { getRegisterState } from '../selectors/register.selector';\n\n@Injectable()\nexport class LoginEffects {\n\n public login = createEffect(() => this.storeActions.pipe(\n ofType(LoginActions.LOGIN),\n switchMap(action => this.usersServiceClient.login(action.payload)\n .pipe(\n map((\n { access_token: accessToken, expires_in, refresh_token: refreshToken },\n ) => new LoginSuccess({\n email: action.payload.email,\n token: {\n accessToken,\n expires: new Date(Date.now() + expires_in * 1000),\n refreshToken,\n },\n })),\n catchError((error: HttpErrorResponse) => of(new LoginError(error.error))),\n ),\n ),\n ));\n\n\n public readonly loginWithTwoFA = createEffect(() => this.storeActions.pipe(\n ofType(LoginActions.LOGIN_TWO_FA),\n switchMap(() => forkJoin([\n this.store.select(getLoginParams).pipe(first()),\n this.store.select(getGoogleIdToken).pipe(first()),\n ])),\n map(([loginParams, googleIdToken]) => {\n if (loginParams && loginParams.email && loginParams.password && !googleIdToken) {\n return new Login(loginParams);\n } else if (loginParams && loginParams.code && googleIdToken) {\n return new GoogleLoginStart();\n } else {\n return new Login(loginParams);\n }\n }),\n ));\n\n\n public loadUserAfterLogin = createEffect(() => this.storeActions.pipe(\n ofType(LoginActions.LOGIN_SUCCESS),\n switchMapTo(this.store.pipe(\n select(getRegisterState),\n first(),\n mergeMap((registerState: RegisterState) => {\n const actionsToReturn: any[] = [\n new GetUserInfo(),\n new GetCreditBalance(),\n ];\n if (registerState && registerState.email) actionsToReturn.push(new RegisterClean());\n\n return actionsToReturn;\n }),\n )),\n ));\n\n\n public onLoginError = createEffect(() => this.storeActions.pipe(\n ofType(LoginActions.LOGIN_ERROR),\n map(action => action.payload[0]),\n switchMap(error => forkJoin([\n of(error),\n this.store.pipe(\n select(getRouterState),\n first(),\n ),\n ])),\n map(([error, routerState]) => {\n if (error.code === LoginErrorsEnum.REGISTRATION_NOT_FINISHED) {\n if (routerState.queryParams.fileFlow) {\n this.router.navigate(\n [AppRoutes.EmailConfirmation],\n { queryParams: { fileFlow: true } },\n );\n } else if (routerState.queryParams.creditFlow) {\n this.router.navigate(\n [AppRoutes.EmailConfirmation],\n { queryParams: { creditFlow: true } },\n );\n } else {\n this.router.navigate([AppRoutes.EmailConfirmation]);\n }\n } else if (error.code === LoginErrorsEnum.TWO_FA_CODE_MISSING) {\n if (routerState.queryParams.fileFlow) {\n this.router.navigate(\n [AppRoutes.Login, LoginRoutes.TwoFA],\n { queryParams: { fileFlow: true } },\n );\n } else if (routerState.queryParams.creditFlow) {\n this.router.navigate(\n [AppRoutes.Login, LoginRoutes.TwoFA],\n { queryParams: { creditFlow: true } },\n );\n } else {\n this.router.navigate([AppRoutes.Login, LoginRoutes.TwoFA]);\n }\n }\n }),\n ), { dispatch: false });\n\n constructor(\n private router: Router,\n private store: Store,\n private storeActions: Actions,\n private usersServiceClient: UsersServiceClient,\n ) {\n }\n}\n","import { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\n\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { asyncScheduler, of, scheduled } from 'rxjs';\nimport { map, mergeMap, tap } from 'rxjs/operators';\n\nimport { PersistenceService } from '../../services/persistence.service';\nimport { GetCreditBalance } from '../actions/getCreditBalance.actions';\nimport { GetUserInfo } from '../actions/getUserInfo.action';\nimport { GoogleAuthActions } from '../actions/google-auth.action';\nimport {\n LoadTokenAction,\n LoadTokenActions,\n LoadTokenError,\n LoadTokenSuccess,\n} from '../actions/loadToken.action';\nimport { LoginAction, LoginActions } from '../actions/login.action';\nimport { Logout, LogoutActions } from '../actions/logout.action';\nimport {\n RefreshTokenAction,\n RefreshTokenActions,\n RefreshTokenError,\n} from '../actions/refreshToken.action';\n\n@Injectable()\nexport class PersistenceEffects {\n\n public readonly persistTokenOnLogin = createEffect(() => this.storeActions.pipe(\n ofType(\n LoginActions.LOGIN_SUCCESS,\n RefreshTokenActions.REFRESH_TOKEN_SUCCESS,\n GoogleAuthActions.GOOGLE_LOGIN_SUCCESS),\n tap(({ payload }) => {\n this.persistenceService.persistToken(payload.token);\n }),\n ), { dispatch: false });\n\n\n public readonly removeTokenOnRefreshTokenError = createEffect(() => this.storeActions.pipe(\n ofType(\n RefreshTokenActions.REFRESH_TOKEN_ERROR, LogoutActions.LOGOUT),\n tap(() => {\n this.persistenceService.removeToken();\n this.router.navigate(['/']);\n }),\n ), { dispatch: false });\n\n /**\n * Autoload persisted token from localStorage\n */\n\n public readonly loadToken = createEffect(() => scheduled(of(null), asyncScheduler).pipe(\n map(() => {\n try {\n return new LoadTokenSuccess({\n token: this.persistenceService.loadToken(),\n });\n } catch {\n return new LoadTokenError();\n }\n }),\n ));\n\n\n public readonly loadUserInfo = createEffect(() => this.storeActions.pipe(\n // TODO: Add refresh token success action\n ofType(LoadTokenActions.LOAD_TOKEN_SUCCESS),\n mergeMap(() => [\n new GetUserInfo(),\n new GetCreditBalance(),\n ]),\n ));\n\n constructor(\n private storeActions: Actions,\n private persistenceService: PersistenceService,\n private router: Router,\n ) {\n }\n\n}\n","import { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { tap } from 'rxjs/operators';\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { RefreshTokenActions } from '../actions/refreshToken.action';\n\n@Injectable()\nexport class RefreshTokenEffects {\n\n\n public refreshTokenError = createEffect(() => this.storeActions.pipe(\n ofType(RefreshTokenActions.REFRESH_TOKEN_ERROR),\n tap(() => {\n this.router.navigate([AppRoutes.Login]);\n }),\n ), { dispatch: false });\n\n constructor(\n private storeActions: Actions,\n private router: Router,\n ) { }\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\n\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { select, Store } from '@ngrx/store';\nimport { of } from 'rxjs';\nimport { catchError, first, map, switchMap, switchMapTo, tap } from 'rxjs/operators';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { getRouterState } from 'src/app/app/states/selectors/router.selectors';\nimport { UsersServiceClient } from 'src/app/client/services/users-service.client';\nimport {\n Register,\n RegisterActions,\n RegisterCancel,\n RegisterClean,\n RegisterError,\n RegisterSuccess,\n} from '../actions/register.action';\nimport { AuthState } from '../auth.reducers';\n\n@Injectable()\nexport class RegisterEffects {\n\n /**\n * Registration of new user\n */\n\n public register = createEffect(() => this.storeActions.pipe(\n ofType(RegisterActions.REGISTER),\n switchMap(action => this.usersServiceClient.register(action.payload).pipe(\n map(() => new RegisterSuccess()),\n catchError((error: HttpErrorResponse) => of(new RegisterError(error.error))),\n ),\n ),\n ));\n\n /**\n * If user decides to start registration again / sign-in as another user\n * and leave confirmation screen, he will be redirected back to sign up\n */\n\n public readonly navigateOnCancelRegistration = createEffect(() => this.storeActions.pipe(\n ofType(RegisterActions.REGISTER_CANCEL),\n switchMapTo(this.store.pipe(\n select(getRouterState),\n first(),\n )),\n tap(state => {\n // If user cancels registration during confirmation, he is redirected to sign-up page\n if (state.url.includes(AppRoutes.EmailConfirmation)) {\n if (state.queryParams.fileFlow) {\n this.router.navigate([AppRoutes.SignUp], { queryParams: { fileFlow: true } });\n } else if (state.queryParams.creditFlow) {\n this.router.navigate([AppRoutes.SignUp], { queryParams: { creditFlow: true } });\n } else {\n this.router.navigate([AppRoutes.SignUp]);\n }\n // Else he is redirected from sign-up page to login screen on registration cancel\n } else if (state.url.includes(AppRoutes.SignUp)) {\n if (state.queryParams.fileFlow) {\n this.router.navigate([AppRoutes.Login], { queryParams: { fileFlow: true } });\n } else if (state.queryParams.creditFlow) {\n this.router.navigate([AppRoutes.Login], { queryParams: { creditFlow: true } });\n } else {\n this.router.navigate([AppRoutes.Login]);\n }\n }\n }),\n ), { dispatch: false });\n\n\n public readonly cancelRegistration = createEffect(() => this.storeActions.pipe(\n ofType(RegisterActions.REGISTER_CANCEL),\n map(() => new RegisterClean()),\n ));\n\n constructor(\n private storeActions: Actions,\n private usersServiceClient: UsersServiceClient,\n private store: Store,\n private router: Router,\n ) {\n }\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { of } from 'rxjs';\nimport { catchError, map, switchMap } from 'rxjs/operators';\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { UsersServiceClient } from 'src/app/client/services/users-service.client';\nimport {\n ResetPasswordConfirm,\n ResetPasswordConfirmActions,\n ResetPasswordConfirmError,\n ResetPasswordConfirmSuccess,\n} from '../actions/reset-password-confirm.actions';\n\n@Injectable()\nexport class ResetPasswordConfirmEffects {\n\n public resetPasswordConfirm = createEffect(() => this.storeActions.pipe(\n ofType(ResetPasswordConfirmActions.RESET_PASSWORD_CONFIRM),\n switchMap(action => this.usersServiceClient.forgotPasswordVerify(action.payload)\n .pipe(\n map(() => new ResetPasswordConfirmSuccess()),\n catchError((error: HttpErrorResponse) => of(new ResetPasswordConfirmError(error.error))),\n ),\n ),\n ));\n\n\n public resetPasswordConfirmSuccess = createEffect(() => this.storeActions.pipe(\n ofType(ResetPasswordConfirmActions.RESET_PASSWORD_CONFIRM_SUCCESS),\n map(() => this.router.navigate(['/', AppRoutes.Login])),\n ), { dispatch: false });\n\n constructor(\n private router: Router,\n private storeActions: Actions,\n private usersServiceClient: UsersServiceClient,\n ) {\n }\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { of } from 'rxjs';\nimport { catchError, map, switchMap } from 'rxjs/operators';\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { UsersServiceClient } from 'src/app/client/services/users-service.client';\nimport {\n ResetPassword,\n ResetPasswordActions,\n ResetPasswordError,\n ResetPasswordSuccess,\n} from '../actions/reset-password.actions';\n\n@Injectable()\nexport class ResetPasswordEffects {\n\n public resetPassword = createEffect(() => this.storeActions.pipe(\n ofType(ResetPasswordActions.RESET_PASSWORD),\n switchMap(action => this.usersServiceClient.forgotPasswordRequest(action.payload)\n .pipe(\n map(() => new ResetPasswordSuccess()),\n catchError((error: HttpErrorResponse) => of(new ResetPasswordError(error.error))),\n ),\n ),\n ));\n\n\n public resetPasswordSuccess = createEffect(() => this.storeActions.pipe(\n ofType(ResetPasswordActions.RESET_PASSWORD_SUCCESS),\n map(() => this.router.navigate([AppRoutes.ResetPassword, AppRoutes.ResetPasswordSent])),\n ), { dispatch: false });\n\n constructor(\n private router: Router,\n private storeActions: Actions,\n private usersServiceClient: UsersServiceClient,\n ) {\n }\n}\n","import { FileLimitEffects } from './effects/file-limit.effects';\nimport { GetCreditBalanceEffects } from './effects/getCreditBalance.effect';\nimport { GetGeoIPEffects } from './effects/getGeoIP.effect';\nimport { GetUserInfoEffects } from './effects/getUserInfo.effect';\nimport { GoogleAuthEffects } from './effects/google-auth.effects';\nimport { LoginEffects } from './effects/login.effect';\nimport { PersistenceEffects } from './effects/persistence.effect';\nimport { RefreshTokenEffects } from './effects/refreshToken.effect';\nimport { RegisterEffects } from './effects/register.effect';\nimport { ResetPasswordConfirmEffects } from './effects/reset-password-confirm.effects';\nimport { ResetPasswordEffects } from './effects/reset-password.effects';\nimport { VerifyEmailEffects } from './effects/verifyEmail.effect';\n\nexport const authEffects = [\n GoogleAuthEffects,\n FileLimitEffects,\n GetCreditBalanceEffects,\n GetGeoIPEffects,\n GetUserInfoEffects,\n LoginEffects,\n RefreshTokenEffects,\n PersistenceEffects,\n RegisterEffects,\n VerifyEmailEffects,\n ResetPasswordEffects,\n ResetPasswordConfirmEffects,\n];\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\n\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { select, Store } from '@ngrx/store';\nimport { forkJoin, of } from 'rxjs';\nimport { catchError, filter, first, map, switchMap, switchMapTo, tap } from 'rxjs/operators';\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { getRouterState } from 'src/app/app/states/selectors/router.selectors';\nimport { Login } from 'src/app/auth/store/actions/login.action';\nimport { UsersServiceClient } from 'src/app/client/services/users-service.client';\nimport { getLoginParams } from 'src/app/pages/login/store/login.selector';\nimport {\n VerifyEmail,\n VerifyEmailActions,\n VerifyEmailError,\n VerifyEmailSuccess,\n} from '../actions/verifyEmail.action';\nimport { getAuthParams } from '../auth.utils';\nimport { getRegisterState } from '../selectors/register.selector';\n\n@Injectable()\nexport class VerifyEmailEffects {\n\n /**\n * Verify user email address with activation code agains BE\n */\n\n public verifyEmail = createEffect(() => this.storeActions.pipe(\n ofType(VerifyEmailActions.VERIFY_EMAIL),\n switchMap(action => forkJoin([\n of(action),\n this.store.select(getRegisterState).pipe(first()),\n this.store.select(getLoginParams).pipe(first()),\n ])),\n switchMap(([action, registerState, loginParams]) => this.usersServiceClient\n .verifyEmail({\n code: action.payload.code,\n email: registerState.email || loginParams.email,\n }).pipe(\n map(() => new VerifyEmailSuccess()),\n catchError((error: HttpErrorResponse) => of(new VerifyEmailError(error.error))),\n ),\n ),\n ));\n\n\n public readonly redirectOnVerifyEmailSuccess = createEffect(() => this.storeActions.pipe(\n ofType(VerifyEmailActions.VERIFY_EMAIL_SUCCESS),\n switchMapTo(this.store.pipe(\n select(getRouterState),\n first(),\n )),\n // all the cases when the fileFlow=True are handled in file-routing.effects.ts\n // all the cases when the creditFlow=True are handled in order-credit.effects.ts\n filter(state =>\n state.url.includes(AppRoutes.EmailConfirmation) &&\n !state.queryParams.fileFlow &&\n !state.queryParams.creditFlow),\n tap(() => this.router.navigate(['/'])),\n ), { dispatch: false });\n\n /**\n * Logins after an email verification\n */\n\n public loginAfterRegistration = createEffect(() => this.storeActions.pipe(\n ofType(VerifyEmailActions.VERIFY_EMAIL_SUCCESS),\n switchMap(() => forkJoin([\n this.store.select(getRegisterState).pipe(first()),\n this.store.select(getLoginParams).pipe(first()),\n ])),\n map(([registerParams, loginParams]) => {\n const params = getAuthParams(registerParams, loginParams, 'VerifyEmailSuccess');\n return new Login(params);\n }),\n ));\n\n constructor(\n private router: Router,\n private storeActions: Actions,\n private store: Store,\n private usersServiceClient: UsersServiceClient,\n ) {\n }\n}\n","import { HTTP_INTERCEPTORS } from '@angular/common/http';\nimport { NgModule } from '@angular/core';\n\nimport { EffectsModule } from '@ngrx/effects';\nimport { StoreModule } from '@ngrx/store';\n\nimport { ClientModule } from '../client/client.module';\nimport { AuthInterceptor } from './interceptors/auth.interceptor';\nimport { PersistenceService } from './services/persistence.service';\nimport { authEffects } from './store/auth.effects';\nimport { authReducers, authStoreName } from './store/auth.reducers';\n\n@NgModule({\n declarations: [],\n imports: [\n StoreModule.forFeature(authStoreName, authReducers),\n EffectsModule.forFeature(authEffects),\n ClientModule,\n ],\n providers: [\n {\n provide: HTTP_INTERCEPTORS,\n useClass: AuthInterceptor,\n multi: true,\n },\n PersistenceService,\n ],\n})\nexport class AuthModule { }\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport { GetLimitExceededResponse } from 'src/app/client/models/mytitle-service.models';\n\nexport enum LimitActions {\n CHECK_FREE_LIMIT = '[limit] check free limit',\n CHECK_FREE_LIMIT_SUCCESS = '[limit] check free limit success',\n FREE_LIMIT_WARNING_SHOWN = '[limit] free limit warning shown',\n}\n\nexport class CheckFreeLimit implements Action {\n public readonly type = LimitActions.CHECK_FREE_LIMIT;\n}\n\nexport class CheckFreeLimitExceededSuccess implements Action {\n public readonly type = LimitActions.CHECK_FREE_LIMIT_SUCCESS;\n constructor(public payload: GetLimitExceededResponse) {\n }\n}\n\nexport class FreeLimitWarningShown implements Action {\n public readonly type = LimitActions.FREE_LIMIT_WARNING_SHOWN;\n}\n\nexport type LimitAction = CheckFreeLimit | CheckFreeLimitExceededSuccess | FreeLimitWarningShown;\n","/* eslint-disable max-classes-per-file */\nimport { HttpErrorResponse } from '@angular/common/http';\nimport { Action } from '@ngrx/store';\nimport { GetUserCreditBalanceResponse } from '../../../client/models/credit.models';\n\nexport enum GetCreditBalanceActions {\n GET_CREDIT_BALANCE = '[Auth] Get credit balance',\n GET_CREDIT_BALANCE_SUCCESS = '[Auth] Get credit balance Success',\n GET_CREDIT_BALANCE_ERROR = '[Auth] Get credit balance Error',\n CLEAR_CREDIT_BALANCE = '[Auth] Clear credit balance',\n}\n\nexport class GetCreditBalance implements Action {\n public readonly type = GetCreditBalanceActions.GET_CREDIT_BALANCE;\n}\n\nexport class GetCreditBalanceSuccess implements Action {\n public readonly type = GetCreditBalanceActions.GET_CREDIT_BALANCE_SUCCESS;\n constructor(public payload: GetUserCreditBalanceResponse) { }\n}\n\nexport class GetCreditBalanceError implements Action {\n public readonly type = GetCreditBalanceActions.GET_CREDIT_BALANCE_ERROR;\n constructor(public payload: HttpErrorResponse) { }\n}\n\nexport class ClearCreditBalance implements Action {\n public readonly type = GetCreditBalanceActions.CLEAR_CREDIT_BALANCE;\n}\n\nexport type GetCreditBalanceAction = GetCreditBalance\n | GetCreditBalanceSuccess\n | GetCreditBalanceError\n | ClearCreditBalance;\n","/* eslint-disable max-classes-per-file */\nimport { HttpErrorResponse } from '@angular/common/http';\nimport { Action } from '@ngrx/store';\nimport { GeoIP } from 'src/app/client/models/users.modules';\n\nexport enum GetGeoIPActions {\n GET_GEO_IP = '[Auth] GetGeoIP',\n GET_GEO_IP_SUCCESS = '[Auth] GetGeoIP Success',\n GET_GEO_IP_ERROR = '[Auth] GetGeoIP Error',\n}\n\nexport class GetGeoIP implements Action {\n public readonly type = GetGeoIPActions.GET_GEO_IP;\n}\n\nexport class GetGeoIPSuccess implements Action {\n public readonly type = GetGeoIPActions.GET_GEO_IP_SUCCESS;\n constructor(public payload: GeoIP) { }\n}\n\nexport class GetGeoIPError implements Action {\n public readonly type = GetGeoIPActions.GET_GEO_IP_ERROR;\n constructor(public payload: HttpErrorResponse) { }\n}\n\nexport type GetGeoIPAction = GetGeoIP | GetGeoIPSuccess | GetGeoIPError;\n","/* eslint-disable max-classes-per-file */\nimport { HttpErrorResponse } from '@angular/common/http';\nimport { Action } from '@ngrx/store';\nimport { User } from '../models/user';\n\nexport enum GetUserInfoActions {\n GET_USER_INFO = '[Auth] GetUserInfo',\n GET_USER_INFO_SUCCESS = '[Auth] GetUserInfo Success',\n GET_USER_INFO_ERROR = '[Auth] GetUserInfo Error',\n\n OPEN_VIDEO_DIALOG = '[Auth] Open video dialog',\n VIDEO_DIALOG_CLOSED = '[Auth] Video dialog closed',\n}\n\nexport class GetUserInfo implements Action {\n public readonly type = GetUserInfoActions.GET_USER_INFO;\n}\n\nexport class GetUserInfoSuccess implements Action {\n public readonly type = GetUserInfoActions.GET_USER_INFO_SUCCESS;\n constructor(public payload: User) { }\n}\n\nexport class GetUserInfoError implements Action {\n public readonly type = GetUserInfoActions.GET_USER_INFO_ERROR;\n constructor(public payload: HttpErrorResponse) { }\n}\n\nexport class OpenVideoDialog implements Action {\n public readonly type = GetUserInfoActions.OPEN_VIDEO_DIALOG;\n}\n\nexport class VideoDialogClosed implements Action {\n public readonly type = GetUserInfoActions.VIDEO_DIALOG_CLOSED;\n}\n\nexport type GetUserInfoAction =\nGetUserInfo |\nGetUserInfoSuccess |\nGetUserInfoError |\nOpenVideoDialog |\nVideoDialogClosed;\n","// eslint-disable-next-line max-classes-per-file\nimport { Action } from '@ngrx/store';\n\nimport { GoogleAuthParams, GoogleErrorResponse } from 'src/app/auth/auth.models';\nimport { TokenInfo } from 'src/app/auth/store/models/tokenInfo';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { GoogleRegistrationStartParams } from 'src/app/client/models/users.modules';\n\nexport enum GoogleAuthActions {\n GOOGLE_AUTH_START = '[auth] Google authentication start',\n GOOGLE_AUTH_SUCCESS = '[auth] Google authentication success',\n GOOGLE_AUTH_ERROR = '[auth] Google authentication error',\n\n GOOGLE_SIGNUP = '[auth] Google signup',\n GOOGLE_SIGNUP_CANCEL = '[auth] Google signup cancel',\n GOOGLE_AUTH_CLEANUP = '[auth] Google auth cleanup',\n\n GOOGLE_LOGIN_START = '[auth] Google login start',\n GOOGLE_LOGIN_SUCCESS = '[auth] Google login success',\n GOOGLE_LOGIN_ERROR = '[auth] Google login error',\n\n GOOGLE_REGISTER_START = '[auth] Google register start',\n GOOGLE_REGISTER_SUCCESS = '[auth] Google register success',\n GOOGLE_REGISTER_ERROR = '[auth] Google register error',\n\n SAVE_CAMPAIGN_CODE = '[auth] Google save campaign code',\n SAVE_AFFILIATE_CODE = '[auth] Google save affiliate code',\n}\n\nexport class GoogleAuthStart implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_AUTH_START;\n}\n\nexport class GoogleAuthSuccess implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_AUTH_SUCCESS;\n constructor(public payload: GoogleAuthParams) {}\n}\n\nexport class GoogleAuthError implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_AUTH_ERROR;\n constructor(public payload: GoogleErrorResponse) {}\n}\n\nexport class GoogleSignUp implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_SIGNUP;\n}\n\nexport class GoogleSignUpCancel implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_SIGNUP_CANCEL;\n}\n\nexport class GoogleAuthCleanup implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_AUTH_CLEANUP;\n}\n\nexport class GoogleRegisterStart implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_REGISTER_START;\n constructor(public payload: GoogleRegistrationStartParams) {}\n}\n\nexport class GoogleRegisterSuccess implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_REGISTER_SUCCESS;\n}\n\nexport class GoogleRegisterError implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_REGISTER_ERROR;\n constructor(public payload: MytitleError[]) {}\n}\n\nexport class GoogleLoginStart implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_LOGIN_START;\n}\n\nexport class GoogleLoginSuccess implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_LOGIN_SUCCESS;\n constructor(public payload: { token: TokenInfo }) {}\n}\n\nexport class GoogleLoginError implements Action {\n public readonly type = GoogleAuthActions.GOOGLE_LOGIN_ERROR;\n constructor(public payload: MytitleError[]) { }\n}\n\nexport class SaveCampaignCode implements Action {\n public readonly type = GoogleAuthActions.SAVE_CAMPAIGN_CODE;\n constructor(public payload: string) {}\n}\n\nexport class SaveAffiliateCode implements Action {\n public readonly type = GoogleAuthActions.SAVE_AFFILIATE_CODE;\n constructor(public payload: string) {}\n}\n\nexport type GoogleAuthAction =\n GoogleAuthStart |\n GoogleAuthSuccess |\n GoogleAuthError |\n GoogleAuthCleanup |\n GoogleSignUp |\n GoogleSignUpCancel |\n GoogleLoginStart |\n GoogleLoginSuccess |\n GoogleLoginError |\n GoogleRegisterStart |\n GoogleRegisterSuccess |\n GoogleRegisterError |\n SaveCampaignCode |\n SaveAffiliateCode;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport { TokenInfo } from '../models/tokenInfo';\n\nexport enum LoadTokenActions {\n LOAD_TOKEN_SUCCESS = '[Auth] LoadToken Success',\n LOAD_TOKEN_ERROR = '[Auth] LoadToken Error',\n}\n\nexport class LoadTokenSuccess implements Action {\n public readonly type = LoadTokenActions.LOAD_TOKEN_SUCCESS;\n constructor(public payload: {\n token: TokenInfo;\n }) { }\n}\n\nexport class LoadTokenError implements Action {\n public readonly type = LoadTokenActions.LOAD_TOKEN_ERROR;\n}\n\nexport type LoadTokenAction = LoadTokenSuccess | LoadTokenError;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\n\nexport enum LocationVerifyActions {\n LOCATION_VERIFIED = '[Auth] Location verified',\n}\n\nexport class LocationVerified implements Action {\n public readonly type = LocationVerifyActions.LOCATION_VERIFIED;\n}\n\nexport type LocationVerifyAction = LocationVerified;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { LoginParams } from 'src/app/client/models/users.modules';\nimport { TokenInfo } from '../models/tokenInfo';\n\nexport enum LoginActions {\n LOGIN = '[Auth] Login',\n LOGIN_TWO_FA = '[Auth] Login with 2FA',\n LOGIN_SUCCESS = '[Auth] Login Success',\n LOGIN_ERROR = '[Auth] Login Error',\n CLEAR_LOGIN_ERROR = '[Auth] Cleared Login Error',\n}\n\nexport class Login implements Action {\n public readonly type = LoginActions.LOGIN;\n constructor(public payload: LoginParams) { }\n}\n\nexport class LoginTwoFA implements Action {\n public readonly type = LoginActions.LOGIN_TWO_FA;\n constructor(public payload: string) {}\n}\n\nexport class LoginSuccess implements Action {\n public readonly type = LoginActions.LOGIN_SUCCESS;\n constructor(public payload: {\n email: string;\n token: TokenInfo;\n }) { }\n}\n\nexport class LoginError implements Action {\n public readonly type = LoginActions.LOGIN_ERROR;\n constructor(public payload: MytitleError[]) { }\n}\n\nexport class ClearLoginError implements Action {\n public readonly type = LoginActions.CLEAR_LOGIN_ERROR;\n}\n\nexport type LoginAction = Login | LoginSuccess | LoginError | LoginTwoFA | ClearLoginError;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\n\nexport enum LogoutActions {\n LOGOUT = '[Auth] Logout',\n}\n\nexport class Logout implements Action {\n public readonly type = LogoutActions.LOGOUT;\n}\n\nexport type LogoutAction = Logout;\n","/* eslint-disable max-classes-per-file */\nimport { HttpErrorResponse } from '@angular/common/http';\nimport { Action } from '@ngrx/store';\nimport { RefreshTokenRequest } from 'src/app/client/models/users.modules';\nimport { TokenInfo } from '../models/tokenInfo';\n\nexport enum RefreshTokenActions {\n REFRESH_TOKEN = '[Auth] Refresh token',\n REFRESH_TOKEN_SUCCESS = '[Auth] Refresh token success',\n REFRESH_TOKEN_ERROR = '[Auth] Refresh token error',\n}\n\nexport class RefreshToken implements Action {\n public readonly type = RefreshTokenActions.REFRESH_TOKEN;\n constructor(public payload: RefreshTokenRequest) { }\n}\n\nexport class RefreshTokenSuccess implements Action {\n public readonly type = RefreshTokenActions.REFRESH_TOKEN_SUCCESS;\n constructor(public payload: {\n token: TokenInfo;\n }) { }\n}\n\nexport class RefreshTokenError implements Action {\n public readonly type = RefreshTokenActions.REFRESH_TOKEN_ERROR;\n constructor(public payload: HttpErrorResponse) { }\n}\n\nexport type RefreshTokenAction = RefreshToken | RefreshTokenSuccess | RefreshTokenError;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { NewRegistrationParams } from 'src/app/client/models/users.modules';\n\nexport enum RegisterActions {\n REGISTER = '[Auth] Register',\n REGISTER_SUCCESS = '[Auth] Register Success',\n REGISTER_ERROR = '[Auth] Register Error',\n REGISTER_CANCEL = '[Auth] Register Cancel',\n REGISTER_CLEAN = '[Auth] Register Clean',\n}\n\nexport class Register implements Action {\n public readonly type = RegisterActions.REGISTER;\n constructor(public payload: NewRegistrationParams) { }\n}\n\nexport class RegisterSuccess implements Action {\n public readonly type = RegisterActions.REGISTER_SUCCESS;\n}\n\nexport class RegisterError implements Action {\n public readonly type = RegisterActions.REGISTER_ERROR;\n constructor(public payload: MytitleError[]) { }\n}\n\nexport class RegisterCancel implements Action {\n public readonly type = RegisterActions.REGISTER_CANCEL;\n}\n\nexport class RegisterClean implements Action {\n public readonly type = RegisterActions.REGISTER_CLEAN;\n}\n\nexport type RegisterAction = Register\n | RegisterSuccess\n | RegisterError\n | RegisterCancel\n | RegisterClean;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { ForgotPasswordVerifyParams } from 'src/app/client/models/users.modules';\n\nexport enum ResetPasswordConfirmActions {\n RESET_PASSWORD_CONFIRM = '[Auth] Reset Password Confirm',\n RESET_PASSWORD_CONFIRM_SUCCESS = '[Auth] Reset Password Confirm Success',\n RESET_PASSWORD_CONFIRM_ERROR = '[Auth] Reset Password Confirm Error',\n}\n\nexport class ResetPasswordConfirm implements Action {\n public readonly type = ResetPasswordConfirmActions.RESET_PASSWORD_CONFIRM;\n constructor(public payload: ForgotPasswordVerifyParams) { }\n}\n\nexport class ResetPasswordConfirmSuccess implements Action {\n public readonly type = ResetPasswordConfirmActions.RESET_PASSWORD_CONFIRM_SUCCESS;\n}\n\nexport class ResetPasswordConfirmError implements Action {\n public readonly type = ResetPasswordConfirmActions.RESET_PASSWORD_CONFIRM_ERROR;\n constructor(public payload: MytitleError[]) { }\n}\n\nexport type ResetPasswordConfirmAction = ResetPasswordConfirm\n | ResetPasswordConfirmSuccess\n | ResetPasswordConfirmError;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { ForgotPasswordRequestParams } from 'src/app/client/models/users.modules';\n\nexport enum ResetPasswordActions {\n RESET_PASSWORD = '[Auth] Reset Password',\n RESET_PASSWORD_SUCCESS = '[Auth] Reset Password Success',\n RESET_PASSWORD_ERROR = '[Auth] Reset Password Error',\n}\n\nexport class ResetPassword implements Action {\n public readonly type = ResetPasswordActions.RESET_PASSWORD;\n constructor(public payload: ForgotPasswordRequestParams) { }\n}\n\nexport class ResetPasswordSuccess implements Action {\n public readonly type = ResetPasswordActions.RESET_PASSWORD_SUCCESS;\n}\n\nexport class ResetPasswordError implements Action {\n public readonly type = ResetPasswordActions.RESET_PASSWORD_ERROR;\n constructor(public payload: MytitleError[]) { }\n}\n\nexport type ResetPasswordAction = ResetPassword | ResetPasswordSuccess | ResetPasswordError;\n","/* eslint-disable max-classes-per-file */\n\nimport { Action } from '@ngrx/store';\nimport { MytitleError } from 'src/app/client/models/client.models';\n\nexport enum VerifyEmailActions {\n VERIFY_EMAIL = '[Auth] Verify Email',\n VERIFY_EMAIL_SUCCESS = '[Auth] Verify Email Success',\n VERIFY_EMAIL_ERROR = '[Auth] Verify Email Error',\n}\n\nexport class VerifyEmail implements Action {\n public readonly type = VerifyEmailActions.VERIFY_EMAIL;\n constructor(public payload: { code: string }) { }\n}\n\nexport class VerifyEmailSuccess implements Action {\n public readonly type = VerifyEmailActions.VERIFY_EMAIL_SUCCESS;\n}\n\nexport class VerifyEmailError implements Action {\n public readonly type = VerifyEmailActions.VERIFY_EMAIL_ERROR;\n constructor(public payload: MytitleError) { }\n}\n\nexport type VerifyEmailAction = VerifyEmail | VerifyEmailSuccess | VerifyEmailError;\n","import { Action } from '@ngrx/store';\nimport { GoogleAuthErrorCodes } from 'src/app/auth/auth.models';\nimport { GoogleAuthAction, GoogleAuthActions } from 'src/app/auth/store/actions/google-auth.action';\nimport { GoogleRegistrationStartParams } from 'src/app/client/models/users.modules';\n\nexport interface GoogleAuthState {\n idToken: string;\n googleRegistrationParams: GoogleRegistrationStartParams;\n campaignCode: string;\n affiliateCode: string;\n errorCode: GoogleAuthErrorCodes;\n isAuthenticating: boolean;\n}\n\nexport const initialGoogleAuthState: GoogleAuthState = {\n idToken: null,\n googleRegistrationParams: null,\n affiliateCode: null,\n campaignCode: null,\n errorCode: null,\n isAuthenticating: null,\n};\n\nexport function googleAuthReducer(\n state = initialGoogleAuthState,\n generic: Action,\n): GoogleAuthState {\n\n const action = generic as GoogleAuthAction;\n switch (action.type) {\n\n case GoogleAuthActions.GOOGLE_AUTH_START: {\n return {\n ...state,\n isAuthenticating: true,\n };\n }\n\n case GoogleAuthActions.GOOGLE_AUTH_ERROR: {\n return {\n ...state,\n isAuthenticating: false,\n errorCode: action.payload.error,\n };\n }\n\n case GoogleAuthActions.GOOGLE_AUTH_SUCCESS: {\n return {\n ...state,\n idToken: action.payload.idToken,\n };\n }\n\n case GoogleAuthActions.GOOGLE_SIGNUP: {\n return {\n ...state,\n isAuthenticating: false,\n };\n }\n\n case GoogleAuthActions.GOOGLE_REGISTER_START: {\n return {\n ...state,\n googleRegistrationParams: action.payload,\n isAuthenticating: true,\n };\n }\n\n case GoogleAuthActions.GOOGLE_REGISTER_ERROR: {\n return {\n ...state,\n isAuthenticating: false,\n };\n }\n\n case GoogleAuthActions.GOOGLE_LOGIN_START: {\n return {\n ...state,\n isAuthenticating: true,\n };\n }\n\n case GoogleAuthActions.GOOGLE_LOGIN_ERROR: {\n return {\n ...state,\n isAuthenticating: false,\n };\n }\n\n case GoogleAuthActions.SAVE_CAMPAIGN_CODE: {\n return {\n ...state,\n campaignCode: action.payload,\n isAuthenticating: false,\n };\n }\n\n case GoogleAuthActions.SAVE_AFFILIATE_CODE: {\n return {\n ...state,\n affiliateCode: action.payload,\n isAuthenticating: false,\n };\n }\n\n case GoogleAuthActions.GOOGLE_AUTH_CLEANUP:\n case GoogleAuthActions.GOOGLE_LOGIN_SUCCESS: {\n return initialGoogleAuthState;\n }\n }\n\n return state;\n}\n","import { Action } from '@ngrx/store';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { RegisterAction, RegisterActions } from '../actions/register.action';\n\nexport interface RegisterState {\n fullName: string;\n email: string;\n password: string;\n country: string;\n registering: boolean;\n registered: boolean;\n registerError: MytitleError[];\n}\n\nconst registerInitialState: RegisterState = {\n fullName: null,\n email: null,\n password: null,\n country: null,\n registering: false,\n registered: false,\n registerError: null,\n};\n\nexport function registerReducer(\n state = registerInitialState,\n generic: Action,\n): RegisterState {\n // Typing here because of strictFunctionTypes\n // prevents setting the `action` type\n const action = generic as RegisterAction;\n\n switch (action.type) {\n case RegisterActions.REGISTER: {\n return {\n ...state,\n ...action.payload,\n registering: true,\n };\n }\n\n case RegisterActions.REGISTER_ERROR: {\n return {\n ...state,\n registering: false,\n registerError: action.payload,\n };\n }\n case RegisterActions.REGISTER_SUCCESS: {\n return {\n ...state,\n registering: false,\n registered: true,\n };\n }\n\n case RegisterActions.REGISTER_CLEAN:\n return registerInitialState;\n }\n\n return state;\n}\n","import { Action } from '@ngrx/store';\nimport { MytitleError } from '../../../client/models/client.models';\nimport {\n ResetPasswordConfirmAction,\n ResetPasswordConfirmActions,\n} from '../actions/reset-password-confirm.actions';\nimport { ResetPasswordAction, ResetPasswordActions } from '../actions/reset-password.actions';\n\nexport interface ResetPasswordState {\n resettingPassword: boolean;\n resetPasswordError: MytitleError[];\n\n resettingPasswordConfirm: boolean;\n resetPasswordConfirmError: MytitleError[];\n}\n\nexport const initialResetPasswordState: ResetPasswordState = {\n resettingPassword: false,\n resetPasswordError: null,\n resettingPasswordConfirm: false,\n resetPasswordConfirmError: null,\n};\n\nexport function resetPasswordReducer(\n state = initialResetPasswordState,\n generic: Action,\n) {\n const action = generic as ResetPasswordAction\n | ResetPasswordConfirmAction;\n switch (action.type) {\n case ResetPasswordActions.RESET_PASSWORD: {\n return { ...state, resettingPassword: true, resetPasswordError: null };\n }\n case ResetPasswordActions.RESET_PASSWORD_SUCCESS: {\n return { ...state, resettingPassword: false, resetPasswordError: null };\n }\n case ResetPasswordActions.RESET_PASSWORD_ERROR: {\n return { ...state, resettingPassword: false, resetPasswordError: action.payload };\n }\n\n case ResetPasswordConfirmActions.RESET_PASSWORD_CONFIRM: {\n return { ...state, resettingPasswordConfirm: true, resetPasswordConfirmError: null };\n }\n case ResetPasswordConfirmActions.RESET_PASSWORD_CONFIRM_SUCCESS: {\n return { ...state, resettingPasswordConfirm: false, resetPasswordConfirmError: null };\n }\n case ResetPasswordConfirmActions.RESET_PASSWORD_CONFIRM_ERROR: {\n return {\n ...state,\n resettingPasswordConfirm: false,\n resetPasswordConfirmError: action.payload,\n };\n }\n }\n return state;\n}\n","import { Action } from '@ngrx/store';\nimport * as jwtDecode from 'jwt-decode';\nimport { GeoIP } from 'src/app/client/models/users.modules';\n\nimport {\n ChangeUserInfoAction,\n ChangeUserInfoActions,\n} from 'src/app/pages/settings/store/actions/change-user-info.actions';\nimport {\n TwoFactorAuthenticationAction,\n TwoFactorAuthenticationActions,\n} from 'src/app/pages/settings/store/actions/two-factor-authentication.actions';\nimport { LimitAction, LimitActions } from '../actions/file-limit.action';\nimport {\n GetCreditBalanceAction,\n GetCreditBalanceActions,\n} from '../actions/getCreditBalance.actions';\nimport { GetGeoIPAction, GetGeoIPActions } from '../actions/getGeoIP.action';\nimport { GetUserInfoAction, GetUserInfoActions } from '../actions/getUserInfo.action';\nimport { GoogleAuthAction, GoogleAuthActions } from '../actions/google-auth.action';\nimport { LoadTokenAction, LoadTokenActions } from '../actions/loadToken.action';\nimport { LocationVerifyAction, LocationVerifyActions } from '../actions/locationVerify';\nimport { LoginAction, LoginActions } from '../actions/login.action';\nimport { LogoutAction, LogoutActions } from '../actions/logout.action';\nimport { RefreshTokenAction, RefreshTokenActions } from '../actions/refreshToken.action';\nimport { JWTTokenPayload } from '../models/jwt-token-payload';\nimport { TokenInfo } from '../models/tokenInfo';\nimport { LimitExceeded, User } from '../models/user';\n\nexport interface UserState {\n user: User;\n isLoadingUser: boolean;\n token: TokenInfo;\n geoIP: GeoIP;\n limitExceeded: LimitExceeded;\n credit: number;\n}\n\nexport const initialUserState: UserState = {\n user: null,\n isLoadingUser: false,\n token: null,\n geoIP: null,\n credit: null,\n limitExceeded: {\n isLimitExceeded: false,\n wasWarningShown: false,\n freeDocuments: null,\n },\n};\n\nexport function userReducer(\n state = initialUserState,\n generic: Action,\n): UserState {\n // Typing here because of strictFunctionTypes\n // prevents setting the `action` type\n const action = generic as LoginAction\n | RefreshTokenAction\n | GetUserInfoAction\n | LoadTokenAction\n | LogoutAction\n | GoogleAuthAction\n | GetCreditBalanceAction\n | GetGeoIPAction\n | LocationVerifyAction\n | TwoFactorAuthenticationAction\n | LimitAction\n | ChangeUserInfoAction;\n\n switch (action.type) {\n case LoginActions.LOGIN_SUCCESS: {\n return {\n ...state,\n user: {\n ...state.user,\n isInLoginProcess: true,\n email: action.payload.email,\n },\n token: {\n ...action.payload.token,\n },\n };\n }\n\n case GoogleAuthActions.GOOGLE_LOGIN_SUCCESS: {\n return {\n ...state,\n token: {\n ...action.payload.token,\n },\n user: {\n ...state.user,\n isInLoginProcess: true,\n },\n };\n }\n\n case RefreshTokenActions.REFRESH_TOKEN_SUCCESS: {\n return {\n ...state,\n token: {\n ...action.payload.token,\n },\n };\n }\n\n case RefreshTokenActions.REFRESH_TOKEN_ERROR: {\n return {\n ...state,\n user: null,\n token: null,\n };\n }\n\n case LogoutActions.LOGOUT: {\n return {\n ...state,\n user: null,\n token: null,\n credit: null,\n limitExceeded: {\n isLimitExceeded: false,\n wasWarningShown: false,\n freeDocuments: null,\n },\n };\n\n }\n\n case LocationVerifyActions.LOCATION_VERIFIED: {\n return {\n ...state,\n user: {\n ...state.user,\n isInLoginProcess: false,\n },\n };\n }\n\n case ChangeUserInfoActions.CHANGE_USER_INFO: {\n return {\n ...state,\n user: {\n ...state.user,\n isInLoginProcess: true,\n },\n };\n }\n\n case GetUserInfoActions.GET_USER_INFO: {\n return {\n ...state,\n user: {\n ...state.user,\n },\n isLoadingUser: true,\n };\n }\n\n case ChangeUserInfoActions.CHANGE_USER_INFO_SUCCESS:\n case GetUserInfoActions.GET_USER_INFO_SUCCESS: {\n return {\n ...state,\n user: {\n ...state.user,\n ...action.payload,\n },\n isLoadingUser: false,\n };\n }\n\n case LoadTokenActions.LOAD_TOKEN_SUCCESS: {\n const decodedToken: JWTTokenPayload = jwtDecode(action.payload.token.accessToken);\n\n return {\n ...state,\n user: {\n ...state.user,\n email: decodedToken.email,\n fullName: decodedToken.name,\n is_eu: decodedToken.is_eu,\n },\n token: {\n ...action.payload.token,\n },\n };\n }\n\n case GetGeoIPActions.GET_GEO_IP_SUCCESS: {\n return {\n ...state,\n geoIP: action.payload,\n };\n }\n\n case TwoFactorAuthenticationActions.TWO_FA_CODE_SUCCESS: {\n return {\n ...state,\n user: {\n ...state.user,\n two_factor_auth: true,\n },\n };\n }\n\n case TwoFactorAuthenticationActions.TWO_FA_REMOVAL_SUCCESS: {\n return {\n ...state,\n user: {\n ...state.user,\n two_factor_auth: false,\n },\n };\n }\n\n case GetCreditBalanceActions.GET_CREDIT_BALANCE_SUCCESS: {\n return {\n ...state,\n credit: action.payload.credits_count,\n };\n }\n\n case GetCreditBalanceActions.CLEAR_CREDIT_BALANCE: {\n return {\n ...state,\n credit: null,\n };\n }\n\n case LimitActions.CHECK_FREE_LIMIT_SUCCESS:\n return {\n ...state,\n limitExceeded: {\n ...state.limitExceeded,\n isLimitExceeded: action.payload.limit_exceeded,\n freeDocuments: action.payload.free_documents,\n },\n };\n\n case LimitActions.FREE_LIMIT_WARNING_SHOWN:\n return {\n ...state,\n limitExceeded: {\n ...state.limitExceeded,\n wasWarningShown: true,\n },\n };\n }\n\n return state;\n}\n","import { Action } from '@ngrx/store';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { VerifyEmailAction, VerifyEmailActions } from '../actions/verifyEmail.action';\n\nexport interface VerifyEmailState {\n verifying: boolean;\n error: MytitleError;\n}\n\nexport const initialVerifyEmailState: VerifyEmailState = {\n verifying: false,\n error: null,\n};\n\nexport function verifyEmailReducer(\n state = initialVerifyEmailState,\n generic: Action,\n) {\n const action = generic as VerifyEmailAction;\n switch (action.type) {\n case VerifyEmailActions.VERIFY_EMAIL: {\n return {\n ...state,\n verifying: true,\n error: null,\n };\n }\n case VerifyEmailActions.VERIFY_EMAIL_SUCCESS: {\n return {\n ...state,\n verifying: false,\n };\n }\n case VerifyEmailActions.VERIFY_EMAIL_ERROR: {\n return {\n ...state,\n error: action.payload,\n verifying: false,\n };\n }\n }\n return state;\n}\n","import { ActionReducerMap, createFeatureSelector } from '@ngrx/store';\nimport { googleAuthReducer, GoogleAuthState } from './reducers/google-auth.reducer';\nimport { registerReducer, RegisterState } from './reducers/register.reducer';\nimport { resetPasswordReducer, ResetPasswordState } from './reducers/reset-password.reducer';\nimport { userReducer, UserState } from './reducers/user.reducer';\nimport { verifyEmailReducer, VerifyEmailState } from './reducers/verifyEmail.reducer';\n\nexport interface AuthState {\n register: RegisterState;\n user: UserState;\n verifyEmail: VerifyEmailState;\n resetPassword: ResetPasswordState;\n google: GoogleAuthState;\n}\n\nexport const authReducers: ActionReducerMap = {\n register: registerReducer,\n user: userReducer,\n verifyEmail: verifyEmailReducer,\n resetPassword: resetPasswordReducer,\n google: googleAuthReducer,\n};\n\nexport const authStoreName = 'auth';\n\nexport const getAuthState = createFeatureSelector(authStoreName);\n","import { LoginParams } from 'src/app/client/models/users.modules';\nimport { RegisterState } from './reducers/register.reducer';\n\nexport function getAuthParams(\n registerState: RegisterState,\n loginParams: LoginParams,\n originEffect: string): { email: string; password: string } {\n if (registerState.email && registerState.password) {\n return { email: registerState.email, password: registerState.password };\n } else if (loginParams.email && loginParams.password) {\n return { email: loginParams.email, password: loginParams.password };\n } else {\n throw new Error(`[${originEffect}] Registration params are missing in\n store registerState and loginParam is null.`);\n }\n}\n","export interface User {\n fullName: string;\n isicNumber: string;\n isicExpiration: Date;\n isValidAcademy: boolean;\n email: string;\n country: string;\n is_eu: boolean;\n two_factor_auth: boolean;\n isInLoginProcess?: boolean;\n affiliate_code: string;\n}\n\nexport interface LimitExceeded {\n isLimitExceeded: boolean;\n wasWarningShown: boolean;\n freeDocuments: number;\n}\n\nexport enum UserCurrencyChange {\n FROM_USD_TO_EUR = 'Based on your account settings currency has been changed from USD to EUR.',\n FROM_EUR_TO_USD = 'Based on your account settings currency has been changed from EUR to USD.',\n}\n\nexport enum LoginErrorsEnum {\n REGISTRATION_NOT_FINISHED = 'REGISTRATION_NOT_FINISHED',\n NO_ACTIVE_ACCOUNT = 'NO_ACTIVE_ACCOUNT',\n TWO_FA_CODE_MISSING = '2FA_CODE_MISSING',\n TWO_FA_CODE_INCORRECT = '2FA_CODE_INCORRECT',\n ALREADY_REGISTERED_WITH_GOOGLE = 'USER_REGISTERED_WITH_GOOGLE',\n GOOGLE_AUTH_FAILED = 'GOOGLE_AUTH_FAILED',\n}\n\nexport enum ResendVerificationCodeErrorsEnum {\n EMAIL_SENT_RECENTLY = 'EMAIL_SENT_RECENTLY',\n EMAIL_ALREADY_VERIFIED = 'EMAIL_ALREADY_VERIFIED',\n NO_ACTIVE_ACCOUNT = 'NO_ACTIVE_ACCOUNT',\n}\n","import { createSelector } from '@ngrx/store';\nimport { getAuthState } from '../auth.reducers';\n\nexport const getGoogleAuthState = createSelector(\n getAuthState,\n state => state.google,\n)\n;\nexport const isGoogleAuthenticating = createSelector(\n getGoogleAuthState,\n state => state.isAuthenticating,\n);\n\nexport const getGoogleIdToken = createSelector(\n getGoogleAuthState,\n state => state.idToken,\n);\n\nexport const getGoogleCampaignCode = createSelector(\n getGoogleAuthState,\n state => state.campaignCode,\n);\n\nexport const getGoogleAffiliateCode = createSelector(\n getGoogleAuthState,\n state => state.affiliateCode,\n);\n","import { createSelector } from '@ngrx/store';\nimport { getAuthState } from '../auth.reducers';\n\nexport const getRegisterState = createSelector(\n getAuthState,\n state => state.register,\n);\n\nexport const getRegistering = createSelector(\n getRegisterState,\n state => state.registering,\n);\n\nexport const getRegistered = createSelector(\n getRegisterState,\n state => state.registered,\n);\n\nexport const getRegisterError = createSelector(\n getRegisterState,\n state => state.registerError,\n);\n\nexport const getRegisterEmail = createSelector(\n getRegisterState,\n state => state.email,\n);\n","import { createSelector } from '@ngrx/store';\nimport { getAuthState } from '../auth.reducers';\n\nexport const getUserState = createSelector(\n getAuthState,\n state => state.user,\n);\n\nexport const getAuthToken = createSelector(\n getUserState,\n userState => userState.token,\n);\n\nexport const getIsAuthorized = createSelector(\n getAuthToken,\n token => !!token,\n);\n\nexport const getFullName = createSelector(\n getUserState,\n state => state.user && state.user.fullName,\n);\n\nexport const getIsicNumber = createSelector(\n getUserState,\n state => state.user && state.user.isicNumber,\n);\n\nexport const getIsicExpiration = createSelector(\n getUserState,\n state => state.user && state.user.isicExpiration,\n);\n\nexport const getIsValidAcademy = createSelector(\n getUserState,\n state => state.user && state.user.isValidAcademy,\n);\n\n\nexport const getUserInfo = createSelector(\n getUserState,\n state => state.user,\n);\n\nexport const getIsLoadingUserInfo = createSelector(\n getUserState,\n state => state.isLoadingUser,\n);\n\nexport const getEmail = createSelector(\n getUserState,\n state => state.user && state.user.email,\n);\n\nexport const getCreditBalance = createSelector(\n getUserState,\n state => state.credit,\n);\n\nexport const getGeoIPState = createSelector(\n getUserState,\n state => state.geoIP,\n);\n\nexport const getIsEU = createSelector(\n getUserState,\n state => {\n if (state.user) return state.user.is_eu;\n else if (state.geoIP) return state.geoIP.is_eu;\n else return false;\n },\n);\n\nexport const hasUserEnabledTwoFA = createSelector(\n getUserState,\n state => {\n if (state.user) return state.user.two_factor_auth;\n else return false;\n },\n);\n\nexport const limitExceededState = createSelector(getUserState, state => state.limitExceeded);\n","import { GopayPaymentCreated } from './gopay.models';\n\nexport enum PaymentGateways {\n GOPAY = 'gopay',\n}\n\nexport interface CreatePaymentRequest {\n credit_order_guid: string;\n payment_gateway: PaymentGateways;\n}\n\nexport interface CreatePaymentResponse {\n gopay?: GopayPaymentCreated;\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\n\nimport { Observable } from 'rxjs';\n\nimport { getHttpParams } from 'src/app/app/utils/get-http-params';\nimport {\n CreateCreditOrderParams,\n CreateCreditOrderResponse,\n CreditOrderHistoryRequest,\n CreditOrderHistoryResponse,\n GetCreditOrderConfigResponse,\n GetUserCreditBalanceResponse,\n VoucherRequest,\n VoucherResponse,\n} from '../models/credit.models';\nimport { GetGopayPaymentStatus } from '../models/gopay.models';\nimport {\n FileOrderRequestParams,\n FileOrderResponse,\n FolderOrderRequestParams,\n FolderOrderResponse,\n} from '../models/order.models';\nimport { CreatePaymentRequest, CreatePaymentResponse } from '../models/payment.models';\n\n@Injectable()\nexport class BillingServiceClient {\n\n private serviceUrl = '/api/v1/billing';\n\n constructor(private http: HttpClient) {}\n\n public getGopayPaymentState(payment_id: number): Observable {\n return this.http.get(\n `${this.serviceUrl}/payment/gopay/${payment_id}/`);\n }\n\n public getCreditOrderConfig(): Observable {\n return this.http.get(`${this.serviceUrl}/credits/order-config`);\n }\n\n public getUserCreditBalance(): Observable {\n return this.http.get(`${this.serviceUrl}/credits/user-balance`);\n }\n\n public createCreditOrder(params: CreateCreditOrderParams): Observable {\n return this.http.post(`${this.serviceUrl}/credits/order`, params);\n }\n\n public createPayment(params: CreatePaymentRequest): Observable {\n return this.http.post(`${this.serviceUrl}/payment/`, params);\n }\n\n public createFileOrder(params: FileOrderRequestParams): Observable {\n return this.http.post(`${this.serviceUrl}/file-order/`, params);\n }\n\n public createFolderOrder(params: FolderOrderRequestParams): Observable {\n return this.http.post(`${this.serviceUrl}/folder-order`, params);\n }\n\n public getCreditOrderHistory(params: CreditOrderHistoryRequest):\n Observable {\n return this.http.get\n (`${this.serviceUrl}/order/credit-order-history`, { params: getHttpParams(params) } );\n }\n\n public validateVoucher(params: VoucherRequest): Observable {\n return this.http.post(`${this.serviceUrl}/voucher/validate`, params);\n }\n}\n","import { HttpClient, HttpEvent, HttpHeaders, HttpRequest } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\n\nimport { Observable } from 'rxjs';\n\nimport { getHttpParams } from 'src/app/app/utils/get-http-params';\nimport { DownloadFolderResponse } from 'src/app/pages/my-documents/my-documents.models';\nimport {\n CheckFolderResponse,\n CreateDocumentParams,\n CreateDocumentsDeletionParams,\n CreateSharingParams,\n Document,\n DocumentActivityResponse,\n DownloadDocumentTokenResponse,\n DownloadSharedDocumentTokenResponse,\n FinishDocumentsDeletionResponse,\n Folder,\n FolderWithChildren,\n GetFlatFolderListParams,\n GetFlatFolderListResponse,\n GetLimitExceededResponse,\n GetTreeFolderListParams,\n ListAllSharingsParams,\n ListDocumentsParams,\n ListDocumentsResponse,\n PatchDocumentRequest,\n PatchFolderParams,\n PublicDocument,\n SharingObject,\n UpdateSharingParams, WatermarkPreview,\n} from '../models/mytitle-service.models';\n\n@Injectable()\nexport class MytitleServiceClient {\n\n private serviceUrl = '/api/v1/mytitle';\n\n constructor(private http: HttpClient) {}\n\n public uploadFile(params: CreateDocumentParams): Observable> {\n const formDataParams = new FormData();\n formDataParams.set('file', params.file);\n formDataParams.set('folder', params.folder);\n formDataParams.set('is_free', '' + params.is_free);\n const req = new HttpRequest(\n 'POST',\n `${this.serviceUrl}/document`,\n formDataParams,\n { reportProgress: true },\n );\n return this.http.request(req);\n }\n\n /**\n * Lists all user's documents.\n */\n public listDocuments(params: ListDocumentsParams): Observable {\n return this.http\n .get(`${this.serviceUrl}/document`, { params: getHttpParams(params) });\n }\n\n /**\n * Get sharing activity for files.\n */\n public getFileActivity(document_guid: string): Observable {\n return this.http\n .get(`${this.serviceUrl}/document/${document_guid}/activity`);\n }\n\n /**\n * Get sharing activity for folders.\n */\n public getFolderActivity(folder_guid: string): Observable {\n return this.http\n .get(\n `/api/v1/mytitle/folder/${folder_guid}/activity`);\n }\n\n\n /**\n * Patch document for verification.\n */\n public patchDocument(\n document_guid: string,\n params: PatchDocumentRequest,\n ): Observable {\n console.log(params);\n return this.http.patch(`${this.serviceUrl}/document/${document_guid}`, params);\n }\n\n /**\n * Get public document for verification.\n */\n public getPublicDocument(document_guid: string): Observable {\n return this.http.get(`${this.serviceUrl}/public-document/${document_guid}`);\n }\n\n /**\n * Get access token to download document file.\n * Token is valid only for 1 minute and can be used only once.\n */\n public getDownloadToken(document_guid: string): Observable {\n return this.http\n .get\n (`${this.serviceUrl}/document/${document_guid}/get_download_token`);\n }\n\n /**\n * Get user's tree folder list\n */\n public getTreeFolderList(params: GetTreeFolderListParams): Observable {\n return this.http.get\n (`${this.serviceUrl}/folder/tree`, { params: getHttpParams(params) } );\n }\n\n /**\n * Get user's flat folder list\n */\n public getFlatFolderList(params: GetFlatFolderListParams): Observable {\n return this.http\n .get\n (`${this.serviceUrl}/folder/flat`, { params: getHttpParams(params) } );\n }\n\n /**\n * Create folder\n */\n public createFolder(params: Folder): Observable {\n return this.http\n .post(`${this.serviceUrl}/folder`, params );\n }\n\n /**\n * Get folder\n */\n public getFolder(folder_guid: string): Observable {\n return this.http\n .get(`${this.serviceUrl}/folder/${folder_guid}`);\n }\n\n /**\n * Patch folder\n */\n public patchFolder(params: PatchFolderParams): Observable {\n const folder_guid = params.folder.guid;\n return this.http\n .patch(`${this.serviceUrl}/folder/${folder_guid}`, params.folder);\n }\n\n /**\n * Checks how many documents (total and free) are inside this folder and it's descendants\n */\n public checkFilesInFolder(folder_guid: string): Observable {\n return this.http.get(`${this.serviceUrl}/folder/${folder_guid}/check`);\n }\n\n /**\n * Creates order for deleting document, needs to be confirmed by user via email\n */\n public createDocumentsDeletion(guids: CreateDocumentsDeletionParams):\n Observable {\n return this.http\n .post(`${this.serviceUrl}/deletion`, guids);\n }\n\n /**\n * Confirms guid sent to user's email and deletes marked documents/folders pernamently\n */\n public finishDocumentsDeletion(deletion_guid: string):\n Observable {\n return this.http.delete\n (`${this.serviceUrl}/deletion/${deletion_guid}`);\n }\n\n /**\n * Get all sharing objects for provided document/folder.\n */\n public listAllSharings(params: ListAllSharingsParams): Observable {\n return this.http\n .get(`${this.serviceUrl}/sharing`, { params: getHttpParams(params) });\n }\n\n /**\n * Create new sharing object for provided document/folder\n */\n public createSharing(params: CreateSharingParams): Observable {\n return this.http\n .post(`${this.serviceUrl}/sharing`, params);\n }\n\n /**\n * Update sharing object for provided document/folder\n */\n public updateSharing(params: UpdateSharingParams, sharing_guid: string):\n Observable {\n return this.http.patch(`${this.serviceUrl}/sharing/${sharing_guid}`, params);\n }\n\n /**\n * Delete sharing object for provided document/folder\n */\n public deleteSharing(sharing_guid: string): Observable {\n return this.http.delete(`${this.serviceUrl}/sharing/${sharing_guid}`);\n }\n\n /**\n * Gets all documents\n */\n public listSharedDocuments(params: ListDocumentsParams): Observable {\n return this.http.get\n (`${this.serviceUrl}/documents_shared_with_me`, { params: getHttpParams(params) });\n }\n\n /**\n * Get access token to download shared document\n * Token is valid only for 1 minute and can be used only once.\n */\n public getSharedDownloadToken(document_guid: string):\n Observable {\n return this.http\n .get\n (`${this.serviceUrl}/documents_shared_with_me/${document_guid}/get_download_token`);\n }\n\n /**\n * Gets all folders shared with user in tree structure\n */\n public getSharedTreeFolderList(): Observable {\n return this.http\n .get(`${this.serviceUrl}/folders_shared_with_me/tree`);\n }\n\n /**\n * gets all folders shared with user in flat structure\n */\n public getSharedFlatFolderList(params: GetFlatFolderListParams):\n Observable {\n return this.http\n .get\n (`${this.serviceUrl}/folders_shared_with_me/flat`, { params: getHttpParams(params) } );\n }\n\n /**\n * Checks whether the free plan is exceeded\n */\n public checkLimit(): Observable {\n return this.http.get(`${this.serviceUrl}/rate-limit-check`);\n }\n\n /**\n * Gets download token for folder downloading (.zip)\n */\n public getFolderDownloadToken(folder_guid: string): Observable {\n return this.http.get(`${this.serviceUrl}/folder/${folder_guid}/get_download_token`);\n }\n\n public getWatermarkPreview(params: WatermarkPreview) {\n const formDataParams = new FormData();\n const headers = new HttpHeaders();\n formDataParams.set('file', params.file);\n params.watermark_types.forEach(type => formDataParams.append('watermark_types', type));\n formDataParams.set('watermark_opacity', '' + params.watermark_opacity);\n return this.http.post(`${this.serviceUrl}/watermark_preview`,formDataParams, {headers, responseType: 'blob'});\n }\n\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Observable } from 'rxjs';\n\nimport {\n CreditOrderTokenResponse,\n DownloadCertificateTokenResponse,\n} from '../models/render-service.models';\n\n@Injectable()\nexport class RenderServiceClient {\n\n private serviceUrl = '/api/v1/render';\n\n constructor(private http: HttpClient) { }\n\n /*\n * Download token for file certificate\n */\n public getDownloadToken(guid: string): Observable {\n return this.http\n .get\n (`${this.serviceUrl}/certificate/${guid}/get_download_token`);\n }\n\n /*\n * Download token for folder certificate\n */\n public getDownloadFolderToken(folder_guid: string): Observable {\n return this.http\n .get\n (`${this.serviceUrl}/folder_certificate/${folder_guid}/get_download_token`);\n }\n\n /*\n * Download token for credit order receipt\n */\n public getCreditOrderDownloadToken(guid: string):\n Observable {\n return this.http.get(`/api/v1/render/credit-order-receipt/${guid}/get_download_token`);\n }\n}\n","import { HttpClient } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Observable } from 'rxjs';\n\nimport {\n ChangeUserInfoParams,\n ForgotPasswordRequestParams,\n ForgotPasswordVerifyParams,\n GeoIP,\n GetUserDeleteInfoResponse,\n GoogleLoginParams,\n GoogleRegistrationParams,\n LoginParams,\n NewRegistrationParams,\n OAuthValidResponse,\n RefreshTokenRequest,\n ResendVerificationCodeParams,\n ScorePasswordParams,\n SubmitUserRemovalParams,\n TwoStepAuthenticationParams,\n TwoStepAuthenticationResponse,\n UserInfo,\n UsersAffiliateEarnings,\n VerifyEmailParams,\n VerifyUserRemovalParams,\n VerifyUserRemovalResponse,\n} from '../models/users.modules';\n\n@Injectable()\nexport class UsersServiceClient {\n\n private serviceUrl = '/api/v1/users';\n\n constructor(private http: HttpClient) {}\n\n /**\n * NewRegistration\n * Creates new user account with user name and email. Sends a verification email.\n * Server will always return 204 if the email is in correct form as a protection\n * against user enumeration.\n *\n * Can be used to resend the email verification email (before the email address is\n * verified). Email verification message contains a code that the user needs\n * to enter to verify email.\n */\n public register(params: NewRegistrationParams): Observable {\n return this.http.post(`${this.serviceUrl}/register/new`, params);\n }\n\n public googleRegister(params: GoogleRegistrationParams): Observable {\n return this.http.post(`${this.serviceUrl}/register/google`, params);\n }\n\n /**\n * VerifyEmail\n * Verifies email and setups news password. Both are required.\n */\n public verifyEmail(params: VerifyEmailParams): Observable {\n return this.http.post(`${this.serviceUrl}/register/email_verify`, params);\n }\n\n /**\n * Resend verification code on email. Requires password and email.\n * Can be done only right after registration or when user logs in an not finished registration\n * code is returned, that means that entered email and password is ok.\n */\n public resendVerificationCode(params: ResendVerificationCodeParams): Observable {\n return this.http.post(`${this.serviceUrl}/register/resend_email_verify_code`, params);\n }\n\n /**\n * UserLogin\n * Logs in the user using provided credentials.\n * https://www.oauth.com/oauth2-servers/access-tokens/access-token-response/\n */\n public login(params: LoginParams): Observable {\n return this.http.post(`${this.serviceUrl}/login`, params);\n }\n\n public googleLogin(params: GoogleLoginParams): Observable {\n return this.http.post(`${this.serviceUrl}/login-google`, params);\n }\n\n /**\n * Retrieve user info\n */\n public getUserInfo(): Observable {\n return this.http.get(`${this.serviceUrl}/user_info`);\n }\n\n /**\n * Changes user info\n */\n public changeUserInfo(params: ChangeUserInfoParams): Observable {\n return this.http.patch(`${this.serviceUrl}/user_info`, params);\n }\n\n /**\n * Get affiliate program info\n */\n public getAffiliateUserInfo(): Observable {\n return this.http.get(`${this.serviceUrl}/user-info/affiliate`);\n }\n\n /**\n * Refresh token\n */\n public refreshToken(params: RefreshTokenRequest): Observable {\n return this.http.post(`${this.serviceUrl}/refresh_token`, params);\n }\n\n /**\n * Forgot password (request)\n * Requests a forgot password email with link to reset it.\n */\n public forgotPasswordRequest(params: ForgotPasswordRequestParams): Observable {\n return this.http.post(`${this.serviceUrl}/password/forgot_request`, params);\n }\n\n /**\n * Forgot password (verify)\n * Verifies and sets new password.\n */\n public forgotPasswordVerify(params: ForgotPasswordVerifyParams): Observable {\n return this.http.post(`${this.serviceUrl}/password/forgot_verify`, params);\n }\n\n /**\n * Score password\n * Checks password security.\n * Responds `204` if password security is sufficient.\n * Responds `400` with error code if not.\n */\n public scorePassword(params: ScorePasswordParams): Observable {\n return this.http.post(`${this.serviceUrl}/password/score`, params);\n }\n\n /**\n * Get Geo IP address\n */\n public getGeoIP(): Observable {\n return this.http.get(`${this.serviceUrl}/geoip`);\n }\n\n /**\n * Enable 2-Step Authentication\n */\n public enableTwoStepAuthentication(params?: TwoStepAuthenticationParams):\n Observable {\n return this.http.post(`${this.serviceUrl}/2fa`, params);\n }\n\n /**\n * Disable 2-Step Authentication\n */\n public disableTwoStepAuthentication() {\n return this.http.delete(`${this.serviceUrl}/2fa`);\n }\n\n /**\n * Tells if user has 2FA or password necessary for deletion\n */\n public getUserDeleteInfo(): Observable {\n return this.http.get(`${this.serviceUrl}/user_deletion/credentials`);\n }\n\n /**\n * Submit user info credentials for account removal\n */\n public submitUserRemoval(params: SubmitUserRemovalParams): Observable {\n return this.http.post(`${this.serviceUrl}/user_deletion/new`, params);\n }\n\n /**\n * Verify users with no 2FA\n */\n public verifyUserRemoval(params: VerifyUserRemovalParams): Observable {\n return this.http.post\n (`${this.serviceUrl}/user_deletion/verify`, params);\n }\n}\n","export enum AboutRoutes {\n Contact = 'contact',\n AboutUs = 'us',\n Gdpr = 'gdpr',\n Terms = 'terms',\n Legal = 'legal',\n Explanation = 'blockchain-notary',\n}\n","export function getCurrencySelector(isEU: boolean): string {\n if (isEU) {\n return 'EUR';\n } else return 'USD';\n}\n\nexport function getCurrencySign(currency: string): string {\n if (currency === 'CZK') return ' Kč';\n else if (currency === 'JPY') return '¥';\n else if (currency === 'EUR') return '€';\n else return '$';\n}\n\nexport function removeDecimals(bundlePrice: string): string {\n return bundlePrice.slice(0, bundlePrice.length - 3);\n}\n","export enum ErrorRoutes {\n Unexpected = 'unexpected',\n NotFound = '**',\n}\n","export enum LoginRoutes {\n TwoFA = 'two-fa',\n}\n","import { Action, createFeatureSelector } from '@ngrx/store';\nimport { GoogleAuthAction, GoogleAuthActions } from 'src/app/auth/store/actions/google-auth.action';\nimport { LoginAction, LoginActions } from 'src/app/auth/store/actions/login.action';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { LoginParams } from 'src/app/client/models/users.modules';\n\ninterface LoginState {\n loginParams: LoginParams;\n loggingIn: boolean;\n error: MytitleError[];\n}\n\nexport const initialLoginState: LoginState = {\n loginParams: null,\n loggingIn: false,\n error: null,\n};\n\nexport function loginReducer(\n state = initialLoginState,\n generic: Action,\n) {\n const action = generic as LoginAction | GoogleAuthAction;\n\n switch (action.type) {\n case LoginActions.LOGIN:\n return { ...state, loggingIn: true, error: null, loginParams: action.payload };\n case LoginActions.LOGIN_ERROR:\n return { ...state, loggingIn: false, error: action.payload };\n case LoginActions.LOGIN_SUCCESS:\n case GoogleAuthActions.GOOGLE_LOGIN_SUCCESS:\n return { ...state, loggingIn: false, error: null, loginParams: null };\n case LoginActions.LOGIN_TWO_FA:\n return {\n ...state,\n loggingIn: true,\n loginParams: { ...state.loginParams, code: action.payload },\n };\n case LoginActions.CLEAR_LOGIN_ERROR:\n return {\n ...state,\n error: null,\n };\n case GoogleAuthActions.GOOGLE_LOGIN_ERROR: {\n return {\n ...state,\n loggingIn: false,\n };\n }\n }\n\n return state;\n}\n\nexport const loginStoreName = 'login';\n\nexport const getLoginState = createFeatureSelector(loginStoreName);\n","import { createSelector } from '@ngrx/store';\nimport { getLoginState } from './login.reducer';\n\nexport const getLoggingIn = createSelector(getLoginState, state => state && state.loggingIn);\nexport const getLoginError = createSelector(getLoginState, state => state && state.error);\nexport const getLoginParams = createSelector(getLoginState, state => state && state.loginParams);\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\n\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport {\n DocumentActivityParams,\n DocumentActivityResponse,\n} from 'src/app/client/models/mytitle-service.models';\nimport { ActivityData } from '../../partials/activity-dialog/activity-dialog.component';\nimport { DocumentActivityState } from '../reducers/document-activity.reducer';\n\nexport enum DocumentActivityActions {\n GET_FILE_ACTIVITY = '[MyDocuments] Get file activity',\n GET_FILE_ACTIVITY_SUCCESS = '[MyDocuments] Get file activity success',\n GET_FILE_ACTIVITY_ERROR = '[MyDocuments] Get file activity error',\n\n GET_FOLDER_ACTIVITY = '[MyDocuments] Get folder activity',\n GET_FOLDER_ACTIVITY_SUCCESS = '[MyDocuments] Get folder activity success',\n GET_FOLDER_ACTIVITY_ERROR = '[MyDocuments] Get folder activity error',\n\n OPEN_ACTIVITY_DIALOG = '[MyDocuments] Open activity dialog',\n ACTIVITY_DIALOG_CLOSED = '[MyDocuments] Activity dialog closed',\n}\n\nexport class GetFileActivity implements Action {\n public readonly type = DocumentActivityActions.GET_FILE_ACTIVITY;\n constructor(public payload: DocumentActivityParams) {}\n}\n\nexport class GetFileActivitySuccess implements Action {\n public readonly type = DocumentActivityActions.GET_FILE_ACTIVITY_SUCCESS;\n constructor(public payload: DocumentActivityResponse[]) {}\n}\n\nexport class GetFileActivityError implements Action {\n public readonly type = DocumentActivityActions.GET_FILE_ACTIVITY_ERROR;\n constructor(public payload: MytitleError[]) {}\n}\n\nexport class GetFolderActivity implements Action {\n public readonly type = DocumentActivityActions.GET_FOLDER_ACTIVITY;\n constructor(public payload: DocumentActivityParams) {}\n}\n\nexport class GetFolderActivitySuccess implements Action {\n public readonly type = DocumentActivityActions.GET_FOLDER_ACTIVITY_SUCCESS;\n constructor(public payload: DocumentActivityResponse[]) {}\n}\n\nexport class GetFolderActivityError implements Action {\n public readonly type = DocumentActivityActions.GET_FOLDER_ACTIVITY_ERROR;\n constructor(public payload: MytitleError[]) {}\n}\n\nexport class OpenActivityDialog implements Action {\n public readonly type = DocumentActivityActions.OPEN_ACTIVITY_DIALOG;\n constructor(public payload: ActivityData) {}\n}\n\nexport class ActivityDialogClosed implements Action {\n public readonly type = DocumentActivityActions.ACTIVITY_DIALOG_CLOSED;\n constructor(public payload: DocumentActivityState) {}\n}\n\nexport type DocumentActivityAction =\n| GetFileActivity\n| GetFileActivitySuccess\n| GetFileActivityError\n| OpenActivityDialog\n| ActivityDialogClosed\n| GetFolderActivity\n| GetFolderActivitySuccess\n| GetFolderActivityError;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\n\nimport { HttpErrorResponse } from '@angular/common/http';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { CheckFolderResponse,\n Folder,\n FolderWithChildren,\n GetFlatFolderListParams,\n GetFlatFolderListResponse,\n GetTreeFolderListParams,\n PatchFolderParams,\n} from 'src/app/client/models/mytitle-service.models';\nimport { FolderOrderRequestParams, FolderOrderResponse } from 'src/app/client/models/order.models';\nimport { DownloadFolderRequest } from '../../my-documents.models';\n\nexport enum FolderActions {\n GET_TREE_FOLDER_LIST_START = '[Folders] Get tree folder list Start',\n GET_TREE_FOLDER_LIST_SUCCESS = '[Folders] Get tree folder list Success',\n\n GET_FLAT_FOLDER_LIST_START = '[Folders] Get flat folder list Start',\n GET_FLAT_FOLDER_LIST_SUCCESS = '[Folders] Get flat folder list Success',\n\n CREATE_FOLDER_START = '[Folders] Create folder Start',\n CREATE_FOLDER_SUCCESS = '[Folders] Create folder Success',\n\n GET_FOLDER_START = '[Folders] Get folder Start',\n GET_FOLDER_SUCCESS = '[Folders] Get folder Success',\n\n PATCH_FOLDER_START = '[Folders] Patch folder Start',\n PATCH_FOLDER_SUCCESS = '[Folders] Patch folder Success',\n PATCH_FOLDER_ERROR = '[Folders] Patch folder Error',\n CLEAN_PATCH_FOLDER = '[Folders] Clean patch folder',\n\n RENAME_FOLDER = '[Folders] Rename folder',\n RENAME_FOLDER_SUCCESS = '[Folders] Rename folder success',\n\n CHECK_FOLDER_FILES = '[Folders] Check folder files',\n CHECK_FOLDER_FILES_SUCCESS = '[Folders] Check folder files success',\n\n CREATE_FOLDER_ORDER = '[Folders] Create',\n FOLDER_ORDER_START = '[Folders] Start',\n FOLDER_ORDER_SUCCESS = '[Folders] Success',\n FOLDER_ORDER_ERROR = '[Folders] Error',\n\n GET_FOLDER_DOWNLOAD_TOKEN = '[Folders] Get folder download token',\n GET_FOLDER_DOWNLOAD_TOKEN_SUCCESS = '[Folders] Get folder download token success',\n}\n\nexport class GetTreeFolderListStart implements Action {\n public readonly type = FolderActions.GET_TREE_FOLDER_LIST_START;\n constructor(public payload: GetTreeFolderListParams) { }\n}\n\nexport class GetTreeFolderListSuccess implements Action {\n public readonly type = FolderActions.GET_TREE_FOLDER_LIST_SUCCESS;\n constructor(public payload: FolderWithChildren[]) { }\n}\n\nexport class GetFlatFolderListStart implements Action {\n public readonly type = FolderActions.GET_FLAT_FOLDER_LIST_START;\n constructor(public payload: GetFlatFolderListParams) { }\n}\n\nexport class GetFlatFolderListSuccess implements Action {\n public readonly type = FolderActions.GET_FLAT_FOLDER_LIST_SUCCESS;\n constructor(public payload: GetFlatFolderListResponse) { }\n}\n\nexport class CreateFolderStart implements Action {\n public readonly type = FolderActions.CREATE_FOLDER_START;\n constructor(public payload: Folder) { }\n}\n\nexport class CreateFolderSuccess implements Action {\n public readonly type = FolderActions.CREATE_FOLDER_SUCCESS;\n constructor(public payload: Folder) { }\n}\n\nexport class GetFolderStart implements Action {\n public readonly type = FolderActions.GET_FOLDER_START;\n constructor(public payload: string) { }\n}\n\nexport class GetFolderSuccess implements Action {\n public readonly type = FolderActions.GET_FOLDER_SUCCESS;\n constructor(public payload: Folder) { }\n}\n\nexport class RenameFolder implements Action {\n public readonly type = FolderActions.RENAME_FOLDER;\n constructor(public payload: PatchFolderParams) { }\n}\n\nexport class RenameFolderSuccess implements Action {\n public readonly type = FolderActions.RENAME_FOLDER_SUCCESS;\n constructor(public payload: PatchFolderParams) { }\n}\n\nexport class PatchFolderStart implements Action {\n public readonly type = FolderActions.PATCH_FOLDER_START;\n constructor(public payload: PatchFolderParams) { }\n}\n\nexport class PatchFolderSuccess implements Action {\n public readonly type = FolderActions.PATCH_FOLDER_SUCCESS;\n constructor(public payload: PatchFolderParams) { }\n}\n\nexport class PatchFolderError implements Action {\n public readonly type = FolderActions.PATCH_FOLDER_ERROR;\n constructor(public payload: MytitleError[]) { }\n}\n\nexport class CleanPatchFolder implements Action {\n public readonly type = FolderActions.CLEAN_PATCH_FOLDER;\n}\n\nexport class CheckFolderFiles implements Action {\n public readonly type = FolderActions.CHECK_FOLDER_FILES;\n constructor(public payload: string) { }\n}\n\nexport class CheckFolderFilesSuccess implements Action {\n public readonly type = FolderActions.CHECK_FOLDER_FILES_SUCCESS;\n constructor(public payload: CheckFolderResponse) { }\n}\n\nexport class CreateFolderOrder implements Action {\n public readonly type = FolderActions.CREATE_FOLDER_ORDER;\n constructor(public payload: Folder) {}\n}\n\nexport class FolderOrderStart implements Action {\n public readonly type = FolderActions.FOLDER_ORDER_START;\n constructor(public payload: FolderOrderRequestParams) {\n }\n}\n\nexport class FolderOrderSuccess implements Action {\n public readonly type = FolderActions.FOLDER_ORDER_SUCCESS;\n constructor(public payload: FolderOrderResponse) {\n }\n}\n\nexport class FolderOrderError implements Action {\n public readonly type = FolderActions.FOLDER_ORDER_ERROR;\n constructor(public payload: HttpErrorResponse) {\n }\n}\n\nexport class GetFolderDownloadToken implements Action {\n public readonly type = FolderActions.GET_FOLDER_DOWNLOAD_TOKEN;\n constructor(public payload: string) {}\n}\n\nexport class GetFolderDownloadTokenSuccess implements Action {\n public readonly type = FolderActions.GET_FOLDER_DOWNLOAD_TOKEN_SUCCESS;\n constructor(public payload: DownloadFolderRequest) {}\n}\n\nexport type FolderAction = GetTreeFolderListStart\n | GetTreeFolderListSuccess\n | GetFlatFolderListStart\n | GetFlatFolderListSuccess\n | CreateFolderStart\n | CreateFolderSuccess\n | GetFolderStart\n | GetFolderSuccess\n | PatchFolderStart\n | PatchFolderSuccess\n | PatchFolderError\n | CleanPatchFolder\n | RenameFolder\n | RenameFolderSuccess\n | CheckFolderFiles\n | CheckFolderFilesSuccess\n | CreateFolderOrder\n | FolderOrderStart\n | FolderOrderSuccess\n | FolderOrderError\n | GetFolderDownloadToken\n | GetFolderDownloadTokenSuccess;\n","/* eslint-disable max-classes-per-file */\nimport { HttpErrorResponse } from '@angular/common/http';\nimport { Action } from '@ngrx/store';\n\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport {\n CreateDocumentsDeletionParams,\n Document,\n FinishDocumentsDeletionResponse,\n ListDocumentsParams,\n ListDocumentsResponse,\n PatchDocumentRequest,\n} from 'src/app/client/models/mytitle-service.models';\n\nexport enum LoadDocumentsActions {\n UPDATE_MY_DOCUMENTS = '[MyDocuments] Update my documents',\n CLEAN_MY_DOCUMENTS = '[MyDocuments] Clean my documents',\n\n LOAD_DOCUMENTS_START = '[MyDocuments] LoadDocuments Start',\n LOAD_DOCUMENTS_SUCCESS = '[MyDocuments] LoadDocuments Success',\n LOAD_DOCUMENTS_ERROR = '[MyDocuments] LoadDocuments Error',\n}\n\nexport class UpdateMyDocuments implements Action {\n public readonly type = LoadDocumentsActions.UPDATE_MY_DOCUMENTS;\n constructor(public payload: { folderGuid: string; searchText: string }) {}\n}\n\nexport class CleanMyDocuments implements Action {\n public readonly type = LoadDocumentsActions.CLEAN_MY_DOCUMENTS;\n}\n\nexport class LoadDocumentsStart implements Action {\n public readonly type = LoadDocumentsActions.LOAD_DOCUMENTS_START;\n constructor(public payload: ListDocumentsParams) {}\n}\n\nexport class LoadDocumentsSuccess implements Action {\n public readonly type = LoadDocumentsActions.LOAD_DOCUMENTS_SUCCESS;\n constructor(public payload: ListDocumentsResponse) { }\n}\n\nexport class LoadDocumentsError implements Action {\n public readonly type = LoadDocumentsActions.LOAD_DOCUMENTS_ERROR;\n constructor(public payload: HttpErrorResponse) { }\n}\n\nexport type LoadDocumentsAction = LoadDocumentsStart | LoadDocumentsSuccess | LoadDocumentsError;\n\nexport enum ChangeDocumentActions {\n CHANGE_DOCUMENT_START = '[MyDocuments] Change Document Start',\n CHANGE_DOCUMENT_SUCCESS = '[MyDocuments] Change Document Success',\n CHANGE_DOCUMENT_ERROR = '[MyDocuments] Change Document Error',\n}\n\nexport class ChangeDocumentStart implements Action {\n public readonly type = ChangeDocumentActions.CHANGE_DOCUMENT_START;\n constructor(public payload: PatchDocumentRequest & { guid: string }) { }\n}\n\nexport class ChangeDocumentSuccess implements Action {\n public readonly type = ChangeDocumentActions.CHANGE_DOCUMENT_SUCCESS;\n constructor(public payload: { document: Document; changes: PatchDocumentRequest }) { }\n}\n\nexport class ChangeDocumentError implements Action {\n public readonly type = ChangeDocumentActions.CHANGE_DOCUMENT_ERROR;\n constructor(public payload: MytitleError[]) { }\n}\n\nexport type ChangeDocumentAction = UpdateMyDocuments\n | CleanMyDocuments\n | ChangeDocumentStart\n | ChangeDocumentSuccess\n | ChangeDocumentError;\n\nexport enum DeleteDocumentsActions {\n CREATE_DELETION_DOCUMENTS_START = '[MyDocuments] Create deletion of documents Start',\n CREATE_DELETION_DOCUMENTS_SUCCESS = '[MyDocuments] Create deletion of documents Success',\n CREATE_DELETION_DOCUMENTS_ERROR = '[MyDocuments] Create deletion of documents Error',\n\n FINISH_DELETION_DOCUMENTS_START = '[MyDocuments] Finish deletion of documents Start',\n FINISH_DELETION_DOCUMENTS_SUCCESS = '[MyDocuments] Finish deletion of documents Success',\n FINISH_DELETION_DOCUMENTS_ERROR = '[MyDocuments] Finish deletion of documents Error',\n}\n\nexport class CreateDeletionDocumentsStart implements Action {\n public readonly type = DeleteDocumentsActions.CREATE_DELETION_DOCUMENTS_START;\n constructor(public payload: CreateDocumentsDeletionParams) { }\n}\n\nexport class CreateDeletionDocumentsSuccess implements Action {\n public readonly type = DeleteDocumentsActions.CREATE_DELETION_DOCUMENTS_SUCCESS;\n}\n\nexport class CreateDeletionDocumentsError implements Action {\n public readonly type = DeleteDocumentsActions.CREATE_DELETION_DOCUMENTS_ERROR;\n constructor(public payload: HttpErrorResponse) { }\n}\n\nexport class FinishDeletionDocumentsStart implements Action {\n public readonly type = DeleteDocumentsActions.FINISH_DELETION_DOCUMENTS_START;\n constructor(public payload: string) { }\n}\n\nexport class FinishDeletionDocumentsSuccess implements Action {\n public readonly type = DeleteDocumentsActions.FINISH_DELETION_DOCUMENTS_SUCCESS;\n constructor(public payload: FinishDocumentsDeletionResponse) { }\n}\n\nexport class FinishDeletionDocumentsError implements Action {\n public readonly type = DeleteDocumentsActions.FINISH_DELETION_DOCUMENTS_ERROR;\n constructor(public payload: MytitleError[]) { }\n}\n\nexport type DeleteDocumentsAction =\n | CleanMyDocuments\n | CreateDeletionDocumentsStart\n | CreateDeletionDocumentsSuccess\n | CreateDeletionDocumentsError\n | FinishDeletionDocumentsStart\n | FinishDeletionDocumentsSuccess\n | FinishDeletionDocumentsError;\n","// eslint-disable-next-line max-classes-per-file\nimport { Action } from '@ngrx/store';\n\nimport { ListDocumentsResponse } from 'src/app/client/models/mytitle-service.models';\nimport { ListDocumentsParams } from 'src/app/client/models/mytitle-service.models';\n\nexport enum SharedDocumentActions {\n UPDATE_SHARED_DOCUMENTS = '[Shared documents] Update shared documents',\n CLEAN_SHARED_DOCUMENTS = '[Shared documents] Cleaning shared documents',\n\n GET_SHARED_DOCUMENTS = '[Shared documents] Get all shared documents',\n GET_SHARED_DOCUMENTS_SUCCESS = '[Shared documents] Get all shared documents success',\n}\n\nexport class GetSharedDocumentsStart implements Action {\n public readonly type = SharedDocumentActions.GET_SHARED_DOCUMENTS;\n constructor(public payload: ListDocumentsParams) {}\n}\n\nexport class GetSharedDocumentsSuccess implements Action {\n public readonly type = SharedDocumentActions.GET_SHARED_DOCUMENTS_SUCCESS;\n constructor(public payload: ListDocumentsResponse) {}\n}\n\nexport class CleanSharedDocuments implements Action {\n public readonly type = SharedDocumentActions.CLEAN_SHARED_DOCUMENTS;\n}\n\nexport class UpdateSharedDocuments implements Action {\n public readonly type = SharedDocumentActions.UPDATE_SHARED_DOCUMENTS;\n constructor(public payload: { folderGuid: string; searchText: string }) {}\n}\n\nexport type SharedDocumentAction =\n | GetSharedDocumentsStart\n | GetSharedDocumentsSuccess\n | UpdateSharedDocuments\n | CleanSharedDocuments;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\n\nimport {\n FolderWithChildren,\n GetFlatFolderListParams,\n GetFlatFolderListResponse,\n GetTreeFolderListParams,\n} from 'src/app/client/models/mytitle-service.models';\n\nexport enum SharedFolderActions {\n GET_TREE_FOLDER_LIST_START = '[Shared folders] Get tree folder list Start',\n GET_TREE_FOLDER_LIST_SUCCESS = '[Shared folders] Get tree folder list Success',\n\n GET_FLAT_FOLDER_LIST_START = '[Shared folders] Get flat folder list Start',\n GET_FLAT_FOLDER_LIST_SUCCESS = '[Shared folders] Get flat folder list Success',\n}\n\nexport class GetSharedTreeFolderListStart implements Action {\n public readonly type = SharedFolderActions.GET_TREE_FOLDER_LIST_START;\n constructor(public payload: GetTreeFolderListParams) { }\n}\n\nexport class GetSharedTreeFolderListSuccess implements Action {\n public readonly type = SharedFolderActions.GET_TREE_FOLDER_LIST_SUCCESS;\n constructor(public payload: FolderWithChildren[]) { }\n}\n\nexport class GetSharedFlatFolderListStart implements Action {\n public readonly type = SharedFolderActions.GET_FLAT_FOLDER_LIST_START;\n constructor(public payload: GetFlatFolderListParams) { }\n}\n\nexport class GetSharedFlatFolderListSuccess implements Action {\n public readonly type = SharedFolderActions.GET_FLAT_FOLDER_LIST_SUCCESS;\n constructor(public payload: GetFlatFolderListResponse) { }\n}\n\nexport type SharedFolderAction = GetSharedTreeFolderListStart |\n GetSharedTreeFolderListSuccess |\n GetSharedFlatFolderListStart |\n GetSharedFlatFolderListSuccess;\n","// eslint-disable-next-line max-classes-per-file\nimport { Action } from '@ngrx/store';\n\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport {\n CreateSharingParams,\n ListAllSharingsParams,\n SharingObject,\n UpdateSharingParams,\n} from 'src/app/client/models/mytitle-service.models';\nimport { ShareData } from '../../partials/sharing-dialog/sharing-dialog.component';\nimport { SharingsState } from './../reducers/sharing.reducer';\n\nexport enum SharingActions {\n GET_ALL_SHARINGS = '[MyDocuments] Get all sharings',\n GET_ALL_SHARINGS_SUCCESS = '[MyDocuments] Get all sharings success',\n CREATE_SHARING = '[MyDocuments] Create sharing',\n CREATE_SHARING_SUCCESS = '[MyDocuments] Create sharing success',\n CREATE_SHARING_ERROR = '[MyDocuments] Create sharing error',\n UPDATE_SHARING = '[MyDocuments] Update sharing',\n UPDATE_SHARING_SUCCESS = '[MyDocuments] Update sharing success',\n DELETE_SHARING = '[MyDocuments] Delete sharing',\n DELETE_SHARING_SUCCESS = '[MyDocuments] Delete sharing success',\n OPEN_SHARING_DIALOG = '[MyDocuments] Open sharing dialog',\n SHARING_DIALOG_CLOSED = '[MyDocuments] Sharing dialog closed',\n}\n\nexport class GetAllSharings implements Action {\n public readonly type = SharingActions.GET_ALL_SHARINGS;\n constructor(public payload: ListAllSharingsParams) {}\n}\n\nexport class GetAllSharingsSuccess implements Action {\n public readonly type = SharingActions.GET_ALL_SHARINGS_SUCCESS;\n constructor(public payload: SharingObject[]) {}\n}\n\nexport class CreateSharing implements Action {\n public readonly type = SharingActions.CREATE_SHARING;\n constructor(public payload: CreateSharingParams) {}\n}\n\nexport class CreateSharingSuccess implements Action {\n public readonly type = SharingActions.CREATE_SHARING_SUCCESS;\n constructor(public payload: SharingObject) {}\n}\n\nexport class CreateSharingError implements Action {\n public readonly type = SharingActions.CREATE_SHARING_ERROR;\n constructor(public payload: MytitleError[]) {}\n}\n\nexport class UpdateSharing implements Action {\n public readonly type = SharingActions.UPDATE_SHARING;\n constructor(public payload: { params: UpdateSharingParams; sharingGuid: string}) {}\n}\n\nexport class UpdateSharingSuccess implements Action {\n public readonly type = SharingActions.UPDATE_SHARING_SUCCESS;\n constructor(public payload: SharingObject) {}\n}\n\nexport class DeleteSharing implements Action {\n public readonly type = SharingActions.DELETE_SHARING;\n constructor(public payload: string) {}\n}\n\nexport class DeleteSharingSuccess implements Action {\n public readonly type = SharingActions.DELETE_SHARING_SUCCESS;\n constructor(public payload: string) {}\n}\n\nexport class OpenSharingDialog implements Action {\n public readonly type = SharingActions.OPEN_SHARING_DIALOG;\n constructor(public payload: ShareData) {}\n}\n\nexport class SharingDialogClosed implements Action {\n public readonly type = SharingActions.SHARING_DIALOG_CLOSED;\n constructor(public payload: SharingsState) {}\n}\n\nexport type SharingAction =\n GetAllSharings |\n GetAllSharingsSuccess |\n CreateSharing |\n CreateSharingSuccess |\n CreateSharingError |\n UpdateSharing |\n UpdateSharingSuccess |\n DeleteSharing |\n DeleteSharingSuccess |\n OpenSharingDialog |\n SharingDialogClosed;\n","import { Action } from '@ngrx/store';\n\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { DocumentActivityResponse } from 'src/app/client/models/mytitle-service.models';\nimport {\n DocumentActivityAction,\n DocumentActivityActions,\n} from '../actions/document-activity.actions';\n\nexport interface DocumentActivityState {\n documentActivity: DocumentActivityResponse[];\n isActivityLoading: boolean;\n activityError: MytitleError[];\n}\n\nexport const documentActivityInitialState: DocumentActivityState = {\n documentActivity: [],\n isActivityLoading: false,\n activityError: [],\n};\n\nexport function documentActivityReducer(\n state = documentActivityInitialState,\n generic: Action,\n): DocumentActivityState {\n\n const action = generic as DocumentActivityAction;\n switch (action.type) {\n\n case DocumentActivityActions.GET_FILE_ACTIVITY: {\n return {\n ...state,\n isActivityLoading: true,\n };\n }\n\n case DocumentActivityActions.GET_FILE_ACTIVITY_SUCCESS: {\n return {\n ...state,\n isActivityLoading: false,\n documentActivity: action.payload,\n };\n }\n\n case DocumentActivityActions.GET_FILE_ACTIVITY_ERROR: {\n return {\n ...state,\n activityError: action.payload,\n isActivityLoading: false,\n };\n }\n\n case DocumentActivityActions.GET_FOLDER_ACTIVITY: {\n return {\n ...state,\n isActivityLoading: true,\n };\n }\n\n case DocumentActivityActions.GET_FOLDER_ACTIVITY_SUCCESS: {\n return {\n ...state,\n isActivityLoading: false,\n documentActivity: action.payload,\n };\n }\n\n case DocumentActivityActions.GET_FOLDER_ACTIVITY_ERROR: {\n return {\n ...state,\n activityError: action.payload,\n isActivityLoading: false,\n };\n }\n\n case DocumentActivityActions.ACTIVITY_DIALOG_CLOSED: {\n return documentActivityInitialState;\n }\n\n default: return state;\n }\n}\n","import { Action } from '@ngrx/store';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport {\n CheckFolderResponse,\n Folder } from 'src/app/client/models/mytitle-service.models';\nimport { FolderAction, FolderActions } from '../actions/folder.actions';\n\nexport interface FolderState {\n folderBeingUpdated: boolean;\n folder: Folder;\n folderCheck: CheckFolderResponse;\n error: MytitleError[];\n}\n\nexport const folderInitialState: FolderState = {\n folderBeingUpdated: false,\n folder: null,\n folderCheck: null,\n error: null,\n};\n\nexport function folderReducer(\n state = folderInitialState,\n generic: Action,\n): FolderState {\n const action = generic as FolderAction;\n\n switch (action.type) {\n case (FolderActions.PATCH_FOLDER_START):\n return { ...state, folderBeingUpdated: true };\n\n case (FolderActions.PATCH_FOLDER_SUCCESS):\n return {\n ...state,\n folderBeingUpdated: action.payload.isUpgradingFolder,\n };\n\n case (FolderActions.PATCH_FOLDER_ERROR):\n return { ...state, error: action.payload };\n\n case (FolderActions.CLEAN_PATCH_FOLDER):\n return folderInitialState;\n\n case (FolderActions.CREATE_FOLDER_START):\n return { ...state, folderBeingUpdated: true };\n\n case (FolderActions.CREATE_FOLDER_SUCCESS):\n return { ...state, folderBeingUpdated: false };\n\n case (FolderActions.CHECK_FOLDER_FILES_SUCCESS):\n return { ...state, folderCheck: action.payload };\n\n case (FolderActions.CREATE_FOLDER_ORDER):\n return { ...state, folder: action.payload };\n }\n return state;\n}\n","/**\n * My documents store module which is eager loaded upon app init\n */\n\nimport { Action } from '@ngrx/store';\nimport { FileAction } from 'src/app/app/states/actions/file.action';\n\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport {\n Document,\n Folder,\n FolderPath,\n FolderWithChildren,\n} from 'src/app/client/models/mytitle-service.models';\nimport {\n FolderAction,\n FolderActions,\n} from 'src/app/pages/my-documents/store/actions/folder.actions';\nimport {\n ChangeDocumentAction,\n ChangeDocumentActions,\n LoadDocumentsAction,\n LoadDocumentsActions,\n LoadDocumentsSuccess,\n} from '../actions/my-documents.actions';\nimport {\n SharingAction,\n SharingActions,\n} from '../actions/sharing.actions';\nimport {\n SharingsState,\n} from './sharing.reducer';\n\nexport interface MyDocumentsState {\n documents: Document[];\n documentsPagination: {\n count: number;\n offset: number;\n totalCount: number;\n };\n documentsLoading: boolean;\n additionalDocumentsLoading: boolean;\n rollbackCopies: { [guid: string]: Document };\n treeFolders: FolderWithChildren[];\n treeFoldersLoading: boolean;\n flatFolders: Folder[];\n flatFolderPath: FolderPath[];\n folderLoading: boolean;\n error: MytitleError[];\n}\n\nexport const myDocumentsInitialState: MyDocumentsState = {\n documents: [],\n documentsPagination: {\n count: null,\n offset: null,\n totalCount: null,\n },\n documentsLoading: false,\n additionalDocumentsLoading: false,\n rollbackCopies: {},\n treeFolders: [],\n treeFoldersLoading: false,\n flatFolders: [],\n flatFolderPath: [],\n folderLoading: false,\n error: null,\n};\n\nexport function myDocumentsReducer(\n state = myDocumentsInitialState,\n generic: Action,\n): MyDocumentsState {\n const action = generic as LoadDocumentsAction |\n ChangeDocumentAction |\n FolderAction |\n FileAction |\n SharingAction;\n\n switch (action.type) {\n case (LoadDocumentsActions.LOAD_DOCUMENTS_START):\n if (action.payload.offset) return { ...state, additionalDocumentsLoading: true };\n else return { ...state, documentsLoading: true };\n\n case (LoadDocumentsActions.LOAD_DOCUMENTS_SUCCESS):\n return {\n ...state,\n documentsLoading: false,\n additionalDocumentsLoading: false,\n documents: getDocumentsState(state, action),\n documentsPagination: {\n count: action.payload.results_len,\n offset: action.payload.offset,\n totalCount: action.payload.total,\n },\n };\n\n case (LoadDocumentsActions.LOAD_DOCUMENTS_ERROR):\n return { ...state, documentsLoading: false };\n\n case (ChangeDocumentActions.CHANGE_DOCUMENT_START):\n const { guid, ...changes } = action.payload;\n const orig = state.documents.find(doc => doc.guid === guid);\n return {\n ...state,\n documents: state.documents\n .map(doc => doc.guid === guid ? { ...doc, ...changes } : doc),\n rollbackCopies: { ...state.rollbackCopies, [guid]: orig },\n };\n\n case (ChangeDocumentActions.CHANGE_DOCUMENT_SUCCESS):\n return {\n ...state,\n documents: state.documents\n .map(doc => doc.guid === action.payload.document.guid ? action.payload.document : doc),\n };\n\n case (SharingActions.SHARING_DIALOG_CLOSED):\n return {\n ...state,\n documents: updateDocumentShareStatus(state, action.payload),\n flatFolders: updateFolderShareStatus(state, action.payload),\n };\n\n case (ChangeDocumentActions.CHANGE_DOCUMENT_ERROR):\n return {\n ...state,\n error: action.payload,\n };\n\n case (FolderActions.GET_TREE_FOLDER_LIST_START):\n return { ...state, treeFoldersLoading: true };\n\n case (FolderActions.GET_TREE_FOLDER_LIST_SUCCESS):\n return { ...state, treeFoldersLoading: false, treeFolders: action.payload };\n\n case (FolderActions.GET_FLAT_FOLDER_LIST_START):\n return { ...state, folderLoading: true };\n\n case (FolderActions.GET_FLAT_FOLDER_LIST_SUCCESS):\n return {\n ...state,\n folderLoading: false,\n flatFolders: action.payload.folders,\n flatFolderPath: action.payload.folder_path,\n };\n\n case (FolderActions.GET_FOLDER_START):\n return { ...state, folderLoading: true };\n\n case (FolderActions.GET_FOLDER_SUCCESS):\n return { ...state, folderLoading: false, flatFolders: [action.payload] };\n\n case (LoadDocumentsActions.CLEAN_MY_DOCUMENTS):\n return myDocumentsInitialState;\n }\n return state;\n}\n\nfunction getDocumentsState(state: MyDocumentsState, action: LoadDocumentsSuccess) {\n // if returned request is already with offset check if there are alread some\n // documents in store and if they are concat those two arrays otherwise store returned one\n // if returned request has offset 0, wipe store and store these results\n if (action.payload.offset > 0) {\n return state.documents.length > 0 ?\n state.documents.concat(action.payload.results) :\n action.payload.results;\n } else return action.payload.results;\n}\n\nfunction updateDocumentShareStatus(\n state: MyDocumentsState, sharingDialogState: SharingsState): Document[] {\n\n if (sharingDialogState.documentGuid) {\n const documents = [...state.documents];\n const fileIndex = documents.findIndex(x => x.guid === sharingDialogState.documentGuid);\n\n if (!sharingDialogState.allSharings || !sharingDialogState.allSharings.length) {\n documents[fileIndex].is_shared = false;\n } else documents[fileIndex].is_shared = true;\n\n return documents;\n } else return state.documents;\n\n}\n\nfunction updateFolderShareStatus(\n state: MyDocumentsState, sharingDialogState: SharingsState): Folder[] {\n\n if (sharingDialogState.folderGuid) {\n const folders = [...state.flatFolders];\n const folderIndex = folders.findIndex(x => x.guid === sharingDialogState.folderGuid);\n\n if (!sharingDialogState.allSharings || !sharingDialogState.allSharings.length) {\n folders[folderIndex].is_shared = false;\n } else folders[folderIndex].is_shared = true;\n\n return folders;\n } else return state.flatFolders;\n}\n","import { Action } from '@ngrx/store';\n\nimport { Document } from 'src/app/client/models/mytitle-service.models';\nimport { SharedDocumentAction, SharedDocumentActions } from '../actions/shared-document.actions';\nimport { GetSharedDocumentsSuccess } from './../actions/shared-document.actions';\n\nexport interface SharedDocumentsState {\n documents: Document[];\n documentsPagination: {\n count: number;\n offset: number;\n totalCount: number;\n };\n documentsLoading: boolean;\n additionalDocumentsLoading: boolean;\n}\n\nexport const sharedDocumentsInitialState: SharedDocumentsState = {\n documents: [],\n documentsPagination: {\n count: null,\n offset: null,\n totalCount: null,\n },\n documentsLoading: false,\n additionalDocumentsLoading: false,\n};\n\nexport function sharedDocumentsReducer(\n state = sharedDocumentsInitialState,\n generic: Action,\n): SharedDocumentsState {\n\n const action = generic as SharedDocumentAction;\n switch (action.type) {\n\n case SharedDocumentActions.GET_SHARED_DOCUMENTS: {\n if (action.payload.offset) {\n return {\n ...state,\n additionalDocumentsLoading: true,\n };\n } else {\n return {\n ...state,\n documentsLoading: true,\n };\n }\n }\n\n case SharedDocumentActions.GET_SHARED_DOCUMENTS_SUCCESS: {\n return {\n ...state,\n documentsLoading: false,\n additionalDocumentsLoading: false,\n documents: getSharedDocumentsState(state, action),\n documentsPagination: {\n count: action.payload.results_len,\n offset: action.payload.offset,\n totalCount: action.payload.total,\n },\n };\n }\n\n case SharedDocumentActions.CLEAN_SHARED_DOCUMENTS: {\n return sharedDocumentsInitialState;\n }\n\n default: return state;\n }\n}\n\nfunction getSharedDocumentsState(state: SharedDocumentsState, action: GetSharedDocumentsSuccess) {\n // if returned request is already with offset check if there are alread some\n // documents in store and if they are concat those two arrays otherwise store returned one\n // if returned request has offset 0, wipe store and store these results\n if (action.payload.offset > 0) {\n return state.documents.length > 0 ?\n state.documents.concat(action.payload.results) :\n action.payload.results;\n } else return action.payload.results;\n}\n","import { Action } from '@ngrx/store';\n\nimport { FolderPath, FolderWithChildren } from 'src/app/client/models/mytitle-service.models';\nimport { Folder } from 'src/app/client/models/mytitle-service.models';\nimport { SharedDocumentAction, SharedDocumentActions } from '../actions/shared-document.actions';\nimport { SharedFolderAction, SharedFolderActions } from '../actions/shared-folder.actions';\n\nexport interface SharedFoldersState {\n treeFolders: FolderWithChildren[];\n flatFolders: Folder[];\n flatFolderPath: FolderPath[];\n flatFolderLoading: boolean;\n treeFolderLoading: boolean;\n}\n\nexport const sharedFoldersInitialState: SharedFoldersState = {\n treeFolders: [],\n flatFolders: [],\n flatFolderPath: [],\n flatFolderLoading: false,\n treeFolderLoading: false,\n};\n\nexport function sharedFoldersReducer(\n state = sharedFoldersInitialState,\n generic: Action,\n): SharedFoldersState {\n\n const action = generic as SharedFolderAction | SharedDocumentAction;\n switch (action.type) {\n\n case SharedFolderActions.GET_FLAT_FOLDER_LIST_START: {\n return {\n ...state,\n flatFolderLoading: true,\n };\n }\n\n case SharedFolderActions.GET_TREE_FOLDER_LIST_START: {\n return {\n ...state,\n treeFolderLoading: true,\n };\n }\n\n case SharedFolderActions.GET_FLAT_FOLDER_LIST_SUCCESS: {\n return {\n ...state,\n flatFolderLoading: false,\n flatFolders: action.payload.folders,\n flatFolderPath: action.payload.folder_path,\n };\n }\n\n case SharedFolderActions.GET_TREE_FOLDER_LIST_SUCCESS: {\n return {\n ...state,\n treeFolderLoading: false,\n treeFolders: action.payload,\n };\n }\n\n case SharedDocumentActions.CLEAN_SHARED_DOCUMENTS: {\n return sharedFoldersInitialState;\n }\n\n default: return state;\n }\n}\n","import { Action } from '@ngrx/store';\n\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport { SharingObject } from 'src/app/client/models/mytitle-service.models';\nimport {\n SharingAction,\n SharingActions,\n} from '../actions/sharing.actions';\n\nexport interface SharingsState {\n documentGuid: string;\n folderGuid: string;\n allSharings: SharingObject[];\n sharingError: MytitleError[];\n isLoading: boolean;\n}\n\nexport const sharingsInitialState: SharingsState = {\n documentGuid: null,\n folderGuid: null,\n sharingError: null,\n allSharings: [],\n isLoading: false,\n};\n\nexport function sharingsReducer(\n state = sharingsInitialState,\n generic: Action,\n): SharingsState {\n\n const action = generic as SharingAction;\n switch (action.type) {\n\n case SharingActions.GET_ALL_SHARINGS: {\n return {\n ...state,\n isLoading: true,\n documentGuid: action.payload.shared_document || null,\n folderGuid: action.payload.shared_folder || null,\n };\n }\n\n case SharingActions.GET_ALL_SHARINGS_SUCCESS: {\n return {\n ...state,\n isLoading: false,\n allSharings: action.payload,\n };\n }\n\n case SharingActions.CREATE_SHARING:\n case SharingActions.UPDATE_SHARING:\n case SharingActions.DELETE_SHARING: {\n return {\n ...state,\n isLoading: true,\n };\n }\n\n case SharingActions.CREATE_SHARING_SUCCESS: {\n return {\n ...state,\n isLoading: false,\n allSharings: state.allSharings.concat([action.payload]),\n };\n }\n\n case SharingActions.CREATE_SHARING_ERROR: {\n return {\n ...state,\n sharingError: action.payload,\n isLoading: false,\n };\n }\n\n case SharingActions.UPDATE_SHARING_SUCCESS: {\n return {\n ...state,\n isLoading: false,\n allSharings: replaceSharingObject(\n action.payload,\n state.allSharings,\n ),\n };\n }\n\n case SharingActions.DELETE_SHARING_SUCCESS: {\n return {\n ...state,\n isLoading: false,\n allSharings: removeSharingObject(\n action.payload,\n state.allSharings,\n ),\n };\n }\n\n case SharingActions.SHARING_DIALOG_CLOSED: {\n return sharingsInitialState;\n }\n\n default: return state;\n }\n}\n\nfunction replaceSharingObject(object: SharingObject, array: SharingObject[]): SharingObject[] {\n const index = array.findIndex(x => x.guid === object.guid);\n if (index !== -1) array[index] = object;\n else throw new Error('Updated sharing object was not found in store.');\n\n return array;\n}\n\nfunction removeSharingObject(guid: string, array: SharingObject[]): SharingObject[] {\n return array.filter(x => x.guid !== guid);\n}\n","/**\n * My documents store module which is lazy loaded when my-documents page is opened\n */\n\nimport { ActionReducerMap, createFeatureSelector } from '@ngrx/store';\n\nimport {\n documentActivityReducer,\n DocumentActivityState,\n} from './reducers/document-activity.reducer';\nimport { folderReducer, FolderState } from './reducers/folder.reducer';\nimport { myDocumentsReducer, MyDocumentsState } from './reducers/my-documents.reducers';\nimport { sharedDocumentsReducer, SharedDocumentsState } from './reducers/shared-document.reducer';\nimport { sharedFoldersReducer, SharedFoldersState } from './reducers/shared-folder.reducer';\nimport { sharingsReducer, SharingsState } from './reducers/sharing.reducer';\n\nexport const myDocumentsLazyStoreName = 'my-documents-lazy';\n\nexport interface MyDocumentsLazyState {\n documentActivity: DocumentActivityState;\n sharings: SharingsState;\n sharedDocuments: SharedDocumentsState;\n sharedFolders: SharedFoldersState;\n myDocuments: MyDocumentsState;\n folder: FolderState;\n}\n\nexport const myDocumentsLazyReducers: ActionReducerMap = {\n documentActivity: documentActivityReducer,\n sharings: sharingsReducer,\n sharedDocuments: sharedDocumentsReducer,\n sharedFolders: sharedFoldersReducer,\n myDocuments: myDocumentsReducer,\n folder: folderReducer,\n};\n\nexport const getMyDocumentsLazyState =\n createFeatureSelector(myDocumentsLazyStoreName);\n","import { createSelector } from '@ngrx/store';\nimport { getMyDocumentsLazyState } from '../my-documents.reducers';\n\nexport const getFolderState = createSelector(\n getMyDocumentsLazyState,\n state => state && state.folder,\n);\n\nexport const getUpgradingFolder = createSelector(\n getFolderState,\n state => state && state.folder,\n);\n\nexport const getFolderCheck = createSelector(\n getFolderState,\n state => state.folderCheck,\n);\n\nexport const getFolderBeingMytitled = createSelector(\n getFolderState,\n state => state.folderBeingUpdated,\n);\n","// eslint-disable-next-line max-classes-per-file\nimport { Action } from '@ngrx/store';\n\nimport { User } from 'src/app/auth/store/models/user';\nimport { ChangeUserInfoParams } from 'src/app/client/models/users.modules';\nimport { MytitleError } from 'src/app/client/models/client.models';\n\nexport enum ChangeUserInfoActions {\n CHANGE_USER_INFO_LOCALIZATION = '[settings] Change user info localization',\n CHANGE_USER_INFO = '[settings] Change user info',\n CHANGE_USER_INFO_SUCCESS = '[settings] Change user info success',\n CHANGE_USER_INFO_ERROR = '[settings] Change user info error',\n}\n\nexport class ChangeUserInfoLocalization implements Action {\n public readonly type = ChangeUserInfoActions.CHANGE_USER_INFO_LOCALIZATION;\n constructor(public payload: User) {}\n}\n\nexport class ChangeUserInfo implements Action {\n public readonly type = ChangeUserInfoActions.CHANGE_USER_INFO;\n constructor(public payload: ChangeUserInfoParams) {}\n}\n\nexport class ChangeUserInfoSuccess implements Action {\n public readonly type = ChangeUserInfoActions.CHANGE_USER_INFO_SUCCESS;\n constructor(public payload: User) {}\n}\n\nexport class ChangeUserInfoError implements Action {\n public readonly type = ChangeUserInfoActions.CHANGE_USER_INFO_ERROR;\n constructor(public payload: MytitleError[]) { }\n}\n\nexport type ChangeUserInfoAction =\n ChangeUserInfo |\n ChangeUserInfoSuccess |\n ChangeUserInfoError;\n","/* eslint-disable max-classes-per-file */\nimport { Action } from '@ngrx/store';\nimport {\n EnableTwoFACodeRequestPayload,\n EnableTwoFACodeSuccessPayload,\n EnableTwoFASuccessPayload,\n} from '../models/two-factor-authentication.models';\n\nexport enum TwoFactorAuthenticationActions {\n TWO_FA_REQUEST = '[settings] Requesting enabling 2FA',\n TWO_FA_SUCCESS = '[settings] 2FA request succeeded',\n TWO_FA_CODE_REQUEST = '[settings] Submiting 2FA code for confirmation',\n TWO_FA_CODE_SUCCESS = '[settings] 2FA code submit succeeded',\n TWO_FA_CODE_ERROR= '[settings] 2FA code has validation errors',\n TWO_FA_REMOVAL_REQUEST = '[settings] Requesting 2FA removal',\n TWO_FA_REMOVAL_SUCCESS = '[settings] 2FA was removed',\n}\n\nexport class EnableTwoFARequest implements Action {\n public readonly type = TwoFactorAuthenticationActions.TWO_FA_REQUEST;\n}\n\nexport class EnableTwoFASuccess implements Action {\n public readonly type = TwoFactorAuthenticationActions.TWO_FA_SUCCESS;\n constructor(public payload: EnableTwoFASuccessPayload) {}\n}\n\nexport class EnableTwoFACodeRequest implements Action {\n public readonly type = TwoFactorAuthenticationActions.TWO_FA_CODE_REQUEST;\n constructor(public payload: EnableTwoFACodeRequestPayload) {}\n}\n\nexport class EnableTwoFACodeSuccess implements Action {\n public readonly type = TwoFactorAuthenticationActions.TWO_FA_CODE_SUCCESS;\n constructor(public payload: EnableTwoFACodeSuccessPayload) {}\n}\n\nexport class EnableTwoFACodeError implements Action {\n public readonly type = TwoFactorAuthenticationActions.TWO_FA_CODE_ERROR;\n constructor(public payload: string) {}\n}\n\nexport class DisableTwoFARequest implements Action {\n public readonly type = TwoFactorAuthenticationActions.TWO_FA_REMOVAL_REQUEST;\n}\n\nexport class DisableTwoFASuccess implements Action {\n public readonly type = TwoFactorAuthenticationActions.TWO_FA_REMOVAL_SUCCESS;\n}\n\nexport type TwoFactorAuthenticationAction =\n EnableTwoFARequest |\n EnableTwoFASuccess |\n EnableTwoFACodeRequest |\n EnableTwoFACodeSuccess |\n EnableTwoFACodeError |\n DisableTwoFARequest |\n DisableTwoFASuccess;\n","export enum SignUpRoutes {\n Country = 'country',\n}\n","import { CommonModule } from '@angular/common';\nimport { NgModule } from '@angular/core';\nimport { MatLegacyButtonModule as MatButtonModule } from '@angular/material/legacy-button';\nimport { MatLegacyDialogModule as MatDialogModule } from '@angular/material/legacy-dialog';\n\nimport { ConfirmationDialogComponent } from './confirmation-dialog/confirmation-dialog.component';\n\n@NgModule({\n declarations: [\n ConfirmationDialogComponent,\n ],\n imports: [\n CommonModule,\n MatButtonModule,\n MatDialogModule,\n ],\n exports: [\n ConfirmationDialogComponent,\n ],\n})\nexport class ConfirmationDialogModule {}\n","import { Component, Inject } from '@angular/core';\nimport { MatLegacyDialogRef as MatDialogRef, MAT_LEGACY_DIALOG_DATA as MAT_DIALOG_DATA } from '@angular/material/legacy-dialog';\n\n@Component({\n selector: 'mt-confirmation-dialog',\n templateUrl: './confirmation-dialog.component.html',\n styleUrls: ['./confirmation-dialog.component.scss'],\n})\nexport class ConfirmationDialogComponent {\n\n constructor(\n @Inject(MAT_DIALOG_DATA) public text: string,\n private matDialogRef: MatDialogRef,\n ) {}\n\n public sendResult(confirmed: boolean) {\n this.matDialogRef.close(confirmed);\n }\n\n}\n","

Confirmation

\n\n
\n {{ text }}\n
\n\n
\n \n Cancel\n \n \n Confirm\n \n
\n","import {\n Component,\n ElementRef,\n EventEmitter,\n forwardRef,\n HostBinding,\n HostListener,\n Input,\n Output,\n ViewChild,\n} from '@angular/core';\nimport { ControlValueAccessor, NG_VALUE_ACCESSOR } from '@angular/forms';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { SnackbarService } from '../../shared/services/snackbar.service';\n\n@Component({\n selector: 'mt-drop-zone',\n templateUrl: './drop-zone.component.html',\n styleUrls: ['./drop-zone.component.scss'],\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n // eslint-disable-next-line @angular-eslint/no-forward-ref\n useExisting: forwardRef(() => DropZoneComponent),\n multi: true,\n },\n ],\n})\nexport class DropZoneComponent implements ControlValueAccessor {\n @ViewChild('fileInput', {static: false})\n public fileInput: ElementRef;\n\n public selectedFile: File;\n\n public isFileOver: boolean;\n\n /**\n * Emmits File when selected\n */\n @Output()\n // eslint-disable-next-line @angular-eslint/no-output-native\n public select = new EventEmitter();\n\n @Output()\n public isDragging = new EventEmitter();\n\n @Input()\n private clickable = true;\n\n // ControlValueAccessor filled\n private onChangeHandler: (file: File) => void;\n private onTouchedHandler: () => void;\n\n constructor(\n private snackbarService: SnackbarService,\n ) {\n }\n\n @HostBinding('class.dragover')\n public get classDragover() {\n return this.isFileOver;\n }\n\n @HostBinding('class.selected')\n public get classSelected() {\n return !!this.selectedFile;\n }\n\n @HostListener('dragover', ['$event'])\n public onDragover(event: Event) {\n this.isFileOver = true;\n (event as DragEvent).dataTransfer.dropEffect = 'link';\n event.preventDefault();\n event.stopPropagation();\n this.isDragging.emit(this.isFileOver);\n }\n\n @HostListener('dragenter', ['$event'])\n public onDragenter(event: Event) {\n this.isFileOver = true;\n (event as DragEvent).dataTransfer.dropEffect = 'link';\n event.preventDefault();\n event.stopPropagation();\n this.isDragging.emit(this.isFileOver);\n }\n\n @HostListener('dragleave', ['$event'])\n public onDragleave(event: Event) {\n this.isFileOver = false;\n this.isDragging.emit(false);\n event.preventDefault();\n event.stopPropagation();\n }\n\n @HostListener('drop', ['$event'])\n public onDrop(event: Event) {\n this.fireTouched();\n this.isFileOver = false;\n this.isDragging.emit(this.isFileOver);\n event.preventDefault();\n event.stopPropagation();\n const item = (event as DragEvent).dataTransfer.items[0];\n try {\n if (item && item.webkitGetAsEntry().isFile) {\n this.fileChanged(item.getAsFile());\n }\n // TODO: This is attepted browser compatibility solution. Check webkitGetAsEntry availibility\n // instead.\n } catch (e) {\n this.fileChanged((event as DragEvent).dataTransfer.files[0]);\n // TODO: Create `asyncError` utility function\n setTimeout(() => {\n throw e;\n });\n }\n }\n\n //// ControlValueAccessor\n\n public writeValue(file: any): void {\n if (file instanceof File) {\n this.selectedFile = file;\n } else {\n this.selectedFile = null;\n }\n }\n\n public registerOnChange(fn: any): void {\n this.onChangeHandler = fn;\n }\n\n public registerOnTouched(fn: any): void {\n this.onTouchedHandler = fn;\n }\n\n //// ControlValueAccessor end\n\n /**\n * Callback for when file changes\n */\n public fileChanged(file: File) {\n if (file) {\n if (file.size === 0) {\n this.snackbarService.queueSnackBar(Notifications.FileEmpty);\n return;\n } else if (file.size > 5e8) {\n this.snackbarService.queueSnackBar(Notifications.MaxSize);\n return;\n }\n this.selectedFile = file;\n this.select.emit(file);\n if (this.onChangeHandler) {\n this.onChangeHandler(file);\n }\n }\n this.fileInput.nativeElement.value = null;\n }\n\n /**\n * Opens a system dialog to select file.\n */\n public selectFile() {\n this.fireTouched();\n this.fileInput.nativeElement.click();\n }\n\n public clicked(event: Event) {\n event.stopPropagation();\n if (this.clickable) this.selectFile();\n }\n\n private fireTouched() {\n if (this.onTouchedHandler) {\n this.onTouchedHandler();\n }\n }\n\n}\n","
\n\n\n
\n","import { CommonModule } from '@angular/common';\nimport { NgModule } from '@angular/core';\nimport { MatLegacySnackBarModule as MatSnackBarModule } from '@angular/material/legacy-snack-bar';\nimport { DropZoneComponent } from './drop-zone.component';\n\n@NgModule({\n declarations: [\n DropZoneComponent,\n ],\n imports: [\n CommonModule,\n MatSnackBarModule,\n ],\n exports: [\n DropZoneComponent,\n ],\n})\nexport class DropZoneModule { }\n","/* eslint-disable @angular-eslint/no-forward-ref */\nimport {\n Component,\n ElementRef,\n EventEmitter,\n forwardRef,\n Output,\n ViewChild,\n} from '@angular/core';\nimport { ControlValueAccessor, NG_VALUE_ACCESSOR } from '@angular/forms';\n\nimport { FileExt } from 'src/app/app/states/reducers/upload-folder.reducer';\n\n@Component({\n selector: 'mt-folder-upload',\n templateUrl: './folder-upload.component.html',\n styleUrls: ['./folder-upload.component.scss'],\n providers: [\n {\n provide: NG_VALUE_ACCESSOR,\n useExisting: forwardRef(() => FolderUploadComponent),\n multi: true,\n },\n ],\n})\nexport class FolderUploadComponent implements ControlValueAccessor {\n\n @ViewChild('folderInput', { static: false })\n public folderInput: ElementRef;\n\n @Output()\n // eslint-disable-next-line @angular-eslint/no-output-native\n public select = new EventEmitter();\n\n public selectedFolder: FileExt[];\n\n public isFileOver: boolean;\n\n // ControlValueAccessor filled\n private onChangeHandler: (folder: FileExt[]) => void;\n private onTouchedHandler: () => void;\n\n constructor() {}\n\n //// ControlValueAccessor\n public writeValue(folder: any): void {\n this.selectedFolder = folder;\n }\n\n public registerOnChange(fn: any): void {\n this.onChangeHandler = fn;\n }\n\n public registerOnTouched(fn: any): void {\n this.onTouchedHandler = fn;\n }\n //// ControlValueAccessor end\n\n public folderChanged(files: FileList) {\n const filesArray = Object.values(files) as FileExt[];\n\n if (!filesArray.length) return;\n\n this.selectedFolder = filesArray;\n this.select.emit(filesArray);\n\n if (this.onChangeHandler) {\n this.onChangeHandler(filesArray);\n }\n }\n\n public selectFolder() {\n this.fireTouched();\n this.folderInput.nativeElement.click();\n }\n\n public clicked(event: Event) {\n event.stopPropagation();\n this.selectFolder();\n }\n\n private fireTouched() {\n if (this.onTouchedHandler) {\n this.onTouchedHandler();\n }\n }\n}\n","
\n \n \n
","import { CommonModule } from '@angular/common';\nimport { NgModule } from '@angular/core';\n\nimport { FolderUploadComponent } from './folder-upload.component';\n\n@NgModule({\n declarations: [\n FolderUploadComponent,\n ],\n imports: [\n CommonModule,\n ],\n exports: [\n FolderUploadComponent,\n ],\n})\nexport class FolderUploadModule {}\n","import { CommonModule } from '@angular/common';\nimport { NgModule } from '@angular/core';\nimport { RouterModule } from '@angular/router';\n\nimport { FooterComponent } from './footer/footer.component';\n\n@NgModule({\n declarations: [\n FooterComponent,\n ],\n imports: [\n CommonModule,\n RouterModule,\n ],\n exports: [FooterComponent],\n})\nexport class FooterModule {}\n","import { NgModule } from '@angular/core';\nimport { PaymentOptionsComponent } from './payment-options/payment-options.component';\n\n@NgModule({\n declarations: [PaymentOptionsComponent],\n imports: [\n ],\n exports: [\n PaymentOptionsComponent,\n ],\n})\nexport class PaymentOptionsModule { }\n","import { Component } from '@angular/core';\n\n@Component({\n selector: 'mt-payment-options',\n templateUrl: './payment-options.component.html',\n styleUrls: ['./payment-options.component.scss'],\n})\nexport class PaymentOptionsComponent {}\n","
\n
\n
\n \"\"\n\n \"\"\n\n \"\"\n\n \"\"\n\n \"\"\n\n \"\"\n\n \"\"\n\n \"\"\n\n
\n
\n
\n"," /* eslint-disable max-len */\n\nexport enum Notifications {\n Expires = 'Vyprší za ',\n UserNotRegistered = 'Uživatel není ještě registrován.',\n UserRegistered = 'Uživatel je již registrován.',\n NoLimit = 'Zdílení je časovo neomezené.',\n DocUpgradeSuccess = 'Úspěšně jste upgradovali váš dokument!',\n FolderUpgradeSuccess = 'Úspěšně jste upgradovali váši složku!',\n Unexpected = 'Neočekávaná chyba, která vznikla při nahrání souboru. Prosím zkuste znovu.',\n NotEnoughCredits = 'Nemáte dostatek kreditů',\n FolderUpgrade = 'Jste si jisti, že chcete vytvořit certifikát na tuto složku? Tato složka bude uzamknuta a nebudete mít možnost ji změnit.',\n Upgrade = 'Jste si jistý, že chcete upgradovat váš dokument?',\n MissingGuid = 'Chybí ID souboru',\n QuotaExceeded = 'Množství volných kreditů bylo překročeno',\n LinkSent = 'Potvrzovací link ke smazání byl poslán na váš email.',\n FileChanged = 'Váš soubor byl uspěšně změněn.',\n FileMoved = 'Váš soubor byl úspěšně přesunut.',\n FileRenamed = 'Váš soubor byl úspěšně přejmenován.',\n NotChecked = 'Neoznačil jste žádný dokument ke smazání.',\n DeleteSelected = 'Chcete opravdu smazat vybrané',\n Document = 'dokument',\n Documents = 'dokumenty',\n FolderMoved = 'Vaše složka byla úspěšně přesunuta.',\n FolderRenamed = 'Vaše složka byla úspěšně přejmenována.',\n LoggedOut = 'Byli jste odhlášeni',\n FileEmpty = 'Váš soubor je prázdný',\n MaxSize = 'Maximální velikost souboru je 500 MB',\n CopiedLink = 'Odkaz byl zkopírován',\n AlreadySigned = 'Už jste u nás zaregistrováni. Přihlásili jsme vás.',\n DisabledTwoFa = '2-fázové ověření bylo úspěšně odebráno.',\n DeletionStarted = 'Váš účet byl deaktivován a bude smazán za 30 dní.',\n AccountDeleted = 'Váš účet byl smazán.',\n ErrorOccured = 'Chyba nastala během ukládání změny na vašem účtě.',\n InfoChanged = 'Informace o účtu byly úspěšně změněny.',\n Invoice = 'Faktura nebyla stažena.',\n SharingWithYourself = 'Nemůžete sdílet dokument sám se sebou.',\n AlreadySharing = 'Tento dokument byl již sdílen s touto emailovou adresou.',\n Confirmed = 'Certifikát může být stažen jakmile je \"orazítkován\".',\n AuthError = 'Chyba nastala v ověření. Prosím zkuste se znovu přihlásit.',\n MailResent = 'Potvrzovací email byl zaslán',\n GoogleCodeIncorrect = 'Google ověřovací kód je nesprávný nebo mu vypršela platnost. Prosím zkuste znovu.',\n GoogleWindowClosed = 'Ověření nebylo úspěšné. Google ověřovací okno bylo zavřeno.',\n GoogleAccessDenied = 'Ověření nebylo úspěšné. Google zamítl přístup pro poskytnutý účet.',\n GoogleError = 'Chyba nastala během ověření pomocí Google účtu. Opakujte později.',\n WithoutName = 'Nahráno bez názvu',\n WrongButton = 'Namísto složky byl vybrán soubor. Použijte tlačítko \"nahrát soubor\".',\n NothingSelected = 'Žádné položky nebyly vybrány.',\n PaygateUnexpected = 'Neočekávaná chyba nastala během přístupu k platební bráně. Zkuste prosím znovu.',\n PaygateInvalidISIC = 'Pro zakoupení Academy kreditů zadejte číslo své ISIC karty.',\n PaygateISICBuyingStandard = 'Jste člen Academy. Vyberte si balíček z výhodnějších Academy kreditů.',\n LimitExceeded = 'Váš limit volných souborů byl překročen',\n FreeDocumentsInFolder = 'Ve složce, kterou chcete ověřit, jsou dokumenty zdarma. Nejprve ji upgradujte.',\n FolderLocked = 'Uzamčenou složku nelze měnit.',\n FolderEmpty = 'Nelze uzamknout prázdnou složku.',\n ContinueAfterUpload = 'V tomto procesu můžete pokračovat po nahrání souboru.',\n Remove = 'Klikněte pro odstranění údajů.',\n FileOrderError = 'Neočekávaná chyba nastala během zpracovávaní Vašeho dokumentu. Prosím zkuste znovu.',\n}\n","import { Injectable } from '@angular/core';\nimport { UniversalService } from '../universal/universal.service';\nimport { DataLayerEvent } from './data-layer.events';\n\n@Injectable({\n providedIn: 'root',\n})\nexport class DataLayerService {\n\n constructor(\n private universalService: UniversalService,\n ) { }\n\n public push(event: DataLayerEvent) {\n if (this.universalService.isPlatformServer()) {\n return;\n }\n const windowObj: any = window;\n if (windowObj?.dataLayer) windowObj.dataLayer.push(event);\n }\n}\n","import { Injectable } from '@angular/core';\n\nimport { environment } from 'src/environments/environment';\nimport { Environment } from 'src/environments/models/environment.models';\nimport { AvailableLanguageMutations } from 'src/environments/models/language.models';\n\n\n@Injectable({\n providedIn: 'root',\n})\nexport class EnvironmentService {\n\n private environment: Environment;\n\n constructor() {\n this.environment = environment;\n }\n\n public get isCzechEnvironment(): boolean {\n return this.environment.language === AvailableLanguageMutations.CZECH;\n }\n\n public get isEnglishEnvironment(): boolean {\n return this.environment.language === AvailableLanguageMutations.ENGLISH;\n }\n\n\n public isIOS() {\n return [\n 'iPad Simulator',\n 'iPhone Simulator',\n 'iPod Simulator',\n 'iPad',\n 'iPhone',\n 'iPod',\n ].includes(navigator.platform)\n // iPad on iOS 13 detection\n || (navigator.userAgent.includes('Mac') && 'ontouchend' in document);\n }\n\n public isMac() {\n return !!navigator.platform.match(/(Mac|iPhone|iPod|iPad)/i);\n }\n\n public isSmall() {\n return (/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent));\n }\n\n\n}\n","import { ErrorHandler, Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\nimport {\n EMPTY,\n MonoTypeOperatorFunction,\n} from 'rxjs';\nimport { catchError } from 'rxjs/operators';\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { ErrorRoutes } from 'src/app/pages/error/error.routes.misc';\n\n@Injectable({\n providedIn: 'root',\n})\nexport class ErrorHelperService {\n\n constructor(\n private errorHandler: ErrorHandler,\n private router: Router,\n ) { }\n\n /**\n * Resolve any error by showing an error page\n * returning an empty observable.\n */\n public raiseError(): MonoTypeOperatorFunction {\n return source => source.pipe(\n catchError(err => {\n if (err && err.status !== 401) this.showError(err);\n return EMPTY;\n }),\n );\n }\n\n private showError(error: any) {\n this.errorHandler.handleError(error);\n this.router.navigate([AppRoutes.Error, ErrorRoutes.Unexpected]);\n }\n\n}\n","import { Injectable, OnDestroy } from '@angular/core';\n\nimport { Store } from '@ngrx/store';\nimport { BehaviorSubject, Observable, Subject } from 'rxjs';\nimport { delay, filter, map, take, takeUntil, tap } from 'rxjs/operators';\n\nimport { MatLegacySnackBar as MatSnackBar, MatLegacySnackBarDismiss as MatSnackBarDismiss } from '@angular/material/legacy-snack-bar';\nimport { AppState } from '../../app/states/models/app.models';\nimport { FreeLimitWarningShown } from '../../auth/store/actions/file-limit.action';\n\ntype SnackbarActionType = 'FREE_LIMIT_WARNING_SHOWN';\n\nexport interface SnackbarConfigParams {\n duration?: number;\n triggerAction?: SnackbarActionType;\n}\n\nexport interface SnackBarQueueItem {\n message: string;\n beingDispatched: boolean;\n configParams?: SnackbarConfigParams;\n}\n\n@Injectable({\n providedIn: 'root',\n})\nexport class SnackbarService implements OnDestroy {\n\n private readonly snackBarQueue = new BehaviorSubject([]);\n private readonly snackBarQueue$ = this.snackBarQueue.asObservable();\n private ngDestroy = new Subject();\n\n constructor(\n private matSnackBar: MatSnackBar,\n private store: Store,\n ) {\n\n /* Dispatches all queued snack bars one by one */\n this.snackBarQueue$\n .pipe(\n filter(queue => queue.length > 0 && !queue[0].beingDispatched),\n tap(() => {\n const updatedQueue = this.snackBarQueue.value;\n updatedQueue[0].beingDispatched = true;\n this.snackBarQueue.next(updatedQueue);\n }),\n map(queue => queue[0]),\n takeUntil(this.ngDestroy))\n .subscribe(snackBarItem => this.showSnackbar(snackBarItem.message, snackBarItem.configParams));\n }\n\n public queueSnackBar(message: string, configParams?: SnackbarConfigParams) {\n this.snackBarQueue.next(\n this.snackBarQueue.value.concat([{ message, configParams, beingDispatched: false }]),\n );\n }\n\n public ngOnDestroy() {\n this.snackBarQueue.next([]);\n this.snackBarQueue.complete();\n this.ngDestroy.next();\n this.ngDestroy.complete();\n }\n\n private showSnackbar(message: string, configParams?: SnackbarConfigParams) {\n const duration = this.getDuration(configParams);\n this.removeDismissedSnackBar(\n this.matSnackBar.open(message, 'OK', { duration }).afterDismissed(),\n );\n this.triggerAction(configParams);\n }\n\n /* Remove dismissed snack bar from queue and triggers another one to appear */\n private removeDismissedSnackBar(dismissed: Observable) {\n dismissed\n .pipe(\n delay(1000),\n take(1))\n .subscribe(() => {\n const updatedQueue = this.snackBarQueue.value;\n if (updatedQueue[0].beingDispatched) updatedQueue.shift();\n this.snackBarQueue.next(updatedQueue);\n });\n }\n\n private getDuration(configParams?: SnackbarConfigParams): number {\n if (configParams && configParams.duration) return configParams.duration;\n else return 10000;\n }\n\n private triggerAction(configParams?: SnackbarConfigParams) {\n if (configParams && configParams.triggerAction) {\n if (configParams.triggerAction === 'FREE_LIMIT_WARNING_SHOWN') {\n this.store.dispatch(new FreeLimitWarningShown());\n }\n }\n }\n}\n","import { APP_INITIALIZER, NgModule } from '@angular/core';\nimport { makeStateKey, TransferState } from '@angular/platform-browser';\nimport { Store } from '@ngrx/store';\nimport { AppState } from '../../../../app/states/models/app.models';\nimport { ImportSsrStateAction } from './import.actions';\n\n/** Transfer key name for TransferState */\nexport const TRANSFER_STATE_KEY = 'state';\n\n/**\n * Upon application start, the function for inserting server-side-rendered state into the client\n * app is triggered\n */\nexport function importSsrStateFactory(store: Store, transferState: TransferState) {\n return function importSsrState() {\n const serverState = transferState.get(makeStateKey(TRANSFER_STATE_KEY), null);\n store.dispatch(new ImportSsrStateAction(serverState));\n };\n}\n\n/**\n * BrowserImportStateModule inserts the ssr generated state to the ngrx store by dispatching\n * ImportServerStateAction action upon app startup.\n */\n@NgModule({\n providers: [{\n provide: APP_INITIALIZER,\n useFactory: importSsrStateFactory,\n deps: [Store, TransferState],\n multi: true,\n }],\n})\nexport class BrowserImportSsrStateModule {\n}\n","import { Action } from '@ngrx/store';\nimport { AppState } from '../../../../app/states/models/app.models';\n\nexport enum ImportActions {\n IMPORT_SSR_STATE = 'Import SSR State',\n}\n\n/** SSR rendered state replaces the init state */\nexport class ImportSsrStateAction implements Action {\n public readonly type = ImportActions.IMPORT_SSR_STATE;\n\n constructor(public payload: AppState) {\n }\n}\n\nexport type ImportAction\n = ImportSsrStateAction;\n","import { Subscriber } from '../Subscriber';\nexport function skipWhile(predicate) {\n return (source) => source.lift(new SkipWhileOperator(predicate));\n}\nclass SkipWhileOperator {\n constructor(predicate) {\n this.predicate = predicate;\n }\n call(subscriber, source) {\n return source.subscribe(new SkipWhileSubscriber(subscriber, this.predicate));\n }\n}\nclass SkipWhileSubscriber extends Subscriber {\n constructor(destination, predicate) {\n super(destination);\n this.predicate = predicate;\n this.skipping = true;\n this.index = 0;\n }\n _next(value) {\n const destination = this.destination;\n if (this.skipping) {\n this.tryCallPredicate(value);\n }\n if (!this.skipping) {\n destination.next(value);\n }\n }\n tryCallPredicate(value) {\n try {\n const result = this.predicate(value, this.index++);\n this.skipping = Boolean(result);\n }\n catch (err) {\n this.destination.error(err);\n }\n }\n}\n","import { isPlatformServer } from '@angular/common';\nimport { Inject, Injectable, PLATFORM_ID, Type } from '@angular/core';\nimport { makeStateKey, TransferState } from '@angular/platform-browser';\nimport { Event as RouterEvent, Router, RoutesRecognized } from '@angular/router';\nimport { Actions, ofType } from '@ngrx/effects';\nimport { RouterNavigationAction, ROUTER_NAVIGATION } from '@ngrx/router-store';\nimport { MonoTypeOperatorFunction, Observable } from 'rxjs';\nimport { distinctUntilChanged, filter, map, skip, skipWhile, take } from 'rxjs/operators';\nimport { AppState, RouterStateUrl } from '../../app/states/models/app.models';\nimport { TRANSFER_STATE_KEY,\n} from './transfer-state/browser-import-state/browser-import-ssr-state.module';\n\n/** UniversalService contains methods to make easy development in the universal environment. */\n@Injectable({\n providedIn: 'root',\n})\nexport class UniversalService {\n private firstNavigation = true;\n private serverSideRendered: boolean;\n private platformServer: boolean;\n\n constructor(@Inject(PLATFORM_ID) platformId: string,\n transferState: TransferState,\n router: Router,\n private actions: Actions) {\n this.captureFirstNavigation(router);\n this.determineServerSideRendered(transferState);\n this.setPlatformServerAndBrowser(platformId);\n }\n\n /** Returns true when this app runs in the browser and was rendered on the server. */\n public isServerSideRendered(): boolean {\n return this.serverSideRendered;\n }\n\n public isPlatformServer(): boolean {\n return this.platformServer;\n }\n\n /**\n * isRoutingTo parses ROUTER_NAVIGATION based on the given component to which the Angular\n * Router is routing. This method helps to prevent duplicate API calls.\n */\n public isRoutingTo(component: Type): Observable {\n return this.actions\n .pipe(\n // filter by the ROUTER_NAVIGATION action\n ofType>(ROUTER_NAVIGATION),\n // could be null when snapshot is not found\n map(action => this.findRouteSnapshot(component, action.payload.routerState)),\n // do not pass snapshot when is has not changed\n distinctUntilChanged((oldSnapshot, newSnapshot) => {\n // oldSnapshot && ... syntax in case oldSnapshot would be null\n const oldParams = oldSnapshot && {\n url: oldSnapshot.url,\n params: oldSnapshot.params,\n queryParams: oldSnapshot.queryParams,\n };\n const newParams = newSnapshot && {\n url: newSnapshot.url,\n params: newSnapshot.params,\n queryParams: newSnapshot.queryParams,\n };\n // TODO: consider using better comparison method (eg. isEqual from lodash)\n return JSON.stringify(oldParams) === JSON.stringify(newParams);\n }),\n filter(snapshot => !!snapshot), // pass only non-null value\n this.firstOrSkipOp(), // eventually skip the first navigation event\n );\n }\n\n private captureFirstNavigation(router: Router) {\n // if there is a problem with duplicate requests upon first load with future versions of\n // Angular, this would be the place to check\n router.events\n .pipe(\n filter((event: RouterEvent) => event instanceof RoutesRecognized),\n skip(1), // Wait for the second navigation event.\n take(1), // we are not interested in other navigation events.\n )\n .subscribe(() => {\n this.firstNavigation = false;\n });\n }\n\n private determineServerSideRendered(transferState: TransferState) {\n this.serverSideRendered = transferState.hasKey(makeStateKey(TRANSFER_STATE_KEY));\n }\n\n private setPlatformServerAndBrowser(platformId: string) {\n this.platformServer = isPlatformServer(platformId);\n }\n\n /** Take only the first event on the server or skip the first event in the browser on the first\n * navigation.\n */\n private firstOrSkip(observable: Observable): Observable {\n if (this.isPlatformServer()) return observable.pipe(take(1));\n else {\n return observable.pipe(\n skipWhile(() => this.firstNavigation && this.isServerSideRendered()),\n );\n }\n }\n\n private firstOrSkipOp(): MonoTypeOperatorFunction {\n return (source: Observable) => this.firstOrSkip(source);\n }\n\n /** Find the route snapshot by component in the tree of snapshots. */\n private findRouteSnapshot(component: Type,\n snapshot: RouterStateUrl): RouterStateUrl {\n if (snapshot.component === component) return snapshot;\n else return null;\n }\n}\n","export function getFileCreditsValue(filesize: number, isAcademy: boolean): number {\r\n if (!isAcademy) return 1;\r\n const filesizeMB = filesize / 1048576;\r\n\r\n if (filesizeMB <= 1) return 1;\r\n if (filesizeMB <= 5) return 2;\r\n if (filesizeMB <= 20) return 3;\r\n if (filesizeMB <= 50) return 4;\r\n\r\n return 5;\r\n}\r\n","import { Environment } from './models/environment.models';\nimport { AvailableLanguageMutations } from './models/language.models';\n\nexport const environment: Environment = {\n production: true,\n apiUrl: 'https://mytitle.com',\n language: AvailableLanguageMutations.CZECH,\n version: '35ebee10088667aa5d35849c21cb575861a6b889',\n googleClientId: '670683061843-okcoeuaklei07icouss2t3guueeqva0t.apps.googleusercontent.com',\n};\n","export enum AvailableLanguageMutations {\n CZECH = 'cs',\n ENGLISH = 'en',\n}\n","export interface DataLayerEvent {\n event: string;\n}\n\nexport class NavigationEvent implements DataLayerEvent {\n public event = 'angular.navigate';\n public navigatedPage: string;\n constructor(navigatedPage: string) {\n this.navigatedPage = navigatedPage;\n }\n}\n","// eslint-disable max-classes-per-file\nimport { Action } from '@ngrx/store';\nimport { LayoutState } from '../reducers/layout.reducers';\n\nexport enum LayoutActions {\n CHANGE_LAYOUT_STATE = '[layout] Template changed',\n}\n\nexport class ChangeLayoutState implements Action {\n public readonly type = LayoutActions.CHANGE_LAYOUT_STATE;\n constructor(public payload: LayoutState) {}\n}\n","import { Action, createFeatureSelector } from '@ngrx/store';\nimport { ChangeLayoutState, LayoutActions } from './../actions/layout.actions';\n\nexport type ColorTheme = 'azure' | 'white' | 'transparent';\n\nexport interface LayoutState {\n path: string[];\n colorTheme: ColorTheme;\n /* Puts content of your component into container class, if you are\n willing to have container wrapper with margins on sides, set this to true. */\n applyRouterOutletContainer: boolean;\n /* Displays logo on footer element */\n displayFooterLogo: boolean;\n /* If you want to declare you own
element in HTML structure,\n set this property to false. Otherwise
element will be\n instantiated together with navigation component. */\n initializeHeaderElement: boolean;\n}\n\n/* Removes hashes and query params from URL */\nexport function getPathFromUrl(url: string): string {\n return url.split('?')[0].split('#')[0];\n}\n\nexport function getAppLayoutSettings(url: string): LayoutState {\n let routeLayoutState: LayoutState;\n // Try to find defined template for given route\n routeLayoutState = routeLayoutStates.find(x => x.path.includes(getPathFromUrl(url)));\n // If given route has not specified template, use default one\n if (!routeLayoutState) routeLayoutState = routeLayoutStates.find(x => x.path.includes('default'));\n\n return routeLayoutState;\n}\n\n/**\n * If you want to have specific template on your Route, please specify\n * it here. Otherwise default templating will be used.\n */\nconst routeLayoutStates: LayoutState[] = [\n {\n // HOME page\n path: ['/'],\n colorTheme: 'transparent',\n applyRouterOutletContainer: false,\n displayFooterLogo: true,\n initializeHeaderElement: true,\n },\n {\n // ABOUT US page\n path: ['/about/us'],\n colorTheme: 'transparent',\n applyRouterOutletContainer: false,\n displayFooterLogo: true,\n initializeHeaderElement: true,\n },\n {\n // CONTACT page\n path: ['/about/contact'],\n colorTheme: 'transparent',\n applyRouterOutletContainer: false,\n displayFooterLogo: true,\n initializeHeaderElement: true,\n },\n {\n // DEFAULT\n path: ['default'],\n colorTheme: 'white',\n applyRouterOutletContainer: true,\n displayFooterLogo: false,\n initializeHeaderElement: true,\n },\n];\n\nexport const initialLayoutState: LayoutState = routeLayoutStates.find(x => x.path.includes('/'));\n\nexport const layoutStateSelectorName = 'layout';\nexport const getLayoutState =\n createFeatureSelector(layoutStateSelectorName);\n\nexport function layoutReducer(\n state: LayoutState = initialLayoutState,\n generic: Action): LayoutState {\n\n const action = generic as ChangeLayoutState;\n switch (action.type) {\n case LayoutActions.CHANGE_LAYOUT_STATE: {\n return action.payload;\n }\n\n default: return state;\n }\n}\n","import { createSelector } from '@ngrx/store';\nimport { getLayoutState } from '../reducers/layout.reducers';\n\nexport const getColorTheme =\n createSelector(getLayoutState, state => state.colorTheme);\n\nexport const displayFooterLogo =\n createSelector(getLayoutState, state => state.displayFooterLogo);\n\nexport const applyRouterOutletContainer =\n createSelector(getLayoutState, state => state.applyRouterOutletContainer);\n\nexport const initializeHeaderElement =\n createSelector(getLayoutState, state => state.initializeHeaderElement);\n","import { Injectable } from '@angular/core';\nimport { Meta, Title } from '@angular/platform-browser';\nimport { MultilingualMetaTag } from 'src/app/shared/models/meta-tag.models';\nimport { EnvironmentService } from 'src/app/shared/services/environment.service';\nimport { environment } from 'src/environments/environment';\n\n@Injectable({\n providedIn: 'root',\n})\nexport class MetaTagService {\n\n constructor(\n private title: Title,\n private meta: Meta,\n private enviService: EnvironmentService,\n ) { }\n public updateMultilingualTitleTag(title: MultilingualMetaTag) {\n if (title && title[environment.language]) {\n this.title.setTitle(title[environment.language]);\n this.meta.updateTag({ property: 'og:title', content: title[environment.language] });\n }\n }\n\n public updateOgUrlTag(url: string) {\n let ogUrl = environment.apiUrl;\n if (url) ogUrl += `/${url}`;\n this.meta.updateTag({ property: 'og:url', content: ogUrl });\n }\n\n public updateOgImageTag(imageUrl: string) {\n this.meta.updateTag({ property: 'og:image', content: imageUrl });\n }\n\n public updateMultilinguaDescriptionTag(description: MultilingualMetaTag) {\n if (description && description[environment.language]) {\n this.meta.updateTag({\n name: 'description',\n content: description[environment.language],\n });\n this.meta.updateTag({\n property: 'og:description',\n content: description[environment.language],\n });\n }\n }\n\n public updateOgLocaleTag() {\n if (this.enviService.isCzechEnvironment) {\n this.meta.updateTag({ property: 'og:locale', content: 'cs_CZ' });\n } else {\n this.meta.updateTag({ property: 'og:locale', content: 'en_US' });\n }\n }\n}\n","import { ChangeDetectionStrategy, Component } from '@angular/core';\nimport { select, Store } from '@ngrx/store';\nimport { combineLatest, Observable } from 'rxjs';\nimport { filter, map } from 'rxjs/operators';\nimport { Logout } from 'src/app/auth/store/actions/logout.action';\nimport { getEmail, getFullName } from 'src/app/auth/store/selectors/user.selector';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { SnackbarService } from '../../../shared/services/snackbar.service';\n\n@Component({\n selector: 'mt-user-indicator',\n templateUrl: './user-indicator.component.html',\n styleUrls: ['./user-indicator.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n})\nexport class UserIndicatorComponent {\n\n public email: Observable;\n public name: Observable;\n public initial: Observable;\n\n constructor(\n private store: Store,\n private snackbarService: SnackbarService,\n ) {\n this.email = this.store.pipe(select(getEmail));\n this.name = this.store.pipe(select(getFullName));\n this.initial = combineLatest([\n this.name,\n this.email,\n ]).pipe(\n map(([name, email]) => name || email),\n filter(name => !!name),\n map(name => this.createInitial(name)),\n );\n }\n\n public logOut() {\n this.snackbarService.queueSnackBar(\n Notifications.LoggedOut, { duration: 3000 });\n this.store.dispatch(new Logout());\n }\n\n private createInitial(name: string): string {\n const parts = name.split(' ');\n let out = parts[0][0];\n if (parts.length > 1) {\n out += parts[parts.length - 1][0];\n }\n return out;\n }\n}\n","
\n {{ initial | async }}\n
\n\n
{{ name | async }}
\n
{{ email | async }}
\n \n\n \n\n \n
\n","import { Directive } from '@angular/core';\nimport { ScrollSectionDirective } from './scroll-section.directive';\n\n/**\n * https://netbasal.com/anchors-away-how-to-create-smooth-scrolling-in-angular-a657e0ea9699\n */\n@Directive({\n selector: '[mtScrollManager]',\n})\nexport class ScrollManagerDirective {\n private sections = new Map();\n\n scroll(id: string | number) {\n this.sections.get(id)?.scrollToTargetAdjusted();\n }\n\n register(section: ScrollSectionDirective) {\n this.sections.set(section.id, section);\n }\n\n remove(section: ScrollSectionDirective) {\n this.sections.delete(section.id);\n }\n}\n","import { Directive, HostListener, Input } from '@angular/core';\nimport { ScrollManagerDirective } from './scroll-manager.directive';\n\n@Directive({\n selector: '[mtScrollAnchor]',\n})\nexport class ScrollAnchorDirective {\n @Input('mtScrollAnchor') id: string | number;\n\n constructor(private manager: ScrollManagerDirective) {}\n\n @HostListener('click')\n scroll() {\n this.manager.scroll(this.id);\n }\n}\n","
\r\n \r\n
\r\n\r\n\r\n \r\n \r\n Upload file\r\n \r\n \r\n\r\n \r\n \r\n Upload folder\r\n \r\n \r\n\r\n","import { MediaMatcher } from '@angular/cdk/layout';\r\nimport { ChangeDetectionStrategy, Component, Input, ViewChild } from '@angular/core';\r\nimport { MatLegacyMenuTrigger as MatMenuTrigger } from '@angular/material/legacy-menu';\r\nimport { Router } from '@angular/router';\r\nimport { select, Store } from '@ngrx/store';\r\nimport { Observable } from 'rxjs';\r\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\r\nimport { getColorTheme } from 'src/app/app/states/selectors/layout.selectors';\r\nimport {\r\n getCreditBalance,\r\n getIsAuthorized,\r\n} from 'src/app/auth/store/selectors/user.selector';\r\nimport { AboutRoutes } from 'src/app/pages/about/about.routes.misc';\r\nimport { EnvironmentService } from 'src/app/shared/services/environment.service';\r\nimport { UniversalService } from 'src/app/shared/universal/universal.service';\r\nimport { UploadService } from '../../../app/services/upload.service';\r\n\r\n@Component({\r\n selector: 'mt-navbar',\r\n templateUrl: './navbar.component.html',\r\n styleUrls: ['./navbar.component.scss'],\r\n changeDetection: ChangeDetectionStrategy.OnPush,\r\n})\r\nexport class NavbarComponent {\r\n\r\n @Input() public initializeHeaderElement = true;\r\n @Input() public isSticky = false;\r\n @ViewChild(MatMenuTrigger) public trigger: MatMenuTrigger;\r\n public readonly isLoggedIn: Observable;\r\n public readonly creditBalance: Observable;\r\n public readonly appRoutes = AppRoutes;\r\n public readonly aboutRoutes = AboutRoutes;\r\n public readonly smallerScreen: boolean;\r\n public readonly mediumScreen: boolean;\r\n public readonly colorTheme: Observable;\r\n public height: number;\r\n\r\n constructor(private store: Store,\r\n private media: MediaMatcher,\r\n private uniService: UniversalService,\r\n private enviService: EnvironmentService,\r\n public router: Router,\r\n public uploadService: UploadService,\r\n ) {\r\n\r\n this.smallerScreen = this.media.matchMedia('(max-width: 767px)').matches;\r\n this.mediumScreen = this.media.matchMedia('(max-width: 991px)').matches;\r\n\r\n this.colorTheme = this.store.pipe(select(getColorTheme));\r\n this.isLoggedIn = this.store.pipe(select(getIsAuthorized));\r\n this.creditBalance = this.store.pipe(select(getCreditBalance));\r\n }\r\n\r\n public getBusiness() {\r\n if (!this.uniService.isPlatformServer()) {\r\n if (location.hostname.includes('localhost') || location.hostname.includes('dev')) {\r\n return 'https://business.dev2.mytitle.com';\r\n } else {\r\n return 'https://business.mytitle.com';\r\n }\r\n } else {\r\n return 'https://business.mytitle.com';\r\n }\r\n }\r\n\r\n public getBlog() {\r\n if (!this.uniService.isPlatformServer()) {\r\n if (this.enviService.isCzechEnvironment) {\r\n return 'https://mytitle.cz/blog/';\r\n } else {\r\n return 'https://mytitle.com/blog/';\r\n }\r\n } else {\r\n return 'https://mytitle.com/blog/';\r\n }\r\n }\r\n\r\n public closeMenu() {\r\n this.trigger.closeMenu();\r\n }\r\n\r\n}\r\n","
\n
\n
\n
\n \n \n \n \n \n \n\n \n\n
 
\n\n \n
\n
\n
\n
\n","import { Component, Input } from '@angular/core';\n\nimport { select, Store } from '@ngrx/store';\nimport { Observable } from 'rxjs';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { AppState } from 'src/app/app/states/models/app.models';\nimport { Logout } from 'src/app/auth/store/actions/logout.action';\nimport {\n getCreditBalance,\n getIsAuthorized,\n} from 'src/app/auth/store/selectors/user.selector';\nimport { EnvironmentService } from 'src/app/shared/services/environment.service';\nimport { UniversalService } from 'src/app/shared/universal/universal.service';\n\n@Component({\n selector: 'mt-navbar-mobile',\n templateUrl: './navbar-mobile.component.html',\n styleUrls: ['./navbar-mobile.component.scss'],\n})\nexport class NavbarMobileComponent {\n\n @Input() public initializeHeaderElement = false;\n public readonly appRoutes = AppRoutes;\n public readonly isLoggedIn: Observable;\n public readonly creditBalance: Observable;\n private _expanded = false;\n\n constructor(\n private store: Store,\n private uniService: UniversalService,\n private enviService: EnvironmentService,\n ) {\n this.isLoggedIn = this.store.pipe(select(getIsAuthorized));\n this.creditBalance = this.store.pipe(select(getCreditBalance));\n }\n\n get expanded() {\n return this._expanded;\n }\n\n set expanded(value: boolean) {\n this._expanded = value;\n }\n\n public toggleNavbar() {\n this._expanded = !this._expanded;\n }\n\n public logout() {\n this.store.dispatch(new Logout());\n }\n\n public getBusiness() {\n if (!this.uniService.isPlatformServer()) {\n if (location.hostname.includes('localhost') || location.hostname.includes('dev')) {\n return 'https://business.dev2.mytitle.com';\n } else {\n return 'https://business.mytitle.com';\n }\n } else {\n return 'https://business.mytitle.com';\n }\n }\n\n public getBlog() {\n if (!this.uniService.isPlatformServer()) {\n if (this.enviService.isCzechEnvironment) {\n return 'https://mytitle.cz/blog/';\n } else {\n return 'https://mytitle.com/blog/';\n }\n } else {\n return 'https://mytitle.com/blog/';\n }\n }\n}\n","\n\n","import { ChangeDetectionStrategy, Component, Input } from '@angular/core';\nimport { select, Store } from '@ngrx/store';\nimport { Observable } from 'rxjs';\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { getIsAuthorized, getIsEU } from 'src/app/auth/store/selectors/user.selector';\nimport { AboutRoutes } from 'src/app/pages/about/about.routes.misc';\nimport { EnvironmentService } from 'src/app/shared/services/environment.service';\nimport { UniversalService } from 'src/app/shared/universal/universal.service';\n\n@Component({\n selector: 'mt-footer',\n templateUrl: './footer.component.html',\n styleUrls: ['./footer.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n})\nexport class FooterComponent {\n @Input()\n public noLogo = false;\n public appRoutes = AppRoutes;\n public aboutRoutes = AboutRoutes;\n public isEU: Observable;\n public currentDate = new Date();\n public isLoggedIn: Observable;\n\n constructor(\n private store: Store,\n private uniService: UniversalService,\n public enviService: EnvironmentService,\n ) {\n this.isLoggedIn = this.store.pipe(select(getIsAuthorized));\n this.isEU = this.store.pipe(select(getIsEU));\n }\n\n public getBlog() {\n if (!this.uniService.isPlatformServer()) {\n if (this.enviService.isCzechEnvironment) {\n return 'https://mytitle.cz/blog/';\n } else {\n return 'https://mytitle.com/blog/';\n }\n } else {\n return 'https://mytitle.com/blog/';\n }\n }\n}\n","import { Component, HostListener } from '@angular/core';\nimport { ActivationEnd, NavigationEnd, Router } from '@angular/router';\n\nimport { select, Store } from '@ngrx/store';\nimport { Observable } from 'rxjs';\nimport { filter, map } from 'rxjs/operators';\nimport { NavigationEvent } from '../shared/services/data-layer.events';\nimport { DataLayerService } from '../shared/services/data-layer.service';\n\nimport { UniversalService } from '../shared/universal/universal.service';\nimport { MetaTagService } from './services/meta-tag.service';\nimport { AppState } from './states/models/app.models';\nimport { ColorTheme } from './states/reducers/layout.reducers';\nimport {\n applyRouterOutletContainer,\n displayFooterLogo,\n getColorTheme,\n initializeHeaderElement,\n} from './states/selectors/layout.selectors';\n\n@Component({\n selector: 'mt-app',\n templateUrl: './app.component.html',\n styleUrls: ['./app.component.scss'],\n})\nexport class AppComponent {\n\n public readonly colorTheme: Observable;\n public readonly displayFooterLogo: Observable;\n public readonly applyRouterOutletContainer: Observable;\n public readonly initializeHeaderElement: Observable;\n public isSticky = false;\n\n constructor(\n private router: Router,\n private store: Store,\n private dataLayerService: DataLayerService,\n private uniService: UniversalService,\n private metaTagService: MetaTagService,\n ) {\n\n // https://github.com/angular/angular/issues/19420#issuecomment-417050238\n this.router.events.pipe(\n filter(event => event instanceof ActivationEnd),\n map((event: any) => {\n let data = null;\n let route = event.snapshot.root;\n\n while (route) {\n data = route.data || data;\n route = route.firstChild;\n }\n return data;\n }),\n ).subscribe(data => {\n this.metaTagService.updateMultilingualTitleTag(data.title);\n this.metaTagService.updateMultilinguaDescriptionTag(data.description);\n this.metaTagService.updateOgImageTag(data.image);\n this.metaTagService.updateOgUrlTag(data.url);\n this.metaTagService.updateOgLocaleTag();\n });\n this.router.events.forEach(event => {\n if (event instanceof NavigationEnd) {\n this.dataLayerService.push(new NavigationEvent(event.url));\n }\n });\n\n this.colorTheme = this.store.pipe(select(getColorTheme));\n this.displayFooterLogo = this.store.pipe(select(displayFooterLogo));\n this.applyRouterOutletContainer = this.store.pipe(select(applyRouterOutletContainer));\n this.initializeHeaderElement = this.store.pipe(select(initializeHeaderElement));\n }\n\n @HostListener('window:scroll')\n public onWindowScroll() {\n if (!this.uniService.isPlatformServer()) {\n if (!this.router.url.includes('about')) {\n if (window.pageYOffset >= 758) {\n this.isSticky = true;\n } else {\n this.isSticky = false;\n }\n } else {\n this.isSticky = false;\n }\n }\n }\n}\n","
\n \n \n \n \n\n \n \n
\n\n \n \n\n","/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// THIS CODE IS GENERATED - DO NOT MODIFY.\nconst u = undefined;\nfunction plural(val) {\n const n = val, i = Math.floor(Math.abs(val)), v = val.toString().replace(/^[^.]*\\.?/, '').length;\n if (i === 1 && v === 0)\n return 1;\n if (i === Math.floor(i) && (i >= 2 && i <= 4) && v === 0)\n return 3;\n if (!(v === 0))\n return 4;\n return 5;\n}\nexport default [\"cs\", [[\"dop.\", \"odp.\"], u, u], u, [[\"N\", \"P\", \"Ú\", \"S\", \"Č\", \"P\", \"S\"], [\"ne\", \"po\", \"út\", \"st\", \"čt\", \"pá\", \"so\"], [\"neděle\", \"pondělí\", \"úterý\", \"středa\", \"čtvrtek\", \"pátek\", \"sobota\"], [\"ne\", \"po\", \"út\", \"st\", \"čt\", \"pá\", \"so\"]], u, [[\"1\", \"2\", \"3\", \"4\", \"5\", \"6\", \"7\", \"8\", \"9\", \"10\", \"11\", \"12\"], [\"led\", \"úno\", \"bře\", \"dub\", \"kvě\", \"čvn\", \"čvc\", \"srp\", \"zář\", \"říj\", \"lis\", \"pro\"], [\"ledna\", \"února\", \"března\", \"dubna\", \"května\", \"června\", \"července\", \"srpna\", \"září\", \"října\", \"listopadu\", \"prosince\"]], [[\"1\", \"2\", \"3\", \"4\", \"5\", \"6\", \"7\", \"8\", \"9\", \"10\", \"11\", \"12\"], [\"led\", \"úno\", \"bře\", \"dub\", \"kvě\", \"čvn\", \"čvc\", \"srp\", \"zář\", \"říj\", \"lis\", \"pro\"], [\"leden\", \"únor\", \"březen\", \"duben\", \"květen\", \"červen\", \"červenec\", \"srpen\", \"září\", \"říjen\", \"listopad\", \"prosinec\"]], [[\"př.n.l.\", \"n.l.\"], [\"př. n. l.\", \"n. l.\"], [\"před naším letopočtem\", \"našeho letopočtu\"]], 1, [6, 0], [\"dd.MM.yy\", \"d. M. y\", \"d. MMMM y\", \"EEEE d. MMMM y\"], [\"H:mm\", \"H:mm:ss\", \"H:mm:ss z\", \"H:mm:ss zzzz\"], [\"{1} {0}\", u, u, u], [\",\", \" \", \";\", \"%\", \"+\", \"-\", \"E\", \"×\", \"‰\", \"∞\", \"NaN\", \":\"], [\"#,##0.###\", \"#,##0 %\", \"#,##0.00 ¤\", \"#E0\"], \"CZK\", \"Kč\", \"česká koruna\", { \"AUD\": [\"AU$\", \"$\"], \"BYN\": [u, \"р.\"], \"CSK\": [\"Kčs\"], \"CZK\": [\"Kč\"], \"ILS\": [u, \"₪\"], \"INR\": [u, \"₹\"], \"JPY\": [\"JP¥\", \"¥\"], \"PHP\": [u, \"₱\"], \"RON\": [u, \"L\"], \"RUR\": [u, \"р.\"], \"TWD\": [\"NT$\"], \"USD\": [\"US$\", \"$\"], \"VND\": [u, \"₫\"], \"XEU\": [\"ECU\"], \"XXX\": [] }, \"ltr\", plural];\n","import { logger, getEventDescription, stringMatchesSomePattern } from '@sentry/utils';\n\n// \"Script error.\" is hard coded into browsers for errors that it can't read.\n// this is the result of a script being pulled in from an external domain and CORS.\nconst DEFAULT_IGNORE_ERRORS = [/^Script error\\.?$/, /^Javascript error: Script error\\.? on line 0$/];\n\nconst DEFAULT_IGNORE_TRANSACTIONS = [\n /^.*healthcheck.*$/,\n /^.*healthy.*$/,\n /^.*live.*$/,\n /^.*ready.*$/,\n /^.*heartbeat.*$/,\n /^.*\\/health$/,\n /^.*\\/healthz$/,\n];\n\n/** Options for the InboundFilters integration */\n\n/** Inbound filters configurable by the user */\nclass InboundFilters {\n /**\n * @inheritDoc\n */\n static __initStatic() {this.id = 'InboundFilters';}\n\n /**\n * @inheritDoc\n */\n\n constructor(options = {}) {\n this.name = InboundFilters.id;\n this._options = options;\n }\n\n /**\n * @inheritDoc\n */\n setupOnce(addGlobalEventProcessor, getCurrentHub) {\n const eventProcess = (event) => {\n const hub = getCurrentHub();\n if (hub) {\n const self = hub.getIntegration(InboundFilters);\n if (self) {\n const client = hub.getClient();\n const clientOptions = client ? client.getOptions() : {};\n const options = _mergeOptions(self._options, clientOptions);\n return _shouldDropEvent(event, options) ? null : event;\n }\n }\n return event;\n };\n\n eventProcess.id = this.name;\n addGlobalEventProcessor(eventProcess);\n }\n} InboundFilters.__initStatic();\n\n/** JSDoc */\nfunction _mergeOptions(\n internalOptions = {},\n clientOptions = {},\n) {\n return {\n allowUrls: [...(internalOptions.allowUrls || []), ...(clientOptions.allowUrls || [])],\n denyUrls: [...(internalOptions.denyUrls || []), ...(clientOptions.denyUrls || [])],\n ignoreErrors: [\n ...(internalOptions.ignoreErrors || []),\n ...(clientOptions.ignoreErrors || []),\n ...(internalOptions.disableErrorDefaults ? [] : DEFAULT_IGNORE_ERRORS),\n ],\n ignoreTransactions: [\n ...(internalOptions.ignoreTransactions || []),\n ...(clientOptions.ignoreTransactions || []),\n ...(internalOptions.disableTransactionDefaults ? [] : DEFAULT_IGNORE_TRANSACTIONS),\n ],\n ignoreInternal: internalOptions.ignoreInternal !== undefined ? internalOptions.ignoreInternal : true,\n };\n}\n\n/** JSDoc */\nfunction _shouldDropEvent(event, options) {\n if (options.ignoreInternal && _isSentryError(event)) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.warn(`Event dropped due to being internal Sentry Error.\\nEvent: ${getEventDescription(event)}`);\n return true;\n }\n if (_isIgnoredError(event, options.ignoreErrors)) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.warn(\n `Event dropped due to being matched by \\`ignoreErrors\\` option.\\nEvent: ${getEventDescription(event)}`,\n );\n return true;\n }\n if (_isIgnoredTransaction(event, options.ignoreTransactions)) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.warn(\n `Event dropped due to being matched by \\`ignoreTransactions\\` option.\\nEvent: ${getEventDescription(event)}`,\n );\n return true;\n }\n if (_isDeniedUrl(event, options.denyUrls)) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.warn(\n `Event dropped due to being matched by \\`denyUrls\\` option.\\nEvent: ${getEventDescription(\n event,\n )}.\\nUrl: ${_getEventFilterUrl(event)}`,\n );\n return true;\n }\n if (!_isAllowedUrl(event, options.allowUrls)) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.warn(\n `Event dropped due to not being matched by \\`allowUrls\\` option.\\nEvent: ${getEventDescription(\n event,\n )}.\\nUrl: ${_getEventFilterUrl(event)}`,\n );\n return true;\n }\n return false;\n}\n\nfunction _isIgnoredError(event, ignoreErrors) {\n // If event.type, this is not an error\n if (event.type || !ignoreErrors || !ignoreErrors.length) {\n return false;\n }\n\n return _getPossibleEventMessages(event).some(message => stringMatchesSomePattern(message, ignoreErrors));\n}\n\nfunction _isIgnoredTransaction(event, ignoreTransactions) {\n if (event.type !== 'transaction' || !ignoreTransactions || !ignoreTransactions.length) {\n return false;\n }\n\n const name = event.transaction;\n return name ? stringMatchesSomePattern(name, ignoreTransactions) : false;\n}\n\nfunction _isDeniedUrl(event, denyUrls) {\n // TODO: Use Glob instead?\n if (!denyUrls || !denyUrls.length) {\n return false;\n }\n const url = _getEventFilterUrl(event);\n return !url ? false : stringMatchesSomePattern(url, denyUrls);\n}\n\nfunction _isAllowedUrl(event, allowUrls) {\n // TODO: Use Glob instead?\n if (!allowUrls || !allowUrls.length) {\n return true;\n }\n const url = _getEventFilterUrl(event);\n return !url ? true : stringMatchesSomePattern(url, allowUrls);\n}\n\nfunction _getPossibleEventMessages(event) {\n if (event.message) {\n return [event.message];\n }\n if (event.exception) {\n const { values } = event.exception;\n try {\n const { type = '', value = '' } = (values && values[values.length - 1]) || {};\n return [`${value}`, `${type}: ${value}`];\n } catch (oO) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error(`Cannot extract message for event ${getEventDescription(event)}`);\n return [];\n }\n }\n return [];\n}\n\nfunction _isSentryError(event) {\n try {\n // @ts-ignore can't be a sentry error if undefined\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return event.exception.values[0].type === 'SentryError';\n } catch (e) {\n // ignore\n }\n return false;\n}\n\nfunction _getLastValidUrl(frames = []) {\n for (let i = frames.length - 1; i >= 0; i--) {\n const frame = frames[i];\n\n if (frame && frame.filename !== '' && frame.filename !== '[native code]') {\n return frame.filename || null;\n }\n }\n\n return null;\n}\n\nfunction _getEventFilterUrl(event) {\n try {\n let frames;\n try {\n // @ts-ignore we only care about frames if the whole thing here is defined\n frames = event.exception.values[0].stacktrace.frames;\n } catch (e) {\n // ignore\n }\n return frames ? _getLastValidUrl(frames) : null;\n } catch (oO) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error(`Cannot extract url for event ${getEventDescription(event)}`);\n return null;\n }\n}\n\nexport { InboundFilters, _mergeOptions, _shouldDropEvent };\n","import { getOriginalFunction } from '@sentry/utils';\n\nlet originalFunctionToString;\n\n/** Patch toString calls to return proper name for wrapped functions */\nclass FunctionToString {\n /**\n * @inheritDoc\n */\n static __initStatic() {this.id = 'FunctionToString';}\n\n /**\n * @inheritDoc\n */\n\n constructor() {\n this.name = FunctionToString.id;\n }\n\n /**\n * @inheritDoc\n */\n setupOnce() {\n // eslint-disable-next-line @typescript-eslint/unbound-method\n originalFunctionToString = Function.prototype.toString;\n\n // intrinsics (like Function.prototype) might be immutable in some environments\n // e.g. Node with --frozen-intrinsics, XS (an embedded JavaScript engine) or SES (a JavaScript proposal)\n try {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n Function.prototype.toString = function ( ...args) {\n const context = getOriginalFunction(this) || this;\n return originalFunctionToString.apply(context, args);\n };\n } catch (e) {\n // ignore errors here, just don't patch this\n }\n }\n} FunctionToString.__initStatic();\n\nexport { FunctionToString };\n","import { arrayify, logger } from '@sentry/utils';\nimport { getCurrentHub } from './hub.js';\nimport { addGlobalEventProcessor } from './scope.js';\n\nconst installedIntegrations = [];\n\n/** Map of integrations assigned to a client */\n\n/**\n * Remove duplicates from the given array, preferring the last instance of any duplicate. Not guaranteed to\n * preseve the order of integrations in the array.\n *\n * @private\n */\nfunction filterDuplicates(integrations) {\n const integrationsByName = {};\n\n integrations.forEach(currentInstance => {\n const { name } = currentInstance;\n\n const existingInstance = integrationsByName[name];\n\n // We want integrations later in the array to overwrite earlier ones of the same type, except that we never want a\n // default instance to overwrite an existing user instance\n if (existingInstance && !existingInstance.isDefaultInstance && currentInstance.isDefaultInstance) {\n return;\n }\n\n integrationsByName[name] = currentInstance;\n });\n\n return Object.keys(integrationsByName).map(k => integrationsByName[k]);\n}\n\n/** Gets integrations to install */\nfunction getIntegrationsToSetup(options) {\n const defaultIntegrations = options.defaultIntegrations || [];\n const userIntegrations = options.integrations;\n\n // We flag default instances, so that later we can tell them apart from any user-created instances of the same class\n defaultIntegrations.forEach(integration => {\n integration.isDefaultInstance = true;\n });\n\n let integrations;\n\n if (Array.isArray(userIntegrations)) {\n integrations = [...defaultIntegrations, ...userIntegrations];\n } else if (typeof userIntegrations === 'function') {\n integrations = arrayify(userIntegrations(defaultIntegrations));\n } else {\n integrations = defaultIntegrations;\n }\n\n const finalIntegrations = filterDuplicates(integrations);\n\n // The `Debug` integration prints copies of the `event` and `hint` which will be passed to `beforeSend` or\n // `beforeSendTransaction`. It therefore has to run after all other integrations, so that the changes of all event\n // processors will be reflected in the printed values. For lack of a more elegant way to guarantee that, we therefore\n // locate it and, assuming it exists, pop it out of its current spot and shove it onto the end of the array.\n const debugIndex = findIndex(finalIntegrations, integration => integration.name === 'Debug');\n if (debugIndex !== -1) {\n const [debugInstance] = finalIntegrations.splice(debugIndex, 1);\n finalIntegrations.push(debugInstance);\n }\n\n return finalIntegrations;\n}\n\n/**\n * Given a list of integration instances this installs them all. When `withDefaults` is set to `true` then all default\n * integrations are added unless they were already provided before.\n * @param integrations array of integration instances\n * @param withDefault should enable default integrations\n */\nfunction setupIntegrations(integrations) {\n const integrationIndex = {};\n\n integrations.forEach(integration => {\n // guard against empty provided integrations\n if (integration) {\n setupIntegration(integration, integrationIndex);\n }\n });\n\n return integrationIndex;\n}\n\n/** Setup a single integration. */\nfunction setupIntegration(integration, integrationIndex) {\n integrationIndex[integration.name] = integration;\n\n if (installedIntegrations.indexOf(integration.name) === -1) {\n integration.setupOnce(addGlobalEventProcessor, getCurrentHub);\n installedIntegrations.push(integration.name);\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`Integration installed: ${integration.name}`);\n }\n}\n\n// Polyfill for Array.findIndex(), which is not supported in ES5\nfunction findIndex(arr, callback) {\n for (let i = 0; i < arr.length; i++) {\n if (callback(arr[i]) === true) {\n return i;\n }\n }\n\n return -1;\n}\n\nexport { getIntegrationsToSetup, installedIntegrations, setupIntegration, setupIntegrations };\n","import { logger } from './logger.js';\n\n/** Regular expression used to parse a Dsn. */\nconst DSN_REGEX = /^(?:(\\w+):)\\/\\/(?:(\\w+)(?::(\\w+)?)?@)([\\w.-]+)(?::(\\d+))?\\/(.+)/;\n\nfunction isValidProtocol(protocol) {\n return protocol === 'http' || protocol === 'https';\n}\n\n/**\n * Renders the string representation of this Dsn.\n *\n * By default, this will render the public representation without the password\n * component. To get the deprecated private representation, set `withPassword`\n * to true.\n *\n * @param withPassword When set to true, the password will be included.\n */\nfunction dsnToString(dsn, withPassword = false) {\n const { host, path, pass, port, projectId, protocol, publicKey } = dsn;\n return (\n `${protocol}://${publicKey}${withPassword && pass ? `:${pass}` : ''}` +\n `@${host}${port ? `:${port}` : ''}/${path ? `${path}/` : path}${projectId}`\n );\n}\n\n/**\n * Parses a Dsn from a given string.\n *\n * @param str A Dsn as string\n * @returns Dsn as DsnComponents or undefined if @param str is not a valid DSN string\n */\nfunction dsnFromString(str) {\n const match = DSN_REGEX.exec(str);\n\n if (!match) {\n // This should be logged to the console\n // eslint-disable-next-line no-console\n console.error(`Invalid Sentry Dsn: ${str}`);\n return undefined;\n }\n\n const [protocol, publicKey, pass = '', host, port = '', lastPath] = match.slice(1);\n let path = '';\n let projectId = lastPath;\n\n const split = projectId.split('/');\n if (split.length > 1) {\n path = split.slice(0, -1).join('/');\n projectId = split.pop() ;\n }\n\n if (projectId) {\n const projectMatch = projectId.match(/^\\d+/);\n if (projectMatch) {\n projectId = projectMatch[0];\n }\n }\n\n return dsnFromComponents({ host, pass, path, projectId, port, protocol: protocol , publicKey });\n}\n\nfunction dsnFromComponents(components) {\n return {\n protocol: components.protocol,\n publicKey: components.publicKey || '',\n pass: components.pass || '',\n host: components.host,\n port: components.port || '',\n path: components.path || '',\n projectId: components.projectId,\n };\n}\n\nfunction validateDsn(dsn) {\n if (!(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {\n return true;\n }\n\n const { port, projectId, protocol } = dsn;\n\n const requiredComponents = ['protocol', 'publicKey', 'host', 'projectId'];\n const hasMissingRequiredComponent = requiredComponents.find(component => {\n if (!dsn[component]) {\n logger.error(`Invalid Sentry Dsn: ${component} missing`);\n return true;\n }\n return false;\n });\n\n if (hasMissingRequiredComponent) {\n return false;\n }\n\n if (!projectId.match(/^\\d+$/)) {\n logger.error(`Invalid Sentry Dsn: Invalid projectId ${projectId}`);\n return false;\n }\n\n if (!isValidProtocol(protocol)) {\n logger.error(`Invalid Sentry Dsn: Invalid protocol ${protocol}`);\n return false;\n }\n\n if (port && isNaN(parseInt(port, 10))) {\n logger.error(`Invalid Sentry Dsn: Invalid port ${port}`);\n return false;\n }\n\n return true;\n}\n\n/**\n * Creates a valid Sentry Dsn object, identifying a Sentry instance and project.\n * @returns a valid DsnComponents object or `undefined` if @param from is an invalid DSN source\n */\nfunction makeDsn(from) {\n const components = typeof from === 'string' ? dsnFromString(from) : dsnFromComponents(from);\n if (!components || !validateDsn(components)) {\n return undefined;\n }\n return components;\n}\n\nexport { dsnFromString, dsnToString, makeDsn };\n","import { makeDsn, dsnToString, urlEncode } from '@sentry/utils';\n\nconst SENTRY_API_VERSION = '7';\n\n/** Returns the prefix to construct Sentry ingestion API endpoints. */\nfunction getBaseApiEndpoint(dsn) {\n const protocol = dsn.protocol ? `${dsn.protocol}:` : '';\n const port = dsn.port ? `:${dsn.port}` : '';\n return `${protocol}//${dsn.host}${port}${dsn.path ? `/${dsn.path}` : ''}/api/`;\n}\n\n/** Returns the ingest API endpoint for target. */\nfunction _getIngestEndpoint(dsn) {\n return `${getBaseApiEndpoint(dsn)}${dsn.projectId}/envelope/`;\n}\n\n/** Returns a URL-encoded string with auth config suitable for a query string. */\nfunction _encodedAuth(dsn, sdkInfo) {\n return urlEncode({\n // We send only the minimum set of required information. See\n // https://github.com/getsentry/sentry-javascript/issues/2572.\n sentry_key: dsn.publicKey,\n sentry_version: SENTRY_API_VERSION,\n ...(sdkInfo && { sentry_client: `${sdkInfo.name}/${sdkInfo.version}` }),\n });\n}\n\n/**\n * Returns the envelope endpoint URL with auth in the query string.\n *\n * Sending auth as part of the query string and not as custom HTTP headers avoids CORS preflight requests.\n */\nfunction getEnvelopeEndpointWithUrlEncodedAuth(\n dsn,\n // TODO (v8): Remove `tunnelOrOptions` in favor of `options`, and use the substitute code below\n // options: ClientOptions = {} as ClientOptions,\n tunnelOrOptions = {} ,\n) {\n // TODO (v8): Use this code instead\n // const { tunnel, _metadata = {} } = options;\n // return tunnel ? tunnel : `${_getIngestEndpoint(dsn)}?${_encodedAuth(dsn, _metadata.sdk)}`;\n\n const tunnel = typeof tunnelOrOptions === 'string' ? tunnelOrOptions : tunnelOrOptions.tunnel;\n const sdkInfo =\n typeof tunnelOrOptions === 'string' || !tunnelOrOptions._metadata ? undefined : tunnelOrOptions._metadata.sdk;\n\n return tunnel ? tunnel : `${_getIngestEndpoint(dsn)}?${_encodedAuth(dsn, sdkInfo)}`;\n}\n\n/** Returns the url to the report dialog endpoint. */\nfunction getReportDialogEndpoint(\n dsnLike,\n dialogOptions\n\n,\n) {\n const dsn = makeDsn(dsnLike);\n if (!dsn) {\n return '';\n }\n\n const endpoint = `${getBaseApiEndpoint(dsn)}embed/error-page/`;\n\n let encodedOptions = `dsn=${dsnToString(dsn)}`;\n for (const key in dialogOptions) {\n if (key === 'dsn') {\n continue;\n }\n\n if (key === 'user') {\n const user = dialogOptions.user;\n if (!user) {\n continue;\n }\n if (user.name) {\n encodedOptions += `&name=${encodeURIComponent(user.name)}`;\n }\n if (user.email) {\n encodedOptions += `&email=${encodeURIComponent(user.email)}`;\n }\n } else {\n encodedOptions += `&${encodeURIComponent(key)}=${encodeURIComponent(dialogOptions[key] )}`;\n }\n }\n\n return `${endpoint}?${encodedOptions}`;\n}\n\nexport { getEnvelopeEndpointWithUrlEncodedAuth, getReportDialogEndpoint };\n","import { node } from './node-stack-trace.js';\n\nconst STACKTRACE_FRAME_LIMIT = 50;\n// Used to sanitize webpack (error: *) wrapped stack errors\nconst WEBPACK_ERROR_REGEXP = /\\(error: (.*)\\)/;\nconst STRIP_FRAME_REGEXP = /captureMessage|captureException/;\n\n/**\n * Creates a stack parser with the supplied line parsers\n *\n * StackFrames are returned in the correct order for Sentry Exception\n * frames and with Sentry SDK internal frames removed from the top and bottom\n *\n */\nfunction createStackParser(...parsers) {\n const sortedParsers = parsers.sort((a, b) => a[0] - b[0]).map(p => p[1]);\n\n return (stack, skipFirst = 0) => {\n const frames = [];\n const lines = stack.split('\\n');\n\n for (let i = skipFirst; i < lines.length; i++) {\n const line = lines[i];\n // Ignore lines over 1kb as they are unlikely to be stack frames.\n // Many of the regular expressions use backtracking which results in run time that increases exponentially with\n // input size. Huge strings can result in hangs/Denial of Service:\n // https://github.com/getsentry/sentry-javascript/issues/2286\n if (line.length > 1024) {\n continue;\n }\n\n // https://github.com/getsentry/sentry-javascript/issues/5459\n // Remove webpack (error: *) wrappers\n const cleanedLine = WEBPACK_ERROR_REGEXP.test(line) ? line.replace(WEBPACK_ERROR_REGEXP, '$1') : line;\n\n // https://github.com/getsentry/sentry-javascript/issues/7813\n // Skip Error: lines\n if (cleanedLine.match(/\\S*Error: /)) {\n continue;\n }\n\n for (const parser of sortedParsers) {\n const frame = parser(cleanedLine);\n\n if (frame) {\n frames.push(frame);\n break;\n }\n }\n\n if (frames.length >= STACKTRACE_FRAME_LIMIT) {\n break;\n }\n }\n\n return stripSentryFramesAndReverse(frames);\n };\n}\n\n/**\n * Gets a stack parser implementation from Options.stackParser\n * @see Options\n *\n * If options contains an array of line parsers, it is converted into a parser\n */\nfunction stackParserFromStackParserOptions(stackParser) {\n if (Array.isArray(stackParser)) {\n return createStackParser(...stackParser);\n }\n return stackParser;\n}\n\n/**\n * Removes Sentry frames from the top and bottom of the stack if present and enforces a limit of max number of frames.\n * Assumes stack input is ordered from top to bottom and returns the reverse representation so call site of the\n * function that caused the crash is the last frame in the array.\n * @hidden\n */\nfunction stripSentryFramesAndReverse(stack) {\n if (!stack.length) {\n return [];\n }\n\n const localStack = Array.from(stack);\n\n // If stack starts with one of our API calls, remove it (starts, meaning it's the top of the stack - aka last call)\n if (/sentryWrapped/.test(localStack[localStack.length - 1].function || '')) {\n localStack.pop();\n }\n\n // Reversing in the middle of the procedure allows us to just pop the values off the stack\n localStack.reverse();\n\n // If stack ends with one of our internal API calls, remove it (ends, meaning it's the bottom of the stack - aka top-most call)\n if (STRIP_FRAME_REGEXP.test(localStack[localStack.length - 1].function || '')) {\n localStack.pop();\n\n // When using synthetic events, we will have a 2 levels deep stack, as `new Error('Sentry syntheticException')`\n // is produced within the hub itself, making it:\n //\n // Sentry.captureException()\n // getCurrentHub().captureException()\n //\n // instead of just the top `Sentry` call itself.\n // This forces us to possibly strip an additional frame in the exact same was as above.\n if (STRIP_FRAME_REGEXP.test(localStack[localStack.length - 1].function || '')) {\n localStack.pop();\n }\n }\n\n return localStack.slice(0, STACKTRACE_FRAME_LIMIT).map(frame => ({\n ...frame,\n filename: frame.filename || localStack[localStack.length - 1].filename,\n function: frame.function || '?',\n }));\n}\n\nconst defaultFunctionName = '';\n\n/**\n * Safely extract function name from itself\n */\nfunction getFunctionName(fn) {\n try {\n if (!fn || typeof fn !== 'function') {\n return defaultFunctionName;\n }\n return fn.name || defaultFunctionName;\n } catch (e) {\n // Just accessing custom props in some Selenium environments\n // can cause a \"Permission denied\" exception (see raven-js#495).\n return defaultFunctionName;\n }\n}\n\n/**\n * Node.js stack line parser\n *\n * This is in @sentry/utils so it can be used from the Electron SDK in the browser for when `nodeIntegration == true`.\n * This allows it to be used without referencing or importing any node specific code which causes bundlers to complain\n */\nfunction nodeStackLineParser(getModule) {\n return [90, node(getModule)];\n}\n\nexport { createStackParser, getFunctionName, nodeStackLineParser, stackParserFromStackParserOptions, stripSentryFramesAndReverse };\n","import { logger } from './logger.js';\nimport { getGlobalObject } from './worldwide.js';\n\n// eslint-disable-next-line deprecation/deprecation\nconst WINDOW = getGlobalObject();\n\n/**\n * Tells whether current environment supports ErrorEvent objects\n * {@link supportsErrorEvent}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsErrorEvent() {\n try {\n new ErrorEvent('');\n return true;\n } catch (e) {\n return false;\n }\n}\n\n/**\n * Tells whether current environment supports DOMError objects\n * {@link supportsDOMError}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsDOMError() {\n try {\n // Chrome: VM89:1 Uncaught TypeError: Failed to construct 'DOMError':\n // 1 argument required, but only 0 present.\n // @ts-ignore It really needs 1 argument, not 0.\n new DOMError('');\n return true;\n } catch (e) {\n return false;\n }\n}\n\n/**\n * Tells whether current environment supports DOMException objects\n * {@link supportsDOMException}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsDOMException() {\n try {\n new DOMException('');\n return true;\n } catch (e) {\n return false;\n }\n}\n\n/**\n * Tells whether current environment supports Fetch API\n * {@link supportsFetch}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsFetch() {\n if (!('fetch' in WINDOW)) {\n return false;\n }\n\n try {\n new Headers();\n new Request('http://www.example.com');\n new Response();\n return true;\n } catch (e) {\n return false;\n }\n}\n/**\n * isNativeFetch checks if the given function is a native implementation of fetch()\n */\n// eslint-disable-next-line @typescript-eslint/ban-types\nfunction isNativeFetch(func) {\n return func && /^function fetch\\(\\)\\s+\\{\\s+\\[native code\\]\\s+\\}$/.test(func.toString());\n}\n\n/**\n * Tells whether current environment supports Fetch API natively\n * {@link supportsNativeFetch}.\n *\n * @returns true if `window.fetch` is natively implemented, false otherwise\n */\nfunction supportsNativeFetch() {\n if (!supportsFetch()) {\n return false;\n }\n\n // Fast path to avoid DOM I/O\n // eslint-disable-next-line @typescript-eslint/unbound-method\n if (isNativeFetch(WINDOW.fetch)) {\n return true;\n }\n\n // window.fetch is implemented, but is polyfilled or already wrapped (e.g: by a chrome extension)\n // so create a \"pure\" iframe to see if that has native fetch\n let result = false;\n const doc = WINDOW.document;\n // eslint-disable-next-line deprecation/deprecation\n if (doc && typeof (doc.createElement ) === 'function') {\n try {\n const sandbox = doc.createElement('iframe');\n sandbox.hidden = true;\n doc.head.appendChild(sandbox);\n if (sandbox.contentWindow && sandbox.contentWindow.fetch) {\n // eslint-disable-next-line @typescript-eslint/unbound-method\n result = isNativeFetch(sandbox.contentWindow.fetch);\n }\n doc.head.removeChild(sandbox);\n } catch (err) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.warn('Could not create sandbox iframe for pure fetch check, bailing to window.fetch: ', err);\n }\n }\n\n return result;\n}\n\n/**\n * Tells whether current environment supports ReportingObserver API\n * {@link supportsReportingObserver}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsReportingObserver() {\n return 'ReportingObserver' in WINDOW;\n}\n\n/**\n * Tells whether current environment supports Referrer Policy API\n * {@link supportsReferrerPolicy}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsReferrerPolicy() {\n // Despite all stars in the sky saying that Edge supports old draft syntax, aka 'never', 'always', 'origin' and 'default'\n // (see https://caniuse.com/#feat=referrer-policy),\n // it doesn't. And it throws an exception instead of ignoring this parameter...\n // REF: https://github.com/getsentry/raven-js/issues/1233\n\n if (!supportsFetch()) {\n return false;\n }\n\n try {\n new Request('_', {\n referrerPolicy: 'origin' ,\n });\n return true;\n } catch (e) {\n return false;\n }\n}\n\nexport { isNativeFetch, supportsDOMError, supportsDOMException, supportsErrorEvent, supportsFetch, supportsNativeFetch, supportsReferrerPolicy, supportsReportingObserver };\n","import { getGlobalObject } from '../worldwide.js';\n\n// Based on https://github.com/angular/angular.js/pull/13945/files\n\n// eslint-disable-next-line deprecation/deprecation\nconst WINDOW = getGlobalObject();\n\n/**\n * Tells whether current environment supports History API\n * {@link supportsHistory}.\n *\n * @returns Answer to the given question.\n */\nfunction supportsHistory() {\n // NOTE: in Chrome App environment, touching history.pushState, *even inside\n // a try/catch block*, will cause Chrome to output an error to console.error\n // borrowed from: https://github.com/angular/angular.js/pull/13945/files\n /* eslint-disable @typescript-eslint/no-unsafe-member-access */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const chrome = (WINDOW ).chrome;\n const isChromePackagedApp = chrome && chrome.app && chrome.app.runtime;\n /* eslint-enable @typescript-eslint/no-unsafe-member-access */\n const hasHistoryApi = 'history' in WINDOW && !!WINDOW.history.pushState && !!WINDOW.history.replaceState;\n\n return !isChromePackagedApp && hasHistoryApi;\n}\n\nexport { supportsHistory };\n","import { isString } from './is.js';\nimport { logger, CONSOLE_LEVELS } from './logger.js';\nimport { fill } from './object.js';\nimport { getFunctionName } from './stacktrace.js';\nimport { supportsNativeFetch } from './supports.js';\nimport { getGlobalObject } from './worldwide.js';\nimport { supportsHistory } from './vendor/supportsHistory.js';\n\n// eslint-disable-next-line deprecation/deprecation\nconst WINDOW = getGlobalObject();\n\nconst SENTRY_XHR_DATA_KEY = '__sentry_xhr_v2__';\n\n/**\n * Instrument native APIs to call handlers that can be used to create breadcrumbs, APM spans etc.\n * - Console API\n * - Fetch API\n * - XHR API\n * - History API\n * - DOM API (click/typing)\n * - Error API\n * - UnhandledRejection API\n */\n\nconst handlers = {};\nconst instrumented = {};\n\n/** Instruments given API */\nfunction instrument(type) {\n if (instrumented[type]) {\n return;\n }\n\n instrumented[type] = true;\n\n switch (type) {\n case 'console':\n instrumentConsole();\n break;\n case 'dom':\n instrumentDOM();\n break;\n case 'xhr':\n instrumentXHR();\n break;\n case 'fetch':\n instrumentFetch();\n break;\n case 'history':\n instrumentHistory();\n break;\n case 'error':\n instrumentError();\n break;\n case 'unhandledrejection':\n instrumentUnhandledRejection();\n break;\n default:\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('unknown instrumentation type:', type);\n return;\n }\n}\n\n/**\n * Add handler that will be called when given type of instrumentation triggers.\n * Use at your own risk, this might break without changelog notice, only used internally.\n * @hidden\n */\nfunction addInstrumentationHandler(type, callback) {\n handlers[type] = handlers[type] || [];\n (handlers[type] ).push(callback);\n instrument(type);\n}\n\n/** JSDoc */\nfunction triggerHandlers(type, data) {\n if (!type || !handlers[type]) {\n return;\n }\n\n for (const handler of handlers[type] || []) {\n try {\n handler(data);\n } catch (e) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.error(\n `Error while triggering instrumentation handler.\\nType: ${type}\\nName: ${getFunctionName(handler)}\\nError:`,\n e,\n );\n }\n }\n}\n\n/** JSDoc */\nfunction instrumentConsole() {\n if (!('console' in WINDOW)) {\n return;\n }\n\n CONSOLE_LEVELS.forEach(function (level) {\n if (!(level in WINDOW.console)) {\n return;\n }\n\n fill(WINDOW.console, level, function (originalConsoleMethod) {\n return function (...args) {\n triggerHandlers('console', { args, level });\n\n // this fails for some browsers. :(\n if (originalConsoleMethod) {\n originalConsoleMethod.apply(WINDOW.console, args);\n }\n };\n });\n });\n}\n\n/** JSDoc */\nfunction instrumentFetch() {\n if (!supportsNativeFetch()) {\n return;\n }\n\n fill(WINDOW, 'fetch', function (originalFetch) {\n return function (...args) {\n const { method, url } = parseFetchArgs(args);\n\n const handlerData = {\n args,\n fetchData: {\n method,\n url,\n },\n startTimestamp: Date.now(),\n };\n\n triggerHandlers('fetch', {\n ...handlerData,\n });\n\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return originalFetch.apply(WINDOW, args).then(\n (response) => {\n triggerHandlers('fetch', {\n ...handlerData,\n endTimestamp: Date.now(),\n response,\n });\n return response;\n },\n (error) => {\n triggerHandlers('fetch', {\n ...handlerData,\n endTimestamp: Date.now(),\n error,\n });\n // NOTE: If you are a Sentry user, and you are seeing this stack frame,\n // it means the sentry.javascript SDK caught an error invoking your application code.\n // This is expected behavior and NOT indicative of a bug with sentry.javascript.\n throw error;\n },\n );\n };\n });\n}\n\nfunction hasProp(obj, prop) {\n return !!obj && typeof obj === 'object' && !!(obj )[prop];\n}\n\nfunction getUrlFromResource(resource) {\n if (typeof resource === 'string') {\n return resource;\n }\n\n if (!resource) {\n return '';\n }\n\n if (hasProp(resource, 'url')) {\n return resource.url;\n }\n\n if (resource.toString) {\n return resource.toString();\n }\n\n return '';\n}\n\n/**\n * Parses the fetch arguments to find the used Http method and the url of the request\n */\nfunction parseFetchArgs(fetchArgs) {\n if (fetchArgs.length === 0) {\n return { method: 'GET', url: '' };\n }\n\n if (fetchArgs.length === 2) {\n const [url, options] = fetchArgs ;\n\n return {\n url: getUrlFromResource(url),\n method: hasProp(options, 'method') ? String(options.method).toUpperCase() : 'GET',\n };\n }\n\n const arg = fetchArgs[0];\n return {\n url: getUrlFromResource(arg ),\n method: hasProp(arg, 'method') ? String(arg.method).toUpperCase() : 'GET',\n };\n}\n\n/** JSDoc */\nfunction instrumentXHR() {\n if (!('XMLHttpRequest' in WINDOW)) {\n return;\n }\n\n const xhrproto = XMLHttpRequest.prototype;\n\n fill(xhrproto, 'open', function (originalOpen) {\n return function ( ...args) {\n const url = args[1];\n const xhrInfo = (this[SENTRY_XHR_DATA_KEY] = {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n method: isString(args[0]) ? args[0].toUpperCase() : args[0],\n url: args[1],\n request_headers: {},\n });\n\n // if Sentry key appears in URL, don't capture it as a request\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n if (isString(url) && xhrInfo.method === 'POST' && url.match(/sentry_key/)) {\n this.__sentry_own_request__ = true;\n }\n\n const onreadystatechangeHandler = () => {\n // For whatever reason, this is not the same instance here as from the outer method\n const xhrInfo = this[SENTRY_XHR_DATA_KEY];\n\n if (!xhrInfo) {\n return;\n }\n\n if (this.readyState === 4) {\n try {\n // touching statusCode in some platforms throws\n // an exception\n xhrInfo.status_code = this.status;\n } catch (e) {\n /* do nothing */\n }\n\n triggerHandlers('xhr', {\n args: args ,\n endTimestamp: Date.now(),\n startTimestamp: Date.now(),\n xhr: this,\n } );\n }\n };\n\n if ('onreadystatechange' in this && typeof this.onreadystatechange === 'function') {\n fill(this, 'onreadystatechange', function (original) {\n return function ( ...readyStateArgs) {\n onreadystatechangeHandler();\n return original.apply(this, readyStateArgs);\n };\n });\n } else {\n this.addEventListener('readystatechange', onreadystatechangeHandler);\n }\n\n // Intercepting `setRequestHeader` to access the request headers of XHR instance.\n // This will only work for user/library defined headers, not for the default/browser-assigned headers.\n // Request cookies are also unavailable for XHR, as `Cookie` header can't be defined by `setRequestHeader`.\n fill(this, 'setRequestHeader', function (original) {\n return function ( ...setRequestHeaderArgs) {\n const [header, value] = setRequestHeaderArgs ;\n\n const xhrInfo = this[SENTRY_XHR_DATA_KEY];\n\n if (xhrInfo) {\n xhrInfo.request_headers[header.toLowerCase()] = value;\n }\n\n return original.apply(this, setRequestHeaderArgs);\n };\n });\n\n return originalOpen.apply(this, args);\n };\n });\n\n fill(xhrproto, 'send', function (originalSend) {\n return function ( ...args) {\n const sentryXhrData = this[SENTRY_XHR_DATA_KEY];\n if (sentryXhrData && args[0] !== undefined) {\n sentryXhrData.body = args[0];\n }\n\n triggerHandlers('xhr', {\n args,\n startTimestamp: Date.now(),\n xhr: this,\n });\n\n return originalSend.apply(this, args);\n };\n });\n}\n\nlet lastHref;\n\n/** JSDoc */\nfunction instrumentHistory() {\n if (!supportsHistory()) {\n return;\n }\n\n const oldOnPopState = WINDOW.onpopstate;\n WINDOW.onpopstate = function ( ...args) {\n const to = WINDOW.location.href;\n // keep track of the current URL state, as we always receive only the updated state\n const from = lastHref;\n lastHref = to;\n triggerHandlers('history', {\n from,\n to,\n });\n if (oldOnPopState) {\n // Apparently this can throw in Firefox when incorrectly implemented plugin is installed.\n // https://github.com/getsentry/sentry-javascript/issues/3344\n // https://github.com/bugsnag/bugsnag-js/issues/469\n try {\n return oldOnPopState.apply(this, args);\n } catch (_oO) {\n // no-empty\n }\n }\n };\n\n /** @hidden */\n function historyReplacementFunction(originalHistoryFunction) {\n return function ( ...args) {\n const url = args.length > 2 ? args[2] : undefined;\n if (url) {\n // coerce to string (this is what pushState does)\n const from = lastHref;\n const to = String(url);\n // keep track of the current URL state, as we always receive only the updated state\n lastHref = to;\n triggerHandlers('history', {\n from,\n to,\n });\n }\n return originalHistoryFunction.apply(this, args);\n };\n }\n\n fill(WINDOW.history, 'pushState', historyReplacementFunction);\n fill(WINDOW.history, 'replaceState', historyReplacementFunction);\n}\n\nconst debounceDuration = 1000;\nlet debounceTimerID;\nlet lastCapturedEvent;\n\n/**\n * Decide whether the current event should finish the debounce of previously captured one.\n * @param previous previously captured event\n * @param current event to be captured\n */\nfunction shouldShortcircuitPreviousDebounce(previous, current) {\n // If there was no previous event, it should always be swapped for the new one.\n if (!previous) {\n return true;\n }\n\n // If both events have different type, then user definitely performed two separate actions. e.g. click + keypress.\n if (previous.type !== current.type) {\n return true;\n }\n\n try {\n // If both events have the same type, it's still possible that actions were performed on different targets.\n // e.g. 2 clicks on different buttons.\n if (previous.target !== current.target) {\n return true;\n }\n } catch (e) {\n // just accessing `target` property can throw an exception in some rare circumstances\n // see: https://github.com/getsentry/sentry-javascript/issues/838\n }\n\n // If both events have the same type _and_ same `target` (an element which triggered an event, _not necessarily_\n // to which an event listener was attached), we treat them as the same action, as we want to capture\n // only one breadcrumb. e.g. multiple clicks on the same button, or typing inside a user input box.\n return false;\n}\n\n/**\n * Decide whether an event should be captured.\n * @param event event to be captured\n */\nfunction shouldSkipDOMEvent(event) {\n // We are only interested in filtering `keypress` events for now.\n if (event.type !== 'keypress') {\n return false;\n }\n\n try {\n const target = event.target ;\n\n if (!target || !target.tagName) {\n return true;\n }\n\n // Only consider keypress events on actual input elements. This will disregard keypresses targeting body\n // e.g.tabbing through elements, hotkeys, etc.\n if (target.tagName === 'INPUT' || target.tagName === 'TEXTAREA' || target.isContentEditable) {\n return false;\n }\n } catch (e) {\n // just accessing `target` property can throw an exception in some rare circumstances\n // see: https://github.com/getsentry/sentry-javascript/issues/838\n }\n\n return true;\n}\n\n/**\n * Wraps addEventListener to capture UI breadcrumbs\n * @param handler function that will be triggered\n * @param globalListener indicates whether event was captured by the global event listener\n * @returns wrapped breadcrumb events handler\n * @hidden\n */\nfunction makeDOMEventHandler(handler, globalListener = false) {\n return (event) => {\n // It's possible this handler might trigger multiple times for the same\n // event (e.g. event propagation through node ancestors).\n // Ignore if we've already captured that event.\n if (!event || lastCapturedEvent === event) {\n return;\n }\n\n // We always want to skip _some_ events.\n if (shouldSkipDOMEvent(event)) {\n return;\n }\n\n const name = event.type === 'keypress' ? 'input' : event.type;\n\n // If there is no debounce timer, it means that we can safely capture the new event and store it for future comparisons.\n if (debounceTimerID === undefined) {\n handler({\n event: event,\n name,\n global: globalListener,\n });\n lastCapturedEvent = event;\n }\n // If there is a debounce awaiting, see if the new event is different enough to treat it as a unique one.\n // If that's the case, emit the previous event and store locally the newly-captured DOM event.\n else if (shouldShortcircuitPreviousDebounce(lastCapturedEvent, event)) {\n handler({\n event: event,\n name,\n global: globalListener,\n });\n lastCapturedEvent = event;\n }\n\n // Start a new debounce timer that will prevent us from capturing multiple events that should be grouped together.\n clearTimeout(debounceTimerID);\n debounceTimerID = WINDOW.setTimeout(() => {\n debounceTimerID = undefined;\n }, debounceDuration);\n };\n}\n\n/** JSDoc */\nfunction instrumentDOM() {\n if (!('document' in WINDOW)) {\n return;\n }\n\n // Make it so that any click or keypress that is unhandled / bubbled up all the way to the document triggers our dom\n // handlers. (Normally we have only one, which captures a breadcrumb for each click or keypress.) Do this before\n // we instrument `addEventListener` so that we don't end up attaching this handler twice.\n const triggerDOMHandler = triggerHandlers.bind(null, 'dom');\n const globalDOMEventHandler = makeDOMEventHandler(triggerDOMHandler, true);\n WINDOW.document.addEventListener('click', globalDOMEventHandler, false);\n WINDOW.document.addEventListener('keypress', globalDOMEventHandler, false);\n\n // After hooking into click and keypress events bubbled up to `document`, we also hook into user-handled\n // clicks & keypresses, by adding an event listener of our own to any element to which they add a listener. That\n // way, whenever one of their handlers is triggered, ours will be, too. (This is needed because their handler\n // could potentially prevent the event from bubbling up to our global listeners. This way, our handler are still\n // guaranteed to fire at least once.)\n ['EventTarget', 'Node'].forEach((target) => {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n const proto = (WINDOW )[target] && (WINDOW )[target].prototype;\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access, no-prototype-builtins\n if (!proto || !proto.hasOwnProperty || !proto.hasOwnProperty('addEventListener')) {\n return;\n }\n\n fill(proto, 'addEventListener', function (originalAddEventListener) {\n return function (\n\n type,\n listener,\n options,\n ) {\n if (type === 'click' || type == 'keypress') {\n try {\n const el = this ;\n const handlers = (el.__sentry_instrumentation_handlers__ = el.__sentry_instrumentation_handlers__ || {});\n const handlerForType = (handlers[type] = handlers[type] || { refCount: 0 });\n\n if (!handlerForType.handler) {\n const handler = makeDOMEventHandler(triggerDOMHandler);\n handlerForType.handler = handler;\n originalAddEventListener.call(this, type, handler, options);\n }\n\n handlerForType.refCount++;\n } catch (e) {\n // Accessing dom properties is always fragile.\n // Also allows us to skip `addEventListenrs` calls with no proper `this` context.\n }\n }\n\n return originalAddEventListener.call(this, type, listener, options);\n };\n });\n\n fill(\n proto,\n 'removeEventListener',\n function (originalRemoveEventListener) {\n return function (\n\n type,\n listener,\n options,\n ) {\n if (type === 'click' || type == 'keypress') {\n try {\n const el = this ;\n const handlers = el.__sentry_instrumentation_handlers__ || {};\n const handlerForType = handlers[type];\n\n if (handlerForType) {\n handlerForType.refCount--;\n // If there are no longer any custom handlers of the current type on this element, we can remove ours, too.\n if (handlerForType.refCount <= 0) {\n originalRemoveEventListener.call(this, type, handlerForType.handler, options);\n handlerForType.handler = undefined;\n delete handlers[type]; // eslint-disable-line @typescript-eslint/no-dynamic-delete\n }\n\n // If there are no longer any custom handlers of any type on this element, cleanup everything.\n if (Object.keys(handlers).length === 0) {\n delete el.__sentry_instrumentation_handlers__;\n }\n }\n } catch (e) {\n // Accessing dom properties is always fragile.\n // Also allows us to skip `addEventListenrs` calls with no proper `this` context.\n }\n }\n\n return originalRemoveEventListener.call(this, type, listener, options);\n };\n },\n );\n });\n}\n\nlet _oldOnErrorHandler = null;\n/** JSDoc */\nfunction instrumentError() {\n _oldOnErrorHandler = WINDOW.onerror;\n\n WINDOW.onerror = function (msg, url, line, column, error) {\n triggerHandlers('error', {\n column,\n error,\n line,\n msg,\n url,\n });\n\n if (_oldOnErrorHandler && !_oldOnErrorHandler.__SENTRY_LOADER__) {\n // eslint-disable-next-line prefer-rest-params\n return _oldOnErrorHandler.apply(this, arguments);\n }\n\n return false;\n };\n\n WINDOW.onerror.__SENTRY_INSTRUMENTED__ = true;\n}\n\nlet _oldOnUnhandledRejectionHandler = null;\n/** JSDoc */\nfunction instrumentUnhandledRejection() {\n _oldOnUnhandledRejectionHandler = WINDOW.onunhandledrejection;\n\n WINDOW.onunhandledrejection = function (e) {\n triggerHandlers('unhandledrejection', e);\n\n if (_oldOnUnhandledRejectionHandler && !_oldOnUnhandledRejectionHandler.__SENTRY_LOADER__) {\n // eslint-disable-next-line prefer-rest-params\n return _oldOnUnhandledRejectionHandler.apply(this, arguments);\n }\n\n return true;\n };\n\n WINDOW.onunhandledrejection.__SENTRY_INSTRUMENTED__ = true;\n}\n\nexport { SENTRY_XHR_DATA_KEY, addInstrumentationHandler, parseFetchArgs };\n","import { isNaN, isSyntheticEvent } from './is.js';\nimport { memoBuilder } from './memo.js';\nimport { convertToPlainObject } from './object.js';\nimport { getFunctionName } from './stacktrace.js';\n\n/**\n * Recursively normalizes the given object.\n *\n * - Creates a copy to prevent original input mutation\n * - Skips non-enumerable properties\n * - When stringifying, calls `toJSON` if implemented\n * - Removes circular references\n * - Translates non-serializable values (`undefined`/`NaN`/functions) to serializable format\n * - Translates known global objects/classes to a string representations\n * - Takes care of `Error` object serialization\n * - Optionally limits depth of final output\n * - Optionally limits number of properties/elements included in any single object/array\n *\n * @param input The object to be normalized.\n * @param depth The max depth to which to normalize the object. (Anything deeper stringified whole.)\n * @param maxProperties The max number of elements or properties to be included in any single array or\n * object in the normallized output.\n * @returns A normalized version of the object, or `\"**non-serializable**\"` if any errors are thrown during normalization.\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction normalize(input, depth = 100, maxProperties = +Infinity) {\n try {\n // since we're at the outermost level, we don't provide a key\n return visit('', input, depth, maxProperties);\n } catch (err) {\n return { ERROR: `**non-serializable** (${err})` };\n }\n}\n\n/** JSDoc */\nfunction normalizeToSize(\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n object,\n // Default Node.js REPL depth\n depth = 3,\n // 100kB, as 200kB is max payload size, so half sounds reasonable\n maxSize = 100 * 1024,\n) {\n const normalized = normalize(object, depth);\n\n if (jsonSize(normalized) > maxSize) {\n return normalizeToSize(object, depth - 1, maxSize);\n }\n\n return normalized ;\n}\n\n/**\n * Visits a node to perform normalization on it\n *\n * @param key The key corresponding to the given node\n * @param value The node to be visited\n * @param depth Optional number indicating the maximum recursion depth\n * @param maxProperties Optional maximum number of properties/elements included in any single object/array\n * @param memo Optional Memo class handling decycling\n */\nfunction visit(\n key,\n value,\n depth = +Infinity,\n maxProperties = +Infinity,\n memo = memoBuilder(),\n) {\n const [memoize, unmemoize] = memo;\n\n // Get the simple cases out of the way first\n if (\n value == null || // this matches null and undefined -> eqeq not eqeqeq\n (['number', 'boolean', 'string'].includes(typeof value) && !isNaN(value))\n ) {\n return value ;\n }\n\n const stringified = stringifyValue(key, value);\n\n // Anything we could potentially dig into more (objects or arrays) will have come back as `\"[object XXXX]\"`.\n // Everything else will have already been serialized, so if we don't see that pattern, we're done.\n if (!stringified.startsWith('[object ')) {\n return stringified;\n }\n\n // From here on, we can assert that `value` is either an object or an array.\n\n // Do not normalize objects that we know have already been normalized. As a general rule, the\n // \"__sentry_skip_normalization__\" property should only be used sparingly and only should only be set on objects that\n // have already been normalized.\n if ((value )['__sentry_skip_normalization__']) {\n return value ;\n }\n\n // We can set `__sentry_override_normalization_depth__` on an object to ensure that from there\n // We keep a certain amount of depth.\n // This should be used sparingly, e.g. we use it for the redux integration to ensure we get a certain amount of state.\n const remainingDepth =\n typeof (value )['__sentry_override_normalization_depth__'] === 'number'\n ? ((value )['__sentry_override_normalization_depth__'] )\n : depth;\n\n // We're also done if we've reached the max depth\n if (remainingDepth === 0) {\n // At this point we know `serialized` is a string of the form `\"[object XXXX]\"`. Clean it up so it's just `\"[XXXX]\"`.\n return stringified.replace('object ', '');\n }\n\n // If we've already visited this branch, bail out, as it's circular reference. If not, note that we're seeing it now.\n if (memoize(value)) {\n return '[Circular ~]';\n }\n\n // If the value has a `toJSON` method, we call it to extract more information\n const valueWithToJSON = value ;\n if (valueWithToJSON && typeof valueWithToJSON.toJSON === 'function') {\n try {\n const jsonValue = valueWithToJSON.toJSON();\n // We need to normalize the return value of `.toJSON()` in case it has circular references\n return visit('', jsonValue, remainingDepth - 1, maxProperties, memo);\n } catch (err) {\n // pass (The built-in `toJSON` failed, but we can still try to do it ourselves)\n }\n }\n\n // At this point we know we either have an object or an array, we haven't seen it before, and we're going to recurse\n // because we haven't yet reached the max depth. Create an accumulator to hold the results of visiting each\n // property/entry, and keep track of the number of items we add to it.\n const normalized = (Array.isArray(value) ? [] : {}) ;\n let numAdded = 0;\n\n // Before we begin, convert`Error` and`Event` instances into plain objects, since some of each of their relevant\n // properties are non-enumerable and otherwise would get missed.\n const visitable = convertToPlainObject(value );\n\n for (const visitKey in visitable) {\n // Avoid iterating over fields in the prototype if they've somehow been exposed to enumeration.\n if (!Object.prototype.hasOwnProperty.call(visitable, visitKey)) {\n continue;\n }\n\n if (numAdded >= maxProperties) {\n normalized[visitKey] = '[MaxProperties ~]';\n break;\n }\n\n // Recursively visit all the child nodes\n const visitValue = visitable[visitKey];\n normalized[visitKey] = visit(visitKey, visitValue, remainingDepth - 1, maxProperties, memo);\n\n numAdded++;\n }\n\n // Once we've visited all the branches, remove the parent from memo storage\n unmemoize(value);\n\n // Return accumulated values\n return normalized;\n}\n\n/* eslint-disable complexity */\n/**\n * Stringify the given value. Handles various known special values and types.\n *\n * Not meant to be used on simple primitives which already have a string representation, as it will, for example, turn\n * the number 1231 into \"[Object Number]\", nor on `null`, as it will throw.\n *\n * @param value The value to stringify\n * @returns A stringified representation of the given value\n */\nfunction stringifyValue(\n key,\n // this type is a tiny bit of a cheat, since this function does handle NaN (which is technically a number), but for\n // our internal use, it'll do\n value,\n) {\n try {\n if (key === 'domain' && value && typeof value === 'object' && (value )._events) {\n return '[Domain]';\n }\n\n if (key === 'domainEmitter') {\n return '[DomainEmitter]';\n }\n\n // It's safe to use `global`, `window`, and `document` here in this manner, as we are asserting using `typeof` first\n // which won't throw if they are not present.\n\n if (typeof global !== 'undefined' && value === global) {\n return '[Global]';\n }\n\n // eslint-disable-next-line no-restricted-globals\n if (typeof window !== 'undefined' && value === window) {\n return '[Window]';\n }\n\n // eslint-disable-next-line no-restricted-globals\n if (typeof document !== 'undefined' && value === document) {\n return '[Document]';\n }\n\n // React's SyntheticEvent thingy\n if (isSyntheticEvent(value)) {\n return '[SyntheticEvent]';\n }\n\n if (typeof value === 'number' && value !== value) {\n return '[NaN]';\n }\n\n if (typeof value === 'function') {\n return `[Function: ${getFunctionName(value)}]`;\n }\n\n if (typeof value === 'symbol') {\n return `[${String(value)}]`;\n }\n\n // stringified BigInts are indistinguishable from regular numbers, so we need to label them to avoid confusion\n if (typeof value === 'bigint') {\n return `[BigInt: ${String(value)}]`;\n }\n\n // Now that we've knocked out all the special cases and the primitives, all we have left are objects. Simply casting\n // them to strings means that instances of classes which haven't defined their `toStringTag` will just come out as\n // `\"[object Object]\"`. If we instead look at the constructor's name (which is the same as the name of the class),\n // we can make sure that only plain objects come out that way.\n const objName = getConstructorName(value);\n\n // Handle HTML Elements\n if (/^HTML(\\w*)Element$/.test(objName)) {\n return `[HTMLElement: ${objName}]`;\n }\n\n return `[object ${objName}]`;\n } catch (err) {\n return `**non-serializable** (${err})`;\n }\n}\n/* eslint-enable complexity */\n\nfunction getConstructorName(value) {\n const prototype = Object.getPrototypeOf(value);\n\n return prototype ? prototype.constructor.name : 'null prototype';\n}\n\n/** Calculates bytes size of input string */\nfunction utf8Length(value) {\n // eslint-disable-next-line no-bitwise\n return ~-encodeURI(value).split(/%..|./).length;\n}\n\n/** Calculates bytes size of input object */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction jsonSize(value) {\n return utf8Length(JSON.stringify(value));\n}\n\nexport { normalize, normalizeToSize, visit as walk };\n","/* eslint-disable @typescript-eslint/no-unsafe-member-access */\n/* eslint-disable @typescript-eslint/no-explicit-any */\n\n/**\n * Helper to decycle json objects\n */\nfunction memoBuilder() {\n const hasWeakSet = typeof WeakSet === 'function';\n const inner = hasWeakSet ? new WeakSet() : [];\n function memoize(obj) {\n if (hasWeakSet) {\n if (inner.has(obj)) {\n return true;\n }\n inner.add(obj);\n return false;\n }\n // eslint-disable-next-line @typescript-eslint/prefer-for-of\n for (let i = 0; i < inner.length; i++) {\n const value = inner[i];\n if (value === obj) {\n return true;\n }\n }\n inner.push(obj);\n return false;\n }\n\n function unmemoize(obj) {\n if (hasWeakSet) {\n inner.delete(obj);\n } else {\n for (let i = 0; i < inner.length; i++) {\n if (inner[i] === obj) {\n inner.splice(i, 1);\n break;\n }\n }\n }\n }\n return [memoize, unmemoize];\n}\n\nexport { memoBuilder };\n","import { dsnToString } from './dsn.js';\nimport { normalize } from './normalize.js';\nimport { dropUndefinedKeys } from './object.js';\n\n/**\n * Creates an envelope.\n * Make sure to always explicitly provide the generic to this function\n * so that the envelope types resolve correctly.\n */\nfunction createEnvelope(headers, items = []) {\n return [headers, items] ;\n}\n\n/**\n * Add an item to an envelope.\n * Make sure to always explicitly provide the generic to this function\n * so that the envelope types resolve correctly.\n */\nfunction addItemToEnvelope(envelope, newItem) {\n const [headers, items] = envelope;\n return [headers, [...items, newItem]] ;\n}\n\n/**\n * Convenience function to loop through the items and item types of an envelope.\n * (This function was mostly created because working with envelope types is painful at the moment)\n *\n * If the callback returns true, the rest of the items will be skipped.\n */\nfunction forEachEnvelopeItem(\n envelope,\n callback,\n) {\n const envelopeItems = envelope[1];\n\n for (const envelopeItem of envelopeItems) {\n const envelopeItemType = envelopeItem[0].type;\n const result = callback(envelopeItem, envelopeItemType);\n\n if (result) {\n return true;\n }\n }\n\n return false;\n}\n\n/**\n * Returns true if the envelope contains any of the given envelope item types\n */\nfunction envelopeContainsItemType(envelope, types) {\n return forEachEnvelopeItem(envelope, (_, type) => types.includes(type));\n}\n\n/**\n * Encode a string to UTF8.\n */\nfunction encodeUTF8(input, textEncoder) {\n const utf8 = textEncoder || new TextEncoder();\n return utf8.encode(input);\n}\n\n/**\n * Serializes an envelope.\n */\nfunction serializeEnvelope(envelope, textEncoder) {\n const [envHeaders, items] = envelope;\n\n // Initially we construct our envelope as a string and only convert to binary chunks if we encounter binary data\n let parts = JSON.stringify(envHeaders);\n\n function append(next) {\n if (typeof parts === 'string') {\n parts = typeof next === 'string' ? parts + next : [encodeUTF8(parts, textEncoder), next];\n } else {\n parts.push(typeof next === 'string' ? encodeUTF8(next, textEncoder) : next);\n }\n }\n\n for (const item of items) {\n const [itemHeaders, payload] = item;\n\n append(`\\n${JSON.stringify(itemHeaders)}\\n`);\n\n if (typeof payload === 'string' || payload instanceof Uint8Array) {\n append(payload);\n } else {\n let stringifiedPayload;\n try {\n stringifiedPayload = JSON.stringify(payload);\n } catch (e) {\n // In case, despite all our efforts to keep `payload` circular-dependency-free, `JSON.strinify()` still\n // fails, we try again after normalizing it again with infinite normalization depth. This of course has a\n // performance impact but in this case a performance hit is better than throwing.\n stringifiedPayload = JSON.stringify(normalize(payload));\n }\n append(stringifiedPayload);\n }\n }\n\n return typeof parts === 'string' ? parts : concatBuffers(parts);\n}\n\nfunction concatBuffers(buffers) {\n const totalLength = buffers.reduce((acc, buf) => acc + buf.length, 0);\n\n const merged = new Uint8Array(totalLength);\n let offset = 0;\n for (const buffer of buffers) {\n merged.set(buffer, offset);\n offset += buffer.length;\n }\n\n return merged;\n}\n\n/**\n * Parses an envelope\n */\nfunction parseEnvelope(\n env,\n textEncoder,\n textDecoder,\n) {\n let buffer = typeof env === 'string' ? textEncoder.encode(env) : env;\n\n function readBinary(length) {\n const bin = buffer.subarray(0, length);\n // Replace the buffer with the remaining data excluding trailing newline\n buffer = buffer.subarray(length + 1);\n return bin;\n }\n\n function readJson() {\n let i = buffer.indexOf(0xa);\n // If we couldn't find a newline, we must have found the end of the buffer\n if (i < 0) {\n i = buffer.length;\n }\n\n return JSON.parse(textDecoder.decode(readBinary(i))) ;\n }\n\n const envelopeHeader = readJson();\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const items = [];\n\n while (buffer.length) {\n const itemHeader = readJson();\n const binaryLength = typeof itemHeader.length === 'number' ? itemHeader.length : undefined;\n\n items.push([itemHeader, binaryLength ? readBinary(binaryLength) : readJson()]);\n }\n\n return [envelopeHeader, items];\n}\n\n/**\n * Creates attachment envelope items\n */\nfunction createAttachmentEnvelopeItem(\n attachment,\n textEncoder,\n) {\n const buffer = typeof attachment.data === 'string' ? encodeUTF8(attachment.data, textEncoder) : attachment.data;\n\n return [\n dropUndefinedKeys({\n type: 'attachment',\n length: buffer.length,\n filename: attachment.filename,\n content_type: attachment.contentType,\n attachment_type: attachment.attachmentType,\n }),\n buffer,\n ];\n}\n\nconst ITEM_TYPE_TO_DATA_CATEGORY_MAP = {\n session: 'session',\n sessions: 'session',\n attachment: 'attachment',\n transaction: 'transaction',\n event: 'error',\n client_report: 'internal',\n user_report: 'default',\n profile: 'profile',\n replay_event: 'replay',\n replay_recording: 'replay',\n check_in: 'monitor',\n};\n\n/**\n * Maps the type of an envelope item to a data category.\n */\nfunction envelopeItemTypeToDataCategory(type) {\n return ITEM_TYPE_TO_DATA_CATEGORY_MAP[type];\n}\n\n/** Extracts the minimal SDK info from from the metadata or an events */\nfunction getSdkMetadataForEnvelopeHeader(metadataOrEvent) {\n if (!metadataOrEvent || !metadataOrEvent.sdk) {\n return;\n }\n const { name, version } = metadataOrEvent.sdk;\n return { name, version };\n}\n\n/**\n * Creates event envelope headers, based on event, sdk info and tunnel\n * Note: This function was extracted from the core package to make it available in Replay\n */\nfunction createEventEnvelopeHeaders(\n event,\n sdkInfo,\n tunnel,\n dsn,\n) {\n const dynamicSamplingContext = event.sdkProcessingMetadata && event.sdkProcessingMetadata.dynamicSamplingContext;\n return {\n event_id: event.event_id ,\n sent_at: new Date().toISOString(),\n ...(sdkInfo && { sdk: sdkInfo }),\n ...(!!tunnel && { dsn: dsnToString(dsn) }),\n ...(dynamicSamplingContext && {\n trace: dropUndefinedKeys({ ...dynamicSamplingContext }),\n }),\n };\n}\n\nexport { addItemToEnvelope, createAttachmentEnvelopeItem, createEnvelope, createEventEnvelopeHeaders, envelopeContainsItemType, envelopeItemTypeToDataCategory, forEachEnvelopeItem, getSdkMetadataForEnvelopeHeader, parseEnvelope, serializeEnvelope };\n","/** An error emitted by Sentry SDKs and related utilities. */\nclass SentryError extends Error {\n /** Display name of this error instance. */\n\n constructor( message, logLevel = 'warn') {\n super(message);this.message = message;\n this.name = new.target.prototype.constructor.name;\n // This sets the prototype to be `Error`, not `SentryError`. It's unclear why we do this, but commenting this line\n // out causes various (seemingly totally unrelated) playwright tests consistently time out. FYI, this makes\n // instances of `SentryError` fail `obj instanceof SentryError` checks.\n Object.setPrototypeOf(this, new.target.prototype);\n this.logLevel = logLevel;\n }\n}\n\nexport { SentryError };\n","import { uuid4, dateTimestampInSeconds, resolvedSyncPromise, truncate, GLOBAL_OBJ, normalize } from '@sentry/utils';\nimport { DEFAULT_ENVIRONMENT } from '../constants.js';\nimport { Scope } from '../scope.js';\n\n/**\n * Adds common information to events.\n *\n * The information includes release and environment from `options`,\n * breadcrumbs and context (extra, tags and user) from the scope.\n *\n * Information that is already present in the event is never overwritten. For\n * nested objects, such as the context, keys are merged.\n *\n * Note: This also triggers callbacks for `addGlobalEventProcessor`, but not `beforeSend`.\n *\n * @param event The original event.\n * @param hint May contain additional information about the original exception.\n * @param scope A scope containing event metadata.\n * @returns A new event with more information.\n * @hidden\n */\nfunction prepareEvent(\n options,\n event,\n hint,\n scope,\n) {\n const { normalizeDepth = 3, normalizeMaxBreadth = 1000 } = options;\n const prepared = {\n ...event,\n event_id: event.event_id || hint.event_id || uuid4(),\n timestamp: event.timestamp || dateTimestampInSeconds(),\n };\n const integrations = hint.integrations || options.integrations.map(i => i.name);\n\n applyClientOptions(prepared, options);\n applyIntegrationsMetadata(prepared, integrations);\n\n // Only put debug IDs onto frames for error events.\n if (event.type === undefined) {\n applyDebugIds(prepared, options.stackParser);\n }\n\n // If we have scope given to us, use it as the base for further modifications.\n // This allows us to prevent unnecessary copying of data if `captureContext` is not provided.\n let finalScope = scope;\n if (hint.captureContext) {\n finalScope = Scope.clone(finalScope).update(hint.captureContext);\n }\n\n // We prepare the result here with a resolved Event.\n let result = resolvedSyncPromise(prepared);\n\n // This should be the last thing called, since we want that\n // {@link Hub.addEventProcessor} gets the finished prepared event.\n //\n // We need to check for the existence of `finalScope.getAttachments`\n // because `getAttachments` can be undefined if users are using an older version\n // of `@sentry/core` that does not have the `getAttachments` method.\n // See: https://github.com/getsentry/sentry-javascript/issues/5229\n if (finalScope) {\n // Collect attachments from the hint and scope\n if (finalScope.getAttachments) {\n const attachments = [...(hint.attachments || []), ...finalScope.getAttachments()];\n\n if (attachments.length) {\n hint.attachments = attachments;\n }\n }\n\n // In case we have a hub we reassign it.\n result = finalScope.applyToEvent(prepared, hint);\n }\n\n return result.then(evt => {\n if (evt) {\n // We apply the debug_meta field only after all event processors have ran, so that if any event processors modified\n // file names (e.g.the RewriteFrames integration) the filename -> debug ID relationship isn't destroyed.\n // This should not cause any PII issues, since we're only moving data that is already on the event and not adding\n // any new data\n applyDebugMeta(evt);\n }\n\n if (typeof normalizeDepth === 'number' && normalizeDepth > 0) {\n return normalizeEvent(evt, normalizeDepth, normalizeMaxBreadth);\n }\n return evt;\n });\n}\n\n/**\n * Enhances event using the client configuration.\n * It takes care of all \"static\" values like environment, release and `dist`,\n * as well as truncating overly long values.\n * @param event event instance to be enhanced\n */\nfunction applyClientOptions(event, options) {\n const { environment, release, dist, maxValueLength = 250 } = options;\n\n if (!('environment' in event)) {\n event.environment = 'environment' in options ? environment : DEFAULT_ENVIRONMENT;\n }\n\n if (event.release === undefined && release !== undefined) {\n event.release = release;\n }\n\n if (event.dist === undefined && dist !== undefined) {\n event.dist = dist;\n }\n\n if (event.message) {\n event.message = truncate(event.message, maxValueLength);\n }\n\n const exception = event.exception && event.exception.values && event.exception.values[0];\n if (exception && exception.value) {\n exception.value = truncate(exception.value, maxValueLength);\n }\n\n const request = event.request;\n if (request && request.url) {\n request.url = truncate(request.url, maxValueLength);\n }\n}\n\nconst debugIdStackParserCache = new WeakMap();\n\n/**\n * Puts debug IDs into the stack frames of an error event.\n */\nfunction applyDebugIds(event, stackParser) {\n const debugIdMap = GLOBAL_OBJ._sentryDebugIds;\n\n if (!debugIdMap) {\n return;\n }\n\n let debugIdStackFramesCache;\n const cachedDebugIdStackFrameCache = debugIdStackParserCache.get(stackParser);\n if (cachedDebugIdStackFrameCache) {\n debugIdStackFramesCache = cachedDebugIdStackFrameCache;\n } else {\n debugIdStackFramesCache = new Map();\n debugIdStackParserCache.set(stackParser, debugIdStackFramesCache);\n }\n\n // Build a map of filename -> debug_id\n const filenameDebugIdMap = Object.keys(debugIdMap).reduce((acc, debugIdStackTrace) => {\n let parsedStack;\n const cachedParsedStack = debugIdStackFramesCache.get(debugIdStackTrace);\n if (cachedParsedStack) {\n parsedStack = cachedParsedStack;\n } else {\n parsedStack = stackParser(debugIdStackTrace);\n debugIdStackFramesCache.set(debugIdStackTrace, parsedStack);\n }\n\n for (let i = parsedStack.length - 1; i >= 0; i--) {\n const stackFrame = parsedStack[i];\n if (stackFrame.filename) {\n acc[stackFrame.filename] = debugIdMap[debugIdStackTrace];\n break;\n }\n }\n return acc;\n }, {});\n\n try {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n event.exception.values.forEach(exception => {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n exception.stacktrace.frames.forEach(frame => {\n if (frame.filename) {\n frame.debug_id = filenameDebugIdMap[frame.filename];\n }\n });\n });\n } catch (e) {\n // To save bundle size we're just try catching here instead of checking for the existence of all the different objects.\n }\n}\n\n/**\n * Moves debug IDs from the stack frames of an error event into the debug_meta field.\n */\nfunction applyDebugMeta(event) {\n // Extract debug IDs and filenames from the stack frames on the event.\n const filenameDebugIdMap = {};\n try {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n event.exception.values.forEach(exception => {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n exception.stacktrace.frames.forEach(frame => {\n if (frame.debug_id) {\n if (frame.abs_path) {\n filenameDebugIdMap[frame.abs_path] = frame.debug_id;\n } else if (frame.filename) {\n filenameDebugIdMap[frame.filename] = frame.debug_id;\n }\n delete frame.debug_id;\n }\n });\n });\n } catch (e) {\n // To save bundle size we're just try catching here instead of checking for the existence of all the different objects.\n }\n\n if (Object.keys(filenameDebugIdMap).length === 0) {\n return;\n }\n\n // Fill debug_meta information\n event.debug_meta = event.debug_meta || {};\n event.debug_meta.images = event.debug_meta.images || [];\n const images = event.debug_meta.images;\n Object.keys(filenameDebugIdMap).forEach(filename => {\n images.push({\n type: 'sourcemap',\n code_file: filename,\n debug_id: filenameDebugIdMap[filename],\n });\n });\n}\n\n/**\n * This function adds all used integrations to the SDK info in the event.\n * @param event The event that will be filled with all integrations.\n */\nfunction applyIntegrationsMetadata(event, integrationNames) {\n if (integrationNames.length > 0) {\n event.sdk = event.sdk || {};\n event.sdk.integrations = [...(event.sdk.integrations || []), ...integrationNames];\n }\n}\n\n/**\n * Applies `normalize` function on necessary `Event` attributes to make them safe for serialization.\n * Normalized keys:\n * - `breadcrumbs.data`\n * - `user`\n * - `contexts`\n * - `extra`\n * @param event Event\n * @returns Normalized event\n */\nfunction normalizeEvent(event, depth, maxBreadth) {\n if (!event) {\n return null;\n }\n\n const normalized = {\n ...event,\n ...(event.breadcrumbs && {\n breadcrumbs: event.breadcrumbs.map(b => ({\n ...b,\n ...(b.data && {\n data: normalize(b.data, depth, maxBreadth),\n }),\n })),\n }),\n ...(event.user && {\n user: normalize(event.user, depth, maxBreadth),\n }),\n ...(event.contexts && {\n contexts: normalize(event.contexts, depth, maxBreadth),\n }),\n ...(event.extra && {\n extra: normalize(event.extra, depth, maxBreadth),\n }),\n };\n\n // event.contexts.trace stores information about a Transaction. Similarly,\n // event.spans[] stores information about child Spans. Given that a\n // Transaction is conceptually a Span, normalization should apply to both\n // Transactions and Spans consistently.\n // For now the decision is to skip normalization of Transactions and Spans,\n // so this block overwrites the normalized event to add back the original\n // Transaction information prior to normalization.\n if (event.contexts && event.contexts.trace && normalized.contexts) {\n normalized.contexts.trace = event.contexts.trace;\n\n // event.contexts.trace.data may contain circular/dangerous data so we need to normalize it\n if (event.contexts.trace.data) {\n normalized.contexts.trace.data = normalize(event.contexts.trace.data, depth, maxBreadth);\n }\n }\n\n // event.spans[].data may contain circular/dangerous data so we need to normalize it\n if (event.spans) {\n normalized.spans = event.spans.map(span => {\n // We cannot use the spread operator here because `toJSON` on `span` is non-enumerable\n if (span.data) {\n span.data = normalize(span.data, depth, maxBreadth);\n }\n return span;\n });\n }\n\n return normalized;\n}\n\nexport { applyDebugIds, applyDebugMeta, prepareEvent };\n","import { makeDsn, logger, checkOrSetAlreadyCaught, isPrimitive, resolvedSyncPromise, addItemToEnvelope, createAttachmentEnvelopeItem, SyncPromise, rejectedSyncPromise, SentryError, isThenable, isPlainObject } from '@sentry/utils';\nimport { getEnvelopeEndpointWithUrlEncodedAuth } from './api.js';\nimport { createEventEnvelope, createSessionEnvelope } from './envelope.js';\nimport { setupIntegrations, setupIntegration } from './integration.js';\nimport { updateSession } from './session.js';\nimport { getDynamicSamplingContextFromClient } from './tracing/dynamicSamplingContext.js';\nimport { prepareEvent } from './utils/prepareEvent.js';\n\nconst ALREADY_SEEN_ERROR = \"Not capturing exception because it's already been captured.\";\n\n/**\n * Base implementation for all JavaScript SDK clients.\n *\n * Call the constructor with the corresponding options\n * specific to the client subclass. To access these options later, use\n * {@link Client.getOptions}.\n *\n * If a Dsn is specified in the options, it will be parsed and stored. Use\n * {@link Client.getDsn} to retrieve the Dsn at any moment. In case the Dsn is\n * invalid, the constructor will throw a {@link SentryException}. Note that\n * without a valid Dsn, the SDK will not send any events to Sentry.\n *\n * Before sending an event, it is passed through\n * {@link BaseClient._prepareEvent} to add SDK information and scope data\n * (breadcrumbs and context). To add more custom information, override this\n * method and extend the resulting prepared event.\n *\n * To issue automatically created events (e.g. via instrumentation), use\n * {@link Client.captureEvent}. It will prepare the event and pass it through\n * the callback lifecycle. To issue auto-breadcrumbs, use\n * {@link Client.addBreadcrumb}.\n *\n * @example\n * class NodeClient extends BaseClient {\n * public constructor(options: NodeOptions) {\n * super(options);\n * }\n *\n * // ...\n * }\n */\nclass BaseClient {\n /** Options passed to the SDK. */\n\n /** The client Dsn, if specified in options. Without this Dsn, the SDK will be disabled. */\n\n /** Array of set up integrations. */\n\n /** Indicates whether this client's integrations have been set up. */\n\n /** Number of calls being processed */\n\n /** Holds flushable */\n\n // eslint-disable-next-line @typescript-eslint/ban-types\n\n /**\n * Initializes this client instance.\n *\n * @param options Options for the client.\n */\n constructor(options) {\n this._options = options;\n this._integrations = {};\n this._integrationsInitialized = false;\n this._numProcessing = 0;\n this._outcomes = {};\n this._hooks = {};\n\n if (options.dsn) {\n this._dsn = makeDsn(options.dsn);\n } else {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('No DSN provided, client will not do anything.');\n }\n\n if (this._dsn) {\n const url = getEnvelopeEndpointWithUrlEncodedAuth(this._dsn, options);\n this._transport = options.transport({\n recordDroppedEvent: this.recordDroppedEvent.bind(this),\n ...options.transportOptions,\n url,\n });\n }\n }\n\n /**\n * @inheritDoc\n */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/explicit-module-boundary-types\n captureException(exception, hint, scope) {\n // ensure we haven't captured this very object before\n if (checkOrSetAlreadyCaught(exception)) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(ALREADY_SEEN_ERROR);\n return;\n }\n\n let eventId = hint && hint.event_id;\n\n this._process(\n this.eventFromException(exception, hint)\n .then(event => this._captureEvent(event, hint, scope))\n .then(result => {\n eventId = result;\n }),\n );\n\n return eventId;\n }\n\n /**\n * @inheritDoc\n */\n captureMessage(\n message,\n // eslint-disable-next-line deprecation/deprecation\n level,\n hint,\n scope,\n ) {\n let eventId = hint && hint.event_id;\n\n const promisedEvent = isPrimitive(message)\n ? this.eventFromMessage(String(message), level, hint)\n : this.eventFromException(message, hint);\n\n this._process(\n promisedEvent\n .then(event => this._captureEvent(event, hint, scope))\n .then(result => {\n eventId = result;\n }),\n );\n\n return eventId;\n }\n\n /**\n * @inheritDoc\n */\n captureEvent(event, hint, scope) {\n // ensure we haven't captured this very object before\n if (hint && hint.originalException && checkOrSetAlreadyCaught(hint.originalException)) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(ALREADY_SEEN_ERROR);\n return;\n }\n\n let eventId = hint && hint.event_id;\n\n this._process(\n this._captureEvent(event, hint, scope).then(result => {\n eventId = result;\n }),\n );\n\n return eventId;\n }\n\n /**\n * @inheritDoc\n */\n captureSession(session) {\n if (!this._isEnabled()) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('SDK not enabled, will not capture session.');\n return;\n }\n\n if (!(typeof session.release === 'string')) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Discarded session because of missing or non-string release');\n } else {\n this.sendSession(session);\n // After sending, we set init false to indicate it's not the first occurrence\n updateSession(session, { init: false });\n }\n }\n\n /**\n * @inheritDoc\n */\n getDsn() {\n return this._dsn;\n }\n\n /**\n * @inheritDoc\n */\n getOptions() {\n return this._options;\n }\n\n /**\n * @see SdkMetadata in @sentry/types\n *\n * @return The metadata of the SDK\n */\n getSdkMetadata() {\n return this._options._metadata;\n }\n\n /**\n * @inheritDoc\n */\n getTransport() {\n return this._transport;\n }\n\n /**\n * @inheritDoc\n */\n flush(timeout) {\n const transport = this._transport;\n if (transport) {\n return this._isClientDoneProcessing(timeout).then(clientFinished => {\n return transport.flush(timeout).then(transportFlushed => clientFinished && transportFlushed);\n });\n } else {\n return resolvedSyncPromise(true);\n }\n }\n\n /**\n * @inheritDoc\n */\n close(timeout) {\n return this.flush(timeout).then(result => {\n this.getOptions().enabled = false;\n return result;\n });\n }\n\n /**\n * Sets up the integrations\n */\n setupIntegrations() {\n if (this._isEnabled() && !this._integrationsInitialized) {\n this._integrations = setupIntegrations(this._options.integrations);\n this._integrationsInitialized = true;\n }\n }\n\n /**\n * Gets an installed integration by its `id`.\n *\n * @returns The installed integration or `undefined` if no integration with that `id` was installed.\n */\n getIntegrationById(integrationId) {\n return this._integrations[integrationId];\n }\n\n /**\n * @inheritDoc\n */\n getIntegration(integration) {\n try {\n return (this._integrations[integration.id] ) || null;\n } catch (_oO) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn(`Cannot retrieve integration ${integration.id} from the current Client`);\n return null;\n }\n }\n\n /**\n * @inheritDoc\n */\n addIntegration(integration) {\n setupIntegration(integration, this._integrations);\n }\n\n /**\n * @inheritDoc\n */\n sendEvent(event, hint = {}) {\n if (this._dsn) {\n let env = createEventEnvelope(event, this._dsn, this._options._metadata, this._options.tunnel);\n\n for (const attachment of hint.attachments || []) {\n env = addItemToEnvelope(\n env,\n createAttachmentEnvelopeItem(\n attachment,\n this._options.transportOptions && this._options.transportOptions.textEncoder,\n ),\n );\n }\n\n const promise = this._sendEnvelope(env);\n if (promise) {\n promise.then(sendResponse => this.emit('afterSendEvent', event, sendResponse), null);\n }\n }\n }\n\n /**\n * @inheritDoc\n */\n sendSession(session) {\n if (this._dsn) {\n const env = createSessionEnvelope(session, this._dsn, this._options._metadata, this._options.tunnel);\n void this._sendEnvelope(env);\n }\n }\n\n /**\n * @inheritDoc\n */\n recordDroppedEvent(reason, category, _event) {\n // Note: we use `event` in replay, where we overwrite this hook.\n\n if (this._options.sendClientReports) {\n // We want to track each category (error, transaction, session, replay_event) separately\n // but still keep the distinction between different type of outcomes.\n // We could use nested maps, but it's much easier to read and type this way.\n // A correct type for map-based implementation if we want to go that route\n // would be `Partial>>>`\n // With typescript 4.1 we could even use template literal types\n const key = `${reason}:${category}`;\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`Adding outcome: \"${key}\"`);\n\n // The following works because undefined + 1 === NaN and NaN is falsy\n this._outcomes[key] = this._outcomes[key] + 1 || 1;\n }\n }\n\n // Keep on() & emit() signatures in sync with types' client.ts interface\n\n /** @inheritdoc */\n\n /** @inheritdoc */\n on(hook, callback) {\n if (!this._hooks[hook]) {\n this._hooks[hook] = [];\n }\n\n // @ts-ignore We assue the types are correct\n this._hooks[hook].push(callback);\n }\n\n /** @inheritdoc */\n\n /** @inheritdoc */\n emit(hook, ...rest) {\n if (this._hooks[hook]) {\n // @ts-ignore we cannot enforce the callback to match the hook\n this._hooks[hook].forEach(callback => callback(...rest));\n }\n }\n\n /** Updates existing session based on the provided event */\n _updateSessionFromEvent(session, event) {\n let crashed = false;\n let errored = false;\n const exceptions = event.exception && event.exception.values;\n\n if (exceptions) {\n errored = true;\n\n for (const ex of exceptions) {\n const mechanism = ex.mechanism;\n if (mechanism && mechanism.handled === false) {\n crashed = true;\n break;\n }\n }\n }\n\n // A session is updated and that session update is sent in only one of the two following scenarios:\n // 1. Session with non terminal status and 0 errors + an error occurred -> Will set error count to 1 and send update\n // 2. Session with non terminal status and 1 error + a crash occurred -> Will set status crashed and send update\n const sessionNonTerminal = session.status === 'ok';\n const shouldUpdateAndSend = (sessionNonTerminal && session.errors === 0) || (sessionNonTerminal && crashed);\n\n if (shouldUpdateAndSend) {\n updateSession(session, {\n ...(crashed && { status: 'crashed' }),\n errors: session.errors || Number(errored || crashed),\n });\n this.captureSession(session);\n }\n }\n\n /**\n * Determine if the client is finished processing. Returns a promise because it will wait `timeout` ms before saying\n * \"no\" (resolving to `false`) in order to give the client a chance to potentially finish first.\n *\n * @param timeout The time, in ms, after which to resolve to `false` if the client is still busy. Passing `0` (or not\n * passing anything) will make the promise wait as long as it takes for processing to finish before resolving to\n * `true`.\n * @returns A promise which will resolve to `true` if processing is already done or finishes before the timeout, and\n * `false` otherwise\n */\n _isClientDoneProcessing(timeout) {\n return new SyncPromise(resolve => {\n let ticked = 0;\n const tick = 1;\n\n const interval = setInterval(() => {\n if (this._numProcessing == 0) {\n clearInterval(interval);\n resolve(true);\n } else {\n ticked += tick;\n if (timeout && ticked >= timeout) {\n clearInterval(interval);\n resolve(false);\n }\n }\n }, tick);\n });\n }\n\n /** Determines whether this SDK is enabled and a valid Dsn is present. */\n _isEnabled() {\n return this.getOptions().enabled !== false && this._dsn !== undefined;\n }\n\n /**\n * Adds common information to events.\n *\n * The information includes release and environment from `options`,\n * breadcrumbs and context (extra, tags and user) from the scope.\n *\n * Information that is already present in the event is never overwritten. For\n * nested objects, such as the context, keys are merged.\n *\n * @param event The original event.\n * @param hint May contain additional information about the original exception.\n * @param scope A scope containing event metadata.\n * @returns A new event with more information.\n */\n _prepareEvent(event, hint, scope) {\n const options = this.getOptions();\n const integrations = Object.keys(this._integrations);\n if (!hint.integrations && integrations.length > 0) {\n hint.integrations = integrations;\n }\n return prepareEvent(options, event, hint, scope).then(evt => {\n if (evt === null) {\n return evt;\n }\n\n // If a trace context is not set on the event, we use the propagationContext set on the event to\n // generate a trace context. If the propagationContext does not have a dynamic sampling context, we\n // also generate one for it.\n const { propagationContext } = evt.sdkProcessingMetadata || {};\n const trace = evt.contexts && evt.contexts.trace;\n if (!trace && propagationContext) {\n const { traceId: trace_id, spanId, parentSpanId, dsc } = propagationContext ;\n evt.contexts = {\n trace: {\n trace_id,\n span_id: spanId,\n parent_span_id: parentSpanId,\n },\n ...evt.contexts,\n };\n\n const dynamicSamplingContext = dsc ? dsc : getDynamicSamplingContextFromClient(trace_id, this, scope);\n\n evt.sdkProcessingMetadata = {\n dynamicSamplingContext,\n ...evt.sdkProcessingMetadata,\n };\n }\n return evt;\n });\n }\n\n /**\n * Processes the event and logs an error in case of rejection\n * @param event\n * @param hint\n * @param scope\n */\n _captureEvent(event, hint = {}, scope) {\n return this._processEvent(event, hint, scope).then(\n finalEvent => {\n return finalEvent.event_id;\n },\n reason => {\n if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {\n // If something's gone wrong, log the error as a warning. If it's just us having used a `SentryError` for\n // control flow, log just the message (no stack) as a log-level log.\n const sentryError = reason ;\n if (sentryError.logLevel === 'log') {\n logger.log(sentryError.message);\n } else {\n logger.warn(sentryError);\n }\n }\n return undefined;\n },\n );\n }\n\n /**\n * Processes an event (either error or message) and sends it to Sentry.\n *\n * This also adds breadcrumbs and context information to the event. However,\n * platform specific meta data (such as the User's IP address) must be added\n * by the SDK implementor.\n *\n *\n * @param event The event to send to Sentry.\n * @param hint May contain additional information about the original exception.\n * @param scope A scope containing event metadata.\n * @returns A SyncPromise that resolves with the event or rejects in case event was/will not be send.\n */\n _processEvent(event, hint, scope) {\n const options = this.getOptions();\n const { sampleRate } = options;\n\n if (!this._isEnabled()) {\n return rejectedSyncPromise(new SentryError('SDK not enabled, will not capture event.', 'log'));\n }\n\n const isTransaction = isTransactionEvent(event);\n const isError = isErrorEvent(event);\n const eventType = event.type || 'error';\n const beforeSendLabel = `before send for type \\`${eventType}\\``;\n\n // 1.0 === 100% events are sent\n // 0.0 === 0% events are sent\n // Sampling for transaction happens somewhere else\n if (isError && typeof sampleRate === 'number' && Math.random() > sampleRate) {\n this.recordDroppedEvent('sample_rate', 'error', event);\n return rejectedSyncPromise(\n new SentryError(\n `Discarding event because it's not included in the random sample (sampling rate = ${sampleRate})`,\n 'log',\n ),\n );\n }\n\n const dataCategory = eventType === 'replay_event' ? 'replay' : eventType;\n\n return this._prepareEvent(event, hint, scope)\n .then(prepared => {\n if (prepared === null) {\n this.recordDroppedEvent('event_processor', dataCategory, event);\n throw new SentryError('An event processor returned `null`, will not send event.', 'log');\n }\n\n const isInternalException = hint.data && (hint.data ).__sentry__ === true;\n if (isInternalException) {\n return prepared;\n }\n\n const result = processBeforeSend(options, prepared, hint);\n return _validateBeforeSendResult(result, beforeSendLabel);\n })\n .then(processedEvent => {\n if (processedEvent === null) {\n this.recordDroppedEvent('before_send', dataCategory, event);\n throw new SentryError(`${beforeSendLabel} returned \\`null\\`, will not send event.`, 'log');\n }\n\n const session = scope && scope.getSession();\n if (!isTransaction && session) {\n this._updateSessionFromEvent(session, processedEvent);\n }\n\n // None of the Sentry built event processor will update transaction name,\n // so if the transaction name has been changed by an event processor, we know\n // it has to come from custom event processor added by a user\n const transactionInfo = processedEvent.transaction_info;\n if (isTransaction && transactionInfo && processedEvent.transaction !== event.transaction) {\n const source = 'custom';\n processedEvent.transaction_info = {\n ...transactionInfo,\n source,\n };\n }\n\n this.sendEvent(processedEvent, hint);\n return processedEvent;\n })\n .then(null, reason => {\n if (reason instanceof SentryError) {\n throw reason;\n }\n\n this.captureException(reason, {\n data: {\n __sentry__: true,\n },\n originalException: reason,\n });\n throw new SentryError(\n `Event processing pipeline threw an error, original event will not be sent. Details have been sent as a new event.\\nReason: ${reason}`,\n );\n });\n }\n\n /**\n * Occupies the client with processing and event\n */\n _process(promise) {\n this._numProcessing++;\n void promise.then(\n value => {\n this._numProcessing--;\n return value;\n },\n reason => {\n this._numProcessing--;\n return reason;\n },\n );\n }\n\n /**\n * @inheritdoc\n */\n _sendEnvelope(envelope) {\n if (this._transport && this._dsn) {\n this.emit('beforeEnvelope', envelope);\n\n return this._transport.send(envelope).then(null, reason => {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Error while sending event:', reason);\n });\n } else {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Transport disabled');\n }\n }\n\n /**\n * Clears outcomes on this client and returns them.\n */\n _clearOutcomes() {\n const outcomes = this._outcomes;\n this._outcomes = {};\n return Object.keys(outcomes).map(key => {\n const [reason, category] = key.split(':') ;\n return {\n reason,\n category,\n quantity: outcomes[key],\n };\n });\n }\n\n /**\n * @inheritDoc\n */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/explicit-module-boundary-types\n\n}\n\n/**\n * Verifies that return value of configured `beforeSend` or `beforeSendTransaction` is of expected type, and returns the value if so.\n */\nfunction _validateBeforeSendResult(\n beforeSendResult,\n beforeSendLabel,\n) {\n const invalidValueError = `${beforeSendLabel} must return \\`null\\` or a valid event.`;\n if (isThenable(beforeSendResult)) {\n return beforeSendResult.then(\n event => {\n if (!isPlainObject(event) && event !== null) {\n throw new SentryError(invalidValueError);\n }\n return event;\n },\n e => {\n throw new SentryError(`${beforeSendLabel} rejected with ${e}`);\n },\n );\n } else if (!isPlainObject(beforeSendResult) && beforeSendResult !== null) {\n throw new SentryError(invalidValueError);\n }\n return beforeSendResult;\n}\n\n/**\n * Process the matching `beforeSendXXX` callback.\n */\nfunction processBeforeSend(\n options,\n event,\n hint,\n) {\n const { beforeSend, beforeSendTransaction } = options;\n\n if (isErrorEvent(event) && beforeSend) {\n return beforeSend(event, hint);\n }\n\n if (isTransactionEvent(event) && beforeSendTransaction) {\n return beforeSendTransaction(event, hint);\n }\n\n return event;\n}\n\nfunction isErrorEvent(event) {\n return event.type === undefined;\n}\n\nfunction isTransactionEvent(event) {\n return event.type === 'transaction';\n}\n\nexport { BaseClient };\n","import { getSdkMetadataForEnvelopeHeader, dsnToString, createEnvelope, createEventEnvelopeHeaders } from '@sentry/utils';\n\n/**\n * Apply SdkInfo (name, version, packages, integrations) to the corresponding event key.\n * Merge with existing data if any.\n **/\nfunction enhanceEventWithSdkInfo(event, sdkInfo) {\n if (!sdkInfo) {\n return event;\n }\n event.sdk = event.sdk || {};\n event.sdk.name = event.sdk.name || sdkInfo.name;\n event.sdk.version = event.sdk.version || sdkInfo.version;\n event.sdk.integrations = [...(event.sdk.integrations || []), ...(sdkInfo.integrations || [])];\n event.sdk.packages = [...(event.sdk.packages || []), ...(sdkInfo.packages || [])];\n return event;\n}\n\n/** Creates an envelope from a Session */\nfunction createSessionEnvelope(\n session,\n dsn,\n metadata,\n tunnel,\n) {\n const sdkInfo = getSdkMetadataForEnvelopeHeader(metadata);\n const envelopeHeaders = {\n sent_at: new Date().toISOString(),\n ...(sdkInfo && { sdk: sdkInfo }),\n ...(!!tunnel && { dsn: dsnToString(dsn) }),\n };\n\n const envelopeItem =\n 'aggregates' in session ? [{ type: 'sessions' }, session] : [{ type: 'session' }, session.toJSON()];\n\n return createEnvelope(envelopeHeaders, [envelopeItem]);\n}\n\n/**\n * Create an Envelope from an event.\n */\nfunction createEventEnvelope(\n event,\n dsn,\n metadata,\n tunnel,\n) {\n const sdkInfo = getSdkMetadataForEnvelopeHeader(metadata);\n\n /*\n Note: Due to TS, event.type may be `replay_event`, theoretically.\n In practice, we never call `createEventEnvelope` with `replay_event` type,\n and we'd have to adjut a looot of types to make this work properly.\n We want to avoid casting this around, as that could lead to bugs (e.g. when we add another type)\n So the safe choice is to really guard against the replay_event type here.\n */\n const eventType = event.type && event.type !== 'replay_event' ? event.type : 'event';\n\n enhanceEventWithSdkInfo(event, metadata && metadata.sdk);\n\n const envelopeHeaders = createEventEnvelopeHeaders(event, sdkInfo, tunnel, dsn);\n\n // Prevent this data (which, if it exists, was used in earlier steps in the processing pipeline) from being sent to\n // sentry. (Note: Our use of this property comes and goes with whatever we might be debugging, whatever hacks we may\n // have temporarily added, etc. Even if we don't happen to be using it at some point in the future, let's not get rid\n // of this `delete`, lest we miss putting it back in the next time the property is in use.)\n delete event.sdkProcessingMetadata;\n\n const eventItem = [{ type: eventType }, event];\n return createEnvelope(envelopeHeaders, [eventItem]);\n}\n\nexport { createEventEnvelope, createSessionEnvelope };\n","import { dropUndefinedKeys } from '@sentry/utils';\nimport { DEFAULT_ENVIRONMENT } from '../constants.js';\n\n/**\n * Creates a dynamic sampling context from a client.\n *\n * Dispatchs the `createDsc` lifecycle hook as a side effect.\n */\nfunction getDynamicSamplingContextFromClient(\n trace_id,\n client,\n scope,\n) {\n const options = client.getOptions();\n\n const { publicKey: public_key } = client.getDsn() || {};\n const { segment: user_segment } = (scope && scope.getUser()) || {};\n\n const dsc = dropUndefinedKeys({\n environment: options.environment || DEFAULT_ENVIRONMENT,\n release: options.release,\n user_segment,\n public_key,\n trace_id,\n }) ;\n\n client.emit && client.emit('createDsc', dsc);\n\n return dsc;\n}\n\nexport { getDynamicSamplingContextFromClient };\n","const SDK_VERSION = '7.62.0';\n\nexport { SDK_VERSION };\n","import { getCurrentHub } from '@sentry/core';\nimport { addExceptionMechanism, resolvedSyncPromise, isErrorEvent, isDOMError, isDOMException, addExceptionTypeValue, isError, isPlainObject, isEvent, normalizeToSize, extractExceptionKeysForMessage } from '@sentry/utils';\n\n/**\n * This function creates an exception from a JavaScript Error\n */\nfunction exceptionFromError(stackParser, ex) {\n // Get the frames first since Opera can lose the stack if we touch anything else first\n const frames = parseStackFrames(stackParser, ex);\n\n const exception = {\n type: ex && ex.name,\n value: extractMessage(ex),\n };\n\n if (frames.length) {\n exception.stacktrace = { frames };\n }\n\n if (exception.type === undefined && exception.value === '') {\n exception.value = 'Unrecoverable error caught';\n }\n\n return exception;\n}\n\n/**\n * @hidden\n */\nfunction eventFromPlainObject(\n stackParser,\n exception,\n syntheticException,\n isUnhandledRejection,\n) {\n const hub = getCurrentHub();\n const client = hub.getClient();\n const normalizeDepth = client && client.getOptions().normalizeDepth;\n\n const event = {\n exception: {\n values: [\n {\n type: isEvent(exception) ? exception.constructor.name : isUnhandledRejection ? 'UnhandledRejection' : 'Error',\n value: getNonErrorObjectExceptionValue(exception, { isUnhandledRejection }),\n },\n ],\n },\n extra: {\n __serialized__: normalizeToSize(exception, normalizeDepth),\n },\n };\n\n if (syntheticException) {\n const frames = parseStackFrames(stackParser, syntheticException);\n if (frames.length) {\n // event.exception.values[0] has been set above\n (event.exception ).values[0].stacktrace = { frames };\n }\n }\n\n return event;\n}\n\n/**\n * @hidden\n */\nfunction eventFromError(stackParser, ex) {\n return {\n exception: {\n values: [exceptionFromError(stackParser, ex)],\n },\n };\n}\n\n/** Parses stack frames from an error */\nfunction parseStackFrames(\n stackParser,\n ex,\n) {\n // Access and store the stacktrace property before doing ANYTHING\n // else to it because Opera is not very good at providing it\n // reliably in other circumstances.\n const stacktrace = ex.stacktrace || ex.stack || '';\n\n const popSize = getPopSize(ex);\n\n try {\n return stackParser(stacktrace, popSize);\n } catch (e) {\n // no-empty\n }\n\n return [];\n}\n\n// Based on our own mapping pattern - https://github.com/getsentry/sentry/blob/9f08305e09866c8bd6d0c24f5b0aabdd7dd6c59c/src/sentry/lang/javascript/errormapping.py#L83-L108\nconst reactMinifiedRegexp = /Minified React error #\\d+;/i;\n\nfunction getPopSize(ex) {\n if (ex) {\n if (typeof ex.framesToPop === 'number') {\n return ex.framesToPop;\n }\n\n if (reactMinifiedRegexp.test(ex.message)) {\n return 1;\n }\n }\n\n return 0;\n}\n\n/**\n * There are cases where stacktrace.message is an Event object\n * https://github.com/getsentry/sentry-javascript/issues/1949\n * In this specific case we try to extract stacktrace.message.error.message\n */\nfunction extractMessage(ex) {\n const message = ex && ex.message;\n if (!message) {\n return 'No error message';\n }\n if (message.error && typeof message.error.message === 'string') {\n return message.error.message;\n }\n return message;\n}\n\n/**\n * Creates an {@link Event} from all inputs to `captureException` and non-primitive inputs to `captureMessage`.\n * @hidden\n */\nfunction eventFromException(\n stackParser,\n exception,\n hint,\n attachStacktrace,\n) {\n const syntheticException = (hint && hint.syntheticException) || undefined;\n const event = eventFromUnknownInput(stackParser, exception, syntheticException, attachStacktrace);\n addExceptionMechanism(event); // defaults to { type: 'generic', handled: true }\n event.level = 'error';\n if (hint && hint.event_id) {\n event.event_id = hint.event_id;\n }\n return resolvedSyncPromise(event);\n}\n\n/**\n * Builds and Event from a Message\n * @hidden\n */\nfunction eventFromMessage(\n stackParser,\n message,\n // eslint-disable-next-line deprecation/deprecation\n level = 'info',\n hint,\n attachStacktrace,\n) {\n const syntheticException = (hint && hint.syntheticException) || undefined;\n const event = eventFromString(stackParser, message, syntheticException, attachStacktrace);\n event.level = level;\n if (hint && hint.event_id) {\n event.event_id = hint.event_id;\n }\n return resolvedSyncPromise(event);\n}\n\n/**\n * @hidden\n */\nfunction eventFromUnknownInput(\n stackParser,\n exception,\n syntheticException,\n attachStacktrace,\n isUnhandledRejection,\n) {\n let event;\n\n if (isErrorEvent(exception ) && (exception ).error) {\n // If it is an ErrorEvent with `error` property, extract it to get actual Error\n const errorEvent = exception ;\n return eventFromError(stackParser, errorEvent.error );\n }\n\n // If it is a `DOMError` (which is a legacy API, but still supported in some browsers) then we just extract the name\n // and message, as it doesn't provide anything else. According to the spec, all `DOMExceptions` should also be\n // `Error`s, but that's not the case in IE11, so in that case we treat it the same as we do a `DOMError`.\n //\n // https://developer.mozilla.org/en-US/docs/Web/API/DOMError\n // https://developer.mozilla.org/en-US/docs/Web/API/DOMException\n // https://webidl.spec.whatwg.org/#es-DOMException-specialness\n if (isDOMError(exception) || isDOMException(exception )) {\n const domException = exception ;\n\n if ('stack' in (exception )) {\n event = eventFromError(stackParser, exception );\n } else {\n const name = domException.name || (isDOMError(domException) ? 'DOMError' : 'DOMException');\n const message = domException.message ? `${name}: ${domException.message}` : name;\n event = eventFromString(stackParser, message, syntheticException, attachStacktrace);\n addExceptionTypeValue(event, message);\n }\n if ('code' in domException) {\n // eslint-disable-next-line deprecation/deprecation\n event.tags = { ...event.tags, 'DOMException.code': `${domException.code}` };\n }\n\n return event;\n }\n if (isError(exception)) {\n // we have a real Error object, do nothing\n return eventFromError(stackParser, exception);\n }\n if (isPlainObject(exception) || isEvent(exception)) {\n // If it's a plain object or an instance of `Event` (the built-in JS kind, not this SDK's `Event` type), serialize\n // it manually. This will allow us to group events based on top-level keys which is much better than creating a new\n // group on any key/value change.\n const objectException = exception ;\n event = eventFromPlainObject(stackParser, objectException, syntheticException, isUnhandledRejection);\n addExceptionMechanism(event, {\n synthetic: true,\n });\n return event;\n }\n\n // If none of previous checks were valid, then it means that it's not:\n // - an instance of DOMError\n // - an instance of DOMException\n // - an instance of Event\n // - an instance of Error\n // - a valid ErrorEvent (one with an error property)\n // - a plain Object\n //\n // So bail out and capture it as a simple message:\n event = eventFromString(stackParser, exception , syntheticException, attachStacktrace);\n addExceptionTypeValue(event, `${exception}`, undefined);\n addExceptionMechanism(event, {\n synthetic: true,\n });\n\n return event;\n}\n\n/**\n * @hidden\n */\nfunction eventFromString(\n stackParser,\n input,\n syntheticException,\n attachStacktrace,\n) {\n const event = {\n message: input,\n };\n\n if (attachStacktrace && syntheticException) {\n const frames = parseStackFrames(stackParser, syntheticException);\n if (frames.length) {\n event.exception = {\n values: [{ value: input, stacktrace: { frames } }],\n };\n }\n }\n\n return event;\n}\n\nfunction getNonErrorObjectExceptionValue(\n exception,\n { isUnhandledRejection },\n) {\n const keys = extractExceptionKeysForMessage(exception);\n const captureType = isUnhandledRejection ? 'promise rejection' : 'exception';\n\n // Some ErrorEvent instances do not have an `error` property, which is why they are not handled before\n // We still want to try to get a decent message for these cases\n if (isErrorEvent(exception)) {\n return `Event \\`ErrorEvent\\` captured as ${captureType} with message \\`${exception.message}\\``;\n }\n\n if (isEvent(exception)) {\n const className = getObjectClassName(exception);\n return `Event \\`${className}\\` (type=${exception.type}) captured as ${captureType}`;\n }\n\n return `Object captured as ${captureType} with keys: ${keys}`;\n}\n\nfunction getObjectClassName(obj) {\n try {\n const prototype = Object.getPrototypeOf(obj);\n return prototype ? prototype.constructor.name : undefined;\n } catch (e) {\n // ignore errors here\n }\n}\n\nexport { eventFromError, eventFromException, eventFromMessage, eventFromPlainObject, eventFromString, eventFromUnknownInput, exceptionFromError, parseStackFrames };\n","import { withScope, captureException } from '@sentry/core';\nimport { GLOBAL_OBJ, getOriginalFunction, markFunctionWrapped, addNonEnumerableProperty, addExceptionTypeValue, addExceptionMechanism } from '@sentry/utils';\n\nconst WINDOW = GLOBAL_OBJ ;\n\nlet ignoreOnError = 0;\n\n/**\n * @hidden\n */\nfunction shouldIgnoreOnError() {\n return ignoreOnError > 0;\n}\n\n/**\n * @hidden\n */\nfunction ignoreNextOnError() {\n // onerror should trigger before setTimeout\n ignoreOnError++;\n setTimeout(() => {\n ignoreOnError--;\n });\n}\n\n/**\n * Instruments the given function and sends an event to Sentry every time the\n * function throws an exception.\n *\n * @param fn A function to wrap. It is generally safe to pass an unbound function, because the returned wrapper always\n * has a correct `this` context.\n * @returns The wrapped function.\n * @hidden\n */\nfunction wrap(\n fn,\n options\n\n = {},\n before,\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n) {\n // for future readers what this does is wrap a function and then create\n // a bi-directional wrapping between them.\n //\n // example: wrapped = wrap(original);\n // original.__sentry_wrapped__ -> wrapped\n // wrapped.__sentry_original__ -> original\n\n if (typeof fn !== 'function') {\n return fn;\n }\n\n try {\n // if we're dealing with a function that was previously wrapped, return\n // the original wrapper.\n const wrapper = fn.__sentry_wrapped__;\n if (wrapper) {\n return wrapper;\n }\n\n // We don't wanna wrap it twice\n if (getOriginalFunction(fn)) {\n return fn;\n }\n } catch (e) {\n // Just accessing custom props in some Selenium environments\n // can cause a \"Permission denied\" exception (see raven-js#495).\n // Bail on wrapping and return the function as-is (defers to window.onerror).\n return fn;\n }\n\n /* eslint-disable prefer-rest-params */\n // It is important that `sentryWrapped` is not an arrow function to preserve the context of `this`\n const sentryWrapped = function () {\n const args = Array.prototype.slice.call(arguments);\n\n try {\n if (before && typeof before === 'function') {\n before.apply(this, arguments);\n }\n\n // eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/no-unsafe-member-access\n const wrappedArguments = args.map((arg) => wrap(arg, options));\n\n // Attempt to invoke user-land function\n // NOTE: If you are a Sentry user, and you are seeing this stack frame, it\n // means the sentry.javascript SDK caught an error invoking your application code. This\n // is expected behavior and NOT indicative of a bug with sentry.javascript.\n return fn.apply(this, wrappedArguments);\n } catch (ex) {\n ignoreNextOnError();\n\n withScope((scope) => {\n scope.addEventProcessor((event) => {\n if (options.mechanism) {\n addExceptionTypeValue(event, undefined, undefined);\n addExceptionMechanism(event, options.mechanism);\n }\n\n event.extra = {\n ...event.extra,\n arguments: args,\n };\n\n return event;\n });\n\n captureException(ex);\n });\n\n throw ex;\n }\n };\n /* eslint-enable prefer-rest-params */\n\n // Accessing some objects may throw\n // ref: https://github.com/getsentry/sentry-javascript/issues/1168\n try {\n for (const property in fn) {\n if (Object.prototype.hasOwnProperty.call(fn, property)) {\n sentryWrapped[property] = fn[property];\n }\n }\n } catch (_oO) {} // eslint-disable-line no-empty\n\n // Signal that this function has been wrapped/filled already\n // for both debugging and to prevent it to being wrapped/filled twice\n markFunctionWrapped(sentryWrapped, fn);\n\n addNonEnumerableProperty(fn, '__sentry_wrapped__', sentryWrapped);\n\n // Restore original function name (not all browsers allow that)\n try {\n const descriptor = Object.getOwnPropertyDescriptor(sentryWrapped, 'name') ;\n if (descriptor.configurable) {\n Object.defineProperty(sentryWrapped, 'name', {\n get() {\n return fn.name;\n },\n });\n }\n // eslint-disable-next-line no-empty\n } catch (_oO) {}\n\n return sentryWrapped;\n}\n\n/**\n * All properties the report dialog supports\n */\n\nexport { WINDOW, ignoreNextOnError, shouldIgnoreOnError, wrap };\n","// Note: Ideally the `SeverityLevel` type would be derived from `validSeverityLevels`, but that would mean either\n//\n// a) moving `validSeverityLevels` to `@sentry/types`,\n// b) moving the`SeverityLevel` type here, or\n// c) importing `validSeverityLevels` from here into `@sentry/types`.\n//\n// Option A would make `@sentry/types` a runtime dependency of `@sentry/utils` (not good), and options B and C would\n// create a circular dependency between `@sentry/types` and `@sentry/utils` (also not good). So a TODO accompanying the\n// type, reminding anyone who changes it to change this list also, will have to do.\n\nconst validSeverityLevels = ['fatal', 'error', 'warning', 'log', 'info', 'debug'];\n\n/**\n * Converts a string-based level into a member of the deprecated {@link Severity} enum.\n *\n * @deprecated `severityFromString` is deprecated. Please use `severityLevelFromString` instead.\n *\n * @param level String representation of Severity\n * @returns Severity\n */\nfunction severityFromString(level) {\n return severityLevelFromString(level) ;\n}\n\n/**\n * Converts a string-based level into a `SeverityLevel`, normalizing it along the way.\n *\n * @param level String representation of desired `SeverityLevel`.\n * @returns The `SeverityLevel` corresponding to the given string, or 'log' if the string isn't a valid level.\n */\nfunction severityLevelFromString(level) {\n return (level === 'warn' ? 'warning' : validSeverityLevels.includes(level) ? level : 'log') ;\n}\n\nexport { severityFromString, severityLevelFromString, validSeverityLevels };\n","/**\n * Parses string form of URL into an object\n * // borrowed from https://tools.ietf.org/html/rfc3986#appendix-B\n * // intentionally using regex and not href parsing trick because React Native and other\n * // environments where DOM might not be available\n * @returns parsed URL object\n */\nfunction parseUrl(url) {\n if (!url) {\n return {};\n }\n\n const match = url.match(/^(([^:/?#]+):)?(\\/\\/([^/?#]*))?([^?#]*)(\\?([^#]*))?(#(.*))?$/);\n\n if (!match) {\n return {};\n }\n\n // coerce to undefined values to empty string so we don't get 'undefined'\n const query = match[6] || '';\n const fragment = match[8] || '';\n return {\n host: match[4],\n path: match[5],\n protocol: match[2],\n search: query,\n hash: fragment,\n relative: match[5] + query + fragment, // everything minus origin\n };\n}\n\n/**\n * Strip the query string and fragment off of a given URL or path (if present)\n *\n * @param urlPath Full URL or path, including possible query string and/or fragment\n * @returns URL or path without query string or fragment\n */\nfunction stripUrlQueryAndFragment(urlPath) {\n // eslint-disable-next-line no-useless-escape\n return urlPath.split(/[\\?#]/, 1)[0];\n}\n\n/**\n * Returns number of URL segments of a passed string URL.\n */\nfunction getNumberOfUrlSegments(url) {\n // split at '/' or at '\\/' to split regex urls correctly\n return url.split(/\\\\?\\//).filter(s => s.length > 0 && s !== ',').length;\n}\n\n/**\n * Takes a URL object and returns a sanitized string which is safe to use as span description\n * see: https://develop.sentry.dev/sdk/data-handling/#structuring-data\n */\nfunction getSanitizedUrlString(url) {\n const { protocol, host, path } = url;\n\n const filteredHost =\n (host &&\n host\n // Always filter out authority\n .replace(/^.*@/, '[filtered]:[filtered]@')\n // Don't show standard :80 (http) and :443 (https) ports to reduce the noise\n .replace(':80', '')\n .replace(':443', '')) ||\n '';\n\n return `${protocol ? `${protocol}://` : ''}${filteredHost}${path}`;\n}\n\nexport { getNumberOfUrlSegments, getSanitizedUrlString, parseUrl, stripUrlQueryAndFragment };\n","import { getCurrentHub } from '@sentry/core';\nimport { addInstrumentationHandler, getEventDescription, severityLevelFromString, safeJoin, SENTRY_XHR_DATA_KEY, parseUrl, logger, htmlTreeAsString } from '@sentry/utils';\nimport { WINDOW } from '../helpers.js';\n\n/* eslint-disable @typescript-eslint/no-unsafe-member-access */\n\n/** maxStringLength gets capped to prevent 100 breadcrumbs exceeding 1MB event payload size */\nconst MAX_ALLOWED_STRING_LENGTH = 1024;\n\nconst BREADCRUMB_INTEGRATION_ID = 'Breadcrumbs';\n\n/**\n * Default Breadcrumbs instrumentations\n * TODO: Deprecated - with v6, this will be renamed to `Instrument`\n */\nclass Breadcrumbs {\n /**\n * @inheritDoc\n */\n static __initStatic() {this.id = BREADCRUMB_INTEGRATION_ID;}\n\n /**\n * @inheritDoc\n */\n\n /**\n * Options of the breadcrumbs integration.\n */\n // This field is public, because we use it in the browser client to check if the `sentry` option is enabled.\n\n /**\n * @inheritDoc\n */\n constructor(options) {\n this.name = Breadcrumbs.id;\n this.options = {\n console: true,\n dom: true,\n fetch: true,\n history: true,\n sentry: true,\n xhr: true,\n ...options,\n };\n }\n\n /**\n * Instrument browser built-ins w/ breadcrumb capturing\n * - Console API\n * - DOM API (click/typing)\n * - XMLHttpRequest API\n * - Fetch API\n * - History API\n */\n setupOnce() {\n if (this.options.console) {\n addInstrumentationHandler('console', _consoleBreadcrumb);\n }\n if (this.options.dom) {\n addInstrumentationHandler('dom', _domBreadcrumb(this.options.dom));\n }\n if (this.options.xhr) {\n addInstrumentationHandler('xhr', _xhrBreadcrumb);\n }\n if (this.options.fetch) {\n addInstrumentationHandler('fetch', _fetchBreadcrumb);\n }\n if (this.options.history) {\n addInstrumentationHandler('history', _historyBreadcrumb);\n }\n }\n\n /**\n * Adds a breadcrumb for Sentry events or transactions if this option is enabled.\n */\n addSentryBreadcrumb(event) {\n if (this.options.sentry) {\n getCurrentHub().addBreadcrumb(\n {\n category: `sentry.${event.type === 'transaction' ? 'transaction' : 'event'}`,\n event_id: event.event_id,\n level: event.level,\n message: getEventDescription(event),\n },\n {\n event,\n },\n );\n }\n }\n} Breadcrumbs.__initStatic();\n\n/**\n * A HOC that creaes a function that creates breadcrumbs from DOM API calls.\n * This is a HOC so that we get access to dom options in the closure.\n */\nfunction _domBreadcrumb(dom) {\n function _innerDomBreadcrumb(handlerData) {\n let target;\n let keyAttrs = typeof dom === 'object' ? dom.serializeAttribute : undefined;\n\n let maxStringLength =\n typeof dom === 'object' && typeof dom.maxStringLength === 'number' ? dom.maxStringLength : undefined;\n if (maxStringLength && maxStringLength > MAX_ALLOWED_STRING_LENGTH) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.warn(\n `\\`dom.maxStringLength\\` cannot exceed ${MAX_ALLOWED_STRING_LENGTH}, but a value of ${maxStringLength} was configured. Sentry will use ${MAX_ALLOWED_STRING_LENGTH} instead.`,\n );\n maxStringLength = MAX_ALLOWED_STRING_LENGTH;\n }\n\n if (typeof keyAttrs === 'string') {\n keyAttrs = [keyAttrs];\n }\n\n // Accessing event.target can throw (see getsentry/raven-js#838, #768)\n try {\n const event = handlerData.event ;\n target = _isEvent(event)\n ? htmlTreeAsString(event.target, { keyAttrs, maxStringLength })\n : htmlTreeAsString(event, { keyAttrs, maxStringLength });\n } catch (e) {\n target = '';\n }\n\n if (target.length === 0) {\n return;\n }\n\n getCurrentHub().addBreadcrumb(\n {\n category: `ui.${handlerData.name}`,\n message: target,\n },\n {\n event: handlerData.event,\n name: handlerData.name,\n global: handlerData.global,\n },\n );\n }\n\n return _innerDomBreadcrumb;\n}\n\n/**\n * Creates breadcrumbs from console API calls\n */\nfunction _consoleBreadcrumb(handlerData) {\n // This is a hack to fix a Vue3-specific bug that causes an infinite loop of\n // console warnings. This happens when a Vue template is rendered with\n // an undeclared variable, which we try to stringify, ultimately causing\n // Vue to issue another warning which repeats indefinitely.\n // see: https://github.com/getsentry/sentry-javascript/pull/6010\n // see: https://github.com/getsentry/sentry-javascript/issues/5916\n for (let i = 0; i < handlerData.args.length; i++) {\n if (handlerData.args[i] === 'ref=Ref<') {\n handlerData.args[i + 1] = 'viewRef';\n break;\n }\n }\n const breadcrumb = {\n category: 'console',\n data: {\n arguments: handlerData.args,\n logger: 'console',\n },\n level: severityLevelFromString(handlerData.level),\n message: safeJoin(handlerData.args, ' '),\n };\n\n if (handlerData.level === 'assert') {\n if (handlerData.args[0] === false) {\n breadcrumb.message = `Assertion failed: ${safeJoin(handlerData.args.slice(1), ' ') || 'console.assert'}`;\n breadcrumb.data.arguments = handlerData.args.slice(1);\n } else {\n // Don't capture a breadcrumb for passed assertions\n return;\n }\n }\n\n getCurrentHub().addBreadcrumb(breadcrumb, {\n input: handlerData.args,\n level: handlerData.level,\n });\n}\n\n/**\n * Creates breadcrumbs from XHR API calls\n */\nfunction _xhrBreadcrumb(handlerData) {\n const { startTimestamp, endTimestamp } = handlerData;\n\n const sentryXhrData = handlerData.xhr[SENTRY_XHR_DATA_KEY];\n\n // We only capture complete, non-sentry requests\n if (!startTimestamp || !endTimestamp || !sentryXhrData) {\n return;\n }\n\n const { method, url, status_code, body } = sentryXhrData;\n\n const data = {\n method,\n url,\n status_code,\n };\n\n const hint = {\n xhr: handlerData.xhr,\n input: body,\n startTimestamp,\n endTimestamp,\n };\n\n getCurrentHub().addBreadcrumb(\n {\n category: 'xhr',\n data,\n type: 'http',\n },\n hint,\n );\n}\n\n/**\n * Creates breadcrumbs from fetch API calls\n */\nfunction _fetchBreadcrumb(handlerData) {\n const { startTimestamp, endTimestamp } = handlerData;\n\n // We only capture complete fetch requests\n if (!endTimestamp) {\n return;\n }\n\n if (handlerData.fetchData.url.match(/sentry_key/) && handlerData.fetchData.method === 'POST') {\n // We will not create breadcrumbs for fetch requests that contain `sentry_key` (internal sentry requests)\n return;\n }\n\n if (handlerData.error) {\n const data = handlerData.fetchData;\n const hint = {\n data: handlerData.error,\n input: handlerData.args,\n startTimestamp,\n endTimestamp,\n };\n\n getCurrentHub().addBreadcrumb(\n {\n category: 'fetch',\n data,\n level: 'error',\n type: 'http',\n },\n hint,\n );\n } else {\n const data = {\n ...handlerData.fetchData,\n status_code: handlerData.response && handlerData.response.status,\n };\n const hint = {\n input: handlerData.args,\n response: handlerData.response,\n startTimestamp,\n endTimestamp,\n };\n getCurrentHub().addBreadcrumb(\n {\n category: 'fetch',\n data,\n type: 'http',\n },\n hint,\n );\n }\n}\n\n/**\n * Creates breadcrumbs from history API calls\n */\nfunction _historyBreadcrumb(handlerData) {\n let from = handlerData.from;\n let to = handlerData.to;\n const parsedLoc = parseUrl(WINDOW.location.href);\n let parsedFrom = parseUrl(from);\n const parsedTo = parseUrl(to);\n\n // Initial pushState doesn't provide `from` information\n if (!parsedFrom.path) {\n parsedFrom = parsedLoc;\n }\n\n // Use only the path component of the URL if the URL matches the current\n // document (almost all the time when using pushState)\n if (parsedLoc.protocol === parsedTo.protocol && parsedLoc.host === parsedTo.host) {\n to = parsedTo.relative;\n }\n if (parsedLoc.protocol === parsedFrom.protocol && parsedLoc.host === parsedFrom.host) {\n from = parsedFrom.relative;\n }\n\n getCurrentHub().addBreadcrumb({\n category: 'navigation',\n data: {\n from,\n to,\n },\n });\n}\n\nfunction _isEvent(event) {\n return !!event && !!(event ).target;\n}\n\nexport { BREADCRUMB_INTEGRATION_ID, Breadcrumbs };\n","import { BaseClient, SDK_VERSION } from '@sentry/core';\nimport { getSDKSource, logger, createClientReportEnvelope, dsnToString } from '@sentry/utils';\nimport { eventFromException, eventFromMessage } from './eventbuilder.js';\nimport { WINDOW } from './helpers.js';\nimport { BREADCRUMB_INTEGRATION_ID } from './integrations/breadcrumbs.js';\nimport { createUserFeedbackEnvelope } from './userfeedback.js';\n\n/**\n * Configuration options for the Sentry Browser SDK.\n * @see @sentry/types Options for more information.\n */\n\n/**\n * The Sentry Browser SDK Client.\n *\n * @see BrowserOptions for documentation on configuration options.\n * @see SentryClient for usage documentation.\n */\nclass BrowserClient extends BaseClient {\n /**\n * Creates a new Browser SDK instance.\n *\n * @param options Configuration options for this SDK.\n */\n constructor(options) {\n const sdkSource = WINDOW.SENTRY_SDK_SOURCE || getSDKSource();\n\n options._metadata = options._metadata || {};\n options._metadata.sdk = options._metadata.sdk || {\n name: 'sentry.javascript.browser',\n packages: [\n {\n name: `${sdkSource}:@sentry/browser`,\n version: SDK_VERSION,\n },\n ],\n version: SDK_VERSION,\n };\n\n super(options);\n\n if (options.sendClientReports && WINDOW.document) {\n WINDOW.document.addEventListener('visibilitychange', () => {\n if (WINDOW.document.visibilityState === 'hidden') {\n this._flushOutcomes();\n }\n });\n }\n }\n\n /**\n * @inheritDoc\n */\n eventFromException(exception, hint) {\n return eventFromException(this._options.stackParser, exception, hint, this._options.attachStacktrace);\n }\n\n /**\n * @inheritDoc\n */\n eventFromMessage(\n message,\n // eslint-disable-next-line deprecation/deprecation\n level = 'info',\n hint,\n ) {\n return eventFromMessage(this._options.stackParser, message, level, hint, this._options.attachStacktrace);\n }\n\n /**\n * @inheritDoc\n */\n sendEvent(event, hint) {\n // We only want to add the sentry event breadcrumb when the user has the breadcrumb integration installed and\n // activated its `sentry` option.\n // We also do not want to use the `Breadcrumbs` class here directly, because we do not want it to be included in\n // bundles, if it is not used by the SDK.\n // This all sadly is a bit ugly, but we currently don't have a \"pre-send\" hook on the integrations so we do it this\n // way for now.\n const breadcrumbIntegration = this.getIntegrationById(BREADCRUMB_INTEGRATION_ID) ;\n // We check for definedness of `addSentryBreadcrumb` in case users provided their own integration with id\n // \"Breadcrumbs\" that does not have this function.\n if (breadcrumbIntegration && breadcrumbIntegration.addSentryBreadcrumb) {\n breadcrumbIntegration.addSentryBreadcrumb(event);\n }\n\n super.sendEvent(event, hint);\n }\n\n /**\n * Sends user feedback to Sentry.\n */\n captureUserFeedback(feedback) {\n if (!this._isEnabled()) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('SDK not enabled, will not capture user feedback.');\n return;\n }\n\n const envelope = createUserFeedbackEnvelope(feedback, {\n metadata: this.getSdkMetadata(),\n dsn: this.getDsn(),\n tunnel: this.getOptions().tunnel,\n });\n void this._sendEnvelope(envelope);\n }\n\n /**\n * @inheritDoc\n */\n _prepareEvent(event, hint, scope) {\n event.platform = event.platform || 'javascript';\n return super._prepareEvent(event, hint, scope);\n }\n\n /**\n * Sends client reports as an envelope.\n */\n _flushOutcomes() {\n const outcomes = this._clearOutcomes();\n\n if (outcomes.length === 0) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('No outcomes to send');\n return;\n }\n\n if (!this._dsn) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('No dsn provided, will not send outcomes');\n return;\n }\n\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('Sending outcomes:', outcomes);\n\n const envelope = createClientReportEnvelope(outcomes, this._options.tunnel && dsnToString(this._dsn));\n void this._sendEnvelope(envelope);\n }\n}\n\nexport { BrowserClient };\n","import { dsnToString, createEnvelope } from '@sentry/utils';\n\n/**\n * Creates an envelope from a user feedback.\n */\nfunction createUserFeedbackEnvelope(\n feedback,\n {\n metadata,\n tunnel,\n dsn,\n }\n\n,\n) {\n const headers = {\n event_id: feedback.event_id,\n sent_at: new Date().toISOString(),\n ...(metadata &&\n metadata.sdk && {\n sdk: {\n name: metadata.sdk.name,\n version: metadata.sdk.version,\n },\n }),\n ...(!!tunnel && !!dsn && { dsn: dsnToString(dsn) }),\n };\n const item = createUserFeedbackEnvelopeItem(feedback);\n\n return createEnvelope(headers, [item]);\n}\n\nfunction createUserFeedbackEnvelopeItem(feedback) {\n const feedbackHeaders = {\n type: 'user_report',\n };\n return [feedbackHeaders, feedback];\n}\n\nexport { createUserFeedbackEnvelope };\n","import { createEnvelope } from './envelope.js';\nimport { dateTimestampInSeconds } from './time.js';\n\n/**\n * Creates client report envelope\n * @param discarded_events An array of discard events\n * @param dsn A DSN that can be set on the header. Optional.\n */\nfunction createClientReportEnvelope(\n discarded_events,\n dsn,\n timestamp,\n) {\n const clientReportItem = [\n { type: 'client_report' },\n {\n timestamp: timestamp || dateTimestampInSeconds(),\n discarded_events,\n },\n ];\n return createEnvelope(dsn ? { dsn } : {}, [clientReportItem]);\n}\n\nexport { createClientReportEnvelope };\n","import { getCurrentHub } from '@sentry/core';\nimport { addInstrumentationHandler, isString, isPrimitive, isErrorEvent, getLocationHref, logger, addExceptionMechanism } from '@sentry/utils';\nimport { eventFromUnknownInput } from '../eventbuilder.js';\nimport { shouldIgnoreOnError } from '../helpers.js';\n\n/* eslint-disable @typescript-eslint/no-unsafe-member-access */\n\n/** Global handlers */\nclass GlobalHandlers {\n /**\n * @inheritDoc\n */\n static __initStatic() {this.id = 'GlobalHandlers';}\n\n /**\n * @inheritDoc\n */\n\n /** JSDoc */\n\n /**\n * Stores references functions to installing handlers. Will set to undefined\n * after they have been run so that they are not used twice.\n */\n\n /** JSDoc */\n constructor(options) {\n this.name = GlobalHandlers.id;\n this._options = {\n onerror: true,\n onunhandledrejection: true,\n ...options,\n };\n\n this._installFunc = {\n onerror: _installGlobalOnErrorHandler,\n onunhandledrejection: _installGlobalOnUnhandledRejectionHandler,\n };\n }\n /**\n * @inheritDoc\n */\n setupOnce() {\n Error.stackTraceLimit = 50;\n const options = this._options;\n\n // We can disable guard-for-in as we construct the options object above + do checks against\n // `this._installFunc` for the property.\n // eslint-disable-next-line guard-for-in\n for (const key in options) {\n const installFunc = this._installFunc[key ];\n if (installFunc && options[key ]) {\n globalHandlerLog(key);\n installFunc();\n this._installFunc[key ] = undefined;\n }\n }\n }\n} GlobalHandlers.__initStatic();\n\n/** JSDoc */\nfunction _installGlobalOnErrorHandler() {\n addInstrumentationHandler(\n 'error',\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n (data) => {\n const [hub, stackParser, attachStacktrace] = getHubAndOptions();\n if (!hub.getIntegration(GlobalHandlers)) {\n return;\n }\n const { msg, url, line, column, error } = data;\n if (shouldIgnoreOnError() || (error && error.__sentry_own_request__)) {\n return;\n }\n\n const event =\n error === undefined && isString(msg)\n ? _eventFromIncompleteOnError(msg, url, line, column)\n : _enhanceEventWithInitialFrame(\n eventFromUnknownInput(stackParser, error || msg, undefined, attachStacktrace, false),\n url,\n line,\n column,\n );\n\n event.level = 'error';\n\n addMechanismAndCapture(hub, error, event, 'onerror');\n },\n );\n}\n\n/** JSDoc */\nfunction _installGlobalOnUnhandledRejectionHandler() {\n addInstrumentationHandler(\n 'unhandledrejection',\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n (e) => {\n const [hub, stackParser, attachStacktrace] = getHubAndOptions();\n if (!hub.getIntegration(GlobalHandlers)) {\n return;\n }\n let error = e;\n\n // dig the object of the rejection out of known event types\n try {\n // PromiseRejectionEvents store the object of the rejection under 'reason'\n // see https://developer.mozilla.org/en-US/docs/Web/API/PromiseRejectionEvent\n if ('reason' in e) {\n error = e.reason;\n }\n // something, somewhere, (likely a browser extension) effectively casts PromiseRejectionEvents\n // to CustomEvents, moving the `promise` and `reason` attributes of the PRE into\n // the CustomEvent's `detail` attribute, since they're not part of CustomEvent's spec\n // see https://developer.mozilla.org/en-US/docs/Web/API/CustomEvent and\n // https://github.com/getsentry/sentry-javascript/issues/2380\n else if ('detail' in e && 'reason' in e.detail) {\n error = e.detail.reason;\n }\n } catch (_oO) {\n // no-empty\n }\n\n if (shouldIgnoreOnError() || (error && error.__sentry_own_request__)) {\n return true;\n }\n\n const event = isPrimitive(error)\n ? _eventFromRejectionWithPrimitive(error)\n : eventFromUnknownInput(stackParser, error, undefined, attachStacktrace, true);\n\n event.level = 'error';\n\n addMechanismAndCapture(hub, error, event, 'onunhandledrejection');\n return;\n },\n );\n}\n\n/**\n * Create an event from a promise rejection where the `reason` is a primitive.\n *\n * @param reason: The `reason` property of the promise rejection\n * @returns An Event object with an appropriate `exception` value\n */\nfunction _eventFromRejectionWithPrimitive(reason) {\n return {\n exception: {\n values: [\n {\n type: 'UnhandledRejection',\n // String() is needed because the Primitive type includes symbols (which can't be automatically stringified)\n value: `Non-Error promise rejection captured with value: ${String(reason)}`,\n },\n ],\n },\n };\n}\n\n/**\n * This function creates a stack from an old, error-less onerror handler.\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction _eventFromIncompleteOnError(msg, url, line, column) {\n const ERROR_TYPES_RE =\n /^(?:[Uu]ncaught (?:exception: )?)?(?:((?:Eval|Internal|Range|Reference|Syntax|Type|URI|)Error): )?(.*)$/i;\n\n // If 'message' is ErrorEvent, get real message from inside\n let message = isErrorEvent(msg) ? msg.message : msg;\n let name = 'Error';\n\n const groups = message.match(ERROR_TYPES_RE);\n if (groups) {\n name = groups[1];\n message = groups[2];\n }\n\n const event = {\n exception: {\n values: [\n {\n type: name,\n value: message,\n },\n ],\n },\n };\n\n return _enhanceEventWithInitialFrame(event, url, line, column);\n}\n\n/** JSDoc */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction _enhanceEventWithInitialFrame(event, url, line, column) {\n // event.exception\n const e = (event.exception = event.exception || {});\n // event.exception.values\n const ev = (e.values = e.values || []);\n // event.exception.values[0]\n const ev0 = (ev[0] = ev[0] || {});\n // event.exception.values[0].stacktrace\n const ev0s = (ev0.stacktrace = ev0.stacktrace || {});\n // event.exception.values[0].stacktrace.frames\n const ev0sf = (ev0s.frames = ev0s.frames || []);\n\n const colno = isNaN(parseInt(column, 10)) ? undefined : column;\n const lineno = isNaN(parseInt(line, 10)) ? undefined : line;\n const filename = isString(url) && url.length > 0 ? url : getLocationHref();\n\n // event.exception.values[0].stacktrace.frames\n if (ev0sf.length === 0) {\n ev0sf.push({\n colno,\n filename,\n function: '?',\n in_app: true,\n lineno,\n });\n }\n\n return event;\n}\n\nfunction globalHandlerLog(type) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`Global Handler attached: ${type}`);\n}\n\nfunction addMechanismAndCapture(hub, error, event, type) {\n addExceptionMechanism(event, {\n handled: false,\n type,\n });\n hub.captureEvent(event, {\n originalException: error,\n });\n}\n\nfunction getHubAndOptions() {\n const hub = getCurrentHub();\n const client = hub.getClient();\n const options = (client && client.getOptions()) || {\n stackParser: () => [],\n attachStacktrace: false,\n };\n return [hub, options.stackParser, options.attachStacktrace];\n}\n\nexport { GlobalHandlers };\n","import { fill, getFunctionName, getOriginalFunction } from '@sentry/utils';\nimport { WINDOW, wrap } from '../helpers.js';\n\nconst DEFAULT_EVENT_TARGET = [\n 'EventTarget',\n 'Window',\n 'Node',\n 'ApplicationCache',\n 'AudioTrackList',\n 'ChannelMergerNode',\n 'CryptoOperation',\n 'EventSource',\n 'FileReader',\n 'HTMLUnknownElement',\n 'IDBDatabase',\n 'IDBRequest',\n 'IDBTransaction',\n 'KeyOperation',\n 'MediaController',\n 'MessagePort',\n 'ModalWindow',\n 'Notification',\n 'SVGElementInstance',\n 'Screen',\n 'TextTrack',\n 'TextTrackCue',\n 'TextTrackList',\n 'WebSocket',\n 'WebSocketWorker',\n 'Worker',\n 'XMLHttpRequest',\n 'XMLHttpRequestEventTarget',\n 'XMLHttpRequestUpload',\n];\n\n/** Wrap timer functions and event targets to catch errors and provide better meta data */\nclass TryCatch {\n /**\n * @inheritDoc\n */\n static __initStatic() {this.id = 'TryCatch';}\n\n /**\n * @inheritDoc\n */\n\n /** JSDoc */\n\n /**\n * @inheritDoc\n */\n constructor(options) {\n this.name = TryCatch.id;\n this._options = {\n XMLHttpRequest: true,\n eventTarget: true,\n requestAnimationFrame: true,\n setInterval: true,\n setTimeout: true,\n ...options,\n };\n }\n\n /**\n * Wrap timer functions and event targets to catch errors\n * and provide better metadata.\n */\n setupOnce() {\n if (this._options.setTimeout) {\n fill(WINDOW, 'setTimeout', _wrapTimeFunction);\n }\n\n if (this._options.setInterval) {\n fill(WINDOW, 'setInterval', _wrapTimeFunction);\n }\n\n if (this._options.requestAnimationFrame) {\n fill(WINDOW, 'requestAnimationFrame', _wrapRAF);\n }\n\n if (this._options.XMLHttpRequest && 'XMLHttpRequest' in WINDOW) {\n fill(XMLHttpRequest.prototype, 'send', _wrapXHR);\n }\n\n const eventTargetOption = this._options.eventTarget;\n if (eventTargetOption) {\n const eventTarget = Array.isArray(eventTargetOption) ? eventTargetOption : DEFAULT_EVENT_TARGET;\n eventTarget.forEach(_wrapEventTarget);\n }\n }\n} TryCatch.__initStatic();\n\n/** JSDoc */\nfunction _wrapTimeFunction(original) {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n return function ( ...args) {\n const originalCallback = args[0];\n args[0] = wrap(originalCallback, {\n mechanism: {\n data: { function: getFunctionName(original) },\n handled: true,\n type: 'instrument',\n },\n });\n return original.apply(this, args);\n };\n}\n\n/** JSDoc */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction _wrapRAF(original) {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n return function ( callback) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return original.apply(this, [\n wrap(callback, {\n mechanism: {\n data: {\n function: 'requestAnimationFrame',\n handler: getFunctionName(original),\n },\n handled: true,\n type: 'instrument',\n },\n }),\n ]);\n };\n}\n\n/** JSDoc */\nfunction _wrapXHR(originalSend) {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n return function ( ...args) {\n // eslint-disable-next-line @typescript-eslint/no-this-alias\n const xhr = this;\n const xmlHttpRequestProps = ['onload', 'onerror', 'onprogress', 'onreadystatechange'];\n\n xmlHttpRequestProps.forEach(prop => {\n if (prop in xhr && typeof xhr[prop] === 'function') {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n fill(xhr, prop, function (original) {\n const wrapOptions = {\n mechanism: {\n data: {\n function: prop,\n handler: getFunctionName(original),\n },\n handled: true,\n type: 'instrument',\n },\n };\n\n // If Instrument integration has been called before TryCatch, get the name of original function\n const originalFunction = getOriginalFunction(original);\n if (originalFunction) {\n wrapOptions.mechanism.data.handler = getFunctionName(originalFunction);\n }\n\n // Otherwise wrap directly\n return wrap(original, wrapOptions);\n });\n }\n });\n\n return originalSend.apply(this, args);\n };\n}\n\n/** JSDoc */\nfunction _wrapEventTarget(target) {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const globalObject = WINDOW ;\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n const proto = globalObject[target] && globalObject[target].prototype;\n\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access, no-prototype-builtins\n if (!proto || !proto.hasOwnProperty || !proto.hasOwnProperty('addEventListener')) {\n return;\n }\n\n fill(proto, 'addEventListener', function (original)\n\n {\n return function (\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n\n eventName,\n fn,\n options,\n ) {\n try {\n if (typeof fn.handleEvent === 'function') {\n // ESlint disable explanation:\n // First, it is generally safe to call `wrap` with an unbound function. Furthermore, using `.bind()` would\n // introduce a bug here, because bind returns a new function that doesn't have our\n // flags(like __sentry_original__) attached. `wrap` checks for those flags to avoid unnecessary wrapping.\n // Without those flags, every call to addEventListener wraps the function again, causing a memory leak.\n // eslint-disable-next-line @typescript-eslint/unbound-method\n fn.handleEvent = wrap(fn.handleEvent, {\n mechanism: {\n data: {\n function: 'handleEvent',\n handler: getFunctionName(fn),\n target,\n },\n handled: true,\n type: 'instrument',\n },\n });\n }\n } catch (err) {\n // can sometimes get 'Permission denied to access property \"handle Event'\n }\n\n return original.apply(this, [\n eventName,\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n wrap(fn , {\n mechanism: {\n data: {\n function: 'addEventListener',\n handler: getFunctionName(fn),\n target,\n },\n handled: true,\n type: 'instrument',\n },\n }),\n options,\n ]);\n };\n });\n\n fill(\n proto,\n 'removeEventListener',\n function (\n originalRemoveEventListener,\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n ) {\n return function (\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n\n eventName,\n fn,\n options,\n ) {\n /**\n * There are 2 possible scenarios here:\n *\n * 1. Someone passes a callback, which was attached prior to Sentry initialization, or by using unmodified\n * method, eg. `document.addEventListener.call(el, name, handler). In this case, we treat this function\n * as a pass-through, and call original `removeEventListener` with it.\n *\n * 2. Someone passes a callback, which was attached after Sentry was initialized, which means that it was using\n * our wrapped version of `addEventListener`, which internally calls `wrap` helper.\n * This helper \"wraps\" whole callback inside a try/catch statement, and attached appropriate metadata to it,\n * in order for us to make a distinction between wrapped/non-wrapped functions possible.\n * If a function was wrapped, it has additional property of `__sentry_wrapped__`, holding the handler.\n *\n * When someone adds a handler prior to initialization, and then do it again, but after,\n * then we have to detach both of them. Otherwise, if we'd detach only wrapped one, it'd be impossible\n * to get rid of the initial handler and it'd stick there forever.\n */\n const wrappedEventHandler = fn ;\n try {\n const originalEventHandler = wrappedEventHandler && wrappedEventHandler.__sentry_wrapped__;\n if (originalEventHandler) {\n originalRemoveEventListener.call(this, eventName, originalEventHandler, options);\n }\n } catch (e) {\n // ignore, accessing __sentry_wrapped__ will throw in some Selenium environments\n }\n return originalRemoveEventListener.call(this, eventName, wrappedEventHandler, options);\n };\n },\n );\n}\n\nexport { TryCatch };\n","import { isInstanceOf } from './is.js';\nimport { truncate } from './string.js';\n\n/**\n * Creates exceptions inside `event.exception.values` for errors that are nested on properties based on the `key` parameter.\n */\nfunction applyAggregateErrorsToEvent(\n exceptionFromErrorImplementation,\n parser,\n maxValueLimit = 250,\n key,\n limit,\n event,\n hint,\n) {\n if (!event.exception || !event.exception.values || !hint || !isInstanceOf(hint.originalException, Error)) {\n return;\n }\n\n // Generally speaking the last item in `event.exception.values` is the exception originating from the original Error\n const originalException =\n event.exception.values.length > 0 ? event.exception.values[event.exception.values.length - 1] : undefined;\n\n // We only create exception grouping if there is an exception in the event.\n if (originalException) {\n event.exception.values = truncateAggregateExceptions(\n aggregateExceptionsFromError(\n exceptionFromErrorImplementation,\n parser,\n limit,\n hint.originalException ,\n key,\n event.exception.values,\n originalException,\n 0,\n ),\n maxValueLimit,\n );\n }\n}\n\nfunction aggregateExceptionsFromError(\n exceptionFromErrorImplementation,\n parser,\n limit,\n error,\n key,\n prevExceptions,\n exception,\n exceptionId,\n) {\n if (prevExceptions.length >= limit + 1) {\n return prevExceptions;\n }\n\n let newExceptions = [...prevExceptions];\n\n if (isInstanceOf(error[key], Error)) {\n applyExceptionGroupFieldsForParentException(exception, exceptionId);\n const newException = exceptionFromErrorImplementation(parser, error[key]);\n const newExceptionId = newExceptions.length;\n applyExceptionGroupFieldsForChildException(newException, key, newExceptionId, exceptionId);\n newExceptions = aggregateExceptionsFromError(\n exceptionFromErrorImplementation,\n parser,\n limit,\n error[key],\n key,\n [newException, ...newExceptions],\n newException,\n newExceptionId,\n );\n }\n\n // This will create exception grouping for AggregateErrors\n // https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/AggregateError\n if (Array.isArray(error.errors)) {\n error.errors.forEach((childError, i) => {\n if (isInstanceOf(childError, Error)) {\n applyExceptionGroupFieldsForParentException(exception, exceptionId);\n const newException = exceptionFromErrorImplementation(parser, childError);\n const newExceptionId = newExceptions.length;\n applyExceptionGroupFieldsForChildException(newException, `errors[${i}]`, newExceptionId, exceptionId);\n newExceptions = aggregateExceptionsFromError(\n exceptionFromErrorImplementation,\n parser,\n limit,\n childError,\n key,\n [newException, ...newExceptions],\n newException,\n newExceptionId,\n );\n }\n });\n }\n\n return newExceptions;\n}\n\nfunction applyExceptionGroupFieldsForParentException(exception, exceptionId) {\n // Don't know if this default makes sense. The protocol requires us to set these values so we pick *some* default.\n exception.mechanism = exception.mechanism || { type: 'generic', handled: true };\n\n exception.mechanism = {\n ...exception.mechanism,\n is_exception_group: true,\n exception_id: exceptionId,\n };\n}\n\nfunction applyExceptionGroupFieldsForChildException(\n exception,\n source,\n exceptionId,\n parentId,\n) {\n // Don't know if this default makes sense. The protocol requires us to set these values so we pick *some* default.\n exception.mechanism = exception.mechanism || { type: 'generic', handled: true };\n\n exception.mechanism = {\n ...exception.mechanism,\n type: 'chained',\n source,\n exception_id: exceptionId,\n parent_id: parentId,\n };\n}\n\n/**\n * Truncate the message (exception.value) of all exceptions in the event.\n * Because this event processor is ran after `applyClientOptions`,\n * we need to truncate the message of the added exceptions here.\n */\nfunction truncateAggregateExceptions(exceptions, maxValueLength) {\n return exceptions.map(exception => {\n if (exception.value) {\n exception.value = truncate(exception.value, maxValueLength);\n }\n return exception;\n });\n}\n\nexport { applyAggregateErrorsToEvent };\n","import { applyAggregateErrorsToEvent } from '@sentry/utils';\nimport { exceptionFromError } from '../eventbuilder.js';\n\nconst DEFAULT_KEY = 'cause';\nconst DEFAULT_LIMIT = 5;\n\n/** Adds SDK info to an event. */\nclass LinkedErrors {\n /**\n * @inheritDoc\n */\n static __initStatic() {this.id = 'LinkedErrors';}\n\n /**\n * @inheritDoc\n */\n\n /**\n * @inheritDoc\n */\n\n /**\n * @inheritDoc\n */\n\n /**\n * @inheritDoc\n */\n constructor(options = {}) {\n this.name = LinkedErrors.id;\n this._key = options.key || DEFAULT_KEY;\n this._limit = options.limit || DEFAULT_LIMIT;\n }\n\n /**\n * @inheritDoc\n */\n setupOnce(addGlobalEventProcessor, getCurrentHub) {\n addGlobalEventProcessor((event, hint) => {\n const hub = getCurrentHub();\n const client = hub.getClient();\n const self = hub.getIntegration(LinkedErrors);\n\n if (!client || !self) {\n return event;\n }\n\n const options = client.getOptions();\n applyAggregateErrorsToEvent(\n exceptionFromError,\n options.stackParser,\n options.maxValueLength,\n self._key,\n self._limit,\n event,\n hint,\n );\n\n return event;\n });\n }\n} LinkedErrors.__initStatic();\n\nexport { LinkedErrors };\n","import { addGlobalEventProcessor, getCurrentHub } from '@sentry/core';\nimport { WINDOW } from '../helpers.js';\n\n/** HttpContext integration collects information about HTTP request headers */\nclass HttpContext {\n /**\n * @inheritDoc\n */\n static __initStatic() {this.id = 'HttpContext';}\n\n /**\n * @inheritDoc\n */\n\n constructor() {\n this.name = HttpContext.id;\n }\n\n /**\n * @inheritDoc\n */\n setupOnce() {\n addGlobalEventProcessor((event) => {\n if (getCurrentHub().getIntegration(HttpContext)) {\n // if none of the information we want exists, don't bother\n if (!WINDOW.navigator && !WINDOW.location && !WINDOW.document) {\n return event;\n }\n\n // grab as much info as exists and add it to the event\n const url = (event.request && event.request.url) || (WINDOW.location && WINDOW.location.href);\n const { referrer } = WINDOW.document || {};\n const { userAgent } = WINDOW.navigator || {};\n\n const headers = {\n ...(event.request && event.request.headers),\n ...(referrer && { Referer: referrer }),\n ...(userAgent && { 'User-Agent': userAgent }),\n };\n const request = { ...event.request, ...(url && { url }), headers };\n\n return { ...event, request };\n }\n return event;\n });\n }\n} HttpContext.__initStatic();\n\nexport { HttpContext };\n","import { logger } from '@sentry/utils';\n\n/** Deduplication filter */\nclass Dedupe {\n /**\n * @inheritDoc\n */\n static __initStatic() {this.id = 'Dedupe';}\n\n /**\n * @inheritDoc\n */\n\n /**\n * @inheritDoc\n */\n\n constructor() {\n this.name = Dedupe.id;\n }\n\n /**\n * @inheritDoc\n */\n setupOnce(addGlobalEventProcessor, getCurrentHub) {\n const eventProcessor = currentEvent => {\n // We want to ignore any non-error type events, e.g. transactions or replays\n // These should never be deduped, and also not be compared against as _previousEvent.\n if (currentEvent.type) {\n return currentEvent;\n }\n\n const self = getCurrentHub().getIntegration(Dedupe);\n if (self) {\n // Juuust in case something goes wrong\n try {\n if (_shouldDropEvent(currentEvent, self._previousEvent)) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Event dropped due to being a duplicate of previously captured event.');\n return null;\n }\n } catch (_oO) {\n return (self._previousEvent = currentEvent);\n }\n\n return (self._previousEvent = currentEvent);\n }\n return currentEvent;\n };\n\n eventProcessor.id = this.name;\n addGlobalEventProcessor(eventProcessor);\n }\n} Dedupe.__initStatic();\n\n/** JSDoc */\nfunction _shouldDropEvent(currentEvent, previousEvent) {\n if (!previousEvent) {\n return false;\n }\n\n if (_isSameMessageEvent(currentEvent, previousEvent)) {\n return true;\n }\n\n if (_isSameExceptionEvent(currentEvent, previousEvent)) {\n return true;\n }\n\n return false;\n}\n\n/** JSDoc */\nfunction _isSameMessageEvent(currentEvent, previousEvent) {\n const currentMessage = currentEvent.message;\n const previousMessage = previousEvent.message;\n\n // If neither event has a message property, they were both exceptions, so bail out\n if (!currentMessage && !previousMessage) {\n return false;\n }\n\n // If only one event has a stacktrace, but not the other one, they are not the same\n if ((currentMessage && !previousMessage) || (!currentMessage && previousMessage)) {\n return false;\n }\n\n if (currentMessage !== previousMessage) {\n return false;\n }\n\n if (!_isSameFingerprint(currentEvent, previousEvent)) {\n return false;\n }\n\n if (!_isSameStacktrace(currentEvent, previousEvent)) {\n return false;\n }\n\n return true;\n}\n\n/** JSDoc */\nfunction _isSameExceptionEvent(currentEvent, previousEvent) {\n const previousException = _getExceptionFromEvent(previousEvent);\n const currentException = _getExceptionFromEvent(currentEvent);\n\n if (!previousException || !currentException) {\n return false;\n }\n\n if (previousException.type !== currentException.type || previousException.value !== currentException.value) {\n return false;\n }\n\n if (!_isSameFingerprint(currentEvent, previousEvent)) {\n return false;\n }\n\n if (!_isSameStacktrace(currentEvent, previousEvent)) {\n return false;\n }\n\n return true;\n}\n\n/** JSDoc */\nfunction _isSameStacktrace(currentEvent, previousEvent) {\n let currentFrames = _getFramesFromEvent(currentEvent);\n let previousFrames = _getFramesFromEvent(previousEvent);\n\n // If neither event has a stacktrace, they are assumed to be the same\n if (!currentFrames && !previousFrames) {\n return true;\n }\n\n // If only one event has a stacktrace, but not the other one, they are not the same\n if ((currentFrames && !previousFrames) || (!currentFrames && previousFrames)) {\n return false;\n }\n\n currentFrames = currentFrames ;\n previousFrames = previousFrames ;\n\n // If number of frames differ, they are not the same\n if (previousFrames.length !== currentFrames.length) {\n return false;\n }\n\n // Otherwise, compare the two\n for (let i = 0; i < previousFrames.length; i++) {\n const frameA = previousFrames[i];\n const frameB = currentFrames[i];\n\n if (\n frameA.filename !== frameB.filename ||\n frameA.lineno !== frameB.lineno ||\n frameA.colno !== frameB.colno ||\n frameA.function !== frameB.function\n ) {\n return false;\n }\n }\n\n return true;\n}\n\n/** JSDoc */\nfunction _isSameFingerprint(currentEvent, previousEvent) {\n let currentFingerprint = currentEvent.fingerprint;\n let previousFingerprint = previousEvent.fingerprint;\n\n // If neither event has a fingerprint, they are assumed to be the same\n if (!currentFingerprint && !previousFingerprint) {\n return true;\n }\n\n // If only one event has a fingerprint, but not the other one, they are not the same\n if ((currentFingerprint && !previousFingerprint) || (!currentFingerprint && previousFingerprint)) {\n return false;\n }\n\n currentFingerprint = currentFingerprint ;\n previousFingerprint = previousFingerprint ;\n\n // Otherwise, compare the two\n try {\n return !!(currentFingerprint.join('') === previousFingerprint.join(''));\n } catch (_oO) {\n return false;\n }\n}\n\n/** JSDoc */\nfunction _getExceptionFromEvent(event) {\n return event.exception && event.exception.values && event.exception.values[0];\n}\n\n/** JSDoc */\nfunction _getFramesFromEvent(event) {\n const exception = event.exception;\n\n if (exception) {\n try {\n // @ts-ignore Object could be undefined\n return exception.values[0].stacktrace.frames;\n } catch (_oO) {\n return undefined;\n }\n }\n return undefined;\n}\n\nexport { Dedupe };\n","import { createStackParser } from '@sentry/utils';\n\n// global reference to slice\nconst UNKNOWN_FUNCTION = '?';\n\nconst OPERA10_PRIORITY = 10;\nconst OPERA11_PRIORITY = 20;\nconst CHROME_PRIORITY = 30;\nconst WINJS_PRIORITY = 40;\nconst GECKO_PRIORITY = 50;\n\nfunction createFrame(filename, func, lineno, colno) {\n const frame = {\n filename,\n function: func,\n in_app: true, // All browser frames are considered in_app\n };\n\n if (lineno !== undefined) {\n frame.lineno = lineno;\n }\n\n if (colno !== undefined) {\n frame.colno = colno;\n }\n\n return frame;\n}\n\n// Chromium based browsers: Chrome, Brave, new Opera, new Edge\nconst chromeRegex =\n /^\\s*at (?:(.+?\\)(?: \\[.+\\])?|.*?) ?\\((?:address at )?)?(?:async )?((?:|[-a-z]+:|.*bundle|\\/)?.*?)(?::(\\d+))?(?::(\\d+))?\\)?\\s*$/i;\nconst chromeEvalRegex = /\\((\\S*)(?::(\\d+))(?::(\\d+))\\)/;\n\nconst chrome = line => {\n const parts = chromeRegex.exec(line);\n\n if (parts) {\n const isEval = parts[2] && parts[2].indexOf('eval') === 0; // start of line\n\n if (isEval) {\n const subMatch = chromeEvalRegex.exec(parts[2]);\n\n if (subMatch) {\n // throw out eval line/column and use top-most line/column number\n parts[2] = subMatch[1]; // url\n parts[3] = subMatch[2]; // line\n parts[4] = subMatch[3]; // column\n }\n }\n\n // Kamil: One more hack won't hurt us right? Understanding and adding more rules on top of these regexps right now\n // would be way too time consuming. (TODO: Rewrite whole RegExp to be more readable)\n const [func, filename] = extractSafariExtensionDetails(parts[1] || UNKNOWN_FUNCTION, parts[2]);\n\n return createFrame(filename, func, parts[3] ? +parts[3] : undefined, parts[4] ? +parts[4] : undefined);\n }\n\n return;\n};\n\nconst chromeStackLineParser = [CHROME_PRIORITY, chrome];\n\n// gecko regex: `(?:bundle|\\d+\\.js)`: `bundle` is for react native, `\\d+\\.js` also but specifically for ram bundles because it\n// generates filenames without a prefix like `file://` the filenames in the stacktrace are just 42.js\n// We need this specific case for now because we want no other regex to match.\nconst geckoREgex =\n /^\\s*(.*?)(?:\\((.*?)\\))?(?:^|@)?((?:[-a-z]+)?:\\/.*?|\\[native code\\]|[^@]*(?:bundle|\\d+\\.js)|\\/[\\w\\-. /=]+)(?::(\\d+))?(?::(\\d+))?\\s*$/i;\nconst geckoEvalRegex = /(\\S+) line (\\d+)(?: > eval line \\d+)* > eval/i;\n\nconst gecko = line => {\n const parts = geckoREgex.exec(line);\n\n if (parts) {\n const isEval = parts[3] && parts[3].indexOf(' > eval') > -1;\n if (isEval) {\n const subMatch = geckoEvalRegex.exec(parts[3]);\n\n if (subMatch) {\n // throw out eval line/column and use top-most line number\n parts[1] = parts[1] || 'eval';\n parts[3] = subMatch[1];\n parts[4] = subMatch[2];\n parts[5] = ''; // no column when eval\n }\n }\n\n let filename = parts[3];\n let func = parts[1] || UNKNOWN_FUNCTION;\n [func, filename] = extractSafariExtensionDetails(func, filename);\n\n return createFrame(filename, func, parts[4] ? +parts[4] : undefined, parts[5] ? +parts[5] : undefined);\n }\n\n return;\n};\n\nconst geckoStackLineParser = [GECKO_PRIORITY, gecko];\n\nconst winjsRegex = /^\\s*at (?:((?:\\[object object\\])?.+) )?\\(?((?:[-a-z]+):.*?):(\\d+)(?::(\\d+))?\\)?\\s*$/i;\n\nconst winjs = line => {\n const parts = winjsRegex.exec(line);\n\n return parts\n ? createFrame(parts[2], parts[1] || UNKNOWN_FUNCTION, +parts[3], parts[4] ? +parts[4] : undefined)\n : undefined;\n};\n\nconst winjsStackLineParser = [WINJS_PRIORITY, winjs];\n\nconst opera10Regex = / line (\\d+).*script (?:in )?(\\S+)(?:: in function (\\S+))?$/i;\n\nconst opera10 = line => {\n const parts = opera10Regex.exec(line);\n return parts ? createFrame(parts[2], parts[3] || UNKNOWN_FUNCTION, +parts[1]) : undefined;\n};\n\nconst opera10StackLineParser = [OPERA10_PRIORITY, opera10];\n\nconst opera11Regex =\n / line (\\d+), column (\\d+)\\s*(?:in (?:]+)>|([^)]+))\\(.*\\))? in (.*):\\s*$/i;\n\nconst opera11 = line => {\n const parts = opera11Regex.exec(line);\n return parts ? createFrame(parts[5], parts[3] || parts[4] || UNKNOWN_FUNCTION, +parts[1], +parts[2]) : undefined;\n};\n\nconst opera11StackLineParser = [OPERA11_PRIORITY, opera11];\n\nconst defaultStackLineParsers = [chromeStackLineParser, geckoStackLineParser, winjsStackLineParser];\n\nconst defaultStackParser = createStackParser(...defaultStackLineParsers);\n\n/**\n * Safari web extensions, starting version unknown, can produce \"frames-only\" stacktraces.\n * What it means, is that instead of format like:\n *\n * Error: wat\n * at function@url:row:col\n * at function@url:row:col\n * at function@url:row:col\n *\n * it produces something like:\n *\n * function@url:row:col\n * function@url:row:col\n * function@url:row:col\n *\n * Because of that, it won't be captured by `chrome` RegExp and will fall into `Gecko` branch.\n * This function is extracted so that we can use it in both places without duplicating the logic.\n * Unfortunately \"just\" changing RegExp is too complicated now and making it pass all tests\n * and fix this case seems like an impossible, or at least way too time-consuming task.\n */\nconst extractSafariExtensionDetails = (func, filename) => {\n const isSafariExtension = func.indexOf('safari-extension') !== -1;\n const isSafariWebExtension = func.indexOf('safari-web-extension') !== -1;\n\n return isSafariExtension || isSafariWebExtension\n ? [\n func.indexOf('@') !== -1 ? func.split('@')[0] : UNKNOWN_FUNCTION,\n isSafariExtension ? `safari-extension:${filename}` : `safari-web-extension:${filename}`,\n ]\n : [func, filename];\n};\n\nexport { chromeStackLineParser, defaultStackLineParsers, defaultStackParser, geckoStackLineParser, opera10StackLineParser, opera11StackLineParser, winjsStackLineParser };\n","// Intentionally keeping the key broad, as we don't know for sure what rate limit headers get returned from backend\n\nconst DEFAULT_RETRY_AFTER = 60 * 1000; // 60 seconds\n\n/**\n * Extracts Retry-After value from the request header or returns default value\n * @param header string representation of 'Retry-After' header\n * @param now current unix timestamp\n *\n */\nfunction parseRetryAfterHeader(header, now = Date.now()) {\n const headerDelay = parseInt(`${header}`, 10);\n if (!isNaN(headerDelay)) {\n return headerDelay * 1000;\n }\n\n const headerDate = Date.parse(`${header}`);\n if (!isNaN(headerDate)) {\n return headerDate - now;\n }\n\n return DEFAULT_RETRY_AFTER;\n}\n\n/**\n * Gets the time that the given category is disabled until for rate limiting.\n * In case no category-specific limit is set but a general rate limit across all categories is active,\n * that time is returned.\n *\n * @return the time in ms that the category is disabled until or 0 if there's no active rate limit.\n */\nfunction disabledUntil(limits, category) {\n return limits[category] || limits.all || 0;\n}\n\n/**\n * Checks if a category is rate limited\n */\nfunction isRateLimited(limits, category, now = Date.now()) {\n return disabledUntil(limits, category) > now;\n}\n\n/**\n * Update ratelimits from incoming headers.\n *\n * @return the updated RateLimits object.\n */\nfunction updateRateLimits(\n limits,\n { statusCode, headers },\n now = Date.now(),\n) {\n const updatedRateLimits = {\n ...limits,\n };\n\n // \"The name is case-insensitive.\"\n // https://developer.mozilla.org/en-US/docs/Web/API/Headers/get\n const rateLimitHeader = headers && headers['x-sentry-rate-limits'];\n const retryAfterHeader = headers && headers['retry-after'];\n\n if (rateLimitHeader) {\n /**\n * rate limit headers are of the form\n *
,
,..\n * where each
is of the form\n * : : : \n * where\n * is a delay in seconds\n * is the event type(s) (error, transaction, etc) being rate limited and is of the form\n * ;;...\n * is what's being limited (org, project, or key) - ignored by SDK\n * is an arbitrary string like \"org_quota\" - ignored by SDK\n */\n for (const limit of rateLimitHeader.trim().split(',')) {\n const [retryAfter, categories] = limit.split(':', 2);\n const headerDelay = parseInt(retryAfter, 10);\n const delay = (!isNaN(headerDelay) ? headerDelay : 60) * 1000; // 60sec default\n if (!categories) {\n updatedRateLimits.all = now + delay;\n } else {\n for (const category of categories.split(';')) {\n updatedRateLimits[category] = now + delay;\n }\n }\n }\n } else if (retryAfterHeader) {\n updatedRateLimits.all = now + parseRetryAfterHeader(retryAfterHeader, now);\n } else if (statusCode === 429) {\n updatedRateLimits.all = now + 60 * 1000;\n }\n\n return updatedRateLimits;\n}\n\nexport { DEFAULT_RETRY_AFTER, disabledUntil, isRateLimited, parseRetryAfterHeader, updateRateLimits };\n","import { makePromiseBuffer, forEachEnvelopeItem, envelopeItemTypeToDataCategory, isRateLimited, resolvedSyncPromise, createEnvelope, SentryError, logger, serializeEnvelope, updateRateLimits } from '@sentry/utils';\n\nconst DEFAULT_TRANSPORT_BUFFER_SIZE = 30;\n\n/**\n * Creates an instance of a Sentry `Transport`\n *\n * @param options\n * @param makeRequest\n */\nfunction createTransport(\n options,\n makeRequest,\n buffer = makePromiseBuffer(\n options.bufferSize || DEFAULT_TRANSPORT_BUFFER_SIZE,\n ),\n) {\n let rateLimits = {};\n const flush = (timeout) => buffer.drain(timeout);\n\n function send(envelope) {\n const filteredEnvelopeItems = [];\n\n // Drop rate limited items from envelope\n forEachEnvelopeItem(envelope, (item, type) => {\n const envelopeItemDataCategory = envelopeItemTypeToDataCategory(type);\n if (isRateLimited(rateLimits, envelopeItemDataCategory)) {\n const event = getEventForEnvelopeItem(item, type);\n options.recordDroppedEvent('ratelimit_backoff', envelopeItemDataCategory, event);\n } else {\n filteredEnvelopeItems.push(item);\n }\n });\n\n // Skip sending if envelope is empty after filtering out rate limited events\n if (filteredEnvelopeItems.length === 0) {\n return resolvedSyncPromise();\n }\n\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n const filteredEnvelope = createEnvelope(envelope[0], filteredEnvelopeItems );\n\n // Creates client report for each item in an envelope\n const recordEnvelopeLoss = (reason) => {\n forEachEnvelopeItem(filteredEnvelope, (item, type) => {\n const event = getEventForEnvelopeItem(item, type);\n options.recordDroppedEvent(reason, envelopeItemTypeToDataCategory(type), event);\n });\n };\n\n const requestTask = () =>\n makeRequest({ body: serializeEnvelope(filteredEnvelope, options.textEncoder) }).then(\n response => {\n // We don't want to throw on NOK responses, but we want to at least log them\n if (response.statusCode !== undefined && (response.statusCode < 200 || response.statusCode >= 300)) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn(`Sentry responded with status code ${response.statusCode} to sent event.`);\n }\n\n rateLimits = updateRateLimits(rateLimits, response);\n return response;\n },\n error => {\n recordEnvelopeLoss('network_error');\n throw error;\n },\n );\n\n return buffer.add(requestTask).then(\n result => result,\n error => {\n if (error instanceof SentryError) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Skipped sending event because buffer is full.');\n recordEnvelopeLoss('queue_overflow');\n return resolvedSyncPromise();\n } else {\n throw error;\n }\n },\n );\n }\n\n // We use this to identifify if the transport is the base transport\n // TODO (v8): Remove this again as we'll no longer need it\n send.__sentry__baseTransport__ = true;\n\n return {\n send,\n flush,\n };\n}\n\nfunction getEventForEnvelopeItem(item, type) {\n if (type !== 'event' && type !== 'transaction') {\n return undefined;\n }\n\n return Array.isArray(item) ? (item )[1] : undefined;\n}\n\nexport { DEFAULT_TRANSPORT_BUFFER_SIZE, createTransport };\n","import { SentryError } from './error.js';\nimport { rejectedSyncPromise, SyncPromise, resolvedSyncPromise } from './syncpromise.js';\n\n/**\n * Creates an new PromiseBuffer object with the specified limit\n * @param limit max number of promises that can be stored in the buffer\n */\nfunction makePromiseBuffer(limit) {\n const buffer = [];\n\n function isReady() {\n return limit === undefined || buffer.length < limit;\n }\n\n /**\n * Remove a promise from the queue.\n *\n * @param task Can be any PromiseLike\n * @returns Removed promise.\n */\n function remove(task) {\n return buffer.splice(buffer.indexOf(task), 1)[0];\n }\n\n /**\n * Add a promise (representing an in-flight action) to the queue, and set it to remove itself on fulfillment.\n *\n * @param taskProducer A function producing any PromiseLike; In previous versions this used to be `task:\n * PromiseLike`, but under that model, Promises were instantly created on the call-site and their executor\n * functions therefore ran immediately. Thus, even if the buffer was full, the action still happened. By\n * requiring the promise to be wrapped in a function, we can defer promise creation until after the buffer\n * limit check.\n * @returns The original promise.\n */\n function add(taskProducer) {\n if (!isReady()) {\n return rejectedSyncPromise(new SentryError('Not adding Promise because buffer limit was reached.'));\n }\n\n // start the task and add its promise to the queue\n const task = taskProducer();\n if (buffer.indexOf(task) === -1) {\n buffer.push(task);\n }\n void task\n .then(() => remove(task))\n // Use `then(null, rejectionHandler)` rather than `catch(rejectionHandler)` so that we can use `PromiseLike`\n // rather than `Promise`. `PromiseLike` doesn't have a `.catch` method, making its polyfill smaller. (ES5 didn't\n // have promises, so TS has to polyfill when down-compiling.)\n .then(null, () =>\n remove(task).then(null, () => {\n // We have to add another catch here because `remove()` starts a new promise chain.\n }),\n );\n return task;\n }\n\n /**\n * Wait for all promises in the queue to resolve or for timeout to expire, whichever comes first.\n *\n * @param timeout The time, in ms, after which to resolve to `false` if the queue is still non-empty. Passing `0` (or\n * not passing anything) will make the promise wait as long as it takes for the queue to drain before resolving to\n * `true`.\n * @returns A promise which will resolve to `true` if the queue is already empty or drains before the timeout, and\n * `false` otherwise\n */\n function drain(timeout) {\n return new SyncPromise((resolve, reject) => {\n let counter = buffer.length;\n\n if (!counter) {\n return resolve(true);\n }\n\n // wait for `timeout` ms and then resolve to `false` (if not cancelled first)\n const capturedSetTimeout = setTimeout(() => {\n if (timeout && timeout > 0) {\n resolve(false);\n }\n }, timeout);\n\n // if all promises resolve in time, cancel the timer and resolve to `true`\n buffer.forEach(item => {\n void resolvedSyncPromise(item).then(() => {\n if (!--counter) {\n clearTimeout(capturedSetTimeout);\n resolve(true);\n }\n }, reject);\n });\n });\n }\n\n return {\n $: buffer,\n add,\n drain,\n };\n}\n\nexport { makePromiseBuffer };\n","import { isNativeFetch, logger } from '@sentry/utils';\nimport { WINDOW } from '../helpers.js';\n\nlet cachedFetchImpl = undefined;\n\n/**\n * A special usecase for incorrectly wrapped Fetch APIs in conjunction with ad-blockers.\n * Whenever someone wraps the Fetch API and returns the wrong promise chain,\n * this chain becomes orphaned and there is no possible way to capture it's rejections\n * other than allowing it bubble up to this very handler. eg.\n *\n * const f = window.fetch;\n * window.fetch = function () {\n * const p = f.apply(this, arguments);\n *\n * p.then(function() {\n * console.log('hi.');\n * });\n *\n * return p;\n * }\n *\n * `p.then(function () { ... })` is producing a completely separate promise chain,\n * however, what's returned is `p` - the result of original `fetch` call.\n *\n * This mean, that whenever we use the Fetch API to send our own requests, _and_\n * some ad-blocker blocks it, this orphaned chain will _always_ reject,\n * effectively causing another event to be captured.\n * This makes a whole process become an infinite loop, which we need to somehow\n * deal with, and break it in one way or another.\n *\n * To deal with this issue, we are making sure that we _always_ use the real\n * browser Fetch API, instead of relying on what `window.fetch` exposes.\n * The only downside to this would be missing our own requests as breadcrumbs,\n * but because we are already not doing this, it should be just fine.\n *\n * Possible failed fetch error messages per-browser:\n *\n * Chrome: Failed to fetch\n * Edge: Failed to Fetch\n * Firefox: NetworkError when attempting to fetch resource\n * Safari: resource blocked by content blocker\n */\nfunction getNativeFetchImplementation() {\n if (cachedFetchImpl) {\n return cachedFetchImpl;\n }\n\n /* eslint-disable @typescript-eslint/unbound-method */\n\n // Fast path to avoid DOM I/O\n if (isNativeFetch(WINDOW.fetch)) {\n return (cachedFetchImpl = WINDOW.fetch.bind(WINDOW));\n }\n\n const document = WINDOW.document;\n let fetchImpl = WINDOW.fetch;\n // eslint-disable-next-line deprecation/deprecation\n if (document && typeof document.createElement === 'function') {\n try {\n const sandbox = document.createElement('iframe');\n sandbox.hidden = true;\n document.head.appendChild(sandbox);\n const contentWindow = sandbox.contentWindow;\n if (contentWindow && contentWindow.fetch) {\n fetchImpl = contentWindow.fetch;\n }\n document.head.removeChild(sandbox);\n } catch (e) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.warn('Could not create sandbox iframe for pure fetch check, bailing to window.fetch: ', e);\n }\n }\n\n return (cachedFetchImpl = fetchImpl.bind(WINDOW));\n /* eslint-enable @typescript-eslint/unbound-method */\n}\n\n/** Clears cached fetch impl */\nfunction clearCachedFetchImplementation() {\n cachedFetchImpl = undefined;\n}\n\nexport { clearCachedFetchImplementation, getNativeFetchImplementation };\n","import { createTransport } from '@sentry/core';\nimport { rejectedSyncPromise } from '@sentry/utils';\nimport { getNativeFetchImplementation, clearCachedFetchImplementation } from './utils.js';\n\n/**\n * Creates a Transport that uses the Fetch API to send events to Sentry.\n */\nfunction makeFetchTransport(\n options,\n nativeFetch = getNativeFetchImplementation(),\n) {\n let pendingBodySize = 0;\n let pendingCount = 0;\n\n function makeRequest(request) {\n const requestSize = request.body.length;\n pendingBodySize += requestSize;\n pendingCount++;\n\n const requestOptions = {\n body: request.body,\n method: 'POST',\n referrerPolicy: 'origin',\n headers: options.headers,\n // Outgoing requests are usually cancelled when navigating to a different page, causing a \"TypeError: Failed to\n // fetch\" error and sending a \"network_error\" client-outcome - in Chrome, the request status shows \"(cancelled)\".\n // The `keepalive` flag keeps outgoing requests alive, even when switching pages. We want this since we're\n // frequently sending events right before the user is switching pages (eg. whenfinishing navigation transactions).\n // Gotchas:\n // - `keepalive` isn't supported by Firefox\n // - As per spec (https://fetch.spec.whatwg.org/#http-network-or-cache-fetch):\n // If the sum of contentLength and inflightKeepaliveBytes is greater than 64 kibibytes, then return a network error.\n // We will therefore only activate the flag when we're below that limit.\n // There is also a limit of requests that can be open at the same time, so we also limit this to 15\n // See https://github.com/getsentry/sentry-javascript/pull/7553 for details\n keepalive: pendingBodySize <= 60000 && pendingCount < 15,\n ...options.fetchOptions,\n };\n\n try {\n return nativeFetch(options.url, requestOptions).then(response => {\n pendingBodySize -= requestSize;\n pendingCount--;\n return {\n statusCode: response.status,\n headers: {\n 'x-sentry-rate-limits': response.headers.get('X-Sentry-Rate-Limits'),\n 'retry-after': response.headers.get('Retry-After'),\n },\n };\n });\n } catch (e) {\n clearCachedFetchImplementation();\n pendingBodySize -= requestSize;\n pendingCount--;\n return rejectedSyncPromise(e);\n }\n }\n\n return createTransport(options, makeRequest);\n}\n\nexport { makeFetchTransport };\n","import { createTransport } from '@sentry/core';\nimport { SyncPromise } from '@sentry/utils';\n\n/**\n * The DONE ready state for XmlHttpRequest\n *\n * Defining it here as a constant b/c XMLHttpRequest.DONE is not always defined\n * (e.g. during testing, it is `undefined`)\n *\n * @see {@link https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest/readyState}\n */\nconst XHR_READYSTATE_DONE = 4;\n\n/**\n * Creates a Transport that uses the XMLHttpRequest API to send events to Sentry.\n */\nfunction makeXHRTransport(options) {\n function makeRequest(request) {\n return new SyncPromise((resolve, reject) => {\n const xhr = new XMLHttpRequest();\n\n xhr.onerror = reject;\n\n xhr.onreadystatechange = () => {\n if (xhr.readyState === XHR_READYSTATE_DONE) {\n resolve({\n statusCode: xhr.status,\n headers: {\n 'x-sentry-rate-limits': xhr.getResponseHeader('X-Sentry-Rate-Limits'),\n 'retry-after': xhr.getResponseHeader('Retry-After'),\n },\n });\n }\n };\n\n xhr.open('POST', options.url);\n\n for (const header in options.headers) {\n if (Object.prototype.hasOwnProperty.call(options.headers, header)) {\n xhr.setRequestHeader(header, options.headers[header]);\n }\n }\n\n xhr.send(request.body);\n });\n }\n\n return createTransport(options, makeRequest);\n}\n\nexport { makeXHRTransport };\n","import { Integrations, getIntegrationsToSetup, initAndBind, getReportDialogEndpoint, getCurrentHub } from '@sentry/core';\nimport { stackParserFromStackParserOptions, supportsFetch, logger, addInstrumentationHandler } from '@sentry/utils';\nimport { BrowserClient } from './client.js';\nimport { WINDOW, wrap as wrap$1 } from './helpers.js';\nimport { GlobalHandlers } from './integrations/globalhandlers.js';\nimport { TryCatch } from './integrations/trycatch.js';\nimport { Breadcrumbs } from './integrations/breadcrumbs.js';\nimport { LinkedErrors } from './integrations/linkederrors.js';\nimport { HttpContext } from './integrations/httpcontext.js';\nimport { Dedupe } from './integrations/dedupe.js';\nimport { defaultStackParser } from './stack-parsers.js';\nimport { makeFetchTransport } from './transports/fetch.js';\nimport { makeXHRTransport } from './transports/xhr.js';\n\nconst defaultIntegrations = [\n new Integrations.InboundFilters(),\n new Integrations.FunctionToString(),\n new TryCatch(),\n new Breadcrumbs(),\n new GlobalHandlers(),\n new LinkedErrors(),\n new Dedupe(),\n new HttpContext(),\n];\n\n/**\n * A magic string that build tooling can leverage in order to inject a release value into the SDK.\n */\n\n/**\n * The Sentry Browser SDK Client.\n *\n * To use this SDK, call the {@link init} function as early as possible when\n * loading the web page. To set context information or send manual events, use\n * the provided methods.\n *\n * @example\n *\n * ```\n *\n * import { init } from '@sentry/browser';\n *\n * init({\n * dsn: '__DSN__',\n * // ...\n * });\n * ```\n *\n * @example\n * ```\n *\n * import { configureScope } from '@sentry/browser';\n * configureScope((scope: Scope) => {\n * scope.setExtra({ battery: 0.7 });\n * scope.setTag({ user_mode: 'admin' });\n * scope.setUser({ id: '4711' });\n * });\n * ```\n *\n * @example\n * ```\n *\n * import { addBreadcrumb } from '@sentry/browser';\n * addBreadcrumb({\n * message: 'My Breadcrumb',\n * // ...\n * });\n * ```\n *\n * @example\n *\n * ```\n *\n * import * as Sentry from '@sentry/browser';\n * Sentry.captureMessage('Hello, world!');\n * Sentry.captureException(new Error('Good bye'));\n * Sentry.captureEvent({\n * message: 'Manual',\n * stacktrace: [\n * // ...\n * ],\n * });\n * ```\n *\n * @see {@link BrowserOptions} for documentation on configuration options.\n */\nfunction init(options = {}) {\n if (options.defaultIntegrations === undefined) {\n options.defaultIntegrations = defaultIntegrations;\n }\n if (options.release === undefined) {\n // This allows build tooling to find-and-replace __SENTRY_RELEASE__ to inject a release value\n if (typeof __SENTRY_RELEASE__ === 'string') {\n options.release = __SENTRY_RELEASE__;\n }\n\n // This supports the variable that sentry-webpack-plugin injects\n if (WINDOW.SENTRY_RELEASE && WINDOW.SENTRY_RELEASE.id) {\n options.release = WINDOW.SENTRY_RELEASE.id;\n }\n }\n if (options.autoSessionTracking === undefined) {\n options.autoSessionTracking = true;\n }\n if (options.sendClientReports === undefined) {\n options.sendClientReports = true;\n }\n\n const clientOptions = {\n ...options,\n stackParser: stackParserFromStackParserOptions(options.stackParser || defaultStackParser),\n integrations: getIntegrationsToSetup(options),\n transport: options.transport || (supportsFetch() ? makeFetchTransport : makeXHRTransport),\n };\n\n initAndBind(BrowserClient, clientOptions);\n\n if (options.autoSessionTracking) {\n startSessionTracking();\n }\n}\n\n/**\n * Present the user with a report dialog.\n *\n * @param options Everything is optional, we try to fetch all info need from the global scope.\n */\nfunction showReportDialog(options = {}, hub = getCurrentHub()) {\n // doesn't work without a document (React Native)\n if (!WINDOW.document) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Global document not defined in showReportDialog call');\n return;\n }\n\n const { client, scope } = hub.getStackTop();\n const dsn = options.dsn || (client && client.getDsn());\n if (!dsn) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('DSN not configured for showReportDialog call');\n return;\n }\n\n if (scope) {\n options.user = {\n ...scope.getUser(),\n ...options.user,\n };\n }\n\n if (!options.eventId) {\n options.eventId = hub.lastEventId();\n }\n\n const script = WINDOW.document.createElement('script');\n script.async = true;\n script.crossOrigin = 'anonymous';\n script.src = getReportDialogEndpoint(dsn, options);\n\n if (options.onLoad) {\n script.onload = options.onLoad;\n }\n\n const injectionPoint = WINDOW.document.head || WINDOW.document.body;\n if (injectionPoint) {\n injectionPoint.appendChild(script);\n } else {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Not injecting report dialog. No injection point found in HTML');\n }\n}\n\n/**\n * This function is here to be API compatible with the loader.\n * @hidden\n */\nfunction forceLoad() {\n // Noop\n}\n\n/**\n * This function is here to be API compatible with the loader.\n * @hidden\n */\nfunction onLoad(callback) {\n callback();\n}\n\n/**\n * Wrap code within a try/catch block so the SDK is able to capture errors.\n *\n * @param fn A function to wrap.\n *\n * @returns The result of wrapped function call.\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction wrap(fn) {\n return wrap$1(fn)();\n}\n\nfunction startSessionOnHub(hub) {\n hub.startSession({ ignoreDuration: true });\n hub.captureSession();\n}\n\n/**\n * Enable automatic Session Tracking for the initial page load.\n */\nfunction startSessionTracking() {\n if (typeof WINDOW.document === 'undefined') {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n logger.warn('Session tracking in non-browser environment with @sentry/browser is not supported.');\n return;\n }\n\n const hub = getCurrentHub();\n\n // The only way for this to be false is for there to be a version mismatch between @sentry/browser (>= 6.0.0) and\n // @sentry/hub (< 5.27.0). In the simple case, there won't ever be such a mismatch, because the two packages are\n // pinned at the same version in package.json, but there are edge cases where it's possible. See\n // https://github.com/getsentry/sentry-javascript/issues/3207 and\n // https://github.com/getsentry/sentry-javascript/issues/3234 and\n // https://github.com/getsentry/sentry-javascript/issues/3278.\n if (!hub.captureSession) {\n return;\n }\n\n // The session duration for browser sessions does not track a meaningful\n // concept that can be used as a metric.\n // Automatically captured sessions are akin to page views, and thus we\n // discard their duration.\n startSessionOnHub(hub);\n\n // We want to create a session for every navigation as well\n addInstrumentationHandler('history', ({ from, to }) => {\n // Don't create an additional session for the initial route or if the location did not change\n if (!(from === undefined || from === to)) {\n startSessionOnHub(getCurrentHub());\n }\n });\n}\n\n/**\n * Captures user feedback and sends it to Sentry.\n */\nfunction captureUserFeedback(feedback) {\n const client = getCurrentHub().getClient();\n if (client) {\n client.captureUserFeedback(feedback);\n }\n}\n\nexport { captureUserFeedback, defaultIntegrations, forceLoad, init, onLoad, showReportDialog, wrap };\n","import * as Sentry from '@sentry/browser';\nimport { SDK_VERSION, defaultIntegrations, init as init$1, setContext, WINDOW, getCurrentHub } from '@sentry/browser';\nexport * from '@sentry/browser';\nimport * as i0 from '@angular/core';\nimport { VERSION, Injectable, Inject, Directive, Input, NgModule } from '@angular/core';\nimport { logger, isString, addExceptionMechanism, stripUrlQueryAndFragment, timestampInSeconds } from '@sentry/utils';\nimport { HttpErrorResponse } from '@angular/common/http';\nimport * as i1 from '@angular/router';\nimport { NavigationStart, ResolveEnd, NavigationEnd, NavigationCancel, NavigationError } from '@angular/router';\nimport { Subscription } from 'rxjs';\nimport { filter, tap } from 'rxjs/operators';\n\n/*\n * This file defines flags and constants that can be modified during compile time in order to facilitate tree shaking\n * for users.\n *\n * We define \"magic strings\" like `__SENTRY_DEBUG__` that may get replaced with actual values during our, or the user's\n * build process. Take care when introducing new flags - they must not throw if they are not replaced. See the Debug\n * Build Flags section in CONTRIBUTING.md.\n */\n/** Flag that is true for debug builds, false otherwise. */\nconst IS_DEBUG_BUILD = typeof __SENTRY_DEBUG__ === 'undefined' ? true : __SENTRY_DEBUG__;\n\n/**\n * Inits the Angular SDK\n */\nfunction init(options) {\n options._metadata = options._metadata || {};\n options._metadata.sdk = {\n name: 'sentry.javascript.angular-ivy',\n packages: [\n {\n name: 'npm:@sentry/angular-ivy',\n version: SDK_VERSION,\n },\n ],\n version: SDK_VERSION,\n };\n // Filter out TryCatch integration as it interferes with our Angular `ErrorHandler`:\n // TryCatch would catch certain errors before they reach the `ErrorHandler` and thus provide a\n // lower fidelity error than what `SentryErrorHandler` (see errorhandler.ts) would provide.\n // see:\n // - https://github.com/getsentry/sentry-javascript/issues/5417#issuecomment-1453407097\n // - https://github.com/getsentry/sentry-javascript/issues/2744\n if (options.defaultIntegrations === undefined) {\n options.defaultIntegrations = defaultIntegrations.filter(integration => {\n return integration.name !== 'TryCatch';\n });\n }\n checkAndSetAngularVersion();\n init$1(options);\n}\nfunction checkAndSetAngularVersion() {\n const ANGULAR_MINIMUM_VERSION = 12;\n const angularVersion = VERSION && VERSION.major ? parseInt(VERSION.major, 10) : undefined;\n if (angularVersion) {\n if (angularVersion < ANGULAR_MINIMUM_VERSION) {\n IS_DEBUG_BUILD &&\n logger.warn(`This Sentry SDK does not officially support Angular ${angularVersion}.`, `This SDK only supports Angular ${ANGULAR_MINIMUM_VERSION} and above.`, \"If you're using Angular 10 or 11, please use `@sentry/angular` instead.\", 'Otherwise, please consider upgrading your Angular version.');\n }\n setContext('angular', { version: angularVersion });\n }\n}\n\n// There're 2 types of Angular applications:\n// 1) zone-full (by default)\n// 2) zone-less\n// The developer can avoid importing the `zone.js` package and tells Angular that\n// he is responsible for running the change detection by himself. This is done by\n// \"nooping\" the zone through `CompilerOptions` when bootstrapping the root module.\n// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\nconst isNgZoneEnabled = typeof Zone !== 'undefined' && !!Zone.current;\n/**\n * The function that does the same job as `NgZone.runOutsideAngular`.\n */\nfunction runOutsideAngular(callback) {\n // The `Zone.root.run` basically will run the `callback` in the most parent zone.\n // Any asynchronous API used inside the `callback` won't catch Angular's zone\n // since `Zone.current` will reference `Zone.root`.\n // The Angular's zone is forked from the `Zone.root`. In this case, `zone.js` won't\n // trigger change detection, and `ApplicationRef.tick()` will not be run.\n // Caretaker note: we're using `Zone.root` except `NgZone.runOutsideAngular` since this\n // will require injecting the `NgZone` facade. That will create a breaking change for\n // projects already using the `@sentry/angular`.\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return isNgZoneEnabled ? Zone.root.run(callback) : callback();\n}\n\n// https://github.com/angular/angular/blob/master/packages/core/src/util/errors.ts\nfunction tryToUnwrapZonejsError(error) {\n // TODO: once Angular14 is the minimum requirement ERROR_ORIGINAL_ERROR and\n // getOriginalError from error.ts can be used directly.\n return error && error.ngOriginalError\n ? error.ngOriginalError\n : error;\n}\nfunction extractHttpModuleError(error) {\n // The `error` property of http exception can be either an `Error` object, which we can use directly...\n if (isErrorOrErrorLikeObject(error.error)) {\n return error.error;\n }\n // ... or an`ErrorEvent`, which can provide us with the message but no stack...\n if (error.error instanceof ErrorEvent && error.error.message) {\n return error.error.message;\n }\n // ...or the request body itself, which we can use as a message instead.\n if (typeof error.error === 'string') {\n return `Server returned code ${error.status} with body \"${error.error}\"`;\n }\n // If we don't have any detailed information, fallback to the request message itself.\n return error.message;\n}\nfunction isErrorOrErrorLikeObject(value) {\n if (value instanceof Error) {\n return true;\n }\n if (value === null || typeof value !== 'object') {\n return false;\n }\n const candidate = value;\n return (isString(candidate.name) &&\n isString(candidate.message) &&\n (undefined === candidate.stack || isString(candidate.stack)));\n}\n/**\n * Implementation of Angular's ErrorHandler provider that can be used as a drop-in replacement for the stock one.\n */\nclass SentryErrorHandler {\n constructor(options) {\n this._registeredAfterSendEventHandler = false;\n this._options = Object.assign({ logErrors: true }, options);\n }\n /**\n * Method called for every value captured through the ErrorHandler\n */\n handleError(error) {\n const extractedError = this._extractError(error) || 'Handled unknown error';\n // Capture handled exception and send it to Sentry.\n const eventId = runOutsideAngular(() => Sentry.captureException(extractedError, (scope) => {\n scope.addEventProcessor(event => {\n addExceptionMechanism(event, {\n type: 'angular',\n handled: false,\n });\n return event;\n });\n return scope;\n }));\n // When in development mode, log the error to console for immediate feedback.\n if (this._options.logErrors) {\n // eslint-disable-next-line no-console\n console.error(extractedError);\n }\n // Optionally show user dialog to provide details on what happened.\n if (this._options.showDialog) {\n const client = Sentry.getCurrentHub().getClient();\n if (client && client.on && !this._registeredAfterSendEventHandler) {\n client.on('afterSendEvent', (event) => {\n if (!event.type) {\n Sentry.showReportDialog(Object.assign(Object.assign({}, this._options.dialogOptions), { eventId: event.event_id }));\n }\n });\n // We only want to register this hook once in the lifetime of the error handler\n this._registeredAfterSendEventHandler = true;\n }\n else if (!client || !client.on) {\n Sentry.showReportDialog(Object.assign(Object.assign({}, this._options.dialogOptions), { eventId }));\n }\n }\n }\n /**\n * Used to pull a desired value that will be used to capture an event out of the raw value captured by ErrorHandler.\n */\n _extractError(error) {\n // Allow custom overrides of extracting function\n if (this._options.extractor) {\n const defaultExtractor = this._defaultExtractor.bind(this);\n return this._options.extractor(error, defaultExtractor);\n }\n return this._defaultExtractor(error);\n }\n /**\n * Default implementation of error extraction that handles default error wrapping, HTTP responses, ErrorEvent and few other known cases.\n */\n _defaultExtractor(errorCandidate) {\n const error = tryToUnwrapZonejsError(errorCandidate);\n // If it's http module error, extract as much information from it as we can.\n if (error instanceof HttpErrorResponse) {\n return extractHttpModuleError(error);\n }\n // We can handle messages and Error objects directly.\n if (typeof error === 'string' || isErrorOrErrorLikeObject(error)) {\n return error;\n }\n // Nothing was extracted, fallback to default error message.\n return null;\n }\n}\nSentryErrorHandler.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: SentryErrorHandler, deps: [{ token: 'errorHandlerOptions' }], target: i0.ɵɵFactoryTarget.Injectable });\nSentryErrorHandler.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: SentryErrorHandler, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: SentryErrorHandler, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: ['errorHandlerOptions']\n }] }]; } });\n/**\n * Factory function that creates an instance of a preconfigured ErrorHandler provider.\n */\nfunction createErrorHandler(config) {\n return new SentryErrorHandler(config);\n}\n\nconst ANGULAR_ROUTING_OP = 'ui.angular.routing';\nconst ANGULAR_INIT_OP = 'ui.angular.init';\nconst ANGULAR_OP = 'ui.angular';\n\nlet instrumentationInitialized;\nlet stashedStartTransaction;\nlet stashedStartTransactionOnLocationChange;\n/**\n * Creates routing instrumentation for Angular Router.\n */\nfunction routingInstrumentation(customStartTransaction, startTransactionOnPageLoad = true, startTransactionOnLocationChange = true) {\n instrumentationInitialized = true;\n stashedStartTransaction = customStartTransaction;\n stashedStartTransactionOnLocationChange = startTransactionOnLocationChange;\n if (startTransactionOnPageLoad && WINDOW && WINDOW.location) {\n customStartTransaction({\n name: WINDOW.location.pathname,\n op: 'pageload',\n metadata: { source: 'url' },\n });\n }\n}\nconst instrumentAngularRouting = routingInstrumentation;\n/**\n * Grabs active transaction off scope\n */\nfunction getActiveTransaction() {\n const currentHub = getCurrentHub();\n if (currentHub) {\n const scope = currentHub.getScope();\n if (scope) {\n return scope.getTransaction();\n }\n }\n return undefined;\n}\n/**\n * Angular's Service responsible for hooking into Angular Router and tracking current navigation process.\n * Creates a new transaction for every route change and measures a duration of routing process.\n */\nclass TraceService {\n constructor(_router) {\n this._router = _router;\n this.navStart$ = this._router.events.pipe(filter((event) => event instanceof NavigationStart), tap(navigationEvent => {\n if (!instrumentationInitialized) {\n IS_DEBUG_BUILD &&\n logger.error('Angular integration has tracing enabled, but Tracing integration is not configured');\n return;\n }\n const strippedUrl = stripUrlQueryAndFragment(navigationEvent.url);\n let activeTransaction = getActiveTransaction();\n if (!activeTransaction && stashedStartTransactionOnLocationChange) {\n activeTransaction = stashedStartTransaction({\n name: strippedUrl,\n op: 'navigation',\n metadata: { source: 'url' },\n });\n }\n if (activeTransaction) {\n if (this._routingSpan) {\n this._routingSpan.finish();\n }\n this._routingSpan = activeTransaction.startChild({\n description: `${navigationEvent.url}`,\n op: ANGULAR_ROUTING_OP,\n tags: Object.assign({ 'routing.instrumentation': '@sentry/angular', url: strippedUrl }, (navigationEvent.navigationTrigger && {\n navigationTrigger: navigationEvent.navigationTrigger,\n })),\n });\n }\n }));\n // The ResolveEnd event is fired when the Angular router has resolved the URL and\n // the parameter<->value mapping. It holds the new resolved router state with\n // the mapping and the new URL.\n // Only After this event, the route is activated, meaning that the transaction\n // can be updated with the parameterized route name before e.g. the route's root\n // component is initialized. This should be early enough before outgoing requests\n // are made from the new route, with the exceptions of requests being made during\n // a navigation.\n this.resEnd$ = this._router.events.pipe(filter((event) => event instanceof ResolveEnd), tap(event => {\n const route = getParameterizedRouteFromSnapshot(event.state.root);\n const transaction = getActiveTransaction();\n // TODO (v8 / #5416): revisit the source condition. Do we want to make the parameterized route the default?\n if (transaction && transaction.metadata.source === 'url') {\n transaction.setName(route, 'route');\n }\n }));\n this.navEnd$ = this._router.events.pipe(filter(event => event instanceof NavigationEnd || event instanceof NavigationCancel || event instanceof NavigationError), tap(() => {\n if (this._routingSpan) {\n runOutsideAngular(() => {\n // eslint-disable-next-line @typescript-eslint/no-non-null-assertion\n this._routingSpan.finish();\n });\n this._routingSpan = null;\n }\n }));\n this._routingSpan = null;\n this._subscription = new Subscription();\n this._subscription.add(this.navStart$.subscribe());\n this._subscription.add(this.resEnd$.subscribe());\n this._subscription.add(this.navEnd$.subscribe());\n }\n /**\n * This is used to prevent memory leaks when the root view is created and destroyed multiple times,\n * since `subscribe` callbacks capture `this` and prevent many resources from being GC'd.\n */\n ngOnDestroy() {\n this._subscription.unsubscribe();\n }\n}\nTraceService.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceService, deps: [{ token: i1.Router }], target: i0.ɵɵFactoryTarget.Injectable });\nTraceService.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceService, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceService, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Router }]; } });\nconst UNKNOWN_COMPONENT = 'unknown';\n/**\n * A directive that can be used to capture initialization lifecycle of the whole component.\n */\nclass TraceDirective {\n /**\n * Implementation of OnInit lifecycle method\n * @inheritdoc\n */\n ngOnInit() {\n if (!this.componentName) {\n this.componentName = UNKNOWN_COMPONENT;\n }\n const activeTransaction = getActiveTransaction();\n if (activeTransaction) {\n this._tracingSpan = activeTransaction.startChild({\n description: `<${this.componentName}>`,\n op: ANGULAR_INIT_OP,\n });\n }\n }\n /**\n * Implementation of AfterViewInit lifecycle method\n * @inheritdoc\n */\n ngAfterViewInit() {\n if (this._tracingSpan) {\n this._tracingSpan.finish();\n }\n }\n}\nTraceDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceDirective, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nTraceDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"12.0.0\", version: \"12.2.17\", type: TraceDirective, selector: \"[trace]\", inputs: { componentName: [\"trace\", \"componentName\"] }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceDirective, decorators: [{\n type: Directive,\n args: [{ selector: '[trace]' }]\n }], propDecorators: { componentName: [{\n type: Input,\n args: ['trace']\n }] } });\n/**\n * A module serves as a single compilation unit for the `TraceDirective` and can be re-used by any other module.\n */\nclass TraceModule {\n}\nTraceModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nTraceModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceModule, declarations: [TraceDirective], exports: [TraceDirective] });\nTraceModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"12.2.17\", ngImport: i0, type: TraceModule, decorators: [{\n type: NgModule,\n args: [{\n declarations: [TraceDirective],\n exports: [TraceDirective],\n }]\n }] });\n/**\n * Decorator function that can be used to capture initialization lifecycle of the whole component.\n */\nfunction TraceClassDecorator() {\n let tracingSpan;\n /* eslint-disable @typescript-eslint/no-unsafe-member-access */\n // eslint-disable-next-line @typescript-eslint/explicit-function-return-type\n return target => {\n const originalOnInit = target.prototype.ngOnInit;\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n target.prototype.ngOnInit = function (...args) {\n const activeTransaction = getActiveTransaction();\n if (activeTransaction) {\n tracingSpan = activeTransaction.startChild({\n description: `<${target.name}>`,\n op: ANGULAR_INIT_OP,\n });\n }\n if (originalOnInit) {\n return originalOnInit.apply(this, args);\n }\n };\n const originalAfterViewInit = target.prototype.ngAfterViewInit;\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n target.prototype.ngAfterViewInit = function (...args) {\n if (tracingSpan) {\n tracingSpan.finish();\n }\n if (originalAfterViewInit) {\n return originalAfterViewInit.apply(this, args);\n }\n };\n };\n /* eslint-enable @typescript-eslint/no-unsafe-member-access */\n}\n/**\n * Decorator function that can be used to capture a single lifecycle methods of the component.\n */\nfunction TraceMethodDecorator() {\n // eslint-disable-next-line @typescript-eslint/explicit-function-return-type, @typescript-eslint/ban-types\n return (target, propertyKey, descriptor) => {\n const originalMethod = descriptor.value;\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n descriptor.value = function (...args) {\n const now = timestampInSeconds();\n const activeTransaction = getActiveTransaction();\n if (activeTransaction) {\n activeTransaction.startChild({\n description: `<${target.constructor.name}>`,\n endTimestamp: now,\n op: `${ANGULAR_OP}.${String(propertyKey)}`,\n startTimestamp: now,\n });\n }\n if (originalMethod) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return originalMethod.apply(this, args);\n }\n };\n return descriptor;\n };\n}\n/**\n * Takes the parameterized route from a given ActivatedRouteSnapshot and concatenates the snapshot's\n * child route with its parent to produce the complete parameterized URL of the activated route.\n * This happens recursively until the last child (i.e. the end of the URL) is reached.\n *\n * @param route the ActivatedRouteSnapshot of which its path and its child's path is concatenated\n *\n * @returns the concatenated parameterized route string\n */\nfunction getParameterizedRouteFromSnapshot(route) {\n const parts = [];\n let currentRoute = route && route.firstChild;\n while (currentRoute) {\n const path = currentRoute && currentRoute.routeConfig && currentRoute.routeConfig.path;\n if (path === null || path === undefined) {\n break;\n }\n parts.push(path);\n currentRoute = currentRoute.firstChild;\n }\n const fullPath = parts.filter(part => part).join('/');\n return fullPath ? `/${fullPath}/` : '/';\n}\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { SentryErrorHandler, TraceClassDecorator, TraceDirective, TraceMethodDecorator, TraceModule, TraceService, createErrorHandler, getActiveTransaction, init, instrumentAngularRouting, routingInstrumentation };\n","import { CommonModule } from '@angular/common';\nimport { NgModule } from '@angular/core';\nimport { MatLegacyButtonModule as MatButtonModule } from '@angular/material/legacy-button';\nimport { MatLegacyDialogModule as MatDialogModule } from '@angular/material/legacy-dialog';\n\nimport { VideoDialogComponent } from './video-dialog.component';\n\n@NgModule({\n declarations: [\n VideoDialogComponent,\n ],\n imports: [\n CommonModule,\n MatButtonModule,\n MatDialogModule,\n ],\n exports: [\n VideoDialogComponent,\n ],\n})\nexport class VideoDialogModule {}\n","import { NgModule } from '@angular/core';\nimport { ScrollAnchorDirective } from './scroll-anchor.directive';\nimport { ScrollManagerDirective } from './scroll-manager.directive';\nimport { ScrollSectionDirective } from './scroll-section.directive';\n\n\n\n@NgModule({\n declarations: [\n ScrollAnchorDirective,\n ScrollSectionDirective,\n ScrollManagerDirective,\n ],\n exports: [\n ScrollAnchorDirective,\n ScrollSectionDirective,\n ScrollManagerDirective,\n ],\n})\nexport class ScrollModule { }\n","import { CommonModule } from '@angular/common';\nimport { NgModule } from '@angular/core';\nimport { MatLegacyButtonModule as MatButtonModule } from '@angular/material/legacy-button';\nimport { MatDividerModule } from '@angular/material/divider';\nimport { MatLegacyMenuModule as MatMenuModule } from '@angular/material/legacy-menu';\nimport { RouterModule } from '@angular/router';\nimport { AuthModule } from '../../auth/auth.module';\nimport { UserIndicatorComponent } from './user-indicator/user-indicator.component';\n\n@NgModule({\n declarations: [UserIndicatorComponent],\n imports: [\n CommonModule,\n MatButtonModule,\n MatMenuModule,\n RouterModule,\n AuthModule,\n MatDividerModule,\n ],\n exports: [\n UserIndicatorComponent,\n ],\n})\nexport class UserIndicatorModule { }\n","import { CommonModule } from '@angular/common';\nimport { NgModule } from '@angular/core';\nimport { FormsModule } from '@angular/forms';\nimport { MatDividerModule } from '@angular/material/divider';\nimport { MatLegacyMenuModule as MatMenuModule } from '@angular/material/legacy-menu';\nimport { RouterModule } from '@angular/router';\nimport { ScrollModule } from '../../app/directives/scroll/scroll.module';\nimport { DropZoneModule } from '../drop-zone/drop-zone.module';\nimport { FolderUploadModule } from '../folder-upload/folder-upload.module';\nimport { UserIndicatorModule } from '../user-indicator/user-indicator.module';\nimport { NavbarMobileComponent } from './navbar-mobile/navbar-mobile.component';\nimport { NavbarComponent } from './navbar/navbar.component';\n\n@NgModule({\n imports: [\n CommonModule,\n FormsModule,\n RouterModule,\n MatDividerModule,\n UserIndicatorModule,\n MatMenuModule,\n DropZoneModule,\n FolderUploadModule,\n ScrollModule,\n ],\n declarations: [\n NavbarComponent,\n NavbarMobileComponent,\n ],\n exports: [\n NavbarComponent,\n NavbarMobileComponent,\n ],\n})\nexport class NavbarModule {\n}\n","export interface QuestionAndAnswer {\n question: string;\n answer: string;\n}\n\n export const myTitleServiceFAQEn: QuestionAndAnswer[] = [\n {\n question: 'What service do you provide?',\n answer: 'Mytitle provides digital proof of your data ownership. Meaning, it helps to protect your intellectual property.',\n },\n {\n question: 'How does it work? ',\n answer: 'Simply log in to your Mytitle account. Uploaded files will be stored in our storage and encrypted right away. After the comprised detail of your files is submited to the Litecoin blockchain, your ownership certificate gets generated. All is done in just a few minutes.',\n },\n {\n question: 'What is the output of your service?',\n answer: 'A lifelong certificate, secured backup storage of your files for 10 years where you can share all your files and send verification links from.',\n },\n {\n question: 'Will my files be stored forever?',\n answer: 'No, we are obliged to maintain the storage for 10 years but information about your stored data will be trackable on Litecoin forever.',\n },\n {\n question: 'Where do my documents \"go\" after trial period?',\n answer: 'We can\\'t recover your files after that period of time. But the certificates are valid basically forever and can be found on your email address. For keeping your files in Mytitle, please upgrade your file before the trial period ends',\n },\n {\n question: 'How many files can I upload at once?',\n answer: 'It´s even possible to upload the whole folder. You will get certificates not just for the folder with files but also for each file inside.',\n },\n];\n\nexport const protectionFAQEn: QuestionAndAnswer[] = [\n {\n question: 'What does Mytitle protect?',\n answer: 'Mytitle helps to protect one\\'s ownership of any creation, therefore your claim of ownership of a particular subject.',\n },\n {\n question: 'Why should I protect my files?',\n answer: 'Anytime you share your work publicly or with a second party there is always a danger of copyright infringement. If you want to prevent yourself from losing the claim to your own property, you should certify your ownership first. That way you can safely share your work with the world.',\n },\n {\n question: 'What could be the subject of protection?',\n answer: 'It could be filed contracts, scripts, research data, porfolios, trade secrets and know-hows, scanned documents of graphic content like fashion designs, architectural sketches, videos, etc. Basicaly any form of digital documents.',\n },\n {\n question: 'What form of a document can be protected?',\n answer: 'Anything.\\n' +\n 'For example: .doc, .pdf, .vcf, .zip, .mp4, .mov, .sol, .odt, .html, to .wav but also .py, .js, .css, .cpp, .c, .h, .java, .hs, .collada, .fbx and others.\\n' +\n 'You can also submit a file without any suffix. We will manage.',\n },\n {\n question: 'How can I securely share the subjected documents?',\n answer: 'Before your uploaded documents reach the storage, they are encrypted.\\n' +\n 'So your data is protected from the very beginning of the process.',\n },\n {\n question: 'Can Mytitle steal my intellectual property?',\n answer: 'Nobody from Mytitle has access to your files or the content.\\n' +\n 'It\\'s just not possible.',\n },\n];\n\nexport const blockchainFAQEn: QuestionAndAnswer[] = [\n {\n question: 'What is blockchain?',\n answer: 'It´s a decentralized technology of distributed ledger improving many areas of digital world. It´s used for crypto payment and software applications.',\n },\n {\n question: 'What is Litecoin blockchain?',\n answer: 'Litecoin blockchain is decentralized, immutable and transparent platfom where applications are build. It tracks all records submitted and the detail of your \"signed\" data is built into it. Here, nobody can change it or extract it.',\n },\n {\n question: 'Why is blockchain involved?',\n answer: 'It´s the only platform where we can securely incorporate your data to receive an immutable proof that you hold a digital document at certain time & date.',\n },\n];\n\nexport const ownershipCertificationFAQEn: QuestionAndAnswer[] = [\n {\n question: 'How long until getting my ownership certification?',\n answer: 'Minutes. Simply register yourself, upload your document, fill in the important info and wait a few minutes to receive the certificate. It takes about 10 minutes and your documents are ready to share.',\n },\n {\n question: 'Can I submit my website portfolio for certification?',\n answer: 'Only in case your portfolio hasn\\'t gone public or hasn\\'t been shared with any other party. The onwnership certificaton makes sense only if subject hasn\\'t been previously exposed.',\n },\n {\n question: 'Can I use the certificate in a legal dispute?',\n answer: 'Of course. There are many countries which confirm blockchain timestamp as a legal proof. Other countries haven\\'t incorporated blockchain in their legal ground yet, but the information from certificate can work as an indirect proof of your authorship and ownership. See more information on our blog.',\n },\n {\n question: 'Can other person verify my IP ownership?',\n answer: 'Anybody can verify that your files are really yours in case of doubts. Either 1) share the verification link connected to the file with the person, or 2) send the hash code from certificate (or send the whole certificate) to that person so they can verify it themselves.',\n },\n];\n\nexport const questionsAndAnswersCS: QuestionAndAnswer[] = [\n {\n question: 'Jak bezpečné je vaše úložiště?',\n answer: 'Vaše bezpečnost je naše nejvyšší priorita. Proto je každý nově nahraný soubor, a to hned ve chvíli kdy dorazí na náš server, důkladně zašifrován speciálním klíčem, teprve pak Mytitle soubor uloží. Klíč je poté uschován do našeho vysoce zabezpečeného Vaultu. Tak je nahraný soubor zajištěn a chráněn před potenciálním bezpečnostním narušením.',\n },\n {\n question: 'Kdo má přístup k mému souboru?',\n answer: 'Obsah Vašeho souboru je zcela nedostupný veřejnosti. Mytitle využívá blockchain technologii, jež je založena na vzájemně propojených data blocích a šifrování dat. Je zcela nemožné tento systém narušit a zpřístupnit Vaše soubory. Pokud však chcete sami dokázat vlastnictví nahraných souborů, bez sdílení jejich obsahu, lze jednoduše sdílet Váš certifikát. Certifikát zpřístupňuje data jako např. kdy byl soubor nahrán nebo kdo je jeho majitelem. Pokud byste chtěli sdílet samotný soubor, je to také možné. Stačí určit příjemce a nastavit časové rozmezí, ve kterém mohou příjemci soubor otevřít. Jakmile čas vyprší, přístupové okno se zavře.',\n },\n {\n question: 'Mohu si ponechat klíč sám pro sebe?',\n answer: 'Zákazníci si v tuto chvíli nemají možnost klíč ponechat. Toto bezpečnostní opatření bylo implementováno z důvodu ochrany klíče a předejití jeho možné ztráty a tedy i nenávratné ztráty uložených souborů.',\n },\n {\n question: 'K čemu slouží \"Certificate of Holding of the Digital File\"?',\n answer: 'Certifikát Vám poskytuje informace potřebné k prokázání vlastnictví zaznamenaných dat. Obsahuje datum a čas nahrání, unikátní identifikaci souboru a návod, jak si zobrazit tato identifikační data na samotném blockchainu. To vám umožňuje dokázat, že určitý soubor byl opravdu ve vašem držení a vámi nahrán v určitém čase. A díky povaze blockchain technologie, jsou tato data neměnitelná.',\n },\n {\n question: 'Může si někdo přečíst má osobní data uložená na blockchainu?',\n answer: 'Ne! Vaše osobní data jsou na blockchainu viditelná pouze jako hash (unikátní kód). Vaše osobní informace jako jméno atd. jsou viditelné pouze na Vaší kopii certifikátu, kde také najdete zmíněný hash kód. Pokud by někdo chtěl ověřit autenticitu certifikátu, stačí vyhledat hash kód na něm napsaný a poté porovnat klíčová data jako datum nahrání souboru. Ale v žádném případě se nikdy nezobrazí Vaše soukromá data.',\n },\n {\n question: 'Co kdybych musel potvrdit vlastnictví souboru u soudu?',\n answer: 'Mytitle certifikát dokazuje, že jste právě vy měli v držení určitá data, v určitou chvíli. Taková informace může významně pomoci dokázat, že jste byli původními majiteli dávno předtím, než byla data neprávem jakkoli zneužita. My poskytujeme deklarované vlastnictví a nezávislé ověření Vašeho souboru. Vaším úkolem je pak dokázat, že právě vy vlastníte autorská práva k souboru, který jste na Mytitle nahráli. Úzce spolupracujeme s mezinárodním týmem právníků a moc rádi vám pomůžeme, pokud bude potřeba.',\n },\n];\n\n\nexport const faqStructure = [myTitleServiceFAQEn, protectionFAQEn, blockchainFAQEn, ownershipCertificationFAQEn];\n","
\n \n
\n","import { Component } from '@angular/core';\nimport { MatLegacyTabChangeEvent as MatTabChangeEvent } from '@angular/material/legacy-tabs';\nimport { EnvironmentService } from '../../shared/services/environment.service';\nimport { faqStructure, questionsAndAnswersCS } from './faq';\n\n@Component({\n selector: 'mt-faq',\n templateUrl: './faq.component.html',\n styleUrls: ['./faq.component.scss'],\n})\nexport class FaqComponent {\n public items;\n public tabs = ['Mytitle service', 'Protection', 'Blockchain', 'Ownership certification'];\n\n constructor(private enviService: EnvironmentService) {\n this.items = faqStructure[0];\n if (this.enviService.isCzechEnvironment) {\n this.tabs = ['Časté dotazy'];\n this.items = questionsAndAnswersCS;\n }\n }\n\n selectFaq(changeEvent: MatTabChangeEvent) {\n this.items = faqStructure[changeEvent.index];\n }\n}\n","import { Directive, ElementRef, Input, OnDestroy, OnInit } from '@angular/core';\nimport { ScrollManagerDirective } from './scroll-manager.directive';\n\n@Directive({\n selector: '[mtScrollSection]',\n})\nexport class ScrollSectionDirective implements OnInit, OnDestroy {\n @Input('mtScrollSection') id: string | number;\n\n constructor(\n private host: ElementRef,\n private manager: ScrollManagerDirective,\n ) {}\n\n ngOnInit() {\n this.manager.register(this);\n }\n\n ngOnDestroy() {\n this.manager.remove(this);\n }\n\n scroll() {\n this.host.nativeElement.scrollIntoView({\n behavior: 'smooth',\n });\n }\n\n scrollToTargetAdjusted(offset = 100) {\n const headerOffset = offset;\n const elementPosition = this.host.nativeElement.getBoundingClientRect().top;\n const offsetPosition = elementPosition + window.scrollY - headerOffset;\n\n window.scrollTo({\n top: offsetPosition,\n behavior: 'smooth',\n });\n }\n}\n","import { Subject } from '../Subject';\nimport { SimpleOuterSubscriber, innerSubscribe, SimpleInnerSubscriber } from '../innerSubscribe';\nexport function repeatWhen(notifier) {\n return (source) => source.lift(new RepeatWhenOperator(notifier));\n}\nclass RepeatWhenOperator {\n constructor(notifier) {\n this.notifier = notifier;\n }\n call(subscriber, source) {\n return source.subscribe(new RepeatWhenSubscriber(subscriber, this.notifier, source));\n }\n}\nclass RepeatWhenSubscriber extends SimpleOuterSubscriber {\n constructor(destination, notifier, source) {\n super(destination);\n this.notifier = notifier;\n this.source = source;\n this.sourceIsBeingSubscribedTo = true;\n }\n notifyNext() {\n this.sourceIsBeingSubscribedTo = true;\n this.source.subscribe(this);\n }\n notifyComplete() {\n if (this.sourceIsBeingSubscribedTo === false) {\n return super.complete();\n }\n }\n complete() {\n this.sourceIsBeingSubscribedTo = false;\n if (!this.isStopped) {\n if (!this.retries) {\n this.subscribeToRetries();\n }\n if (!this.retriesSubscription || this.retriesSubscription.closed) {\n return super.complete();\n }\n this._unsubscribeAndRecycle();\n this.notifications.next(undefined);\n }\n }\n _unsubscribe() {\n const { notifications, retriesSubscription } = this;\n if (notifications) {\n notifications.unsubscribe();\n this.notifications = undefined;\n }\n if (retriesSubscription) {\n retriesSubscription.unsubscribe();\n this.retriesSubscription = undefined;\n }\n this.retries = undefined;\n }\n _unsubscribeAndRecycle() {\n const { _unsubscribe } = this;\n this._unsubscribe = null;\n super._unsubscribeAndRecycle();\n this._unsubscribe = _unsubscribe;\n return this;\n }\n subscribeToRetries() {\n this.notifications = new Subject();\n let retries;\n try {\n const { notifier } = this;\n retries = notifier(this.notifications);\n }\n catch (e) {\n return super.complete();\n }\n this.retries = retries;\n this.retriesSubscription = innerSubscribe(retries, new SimpleInnerSubscriber(this));\n }\n}\n","import { AfterViewInit, Component, OnDestroy } from '@angular/core';\nimport { fromEvent, Observable, Subject, timer } from 'rxjs';\nimport { map, repeatWhen, takeUntil } from 'rxjs/operators';\nimport { UniversalService } from 'src/app/shared/universal/universal.service';\n\n@Component({\n selector: 'mt-how-it-works',\n templateUrl: './how-it-works.component.html',\n styleUrls: ['./how-it-works.component.scss'],\n})\nexport class HowItWorksComponent implements AfterViewInit, OnDestroy {\n public selectedContainerId = 0;\n public carouselImages = [\n '/assets/how-it-works/timeline-first.png',\n '/assets/how-it-works/timeline-second.png',\n '/assets/how-it-works/timeline-third.png',\n '/assets/how-it-works/timeline-fourth.png',\n '/assets/how-it-works/timeline-fifth.png',\n ];\n private observable$: Observable;\n private readonly _stop = new Subject();\n private readonly _start = new Subject();\n private readonly ngDestroy = new Subject();\n private readonly interval = 3500;\n\n constructor(\n private universalService: UniversalService,\n ) {}\n\n public ngAfterViewInit() {\n if (!this.universalService.isPlatformServer()) {\n const element = document.getElementsByClassName('section__step');\n const mouseenter$ = fromEvent(element, 'mouseenter');\n const mouseleave$ = fromEvent(element, 'mouseleave');\n\n mouseenter$.subscribe(() => this.stop());\n mouseleave$.subscribe(() => this.start());\n this.observable$ = timer(this.interval, this.interval)\n .pipe(\n map(thing => thing as any),\n takeUntil(this._stop),\n repeatWhen(() => this._start),\n );\n\n this.observable$.subscribe(() => this.next());\n }\n }\n\n public selectContainer(selected: number) {\n this.selectedContainerId = selected;\n }\n\n public getCorrectImagePosition(index: number) {\n if (index === 0) {\n return 'section__image--first';\n } else if (index === 1) {\n return 'section__image--second';\n } else if (index === 2) {\n return 'section__image--third';\n } else if (index === 3) {\n return 'section__image--fourth';\n } else if (index === 4) {\n return 'section__image--fifth';\n } else return '';\n }\n\n public ngOnDestroy() {\n this.ngDestroy.next();\n this.ngDestroy.complete();\n }\n\n private start(): void {\n this._start.next();\n }\n\n private stop(): void {\n this._stop.next();\n }\n\n private next() {\n if (this.selectedContainerId === 4) {\n this.selectedContainerId = 0;\n } else {\n this.selectedContainerId = this.selectedContainerId + 1;\n }\n }\n}\n","
\n

Mytitling process step by step

\n \n
\n
\n
\n
\n

Validation hash saved onto blockchain

\n

We create a code of your file and store it on blockchain.\n This step is verified by a digital timestamp, which identifies the date stored.

\n
\n
\n

Download your ownership certificate

\n

The ownership certificate carries the information about your stored files and your personal ID.\n It serves as a legal proof oof your ownership in case it is questioned or misused.

\n
\n
\n
\n
\n
\n

Personal account & uploaded files

\n

Create your personal account and choose a plan which fits your needs.\n Simply upload the file from your computer.\n Now your files are safely stored and encrypted on this private storage.

\n
\n
\n

Get the digital stamp

\n

The digital timestamp is a protection tool, which serves as the identificator.\n Such timestamp allows to recognise the encrypted version of your stored data.

\n
\n
\n

Have a lifelong protection of your work

\n

With this ownership proof you do not have to worry any longer.\n Via blockchain, Mytitle helps to protect what is rightfully yours permanently.

\n
\n
\n
\n
\n \"\"\n \"\"\n\n
\n
\n \n
\n
\n
\n

Validation hash saved onto blockchain

\n

We create a code of your file and store it on blockchain.\n This step is verified by a digital timestamp, which identifies the date stored.

\n
\n
\n

Download your ownership certificate

\n

The ownership certificate carries the information about your stored files and your personal ID.\n It serves as a legal proof oof your ownership in case it is questioned or misused.

\n
\n
\n

Personal account & uploaded files

\n

Create your personal account and choose a plan which fits your needs.\n Simply upload the file from your computer.\n Now your files are safely stored and encrypted on this private storage.

\n
\n
\n

Get the digital stamp

\n

The digital timestamp is a protection tool, which serves as the identificator.\n Such timestamp allows to recognise the encrypted version of your stored data.

\n
\n
\n

Have a lifelong protection of your work

\n

With this ownership proof you do not have to worry any longer.\n Via blockchain, Mytitle helps to protect what is rightfully yours permanently.

\n
\n
\n
\n
","
\n
\n
\n

Pricing

\n

\n Get your certificate for only\n {{ oneCredit }}. \n Protect your intellectual property or valuable files.\n

\n

Check out our price packages

\n
\n
\n
\n
\n
\n

Trial

\n
\n
\n \"\"\n
\n \n

Try for

\n

Free

\n
\n
\n
\n \n \n \n
\n
\n
\n
\n
\n
\n \"\"\n

Free

\n
\n
\n \"\"\n

\n Up to\n 50 MB \n per file\n

\n
\n
\n \"\"\n

Litecoin Testnet blockchain

\n
\n
\n \"\"\n

\n Encrypted backup for \n 3 months\n

\n
\n
\n
\n
\n
\n \n \n
\n \n

\n Best offer

\n

{{ bundle.credits_count }}\n credit\n 1\" i18n=\"@@credits\">credits\n

\n {{ removeDecimals(bundle.total_price) }} {{ getCurrencySign(bundle.currency) }}\n

\n
\n
\n
\n Best offer\n
\n \n \n
\n
\n
\n \"\"\n

Litecoin blockchain

\n
\n
\n \"\"\n

\n Up to\n 500 MB \n per file\n

\n
\n
\n \"\"\n

\n Encrypted backup for \n 10 years\n

\n
\n
\n \"\"\n

Requires valid ISIC/ITIC card

\n
\n
\n
\n
\n \"\"\n

Full owners identification

\n
\n
\n \"\"\n

Digital Fingerprint

\n
\n
\n \"\"\n

Blockchain Timestamp

\n
\n
\n
\n
\n
\n
\n
\n \n
\n
\n
\n
\n

Which files can you upload?

\n

\n Any digital content. Any formatted ideas, contracts, wills, financial documents, e-books, screenplays, articles,\n art design, mp3 and more.\n The options are endless.

\n
\n
\n
\n \"image-icon\"\n \"code-icon\"\n \"pdf-icon\"\n \"excel-icon\"\n \"video-icon\"\n \"psd-icon\"\n \"doc-icon\"\n \"camera-icon\"\n
\n
\n","import { MediaMatcher } from '@angular/cdk/layout';\nimport { Component, OnDestroy } from '@angular/core';\nimport { select, Store } from '@ngrx/store';\nimport { combineLatest, Observable, Subject } from 'rxjs';\nimport { filter, map, takeUntil } from 'rxjs/operators';\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport {\n GetCreditBundles,\n GetCreditOrderSummary,\n} from 'src/app/app/states/actions/credit-bundle-choice.actions';\nimport { FileUpdated, SelectDocumentPrice } from 'src/app/app/states/actions/file.action';\nimport { AppState } from 'src/app/app/states/models/app.models';\nimport { getCreditBundles } from 'src/app/app/states/selectors/credit-bundle-choice.selectors';\nimport { GetUserInfo } from 'src/app/auth/store/actions/getUserInfo.action';\nimport { LimitExceeded } from 'src/app/auth/store/models/user';\nimport {\n getGeoIPState,\n getIsAuthorized,\n getIsValidAcademy,\n getIsEU,\n limitExceededState,\n} from 'src/app/auth/store/selectors/user.selector';\nimport { CreateCreditOrderParams, CreditConfig } from 'src/app/client/models/credit.models';\nimport {\n getCurrencySign,\n removeDecimals,\n} from 'src/app/pages/credit-bundle-choice/credit-bundle-choice.utils';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { EnvironmentService } from 'src/app/shared/services/environment.service';\nimport { SnackbarService } from 'src/app/shared/services/snackbar.service';\n\n@Component({\n selector: 'mt-pricing',\n templateUrl: './pricing.component.html',\n styleUrls: ['./pricing.component.scss'],\n})\nexport class PricingComponent implements OnDestroy {\n public readonly isLoadingBundles: Observable;\n public readonly isLoggedIn$: Observable;\n public readonly getCurrencySign = getCurrencySign;\n public readonly removeDecimals = removeDecimals;\n public readonly appRoutes = AppRoutes;\n public limitExceededState: LimitExceeded;\n public bundles: CreditConfig[];\n public filteredBundles: CreditConfig[];\n public selectedContainerId = 0;\n public showBestOffer = false;\n public isSmallScreen = false;\n public oneCredit = '5 €';\n public bestOfferCreditIndex = 0;\n public pricingTables = ['Standard', 'Academy'];\n public selectedPricing: Number;\n\n private ngDestroy$ = new Subject();\n\n constructor(\n public enviService: EnvironmentService,\n private media: MediaMatcher,\n private store: Store,\n private snackbarService: SnackbarService,\n ) {\n this.isLoggedIn$ = this.store.pipe(select(getIsAuthorized));\n this.isSmallScreen = this.media.matchMedia('(max-width: 768px)').matches;\n\n this.store.pipe(\n select(limitExceededState),\n ).subscribe(s => this.limitExceededState = s);\n\n this.store.dispatch(new GetUserInfo());\n this.store.dispatch(new GetCreditBundles());\n\n combineLatest([\n this.store.select(getCreditBundles).pipe(\n filter(bundles => !!bundles),\n ),\n this.store.select(getGeoIPState),\n this.store.select(getIsEU),\n this.store.select(getIsValidAcademy),\n ]).pipe(\n map(([bundles, _, isEU, isValidAcademy]) => {\n this.selectedPricing = isValidAcademy ? 1 : 0\n let filteredBundles = [];\n if (this.enviService.isCzechEnvironment) {\n filteredBundles = bundles.filter(bundle =>\n bundle.currency === 'CZK');\n this.oneCredit = '100 Kč';\n } else {\n let currency = '';\n if (isEU) {\n currency = 'EUR';\n this.oneCredit = '5 €';\n } else {\n currency = 'USD';\n this.oneCredit = '5 $';\n }\n filteredBundles = bundles.filter(bundle => bundle.currency === currency);\n }\n return [filteredBundles] as [CreditConfig[]];\n },\n takeUntil(this.ngDestroy$)),\n ).subscribe(([bundles]) => {\n this.bundles = bundles;\n this.filterBundles();\n });\n }\n\n public fileAdded(file: File, isFree: boolean) {\n if (this.limitExceededState.isLimitExceeded && isFree) {\n if (!this.limitExceededState.wasWarningShown) {\n this.snackbarService.queueSnackBar(\n 'Free quota exceeded', { triggerAction: 'FREE_LIMIT_WARNING_SHOWN' });\n } else {\n this.snackbarService.queueSnackBar(Notifications.QuotaExceeded);\n }\n } else {\n this.store.dispatch(new FileUpdated({\n file,\n folder: null,\n is_free: isFree,\n uploadNow: true,\n },\n ));\n if (isFree) {\n this.store.dispatch(new SelectDocumentPrice({ is_free: isFree }));\n }\n }\n }\n\n public pickCreditBundle(bundleGuid: string) {\n const params: CreateCreditOrderParams = {\n config_guid: bundleGuid,\n };\n this.store.dispatch(new GetCreditOrderSummary(params));\n }\n\n public selectContainer(id: number) {\n this.selectedContainerId = id;\n this.showBestOffer = id === this.bestOfferCreditIndex;\n }\n\n public isContainerSelected(id: number) {\n return id === this.selectedContainerId;\n }\n\n public ngOnDestroy() {\n this.ngDestroy$.next();\n this.ngDestroy$.complete();\n }\n\n private getBestOfferCredit() {\n const results: number[] = [];\n this.filteredBundles.forEach(x => {\n results.push(this.getOneCreditPrice(x));\n });\n\n this.bestOfferCreditIndex = results.indexOf(Math.min(...results));\n }\n\n private getOneCreditPrice(bundle: CreditConfig): number {\n const bundlePrice = parseFloat(bundle.total_price);\n return bundlePrice / bundle.credits_count;\n }\n\n public defineBestOffer() {\n this.getBestOfferCredit();\n this.selectedContainerId = this.bestOfferCreditIndex;\n this.showBestOffer = this.selectedContainerId >= 0\n }\n\n public filterBundles() {\n this.filteredBundles = this.bundles.filter(bundle => bundle.is_academy === (this.selectedPricing === 1))\n this.defineBestOffer()\n }\n}\n","// eslint-disable-next-line max-len\n// https://github.com/trendster-io/ng-lazy-image/blob/master/projects/ng-lazy-image/src/lib/lazy-image.directive.ts\nimport { Directive, ElementRef, Input, OnDestroy, OnInit, Renderer2 } from '@angular/core';\nimport { UniversalService } from '../../universal/universal.service';\n\nexport type AnimationName = 'fadeInLeft' | 'fadeInRight' | 'fadeInUp' | 'bounceInTop';\n\n@Directive({\n // eslint-disable-next-line @angular-eslint/directive-selector\n selector: '[scrollAnimate]',\n})\nexport class AnimationOnScrollDirective implements OnInit, OnDestroy {\n @Input() public animationName: AnimationName = 'fadeInUp';\n\n @Input() public root: Element;\n @Input() public rootMargin: string;\n @Input() public threshold: number | number[] = 0.7;\n\n // default visibility to false\n public isVisible = false;\n\n private intersectionObserver: IntersectionObserver;\n private intersectionObserverVisibility: IntersectionObserver;\n\n constructor(\n private el: ElementRef,\n private renderer: Renderer2,\n private universalService: UniversalService,\n ) {\n }\n\n public ngOnInit(): void {\n this.addIntersectionObserver();\n }\n\n public ngOnDestroy(): void {\n if (this.intersectionObserver) {\n this.removeIntersectionObserver();\n }\n }\n\n private addIntersectionObserver(): void {\n // Check if window is defined to handle SSR, as well as check for IntersectionObserever\n // support in the browser\n if (this.isBrowserWithIntersectionObserver()) {\n this.registerForAnimation();\n }\n }\n\n private isBrowserWithIntersectionObserver(): boolean {\n return !this.universalService.isPlatformServer() && 'IntersectionObserver' in window;\n }\n\n private registerForAnimation(): void {\n // Remove any previous observer if exists\n if (this.intersectionObserver) this.removeIntersectionObserver();\n\n this.intersectionObserver = new IntersectionObserver(\n entry => {\n // because there will only ever be one instance\n // of the element we are observing\n // we can just use entry[0]\n if (entry[0].isIntersecting) {\n this.addAnimationClass();\n this.removeIntersectionObserver();\n }\n },\n {\n root: this.root,\n rootMargin: this.rootMargin,\n threshold: this.threshold,\n },\n );\n this.intersectionObserver.observe(this.el.nativeElement);\n\n this.intersectionObserverVisibility = new IntersectionObserver(\n entry => {\n // because there will only ever be one instance\n // of the element we are observing\n // we can just use entry[0]\n if (entry[0].isIntersecting) {\n if (!this.isVisible) {\n this.setClass('not-visible');\n }\n this.removeIntersectionObserverVisibility();\n }\n },\n {\n root: this.root,\n // the 60px bottom margin makes the intersection event trigger sooner and thus set the\n // visibility to 'hidden', preventing a flickering effect\n rootMargin: '0px 0px 100px 0px',\n threshold: 0,\n },\n );\n this.intersectionObserverVisibility.observe(this.el.nativeElement);\n }\n\n // utility function to mark element visible and add css class\n private addAnimationClass(): void {\n // mark this element visible, we won't remove the class after this\n this.isVisible = true;\n this.setClass('visible');\n // use default for animate.css if no value provided\n this.setClass(this.animationName);\n }\n\n // utility function to add one or more css classes to element in DOM\n private setClass(classes: string): void {\n for (const c of classes.split(' ')) {\n this.renderer.addClass(this.el.nativeElement, c);\n }\n }\n\n private removeIntersectionObserver() {\n this.intersectionObserver.disconnect();\n this.intersectionObserver = null;\n }\n\n private removeIntersectionObserverVisibility() {\n this.intersectionObserverVisibility.disconnect();\n this.intersectionObserverVisibility = null;\n }\n}\n","
\n

We help protect the world's intellectual property

\n
\n \"\"\n\n \"\"\n\n\n \"\"\n\n\n \"\"\n\n
\n
\n","import { Component } from '@angular/core';\nimport { UniversalService } from 'src/app/shared/universal/universal.service';\n\n@Component({\n selector: 'mt-map',\n templateUrl: './map.component.html',\n styleUrls: ['./map.component.scss'],\n})\nexport class MapComponent {\n public isFinished = false;\n public readonly mediumPinNumberArray = [...Array(19).keys()];\n public readonly largePinNumberArray = [...Array(4).keys()];\n public readonly smallPinNumberArray = [...Array(16).keys()];\n\n constructor(\n public uniService: UniversalService,\n ) {}\n\n public isInViewport(element: Element) {\n const rect = element.getBoundingClientRect();\n return (\n rect.top >= 0 &&\n rect.left >= 0 &&\n rect.bottom <= (window.innerHeight || document.documentElement.clientHeight) &&\n rect.right <= (window.innerWidth || document.documentElement.clientWidth)\n );\n }\n\n}\n","import { MediaMatcher } from '@angular/cdk/layout';\nimport { Component, OnDestroy } from '@angular/core';\nimport { Store } from '@ngrx/store';\nimport { Subject } from 'rxjs';\nimport { AppState } from 'src/app/app/states/models/app.models';\nimport { EnvironmentService } from 'src/app/shared/services/environment.service';\nimport { UniversalService } from 'src/app/shared/universal/universal.service';\n\n@Component({\n selector: 'mt-blog-section',\n templateUrl: './blog-section.component.html',\n styleUrls: ['./blog-section.component.scss'],\n})\nexport class BlogSectionComponent implements OnDestroy {\n public selectedContainerId = 0;\n\n public carouselImages = [\n '/assets/blog-section/article-one.svg',\n '/assets/blog-section/article-two.svg',\n '/assets/blog-section/article-three.svg',\n '/assets/blog-section/article-four.svg',\n ];\n\n public carouselImagesMb = [\n '/assets/blog-section/article-mobile-one.png',\n '/assets/blog-section/article-mobile-two.png',\n '/assets/blog-section/article-mobile-three.png',\n '/assets/blog-section/article-mobile-four.png',\n ];\n\n public carouselHeadline = [\n '3 Reasons to Protect Your IP',\n 'How to protect ideas and inventions?',\n 'How to protect your artwork?',\n 'How to protect your text and literary work?',\n ];\n\n public carouselHeadlineCs = [\n 'Digitální certifikace vlastnictví dat',\n 'Chraňte svou hudební tvorbu',\n 'Blockchain pro ochranu vašeho vlastnictví',\n 'Jak zabezpečit umělecké portfolio?',\n ];\n\n public hashtags = [\n '#intellectualproperty',\n '#infringement',\n '#artwork',\n '#textprotection',\n ];\n\n public hastagsCs = [\n '#digitalnicertifikace',\n '#hudba',\n '#blockchain',\n '#grafika',\n ];\n\n private ngDestroy = new Subject();\n\n constructor(\n public store: Store,\n private media: MediaMatcher,\n private enviService: EnvironmentService,\n private uniService: UniversalService,\n ) {\n if (!this.uniService.isPlatformServer()) {\n if (this.enviService.isCzechEnvironment) {\n this.carouselHeadline = this.carouselHeadlineCs;\n this.hashtags = this.hastagsCs;\n }\n }\n if (this.media.matchMedia('(max-width: 768px)').matches) {\n this.carouselImages = this.carouselImagesMb;\n }\n }\n\n public selectContainer(selected: any) {\n this.selectedContainerId = selected.index;\n }\n\n public ngOnDestroy() {\n this.ngDestroy.next();\n this.ngDestroy.complete();\n }\n}\n","
\n \"\"\n
\n

{{ carouselHeadline[selectedContainerId] }}

\n \n \n

The moment a new idea finds its form is something that creatives live for.\n Let's make sure that the original idea stays protected.

\n
\n \n

Whether it is possible to copyright ideas and how to protect your work from copyright infringement.

\n
\n \n

Has someone else taken credits for your creations? Yes.\n Will you be able to prove that that was actually yours to start with?

\n
\n \n

Wandering in your inner bubble of creativity?\n Take care of the safety of your artwork so you can give it further purpose.

\n
\n
\n
\n
\n","
\n \n
\n\n
\n
\n

\n Get an ownership certificate of your intellectual property\n

\n
\n\n
\n \"certificate\"\n
\n \n
\n \"certificate\"\n \"certificate\"\n\n \"certificate\"\n\n \"certificate\"\n\n \"certificate\"\n\n\n\n
\n \"\"\n\n
\n

The author, time and location

\n

Who owns it.

\n
\n
\n
\n \"\"\n\n
\n

Explanation

\n

How the stamp was created.

\n
\n
\n
\n \"\"\n\n
\n

Verification link

\n

Anyone can check the file authorship.

\n
\n
\n
\n \"\"\n\n
\n

Digital fingerprint

\n

Globally unique identifier.

\n
\n
\n
\n
\n","import { ChangeDetectionStrategy, Component } from '@angular/core';\nimport { Store } from '@ngrx/store';\nimport { OpenVideoDialog } from 'src/app/auth/store/actions/getUserInfo.action';\nimport { AppState } from '../../states/models/app.models';\n\n@Component({\n selector: 'mt-certificate',\n templateUrl: './certificate.component.html',\n styleUrls: ['./certificate.component.scss'],\n changeDetection: ChangeDetectionStrategy.OnPush,\n})\nexport class CertificateComponent {\n public selectedContainerId: number;\n\n constructor(\n public store: Store,\n ) {}\n\n public openVideoDialog() {\n this.store.dispatch(new OpenVideoDialog());\n }\n\n public selectContainer(selected: number) {\n this.selectedContainerId = selected;\n }\n\n public isContainerSelected(selected: number) {\n return this.selectedContainerId === selected;\n }\n}\n","
\n \n \"\"\n
\n
\n
\n

\n Intellectual property protection\n & Ownership certification of your files\n

\n
\n
\n
\n \"image-icon\"\n\n \"code-icon\"\n\n \"pdf-icon\"\n\n \"excel-icon\"\n\n \"doc-icon\"\n\n \"doc-icon\"\n\n \"doc-icon\"\n\n \"camera-icon\"\n\n
\n
\n \n \n Try for free\n \n \n \n \n Mytitle it\n \n \n
\n
\n
\n
\n\n","import { Component } from '@angular/core';\nimport { select, Store } from '@ngrx/store';\nimport { Observable } from 'rxjs';\nimport { FileUpdated, SelectDocumentPrice } from 'src/app/app/states/actions/file.action';\nimport { AppState } from 'src/app/app/states/models/app.models';\nimport { LimitExceeded } from 'src/app/auth/store/models/user';\nimport { getIsAuthorized } from 'src/app/auth/store/selectors/user.selector';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { SnackbarService } from 'src/app/shared/services/snackbar.service';\n\n@Component({\n selector: 'mt-quoted-header',\n templateUrl: './quoted-header.component.html',\n styleUrls: ['./quoted-header.component.scss'],\n})\nexport class QuotedHeaderComponent {\n public isLoggedIn: Observable;\n public priceRange: Observable;\n public isMobile: MediaQueryList;\n public limitExceededState: LimitExceeded;\n\n constructor(\n public store: Store,\n public snackbarService: SnackbarService,\n ) {\n this.isLoggedIn = this.store.pipe(select(getIsAuthorized));\n }\n\n public fileAdded(file: File, isFree: boolean) {\n if (this.limitExceededState && this.limitExceededState.isLimitExceeded) {\n if (!this.limitExceededState.wasWarningShown) {\n this.snackbarService.queueSnackBar(\n Notifications.QuotaExceeded, { triggerAction: 'FREE_LIMIT_WARNING_SHOWN' });\n } else {\n this.snackbarService.queueSnackBar(Notifications.QuotaExceeded);\n }\n } else {\n this.store.dispatch(new FileUpdated({\n file,\n folder: null,\n is_free: isFree,\n uploadNow: true,\n },\n ));\n this.store.dispatch(new SelectDocumentPrice({ is_free: isFree }));\n }\n }\n}\n","import { Component } from '@angular/core';\nimport { EnvironmentService } from 'src/app/shared/services/environment.service';\nimport { UniversalService } from 'src/app/shared/universal/universal.service';\n\n@Component({\n selector: 'mt-testimonials',\n templateUrl: './testimonials.component.html',\n styleUrls: ['./testimonials.component.scss'],\n})\nexport class TestimonialsComponent {\n constructor(\n private enviService: EnvironmentService,\n private uniService: UniversalService,\n ) { }\n\n public getEntrepreneurArticle() {\n if (!this.uniService.isPlatformServer()) {\n if (this.enviService.isCzechEnvironment) {\n return 'https://mytitle.cz/blog/podnikatele-chrante-sve-intelektualni-vlastnictvi';\n }\n }\n return 'https://mytitle.com/blog/to-all-the-entrepreneurs';\n }\n\n public getDesignerArticle() {\n if (!this.uniService.isPlatformServer()) {\n if (this.enviService.isCzechEnvironment) {\n return 'https://mytitle.cz/blog/grafici-budte-si-svym-vlastnim-panem';\n }\n }\n return 'https://mytitle.com/blog/what-gives-your-creations-and-designs-value';\n }\n\n public getMusicianArticle() {\n if (!this.uniService.isPlatformServer()) {\n if (this.enviService.isCzechEnvironment) {\n return 'https://mytitle.cz/blog/jsem-skladatel-ktery-si-nenecha-svou-praci-nekym-ukrast';\n }\n }\n return 'https://mytitle.com/blog/the-one-note-script-that-may-have-changed-your-life';\n }\n\n public getWriterArticle() {\n if (!this.uniService.isPlatformServer()) {\n if (this.enviService.isCzechEnvironment) {\n return 'https://mytitle.cz/blog/byt-spisovatelem-je-nelehke-a-prave-proto-chrante-svou-praci';\n }\n }\n return 'https://mytitle.com/blog/stories-protected';\n }\n\n public getDeveloperArticle() {\n if (!this.uniService.isPlatformServer()) {\n if (this.enviService.isCzechEnvironment) {\n return 'https://mytitle.cz/blog/opatrny-vyvojar-uspesny-vyvojar';\n }\n }\n return 'https://mytitle.com/blog/codes-worth-protecting';\n }\n\n public getBlog() {\n if (!this.uniService.isPlatformServer()) {\n if (this.enviService.isCzechEnvironment) {\n return 'https://mytitle.cz/blog/';\n }\n }\n return 'https://mytitle.com/blog/';\n }\n}\n","\n
\n
\n \"\"\n

To whom Mytitle helps to protect their work?

\n Learn more\n \"blog\n \n
\n \n \n \n \n \n
\n\n
\n \n \"blog\n

To whom Mytitle helps to protect their work?

\n
Learn more\n \"blog\n \n \n \n \n \n \n \n
","import { Component } from '@angular/core';\n\n@Component({\n selector: 'mt-home',\n templateUrl: './home.component.html',\n styleUrls: ['./home.component.scss'],\n})\nexport class HomeComponent {}\n","\r\n \r\n \r\n \r\n \r\n \r\n \r\n \r\n \r\n \r\n\r\n\r\n\r\n","import { Injectable } from '@angular/core';\r\nimport { CanActivate, Router, UrlTree } from '@angular/router';\r\nimport { Store } from '@ngrx/store';\r\nimport { forkJoin, Observable } from 'rxjs';\r\nimport { first, map, switchMap } from 'rxjs/operators';\r\nimport { getRegistered } from 'src/app/auth/store/selectors/register.selector';\r\nimport { LoginErrorsEnum } from '../../auth/store/models/user';\r\nimport { getLoginError } from '../../pages/login/store/login.selector';\r\nimport { AppRoutes } from '../app.routes.misc';\r\n\r\n@Injectable({\r\n providedIn: 'root',\r\n})\r\nexport class ConfirmEmailGuardService implements CanActivate {\r\n\r\n constructor(\r\n private router: Router,\r\n private store: Store,\r\n ) {\r\n }\r\n\r\n public canActivate(): Observable {\r\n return this.store.pipe(\r\n switchMap(() => forkJoin([\r\n this.store.select(getRegistered).pipe(first()),\r\n this.store.select(getLoginError).pipe(first()),\r\n ])),\r\n map(([registered, loginError]) => {\r\n if (loginError && loginError[0].code === LoginErrorsEnum.REGISTRATION_NOT_FINISHED) {\r\n return true;\r\n } else if (registered) {\r\n localStorage.removeItem('campaign_code');\r\n return true;\r\n } else {\r\n return this.router.createUrlTree(['/', AppRoutes.SignUp]);\r\n }\r\n }),\r\n );\r\n }\r\n}\r\n","import { Injectable } from '@angular/core';\nimport { CanActivate, Router, UrlTree } from '@angular/router';\nimport { Store } from '@ngrx/store';\nimport { forkJoin, Observable } from 'rxjs';\nimport { first, map, take } from 'rxjs/operators';\nimport { getRouterState } from 'src/app/app/states/selectors/router.selectors';\nimport { getFileState } from '../states/selectors/file.selectors';\n\n@Injectable({\n providedIn: 'root',\n})\nexport class CreditFileGuardService implements CanActivate {\n\n constructor(\n private router: Router,\n private store: Store,\n ) {\n }\n\n public canActivate(): Observable {\n return forkJoin([\n this.store.select(getFileState).pipe(first()),\n this.store.select(getRouterState).pipe(first()),\n ])\n .pipe(\n map(([fileState, routerState]) => [!!fileState.file, !!routerState.queryParams.fileFlow]),\n take(1),\n map(([isFilePresent, isInFileFlow]) => {\n if (isInFileFlow && !isFilePresent) {\n return this.router.createUrlTree(['/']);\n } else {\n return true;\n }\n }),\n );\n }\n}\n","import { Injectable } from '@angular/core';\nimport { CanActivate, Router, UrlTree } from '@angular/router';\nimport { Store } from '@ngrx/store';\nimport { forkJoin, Observable } from 'rxjs';\nimport { first, map, take } from 'rxjs/operators';\nimport { getUpgradingFolder } from 'src/app/pages/my-documents/store/selectors/folder.selectors';\nimport { getFileState, isUpgradingFile } from '../states/selectors/file.selectors';\n\n@Injectable({\n providedIn: 'root',\n})\nexport class DocumentGuardService implements CanActivate {\n\n constructor(\n private router: Router,\n private store: Store,\n ) {}\n\n public canActivate(): Observable {\n return forkJoin([\n this.store\n .select(getFileState)\n .pipe(\n map(fileState => !!fileState.file),\n first()),\n this.store\n .select(isUpgradingFile)\n .pipe(\n first()),\n this.store\n .select(getUpgradingFolder)\n .pipe(\n map(folder => !!folder),\n first()),\n ]).pipe(\n take(1),\n map(([isFilePresent, isBeingUpgraded, folder]) => {\n if (!isFilePresent && !isBeingUpgraded && !folder) return this.router.createUrlTree(['/']);\n else return true;\n }),\n );\n }\n}\n","import { Injectable } from '@angular/core';\nimport { CanActivate, Router, UrlTree } from '@angular/router';\nimport { select, Store } from '@ngrx/store';\nimport { forkJoin, Observable } from 'rxjs';\nimport { map, take } from 'rxjs/operators';\nimport { getIsAuthorized } from '../../auth/store/selectors/user.selector';\nimport { AppRoutes } from '../app.routes.misc';\nimport { isCreatingOrder } from '../states/selectors/credit-bundle-choice.selectors';\nimport { getFileState } from '../states/selectors/file.selectors';\nimport { getRouterState } from '../states/selectors/router.selectors';\n\n@Injectable({\n providedIn: 'root',\n})\nexport class PreventAuthorizedVisitorGuardService implements CanActivate {\n\n constructor(\n private router: Router,\n private store: Store,\n ) { }\n\n public canActivate(): Observable {\n return forkJoin([\n this.store.pipe(select(getIsAuthorized), take(1)),\n this.store.pipe(select(getRouterState), take(1)),\n this.store.pipe(select(getFileState), take(1)),\n this.store.pipe(select(isCreatingOrder), take(1)),\n ]).pipe(\n map(([isAuthorized, routerState, fileState, isCreatingCreditOrder]) => {\n if (isAuthorized) {\n // is authorized and is is not in file or credit workflow\n if ((!routerState.queryParams.fileFlow && !routerState.queryParams.creditFlow) ||\n // is authorized and has fileFlow param but doesnt have file in store (app re-init)\n (routerState.queryParams.fileFlow && !fileState.file) ||\n // is authorized and has creditFlow param but is\n // not currently creating credit order (app re-init)\n (routerState.queryParams.creditFlow && !isCreatingCreditOrder)) {\n return this.router.createUrlTree(['/', AppRoutes.MyDocuments]);\n }\n }\n\n return true;\n }),\n );\n }\n}\n","/* eslint-disable max-len */\n\nimport { Route } from '@angular/router';\nimport { FaqComponent } from '../pages/faq/faq.component';\nimport { AppRoutes } from './app.routes.misc';\nimport { HomeComponent } from './home/home.component';\nimport { AuthGuardService } from './services/auth-guard.service';\nimport { ConfirmEmailGuardService } from './services/confirm-email-guard.service';\nimport { CreditFileGuardService } from './services/credit-file-guard.service';\nimport { DocumentGuardService } from './services/document-guard.service';\nimport { PreventAuthorizedVisitorGuardService } from './services/prevent-authorized-visitor.service';\n\n/**\n * Root app routes.\n */\nexport const appRoutes: Route[] = [\n {\n path: '',\n component: HomeComponent,\n data: {\n title: {\n en: 'Mytitle | Blockchain notary',\n cs: 'Mytitle | Digitální notář',\n },\n description: {\n en: 'Mytitle provides encrypted document management and timestamps your files and ideas using the blockchain technology. Validate your ownership in just a minute!',\n cs: 'Mytitle poskytuje šifrovanou správu dokumentů a časová razítka vašich souborů a nápadů pomocí technologie blockchain. Ověřte své vlastnictví ještě dnes!',\n },\n },\n },\n {\n path: AppRoutes.MyDocuments,\n loadChildren: () => import('../pages/my-documents/my-documents.module').then(m => m.MyDocumentsModule),\n canActivate: [AuthGuardService],\n },\n {\n path: AppRoutes.FAQ,\n component: FaqComponent,\n },\n {\n path: AppRoutes.SignUp,\n loadChildren: () => import('../pages/sign-up/sign-up.module').then(m => m.SignUpModule),\n canActivate: [PreventAuthorizedVisitorGuardService],\n },\n {\n path: AppRoutes.Login,\n loadChildren: () => import('../pages/login/login.module').then(m => m.LoginModule),\n canActivate: [PreventAuthorizedVisitorGuardService],\n },\n {\n path: AppRoutes.Settings,\n loadChildren: () => import('../pages/settings/settings.module').then(m => m.SettingsModule),\n canActivate: [AuthGuardService],\n },\n {\n path: AppRoutes.EmailConfirmation,\n loadChildren: () => import('../pages/email-confirmation/email-confirmation.module').then(m => m.EmailConfirmationModule),\n canActivate: [ConfirmEmailGuardService],\n },\n {\n path: AppRoutes.CreditBundleChoice,\n loadChildren: () => import('../pages/credit-bundle-choice/credit-bundle-choice.module').then(m => m.CreditBundleChoiceModule),\n canActivate: [CreditFileGuardService],\n },\n {\n path: AppRoutes.CreditOrderSummary,\n loadChildren: () => import('../pages/credit-order-summary/credit-order-summary.module').then(m => m.CreditOrderSummaryModule),\n canActivate: [CreditFileGuardService],\n },\n {\n path: AppRoutes.PaymentConfirmation,\n loadChildren: () => import('../pages/payment-confirmation/payment-confirmation.module').then(m => m.PaymentConfirmationModule),\n canActivate: [AuthGuardService],\n },\n {\n path: AppRoutes.DocumentProgress,\n loadChildren: () => import('../pages/document-progress/document-progress.module').then(m => m.DocumentProgressModule),\n canActivate: [DocumentGuardService, AuthGuardService],\n },\n {\n path: AppRoutes.Verification,\n loadChildren: () => import('../pages/verification/verification.module').then(m => m.VerificationModule),\n },\n {\n path: AppRoutes.DocumentCredentials,\n loadChildren: () => import('../pages/document-credentials/document-credentials.module').then(m => m.DocumentCredentialsModule),\n canActivate: [AuthGuardService, DocumentGuardService],\n },\n {\n path: AppRoutes.FolderCredentials,\n loadChildren: () => import('../pages/folder-credentials/folder-credentials.module').then(m => m.FolderCredentialsModule),\n canActivate: [AuthGuardService, DocumentGuardService],\n },\n {\n path: AppRoutes.FolderUploadConfirmation,\n loadChildren: () => import('../pages/folder-upload-confirmation/folder-upload-confirmation.module').then(m => m.FolderUploadConfirmationModule),\n canActivate: [AuthGuardService],\n },\n {\n path: AppRoutes.FolderUploadCredentials,\n loadChildren: () => import('../pages/folder-upload-credentials/folder-upload-credentials.module').then(m => m.FolderUploadCredentialsModule),\n canActivate: [AuthGuardService],\n },\n {\n path: AppRoutes.FolderUploadProgress,\n loadChildren: () => import('../pages/folder-upload-progress/folder-upload-progress.module').then(m => m.FolderUploadProgressModule),\n canActivate: [AuthGuardService],\n },\n {\n path: AppRoutes.DeletionDocumentsConfirm,\n loadChildren: () => import('../pages/delete-documents-confirm/delete-documents-confirm.module').then(m => m.DeleteDocumentsConfirmModule),\n canActivate: [AuthGuardService],\n },\n {\n path: AppRoutes.WatermarkSelection,\n loadChildren: () => import('../pages/watermark-selection/watermark-selection.module').then(m => m.WatermarkSelectionModule),\n canActivate: [AuthGuardService],\n },\n {\n path: AppRoutes.About,\n loadChildren: () => import('../pages/about/about.module').then(m => m.AboutModule),\n },\n {\n path: AppRoutes.ResetPassword,\n loadChildren: () => import('../pages/reset-password/reset-password.module').then(m => m.ResetPasswordModule),\n },\n {\n path: AppRoutes.ResetPasswordConfirm,\n loadChildren: () => import('../pages/reset-password-confirm/reset-password-confirm.module').then(m => m.ResetPasswordConfirmModule),\n },\n {\n path: AppRoutes.Error,\n loadChildren: () => import('../pages/error/error.module').then(m => m.ErrorModule),\n },\n {\n path: AppRoutes.NotFound,\n loadChildren: () => import('../pages/error/error.module').then(m => m.ErrorModule),\n },\n];\n","/**\n * @license Angular v15.2.9\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport { ɵAnimationGroupPlayer, NoopAnimationPlayer, AUTO_STYLE, ɵPRE_STYLE, sequence, style } from '@angular/animations';\nimport * as i0 from '@angular/core';\nimport { ɵRuntimeError, Injectable } from '@angular/core';\n\nconst LINE_START = '\\n - ';\nfunction invalidTimingValue(exp) {\n return new ɵRuntimeError(3000 /* RuntimeErrorCode.INVALID_TIMING_VALUE */, ngDevMode && `The provided timing value \"${exp}\" is invalid.`);\n}\nfunction negativeStepValue() {\n return new ɵRuntimeError(3100 /* RuntimeErrorCode.NEGATIVE_STEP_VALUE */, ngDevMode && 'Duration values below 0 are not allowed for this animation step.');\n}\nfunction negativeDelayValue() {\n return new ɵRuntimeError(3101 /* RuntimeErrorCode.NEGATIVE_DELAY_VALUE */, ngDevMode && 'Delay values below 0 are not allowed for this animation step.');\n}\nfunction invalidStyleParams(varName) {\n return new ɵRuntimeError(3001 /* RuntimeErrorCode.INVALID_STYLE_PARAMS */, ngDevMode &&\n `Unable to resolve the local animation param ${varName} in the given list of values`);\n}\nfunction invalidParamValue(varName) {\n return new ɵRuntimeError(3003 /* RuntimeErrorCode.INVALID_PARAM_VALUE */, ngDevMode && `Please provide a value for the animation param ${varName}`);\n}\nfunction invalidNodeType(nodeType) {\n return new ɵRuntimeError(3004 /* RuntimeErrorCode.INVALID_NODE_TYPE */, ngDevMode && `Unable to resolve animation metadata node #${nodeType}`);\n}\nfunction invalidCssUnitValue(userProvidedProperty, value) {\n return new ɵRuntimeError(3005 /* RuntimeErrorCode.INVALID_CSS_UNIT_VALUE */, ngDevMode && `Please provide a CSS unit value for ${userProvidedProperty}:${value}`);\n}\nfunction invalidTrigger() {\n return new ɵRuntimeError(3006 /* RuntimeErrorCode.INVALID_TRIGGER */, ngDevMode &&\n 'animation triggers cannot be prefixed with an `@` sign (e.g. trigger(\\'@foo\\', [...]))');\n}\nfunction invalidDefinition() {\n return new ɵRuntimeError(3007 /* RuntimeErrorCode.INVALID_DEFINITION */, ngDevMode && 'only state() and transition() definitions can sit inside of a trigger()');\n}\nfunction invalidState(metadataName, missingSubs) {\n return new ɵRuntimeError(3008 /* RuntimeErrorCode.INVALID_STATE */, ngDevMode &&\n `state(\"${metadataName}\", ...) must define default values for all the following style substitutions: ${missingSubs.join(', ')}`);\n}\nfunction invalidStyleValue(value) {\n return new ɵRuntimeError(3002 /* RuntimeErrorCode.INVALID_STYLE_VALUE */, ngDevMode && `The provided style string value ${value} is not allowed.`);\n}\nfunction invalidProperty(prop) {\n return new ɵRuntimeError(3009 /* RuntimeErrorCode.INVALID_PROPERTY */, ngDevMode &&\n `The provided animation property \"${prop}\" is not a supported CSS property for animations`);\n}\nfunction invalidParallelAnimation(prop, firstStart, firstEnd, secondStart, secondEnd) {\n return new ɵRuntimeError(3010 /* RuntimeErrorCode.INVALID_PARALLEL_ANIMATION */, ngDevMode &&\n `The CSS property \"${prop}\" that exists between the times of \"${firstStart}ms\" and \"${firstEnd}ms\" is also being animated in a parallel animation between the times of \"${secondStart}ms\" and \"${secondEnd}ms\"`);\n}\nfunction invalidKeyframes() {\n return new ɵRuntimeError(3011 /* RuntimeErrorCode.INVALID_KEYFRAMES */, ngDevMode && `keyframes() must be placed inside of a call to animate()`);\n}\nfunction invalidOffset() {\n return new ɵRuntimeError(3012 /* RuntimeErrorCode.INVALID_OFFSET */, ngDevMode && `Please ensure that all keyframe offsets are between 0 and 1`);\n}\nfunction keyframeOffsetsOutOfOrder() {\n return new ɵRuntimeError(3200 /* RuntimeErrorCode.KEYFRAME_OFFSETS_OUT_OF_ORDER */, ngDevMode && `Please ensure that all keyframe offsets are in order`);\n}\nfunction keyframesMissingOffsets() {\n return new ɵRuntimeError(3202 /* RuntimeErrorCode.KEYFRAMES_MISSING_OFFSETS */, ngDevMode && `Not all style() steps within the declared keyframes() contain offsets`);\n}\nfunction invalidStagger() {\n return new ɵRuntimeError(3013 /* RuntimeErrorCode.INVALID_STAGGER */, ngDevMode && `stagger() can only be used inside of query()`);\n}\nfunction invalidQuery(selector) {\n return new ɵRuntimeError(3014 /* RuntimeErrorCode.INVALID_QUERY */, ngDevMode &&\n `\\`query(\"${selector}\")\\` returned zero elements. (Use \\`query(\"${selector}\", { optional: true })\\` if you wish to allow this.)`);\n}\nfunction invalidExpression(expr) {\n return new ɵRuntimeError(3015 /* RuntimeErrorCode.INVALID_EXPRESSION */, ngDevMode && `The provided transition expression \"${expr}\" is not supported`);\n}\nfunction invalidTransitionAlias(alias) {\n return new ɵRuntimeError(3016 /* RuntimeErrorCode.INVALID_TRANSITION_ALIAS */, ngDevMode && `The transition alias value \"${alias}\" is not supported`);\n}\nfunction validationFailed(errors) {\n return new ɵRuntimeError(3500 /* RuntimeErrorCode.VALIDATION_FAILED */, ngDevMode && `animation validation failed:\\n${errors.map(err => err.message).join('\\n')}`);\n}\nfunction buildingFailed(errors) {\n return new ɵRuntimeError(3501 /* RuntimeErrorCode.BUILDING_FAILED */, ngDevMode && `animation building failed:\\n${errors.map(err => err.message).join('\\n')}`);\n}\nfunction triggerBuildFailed(name, errors) {\n return new ɵRuntimeError(3404 /* RuntimeErrorCode.TRIGGER_BUILD_FAILED */, ngDevMode &&\n `The animation trigger \"${name}\" has failed to build due to the following errors:\\n - ${errors.map(err => err.message).join('\\n - ')}`);\n}\nfunction animationFailed(errors) {\n return new ɵRuntimeError(3502 /* RuntimeErrorCode.ANIMATION_FAILED */, ngDevMode &&\n `Unable to animate due to the following errors:${LINE_START}${errors.map(err => err.message).join(LINE_START)}`);\n}\nfunction registerFailed(errors) {\n return new ɵRuntimeError(3503 /* RuntimeErrorCode.REGISTRATION_FAILED */, ngDevMode &&\n `Unable to build the animation due to the following errors: ${errors.map(err => err.message).join('\\n')}`);\n}\nfunction missingOrDestroyedAnimation() {\n return new ɵRuntimeError(3300 /* RuntimeErrorCode.MISSING_OR_DESTROYED_ANIMATION */, ngDevMode && 'The requested animation doesn\\'t exist or has already been destroyed');\n}\nfunction createAnimationFailed(errors) {\n return new ɵRuntimeError(3504 /* RuntimeErrorCode.CREATE_ANIMATION_FAILED */, ngDevMode &&\n `Unable to create the animation due to the following errors:${errors.map(err => err.message).join('\\n')}`);\n}\nfunction missingPlayer(id) {\n return new ɵRuntimeError(3301 /* RuntimeErrorCode.MISSING_PLAYER */, ngDevMode && `Unable to find the timeline player referenced by ${id}`);\n}\nfunction missingTrigger(phase, name) {\n return new ɵRuntimeError(3302 /* RuntimeErrorCode.MISSING_TRIGGER */, ngDevMode &&\n `Unable to listen on the animation trigger event \"${phase}\" because the animation trigger \"${name}\" doesn\\'t exist!`);\n}\nfunction missingEvent(name) {\n return new ɵRuntimeError(3303 /* RuntimeErrorCode.MISSING_EVENT */, ngDevMode &&\n `Unable to listen on the animation trigger \"${name}\" because the provided event is undefined!`);\n}\nfunction unsupportedTriggerEvent(phase, name) {\n return new ɵRuntimeError(3400 /* RuntimeErrorCode.UNSUPPORTED_TRIGGER_EVENT */, ngDevMode &&\n `The provided animation trigger event \"${phase}\" for the animation trigger \"${name}\" is not supported!`);\n}\nfunction unregisteredTrigger(name) {\n return new ɵRuntimeError(3401 /* RuntimeErrorCode.UNREGISTERED_TRIGGER */, ngDevMode && `The provided animation trigger \"${name}\" has not been registered!`);\n}\nfunction triggerTransitionsFailed(errors) {\n return new ɵRuntimeError(3402 /* RuntimeErrorCode.TRIGGER_TRANSITIONS_FAILED */, ngDevMode &&\n `Unable to process animations due to the following failed trigger transitions\\n ${errors.map(err => err.message).join('\\n')}`);\n}\nfunction triggerParsingFailed(name, errors) {\n return new ɵRuntimeError(3403 /* RuntimeErrorCode.TRIGGER_PARSING_FAILED */, ngDevMode &&\n `Animation parsing for the ${name} trigger have failed:${LINE_START}${errors.map(err => err.message).join(LINE_START)}`);\n}\nfunction transitionFailed(name, errors) {\n return new ɵRuntimeError(3505 /* RuntimeErrorCode.TRANSITION_FAILED */, ngDevMode && `@${name} has failed due to:\\n ${errors.map(err => err.message).join('\\n- ')}`);\n}\n\n/**\n * Set of all animatable CSS properties\n *\n * @see https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_animated_properties\n */\nconst ANIMATABLE_PROP_SET = new Set([\n '-moz-outline-radius',\n '-moz-outline-radius-bottomleft',\n '-moz-outline-radius-bottomright',\n '-moz-outline-radius-topleft',\n '-moz-outline-radius-topright',\n '-ms-grid-columns',\n '-ms-grid-rows',\n '-webkit-line-clamp',\n '-webkit-text-fill-color',\n '-webkit-text-stroke',\n '-webkit-text-stroke-color',\n 'accent-color',\n 'all',\n 'backdrop-filter',\n 'background',\n 'background-color',\n 'background-position',\n 'background-size',\n 'block-size',\n 'border',\n 'border-block-end',\n 'border-block-end-color',\n 'border-block-end-width',\n 'border-block-start',\n 'border-block-start-color',\n 'border-block-start-width',\n 'border-bottom',\n 'border-bottom-color',\n 'border-bottom-left-radius',\n 'border-bottom-right-radius',\n 'border-bottom-width',\n 'border-color',\n 'border-end-end-radius',\n 'border-end-start-radius',\n 'border-image-outset',\n 'border-image-slice',\n 'border-image-width',\n 'border-inline-end',\n 'border-inline-end-color',\n 'border-inline-end-width',\n 'border-inline-start',\n 'border-inline-start-color',\n 'border-inline-start-width',\n 'border-left',\n 'border-left-color',\n 'border-left-width',\n 'border-radius',\n 'border-right',\n 'border-right-color',\n 'border-right-width',\n 'border-start-end-radius',\n 'border-start-start-radius',\n 'border-top',\n 'border-top-color',\n 'border-top-left-radius',\n 'border-top-right-radius',\n 'border-top-width',\n 'border-width',\n 'bottom',\n 'box-shadow',\n 'caret-color',\n 'clip',\n 'clip-path',\n 'color',\n 'column-count',\n 'column-gap',\n 'column-rule',\n 'column-rule-color',\n 'column-rule-width',\n 'column-width',\n 'columns',\n 'filter',\n 'flex',\n 'flex-basis',\n 'flex-grow',\n 'flex-shrink',\n 'font',\n 'font-size',\n 'font-size-adjust',\n 'font-stretch',\n 'font-variation-settings',\n 'font-weight',\n 'gap',\n 'grid-column-gap',\n 'grid-gap',\n 'grid-row-gap',\n 'grid-template-columns',\n 'grid-template-rows',\n 'height',\n 'inline-size',\n 'input-security',\n 'inset',\n 'inset-block',\n 'inset-block-end',\n 'inset-block-start',\n 'inset-inline',\n 'inset-inline-end',\n 'inset-inline-start',\n 'left',\n 'letter-spacing',\n 'line-clamp',\n 'line-height',\n 'margin',\n 'margin-block-end',\n 'margin-block-start',\n 'margin-bottom',\n 'margin-inline-end',\n 'margin-inline-start',\n 'margin-left',\n 'margin-right',\n 'margin-top',\n 'mask',\n 'mask-border',\n 'mask-position',\n 'mask-size',\n 'max-block-size',\n 'max-height',\n 'max-inline-size',\n 'max-lines',\n 'max-width',\n 'min-block-size',\n 'min-height',\n 'min-inline-size',\n 'min-width',\n 'object-position',\n 'offset',\n 'offset-anchor',\n 'offset-distance',\n 'offset-path',\n 'offset-position',\n 'offset-rotate',\n 'opacity',\n 'order',\n 'outline',\n 'outline-color',\n 'outline-offset',\n 'outline-width',\n 'padding',\n 'padding-block-end',\n 'padding-block-start',\n 'padding-bottom',\n 'padding-inline-end',\n 'padding-inline-start',\n 'padding-left',\n 'padding-right',\n 'padding-top',\n 'perspective',\n 'perspective-origin',\n 'right',\n 'rotate',\n 'row-gap',\n 'scale',\n 'scroll-margin',\n 'scroll-margin-block',\n 'scroll-margin-block-end',\n 'scroll-margin-block-start',\n 'scroll-margin-bottom',\n 'scroll-margin-inline',\n 'scroll-margin-inline-end',\n 'scroll-margin-inline-start',\n 'scroll-margin-left',\n 'scroll-margin-right',\n 'scroll-margin-top',\n 'scroll-padding',\n 'scroll-padding-block',\n 'scroll-padding-block-end',\n 'scroll-padding-block-start',\n 'scroll-padding-bottom',\n 'scroll-padding-inline',\n 'scroll-padding-inline-end',\n 'scroll-padding-inline-start',\n 'scroll-padding-left',\n 'scroll-padding-right',\n 'scroll-padding-top',\n 'scroll-snap-coordinate',\n 'scroll-snap-destination',\n 'scrollbar-color',\n 'shape-image-threshold',\n 'shape-margin',\n 'shape-outside',\n 'tab-size',\n 'text-decoration',\n 'text-decoration-color',\n 'text-decoration-thickness',\n 'text-emphasis',\n 'text-emphasis-color',\n 'text-indent',\n 'text-shadow',\n 'text-underline-offset',\n 'top',\n 'transform',\n 'transform-origin',\n 'translate',\n 'vertical-align',\n 'visibility',\n 'width',\n 'word-spacing',\n 'z-index',\n 'zoom',\n]);\n\nfunction isBrowser() {\n return (typeof window !== 'undefined' && typeof window.document !== 'undefined');\n}\nfunction isNode() {\n // Checking only for `process` isn't enough to identify whether or not we're in a Node\n // environment, because Webpack by default will polyfill the `process`. While we can discern\n // that Webpack polyfilled it by looking at `process.browser`, it's very Webpack-specific and\n // might not be future-proof. Instead we look at the stringified version of `process` which\n // is `[object process]` in Node and `[object Object]` when polyfilled.\n return typeof process !== 'undefined' && {}.toString.call(process) === '[object process]';\n}\nfunction optimizeGroupPlayer(players) {\n switch (players.length) {\n case 0:\n return new NoopAnimationPlayer();\n case 1:\n return players[0];\n default:\n return new ɵAnimationGroupPlayer(players);\n }\n}\nfunction normalizeKeyframes$1(driver, normalizer, element, keyframes, preStyles = new Map(), postStyles = new Map()) {\n const errors = [];\n const normalizedKeyframes = [];\n let previousOffset = -1;\n let previousKeyframe = null;\n keyframes.forEach(kf => {\n const offset = kf.get('offset');\n const isSameOffset = offset == previousOffset;\n const normalizedKeyframe = (isSameOffset && previousKeyframe) || new Map();\n kf.forEach((val, prop) => {\n let normalizedProp = prop;\n let normalizedValue = val;\n if (prop !== 'offset') {\n normalizedProp = normalizer.normalizePropertyName(normalizedProp, errors);\n switch (normalizedValue) {\n case ɵPRE_STYLE:\n normalizedValue = preStyles.get(prop);\n break;\n case AUTO_STYLE:\n normalizedValue = postStyles.get(prop);\n break;\n default:\n normalizedValue =\n normalizer.normalizeStyleValue(prop, normalizedProp, normalizedValue, errors);\n break;\n }\n }\n normalizedKeyframe.set(normalizedProp, normalizedValue);\n });\n if (!isSameOffset) {\n normalizedKeyframes.push(normalizedKeyframe);\n }\n previousKeyframe = normalizedKeyframe;\n previousOffset = offset;\n });\n if (errors.length) {\n throw animationFailed(errors);\n }\n return normalizedKeyframes;\n}\nfunction listenOnPlayer(player, eventName, event, callback) {\n switch (eventName) {\n case 'start':\n player.onStart(() => callback(event && copyAnimationEvent(event, 'start', player)));\n break;\n case 'done':\n player.onDone(() => callback(event && copyAnimationEvent(event, 'done', player)));\n break;\n case 'destroy':\n player.onDestroy(() => callback(event && copyAnimationEvent(event, 'destroy', player)));\n break;\n }\n}\nfunction copyAnimationEvent(e, phaseName, player) {\n const totalTime = player.totalTime;\n const disabled = player.disabled ? true : false;\n const event = makeAnimationEvent(e.element, e.triggerName, e.fromState, e.toState, phaseName || e.phaseName, totalTime == undefined ? e.totalTime : totalTime, disabled);\n const data = e['_data'];\n if (data != null) {\n event['_data'] = data;\n }\n return event;\n}\nfunction makeAnimationEvent(element, triggerName, fromState, toState, phaseName = '', totalTime = 0, disabled) {\n return { element, triggerName, fromState, toState, phaseName, totalTime, disabled: !!disabled };\n}\nfunction getOrSetDefaultValue(map, key, defaultValue) {\n let value = map.get(key);\n if (!value) {\n map.set(key, value = defaultValue);\n }\n return value;\n}\nfunction parseTimelineCommand(command) {\n const separatorPos = command.indexOf(':');\n const id = command.substring(1, separatorPos);\n const action = command.slice(separatorPos + 1);\n return [id, action];\n}\nlet _contains = (elm1, elm2) => false;\nlet _query = (element, selector, multi) => {\n return [];\n};\nlet _documentElement = null;\nfunction getParentElement(element) {\n const parent = element.parentNode || element.host; // consider host to support shadow DOM\n if (parent === _documentElement) {\n return null;\n }\n return parent;\n}\n// Define utility methods for browsers and platform-server(domino) where Element\n// and utility methods exist.\nconst _isNode = isNode();\nif (_isNode || typeof Element !== 'undefined') {\n if (!isBrowser()) {\n _contains = (elm1, elm2) => elm1.contains(elm2);\n }\n else {\n // Read the document element in an IIFE that's been marked pure to avoid a top-level property\n // read that may prevent tree-shaking.\n _documentElement = /* @__PURE__ */ (() => document.documentElement)();\n _contains = (elm1, elm2) => {\n while (elm2) {\n if (elm2 === elm1) {\n return true;\n }\n elm2 = getParentElement(elm2);\n }\n return false;\n };\n }\n _query = (element, selector, multi) => {\n if (multi) {\n return Array.from(element.querySelectorAll(selector));\n }\n const elem = element.querySelector(selector);\n return elem ? [elem] : [];\n };\n}\nfunction containsVendorPrefix(prop) {\n // Webkit is the only real popular vendor prefix nowadays\n // cc: http://shouldiprefix.com/\n return prop.substring(1, 6) == 'ebkit'; // webkit or Webkit\n}\nlet _CACHED_BODY = null;\nlet _IS_WEBKIT = false;\nfunction validateStyleProperty(prop) {\n if (!_CACHED_BODY) {\n _CACHED_BODY = getBodyNode() || {};\n _IS_WEBKIT = _CACHED_BODY.style ? ('WebkitAppearance' in _CACHED_BODY.style) : false;\n }\n let result = true;\n if (_CACHED_BODY.style && !containsVendorPrefix(prop)) {\n result = prop in _CACHED_BODY.style;\n if (!result && _IS_WEBKIT) {\n const camelProp = 'Webkit' + prop.charAt(0).toUpperCase() + prop.slice(1);\n result = camelProp in _CACHED_BODY.style;\n }\n }\n return result;\n}\nfunction validateWebAnimatableStyleProperty(prop) {\n return ANIMATABLE_PROP_SET.has(prop);\n}\nfunction getBodyNode() {\n if (typeof document != 'undefined') {\n return document.body;\n }\n return null;\n}\nconst containsElement = _contains;\nconst invokeQuery = _query;\nfunction hypenatePropsKeys(original) {\n const newMap = new Map();\n original.forEach((val, prop) => {\n const newProp = prop.replace(/([a-z])([A-Z])/g, '$1-$2');\n newMap.set(newProp, val);\n });\n return newMap;\n}\n\n/**\n * @publicApi\n */\nclass NoopAnimationDriver {\n validateStyleProperty(prop) {\n return validateStyleProperty(prop);\n }\n matchesElement(_element, _selector) {\n // This method is deprecated and no longer in use so we return false.\n return false;\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n getParentElement(element) {\n return getParentElement(element);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return defaultValue || '';\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) {\n return new NoopAnimationPlayer(duration, delay);\n }\n}\nNoopAnimationDriver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NoopAnimationDriver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNoopAnimationDriver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NoopAnimationDriver });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NoopAnimationDriver, decorators: [{\n type: Injectable\n }] });\n/**\n * @publicApi\n */\nclass AnimationDriver {\n}\nAnimationDriver.NOOP = ( /* @__PURE__ */new NoopAnimationDriver());\n\nconst ONE_SECOND = 1000;\nconst SUBSTITUTION_EXPR_START = '{{';\nconst SUBSTITUTION_EXPR_END = '}}';\nconst ENTER_CLASSNAME = 'ng-enter';\nconst LEAVE_CLASSNAME = 'ng-leave';\nconst NG_TRIGGER_CLASSNAME = 'ng-trigger';\nconst NG_TRIGGER_SELECTOR = '.ng-trigger';\nconst NG_ANIMATING_CLASSNAME = 'ng-animating';\nconst NG_ANIMATING_SELECTOR = '.ng-animating';\nfunction resolveTimingValue(value) {\n if (typeof value == 'number')\n return value;\n const matches = value.match(/^(-?[\\.\\d]+)(m?s)/);\n if (!matches || matches.length < 2)\n return 0;\n return _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n}\nfunction _convertTimeValueToMS(value, unit) {\n switch (unit) {\n case 's':\n return value * ONE_SECOND;\n default: // ms or something else\n return value;\n }\n}\nfunction resolveTiming(timings, errors, allowNegativeValues) {\n return timings.hasOwnProperty('duration') ?\n timings :\n parseTimeExpression(timings, errors, allowNegativeValues);\n}\nfunction parseTimeExpression(exp, errors, allowNegativeValues) {\n const regex = /^(-?[\\.\\d]+)(m?s)(?:\\s+(-?[\\.\\d]+)(m?s))?(?:\\s+([-a-z]+(?:\\(.+?\\))?))?$/i;\n let duration;\n let delay = 0;\n let easing = '';\n if (typeof exp === 'string') {\n const matches = exp.match(regex);\n if (matches === null) {\n errors.push(invalidTimingValue(exp));\n return { duration: 0, delay: 0, easing: '' };\n }\n duration = _convertTimeValueToMS(parseFloat(matches[1]), matches[2]);\n const delayMatch = matches[3];\n if (delayMatch != null) {\n delay = _convertTimeValueToMS(parseFloat(delayMatch), matches[4]);\n }\n const easingVal = matches[5];\n if (easingVal) {\n easing = easingVal;\n }\n }\n else {\n duration = exp;\n }\n if (!allowNegativeValues) {\n let containsErrors = false;\n let startIndex = errors.length;\n if (duration < 0) {\n errors.push(negativeStepValue());\n containsErrors = true;\n }\n if (delay < 0) {\n errors.push(negativeDelayValue());\n containsErrors = true;\n }\n if (containsErrors) {\n errors.splice(startIndex, 0, invalidTimingValue(exp));\n }\n }\n return { duration, delay, easing };\n}\nfunction copyObj(obj, destination = {}) {\n Object.keys(obj).forEach(prop => {\n destination[prop] = obj[prop];\n });\n return destination;\n}\nfunction convertToMap(obj) {\n const styleMap = new Map();\n Object.keys(obj).forEach(prop => {\n const val = obj[prop];\n styleMap.set(prop, val);\n });\n return styleMap;\n}\nfunction normalizeKeyframes(keyframes) {\n if (!keyframes.length) {\n return [];\n }\n if (keyframes[0] instanceof Map) {\n return keyframes;\n }\n return keyframes.map(kf => convertToMap(kf));\n}\nfunction normalizeStyles(styles) {\n const normalizedStyles = new Map();\n if (Array.isArray(styles)) {\n styles.forEach(data => copyStyles(data, normalizedStyles));\n }\n else {\n copyStyles(styles, normalizedStyles);\n }\n return normalizedStyles;\n}\nfunction copyStyles(styles, destination = new Map(), backfill) {\n if (backfill) {\n for (let [prop, val] of backfill) {\n destination.set(prop, val);\n }\n }\n for (let [prop, val] of styles) {\n destination.set(prop, val);\n }\n return destination;\n}\nfunction getStyleAttributeString(element, key, value) {\n // Return the key-value pair string to be added to the style attribute for the\n // given CSS style key.\n if (value) {\n return key + ':' + value + ';';\n }\n else {\n return '';\n }\n}\nfunction writeStyleAttribute(element) {\n // Read the style property of the element and manually reflect it to the\n // style attribute. This is needed because Domino on platform-server doesn't\n // understand the full set of allowed CSS properties and doesn't reflect some\n // of them automatically.\n let styleAttrValue = '';\n for (let i = 0; i < element.style.length; i++) {\n const key = element.style.item(i);\n styleAttrValue += getStyleAttributeString(element, key, element.style.getPropertyValue(key));\n }\n for (const key in element.style) {\n // Skip internal Domino properties that don't need to be reflected.\n if (!element.style.hasOwnProperty(key) || key.startsWith('_')) {\n continue;\n }\n const dashKey = camelCaseToDashCase(key);\n styleAttrValue += getStyleAttributeString(element, dashKey, element.style[key]);\n }\n element.setAttribute('style', styleAttrValue);\n}\nfunction setStyles(element, styles, formerStyles) {\n if (element['style']) {\n styles.forEach((val, prop) => {\n const camelProp = dashCaseToCamelCase(prop);\n if (formerStyles && !formerStyles.has(prop)) {\n formerStyles.set(prop, element.style[camelProp]);\n }\n element.style[camelProp] = val;\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction eraseStyles(element, styles) {\n if (element['style']) {\n styles.forEach((_, prop) => {\n const camelProp = dashCaseToCamelCase(prop);\n element.style[camelProp] = '';\n });\n // On the server set the 'style' attribute since it's not automatically reflected.\n if (isNode()) {\n writeStyleAttribute(element);\n }\n }\n}\nfunction normalizeAnimationEntry(steps) {\n if (Array.isArray(steps)) {\n if (steps.length == 1)\n return steps[0];\n return sequence(steps);\n }\n return steps;\n}\nfunction validateStyleParams(value, options, errors) {\n const params = options.params || {};\n const matches = extractStyleParams(value);\n if (matches.length) {\n matches.forEach(varName => {\n if (!params.hasOwnProperty(varName)) {\n errors.push(invalidStyleParams(varName));\n }\n });\n }\n}\nconst PARAM_REGEX = new RegExp(`${SUBSTITUTION_EXPR_START}\\\\s*(.+?)\\\\s*${SUBSTITUTION_EXPR_END}`, 'g');\nfunction extractStyleParams(value) {\n let params = [];\n if (typeof value === 'string') {\n let match;\n while (match = PARAM_REGEX.exec(value)) {\n params.push(match[1]);\n }\n PARAM_REGEX.lastIndex = 0;\n }\n return params;\n}\nfunction interpolateParams(value, params, errors) {\n const original = value.toString();\n const str = original.replace(PARAM_REGEX, (_, varName) => {\n let localVal = params[varName];\n // this means that the value was never overridden by the data passed in by the user\n if (localVal == null) {\n errors.push(invalidParamValue(varName));\n localVal = '';\n }\n return localVal.toString();\n });\n // we do this to assert that numeric values stay as they are\n return str == original ? value : str;\n}\nfunction iteratorToArray(iterator) {\n const arr = [];\n let item = iterator.next();\n while (!item.done) {\n arr.push(item.value);\n item = iterator.next();\n }\n return arr;\n}\nconst DASH_CASE_REGEXP = /-+([a-z0-9])/g;\nfunction dashCaseToCamelCase(input) {\n return input.replace(DASH_CASE_REGEXP, (...m) => m[1].toUpperCase());\n}\nfunction camelCaseToDashCase(input) {\n return input.replace(/([a-z])([A-Z])/g, '$1-$2').toLowerCase();\n}\nfunction allowPreviousPlayerStylesMerge(duration, delay) {\n return duration === 0 || delay === 0;\n}\nfunction balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles) {\n if (previousStyles.size && keyframes.length) {\n let startingKeyframe = keyframes[0];\n let missingStyleProps = [];\n previousStyles.forEach((val, prop) => {\n if (!startingKeyframe.has(prop)) {\n missingStyleProps.push(prop);\n }\n startingKeyframe.set(prop, val);\n });\n if (missingStyleProps.length) {\n for (let i = 1; i < keyframes.length; i++) {\n let kf = keyframes[i];\n missingStyleProps.forEach(prop => kf.set(prop, computeStyle(element, prop)));\n }\n }\n }\n return keyframes;\n}\nfunction visitDslNode(visitor, node, context) {\n switch (node.type) {\n case 7 /* AnimationMetadataType.Trigger */:\n return visitor.visitTrigger(node, context);\n case 0 /* AnimationMetadataType.State */:\n return visitor.visitState(node, context);\n case 1 /* AnimationMetadataType.Transition */:\n return visitor.visitTransition(node, context);\n case 2 /* AnimationMetadataType.Sequence */:\n return visitor.visitSequence(node, context);\n case 3 /* AnimationMetadataType.Group */:\n return visitor.visitGroup(node, context);\n case 4 /* AnimationMetadataType.Animate */:\n return visitor.visitAnimate(node, context);\n case 5 /* AnimationMetadataType.Keyframes */:\n return visitor.visitKeyframes(node, context);\n case 6 /* AnimationMetadataType.Style */:\n return visitor.visitStyle(node, context);\n case 8 /* AnimationMetadataType.Reference */:\n return visitor.visitReference(node, context);\n case 9 /* AnimationMetadataType.AnimateChild */:\n return visitor.visitAnimateChild(node, context);\n case 10 /* AnimationMetadataType.AnimateRef */:\n return visitor.visitAnimateRef(node, context);\n case 11 /* AnimationMetadataType.Query */:\n return visitor.visitQuery(node, context);\n case 12 /* AnimationMetadataType.Stagger */:\n return visitor.visitStagger(node, context);\n default:\n throw invalidNodeType(node.type);\n }\n}\nfunction computeStyle(element, prop) {\n return window.getComputedStyle(element)[prop];\n}\n\nconst NG_DEV_MODE = typeof ngDevMode === 'undefined' || !!ngDevMode;\nfunction createListOfWarnings(warnings) {\n const LINE_START = '\\n - ';\n return `${LINE_START}${warnings.filter(Boolean).map(warning => warning).join(LINE_START)}`;\n}\nfunction warnValidation(warnings) {\n NG_DEV_MODE && console.warn(`animation validation warnings:${createListOfWarnings(warnings)}`);\n}\nfunction warnTriggerBuild(name, warnings) {\n NG_DEV_MODE &&\n console.warn(`The animation trigger \"${name}\" has built with the following warnings:${createListOfWarnings(warnings)}`);\n}\nfunction warnRegister(warnings) {\n NG_DEV_MODE &&\n console.warn(`Animation built with the following warnings:${createListOfWarnings(warnings)}`);\n}\nfunction triggerParsingWarnings(name, warnings) {\n NG_DEV_MODE &&\n console.warn(`Animation parsing for the ${name} trigger presents the following warnings:${createListOfWarnings(warnings)}`);\n}\nfunction pushUnrecognizedPropertiesWarning(warnings, props) {\n if (props.length) {\n warnings.push(`The following provided properties are not recognized: ${props.join(', ')}`);\n }\n}\n\nconst ANY_STATE = '*';\nfunction parseTransitionExpr(transitionValue, errors) {\n const expressions = [];\n if (typeof transitionValue == 'string') {\n transitionValue.split(/\\s*,\\s*/).forEach(str => parseInnerTransitionStr(str, expressions, errors));\n }\n else {\n expressions.push(transitionValue);\n }\n return expressions;\n}\nfunction parseInnerTransitionStr(eventStr, expressions, errors) {\n if (eventStr[0] == ':') {\n const result = parseAnimationAlias(eventStr, errors);\n if (typeof result == 'function') {\n expressions.push(result);\n return;\n }\n eventStr = result;\n }\n const match = eventStr.match(/^(\\*|[-\\w]+)\\s*()\\s*(\\*|[-\\w]+)$/);\n if (match == null || match.length < 4) {\n errors.push(invalidExpression(eventStr));\n return expressions;\n }\n const fromState = match[1];\n const separator = match[2];\n const toState = match[3];\n expressions.push(makeLambdaFromStates(fromState, toState));\n const isFullAnyStateExpr = fromState == ANY_STATE && toState == ANY_STATE;\n if (separator[0] == '<' && !isFullAnyStateExpr) {\n expressions.push(makeLambdaFromStates(toState, fromState));\n }\n}\nfunction parseAnimationAlias(alias, errors) {\n switch (alias) {\n case ':enter':\n return 'void => *';\n case ':leave':\n return '* => void';\n case ':increment':\n return (fromState, toState) => parseFloat(toState) > parseFloat(fromState);\n case ':decrement':\n return (fromState, toState) => parseFloat(toState) < parseFloat(fromState);\n default:\n errors.push(invalidTransitionAlias(alias));\n return '* => *';\n }\n}\n// DO NOT REFACTOR ... keep the follow set instantiations\n// with the values intact (closure compiler for some reason\n// removes follow-up lines that add the values outside of\n// the constructor...\nconst TRUE_BOOLEAN_VALUES = new Set(['true', '1']);\nconst FALSE_BOOLEAN_VALUES = new Set(['false', '0']);\nfunction makeLambdaFromStates(lhs, rhs) {\n const LHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(lhs) || FALSE_BOOLEAN_VALUES.has(lhs);\n const RHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(rhs) || FALSE_BOOLEAN_VALUES.has(rhs);\n return (fromState, toState) => {\n let lhsMatch = lhs == ANY_STATE || lhs == fromState;\n let rhsMatch = rhs == ANY_STATE || rhs == toState;\n if (!lhsMatch && LHS_MATCH_BOOLEAN && typeof fromState === 'boolean') {\n lhsMatch = fromState ? TRUE_BOOLEAN_VALUES.has(lhs) : FALSE_BOOLEAN_VALUES.has(lhs);\n }\n if (!rhsMatch && RHS_MATCH_BOOLEAN && typeof toState === 'boolean') {\n rhsMatch = toState ? TRUE_BOOLEAN_VALUES.has(rhs) : FALSE_BOOLEAN_VALUES.has(rhs);\n }\n return lhsMatch && rhsMatch;\n };\n}\n\nconst SELF_TOKEN = ':self';\nconst SELF_TOKEN_REGEX = new RegExp(`\\s*${SELF_TOKEN}\\s*,?`, 'g');\n/*\n * [Validation]\n * The visitor code below will traverse the animation AST generated by the animation verb functions\n * (the output is a tree of objects) and attempt to perform a series of validations on the data. The\n * following corner-cases will be validated:\n *\n * 1. Overlap of animations\n * Given that a CSS property cannot be animated in more than one place at the same time, it's\n * important that this behavior is detected and validated. The way in which this occurs is that\n * each time a style property is examined, a string-map containing the property will be updated with\n * the start and end times for when the property is used within an animation step.\n *\n * If there are two or more parallel animations that are currently running (these are invoked by the\n * group()) on the same element then the validator will throw an error. Since the start/end timing\n * values are collected for each property then if the current animation step is animating the same\n * property and its timing values fall anywhere into the window of time that the property is\n * currently being animated within then this is what causes an error.\n *\n * 2. Timing values\n * The validator will validate to see if a timing value of `duration delay easing` or\n * `durationNumber` is valid or not.\n *\n * (note that upon validation the code below will replace the timing data with an object containing\n * {duration,delay,easing}.\n *\n * 3. Offset Validation\n * Each of the style() calls are allowed to have an offset value when placed inside of keyframes().\n * Offsets within keyframes() are considered valid when:\n *\n * - No offsets are used at all\n * - Each style() entry contains an offset value\n * - Each offset is between 0 and 1\n * - Each offset is greater to or equal than the previous one\n *\n * Otherwise an error will be thrown.\n */\nfunction buildAnimationAst(driver, metadata, errors, warnings) {\n return new AnimationAstBuilderVisitor(driver).build(metadata, errors, warnings);\n}\nconst ROOT_SELECTOR = '';\nclass AnimationAstBuilderVisitor {\n constructor(_driver) {\n this._driver = _driver;\n }\n build(metadata, errors, warnings) {\n const context = new AnimationAstBuilderContext(errors);\n this._resetContextStyleTimingState(context);\n const ast = visitDslNode(this, normalizeAnimationEntry(metadata), context);\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (context.unsupportedCSSPropertiesFound.size) {\n pushUnrecognizedPropertiesWarning(warnings, [...context.unsupportedCSSPropertiesFound.keys()]);\n }\n }\n return ast;\n }\n _resetContextStyleTimingState(context) {\n context.currentQuerySelector = ROOT_SELECTOR;\n context.collectedStyles = new Map();\n context.collectedStyles.set(ROOT_SELECTOR, new Map());\n context.currentTime = 0;\n }\n visitTrigger(metadata, context) {\n let queryCount = context.queryCount = 0;\n let depCount = context.depCount = 0;\n const states = [];\n const transitions = [];\n if (metadata.name.charAt(0) == '@') {\n context.errors.push(invalidTrigger());\n }\n metadata.definitions.forEach(def => {\n this._resetContextStyleTimingState(context);\n if (def.type == 0 /* AnimationMetadataType.State */) {\n const stateDef = def;\n const name = stateDef.name;\n name.toString().split(/\\s*,\\s*/).forEach(n => {\n stateDef.name = n;\n states.push(this.visitState(stateDef, context));\n });\n stateDef.name = name;\n }\n else if (def.type == 1 /* AnimationMetadataType.Transition */) {\n const transition = this.visitTransition(def, context);\n queryCount += transition.queryCount;\n depCount += transition.depCount;\n transitions.push(transition);\n }\n else {\n context.errors.push(invalidDefinition());\n }\n });\n return {\n type: 7 /* AnimationMetadataType.Trigger */,\n name: metadata.name,\n states,\n transitions,\n queryCount,\n depCount,\n options: null\n };\n }\n visitState(metadata, context) {\n const styleAst = this.visitStyle(metadata.styles, context);\n const astParams = (metadata.options && metadata.options.params) || null;\n if (styleAst.containsDynamicStyles) {\n const missingSubs = new Set();\n const params = astParams || {};\n styleAst.styles.forEach(style => {\n if (style instanceof Map) {\n style.forEach(value => {\n extractStyleParams(value).forEach(sub => {\n if (!params.hasOwnProperty(sub)) {\n missingSubs.add(sub);\n }\n });\n });\n }\n });\n if (missingSubs.size) {\n const missingSubsArr = iteratorToArray(missingSubs.values());\n context.errors.push(invalidState(metadata.name, missingSubsArr));\n }\n }\n return {\n type: 0 /* AnimationMetadataType.State */,\n name: metadata.name,\n style: styleAst,\n options: astParams ? { params: astParams } : null\n };\n }\n visitTransition(metadata, context) {\n context.queryCount = 0;\n context.depCount = 0;\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n const matchers = parseTransitionExpr(metadata.expr, context.errors);\n return {\n type: 1 /* AnimationMetadataType.Transition */,\n matchers,\n animation,\n queryCount: context.queryCount,\n depCount: context.depCount,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitSequence(metadata, context) {\n return {\n type: 2 /* AnimationMetadataType.Sequence */,\n steps: metadata.steps.map(s => visitDslNode(this, s, context)),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitGroup(metadata, context) {\n const currentTime = context.currentTime;\n let furthestTime = 0;\n const steps = metadata.steps.map(step => {\n context.currentTime = currentTime;\n const innerAst = visitDslNode(this, step, context);\n furthestTime = Math.max(furthestTime, context.currentTime);\n return innerAst;\n });\n context.currentTime = furthestTime;\n return {\n type: 3 /* AnimationMetadataType.Group */,\n steps,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimate(metadata, context) {\n const timingAst = constructTimingAst(metadata.timings, context.errors);\n context.currentAnimateTimings = timingAst;\n let styleAst;\n let styleMetadata = metadata.styles ? metadata.styles : style({});\n if (styleMetadata.type == 5 /* AnimationMetadataType.Keyframes */) {\n styleAst = this.visitKeyframes(styleMetadata, context);\n }\n else {\n let styleMetadata = metadata.styles;\n let isEmpty = false;\n if (!styleMetadata) {\n isEmpty = true;\n const newStyleData = {};\n if (timingAst.easing) {\n newStyleData['easing'] = timingAst.easing;\n }\n styleMetadata = style(newStyleData);\n }\n context.currentTime += timingAst.duration + timingAst.delay;\n const _styleAst = this.visitStyle(styleMetadata, context);\n _styleAst.isEmptyStep = isEmpty;\n styleAst = _styleAst;\n }\n context.currentAnimateTimings = null;\n return {\n type: 4 /* AnimationMetadataType.Animate */,\n timings: timingAst,\n style: styleAst,\n options: null\n };\n }\n visitStyle(metadata, context) {\n const ast = this._makeStyleAst(metadata, context);\n this._validateStyleAst(ast, context);\n return ast;\n }\n _makeStyleAst(metadata, context) {\n const styles = [];\n const metadataStyles = Array.isArray(metadata.styles) ? metadata.styles : [metadata.styles];\n for (let styleTuple of metadataStyles) {\n if (typeof styleTuple === 'string') {\n if (styleTuple === AUTO_STYLE) {\n styles.push(styleTuple);\n }\n else {\n context.errors.push(invalidStyleValue(styleTuple));\n }\n }\n else {\n styles.push(convertToMap(styleTuple));\n }\n }\n let containsDynamicStyles = false;\n let collectedEasing = null;\n styles.forEach(styleData => {\n if (styleData instanceof Map) {\n if (styleData.has('easing')) {\n collectedEasing = styleData.get('easing');\n styleData.delete('easing');\n }\n if (!containsDynamicStyles) {\n for (let value of styleData.values()) {\n if (value.toString().indexOf(SUBSTITUTION_EXPR_START) >= 0) {\n containsDynamicStyles = true;\n break;\n }\n }\n }\n }\n });\n return {\n type: 6 /* AnimationMetadataType.Style */,\n styles,\n easing: collectedEasing,\n offset: metadata.offset,\n containsDynamicStyles,\n options: null\n };\n }\n _validateStyleAst(ast, context) {\n const timings = context.currentAnimateTimings;\n let endTime = context.currentTime;\n let startTime = context.currentTime;\n if (timings && startTime > 0) {\n startTime -= timings.duration + timings.delay;\n }\n ast.styles.forEach(tuple => {\n if (typeof tuple === 'string')\n return;\n tuple.forEach((value, prop) => {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!this._driver.validateStyleProperty(prop)) {\n tuple.delete(prop);\n context.unsupportedCSSPropertiesFound.add(prop);\n return;\n }\n }\n // This is guaranteed to have a defined Map at this querySelector location making it\n // safe to add the assertion here. It is set as a default empty map in prior methods.\n const collectedStyles = context.collectedStyles.get(context.currentQuerySelector);\n const collectedEntry = collectedStyles.get(prop);\n let updateCollectedStyle = true;\n if (collectedEntry) {\n if (startTime != endTime && startTime >= collectedEntry.startTime &&\n endTime <= collectedEntry.endTime) {\n context.errors.push(invalidParallelAnimation(prop, collectedEntry.startTime, collectedEntry.endTime, startTime, endTime));\n updateCollectedStyle = false;\n }\n // we always choose the smaller start time value since we\n // want to have a record of the entire animation window where\n // the style property is being animated in between\n startTime = collectedEntry.startTime;\n }\n if (updateCollectedStyle) {\n collectedStyles.set(prop, { startTime, endTime });\n }\n if (context.options) {\n validateStyleParams(value, context.options, context.errors);\n }\n });\n });\n }\n visitKeyframes(metadata, context) {\n const ast = { type: 5 /* AnimationMetadataType.Keyframes */, styles: [], options: null };\n if (!context.currentAnimateTimings) {\n context.errors.push(invalidKeyframes());\n return ast;\n }\n const MAX_KEYFRAME_OFFSET = 1;\n let totalKeyframesWithOffsets = 0;\n const offsets = [];\n let offsetsOutOfOrder = false;\n let keyframesOutOfRange = false;\n let previousOffset = 0;\n const keyframes = metadata.steps.map(styles => {\n const style = this._makeStyleAst(styles, context);\n let offsetVal = style.offset != null ? style.offset : consumeOffset(style.styles);\n let offset = 0;\n if (offsetVal != null) {\n totalKeyframesWithOffsets++;\n offset = style.offset = offsetVal;\n }\n keyframesOutOfRange = keyframesOutOfRange || offset < 0 || offset > 1;\n offsetsOutOfOrder = offsetsOutOfOrder || offset < previousOffset;\n previousOffset = offset;\n offsets.push(offset);\n return style;\n });\n if (keyframesOutOfRange) {\n context.errors.push(invalidOffset());\n }\n if (offsetsOutOfOrder) {\n context.errors.push(keyframeOffsetsOutOfOrder());\n }\n const length = metadata.steps.length;\n let generatedOffset = 0;\n if (totalKeyframesWithOffsets > 0 && totalKeyframesWithOffsets < length) {\n context.errors.push(keyframesMissingOffsets());\n }\n else if (totalKeyframesWithOffsets == 0) {\n generatedOffset = MAX_KEYFRAME_OFFSET / (length - 1);\n }\n const limit = length - 1;\n const currentTime = context.currentTime;\n const currentAnimateTimings = context.currentAnimateTimings;\n const animateDuration = currentAnimateTimings.duration;\n keyframes.forEach((kf, i) => {\n const offset = generatedOffset > 0 ? (i == limit ? 1 : (generatedOffset * i)) : offsets[i];\n const durationUpToThisFrame = offset * animateDuration;\n context.currentTime = currentTime + currentAnimateTimings.delay + durationUpToThisFrame;\n currentAnimateTimings.duration = durationUpToThisFrame;\n this._validateStyleAst(kf, context);\n kf.offset = offset;\n ast.styles.push(kf);\n });\n return ast;\n }\n visitReference(metadata, context) {\n return {\n type: 8 /* AnimationMetadataType.Reference */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateChild(metadata, context) {\n context.depCount++;\n return {\n type: 9 /* AnimationMetadataType.AnimateChild */,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitAnimateRef(metadata, context) {\n return {\n type: 10 /* AnimationMetadataType.AnimateRef */,\n animation: this.visitReference(metadata.animation, context),\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitQuery(metadata, context) {\n const parentSelector = context.currentQuerySelector;\n const options = (metadata.options || {});\n context.queryCount++;\n context.currentQuery = metadata;\n const [selector, includeSelf] = normalizeSelector(metadata.selector);\n context.currentQuerySelector =\n parentSelector.length ? (parentSelector + ' ' + selector) : selector;\n getOrSetDefaultValue(context.collectedStyles, context.currentQuerySelector, new Map());\n const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context);\n context.currentQuery = null;\n context.currentQuerySelector = parentSelector;\n return {\n type: 11 /* AnimationMetadataType.Query */,\n selector,\n limit: options.limit || 0,\n optional: !!options.optional,\n includeSelf,\n animation,\n originalSelector: metadata.selector,\n options: normalizeAnimationOptions(metadata.options)\n };\n }\n visitStagger(metadata, context) {\n if (!context.currentQuery) {\n context.errors.push(invalidStagger());\n }\n const timings = metadata.timings === 'full' ?\n { duration: 0, delay: 0, easing: 'full' } :\n resolveTiming(metadata.timings, context.errors, true);\n return {\n type: 12 /* AnimationMetadataType.Stagger */,\n animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context),\n timings,\n options: null\n };\n }\n}\nfunction normalizeSelector(selector) {\n const hasAmpersand = selector.split(/\\s*,\\s*/).find(token => token == SELF_TOKEN) ? true : false;\n if (hasAmpersand) {\n selector = selector.replace(SELF_TOKEN_REGEX, '');\n }\n // Note: the :enter and :leave aren't normalized here since those\n // selectors are filled in at runtime during timeline building\n selector = selector.replace(/@\\*/g, NG_TRIGGER_SELECTOR)\n .replace(/@\\w+/g, match => NG_TRIGGER_SELECTOR + '-' + match.slice(1))\n .replace(/:animating/g, NG_ANIMATING_SELECTOR);\n return [selector, hasAmpersand];\n}\nfunction normalizeParams(obj) {\n return obj ? copyObj(obj) : null;\n}\nclass AnimationAstBuilderContext {\n constructor(errors) {\n this.errors = errors;\n this.queryCount = 0;\n this.depCount = 0;\n this.currentTransition = null;\n this.currentQuery = null;\n this.currentQuerySelector = null;\n this.currentAnimateTimings = null;\n this.currentTime = 0;\n this.collectedStyles = new Map();\n this.options = null;\n this.unsupportedCSSPropertiesFound = new Set();\n }\n}\nfunction consumeOffset(styles) {\n if (typeof styles == 'string')\n return null;\n let offset = null;\n if (Array.isArray(styles)) {\n styles.forEach(styleTuple => {\n if (styleTuple instanceof Map && styleTuple.has('offset')) {\n const obj = styleTuple;\n offset = parseFloat(obj.get('offset'));\n obj.delete('offset');\n }\n });\n }\n else if (styles instanceof Map && styles.has('offset')) {\n const obj = styles;\n offset = parseFloat(obj.get('offset'));\n obj.delete('offset');\n }\n return offset;\n}\nfunction constructTimingAst(value, errors) {\n if (value.hasOwnProperty('duration')) {\n return value;\n }\n if (typeof value == 'number') {\n const duration = resolveTiming(value, errors).duration;\n return makeTimingAst(duration, 0, '');\n }\n const strValue = value;\n const isDynamic = strValue.split(/\\s+/).some(v => v.charAt(0) == '{' && v.charAt(1) == '{');\n if (isDynamic) {\n const ast = makeTimingAst(0, 0, '');\n ast.dynamic = true;\n ast.strValue = strValue;\n return ast;\n }\n const timings = resolveTiming(strValue, errors);\n return makeTimingAst(timings.duration, timings.delay, timings.easing);\n}\nfunction normalizeAnimationOptions(options) {\n if (options) {\n options = copyObj(options);\n if (options['params']) {\n options['params'] = normalizeParams(options['params']);\n }\n }\n else {\n options = {};\n }\n return options;\n}\nfunction makeTimingAst(duration, delay, easing) {\n return { duration, delay, easing };\n}\n\nfunction createTimelineInstruction(element, keyframes, preStyleProps, postStyleProps, duration, delay, easing = null, subTimeline = false) {\n return {\n type: 1 /* AnimationTransitionInstructionType.TimelineAnimation */,\n element,\n keyframes,\n preStyleProps,\n postStyleProps,\n duration,\n delay,\n totalTime: duration + delay,\n easing,\n subTimeline\n };\n}\n\nclass ElementInstructionMap {\n constructor() {\n this._map = new Map();\n }\n get(element) {\n return this._map.get(element) || [];\n }\n append(element, instructions) {\n let existingInstructions = this._map.get(element);\n if (!existingInstructions) {\n this._map.set(element, existingInstructions = []);\n }\n existingInstructions.push(...instructions);\n }\n has(element) {\n return this._map.has(element);\n }\n clear() {\n this._map.clear();\n }\n}\n\nconst ONE_FRAME_IN_MILLISECONDS = 1;\nconst ENTER_TOKEN = ':enter';\nconst ENTER_TOKEN_REGEX = new RegExp(ENTER_TOKEN, 'g');\nconst LEAVE_TOKEN = ':leave';\nconst LEAVE_TOKEN_REGEX = new RegExp(LEAVE_TOKEN, 'g');\n/*\n * The code within this file aims to generate web-animations-compatible keyframes from Angular's\n * animation DSL code.\n *\n * The code below will be converted from:\n *\n * ```\n * sequence([\n * style({ opacity: 0 }),\n * animate(1000, style({ opacity: 0 }))\n * ])\n * ```\n *\n * To:\n * ```\n * keyframes = [{ opacity: 0, offset: 0 }, { opacity: 1, offset: 1 }]\n * duration = 1000\n * delay = 0\n * easing = ''\n * ```\n *\n * For this operation to cover the combination of animation verbs (style, animate, group, etc...) a\n * combination of AST traversal and merge-sort-like algorithms are used.\n *\n * [AST Traversal]\n * Each of the animation verbs, when executed, will return an string-map object representing what\n * type of action it is (style, animate, group, etc...) and the data associated with it. This means\n * that when functional composition mix of these functions is evaluated (like in the example above)\n * then it will end up producing a tree of objects representing the animation itself.\n *\n * When this animation object tree is processed by the visitor code below it will visit each of the\n * verb statements within the visitor. And during each visit it will build the context of the\n * animation keyframes by interacting with the `TimelineBuilder`.\n *\n * [TimelineBuilder]\n * This class is responsible for tracking the styles and building a series of keyframe objects for a\n * timeline between a start and end time. The builder starts off with an initial timeline and each\n * time the AST comes across a `group()`, `keyframes()` or a combination of the two within a\n * `sequence()` then it will generate a sub timeline for each step as well as a new one after\n * they are complete.\n *\n * As the AST is traversed, the timing state on each of the timelines will be incremented. If a sub\n * timeline was created (based on one of the cases above) then the parent timeline will attempt to\n * merge the styles used within the sub timelines into itself (only with group() this will happen).\n * This happens with a merge operation (much like how the merge works in mergeSort) and it will only\n * copy the most recently used styles from the sub timelines into the parent timeline. This ensures\n * that if the styles are used later on in another phase of the animation then they will be the most\n * up-to-date values.\n *\n * [How Missing Styles Are Updated]\n * Each timeline has a `backFill` property which is responsible for filling in new styles into\n * already processed keyframes if a new style shows up later within the animation sequence.\n *\n * ```\n * sequence([\n * style({ width: 0 }),\n * animate(1000, style({ width: 100 })),\n * animate(1000, style({ width: 200 })),\n * animate(1000, style({ width: 300 }))\n * animate(1000, style({ width: 400, height: 400 })) // notice how `height` doesn't exist anywhere\n * else\n * ])\n * ```\n *\n * What is happening here is that the `height` value is added later in the sequence, but is missing\n * from all previous animation steps. Therefore when a keyframe is created it would also be missing\n * from all previous keyframes up until where it is first used. For the timeline keyframe generation\n * to properly fill in the style it will place the previous value (the value from the parent\n * timeline) or a default value of `*` into the backFill map. The `copyStyles` method in util.ts\n * handles propagating that backfill map to the styles object.\n *\n * When a sub-timeline is created it will have its own backFill property. This is done so that\n * styles present within the sub-timeline do not accidentally seep into the previous/future timeline\n * keyframes\n *\n * [Validation]\n * The code in this file is not responsible for validation. That functionality happens with within\n * the `AnimationValidatorVisitor` code.\n */\nfunction buildAnimationTimelines(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles = new Map(), finalStyles = new Map(), options, subInstructions, errors = []) {\n return new AnimationTimelineBuilderVisitor().buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors);\n}\nclass AnimationTimelineBuilderVisitor {\n buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors = []) {\n subInstructions = subInstructions || new ElementInstructionMap();\n const context = new AnimationTimelineContext(driver, rootElement, subInstructions, enterClassName, leaveClassName, errors, []);\n context.options = options;\n const delay = options.delay ? resolveTimingValue(options.delay) : 0;\n context.currentTimeline.delayNextStep(delay);\n context.currentTimeline.setStyles([startingStyles], null, context.errors, options);\n visitDslNode(this, ast, context);\n // this checks to see if an actual animation happened\n const timelines = context.timelines.filter(timeline => timeline.containsAnimation());\n // note: we just want to apply the final styles for the rootElement, so we do not\n // just apply the styles to the last timeline but the last timeline which\n // element is the root one (basically `*`-styles are replaced with the actual\n // state style values only for the root element)\n if (timelines.length && finalStyles.size) {\n let lastRootTimeline;\n for (let i = timelines.length - 1; i >= 0; i--) {\n const timeline = timelines[i];\n if (timeline.element === rootElement) {\n lastRootTimeline = timeline;\n break;\n }\n }\n if (lastRootTimeline && !lastRootTimeline.allowOnlyTimelineStyles()) {\n lastRootTimeline.setStyles([finalStyles], null, context.errors, options);\n }\n }\n return timelines.length ?\n timelines.map(timeline => timeline.buildKeyframes()) :\n [createTimelineInstruction(rootElement, [], [], [], 0, delay, '', false)];\n }\n visitTrigger(ast, context) {\n // these values are not visited in this AST\n }\n visitState(ast, context) {\n // these values are not visited in this AST\n }\n visitTransition(ast, context) {\n // these values are not visited in this AST\n }\n visitAnimateChild(ast, context) {\n const elementInstructions = context.subInstructions.get(context.element);\n if (elementInstructions) {\n const innerContext = context.createSubContext(ast.options);\n const startTime = context.currentTimeline.currentTime;\n const endTime = this._visitSubInstructions(elementInstructions, innerContext, innerContext.options);\n if (startTime != endTime) {\n // we do this on the upper context because we created a sub context for\n // the sub child animations\n context.transformIntoNewTimeline(endTime);\n }\n }\n context.previousNode = ast;\n }\n visitAnimateRef(ast, context) {\n const innerContext = context.createSubContext(ast.options);\n innerContext.transformIntoNewTimeline();\n this._applyAnimationRefDelays([ast.options, ast.animation.options], context, innerContext);\n this.visitReference(ast.animation, innerContext);\n context.transformIntoNewTimeline(innerContext.currentTimeline.currentTime);\n context.previousNode = ast;\n }\n _applyAnimationRefDelays(animationsRefsOptions, context, innerContext) {\n for (const animationRefOptions of animationsRefsOptions) {\n const animationDelay = animationRefOptions?.delay;\n if (animationDelay) {\n const animationDelayValue = typeof animationDelay === 'number' ?\n animationDelay :\n resolveTimingValue(interpolateParams(animationDelay, animationRefOptions?.params ?? {}, context.errors));\n innerContext.delayNextStep(animationDelayValue);\n }\n }\n }\n _visitSubInstructions(instructions, context, options) {\n const startTime = context.currentTimeline.currentTime;\n let furthestTime = startTime;\n // this is a special-case for when a user wants to skip a sub\n // animation from being fired entirely.\n const duration = options.duration != null ? resolveTimingValue(options.duration) : null;\n const delay = options.delay != null ? resolveTimingValue(options.delay) : null;\n if (duration !== 0) {\n instructions.forEach(instruction => {\n const instructionTimings = context.appendInstructionToTimeline(instruction, duration, delay);\n furthestTime =\n Math.max(furthestTime, instructionTimings.duration + instructionTimings.delay);\n });\n }\n return furthestTime;\n }\n visitReference(ast, context) {\n context.updateOptions(ast.options, true);\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n }\n visitSequence(ast, context) {\n const subContextCount = context.subContextCount;\n let ctx = context;\n const options = ast.options;\n if (options && (options.params || options.delay)) {\n ctx = context.createSubContext(options);\n ctx.transformIntoNewTimeline();\n if (options.delay != null) {\n if (ctx.previousNode.type == 6 /* AnimationMetadataType.Style */) {\n ctx.currentTimeline.snapshotCurrentStyles();\n ctx.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n const delay = resolveTimingValue(options.delay);\n ctx.delayNextStep(delay);\n }\n }\n if (ast.steps.length) {\n ast.steps.forEach(s => visitDslNode(this, s, ctx));\n // this is here just in case the inner steps only contain or end with a style() call\n ctx.currentTimeline.applyStylesToKeyframe();\n // this means that some animation function within the sequence\n // ended up creating a sub timeline (which means the current\n // timeline cannot overlap with the contents of the sequence)\n if (ctx.subContextCount > subContextCount) {\n ctx.transformIntoNewTimeline();\n }\n }\n context.previousNode = ast;\n }\n visitGroup(ast, context) {\n const innerTimelines = [];\n let furthestTime = context.currentTimeline.currentTime;\n const delay = ast.options && ast.options.delay ? resolveTimingValue(ast.options.delay) : 0;\n ast.steps.forEach(s => {\n const innerContext = context.createSubContext(ast.options);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n visitDslNode(this, s, innerContext);\n furthestTime = Math.max(furthestTime, innerContext.currentTimeline.currentTime);\n innerTimelines.push(innerContext.currentTimeline);\n });\n // this operation is run after the AST loop because otherwise\n // if the parent timeline's collected styles were updated then\n // it would pass in invalid data into the new-to-be forked items\n innerTimelines.forEach(timeline => context.currentTimeline.mergeTimelineCollectedStyles(timeline));\n context.transformIntoNewTimeline(furthestTime);\n context.previousNode = ast;\n }\n _visitTiming(ast, context) {\n if (ast.dynamic) {\n const strValue = ast.strValue;\n const timingValue = context.params ? interpolateParams(strValue, context.params, context.errors) : strValue;\n return resolveTiming(timingValue, context.errors);\n }\n else {\n return { duration: ast.duration, delay: ast.delay, easing: ast.easing };\n }\n }\n visitAnimate(ast, context) {\n const timings = context.currentAnimateTimings = this._visitTiming(ast.timings, context);\n const timeline = context.currentTimeline;\n if (timings.delay) {\n context.incrementTime(timings.delay);\n timeline.snapshotCurrentStyles();\n }\n const style = ast.style;\n if (style.type == 5 /* AnimationMetadataType.Keyframes */) {\n this.visitKeyframes(style, context);\n }\n else {\n context.incrementTime(timings.duration);\n this.visitStyle(style, context);\n timeline.applyStylesToKeyframe();\n }\n context.currentAnimateTimings = null;\n context.previousNode = ast;\n }\n visitStyle(ast, context) {\n const timeline = context.currentTimeline;\n const timings = context.currentAnimateTimings;\n // this is a special case for when a style() call\n // directly follows an animate() call (but not inside of an animate() call)\n if (!timings && timeline.hasCurrentStyleProperties()) {\n timeline.forwardFrame();\n }\n const easing = (timings && timings.easing) || ast.easing;\n if (ast.isEmptyStep) {\n timeline.applyEmptyStep(easing);\n }\n else {\n timeline.setStyles(ast.styles, easing, context.errors, context.options);\n }\n context.previousNode = ast;\n }\n visitKeyframes(ast, context) {\n const currentAnimateTimings = context.currentAnimateTimings;\n const startTime = (context.currentTimeline).duration;\n const duration = currentAnimateTimings.duration;\n const innerContext = context.createSubContext();\n const innerTimeline = innerContext.currentTimeline;\n innerTimeline.easing = currentAnimateTimings.easing;\n ast.styles.forEach(step => {\n const offset = step.offset || 0;\n innerTimeline.forwardTime(offset * duration);\n innerTimeline.setStyles(step.styles, step.easing, context.errors, context.options);\n innerTimeline.applyStylesToKeyframe();\n });\n // this will ensure that the parent timeline gets all the styles from\n // the child even if the new timeline below is not used\n context.currentTimeline.mergeTimelineCollectedStyles(innerTimeline);\n // we do this because the window between this timeline and the sub timeline\n // should ensure that the styles within are exactly the same as they were before\n context.transformIntoNewTimeline(startTime + duration);\n context.previousNode = ast;\n }\n visitQuery(ast, context) {\n // in the event that the first step before this is a style step we need\n // to ensure the styles are applied before the children are animated\n const startTime = context.currentTimeline.currentTime;\n const options = (ast.options || {});\n const delay = options.delay ? resolveTimingValue(options.delay) : 0;\n if (delay &&\n (context.previousNode.type === 6 /* AnimationMetadataType.Style */ ||\n (startTime == 0 && context.currentTimeline.hasCurrentStyleProperties()))) {\n context.currentTimeline.snapshotCurrentStyles();\n context.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n }\n let furthestTime = startTime;\n const elms = context.invokeQuery(ast.selector, ast.originalSelector, ast.limit, ast.includeSelf, options.optional ? true : false, context.errors);\n context.currentQueryTotal = elms.length;\n let sameElementTimeline = null;\n elms.forEach((element, i) => {\n context.currentQueryIndex = i;\n const innerContext = context.createSubContext(ast.options, element);\n if (delay) {\n innerContext.delayNextStep(delay);\n }\n if (element === context.element) {\n sameElementTimeline = innerContext.currentTimeline;\n }\n visitDslNode(this, ast.animation, innerContext);\n // this is here just incase the inner steps only contain or end\n // with a style() call (which is here to signal that this is a preparatory\n // call to style an element before it is animated again)\n innerContext.currentTimeline.applyStylesToKeyframe();\n const endTime = innerContext.currentTimeline.currentTime;\n furthestTime = Math.max(furthestTime, endTime);\n });\n context.currentQueryIndex = 0;\n context.currentQueryTotal = 0;\n context.transformIntoNewTimeline(furthestTime);\n if (sameElementTimeline) {\n context.currentTimeline.mergeTimelineCollectedStyles(sameElementTimeline);\n context.currentTimeline.snapshotCurrentStyles();\n }\n context.previousNode = ast;\n }\n visitStagger(ast, context) {\n const parentContext = context.parentContext;\n const tl = context.currentTimeline;\n const timings = ast.timings;\n const duration = Math.abs(timings.duration);\n const maxTime = duration * (context.currentQueryTotal - 1);\n let delay = duration * context.currentQueryIndex;\n let staggerTransformer = timings.duration < 0 ? 'reverse' : timings.easing;\n switch (staggerTransformer) {\n case 'reverse':\n delay = maxTime - delay;\n break;\n case 'full':\n delay = parentContext.currentStaggerTime;\n break;\n }\n const timeline = context.currentTimeline;\n if (delay) {\n timeline.delayNextStep(delay);\n }\n const startingTime = timeline.currentTime;\n visitDslNode(this, ast.animation, context);\n context.previousNode = ast;\n // time = duration + delay\n // the reason why this computation is so complex is because\n // the inner timeline may either have a delay value or a stretched\n // keyframe depending on if a subtimeline is not used or is used.\n parentContext.currentStaggerTime =\n (tl.currentTime - startingTime) + (tl.startTime - parentContext.currentTimeline.startTime);\n }\n}\nconst DEFAULT_NOOP_PREVIOUS_NODE = {};\nclass AnimationTimelineContext {\n constructor(_driver, element, subInstructions, _enterClassName, _leaveClassName, errors, timelines, initialTimeline) {\n this._driver = _driver;\n this.element = element;\n this.subInstructions = subInstructions;\n this._enterClassName = _enterClassName;\n this._leaveClassName = _leaveClassName;\n this.errors = errors;\n this.timelines = timelines;\n this.parentContext = null;\n this.currentAnimateTimings = null;\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.subContextCount = 0;\n this.options = {};\n this.currentQueryIndex = 0;\n this.currentQueryTotal = 0;\n this.currentStaggerTime = 0;\n this.currentTimeline = initialTimeline || new TimelineBuilder(this._driver, element, 0);\n timelines.push(this.currentTimeline);\n }\n get params() {\n return this.options.params;\n }\n updateOptions(options, skipIfExists) {\n if (!options)\n return;\n const newOptions = options;\n let optionsToUpdate = this.options;\n // NOTE: this will get patched up when other animation methods support duration overrides\n if (newOptions.duration != null) {\n optionsToUpdate.duration = resolveTimingValue(newOptions.duration);\n }\n if (newOptions.delay != null) {\n optionsToUpdate.delay = resolveTimingValue(newOptions.delay);\n }\n const newParams = newOptions.params;\n if (newParams) {\n let paramsToUpdate = optionsToUpdate.params;\n if (!paramsToUpdate) {\n paramsToUpdate = this.options.params = {};\n }\n Object.keys(newParams).forEach(name => {\n if (!skipIfExists || !paramsToUpdate.hasOwnProperty(name)) {\n paramsToUpdate[name] = interpolateParams(newParams[name], paramsToUpdate, this.errors);\n }\n });\n }\n }\n _copyOptions() {\n const options = {};\n if (this.options) {\n const oldParams = this.options.params;\n if (oldParams) {\n const params = options['params'] = {};\n Object.keys(oldParams).forEach(name => {\n params[name] = oldParams[name];\n });\n }\n }\n return options;\n }\n createSubContext(options = null, element, newTime) {\n const target = element || this.element;\n const context = new AnimationTimelineContext(this._driver, target, this.subInstructions, this._enterClassName, this._leaveClassName, this.errors, this.timelines, this.currentTimeline.fork(target, newTime || 0));\n context.previousNode = this.previousNode;\n context.currentAnimateTimings = this.currentAnimateTimings;\n context.options = this._copyOptions();\n context.updateOptions(options);\n context.currentQueryIndex = this.currentQueryIndex;\n context.currentQueryTotal = this.currentQueryTotal;\n context.parentContext = this;\n this.subContextCount++;\n return context;\n }\n transformIntoNewTimeline(newTime) {\n this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE;\n this.currentTimeline = this.currentTimeline.fork(this.element, newTime);\n this.timelines.push(this.currentTimeline);\n return this.currentTimeline;\n }\n appendInstructionToTimeline(instruction, duration, delay) {\n const updatedTimings = {\n duration: duration != null ? duration : instruction.duration,\n delay: this.currentTimeline.currentTime + (delay != null ? delay : 0) + instruction.delay,\n easing: ''\n };\n const builder = new SubTimelineBuilder(this._driver, instruction.element, instruction.keyframes, instruction.preStyleProps, instruction.postStyleProps, updatedTimings, instruction.stretchStartingKeyframe);\n this.timelines.push(builder);\n return updatedTimings;\n }\n incrementTime(time) {\n this.currentTimeline.forwardTime(this.currentTimeline.duration + time);\n }\n delayNextStep(delay) {\n // negative delays are not yet supported\n if (delay > 0) {\n this.currentTimeline.delayNextStep(delay);\n }\n }\n invokeQuery(selector, originalSelector, limit, includeSelf, optional, errors) {\n let results = [];\n if (includeSelf) {\n results.push(this.element);\n }\n if (selector.length > 0) { // only if :self is used then the selector can be empty\n selector = selector.replace(ENTER_TOKEN_REGEX, '.' + this._enterClassName);\n selector = selector.replace(LEAVE_TOKEN_REGEX, '.' + this._leaveClassName);\n const multi = limit != 1;\n let elements = this._driver.query(this.element, selector, multi);\n if (limit !== 0) {\n elements = limit < 0 ? elements.slice(elements.length + limit, elements.length) :\n elements.slice(0, limit);\n }\n results.push(...elements);\n }\n if (!optional && results.length == 0) {\n errors.push(invalidQuery(originalSelector));\n }\n return results;\n }\n}\nclass TimelineBuilder {\n constructor(_driver, element, startTime, _elementTimelineStylesLookup) {\n this._driver = _driver;\n this.element = element;\n this.startTime = startTime;\n this._elementTimelineStylesLookup = _elementTimelineStylesLookup;\n this.duration = 0;\n this.easing = null;\n this._previousKeyframe = new Map();\n this._currentKeyframe = new Map();\n this._keyframes = new Map();\n this._styleSummary = new Map();\n this._localTimelineStyles = new Map();\n this._pendingStyles = new Map();\n this._backFill = new Map();\n this._currentEmptyStepKeyframe = null;\n if (!this._elementTimelineStylesLookup) {\n this._elementTimelineStylesLookup = new Map();\n }\n this._globalTimelineStyles = this._elementTimelineStylesLookup.get(element);\n if (!this._globalTimelineStyles) {\n this._globalTimelineStyles = this._localTimelineStyles;\n this._elementTimelineStylesLookup.set(element, this._localTimelineStyles);\n }\n this._loadKeyframe();\n }\n containsAnimation() {\n switch (this._keyframes.size) {\n case 0:\n return false;\n case 1:\n return this.hasCurrentStyleProperties();\n default:\n return true;\n }\n }\n hasCurrentStyleProperties() {\n return this._currentKeyframe.size > 0;\n }\n get currentTime() {\n return this.startTime + this.duration;\n }\n delayNextStep(delay) {\n // in the event that a style() step is placed right before a stagger()\n // and that style() step is the very first style() value in the animation\n // then we need to make a copy of the keyframe [0, copy, 1] so that the delay\n // properly applies the style() values to work with the stagger...\n const hasPreStyleStep = this._keyframes.size === 1 && this._pendingStyles.size;\n if (this.duration || hasPreStyleStep) {\n this.forwardTime(this.currentTime + delay);\n if (hasPreStyleStep) {\n this.snapshotCurrentStyles();\n }\n }\n else {\n this.startTime += delay;\n }\n }\n fork(element, currentTime) {\n this.applyStylesToKeyframe();\n return new TimelineBuilder(this._driver, element, currentTime || this.currentTime, this._elementTimelineStylesLookup);\n }\n _loadKeyframe() {\n if (this._currentKeyframe) {\n this._previousKeyframe = this._currentKeyframe;\n }\n this._currentKeyframe = this._keyframes.get(this.duration);\n if (!this._currentKeyframe) {\n this._currentKeyframe = new Map();\n this._keyframes.set(this.duration, this._currentKeyframe);\n }\n }\n forwardFrame() {\n this.duration += ONE_FRAME_IN_MILLISECONDS;\n this._loadKeyframe();\n }\n forwardTime(time) {\n this.applyStylesToKeyframe();\n this.duration = time;\n this._loadKeyframe();\n }\n _updateStyle(prop, value) {\n this._localTimelineStyles.set(prop, value);\n this._globalTimelineStyles.set(prop, value);\n this._styleSummary.set(prop, { time: this.currentTime, value });\n }\n allowOnlyTimelineStyles() {\n return this._currentEmptyStepKeyframe !== this._currentKeyframe;\n }\n applyEmptyStep(easing) {\n if (easing) {\n this._previousKeyframe.set('easing', easing);\n }\n // special case for animate(duration):\n // all missing styles are filled with a `*` value then\n // if any destination styles are filled in later on the same\n // keyframe then they will override the overridden styles\n // We use `_globalTimelineStyles` here because there may be\n // styles in previous keyframes that are not present in this timeline\n for (let [prop, value] of this._globalTimelineStyles) {\n this._backFill.set(prop, value || AUTO_STYLE);\n this._currentKeyframe.set(prop, AUTO_STYLE);\n }\n this._currentEmptyStepKeyframe = this._currentKeyframe;\n }\n setStyles(input, easing, errors, options) {\n if (easing) {\n this._previousKeyframe.set('easing', easing);\n }\n const params = (options && options.params) || {};\n const styles = flattenStyles(input, this._globalTimelineStyles);\n for (let [prop, value] of styles) {\n const val = interpolateParams(value, params, errors);\n this._pendingStyles.set(prop, val);\n if (!this._localTimelineStyles.has(prop)) {\n this._backFill.set(prop, this._globalTimelineStyles.get(prop) ?? AUTO_STYLE);\n }\n this._updateStyle(prop, val);\n }\n }\n applyStylesToKeyframe() {\n if (this._pendingStyles.size == 0)\n return;\n this._pendingStyles.forEach((val, prop) => {\n this._currentKeyframe.set(prop, val);\n });\n this._pendingStyles.clear();\n this._localTimelineStyles.forEach((val, prop) => {\n if (!this._currentKeyframe.has(prop)) {\n this._currentKeyframe.set(prop, val);\n }\n });\n }\n snapshotCurrentStyles() {\n for (let [prop, val] of this._localTimelineStyles) {\n this._pendingStyles.set(prop, val);\n this._updateStyle(prop, val);\n }\n }\n getFinalKeyframe() {\n return this._keyframes.get(this.duration);\n }\n get properties() {\n const properties = [];\n for (let prop in this._currentKeyframe) {\n properties.push(prop);\n }\n return properties;\n }\n mergeTimelineCollectedStyles(timeline) {\n timeline._styleSummary.forEach((details1, prop) => {\n const details0 = this._styleSummary.get(prop);\n if (!details0 || details1.time > details0.time) {\n this._updateStyle(prop, details1.value);\n }\n });\n }\n buildKeyframes() {\n this.applyStylesToKeyframe();\n const preStyleProps = new Set();\n const postStyleProps = new Set();\n const isEmpty = this._keyframes.size === 1 && this.duration === 0;\n let finalKeyframes = [];\n this._keyframes.forEach((keyframe, time) => {\n const finalKeyframe = copyStyles(keyframe, new Map(), this._backFill);\n finalKeyframe.forEach((value, prop) => {\n if (value === ɵPRE_STYLE) {\n preStyleProps.add(prop);\n }\n else if (value === AUTO_STYLE) {\n postStyleProps.add(prop);\n }\n });\n if (!isEmpty) {\n finalKeyframe.set('offset', time / this.duration);\n }\n finalKeyframes.push(finalKeyframe);\n });\n const preProps = preStyleProps.size ? iteratorToArray(preStyleProps.values()) : [];\n const postProps = postStyleProps.size ? iteratorToArray(postStyleProps.values()) : [];\n // special case for a 0-second animation (which is designed just to place styles onscreen)\n if (isEmpty) {\n const kf0 = finalKeyframes[0];\n const kf1 = new Map(kf0);\n kf0.set('offset', 0);\n kf1.set('offset', 1);\n finalKeyframes = [kf0, kf1];\n }\n return createTimelineInstruction(this.element, finalKeyframes, preProps, postProps, this.duration, this.startTime, this.easing, false);\n }\n}\nclass SubTimelineBuilder extends TimelineBuilder {\n constructor(driver, element, keyframes, preStyleProps, postStyleProps, timings, _stretchStartingKeyframe = false) {\n super(driver, element, timings.delay);\n this.keyframes = keyframes;\n this.preStyleProps = preStyleProps;\n this.postStyleProps = postStyleProps;\n this._stretchStartingKeyframe = _stretchStartingKeyframe;\n this.timings = { duration: timings.duration, delay: timings.delay, easing: timings.easing };\n }\n containsAnimation() {\n return this.keyframes.length > 1;\n }\n buildKeyframes() {\n let keyframes = this.keyframes;\n let { delay, duration, easing } = this.timings;\n if (this._stretchStartingKeyframe && delay) {\n const newKeyframes = [];\n const totalTime = duration + delay;\n const startingGap = delay / totalTime;\n // the original starting keyframe now starts once the delay is done\n const newFirstKeyframe = copyStyles(keyframes[0]);\n newFirstKeyframe.set('offset', 0);\n newKeyframes.push(newFirstKeyframe);\n const oldFirstKeyframe = copyStyles(keyframes[0]);\n oldFirstKeyframe.set('offset', roundOffset(startingGap));\n newKeyframes.push(oldFirstKeyframe);\n /*\n When the keyframe is stretched then it means that the delay before the animation\n starts is gone. Instead the first keyframe is placed at the start of the animation\n and it is then copied to where it starts when the original delay is over. This basically\n means nothing animates during that delay, but the styles are still rendered. For this\n to work the original offset values that exist in the original keyframes must be \"warped\"\n so that they can take the new keyframe + delay into account.\n \n delay=1000, duration=1000, keyframes = 0 .5 1\n \n turns into\n \n delay=0, duration=2000, keyframes = 0 .33 .66 1\n */\n // offsets between 1 ... n -1 are all warped by the keyframe stretch\n const limit = keyframes.length - 1;\n for (let i = 1; i <= limit; i++) {\n let kf = copyStyles(keyframes[i]);\n const oldOffset = kf.get('offset');\n const timeAtKeyframe = delay + oldOffset * duration;\n kf.set('offset', roundOffset(timeAtKeyframe / totalTime));\n newKeyframes.push(kf);\n }\n // the new starting keyframe should be added at the start\n duration = totalTime;\n delay = 0;\n easing = '';\n keyframes = newKeyframes;\n }\n return createTimelineInstruction(this.element, keyframes, this.preStyleProps, this.postStyleProps, duration, delay, easing, true);\n }\n}\nfunction roundOffset(offset, decimalPoints = 3) {\n const mult = Math.pow(10, decimalPoints - 1);\n return Math.round(offset * mult) / mult;\n}\nfunction flattenStyles(input, allStyles) {\n const styles = new Map();\n let allProperties;\n input.forEach(token => {\n if (token === '*') {\n allProperties = allProperties || allStyles.keys();\n for (let prop of allProperties) {\n styles.set(prop, AUTO_STYLE);\n }\n }\n else {\n copyStyles(token, styles);\n }\n });\n return styles;\n}\n\nclass Animation {\n constructor(_driver, input) {\n this._driver = _driver;\n const errors = [];\n const warnings = [];\n const ast = buildAnimationAst(_driver, input, errors, warnings);\n if (errors.length) {\n throw validationFailed(errors);\n }\n if (warnings.length) {\n warnValidation(warnings);\n }\n this._animationAst = ast;\n }\n buildTimelines(element, startingStyles, destinationStyles, options, subInstructions) {\n const start = Array.isArray(startingStyles) ? normalizeStyles(startingStyles) :\n startingStyles;\n const dest = Array.isArray(destinationStyles) ? normalizeStyles(destinationStyles) :\n destinationStyles;\n const errors = [];\n subInstructions = subInstructions || new ElementInstructionMap();\n const result = buildAnimationTimelines(this._driver, element, this._animationAst, ENTER_CLASSNAME, LEAVE_CLASSNAME, start, dest, options, subInstructions, errors);\n if (errors.length) {\n throw buildingFailed(errors);\n }\n return result;\n }\n}\n\n/**\n * @publicApi\n */\nclass AnimationStyleNormalizer {\n}\n/**\n * @publicApi\n */\nclass NoopAnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return propertyName;\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n return value;\n }\n}\n\nconst DIMENSIONAL_PROP_SET = new Set([\n 'width',\n 'height',\n 'minWidth',\n 'minHeight',\n 'maxWidth',\n 'maxHeight',\n 'left',\n 'top',\n 'bottom',\n 'right',\n 'fontSize',\n 'outlineWidth',\n 'outlineOffset',\n 'paddingTop',\n 'paddingLeft',\n 'paddingBottom',\n 'paddingRight',\n 'marginTop',\n 'marginLeft',\n 'marginBottom',\n 'marginRight',\n 'borderRadius',\n 'borderWidth',\n 'borderTopWidth',\n 'borderLeftWidth',\n 'borderRightWidth',\n 'borderBottomWidth',\n 'textIndent',\n 'perspective'\n]);\nclass WebAnimationsStyleNormalizer extends AnimationStyleNormalizer {\n normalizePropertyName(propertyName, errors) {\n return dashCaseToCamelCase(propertyName);\n }\n normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) {\n let unit = '';\n const strVal = value.toString().trim();\n if (DIMENSIONAL_PROP_SET.has(normalizedProperty) && value !== 0 && value !== '0') {\n if (typeof value === 'number') {\n unit = 'px';\n }\n else {\n const valAndSuffixMatch = value.match(/^[+-]?[\\d\\.]+([a-z]*)$/);\n if (valAndSuffixMatch && valAndSuffixMatch[1].length == 0) {\n errors.push(invalidCssUnitValue(userProvidedProperty, value));\n }\n }\n }\n return strVal + unit;\n }\n}\n\nfunction createTransitionInstruction(element, triggerName, fromState, toState, isRemovalTransition, fromStyles, toStyles, timelines, queriedElements, preStyleProps, postStyleProps, totalTime, errors) {\n return {\n type: 0 /* AnimationTransitionInstructionType.TransitionAnimation */,\n element,\n triggerName,\n isRemovalTransition,\n fromState,\n fromStyles,\n toState,\n toStyles,\n timelines,\n queriedElements,\n preStyleProps,\n postStyleProps,\n totalTime,\n errors\n };\n}\n\nconst EMPTY_OBJECT = {};\nclass AnimationTransitionFactory {\n constructor(_triggerName, ast, _stateStyles) {\n this._triggerName = _triggerName;\n this.ast = ast;\n this._stateStyles = _stateStyles;\n }\n match(currentState, nextState, element, params) {\n return oneOrMoreTransitionsMatch(this.ast.matchers, currentState, nextState, element, params);\n }\n buildStyles(stateName, params, errors) {\n let styler = this._stateStyles.get('*');\n if (stateName !== undefined) {\n styler = this._stateStyles.get(stateName?.toString()) || styler;\n }\n return styler ? styler.buildStyles(params, errors) : new Map();\n }\n build(driver, element, currentState, nextState, enterClassName, leaveClassName, currentOptions, nextOptions, subInstructions, skipAstBuild) {\n const errors = [];\n const transitionAnimationParams = this.ast.options && this.ast.options.params || EMPTY_OBJECT;\n const currentAnimationParams = currentOptions && currentOptions.params || EMPTY_OBJECT;\n const currentStateStyles = this.buildStyles(currentState, currentAnimationParams, errors);\n const nextAnimationParams = nextOptions && nextOptions.params || EMPTY_OBJECT;\n const nextStateStyles = this.buildStyles(nextState, nextAnimationParams, errors);\n const queriedElements = new Set();\n const preStyleMap = new Map();\n const postStyleMap = new Map();\n const isRemoval = nextState === 'void';\n const animationOptions = {\n params: applyParamDefaults(nextAnimationParams, transitionAnimationParams),\n delay: this.ast.options?.delay,\n };\n const timelines = skipAstBuild ?\n [] :\n buildAnimationTimelines(driver, element, this.ast.animation, enterClassName, leaveClassName, currentStateStyles, nextStateStyles, animationOptions, subInstructions, errors);\n let totalTime = 0;\n timelines.forEach(tl => {\n totalTime = Math.max(tl.duration + tl.delay, totalTime);\n });\n if (errors.length) {\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, [], [], preStyleMap, postStyleMap, totalTime, errors);\n }\n timelines.forEach(tl => {\n const elm = tl.element;\n const preProps = getOrSetDefaultValue(preStyleMap, elm, new Set());\n tl.preStyleProps.forEach(prop => preProps.add(prop));\n const postProps = getOrSetDefaultValue(postStyleMap, elm, new Set());\n tl.postStyleProps.forEach(prop => postProps.add(prop));\n if (elm !== element) {\n queriedElements.add(elm);\n }\n });\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n checkNonAnimatableInTimelines(timelines, this._triggerName, driver);\n }\n const queriedElementsList = iteratorToArray(queriedElements.values());\n return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, timelines, queriedElementsList, preStyleMap, postStyleMap, totalTime);\n }\n}\n/**\n * Checks inside a set of timelines if they try to animate a css property which is not considered\n * animatable, in that case it prints a warning on the console.\n * Besides that the function doesn't have any other effect.\n *\n * Note: this check is done here after the timelines are built instead of doing on a lower level so\n * that we can make sure that the warning appears only once per instruction (we can aggregate here\n * all the issues instead of finding them separately).\n *\n * @param timelines The built timelines for the current instruction.\n * @param triggerName The name of the trigger for the current instruction.\n * @param driver Animation driver used to perform the check.\n *\n */\nfunction checkNonAnimatableInTimelines(timelines, triggerName, driver) {\n if (!driver.validateAnimatableStyleProperty) {\n return;\n }\n const allowedNonAnimatableProps = new Set([\n // 'easing' is a utility/synthetic prop we use to represent\n // easing functions, it represents a property of the animation\n // which is not animatable but different values can be used\n // in different steps\n 'easing'\n ]);\n const invalidNonAnimatableProps = new Set();\n timelines.forEach(({ keyframes }) => {\n const nonAnimatablePropsInitialValues = new Map();\n keyframes.forEach(keyframe => {\n const entriesToCheck = Array.from(keyframe.entries()).filter(([prop]) => !allowedNonAnimatableProps.has(prop));\n for (const [prop, value] of entriesToCheck) {\n if (!driver.validateAnimatableStyleProperty(prop)) {\n if (nonAnimatablePropsInitialValues.has(prop) && !invalidNonAnimatableProps.has(prop)) {\n const propInitialValue = nonAnimatablePropsInitialValues.get(prop);\n if (propInitialValue !== value) {\n invalidNonAnimatableProps.add(prop);\n }\n }\n else {\n nonAnimatablePropsInitialValues.set(prop, value);\n }\n }\n }\n });\n });\n if (invalidNonAnimatableProps.size > 0) {\n console.warn(`Warning: The animation trigger \"${triggerName}\" is attempting to animate the following` +\n ' not animatable properties: ' + Array.from(invalidNonAnimatableProps).join(', ') + '\\n' +\n '(to check the list of all animatable properties visit https://developer.mozilla.org/en-US/docs/Web/CSS/CSS_animated_properties)');\n }\n}\nfunction oneOrMoreTransitionsMatch(matchFns, currentState, nextState, element, params) {\n return matchFns.some(fn => fn(currentState, nextState, element, params));\n}\nfunction applyParamDefaults(userParams, defaults) {\n const result = copyObj(defaults);\n for (const key in userParams) {\n if (userParams.hasOwnProperty(key) && userParams[key] != null) {\n result[key] = userParams[key];\n }\n }\n return result;\n}\nclass AnimationStateStyles {\n constructor(styles, defaultParams, normalizer) {\n this.styles = styles;\n this.defaultParams = defaultParams;\n this.normalizer = normalizer;\n }\n buildStyles(params, errors) {\n const finalStyles = new Map();\n const combinedParams = copyObj(this.defaultParams);\n Object.keys(params).forEach(key => {\n const value = params[key];\n if (value !== null) {\n combinedParams[key] = value;\n }\n });\n this.styles.styles.forEach(value => {\n if (typeof value !== 'string') {\n value.forEach((val, prop) => {\n if (val) {\n val = interpolateParams(val, combinedParams, errors);\n }\n const normalizedProp = this.normalizer.normalizePropertyName(prop, errors);\n val = this.normalizer.normalizeStyleValue(prop, normalizedProp, val, errors);\n finalStyles.set(prop, val);\n });\n }\n });\n return finalStyles;\n }\n}\n\nfunction buildTrigger(name, ast, normalizer) {\n return new AnimationTrigger(name, ast, normalizer);\n}\nclass AnimationTrigger {\n constructor(name, ast, _normalizer) {\n this.name = name;\n this.ast = ast;\n this._normalizer = _normalizer;\n this.transitionFactories = [];\n this.states = new Map();\n ast.states.forEach(ast => {\n const defaultParams = (ast.options && ast.options.params) || {};\n this.states.set(ast.name, new AnimationStateStyles(ast.style, defaultParams, _normalizer));\n });\n balanceProperties(this.states, 'true', '1');\n balanceProperties(this.states, 'false', '0');\n ast.transitions.forEach(ast => {\n this.transitionFactories.push(new AnimationTransitionFactory(name, ast, this.states));\n });\n this.fallbackTransition = createFallbackTransition(name, this.states, this._normalizer);\n }\n get containsQueries() {\n return this.ast.queryCount > 0;\n }\n matchTransition(currentState, nextState, element, params) {\n const entry = this.transitionFactories.find(f => f.match(currentState, nextState, element, params));\n return entry || null;\n }\n matchStyles(currentState, params, errors) {\n return this.fallbackTransition.buildStyles(currentState, params, errors);\n }\n}\nfunction createFallbackTransition(triggerName, states, normalizer) {\n const matchers = [(fromState, toState) => true];\n const animation = { type: 2 /* AnimationMetadataType.Sequence */, steps: [], options: null };\n const transition = {\n type: 1 /* AnimationMetadataType.Transition */,\n animation,\n matchers,\n options: null,\n queryCount: 0,\n depCount: 0\n };\n return new AnimationTransitionFactory(triggerName, transition, states);\n}\nfunction balanceProperties(stateMap, key1, key2) {\n if (stateMap.has(key1)) {\n if (!stateMap.has(key2)) {\n stateMap.set(key2, stateMap.get(key1));\n }\n }\n else if (stateMap.has(key2)) {\n stateMap.set(key1, stateMap.get(key2));\n }\n}\n\nconst EMPTY_INSTRUCTION_MAP = new ElementInstructionMap();\nclass TimelineAnimationEngine {\n constructor(bodyNode, _driver, _normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._normalizer = _normalizer;\n this._animations = new Map();\n this._playersById = new Map();\n this.players = [];\n }\n register(id, metadata) {\n const errors = [];\n const warnings = [];\n const ast = buildAnimationAst(this._driver, metadata, errors, warnings);\n if (errors.length) {\n throw registerFailed(errors);\n }\n else {\n if (warnings.length) {\n warnRegister(warnings);\n }\n this._animations.set(id, ast);\n }\n }\n _buildPlayer(i, preStyles, postStyles) {\n const element = i.element;\n const keyframes = normalizeKeyframes$1(this._driver, this._normalizer, element, i.keyframes, preStyles, postStyles);\n return this._driver.animate(element, keyframes, i.duration, i.delay, i.easing, [], true);\n }\n create(id, element, options = {}) {\n const errors = [];\n const ast = this._animations.get(id);\n let instructions;\n const autoStylesMap = new Map();\n if (ast) {\n instructions = buildAnimationTimelines(this._driver, element, ast, ENTER_CLASSNAME, LEAVE_CLASSNAME, new Map(), new Map(), options, EMPTY_INSTRUCTION_MAP, errors);\n instructions.forEach(inst => {\n const styles = getOrSetDefaultValue(autoStylesMap, inst.element, new Map());\n inst.postStyleProps.forEach(prop => styles.set(prop, null));\n });\n }\n else {\n errors.push(missingOrDestroyedAnimation());\n instructions = [];\n }\n if (errors.length) {\n throw createAnimationFailed(errors);\n }\n autoStylesMap.forEach((styles, element) => {\n styles.forEach((_, prop) => {\n styles.set(prop, this._driver.computeStyle(element, prop, AUTO_STYLE));\n });\n });\n const players = instructions.map(i => {\n const styles = autoStylesMap.get(i.element);\n return this._buildPlayer(i, new Map(), styles);\n });\n const player = optimizeGroupPlayer(players);\n this._playersById.set(id, player);\n player.onDestroy(() => this.destroy(id));\n this.players.push(player);\n return player;\n }\n destroy(id) {\n const player = this._getPlayer(id);\n player.destroy();\n this._playersById.delete(id);\n const index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n }\n _getPlayer(id) {\n const player = this._playersById.get(id);\n if (!player) {\n throw missingPlayer(id);\n }\n return player;\n }\n listen(id, element, eventName, callback) {\n // triggerName, fromState, toState are all ignored for timeline animations\n const baseEvent = makeAnimationEvent(element, '', '', '');\n listenOnPlayer(this._getPlayer(id), eventName, baseEvent, callback);\n return () => { };\n }\n command(id, element, command, args) {\n if (command == 'register') {\n this.register(id, args[0]);\n return;\n }\n if (command == 'create') {\n const options = (args[0] || {});\n this.create(id, element, options);\n return;\n }\n const player = this._getPlayer(id);\n switch (command) {\n case 'play':\n player.play();\n break;\n case 'pause':\n player.pause();\n break;\n case 'reset':\n player.reset();\n break;\n case 'restart':\n player.restart();\n break;\n case 'finish':\n player.finish();\n break;\n case 'init':\n player.init();\n break;\n case 'setPosition':\n player.setPosition(parseFloat(args[0]));\n break;\n case 'destroy':\n this.destroy(id);\n break;\n }\n }\n}\n\nconst QUEUED_CLASSNAME = 'ng-animate-queued';\nconst QUEUED_SELECTOR = '.ng-animate-queued';\nconst DISABLED_CLASSNAME = 'ng-animate-disabled';\nconst DISABLED_SELECTOR = '.ng-animate-disabled';\nconst STAR_CLASSNAME = 'ng-star-inserted';\nconst STAR_SELECTOR = '.ng-star-inserted';\nconst EMPTY_PLAYER_ARRAY = [];\nconst NULL_REMOVAL_STATE = {\n namespaceId: '',\n setForRemoval: false,\n setForMove: false,\n hasAnimation: false,\n removedBeforeQueried: false\n};\nconst NULL_REMOVED_QUERIED_STATE = {\n namespaceId: '',\n setForMove: false,\n setForRemoval: false,\n hasAnimation: false,\n removedBeforeQueried: true\n};\nconst REMOVAL_FLAG = '__ng_removed';\nclass StateValue {\n get params() {\n return this.options.params;\n }\n constructor(input, namespaceId = '') {\n this.namespaceId = namespaceId;\n const isObj = input && input.hasOwnProperty('value');\n const value = isObj ? input['value'] : input;\n this.value = normalizeTriggerValue(value);\n if (isObj) {\n const options = copyObj(input);\n delete options['value'];\n this.options = options;\n }\n else {\n this.options = {};\n }\n if (!this.options.params) {\n this.options.params = {};\n }\n }\n absorbOptions(options) {\n const newParams = options.params;\n if (newParams) {\n const oldParams = this.options.params;\n Object.keys(newParams).forEach(prop => {\n if (oldParams[prop] == null) {\n oldParams[prop] = newParams[prop];\n }\n });\n }\n }\n}\nconst VOID_VALUE = 'void';\nconst DEFAULT_STATE_VALUE = new StateValue(VOID_VALUE);\nclass AnimationTransitionNamespace {\n constructor(id, hostElement, _engine) {\n this.id = id;\n this.hostElement = hostElement;\n this._engine = _engine;\n this.players = [];\n this._triggers = new Map();\n this._queue = [];\n this._elementListeners = new Map();\n this._hostClassName = 'ng-tns-' + id;\n addClass(hostElement, this._hostClassName);\n }\n listen(element, name, phase, callback) {\n if (!this._triggers.has(name)) {\n throw missingTrigger(phase, name);\n }\n if (phase == null || phase.length == 0) {\n throw missingEvent(name);\n }\n if (!isTriggerEventValid(phase)) {\n throw unsupportedTriggerEvent(phase, name);\n }\n const listeners = getOrSetDefaultValue(this._elementListeners, element, []);\n const data = { name, phase, callback };\n listeners.push(data);\n const triggersWithStates = getOrSetDefaultValue(this._engine.statesByElement, element, new Map());\n if (!triggersWithStates.has(name)) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + name);\n triggersWithStates.set(name, DEFAULT_STATE_VALUE);\n }\n return () => {\n // the event listener is removed AFTER the flush has occurred such\n // that leave animations callbacks can fire (otherwise if the node\n // is removed in between then the listeners would be deregistered)\n this._engine.afterFlush(() => {\n const index = listeners.indexOf(data);\n if (index >= 0) {\n listeners.splice(index, 1);\n }\n if (!this._triggers.has(name)) {\n triggersWithStates.delete(name);\n }\n });\n };\n }\n register(name, ast) {\n if (this._triggers.has(name)) {\n // throw\n return false;\n }\n else {\n this._triggers.set(name, ast);\n return true;\n }\n }\n _getTrigger(name) {\n const trigger = this._triggers.get(name);\n if (!trigger) {\n throw unregisteredTrigger(name);\n }\n return trigger;\n }\n trigger(element, triggerName, value, defaultToFallback = true) {\n const trigger = this._getTrigger(triggerName);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n let triggersWithStates = this._engine.statesByElement.get(element);\n if (!triggersWithStates) {\n addClass(element, NG_TRIGGER_CLASSNAME);\n addClass(element, NG_TRIGGER_CLASSNAME + '-' + triggerName);\n this._engine.statesByElement.set(element, triggersWithStates = new Map());\n }\n let fromState = triggersWithStates.get(triggerName);\n const toState = new StateValue(value, this.id);\n const isObj = value && value.hasOwnProperty('value');\n if (!isObj && fromState) {\n toState.absorbOptions(fromState.options);\n }\n triggersWithStates.set(triggerName, toState);\n if (!fromState) {\n fromState = DEFAULT_STATE_VALUE;\n }\n const isRemoval = toState.value === VOID_VALUE;\n // normally this isn't reached by here, however, if an object expression\n // is passed in then it may be a new object each time. Comparing the value\n // is important since that will stay the same despite there being a new object.\n // The removal arc here is special cased because the same element is triggered\n // twice in the event that it contains animations on the outer/inner portions\n // of the host container\n if (!isRemoval && fromState.value === toState.value) {\n // this means that despite the value not changing, some inner params\n // have changed which means that the animation final styles need to be applied\n if (!objEquals(fromState.params, toState.params)) {\n const errors = [];\n const fromStyles = trigger.matchStyles(fromState.value, fromState.params, errors);\n const toStyles = trigger.matchStyles(toState.value, toState.params, errors);\n if (errors.length) {\n this._engine.reportError(errors);\n }\n else {\n this._engine.afterFlush(() => {\n eraseStyles(element, fromStyles);\n setStyles(element, toStyles);\n });\n }\n }\n return;\n }\n const playersOnElement = getOrSetDefaultValue(this._engine.playersByElement, element, []);\n playersOnElement.forEach(player => {\n // only remove the player if it is queued on the EXACT same trigger/namespace\n // we only also deal with queued players here because if the animation has\n // started then we want to keep the player alive until the flush happens\n // (which is where the previousPlayers are passed into the new player)\n if (player.namespaceId == this.id && player.triggerName == triggerName && player.queued) {\n player.destroy();\n }\n });\n let transition = trigger.matchTransition(fromState.value, toState.value, element, toState.params);\n let isFallbackTransition = false;\n if (!transition) {\n if (!defaultToFallback)\n return;\n transition = trigger.fallbackTransition;\n isFallbackTransition = true;\n }\n this._engine.totalQueuedPlayers++;\n this._queue.push({ element, triggerName, transition, fromState, toState, player, isFallbackTransition });\n if (!isFallbackTransition) {\n addClass(element, QUEUED_CLASSNAME);\n player.onStart(() => {\n removeClass(element, QUEUED_CLASSNAME);\n });\n }\n player.onDone(() => {\n let index = this.players.indexOf(player);\n if (index >= 0) {\n this.players.splice(index, 1);\n }\n const players = this._engine.playersByElement.get(element);\n if (players) {\n let index = players.indexOf(player);\n if (index >= 0) {\n players.splice(index, 1);\n }\n }\n });\n this.players.push(player);\n playersOnElement.push(player);\n return player;\n }\n deregister(name) {\n this._triggers.delete(name);\n this._engine.statesByElement.forEach(stateMap => stateMap.delete(name));\n this._elementListeners.forEach((listeners, element) => {\n this._elementListeners.set(element, listeners.filter(entry => {\n return entry.name != name;\n }));\n });\n }\n clearElementCache(element) {\n this._engine.statesByElement.delete(element);\n this._elementListeners.delete(element);\n const elementPlayers = this._engine.playersByElement.get(element);\n if (elementPlayers) {\n elementPlayers.forEach(player => player.destroy());\n this._engine.playersByElement.delete(element);\n }\n }\n _signalRemovalForInnerTriggers(rootElement, context) {\n const elements = this._engine.driver.query(rootElement, NG_TRIGGER_SELECTOR, true);\n // emulate a leave animation for all inner nodes within this node.\n // If there are no animations found for any of the nodes then clear the cache\n // for the element.\n elements.forEach(elm => {\n // this means that an inner remove() operation has already kicked off\n // the animation on this element...\n if (elm[REMOVAL_FLAG])\n return;\n const namespaces = this._engine.fetchNamespacesByElement(elm);\n if (namespaces.size) {\n namespaces.forEach(ns => ns.triggerLeaveAnimation(elm, context, false, true));\n }\n else {\n this.clearElementCache(elm);\n }\n });\n // If the child elements were removed along with the parent, their animations might not\n // have completed. Clear all the elements from the cache so we don't end up with a memory leak.\n this._engine.afterFlushAnimationsDone(() => elements.forEach(elm => this.clearElementCache(elm)));\n }\n triggerLeaveAnimation(element, context, destroyAfterComplete, defaultToFallback) {\n const triggerStates = this._engine.statesByElement.get(element);\n const previousTriggersValues = new Map();\n if (triggerStates) {\n const players = [];\n triggerStates.forEach((state, triggerName) => {\n previousTriggersValues.set(triggerName, state.value);\n // this check is here in the event that an element is removed\n // twice (both on the host level and the component level)\n if (this._triggers.has(triggerName)) {\n const player = this.trigger(element, triggerName, VOID_VALUE, defaultToFallback);\n if (player) {\n players.push(player);\n }\n }\n });\n if (players.length) {\n this._engine.markElementAsRemoved(this.id, element, true, context, previousTriggersValues);\n if (destroyAfterComplete) {\n optimizeGroupPlayer(players).onDone(() => this._engine.processLeaveNode(element));\n }\n return true;\n }\n }\n return false;\n }\n prepareLeaveAnimationListeners(element) {\n const listeners = this._elementListeners.get(element);\n const elementStates = this._engine.statesByElement.get(element);\n // if this statement fails then it means that the element was picked up\n // by an earlier flush (or there are no listeners at all to track the leave).\n if (listeners && elementStates) {\n const visitedTriggers = new Set();\n listeners.forEach(listener => {\n const triggerName = listener.name;\n if (visitedTriggers.has(triggerName))\n return;\n visitedTriggers.add(triggerName);\n const trigger = this._triggers.get(triggerName);\n const transition = trigger.fallbackTransition;\n const fromState = elementStates.get(triggerName) || DEFAULT_STATE_VALUE;\n const toState = new StateValue(VOID_VALUE);\n const player = new TransitionAnimationPlayer(this.id, triggerName, element);\n this._engine.totalQueuedPlayers++;\n this._queue.push({\n element,\n triggerName,\n transition,\n fromState,\n toState,\n player,\n isFallbackTransition: true\n });\n });\n }\n }\n removeNode(element, context) {\n const engine = this._engine;\n if (element.childElementCount) {\n this._signalRemovalForInnerTriggers(element, context);\n }\n // this means that a * => VOID animation was detected and kicked off\n if (this.triggerLeaveAnimation(element, context, true))\n return;\n // find the player that is animating and make sure that the\n // removal is delayed until that player has completed\n let containsPotentialParentTransition = false;\n if (engine.totalAnimations) {\n const currentPlayers = engine.players.length ? engine.playersByQueriedElement.get(element) : [];\n // when this `if statement` does not continue forward it means that\n // a previous animation query has selected the current element and\n // is animating it. In this situation want to continue forwards and\n // allow the element to be queued up for animation later.\n if (currentPlayers && currentPlayers.length) {\n containsPotentialParentTransition = true;\n }\n else {\n let parent = element;\n while (parent = parent.parentNode) {\n const triggers = engine.statesByElement.get(parent);\n if (triggers) {\n containsPotentialParentTransition = true;\n break;\n }\n }\n }\n }\n // at this stage we know that the element will either get removed\n // during flush or will be picked up by a parent query. Either way\n // we need to fire the listeners for this element when it DOES get\n // removed (once the query parent animation is done or after flush)\n this.prepareLeaveAnimationListeners(element);\n // whether or not a parent has an animation we need to delay the deferral of the leave\n // operation until we have more information (which we do after flush() has been called)\n if (containsPotentialParentTransition) {\n engine.markElementAsRemoved(this.id, element, false, context);\n }\n else {\n const removalFlag = element[REMOVAL_FLAG];\n if (!removalFlag || removalFlag === NULL_REMOVAL_STATE) {\n // we do this after the flush has occurred such\n // that the callbacks can be fired\n engine.afterFlush(() => this.clearElementCache(element));\n engine.destroyInnerAnimations(element);\n engine._onRemovalComplete(element, context);\n }\n }\n }\n insertNode(element, parent) {\n addClass(element, this._hostClassName);\n }\n drainQueuedTransitions(microtaskId) {\n const instructions = [];\n this._queue.forEach(entry => {\n const player = entry.player;\n if (player.destroyed)\n return;\n const element = entry.element;\n const listeners = this._elementListeners.get(element);\n if (listeners) {\n listeners.forEach((listener) => {\n if (listener.name == entry.triggerName) {\n const baseEvent = makeAnimationEvent(element, entry.triggerName, entry.fromState.value, entry.toState.value);\n baseEvent['_data'] = microtaskId;\n listenOnPlayer(entry.player, listener.phase, baseEvent, listener.callback);\n }\n });\n }\n if (player.markedForDestroy) {\n this._engine.afterFlush(() => {\n // now we can destroy the element properly since the event listeners have\n // been bound to the player\n player.destroy();\n });\n }\n else {\n instructions.push(entry);\n }\n });\n this._queue = [];\n return instructions.sort((a, b) => {\n // if depCount == 0 them move to front\n // otherwise if a contains b then move back\n const d0 = a.transition.ast.depCount;\n const d1 = b.transition.ast.depCount;\n if (d0 == 0 || d1 == 0) {\n return d0 - d1;\n }\n return this._engine.driver.containsElement(a.element, b.element) ? 1 : -1;\n });\n }\n destroy(context) {\n this.players.forEach(p => p.destroy());\n this._signalRemovalForInnerTriggers(this.hostElement, context);\n }\n elementContainsData(element) {\n let containsData = false;\n if (this._elementListeners.has(element))\n containsData = true;\n containsData =\n (this._queue.find(entry => entry.element === element) ? true : false) || containsData;\n return containsData;\n }\n}\nclass TransitionAnimationEngine {\n /** @internal */\n _onRemovalComplete(element, context) {\n this.onRemovalComplete(element, context);\n }\n constructor(bodyNode, driver, _normalizer) {\n this.bodyNode = bodyNode;\n this.driver = driver;\n this._normalizer = _normalizer;\n this.players = [];\n this.newHostElements = new Map();\n this.playersByElement = new Map();\n this.playersByQueriedElement = new Map();\n this.statesByElement = new Map();\n this.disabledNodes = new Set();\n this.totalAnimations = 0;\n this.totalQueuedPlayers = 0;\n this._namespaceLookup = {};\n this._namespaceList = [];\n this._flushFns = [];\n this._whenQuietFns = [];\n this.namespacesByHostElement = new Map();\n this.collectedEnterElements = [];\n this.collectedLeaveElements = [];\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n }\n get queuedPlayers() {\n const players = [];\n this._namespaceList.forEach(ns => {\n ns.players.forEach(player => {\n if (player.queued) {\n players.push(player);\n }\n });\n });\n return players;\n }\n createNamespace(namespaceId, hostElement) {\n const ns = new AnimationTransitionNamespace(namespaceId, hostElement, this);\n if (this.bodyNode && this.driver.containsElement(this.bodyNode, hostElement)) {\n this._balanceNamespaceList(ns, hostElement);\n }\n else {\n // defer this later until flush during when the host element has\n // been inserted so that we know exactly where to place it in\n // the namespace list\n this.newHostElements.set(hostElement, ns);\n // given that this host element is a part of the animation code, it\n // may or may not be inserted by a parent node that is of an\n // animation renderer type. If this happens then we can still have\n // access to this item when we query for :enter nodes. If the parent\n // is a renderer then the set data-structure will normalize the entry\n this.collectEnterElement(hostElement);\n }\n return this._namespaceLookup[namespaceId] = ns;\n }\n _balanceNamespaceList(ns, hostElement) {\n const namespaceList = this._namespaceList;\n const namespacesByHostElement = this.namespacesByHostElement;\n const limit = namespaceList.length - 1;\n if (limit >= 0) {\n let found = false;\n // Find the closest ancestor with an existing namespace so we can then insert `ns` after it,\n // establishing a top-down ordering of namespaces in `this._namespaceList`.\n let ancestor = this.driver.getParentElement(hostElement);\n while (ancestor) {\n const ancestorNs = namespacesByHostElement.get(ancestor);\n if (ancestorNs) {\n // An animation namespace has been registered for this ancestor, so we insert `ns`\n // right after it to establish top-down ordering of animation namespaces.\n const index = namespaceList.indexOf(ancestorNs);\n namespaceList.splice(index + 1, 0, ns);\n found = true;\n break;\n }\n ancestor = this.driver.getParentElement(ancestor);\n }\n if (!found) {\n // No namespace exists that is an ancestor of `ns`, so `ns` is inserted at the front to\n // ensure that any existing descendants are ordered after `ns`, retaining the desired\n // top-down ordering.\n namespaceList.unshift(ns);\n }\n }\n else {\n namespaceList.push(ns);\n }\n namespacesByHostElement.set(hostElement, ns);\n return ns;\n }\n register(namespaceId, hostElement) {\n let ns = this._namespaceLookup[namespaceId];\n if (!ns) {\n ns = this.createNamespace(namespaceId, hostElement);\n }\n return ns;\n }\n registerTrigger(namespaceId, name, trigger) {\n let ns = this._namespaceLookup[namespaceId];\n if (ns && ns.register(name, trigger)) {\n this.totalAnimations++;\n }\n }\n destroy(namespaceId, context) {\n if (!namespaceId)\n return;\n const ns = this._fetchNamespace(namespaceId);\n this.afterFlush(() => {\n this.namespacesByHostElement.delete(ns.hostElement);\n delete this._namespaceLookup[namespaceId];\n const index = this._namespaceList.indexOf(ns);\n if (index >= 0) {\n this._namespaceList.splice(index, 1);\n }\n });\n this.afterFlushAnimationsDone(() => ns.destroy(context));\n }\n _fetchNamespace(id) {\n return this._namespaceLookup[id];\n }\n fetchNamespacesByElement(element) {\n // normally there should only be one namespace per element, however\n // if @triggers are placed on both the component element and then\n // its host element (within the component code) then there will be\n // two namespaces returned. We use a set here to simply deduplicate\n // the namespaces in case (for the reason described above) there are multiple triggers\n const namespaces = new Set();\n const elementStates = this.statesByElement.get(element);\n if (elementStates) {\n for (let stateValue of elementStates.values()) {\n if (stateValue.namespaceId) {\n const ns = this._fetchNamespace(stateValue.namespaceId);\n if (ns) {\n namespaces.add(ns);\n }\n }\n }\n }\n return namespaces;\n }\n trigger(namespaceId, element, name, value) {\n if (isElementNode(element)) {\n const ns = this._fetchNamespace(namespaceId);\n if (ns) {\n ns.trigger(element, name, value);\n return true;\n }\n }\n return false;\n }\n insertNode(namespaceId, element, parent, insertBefore) {\n if (!isElementNode(element))\n return;\n // special case for when an element is removed and reinserted (move operation)\n // when this occurs we do not want to use the element for deletion later\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n details.setForRemoval = false;\n details.setForMove = true;\n const index = this.collectedLeaveElements.indexOf(element);\n if (index >= 0) {\n this.collectedLeaveElements.splice(index, 1);\n }\n }\n // in the event that the namespaceId is blank then the caller\n // code does not contain any animation code in it, but it is\n // just being called so that the node is marked as being inserted\n if (namespaceId) {\n const ns = this._fetchNamespace(namespaceId);\n // This if-statement is a workaround for router issue #21947.\n // The router sometimes hits a race condition where while a route\n // is being instantiated a new navigation arrives, triggering leave\n // animation of DOM that has not been fully initialized, until this\n // is resolved, we need to handle the scenario when DOM is not in a\n // consistent state during the animation.\n if (ns) {\n ns.insertNode(element, parent);\n }\n }\n // only *directives and host elements are inserted before\n if (insertBefore) {\n this.collectEnterElement(element);\n }\n }\n collectEnterElement(element) {\n this.collectedEnterElements.push(element);\n }\n markElementAsDisabled(element, value) {\n if (value) {\n if (!this.disabledNodes.has(element)) {\n this.disabledNodes.add(element);\n addClass(element, DISABLED_CLASSNAME);\n }\n }\n else if (this.disabledNodes.has(element)) {\n this.disabledNodes.delete(element);\n removeClass(element, DISABLED_CLASSNAME);\n }\n }\n removeNode(namespaceId, element, isHostElement, context) {\n if (isElementNode(element)) {\n const ns = namespaceId ? this._fetchNamespace(namespaceId) : null;\n if (ns) {\n ns.removeNode(element, context);\n }\n else {\n this.markElementAsRemoved(namespaceId, element, false, context);\n }\n if (isHostElement) {\n const hostNS = this.namespacesByHostElement.get(element);\n if (hostNS && hostNS.id !== namespaceId) {\n hostNS.removeNode(element, context);\n }\n }\n }\n else {\n this._onRemovalComplete(element, context);\n }\n }\n markElementAsRemoved(namespaceId, element, hasAnimation, context, previousTriggersValues) {\n this.collectedLeaveElements.push(element);\n element[REMOVAL_FLAG] = {\n namespaceId,\n setForRemoval: context,\n hasAnimation,\n removedBeforeQueried: false,\n previousTriggersValues\n };\n }\n listen(namespaceId, element, name, phase, callback) {\n if (isElementNode(element)) {\n return this._fetchNamespace(namespaceId).listen(element, name, phase, callback);\n }\n return () => { };\n }\n _buildInstruction(entry, subTimelines, enterClassName, leaveClassName, skipBuildAst) {\n return entry.transition.build(this.driver, entry.element, entry.fromState.value, entry.toState.value, enterClassName, leaveClassName, entry.fromState.options, entry.toState.options, subTimelines, skipBuildAst);\n }\n destroyInnerAnimations(containerElement) {\n let elements = this.driver.query(containerElement, NG_TRIGGER_SELECTOR, true);\n elements.forEach(element => this.destroyActiveAnimationsForElement(element));\n if (this.playersByQueriedElement.size == 0)\n return;\n elements = this.driver.query(containerElement, NG_ANIMATING_SELECTOR, true);\n elements.forEach(element => this.finishActiveQueriedAnimationOnElement(element));\n }\n destroyActiveAnimationsForElement(element) {\n const players = this.playersByElement.get(element);\n if (players) {\n players.forEach(player => {\n // special case for when an element is set for destruction, but hasn't started.\n // in this situation we want to delay the destruction until the flush occurs\n // so that any event listeners attached to the player are triggered.\n if (player.queued) {\n player.markedForDestroy = true;\n }\n else {\n player.destroy();\n }\n });\n }\n }\n finishActiveQueriedAnimationOnElement(element) {\n const players = this.playersByQueriedElement.get(element);\n if (players) {\n players.forEach(player => player.finish());\n }\n }\n whenRenderingDone() {\n return new Promise(resolve => {\n if (this.players.length) {\n return optimizeGroupPlayer(this.players).onDone(() => resolve());\n }\n else {\n resolve();\n }\n });\n }\n processLeaveNode(element) {\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n // this will prevent it from removing it twice\n element[REMOVAL_FLAG] = NULL_REMOVAL_STATE;\n if (details.namespaceId) {\n this.destroyInnerAnimations(element);\n const ns = this._fetchNamespace(details.namespaceId);\n if (ns) {\n ns.clearElementCache(element);\n }\n }\n this._onRemovalComplete(element, details.setForRemoval);\n }\n if (element.classList?.contains(DISABLED_CLASSNAME)) {\n this.markElementAsDisabled(element, false);\n }\n this.driver.query(element, DISABLED_SELECTOR, true).forEach(node => {\n this.markElementAsDisabled(node, false);\n });\n }\n flush(microtaskId = -1) {\n let players = [];\n if (this.newHostElements.size) {\n this.newHostElements.forEach((ns, element) => this._balanceNamespaceList(ns, element));\n this.newHostElements.clear();\n }\n if (this.totalAnimations && this.collectedEnterElements.length) {\n for (let i = 0; i < this.collectedEnterElements.length; i++) {\n const elm = this.collectedEnterElements[i];\n addClass(elm, STAR_CLASSNAME);\n }\n }\n if (this._namespaceList.length &&\n (this.totalQueuedPlayers || this.collectedLeaveElements.length)) {\n const cleanupFns = [];\n try {\n players = this._flushAnimations(cleanupFns, microtaskId);\n }\n finally {\n for (let i = 0; i < cleanupFns.length; i++) {\n cleanupFns[i]();\n }\n }\n }\n else {\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n this.processLeaveNode(element);\n }\n }\n this.totalQueuedPlayers = 0;\n this.collectedEnterElements.length = 0;\n this.collectedLeaveElements.length = 0;\n this._flushFns.forEach(fn => fn());\n this._flushFns = [];\n if (this._whenQuietFns.length) {\n // we move these over to a variable so that\n // if any new callbacks are registered in another\n // flush they do not populate the existing set\n const quietFns = this._whenQuietFns;\n this._whenQuietFns = [];\n if (players.length) {\n optimizeGroupPlayer(players).onDone(() => {\n quietFns.forEach(fn => fn());\n });\n }\n else {\n quietFns.forEach(fn => fn());\n }\n }\n }\n reportError(errors) {\n throw triggerTransitionsFailed(errors);\n }\n _flushAnimations(cleanupFns, microtaskId) {\n const subTimelines = new ElementInstructionMap();\n const skippedPlayers = [];\n const skippedPlayersMap = new Map();\n const queuedInstructions = [];\n const queriedElements = new Map();\n const allPreStyleElements = new Map();\n const allPostStyleElements = new Map();\n const disabledElementsSet = new Set();\n this.disabledNodes.forEach(node => {\n disabledElementsSet.add(node);\n const nodesThatAreDisabled = this.driver.query(node, QUEUED_SELECTOR, true);\n for (let i = 0; i < nodesThatAreDisabled.length; i++) {\n disabledElementsSet.add(nodesThatAreDisabled[i]);\n }\n });\n const bodyNode = this.bodyNode;\n const allTriggerElements = Array.from(this.statesByElement.keys());\n const enterNodeMap = buildRootMap(allTriggerElements, this.collectedEnterElements);\n // this must occur before the instructions are built below such that\n // the :enter queries match the elements (since the timeline queries\n // are fired during instruction building).\n const enterNodeMapIds = new Map();\n let i = 0;\n enterNodeMap.forEach((nodes, root) => {\n const className = ENTER_CLASSNAME + i++;\n enterNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n const allLeaveNodes = [];\n const mergedLeaveNodes = new Set();\n const leaveNodesWithoutAnimations = new Set();\n for (let i = 0; i < this.collectedLeaveElements.length; i++) {\n const element = this.collectedLeaveElements[i];\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval) {\n allLeaveNodes.push(element);\n mergedLeaveNodes.add(element);\n if (details.hasAnimation) {\n this.driver.query(element, STAR_SELECTOR, true).forEach(elm => mergedLeaveNodes.add(elm));\n }\n else {\n leaveNodesWithoutAnimations.add(element);\n }\n }\n }\n const leaveNodeMapIds = new Map();\n const leaveNodeMap = buildRootMap(allTriggerElements, Array.from(mergedLeaveNodes));\n leaveNodeMap.forEach((nodes, root) => {\n const className = LEAVE_CLASSNAME + i++;\n leaveNodeMapIds.set(root, className);\n nodes.forEach(node => addClass(node, className));\n });\n cleanupFns.push(() => {\n enterNodeMap.forEach((nodes, root) => {\n const className = enterNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n leaveNodeMap.forEach((nodes, root) => {\n const className = leaveNodeMapIds.get(root);\n nodes.forEach(node => removeClass(node, className));\n });\n allLeaveNodes.forEach(element => {\n this.processLeaveNode(element);\n });\n });\n const allPlayers = [];\n const erroneousTransitions = [];\n for (let i = this._namespaceList.length - 1; i >= 0; i--) {\n const ns = this._namespaceList[i];\n ns.drainQueuedTransitions(microtaskId).forEach(entry => {\n const player = entry.player;\n const element = entry.element;\n allPlayers.push(player);\n if (this.collectedEnterElements.length) {\n const details = element[REMOVAL_FLAG];\n // animations for move operations (elements being removed and reinserted,\n // e.g. when the order of an *ngFor list changes) are currently not supported\n if (details && details.setForMove) {\n if (details.previousTriggersValues &&\n details.previousTriggersValues.has(entry.triggerName)) {\n const previousValue = details.previousTriggersValues.get(entry.triggerName);\n // we need to restore the previous trigger value since the element has\n // only been moved and hasn't actually left the DOM\n const triggersWithStates = this.statesByElement.get(entry.element);\n if (triggersWithStates && triggersWithStates.has(entry.triggerName)) {\n const state = triggersWithStates.get(entry.triggerName);\n state.value = previousValue;\n triggersWithStates.set(entry.triggerName, state);\n }\n }\n player.destroy();\n return;\n }\n }\n const nodeIsOrphaned = !bodyNode || !this.driver.containsElement(bodyNode, element);\n const leaveClassName = leaveNodeMapIds.get(element);\n const enterClassName = enterNodeMapIds.get(element);\n const instruction = this._buildInstruction(entry, subTimelines, enterClassName, leaveClassName, nodeIsOrphaned);\n if (instruction.errors && instruction.errors.length) {\n erroneousTransitions.push(instruction);\n return;\n }\n // even though the element may not be in the DOM, it may still\n // be added at a later point (due to the mechanics of content\n // projection and/or dynamic component insertion) therefore it's\n // important to still style the element.\n if (nodeIsOrphaned) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // if an unmatched transition is queued and ready to go\n // then it SHOULD NOT render an animation and cancel the\n // previously running animations.\n if (entry.isFallbackTransition) {\n player.onStart(() => eraseStyles(element, instruction.fromStyles));\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n skippedPlayers.push(player);\n return;\n }\n // this means that if a parent animation uses this animation as a sub-trigger\n // then it will instruct the timeline builder not to add a player delay, but\n // instead stretch the first keyframe gap until the animation starts. This is\n // important in order to prevent extra initialization styles from being\n // required by the user for the animation.\n const timelines = [];\n instruction.timelines.forEach(tl => {\n tl.stretchStartingKeyframe = true;\n if (!this.disabledNodes.has(tl.element)) {\n timelines.push(tl);\n }\n });\n instruction.timelines = timelines;\n subTimelines.append(element, instruction.timelines);\n const tuple = { instruction, player, element };\n queuedInstructions.push(tuple);\n instruction.queriedElements.forEach(element => getOrSetDefaultValue(queriedElements, element, []).push(player));\n instruction.preStyleProps.forEach((stringMap, element) => {\n if (stringMap.size) {\n let setVal = allPreStyleElements.get(element);\n if (!setVal) {\n allPreStyleElements.set(element, setVal = new Set());\n }\n stringMap.forEach((_, prop) => setVal.add(prop));\n }\n });\n instruction.postStyleProps.forEach((stringMap, element) => {\n let setVal = allPostStyleElements.get(element);\n if (!setVal) {\n allPostStyleElements.set(element, setVal = new Set());\n }\n stringMap.forEach((_, prop) => setVal.add(prop));\n });\n });\n }\n if (erroneousTransitions.length) {\n const errors = [];\n erroneousTransitions.forEach(instruction => {\n errors.push(transitionFailed(instruction.triggerName, instruction.errors));\n });\n allPlayers.forEach(player => player.destroy());\n this.reportError(errors);\n }\n const allPreviousPlayersMap = new Map();\n // this map tells us which element in the DOM tree is contained by\n // which animation. Further down this map will get populated once\n // the players are built and in doing so we can use it to efficiently\n // figure out if a sub player is skipped due to a parent player having priority.\n const animationElementMap = new Map();\n queuedInstructions.forEach(entry => {\n const element = entry.element;\n if (subTimelines.has(element)) {\n animationElementMap.set(element, element);\n this._beforeAnimationBuild(entry.player.namespaceId, entry.instruction, allPreviousPlayersMap);\n }\n });\n skippedPlayers.forEach(player => {\n const element = player.element;\n const previousPlayers = this._getPreviousPlayers(element, false, player.namespaceId, player.triggerName, null);\n previousPlayers.forEach(prevPlayer => {\n getOrSetDefaultValue(allPreviousPlayersMap, element, []).push(prevPlayer);\n prevPlayer.destroy();\n });\n });\n // this is a special case for nodes that will be removed either by\n // having their own leave animations or by being queried in a container\n // that will be removed once a parent animation is complete. The idea\n // here is that * styles must be identical to ! styles because of\n // backwards compatibility (* is also filled in by default in many places).\n // Otherwise * styles will return an empty value or \"auto\" since the element\n // passed to getComputedStyle will not be visible (since * === destination)\n const replaceNodes = allLeaveNodes.filter(node => {\n return replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements);\n });\n // POST STAGE: fill the * styles\n const postStylesMap = new Map();\n const allLeaveQueriedNodes = cloakAndComputeStyles(postStylesMap, this.driver, leaveNodesWithoutAnimations, allPostStyleElements, AUTO_STYLE);\n allLeaveQueriedNodes.forEach(node => {\n if (replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements)) {\n replaceNodes.push(node);\n }\n });\n // PRE STAGE: fill the ! styles\n const preStylesMap = new Map();\n enterNodeMap.forEach((nodes, root) => {\n cloakAndComputeStyles(preStylesMap, this.driver, new Set(nodes), allPreStyleElements, ɵPRE_STYLE);\n });\n replaceNodes.forEach(node => {\n const post = postStylesMap.get(node);\n const pre = preStylesMap.get(node);\n postStylesMap.set(node, new Map([...Array.from(post?.entries() ?? []), ...Array.from(pre?.entries() ?? [])]));\n });\n const rootPlayers = [];\n const subPlayers = [];\n const NO_PARENT_ANIMATION_ELEMENT_DETECTED = {};\n queuedInstructions.forEach(entry => {\n const { element, player, instruction } = entry;\n // this means that it was never consumed by a parent animation which\n // means that it is independent and therefore should be set for animation\n if (subTimelines.has(element)) {\n if (disabledElementsSet.has(element)) {\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n player.disabled = true;\n player.overrideTotalTime(instruction.totalTime);\n skippedPlayers.push(player);\n return;\n }\n // this will flow up the DOM and query the map to figure out\n // if a parent animation has priority over it. In the situation\n // that a parent is detected then it will cancel the loop. If\n // nothing is detected, or it takes a few hops to find a parent,\n // then it will fill in the missing nodes and signal them as having\n // a detected parent (or a NO_PARENT value via a special constant).\n let parentWithAnimation = NO_PARENT_ANIMATION_ELEMENT_DETECTED;\n if (animationElementMap.size > 1) {\n let elm = element;\n const parentsToAdd = [];\n while (elm = elm.parentNode) {\n const detectedParent = animationElementMap.get(elm);\n if (detectedParent) {\n parentWithAnimation = detectedParent;\n break;\n }\n parentsToAdd.push(elm);\n }\n parentsToAdd.forEach(parent => animationElementMap.set(parent, parentWithAnimation));\n }\n const innerPlayer = this._buildAnimation(player.namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap);\n player.setRealPlayer(innerPlayer);\n if (parentWithAnimation === NO_PARENT_ANIMATION_ELEMENT_DETECTED) {\n rootPlayers.push(player);\n }\n else {\n const parentPlayers = this.playersByElement.get(parentWithAnimation);\n if (parentPlayers && parentPlayers.length) {\n player.parentPlayer = optimizeGroupPlayer(parentPlayers);\n }\n skippedPlayers.push(player);\n }\n }\n else {\n eraseStyles(element, instruction.fromStyles);\n player.onDestroy(() => setStyles(element, instruction.toStyles));\n // there still might be a ancestor player animating this\n // element therefore we will still add it as a sub player\n // even if its animation may be disabled\n subPlayers.push(player);\n if (disabledElementsSet.has(element)) {\n skippedPlayers.push(player);\n }\n }\n });\n // find all of the sub players' corresponding inner animation players\n subPlayers.forEach(player => {\n // even if no players are found for a sub animation it\n // will still complete itself after the next tick since it's Noop\n const playersForElement = skippedPlayersMap.get(player.element);\n if (playersForElement && playersForElement.length) {\n const innerPlayer = optimizeGroupPlayer(playersForElement);\n player.setRealPlayer(innerPlayer);\n }\n });\n // the reason why we don't actually play the animation is\n // because all that a skipped player is designed to do is to\n // fire the start/done transition callback events\n skippedPlayers.forEach(player => {\n if (player.parentPlayer) {\n player.syncPlayerEvents(player.parentPlayer);\n }\n else {\n player.destroy();\n }\n });\n // run through all of the queued removals and see if they\n // were picked up by a query. If not then perform the removal\n // operation right away unless a parent animation is ongoing.\n for (let i = 0; i < allLeaveNodes.length; i++) {\n const element = allLeaveNodes[i];\n const details = element[REMOVAL_FLAG];\n removeClass(element, LEAVE_CLASSNAME);\n // this means the element has a removal animation that is being\n // taken care of and therefore the inner elements will hang around\n // until that animation is over (or the parent queried animation)\n if (details && details.hasAnimation)\n continue;\n let players = [];\n // if this element is queried or if it contains queried children\n // then we want for the element not to be removed from the page\n // until the queried animations have finished\n if (queriedElements.size) {\n let queriedPlayerResults = queriedElements.get(element);\n if (queriedPlayerResults && queriedPlayerResults.length) {\n players.push(...queriedPlayerResults);\n }\n let queriedInnerElements = this.driver.query(element, NG_ANIMATING_SELECTOR, true);\n for (let j = 0; j < queriedInnerElements.length; j++) {\n let queriedPlayers = queriedElements.get(queriedInnerElements[j]);\n if (queriedPlayers && queriedPlayers.length) {\n players.push(...queriedPlayers);\n }\n }\n }\n const activePlayers = players.filter(p => !p.destroyed);\n if (activePlayers.length) {\n removeNodesAfterAnimationDone(this, element, activePlayers);\n }\n else {\n this.processLeaveNode(element);\n }\n }\n // this is required so the cleanup method doesn't remove them\n allLeaveNodes.length = 0;\n rootPlayers.forEach(player => {\n this.players.push(player);\n player.onDone(() => {\n player.destroy();\n const index = this.players.indexOf(player);\n this.players.splice(index, 1);\n });\n player.play();\n });\n return rootPlayers;\n }\n elementContainsData(namespaceId, element) {\n let containsData = false;\n const details = element[REMOVAL_FLAG];\n if (details && details.setForRemoval)\n containsData = true;\n if (this.playersByElement.has(element))\n containsData = true;\n if (this.playersByQueriedElement.has(element))\n containsData = true;\n if (this.statesByElement.has(element))\n containsData = true;\n return this._fetchNamespace(namespaceId).elementContainsData(element) || containsData;\n }\n afterFlush(callback) {\n this._flushFns.push(callback);\n }\n afterFlushAnimationsDone(callback) {\n this._whenQuietFns.push(callback);\n }\n _getPreviousPlayers(element, isQueriedElement, namespaceId, triggerName, toStateValue) {\n let players = [];\n if (isQueriedElement) {\n const queriedElementPlayers = this.playersByQueriedElement.get(element);\n if (queriedElementPlayers) {\n players = queriedElementPlayers;\n }\n }\n else {\n const elementPlayers = this.playersByElement.get(element);\n if (elementPlayers) {\n const isRemovalAnimation = !toStateValue || toStateValue == VOID_VALUE;\n elementPlayers.forEach(player => {\n if (player.queued)\n return;\n if (!isRemovalAnimation && player.triggerName != triggerName)\n return;\n players.push(player);\n });\n }\n }\n if (namespaceId || triggerName) {\n players = players.filter(player => {\n if (namespaceId && namespaceId != player.namespaceId)\n return false;\n if (triggerName && triggerName != player.triggerName)\n return false;\n return true;\n });\n }\n return players;\n }\n _beforeAnimationBuild(namespaceId, instruction, allPreviousPlayersMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // when a removal animation occurs, ALL previous players are collected\n // and destroyed (even if they are outside of the current namespace)\n const targetNameSpaceId = instruction.isRemovalTransition ? undefined : namespaceId;\n const targetTriggerName = instruction.isRemovalTransition ? undefined : triggerName;\n for (const timelineInstruction of instruction.timelines) {\n const element = timelineInstruction.element;\n const isQueriedElement = element !== rootElement;\n const players = getOrSetDefaultValue(allPreviousPlayersMap, element, []);\n const previousPlayers = this._getPreviousPlayers(element, isQueriedElement, targetNameSpaceId, targetTriggerName, instruction.toState);\n previousPlayers.forEach(player => {\n const realPlayer = player.getRealPlayer();\n if (realPlayer.beforeDestroy) {\n realPlayer.beforeDestroy();\n }\n player.destroy();\n players.push(player);\n });\n }\n // this needs to be done so that the PRE/POST styles can be\n // computed properly without interfering with the previous animation\n eraseStyles(rootElement, instruction.fromStyles);\n }\n _buildAnimation(namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap) {\n const triggerName = instruction.triggerName;\n const rootElement = instruction.element;\n // we first run this so that the previous animation player\n // data can be passed into the successive animation players\n const allQueriedPlayers = [];\n const allConsumedElements = new Set();\n const allSubElements = new Set();\n const allNewPlayers = instruction.timelines.map(timelineInstruction => {\n const element = timelineInstruction.element;\n allConsumedElements.add(element);\n // FIXME (matsko): make sure to-be-removed animations are removed properly\n const details = element[REMOVAL_FLAG];\n if (details && details.removedBeforeQueried)\n return new NoopAnimationPlayer(timelineInstruction.duration, timelineInstruction.delay);\n const isQueriedElement = element !== rootElement;\n const previousPlayers = flattenGroupPlayers((allPreviousPlayersMap.get(element) || EMPTY_PLAYER_ARRAY)\n .map(p => p.getRealPlayer()))\n .filter(p => {\n // the `element` is not apart of the AnimationPlayer definition, but\n // Mock/WebAnimations\n // use the element within their implementation. This will be added in Angular5 to\n // AnimationPlayer\n const pp = p;\n return pp.element ? pp.element === element : false;\n });\n const preStyles = preStylesMap.get(element);\n const postStyles = postStylesMap.get(element);\n const keyframes = normalizeKeyframes$1(this.driver, this._normalizer, element, timelineInstruction.keyframes, preStyles, postStyles);\n const player = this._buildPlayer(timelineInstruction, keyframes, previousPlayers);\n // this means that this particular player belongs to a sub trigger. It is\n // important that we match this player up with the corresponding (@trigger.listener)\n if (timelineInstruction.subTimeline && skippedPlayersMap) {\n allSubElements.add(element);\n }\n if (isQueriedElement) {\n const wrappedPlayer = new TransitionAnimationPlayer(namespaceId, triggerName, element);\n wrappedPlayer.setRealPlayer(player);\n allQueriedPlayers.push(wrappedPlayer);\n }\n return player;\n });\n allQueriedPlayers.forEach(player => {\n getOrSetDefaultValue(this.playersByQueriedElement, player.element, []).push(player);\n player.onDone(() => deleteOrUnsetInMap(this.playersByQueriedElement, player.element, player));\n });\n allConsumedElements.forEach(element => addClass(element, NG_ANIMATING_CLASSNAME));\n const player = optimizeGroupPlayer(allNewPlayers);\n player.onDestroy(() => {\n allConsumedElements.forEach(element => removeClass(element, NG_ANIMATING_CLASSNAME));\n setStyles(rootElement, instruction.toStyles);\n });\n // this basically makes all of the callbacks for sub element animations\n // be dependent on the upper players for when they finish\n allSubElements.forEach(element => {\n getOrSetDefaultValue(skippedPlayersMap, element, []).push(player);\n });\n return player;\n }\n _buildPlayer(instruction, keyframes, previousPlayers) {\n if (keyframes.length > 0) {\n return this.driver.animate(instruction.element, keyframes, instruction.duration, instruction.delay, instruction.easing, previousPlayers);\n }\n // special case for when an empty transition|definition is provided\n // ... there is no point in rendering an empty animation\n return new NoopAnimationPlayer(instruction.duration, instruction.delay);\n }\n}\nclass TransitionAnimationPlayer {\n constructor(namespaceId, triggerName, element) {\n this.namespaceId = namespaceId;\n this.triggerName = triggerName;\n this.element = element;\n this._player = new NoopAnimationPlayer();\n this._containsRealPlayer = false;\n this._queuedCallbacks = new Map();\n this.destroyed = false;\n this.parentPlayer = null;\n this.markedForDestroy = false;\n this.disabled = false;\n this.queued = true;\n this.totalTime = 0;\n }\n setRealPlayer(player) {\n if (this._containsRealPlayer)\n return;\n this._player = player;\n this._queuedCallbacks.forEach((callbacks, phase) => {\n callbacks.forEach(callback => listenOnPlayer(player, phase, undefined, callback));\n });\n this._queuedCallbacks.clear();\n this._containsRealPlayer = true;\n this.overrideTotalTime(player.totalTime);\n this.queued = false;\n }\n getRealPlayer() {\n return this._player;\n }\n overrideTotalTime(totalTime) {\n this.totalTime = totalTime;\n }\n syncPlayerEvents(player) {\n const p = this._player;\n if (p.triggerCallback) {\n player.onStart(() => p.triggerCallback('start'));\n }\n player.onDone(() => this.finish());\n player.onDestroy(() => this.destroy());\n }\n _queueEvent(name, callback) {\n getOrSetDefaultValue(this._queuedCallbacks, name, []).push(callback);\n }\n onDone(fn) {\n if (this.queued) {\n this._queueEvent('done', fn);\n }\n this._player.onDone(fn);\n }\n onStart(fn) {\n if (this.queued) {\n this._queueEvent('start', fn);\n }\n this._player.onStart(fn);\n }\n onDestroy(fn) {\n if (this.queued) {\n this._queueEvent('destroy', fn);\n }\n this._player.onDestroy(fn);\n }\n init() {\n this._player.init();\n }\n hasStarted() {\n return this.queued ? false : this._player.hasStarted();\n }\n play() {\n !this.queued && this._player.play();\n }\n pause() {\n !this.queued && this._player.pause();\n }\n restart() {\n !this.queued && this._player.restart();\n }\n finish() {\n this._player.finish();\n }\n destroy() {\n this.destroyed = true;\n this._player.destroy();\n }\n reset() {\n !this.queued && this._player.reset();\n }\n setPosition(p) {\n if (!this.queued) {\n this._player.setPosition(p);\n }\n }\n getPosition() {\n return this.queued ? 0 : this._player.getPosition();\n }\n /** @internal */\n triggerCallback(phaseName) {\n const p = this._player;\n if (p.triggerCallback) {\n p.triggerCallback(phaseName);\n }\n }\n}\nfunction deleteOrUnsetInMap(map, key, value) {\n let currentValues = map.get(key);\n if (currentValues) {\n if (currentValues.length) {\n const index = currentValues.indexOf(value);\n currentValues.splice(index, 1);\n }\n if (currentValues.length == 0) {\n map.delete(key);\n }\n }\n return currentValues;\n}\nfunction normalizeTriggerValue(value) {\n // we use `!= null` here because it's the most simple\n // way to test against a \"falsy\" value without mixing\n // in empty strings or a zero value. DO NOT OPTIMIZE.\n return value != null ? value : null;\n}\nfunction isElementNode(node) {\n return node && node['nodeType'] === 1;\n}\nfunction isTriggerEventValid(eventName) {\n return eventName == 'start' || eventName == 'done';\n}\nfunction cloakElement(element, value) {\n const oldValue = element.style.display;\n element.style.display = value != null ? value : 'none';\n return oldValue;\n}\nfunction cloakAndComputeStyles(valuesMap, driver, elements, elementPropsMap, defaultStyle) {\n const cloakVals = [];\n elements.forEach(element => cloakVals.push(cloakElement(element)));\n const failedElements = [];\n elementPropsMap.forEach((props, element) => {\n const styles = new Map();\n props.forEach(prop => {\n const value = driver.computeStyle(element, prop, defaultStyle);\n styles.set(prop, value);\n // there is no easy way to detect this because a sub element could be removed\n // by a parent animation element being detached.\n if (!value || value.length == 0) {\n element[REMOVAL_FLAG] = NULL_REMOVED_QUERIED_STATE;\n failedElements.push(element);\n }\n });\n valuesMap.set(element, styles);\n });\n // we use a index variable here since Set.forEach(a, i) does not return\n // an index value for the closure (but instead just the value)\n let i = 0;\n elements.forEach(element => cloakElement(element, cloakVals[i++]));\n return failedElements;\n}\n/*\nSince the Angular renderer code will return a collection of inserted\nnodes in all areas of a DOM tree, it's up to this algorithm to figure\nout which nodes are roots for each animation @trigger.\n\nBy placing each inserted node into a Set and traversing upwards, it\nis possible to find the @trigger elements and well any direct *star\ninsertion nodes, if a @trigger root is found then the enter element\nis placed into the Map[@trigger] spot.\n */\nfunction buildRootMap(roots, nodes) {\n const rootMap = new Map();\n roots.forEach(root => rootMap.set(root, []));\n if (nodes.length == 0)\n return rootMap;\n const NULL_NODE = 1;\n const nodeSet = new Set(nodes);\n const localRootMap = new Map();\n function getRoot(node) {\n if (!node)\n return NULL_NODE;\n let root = localRootMap.get(node);\n if (root)\n return root;\n const parent = node.parentNode;\n if (rootMap.has(parent)) { // ngIf inside @trigger\n root = parent;\n }\n else if (nodeSet.has(parent)) { // ngIf inside ngIf\n root = NULL_NODE;\n }\n else { // recurse upwards\n root = getRoot(parent);\n }\n localRootMap.set(node, root);\n return root;\n }\n nodes.forEach(node => {\n const root = getRoot(node);\n if (root !== NULL_NODE) {\n rootMap.get(root).push(node);\n }\n });\n return rootMap;\n}\nfunction addClass(element, className) {\n element.classList?.add(className);\n}\nfunction removeClass(element, className) {\n element.classList?.remove(className);\n}\nfunction removeNodesAfterAnimationDone(engine, element, players) {\n optimizeGroupPlayer(players).onDone(() => engine.processLeaveNode(element));\n}\nfunction flattenGroupPlayers(players) {\n const finalPlayers = [];\n _flattenGroupPlayersRecur(players, finalPlayers);\n return finalPlayers;\n}\nfunction _flattenGroupPlayersRecur(players, finalPlayers) {\n for (let i = 0; i < players.length; i++) {\n const player = players[i];\n if (player instanceof ɵAnimationGroupPlayer) {\n _flattenGroupPlayersRecur(player.players, finalPlayers);\n }\n else {\n finalPlayers.push(player);\n }\n }\n}\nfunction objEquals(a, b) {\n const k1 = Object.keys(a);\n const k2 = Object.keys(b);\n if (k1.length != k2.length)\n return false;\n for (let i = 0; i < k1.length; i++) {\n const prop = k1[i];\n if (!b.hasOwnProperty(prop) || a[prop] !== b[prop])\n return false;\n }\n return true;\n}\nfunction replacePostStylesAsPre(element, allPreStyleElements, allPostStyleElements) {\n const postEntry = allPostStyleElements.get(element);\n if (!postEntry)\n return false;\n let preEntry = allPreStyleElements.get(element);\n if (preEntry) {\n postEntry.forEach(data => preEntry.add(data));\n }\n else {\n allPreStyleElements.set(element, postEntry);\n }\n allPostStyleElements.delete(element);\n return true;\n}\n\nclass AnimationEngine {\n constructor(bodyNode, _driver, _normalizer) {\n this.bodyNode = bodyNode;\n this._driver = _driver;\n this._normalizer = _normalizer;\n this._triggerCache = {};\n // this method is designed to be overridden by the code that uses this engine\n this.onRemovalComplete = (element, context) => { };\n this._transitionEngine = new TransitionAnimationEngine(bodyNode, _driver, _normalizer);\n this._timelineEngine = new TimelineAnimationEngine(bodyNode, _driver, _normalizer);\n this._transitionEngine.onRemovalComplete = (element, context) => this.onRemovalComplete(element, context);\n }\n registerTrigger(componentId, namespaceId, hostElement, name, metadata) {\n const cacheKey = componentId + '-' + name;\n let trigger = this._triggerCache[cacheKey];\n if (!trigger) {\n const errors = [];\n const warnings = [];\n const ast = buildAnimationAst(this._driver, metadata, errors, warnings);\n if (errors.length) {\n throw triggerBuildFailed(name, errors);\n }\n if (warnings.length) {\n warnTriggerBuild(name, warnings);\n }\n trigger = buildTrigger(name, ast, this._normalizer);\n this._triggerCache[cacheKey] = trigger;\n }\n this._transitionEngine.registerTrigger(namespaceId, name, trigger);\n }\n register(namespaceId, hostElement) {\n this._transitionEngine.register(namespaceId, hostElement);\n }\n destroy(namespaceId, context) {\n this._transitionEngine.destroy(namespaceId, context);\n }\n onInsert(namespaceId, element, parent, insertBefore) {\n this._transitionEngine.insertNode(namespaceId, element, parent, insertBefore);\n }\n onRemove(namespaceId, element, context, isHostElement) {\n this._transitionEngine.removeNode(namespaceId, element, isHostElement || false, context);\n }\n disableAnimations(element, disable) {\n this._transitionEngine.markElementAsDisabled(element, disable);\n }\n process(namespaceId, element, property, value) {\n if (property.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(property);\n const args = value;\n this._timelineEngine.command(id, element, action, args);\n }\n else {\n this._transitionEngine.trigger(namespaceId, element, property, value);\n }\n }\n listen(namespaceId, element, eventName, eventPhase, callback) {\n // @@listen\n if (eventName.charAt(0) == '@') {\n const [id, action] = parseTimelineCommand(eventName);\n return this._timelineEngine.listen(id, element, action, callback);\n }\n return this._transitionEngine.listen(namespaceId, element, eventName, eventPhase, callback);\n }\n flush(microtaskId = -1) {\n this._transitionEngine.flush(microtaskId);\n }\n get players() {\n return this._transitionEngine.players\n .concat(this._timelineEngine.players);\n }\n whenRenderingDone() {\n return this._transitionEngine.whenRenderingDone();\n }\n}\n\n/**\n * Returns an instance of `SpecialCasedStyles` if and when any special (non animateable) styles are\n * detected.\n *\n * In CSS there exist properties that cannot be animated within a keyframe animation\n * (whether it be via CSS keyframes or web-animations) and the animation implementation\n * will ignore them. This function is designed to detect those special cased styles and\n * return a container that will be executed at the start and end of the animation.\n *\n * @returns an instance of `SpecialCasedStyles` if any special styles are detected otherwise `null`\n */\nfunction packageNonAnimatableStyles(element, styles) {\n let startStyles = null;\n let endStyles = null;\n if (Array.isArray(styles) && styles.length) {\n startStyles = filterNonAnimatableStyles(styles[0]);\n if (styles.length > 1) {\n endStyles = filterNonAnimatableStyles(styles[styles.length - 1]);\n }\n }\n else if (styles instanceof Map) {\n startStyles = filterNonAnimatableStyles(styles);\n }\n return (startStyles || endStyles) ? new SpecialCasedStyles(element, startStyles, endStyles) :\n null;\n}\n/**\n * Designed to be executed during a keyframe-based animation to apply any special-cased styles.\n *\n * When started (when the `start()` method is run) then the provided `startStyles`\n * will be applied. When finished (when the `finish()` method is called) the\n * `endStyles` will be applied as well any any starting styles. Finally when\n * `destroy()` is called then all styles will be removed.\n */\nclass SpecialCasedStyles {\n constructor(_element, _startStyles, _endStyles) {\n this._element = _element;\n this._startStyles = _startStyles;\n this._endStyles = _endStyles;\n this._state = 0 /* SpecialCasedStylesState.Pending */;\n let initialStyles = SpecialCasedStyles.initialStylesByElement.get(_element);\n if (!initialStyles) {\n SpecialCasedStyles.initialStylesByElement.set(_element, initialStyles = new Map());\n }\n this._initialStyles = initialStyles;\n }\n start() {\n if (this._state < 1 /* SpecialCasedStylesState.Started */) {\n if (this._startStyles) {\n setStyles(this._element, this._startStyles, this._initialStyles);\n }\n this._state = 1 /* SpecialCasedStylesState.Started */;\n }\n }\n finish() {\n this.start();\n if (this._state < 2 /* SpecialCasedStylesState.Finished */) {\n setStyles(this._element, this._initialStyles);\n if (this._endStyles) {\n setStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n this._state = 1 /* SpecialCasedStylesState.Started */;\n }\n }\n destroy() {\n this.finish();\n if (this._state < 3 /* SpecialCasedStylesState.Destroyed */) {\n SpecialCasedStyles.initialStylesByElement.delete(this._element);\n if (this._startStyles) {\n eraseStyles(this._element, this._startStyles);\n this._endStyles = null;\n }\n if (this._endStyles) {\n eraseStyles(this._element, this._endStyles);\n this._endStyles = null;\n }\n setStyles(this._element, this._initialStyles);\n this._state = 3 /* SpecialCasedStylesState.Destroyed */;\n }\n }\n}\nSpecialCasedStyles.initialStylesByElement = ( /* @__PURE__ */new WeakMap());\nfunction filterNonAnimatableStyles(styles) {\n let result = null;\n styles.forEach((val, prop) => {\n if (isNonAnimatableStyle(prop)) {\n result = result || new Map();\n result.set(prop, val);\n }\n });\n return result;\n}\nfunction isNonAnimatableStyle(prop) {\n return prop === 'display' || prop === 'position';\n}\n\nclass WebAnimationsPlayer {\n constructor(element, keyframes, options, _specialStyles) {\n this.element = element;\n this.keyframes = keyframes;\n this.options = options;\n this._specialStyles = _specialStyles;\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._initialized = false;\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n // the following original fns are persistent copies of the _onStartFns and _onDoneFns\n // and are used to reset the fns to their original values upon reset()\n // (since the _onStartFns and _onDoneFns get deleted after they are called)\n this._originalOnDoneFns = [];\n this._originalOnStartFns = [];\n this.time = 0;\n this.parentPlayer = null;\n this.currentSnapshot = new Map();\n this._duration = options['duration'];\n this._delay = options['delay'] || 0;\n this.time = this._duration + this._delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this._buildPlayer();\n this._preparePlayerBeforeStart();\n }\n _buildPlayer() {\n if (this._initialized)\n return;\n this._initialized = true;\n const keyframes = this.keyframes;\n // @ts-expect-error overwriting a readonly property\n this.domPlayer = this._triggerWebAnimation(this.element, keyframes, this.options);\n this._finalKeyframe = keyframes.length ? keyframes[keyframes.length - 1] : new Map();\n this.domPlayer.addEventListener('finish', () => this._onFinish());\n }\n _preparePlayerBeforeStart() {\n // this is required so that the player doesn't start to animate right away\n if (this._delay) {\n this._resetDomPlayerState();\n }\n else {\n this.domPlayer.pause();\n }\n }\n _convertKeyframesToObject(keyframes) {\n const kfs = [];\n keyframes.forEach(frame => {\n kfs.push(Object.fromEntries(frame));\n });\n return kfs;\n }\n /** @internal */\n _triggerWebAnimation(element, keyframes, options) {\n // jscompiler doesn't seem to know animate is a native property because it's not fully\n // supported yet across common browsers (we polyfill it for Edge/Safari) [CL #143630929]\n return element['animate'](this._convertKeyframesToObject(keyframes), options);\n }\n onStart(fn) {\n this._originalOnStartFns.push(fn);\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._originalOnDoneFns.push(fn);\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n play() {\n this._buildPlayer();\n if (!this.hasStarted()) {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n this._started = true;\n if (this._specialStyles) {\n this._specialStyles.start();\n }\n }\n this.domPlayer.play();\n }\n pause() {\n this.init();\n this.domPlayer.pause();\n }\n finish() {\n this.init();\n if (this._specialStyles) {\n this._specialStyles.finish();\n }\n this._onFinish();\n this.domPlayer.finish();\n }\n reset() {\n this._resetDomPlayerState();\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n this._onStartFns = this._originalOnStartFns;\n this._onDoneFns = this._originalOnDoneFns;\n }\n _resetDomPlayerState() {\n if (this.domPlayer) {\n this.domPlayer.cancel();\n }\n }\n restart() {\n this.reset();\n this.play();\n }\n hasStarted() {\n return this._started;\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._resetDomPlayerState();\n this._onFinish();\n if (this._specialStyles) {\n this._specialStyles.destroy();\n }\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n setPosition(p) {\n if (this.domPlayer === undefined) {\n this.init();\n }\n this.domPlayer.currentTime = p * this.time;\n }\n getPosition() {\n return this.domPlayer.currentTime / this.time;\n }\n get totalTime() {\n return this._delay + this._duration;\n }\n beforeDestroy() {\n const styles = new Map();\n if (this.hasStarted()) {\n // note: this code is invoked only when the `play` function was called prior to this\n // (thus `hasStarted` returns true), this implies that the code that initializes\n // `_finalKeyframe` has also been executed and the non-null assertion can be safely used here\n const finalKeyframe = this._finalKeyframe;\n finalKeyframe.forEach((val, prop) => {\n if (prop !== 'offset') {\n styles.set(prop, this._finished ? val : computeStyle(this.element, prop));\n }\n });\n }\n this.currentSnapshot = styles;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName === 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\nclass WebAnimationsDriver {\n validateStyleProperty(prop) {\n // Perform actual validation in dev mode only, in prod mode this check is a noop.\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n return validateStyleProperty(prop);\n }\n return true;\n }\n validateAnimatableStyleProperty(prop) {\n // Perform actual validation in dev mode only, in prod mode this check is a noop.\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n const cssProp = camelCaseToDashCase(prop);\n return validateWebAnimatableStyleProperty(cssProp);\n }\n return true;\n }\n matchesElement(_element, _selector) {\n // This method is deprecated and no longer in use so we return false.\n return false;\n }\n containsElement(elm1, elm2) {\n return containsElement(elm1, elm2);\n }\n getParentElement(element) {\n return getParentElement(element);\n }\n query(element, selector, multi) {\n return invokeQuery(element, selector, multi);\n }\n computeStyle(element, prop, defaultValue) {\n return window.getComputedStyle(element)[prop];\n }\n animate(element, keyframes, duration, delay, easing, previousPlayers = []) {\n const fill = delay == 0 ? 'both' : 'forwards';\n const playerOptions = { duration, delay, fill };\n // we check for this to avoid having a null|undefined value be present\n // for the easing (which results in an error for certain browsers #9752)\n if (easing) {\n playerOptions['easing'] = easing;\n }\n const previousStyles = new Map();\n const previousWebAnimationPlayers = previousPlayers.filter(player => player instanceof WebAnimationsPlayer);\n if (allowPreviousPlayerStylesMerge(duration, delay)) {\n previousWebAnimationPlayers.forEach(player => {\n player.currentSnapshot.forEach((val, prop) => previousStyles.set(prop, val));\n });\n }\n let _keyframes = normalizeKeyframes(keyframes).map(styles => copyStyles(styles));\n _keyframes = balancePreviousStylesIntoKeyframes(element, _keyframes, previousStyles);\n const specialStyles = packageNonAnimatableStyles(element, _keyframes);\n return new WebAnimationsPlayer(element, _keyframes, playerOptions, specialStyles);\n }\n}\n\n/**\n * @module\n * @description\n * Entry point for all animation APIs of the animation browser package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AnimationDriver, Animation as ɵAnimation, AnimationEngine as ɵAnimationEngine, AnimationStyleNormalizer as ɵAnimationStyleNormalizer, NoopAnimationDriver as ɵNoopAnimationDriver, NoopAnimationStyleNormalizer as ɵNoopAnimationStyleNormalizer, WebAnimationsDriver as ɵWebAnimationsDriver, WebAnimationsPlayer as ɵWebAnimationsPlayer, WebAnimationsStyleNormalizer as ɵWebAnimationsStyleNormalizer, allowPreviousPlayerStylesMerge as ɵallowPreviousPlayerStylesMerge, containsElement as ɵcontainsElement, getParentElement as ɵgetParentElement, invokeQuery as ɵinvokeQuery, normalizeKeyframes as ɵnormalizeKeyframes, validateStyleProperty as ɵvalidateStyleProperty };\n","/**\n * @license Angular v15.2.9\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { ViewEncapsulation, Injectable, Inject, RendererFactory2, NgZone, ANIMATION_MODULE_TYPE, NgModule } from '@angular/core';\nexport { ANIMATION_MODULE_TYPE } from '@angular/core';\nimport { ɵDomRendererFactory2, BrowserModule } from '@angular/platform-browser';\nimport { AnimationBuilder, sequence, AnimationFactory } from '@angular/animations';\nimport * as i1 from '@angular/animations/browser';\nimport { ɵAnimationEngine, ɵWebAnimationsStyleNormalizer, ɵAnimationStyleNormalizer, AnimationDriver, ɵWebAnimationsDriver, ɵNoopAnimationDriver } from '@angular/animations/browser';\nimport { DOCUMENT } from '@angular/common';\n\nclass BrowserAnimationBuilder extends AnimationBuilder {\n constructor(rootRenderer, doc) {\n super();\n this._nextAnimationId = 0;\n const typeData = { id: '0', encapsulation: ViewEncapsulation.None, styles: [], data: { animation: [] } };\n this._renderer = rootRenderer.createRenderer(doc.body, typeData);\n }\n build(animation) {\n const id = this._nextAnimationId.toString();\n this._nextAnimationId++;\n const entry = Array.isArray(animation) ? sequence(animation) : animation;\n issueAnimationCommand(this._renderer, null, id, 'register', [entry]);\n return new BrowserAnimationFactory(id, this._renderer);\n }\n}\nBrowserAnimationBuilder.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserAnimationBuilder, deps: [{ token: i0.RendererFactory2 }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBrowserAnimationBuilder.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserAnimationBuilder });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserAnimationBuilder, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: i0.RendererFactory2 }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\nclass BrowserAnimationFactory extends AnimationFactory {\n constructor(_id, _renderer) {\n super();\n this._id = _id;\n this._renderer = _renderer;\n }\n create(element, options) {\n return new RendererAnimationPlayer(this._id, element, options || {}, this._renderer);\n }\n}\nclass RendererAnimationPlayer {\n constructor(id, element, options, _renderer) {\n this.id = id;\n this.element = element;\n this._renderer = _renderer;\n this.parentPlayer = null;\n this._started = false;\n this.totalTime = 0;\n this._command('create', options);\n }\n _listen(eventName, callback) {\n return this._renderer.listen(this.element, `@@${this.id}:${eventName}`, callback);\n }\n _command(command, ...args) {\n return issueAnimationCommand(this._renderer, this.element, this.id, command, args);\n }\n onDone(fn) {\n this._listen('done', fn);\n }\n onStart(fn) {\n this._listen('start', fn);\n }\n onDestroy(fn) {\n this._listen('destroy', fn);\n }\n init() {\n this._command('init');\n }\n hasStarted() {\n return this._started;\n }\n play() {\n this._command('play');\n this._started = true;\n }\n pause() {\n this._command('pause');\n }\n restart() {\n this._command('restart');\n }\n finish() {\n this._command('finish');\n }\n destroy() {\n this._command('destroy');\n }\n reset() {\n this._command('reset');\n this._started = false;\n }\n setPosition(p) {\n this._command('setPosition', p);\n }\n getPosition() {\n return this._renderer.engine.players[+this.id]?.getPosition() ?? 0;\n }\n}\nfunction issueAnimationCommand(renderer, element, id, command, args) {\n return renderer.setProperty(element, `@@${id}:${command}`, args);\n}\n\nconst ANIMATION_PREFIX = '@';\nconst DISABLE_ANIMATIONS_FLAG = '@.disabled';\nclass AnimationRendererFactory {\n constructor(delegate, engine, _zone) {\n this.delegate = delegate;\n this.engine = engine;\n this._zone = _zone;\n this._currentId = 0;\n this._microtaskId = 1;\n this._animationCallbacksBuffer = [];\n this._rendererCache = new Map();\n this._cdRecurDepth = 0;\n this.promise = Promise.resolve(0);\n engine.onRemovalComplete = (element, delegate) => {\n // Note: if a component element has a leave animation, and a host leave animation,\n // the view engine will call `removeChild` for the parent\n // component renderer as well as for the child component renderer.\n // Therefore, we need to check if we already removed the element.\n const parentNode = delegate?.parentNode(element);\n if (parentNode) {\n delegate.removeChild(parentNode, element);\n }\n };\n }\n createRenderer(hostElement, type) {\n const EMPTY_NAMESPACE_ID = '';\n // cache the delegates to find out which cached delegate can\n // be used by which cached renderer\n const delegate = this.delegate.createRenderer(hostElement, type);\n if (!hostElement || !type || !type.data || !type.data['animation']) {\n let renderer = this._rendererCache.get(delegate);\n if (!renderer) {\n // Ensure that the renderer is removed from the cache on destroy\n // since it may contain references to detached DOM nodes.\n const onRendererDestroy = () => this._rendererCache.delete(delegate);\n renderer =\n new BaseAnimationRenderer(EMPTY_NAMESPACE_ID, delegate, this.engine, onRendererDestroy);\n // only cache this result when the base renderer is used\n this._rendererCache.set(delegate, renderer);\n }\n return renderer;\n }\n const componentId = type.id;\n const namespaceId = type.id + '-' + this._currentId;\n this._currentId++;\n this.engine.register(namespaceId, hostElement);\n const registerTrigger = (trigger) => {\n if (Array.isArray(trigger)) {\n trigger.forEach(registerTrigger);\n }\n else {\n this.engine.registerTrigger(componentId, namespaceId, hostElement, trigger.name, trigger);\n }\n };\n const animationTriggers = type.data['animation'];\n animationTriggers.forEach(registerTrigger);\n return new AnimationRenderer(this, namespaceId, delegate, this.engine);\n }\n begin() {\n this._cdRecurDepth++;\n if (this.delegate.begin) {\n this.delegate.begin();\n }\n }\n _scheduleCountTask() {\n // always use promise to schedule microtask instead of use Zone\n this.promise.then(() => {\n this._microtaskId++;\n });\n }\n /** @internal */\n scheduleListenerCallback(count, fn, data) {\n if (count >= 0 && count < this._microtaskId) {\n this._zone.run(() => fn(data));\n return;\n }\n if (this._animationCallbacksBuffer.length == 0) {\n Promise.resolve(null).then(() => {\n this._zone.run(() => {\n this._animationCallbacksBuffer.forEach(tuple => {\n const [fn, data] = tuple;\n fn(data);\n });\n this._animationCallbacksBuffer = [];\n });\n });\n }\n this._animationCallbacksBuffer.push([fn, data]);\n }\n end() {\n this._cdRecurDepth--;\n // this is to prevent animations from running twice when an inner\n // component does CD when a parent component instead has inserted it\n if (this._cdRecurDepth == 0) {\n this._zone.runOutsideAngular(() => {\n this._scheduleCountTask();\n this.engine.flush(this._microtaskId);\n });\n }\n if (this.delegate.end) {\n this.delegate.end();\n }\n }\n whenRenderingDone() {\n return this.engine.whenRenderingDone();\n }\n}\nAnimationRendererFactory.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: AnimationRendererFactory, deps: [{ token: i0.RendererFactory2 }, { token: i1.ɵAnimationEngine }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Injectable });\nAnimationRendererFactory.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: AnimationRendererFactory });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: AnimationRendererFactory, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: i0.RendererFactory2 }, { type: i1.ɵAnimationEngine }, { type: i0.NgZone }]; } });\nclass BaseAnimationRenderer {\n constructor(namespaceId, delegate, engine, _onDestroy) {\n this.namespaceId = namespaceId;\n this.delegate = delegate;\n this.engine = engine;\n this._onDestroy = _onDestroy;\n this.destroyNode = this.delegate.destroyNode ? (n) => delegate.destroyNode(n) : null;\n }\n get data() {\n return this.delegate.data;\n }\n destroy() {\n this.engine.destroy(this.namespaceId, this.delegate);\n this.delegate.destroy();\n this._onDestroy?.();\n }\n createElement(name, namespace) {\n return this.delegate.createElement(name, namespace);\n }\n createComment(value) {\n return this.delegate.createComment(value);\n }\n createText(value) {\n return this.delegate.createText(value);\n }\n appendChild(parent, newChild) {\n this.delegate.appendChild(parent, newChild);\n this.engine.onInsert(this.namespaceId, newChild, parent, false);\n }\n insertBefore(parent, newChild, refChild, isMove = true) {\n this.delegate.insertBefore(parent, newChild, refChild);\n // If `isMove` true than we should animate this insert.\n this.engine.onInsert(this.namespaceId, newChild, parent, isMove);\n }\n removeChild(parent, oldChild, isHostElement) {\n this.engine.onRemove(this.namespaceId, oldChild, this.delegate, isHostElement);\n }\n selectRootElement(selectorOrNode, preserveContent) {\n return this.delegate.selectRootElement(selectorOrNode, preserveContent);\n }\n parentNode(node) {\n return this.delegate.parentNode(node);\n }\n nextSibling(node) {\n return this.delegate.nextSibling(node);\n }\n setAttribute(el, name, value, namespace) {\n this.delegate.setAttribute(el, name, value, namespace);\n }\n removeAttribute(el, name, namespace) {\n this.delegate.removeAttribute(el, name, namespace);\n }\n addClass(el, name) {\n this.delegate.addClass(el, name);\n }\n removeClass(el, name) {\n this.delegate.removeClass(el, name);\n }\n setStyle(el, style, value, flags) {\n this.delegate.setStyle(el, style, value, flags);\n }\n removeStyle(el, style, flags) {\n this.delegate.removeStyle(el, style, flags);\n }\n setProperty(el, name, value) {\n if (name.charAt(0) == ANIMATION_PREFIX && name == DISABLE_ANIMATIONS_FLAG) {\n this.disableAnimations(el, !!value);\n }\n else {\n this.delegate.setProperty(el, name, value);\n }\n }\n setValue(node, value) {\n this.delegate.setValue(node, value);\n }\n listen(target, eventName, callback) {\n return this.delegate.listen(target, eventName, callback);\n }\n disableAnimations(element, value) {\n this.engine.disableAnimations(element, value);\n }\n}\nclass AnimationRenderer extends BaseAnimationRenderer {\n constructor(factory, namespaceId, delegate, engine, onDestroy) {\n super(namespaceId, delegate, engine, onDestroy);\n this.factory = factory;\n this.namespaceId = namespaceId;\n }\n setProperty(el, name, value) {\n if (name.charAt(0) == ANIMATION_PREFIX) {\n if (name.charAt(1) == '.' && name == DISABLE_ANIMATIONS_FLAG) {\n value = value === undefined ? true : !!value;\n this.disableAnimations(el, value);\n }\n else {\n this.engine.process(this.namespaceId, el, name.slice(1), value);\n }\n }\n else {\n this.delegate.setProperty(el, name, value);\n }\n }\n listen(target, eventName, callback) {\n if (eventName.charAt(0) == ANIMATION_PREFIX) {\n const element = resolveElementFromTarget(target);\n let name = eventName.slice(1);\n let phase = '';\n // @listener.phase is for trigger animation callbacks\n // @@listener is for animation builder callbacks\n if (name.charAt(0) != ANIMATION_PREFIX) {\n [name, phase] = parseTriggerCallbackName(name);\n }\n return this.engine.listen(this.namespaceId, element, name, phase, event => {\n const countId = event['_data'] || -1;\n this.factory.scheduleListenerCallback(countId, callback, event);\n });\n }\n return this.delegate.listen(target, eventName, callback);\n }\n}\nfunction resolveElementFromTarget(target) {\n switch (target) {\n case 'body':\n return document.body;\n case 'document':\n return document;\n case 'window':\n return window;\n default:\n return target;\n }\n}\nfunction parseTriggerCallbackName(triggerName) {\n const dotIndex = triggerName.indexOf('.');\n const trigger = triggerName.substring(0, dotIndex);\n const phase = triggerName.slice(dotIndex + 1);\n return [trigger, phase];\n}\n\nclass InjectableAnimationEngine extends ɵAnimationEngine {\n // The `ApplicationRef` is injected here explicitly to force the dependency ordering.\n // Since the `ApplicationRef` should be created earlier before the `AnimationEngine`, they\n // both have `ngOnDestroy` hooks and `flush()` must be called after all views are destroyed.\n constructor(doc, driver, normalizer, appRef) {\n super(doc.body, driver, normalizer);\n }\n ngOnDestroy() {\n this.flush();\n }\n}\nInjectableAnimationEngine.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: InjectableAnimationEngine, deps: [{ token: DOCUMENT }, { token: i1.AnimationDriver }, { token: i1.ɵAnimationStyleNormalizer }, { token: i0.ApplicationRef }], target: i0.ɵɵFactoryTarget.Injectable });\nInjectableAnimationEngine.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: InjectableAnimationEngine });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: InjectableAnimationEngine, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1.AnimationDriver }, { type: i1.ɵAnimationStyleNormalizer }, { type: i0.ApplicationRef }]; } });\nfunction instantiateDefaultStyleNormalizer() {\n return new ɵWebAnimationsStyleNormalizer();\n}\nfunction instantiateRendererFactory(renderer, engine, zone) {\n return new AnimationRendererFactory(renderer, engine, zone);\n}\nconst SHARED_ANIMATION_PROVIDERS = [\n { provide: AnimationBuilder, useClass: BrowserAnimationBuilder },\n { provide: ɵAnimationStyleNormalizer, useFactory: instantiateDefaultStyleNormalizer },\n { provide: ɵAnimationEngine, useClass: InjectableAnimationEngine }, {\n provide: RendererFactory2,\n useFactory: instantiateRendererFactory,\n deps: [ɵDomRendererFactory2, ɵAnimationEngine, NgZone]\n }\n];\n/**\n * Separate providers from the actual module so that we can do a local modification in Google3 to\n * include them in the BrowserModule.\n */\nconst BROWSER_ANIMATIONS_PROVIDERS = [\n { provide: AnimationDriver, useFactory: () => new ɵWebAnimationsDriver() },\n { provide: ANIMATION_MODULE_TYPE, useValue: 'BrowserAnimations' }, ...SHARED_ANIMATION_PROVIDERS\n];\n/**\n * Separate providers from the actual module so that we can do a local modification in Google3 to\n * include them in the BrowserTestingModule.\n */\nconst BROWSER_NOOP_ANIMATIONS_PROVIDERS = [\n { provide: AnimationDriver, useClass: ɵNoopAnimationDriver },\n { provide: ANIMATION_MODULE_TYPE, useValue: 'NoopAnimations' }, ...SHARED_ANIMATION_PROVIDERS\n];\n\n/**\n * Exports `BrowserModule` with additional [dependency-injection providers](guide/glossary#provider)\n * for use with animations. See [Animations](guide/animations).\n * @publicApi\n */\nclass BrowserAnimationsModule {\n /**\n * Configures the module based on the specified object.\n *\n * @param config Object used to configure the behavior of the `BrowserAnimationsModule`.\n * @see `BrowserAnimationsModuleConfig`\n *\n * @usageNotes\n * When registering the `BrowserAnimationsModule`, you can use the `withConfig`\n * function as follows:\n * ```\n * @NgModule({\n * imports: [BrowserAnimationsModule.withConfig(config)]\n * })\n * class MyNgModule {}\n * ```\n */\n static withConfig(config) {\n return {\n ngModule: BrowserAnimationsModule,\n providers: config.disableAnimations ? BROWSER_NOOP_ANIMATIONS_PROVIDERS :\n BROWSER_ANIMATIONS_PROVIDERS\n };\n }\n}\nBrowserAnimationsModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserAnimationsModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nBrowserAnimationsModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserAnimationsModule, exports: [BrowserModule] });\nBrowserAnimationsModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserAnimationsModule, providers: BROWSER_ANIMATIONS_PROVIDERS, imports: [BrowserModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserAnimationsModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [BrowserModule],\n providers: BROWSER_ANIMATIONS_PROVIDERS,\n }]\n }] });\n/**\n * Returns the set of [dependency-injection providers](guide/glossary#provider)\n * to enable animations in an application. See [animations guide](guide/animations)\n * to learn more about animations in Angular.\n *\n * @usageNotes\n *\n * The function is useful when you want to enable animations in an application\n * bootstrapped using the `bootstrapApplication` function. In this scenario there\n * is no need to import the `BrowserAnimationsModule` NgModule at all, just add\n * providers returned by this function to the `providers` list as show below.\n *\n * ```typescript\n * bootstrapApplication(RootComponent, {\n * providers: [\n * provideAnimations()\n * ]\n * });\n * ```\n *\n * @publicApi\n */\nfunction provideAnimations() {\n // Return a copy to prevent changes to the original array in case any in-place\n // alterations are performed to the `provideAnimations` call results in app code.\n return [...BROWSER_ANIMATIONS_PROVIDERS];\n}\n/**\n * A null player that must be imported to allow disabling of animations.\n * @publicApi\n */\nclass NoopAnimationsModule {\n}\nNoopAnimationsModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NoopAnimationsModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nNoopAnimationsModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: NoopAnimationsModule, exports: [BrowserModule] });\nNoopAnimationsModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NoopAnimationsModule, providers: BROWSER_NOOP_ANIMATIONS_PROVIDERS, imports: [BrowserModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NoopAnimationsModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [BrowserModule],\n providers: BROWSER_NOOP_ANIMATIONS_PROVIDERS,\n }]\n }] });\n/**\n * Returns the set of [dependency-injection providers](guide/glossary#provider)\n * to disable animations in an application. See [animations guide](guide/animations)\n * to learn more about animations in Angular.\n *\n * @usageNotes\n *\n * The function is useful when you want to bootstrap an application using\n * the `bootstrapApplication` function, but you need to disable animations\n * (for example, when running tests).\n *\n * ```typescript\n * bootstrapApplication(RootComponent, {\n * providers: [\n * provideNoopAnimations()\n * ]\n * });\n * ```\n *\n * @publicApi\n */\nfunction provideNoopAnimations() {\n // Return a copy to prevent changes to the original array in case any in-place\n // alterations are performed to the `provideNoopAnimations` call results in app code.\n return [...BROWSER_NOOP_ANIMATIONS_PROVIDERS];\n}\n\n/**\n * @module\n * @description\n * Entry point for all animation APIs of the animation browser package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BrowserAnimationsModule, NoopAnimationsModule, provideAnimations, provideNoopAnimations, AnimationRenderer as ɵAnimationRenderer, AnimationRendererFactory as ɵAnimationRendererFactory, BrowserAnimationBuilder as ɵBrowserAnimationBuilder, BrowserAnimationFactory as ɵBrowserAnimationFactory, InjectableAnimationEngine as ɵInjectableAnimationEngine };\n","import { NgModule } from '@angular/core';\nimport { AnimationOnScrollDirective } from './animation-on-scroll.directive';\n\n@NgModule({\n declarations: [AnimationOnScrollDirective],\n exports: [AnimationOnScrollDirective],\n})\nexport class AnimationOnScrollModule { }\n","import { NgModule } from '@angular/core';\nimport { CommonModule } from '@angular/common';\nimport { MatLegacyTabsModule as MatTabsModule } from '@angular/material/legacy-tabs';\nimport { MatExpansionModule } from '@angular/material/expansion';\nimport { FaqComponent } from './faq.component';\n\n@NgModule({\n declarations: [FaqComponent],\n exports: [\n FaqComponent,\n ],\n imports: [\n CommonModule,\n MatTabsModule,\n MatExpansionModule,\n ]\n})\nexport class FaqModule { }\n","import { NgModule } from '@angular/core';\nimport { MatLegacyButtonModule as MatButtonModule } from '@angular/material/legacy-button';\nimport { MatLegacyDialogModule as MatDialogModule } from '@angular/material/legacy-dialog';\nimport { MatDividerModule } from '@angular/material/divider';\nimport { MatExpansionModule } from '@angular/material/expansion';\nimport { MatIconModule } from '@angular/material/icon';\nimport { MatLegacyTabsModule as MatTabsModule } from '@angular/material/legacy-tabs';\nimport { BrowserModule } from '@angular/platform-browser';\nimport { BrowserAnimationsModule } from '@angular/platform-browser/animations';\nimport { RouterModule } from '@angular/router';\nimport { DropZoneModule } from 'src/app/partials/drop-zone/drop-zone.module';\nimport { FooterModule } from 'src/app/partials/footer/footer.module';\nimport { AnimationOnScrollModule } from 'src/app/shared/utils/animation-on-scroll/animation-on-scroll.module';\nimport { PaymentOptionsModule } from '../../partials/payment-options/payment-options.module';\nimport { ScrollModule } from '../directives/scroll/scroll.module';\nimport { FaqModule } from '../../pages/faq/faq.module';\nimport { BlogSectionComponent } from './blog-section/blog-section.component';\nimport { CertificateComponent } from './certificate/certificate.component';\nimport { HomeComponent } from './home.component';\nimport { HowItWorksComponent } from './how-it-works/how-it-works.component';\nimport { MapComponent } from './map/map.component';\nimport { PricingComponent } from './pricing/pricing.component';\nimport { QuotedHeaderComponent } from './quoted-header/quoted-header.component';\nimport { TestimonialsComponent } from './testimonials/testimonials.component';\n\n@NgModule({\n declarations: [\n HomeComponent,\n HowItWorksComponent,\n PricingComponent,\n MapComponent,\n BlogSectionComponent,\n CertificateComponent,\n QuotedHeaderComponent,\n TestimonialsComponent,\n ],\n imports: [\n BrowserModule,\n BrowserAnimationsModule,\n FooterModule,\n RouterModule,\n DropZoneModule,\n MatButtonModule,\n MatDialogModule,\n MatDividerModule,\n PaymentOptionsModule,\n MatIconModule,\n MatTabsModule,\n AnimationOnScrollModule,\n MatExpansionModule,\n ScrollModule,\n FaqModule\n ],\n})\nexport class HomeModule {\n}\n","\nimport { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { select, Store } from '@ngrx/store';\nimport { forkJoin, merge } from 'rxjs';\nimport { first, map, switchMap, tap } from 'rxjs/operators';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport {\n GetGeoIPActions,\n GetGeoIPSuccess,\n} from 'src/app/auth/store/actions/getGeoIP.action';\nimport {\n GetUserInfoActions,\n GetUserInfoSuccess,\n} from 'src/app/auth/store/actions/getUserInfo.action';\nimport {\n Logout,\n LogoutActions,\n} from 'src/app/auth/store/actions/logout.action';\nimport { getGeoIPState, getIsEU } from 'src/app/auth/store/selectors/user.selector';\nimport { CreditConfig } from 'src/app/client/models/credit.models';\nimport { BillingServiceClient } from 'src/app/client/services/billing-service.client';\nimport {\n getCurrencySelector,\n getCurrencySign,\n} from 'src/app/pages/credit-bundle-choice/credit-bundle-choice.utils';\nimport {\n ChangeUserInfoActions,\n ChangeUserInfoSuccess,\n} from 'src/app/pages/settings/store/actions/change-user-info.actions';\nimport { EnvironmentService } from 'src/app/shared/services/environment.service';\nimport { ErrorHelperService } from 'src/app/shared/services/error-helper.service';\nimport {\n CreditBundleChoiceActions,\n GetCreditBundles,\n GetCreditBundlesSuccess,\n GetCreditOrderSummary,\n GetPriceRange,\n GetPriceRangeSuccess,\n RepeatCreditChoice,\n} from '../actions/credit-bundle-choice.actions';\nimport { getRouterState } from '../selectors/router.selectors';\nimport { AppState } from './../models/app.models';\n\n@Injectable()\nexport class CreditBundleChoiceEffects {\n\n\n public readonly triggerGetStartingPrice = createEffect(() => merge(\n this.storeActions.pipe(ofType(GetGeoIPActions.GET_GEO_IP_SUCCESS)),\n this.storeActions.pipe(ofType(GetUserInfoActions.GET_USER_INFO_SUCCESS)),\n this.storeActions.pipe(ofType(\n ChangeUserInfoActions.CHANGE_USER_INFO_SUCCESS)),\n this.storeActions.pipe(ofType(LogoutActions.LOGOUT)),\n ).pipe(map(() => new GetPriceRange())));\n\n\n public readonly getCreditPackages = createEffect(() => this.storeActions.pipe(\n ofType(CreditBundleChoiceActions.GET_CREDIT_BUNDLES),\n switchMap(() => this.billingServiceClient.getCreditOrderConfig().pipe(\n map(response => new GetCreditBundlesSuccess(response)),\n this.errorHelperService.raiseError(),\n )),\n ));\n\n\n public readonly retreiveStartingPrice = createEffect(() => this.storeActions.pipe(\n ofType(CreditBundleChoiceActions.GET_PRICE_RANGE),\n switchMap(() => this.billingServiceClient.getCreditOrderConfig().pipe(\n this.errorHelperService.raiseError(),\n )),\n switchMap(bundles => forkJoin([\n this.store.select(getGeoIPState).pipe(first()),\n this.store.select(getIsEU).pipe(first()),\n ])\n .pipe(\n map(([_, isEU]) => {\n if (this.enviService.isCzechEnvironment) {\n return bundles.results.filter(bundle => bundle.currency === 'CZK');\n } else {\n // eslint-disable-next-line max-len\n return bundles.results.filter(bundle => bundle.currency === getCurrencySelector(isEU));\n }\n }),\n )),\n map(bundles => this.getPriceRange(bundles)),\n map(startingPrice => new GetPriceRangeSuccess(startingPrice)),\n ));\n\n\n public readonly redirectBackToCreditBundles = createEffect(() => this.storeActions.pipe(\n ofType(CreditBundleChoiceActions.REPEAT_CREDIT_CHOICE),\n tap(() => this.router.navigate([AppRoutes.CreditBundleChoice])),\n ), { dispatch: false });\n\n\n public readonly navigateIfSelectCreditBundles = createEffect(() => this.storeActions.pipe(\n ofType(CreditBundleChoiceActions.GET_CREDIT_ORDER_SUMMARY),\n switchMap(() => this.store.pipe(\n select(getRouterState),\n first())),\n tap(router => {\n if (router.queryParams.fileFlow) {\n this.router.navigate(\n [AppRoutes.CreditOrderSummary],\n { queryParams: { fileFlow: true } },\n );\n } else if (router.queryParams.creditFlow) {\n this.router.navigate(\n [AppRoutes.CreditOrderSummary],\n { queryParams: { creditFlow: true } },\n );\n } else this.router.navigate([AppRoutes.CreditOrderSummary]);\n }),\n ), { dispatch: false });\n\n constructor(\n private router: Router,\n private store: Store,\n private storeActions: Actions,\n private billingServiceClient: BillingServiceClient,\n private errorHelperService: ErrorHelperService,\n private enviService: EnvironmentService,\n ) { }\n\n private getPriceRange(bundles: CreditConfig[]): string[] {\n const bundleArray: number[] = [];\n\n bundles.forEach(bundle => {\n bundleArray.push(parseFloat(bundle.total_price) / bundle.credits_count);\n bundleArray.sort((a, b) => a - b);\n });\n\n return [\n `${bundleArray[0].toFixed(2)}${getCurrencySign(bundles[0].currency)}`,\n `${bundleArray[bundleArray.length - 1].toFixed(2)}${getCurrencySign(bundles[0].currency)}`,\n ];\n }\n}\n","export function isWatermarkAvailable(file: File) {\n const fileExtension = file.name.toLowerCase().split('.').pop();\n const allowedExtensions = ['jpg', 'png', 'jpeg', 'bmp', 'tiff', 'webp', 'jfif', 'heif', 'heic', 'avif'];\n return allowedExtensions.indexOf(fileExtension) > -1;\n}\n","import { Injectable } from '@angular/core';\n\nimport { Router } from '@angular/router';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { select, Store } from '@ngrx/store';\nimport { first, map, switchMap, takeWhile, tap } from 'rxjs/operators';\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { getIsAuthorized, limitExceededState } from 'src/app/auth/store/selectors/user.selector';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { LimitExceeded } from '../../../auth/store/models/user';\nimport { SnackbarService } from '../../../shared/services/snackbar.service';\nimport { FileAction, FileActions, SelectDocumentPrice } from '../actions/file.action';\nimport { AppState } from '../models/app.models';\nimport { FileState } from '../models/file.models';\nimport { getFileState } from '../selectors/file.selectors';\nimport { isWatermarkAvailable } from '../../utils/file-extensions';\n\n@Injectable()\nexport class FileRoutingEffects {\n\n public navigateAfterFileSelect = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.FILE_UPDATED),\n tap(action => {\n if (isWatermarkAvailable(action.payload.file)) {\n this.router.navigate([AppRoutes.WatermarkSelection]);\n } else {\n this.router.navigate([AppRoutes.DocumentCredentials]);\n }\n }),\n ), {dispatch: false});\n\n public readonly navigateAfterPriceSelect = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.SELECT_DOCUMENT_PRICE),\n switchMap(action => this.store.pipe(\n select(getIsAuthorized),\n takeWhile(authorized => !authorized, true),\n map(authorized => [action, authorized] as [SelectDocumentPrice, boolean])),\n ),\n switchMap(([action, authorized]) => this.store.pipe(\n select(limitExceededState),\n first(),\n map(exceeded => [action, authorized, exceeded] as\n [SelectDocumentPrice, boolean, LimitExceeded])),\n ),\n switchMap(([action, authorized, limitExceeded]) => this.store.pipe(\n select(getFileState),\n first(),\n map(file => [action, authorized, limitExceeded, file] as\n [SelectDocumentPrice, boolean, LimitExceeded, FileState])),\n ),\n tap(([action, authorized, limitExceeded, file]) => {\n if (authorized && file && file.file) {\n if (action.payload.is_free === true) {\n if (limitExceeded.isLimitExceeded) {\n this.snackbarService.queueSnackBar(Notifications.LimitExceeded,\n {triggerAction: 'FREE_LIMIT_WARNING_SHOWN'},\n );\n this.router.navigate([AppRoutes.DocumentProgress]);\n } else if (isWatermarkAvailable(file.file)) {\n this.router.navigate([AppRoutes.WatermarkSelection]);\n }\n } else {\n if (isWatermarkAvailable(file.file)) {\n this.router.navigate([AppRoutes.WatermarkSelection]);\n } else this.router.navigate([AppRoutes.DocumentCredentials]);\n }\n } else {\n this.router.navigate(\n [AppRoutes.SignUp],\n {queryParams: {fileFlow: true}},\n );\n }\n }),\n ), {dispatch: false});\n\n\n public readonly navigateAfterPatchedDocument = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.PATCH_DOCUMENT),\n map(() => [AppRoutes.DocumentProgress]),\n tap(url => this.router.navigate(url)),\n ), {dispatch: false});\n\n constructor(\n private storeActions: Actions,\n private store: Store,\n private router: Router,\n private snackbarService: SnackbarService,\n ) {\n }\n}\n","import { HttpErrorResponse, HttpEventType } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { Store } from '@ngrx/store';\n\nimport { combineLatest, forkJoin, of } from 'rxjs';\nimport {\n catchError,\n delay,\n filter,\n first,\n map,\n mapTo,\n switchMap,\n tap,\n} from 'rxjs/operators';\n\nimport { MatLegacyDialog as MatDialog } from '@angular/material/legacy-dialog';\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { GetCreditBalance } from 'src/app/auth/store/actions/getCreditBalance.actions';\nimport {\n getCreditBalance,\n getIsAuthorized, getIsValidAcademy,\n limitExceededState,\n} from 'src/app/auth/store/selectors/user.selector';\nimport { BillingServiceClient } from 'src/app/client/services/billing-service.client';\nimport { MytitleServiceClient } from 'src/app/client/services/mytitle-service.client';\nimport {\n DeleteDocumentsAction,\n DeleteDocumentsActions,\n FinishDeletionDocumentsError,\n FinishDeletionDocumentsStart,\n FinishDeletionDocumentsSuccess,\n} from 'src/app/pages/my-documents/store/actions/my-documents.actions';\nimport {\n ConfirmationDialogComponent,\n} from 'src/app/partials/confirmation-dialog/confirmation-dialog/confirmation-dialog.component';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { ErrorHelperService } from 'src/app/shared/services/error-helper.service';\nimport { SnackbarService } from 'src/app/shared/services/snackbar.service';\nimport {\n FileAction,\n FileActions,\n FileUpdated,\n FileUpgrade,\n FileUpgradeStart,\n FileUpgradeSuccess,\n FileUploadError,\n FileUploadProgress,\n FileUploadStart,\n FileUploadSuccess,\n NotEnoughCredits,\n PatchDocument,\n PatchDocumentError,\n PatchDocumentSuccess,\n} from '../actions/file.action';\nimport { CreateFileOrder } from '../actions/order-file.actions';\nimport { AppState } from '../models/app.models';\nimport {\n getDocument,\n getFile,\n getFileParentGuid,\n isUpgradingFile,\n upgradedFile,\n} from '../selectors/file.selectors';\nimport {getFileCreditsValue} from \"../../../shared/utils/get-file-credits-value\";\n\n@Injectable()\nexport class FileEffects {\n\n /**\n * Whenever the file is updated and user is authorized,\n * upload file.\n */\n\n public readonly uploadWhenReady = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.FILE_UPDATED),\n switchMap(({ payload: { file, folder, is_free, uploadNow } }) => combineLatest([\n this.store.select(getIsAuthorized),\n this.store.select(limitExceededState),\n ])\n .pipe(\n // as soon as user is authorized an\n filter(([authorized, exceeded]) =>\n authorized && ((exceeded.isLimitExceeded === false && is_free) || !is_free)),\n // let's not consider user logging-off and on again to re-upload to different account\n filter(() => !!uploadNow),\n first(),\n mapTo(new FileUploadStart({ file, folder, is_free })),\n )),\n ));\n\n\n public fileUpload = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.FILE_UPLOAD_START),\n switchMap((action: FileUploadStart) => this.mytitleServiceClient.uploadFile(action.payload)\n .pipe(\n map(event => {\n switch (event.type) {\n case HttpEventType.UploadProgress:\n // Compute and show the % done:\n const percentDone = Math.round(100 * event.loaded / event.total);\n return new FileUploadProgress({ percentDone });\n case HttpEventType.Response:\n event.body.is_free = action.payload.is_free;\n return new FileUploadSuccess(event.body);\n }\n return null;\n }),\n filter(response => !!response),\n catchError((error: HttpErrorResponse) => of(new FileUploadError(error.error))),\n ),\n ),\n ));\n\n\n public readonly redirectOnUploadError = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.FILE_UPLOAD_ERROR),\n tap(() => {\n this.snackbarService.queueSnackBar(Notifications.Unexpected);\n this.router.navigate([AppRoutes.MyDocuments]);\n }),\n ), { dispatch: false });\n\n\n public readonly fileUpgrade = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.FILE_UPGRADE),\n switchMap(() => this.store\n .select(getCreditBalance)\n .pipe(first())),\n filter(credits => {\n if (credits) {\n return true;\n } else {\n this.snackbarService.queueSnackBar(Notifications.NotEnoughCredits);\n return false;\n }\n }),\n switchMap(() => this.matDialog.open(\n ConfirmationDialogComponent, {\n data: Notifications.Upgrade })\n .afterClosed()\n .pipe(\n tap(confirmed => {\n if (confirmed) {\n this.router.navigate([AppRoutes.DocumentCredentials, {upgrade: true}]);\n }\n }),\n )),\n ), { dispatch: false });\n\n\n public fileUpgradeStart = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.FILE_UPGRADE_START),\n switchMap(action => this.billingService.createFileOrder(action.payload)\n .pipe(\n map(response => new FileUpgradeSuccess(response)),\n this.errorHelperService.raiseError(),\n )),\n ));\n\n\n public fileUpgradeSuccess = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.FILE_UPGRADE_SUCCESS),\n switchMap(() => this.store\n .select(getFileParentGuid)\n .pipe(first())),\n delay(2500),\n tap(folder => {\n if (folder) {\n this.router.navigate(\n [AppRoutes.MyDocuments],\n { queryParams: { folder } },\n );\n } else {\n this.router.navigate([AppRoutes.MyDocuments]);\n }\n this.snackbarService.queueSnackBar(Notifications.DocUpgradeSuccess);\n }),\n map(() => new GetCreditBalance()),\n ));\n\n\n public patchDocument = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.PATCH_DOCUMENT),\n switchMap(action => forkJoin([\n of(action.payload),\n this.store.select(upgradedFile).pipe(first()),\n this.store.select(getDocument).pipe(first()),\n ])),\n filter(([upgradedDocGuid, newDocGuid]) => !!upgradedDocGuid || !!newDocGuid),\n switchMap(([payload, upgradedDoc, newDoc]) => {\n let guid = '';\n if (upgradedDoc && upgradedDoc.order_items && upgradedDoc.order_items.length &&\n upgradedDoc.order_items[0] && upgradedDoc.order_items[0].document_guid) {\n guid = upgradedDoc.order_items[0].document_guid;\n } else {\n if (newDoc) {\n guid = newDoc.guid;\n }\n }\n return this.mytitleServiceClient.patchDocument(guid, payload).pipe(\n map(result => new PatchDocumentSuccess(result)),\n catchError((error: HttpErrorResponse) => of(new PatchDocumentError(error.error))),\n );\n }),\n ));\n\n\n public readonly handleFileOrderError$ = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.PATCH_DOCUMENT_ERROR),\n tap(() => {\n setTimeout(() => {\n this.snackbarService.queueSnackBar(Notifications.FileOrderError);\n this.router.navigate([AppRoutes.MyDocuments]);\n }, 2000);\n }),\n ), { dispatch: false });\n\n\n public readonly createOrderAfterPatchedDocument = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.PATCH_DOCUMENT_SUCCESS),\n switchMap(() => this.store.select(getIsAuthorized).pipe(first())),\n filter(isAuthorized => isAuthorized),\n switchMap(() => forkJoin([\n this.store.select(getCreditBalance).pipe(first()),\n this.store.select(isUpgradingFile).pipe(first()),\n this.store.select(upgradedFile).pipe(first()),\n this.store.select(getFile).pipe(first()),\n this.store.select(getIsValidAcademy).pipe(first()),\n ])),\n map(([creditBalance, upgradingFile, isUpgradedFile, file, isAcademy]) => {\n const filesize = upgradingFile ? 0 : file.size\n const hasCredits = creditBalance >= getFileCreditsValue(filesize, isAcademy)\n if (upgradingFile && hasCredits) {\n return new FileUpgradeStart(isUpgradedFile);\n } else if (hasCredits) {\n return new CreateFileOrder();\n } else {\n return new NotEnoughCredits();\n }\n }),\n ));\n\n\n public readonly createFreeOrderAfterPriceSelect = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.FILE_UPLOAD_SUCCESS),\n filter(action => action.payload.is_free === true),\n map(() => new CreateFileOrder()),\n ));\n\n\n public readonly redirectToCreditBundles = createEffect(() => this.storeActions.pipe(\n ofType(FileActions.NOT_ENOUGH_CREDITS),\n map(() =>\n this.router.navigate([AppRoutes.CreditBundleChoice], { queryParams: { fileFlow: true } })),\n ), { dispatch: false });\n\n\n public finishDocumentsDeletion = createEffect(() => this.storeActions.pipe(\n ofType(DeleteDocumentsActions.FINISH_DELETION_DOCUMENTS_START),\n switchMap(action => this.mytitleServiceClient.finishDocumentsDeletion(action.payload)\n .pipe(\n map(result => new FinishDeletionDocumentsSuccess(result)),\n catchError((error: HttpErrorResponse) => of(new FinishDeletionDocumentsError(error.error))),\n ),\n ),\n ));\n\n constructor(\n private storeActions: Actions,\n private store: Store,\n private router: Router,\n private mytitleServiceClient: MytitleServiceClient,\n private snackbarService: SnackbarService,\n private errorHelperService: ErrorHelperService,\n private billingService: BillingServiceClient,\n private matDialog: MatDialog,\n ) {\n }\n}\n","import { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { select, Store } from '@ngrx/store';\nimport { forkJoin } from 'rxjs';\nimport { filter, first, map, switchMap, takeWhile, tap } from 'rxjs/operators';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { RepeatCreditChoice } from 'src/app/app/states/actions/credit-bundle-choice.actions';\nimport {\n CreateCreditOrder,\n CreditOrderAuthorized,\n CreditOrderSuccess,\n CreditOrderUnauthorized,\n OrderCreditActions,\n} from 'src/app/app/states/actions/order-credit.actions';\nimport {\n CreateISICBuyingStandardError,\n CreateISICPaymentError,\n CreatePaymentStart\n} from 'src/app/app/states/actions/payment.actions';\nimport { AppState } from 'src/app/app/states/models/app.models';\nimport {\n getIsSelectedBundleAcademy,\n getSelectedBundle,\n hasPricingChanged\n} from 'src/app/app/states/selectors/credit-bundle-choice.selectors';\nimport { getPaymentGateway } from 'src/app/app/utils/get-payment-gateway';\nimport { LocationVerified, LocationVerifyActions } from 'src/app/auth/store/actions/locationVerify';\nimport { getIsAuthorized, getIsValidAcademy } from 'src/app/auth/store/selectors/user.selector';\nimport { BillingServiceClient } from 'src/app/client/services/billing-service.client';\nimport { DataLayerService } from 'src/app/shared/services/data-layer.service';\nimport { ErrorHelperService } from 'src/app/shared/services/error-helper.service';\nimport { getSavedVoucher } from '../selectors/voucher.selectors';\nimport { HttpErrorResponse } from \"@angular/common/http\";\n\n@Injectable()\nexport class CreditOrderEffects {\n\n\n public readonly authorizeRequest = createEffect(() => this.storeActions.pipe(\n ofType(OrderCreditActions.CREATE_CREDIT_ORDER),\n switchMap(action => this.store.pipe(\n select(getIsAuthorized),\n first(),\n map(isAuthorized => [action, isAuthorized] as [CreateCreditOrder, boolean]),\n )),\n map(([action, isAuthorized]) => isAuthorized ?\n new CreditOrderAuthorized(action.payload) : new CreditOrderUnauthorized()),\n ));\n\n\n public creditOrderCreate = createEffect(() => this.storeActions.pipe(\n ofType(OrderCreditActions.CREDIT_ORDER_AUTHORIZED),\n tap(action => {\n if (!action.payload.file_order_guid) {\n this.router.navigate([AppRoutes.CreditOrderSummary]);\n }\n }),\n switchMap(\n (action: CreditOrderAuthorized) =>\n this.billingServiceClient.createCreditOrder(action.payload)\n .pipe(\n map(result => new CreditOrderSuccess(result)),\n this.errorHelperService.raiseError(),\n ),\n ),\n ));\n\n\n public readonly returnToCreditBundlesAfterAuthentication = createEffect(() => this.storeActions.pipe(\n ofType(OrderCreditActions.CREDIT_ORDER_UNAUTHORIZED),\n switchMap(() => this.store.pipe(\n select(getIsAuthorized),\n takeWhile(isAuthorized => !isAuthorized, true),\n )),\n tap(isAuthorized => {\n if (!isAuthorized) {\n this.router.navigate([AppRoutes.SignUp], { queryParams: { creditFlow: true } });\n }\n }),\n filter(Boolean),\n switchMap(() => this.storeActions.pipe(\n // wait until user location and account settings location is verified\n ofType(LocationVerifyActions.LOCATION_VERIFIED),\n )),\n switchMap(() => forkJoin([\n this.store.select(hasPricingChanged).pipe(first()),\n this.store.select(getSelectedBundle).pipe(first()),\n this.store.select(getIsSelectedBundleAcademy).pipe(first()),\n this.store.select(getSavedVoucher).pipe(first()),\n this.store.select(getIsValidAcademy).pipe(first()),\n ])),\n map(([pricingChanged, selectedBundle, isBundleAcademy, voucher, isUserAcademy]) => {\n if (isBundleAcademy && !isUserAcademy) {\n return new CreateISICPaymentError(new HttpErrorResponse({}))\n } else if (!isBundleAcademy && isUserAcademy) {\n return new CreateISICBuyingStandardError(new HttpErrorResponse({}))\n } else if (pricingChanged) {\n return new RepeatCreditChoice();\n } else {\n if (voucher) {\n return new CreateCreditOrder({\n config_guid: selectedBundle,\n voucher_code: voucher,\n });\n } else {\n return new CreateCreditOrder({\n config_guid: selectedBundle,\n });\n }\n }\n }),\n ));\n\n\n public triggerPaymentOnCreditOrderSuccess = createEffect(() => this.storeActions.pipe(\n ofType(OrderCreditActions.CREDIT_ORDER_SUCCESS),\n map(response => {\n this.dataLayerService.push({ event: 'paid-order-created' });\n return new CreatePaymentStart({\n credit_order_guid: response.payload.credit_order_guid,\n payment_gateway: getPaymentGateway(),\n });\n }),\n ));\n\n constructor(\n private dataLayerService: DataLayerService,\n private storeActions: Actions,\n private router: Router,\n private store: Store,\n private errorHelperService: ErrorHelperService,\n private billingServiceClient: BillingServiceClient,\n ) {\n }\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\n\nimport { Params, Router } from '@angular/router';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { select, Store } from '@ngrx/store';\nimport { forkJoin, of } from 'rxjs';\nimport { catchError, filter, first, map, mergeMap, switchMap, tap } from 'rxjs/operators';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { GetCreditBalance } from 'src/app/auth/store/actions/getCreditBalance.actions';\nimport { getCreditBalance, getIsValidAcademy } from 'src/app/auth/store/selectors/user.selector';\nimport { BillingServiceClient } from 'src/app/client/services/billing-service.client';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { DataLayerService } from 'src/app/shared/services/data-layer.service';\nimport { SnackbarService } from 'src/app/shared/services/snackbar.service';\nimport { getFileCreditsValue } from '../../../shared/utils/get-file-credits-value';\nimport { ClearFileState } from '../actions/file.action';\nimport {\n ClearFileOrder,\n CreateFileOrder,\n FileOrderError,\n FileOrderSuccess,\n HighlightUpdate,\n OrderFileAction,\n OrderFileActions,\n} from '../actions/order-file.actions';\nimport { AppState } from '../models/app.models';\nimport {\n getSelectedBundle,\n isCreatingOrder,\n} from '../selectors/credit-bundle-choice.selectors';\nimport { getFileState } from '../selectors/file.selectors';\nimport { getSavedVoucher } from '../selectors/voucher.selectors';\nimport { CreateCreditOrder } from '../actions/order-credit.actions';\n\n@Injectable()\nexport class FileOrderEffects {\n\n public readonly fileOrderCreate$ = createEffect(() => this.storeActions.pipe(\n ofType(OrderFileActions.CREATE_FILE_ORDER),\n switchMap(() => this.store\n .pipe(\n select(getFileState),\n first(fileState => !!fileState && !!fileState.document),\n ),\n ),\n switchMap(fileState => this.store.pipe(\n select(getIsValidAcademy),\n first(isAcademy => isAcademy !== undefined),\n map(isAcademy => ({ fileState, isAcademy }))\n )),\n switchMap(({ fileState, isAcademy }) => this.billingServiceClient.createFileOrder({\n order_items: [\n {\n is_free: fileState.is_free,\n document_guid: fileState.document.guid,\n credit_value: getFileCreditsValue(fileState.document.filesize_original, isAcademy)\n },\n ],\n })\n .pipe(\n map(result => new FileOrderSuccess(result)),\n catchError((error: HttpErrorResponse) => of(new FileOrderError(error.error))),\n ),\n ),\n ));\n\n\n public readonly handleFileOrderError$ = createEffect(() => this.storeActions.pipe(\n ofType(OrderFileActions.FILE_ORDER_ERROR),\n tap(() => {\n setTimeout(() => {\n this.snackbarService.queueSnackBar(Notifications.FileOrderError);\n this.router.navigate([AppRoutes.MyDocuments]);\n }, 2000);\n }),\n map(() => new ClearFileOrder()),\n ));\n\n\n public readonly createCreditOrder = createEffect(() => this.storeActions.pipe(\n ofType(OrderFileActions.FILE_ORDER_SUCCESS),\n filter(action => !action.payload.is_free),\n switchMap(action => forkJoin([\n this.store.select(getCreditBalance).pipe(first()),\n this.store.select(isCreatingOrder).pipe(first()),\n this.store.select(getSelectedBundle).pipe(first()),\n this.store.select(getFileState).pipe(first()),\n this.store.select(getSavedVoucher).pipe(first()),\n of(action),\n ])),\n mergeMap(([credits, creatingOrder, selectedBundle, fileState, voucher, action]) => {\n if (!credits && creatingOrder) {\n if (voucher) {\n return [\n new CreateCreditOrder({\n config_guid: selectedBundle,\n file_order_guid: action.payload.guid,\n voucher_code: voucher,\n })];\n } else {\n return [\n new CreateCreditOrder({\n config_guid: selectedBundle,\n file_order_guid: action.payload.guid,\n })];\n }\n } else {\n const queryParams: Params = {folder: fileState.folder};\n\n this.router.navigate([AppRoutes.MyDocuments], {queryParams});\n return [\n new ClearFileState(),\n new GetCreditBalance(),\n new HighlightUpdate(true),\n ];\n }\n }),\n ));\n\n\n public readonly navigateIfOrderCreatedFree = createEffect(() => this.storeActions.pipe(\n ofType(OrderFileActions.FILE_ORDER_SUCCESS),\n filter(action => action.payload.is_free),\n mergeMap(action => {\n if (action.payload.is_free) {\n return [new ClearFileState(), new GetCreditBalance()];\n } else {\n return [new GetCreditBalance()];\n }\n }),\n ));\n\n\n public readonly navigateIfOrderCreated = createEffect(() => this.storeActions.pipe(\n ofType(OrderFileActions.FILE_ORDER_SUCCESS),\n switchMap(action => forkJoin([\n this.store.select(getCreditBalance).pipe(first()),\n this.store.select(getFileState).pipe(first()),\n of(action),\n ])),\n mergeMap(([creditBalance, fileState, action]) => {\n if (action.payload.is_free || creditBalance) {\n this.dataLayerService.push({event: 'free-order-created'});\n\n const queryParams: Params = {folder: fileState.folder};\n this.router.navigate([AppRoutes.MyDocuments], {queryParams});\n\n return [\n new HighlightUpdate(true),\n ];\n } else return [];\n }),\n ));\n\n constructor(\n private dataLayerService: DataLayerService,\n private storeActions: Actions,\n private billingServiceClient: BillingServiceClient,\n private snackbarService: SnackbarService,\n private store: Store,\n private router: Router,\n ) {\n }\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable, Optional } from '@angular/core';\nimport { Router } from '@angular/router';\n\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { of } from 'rxjs';\nimport { catchError, map, switchMap, tap } from 'rxjs/operators';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { GopayPaymentService } from 'src/app/app/services/gopay-payment.service';\nimport {\n CreateISICBuyingStandardError,\n CreateISICPaymentError,\n CreatePaymentError,\n CreatePaymentStart,\n CreatePaymentSuccess,\n PaymentActions,\n} from 'src/app/app/states/actions/payment.actions';\nimport { BillingServiceClient } from 'src/app/client/services/billing-service.client';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { SnackbarService } from 'src/app/shared/services/snackbar.service';\n\n@Injectable()\nexport class PaymentEffects {\n\n public paymentCreate = createEffect(() => this.storeActions.pipe(\n ofType(PaymentActions.CREATE_PAYMENT_START),\n switchMap(action => this.billingServiceClient.createPayment(action.payload).pipe(\n map(result => new CreatePaymentSuccess(result)),\n catchError((error: HttpErrorResponse) => of(new CreatePaymentError(error))),\n )),\n ));\n\n\n public triggerPaygate = createEffect(() => this.storeActions.pipe(\n ofType(PaymentActions.CREATE_PAYMENT_SUCCESS),\n tap(action => {\n this.gopayPaymentService.triggerPaygate(action.payload.gopay.gw_url);\n }),\n ), { dispatch: false });\n\n\n public catchErrorPaygate = createEffect(() => this.storeActions.pipe(\n ofType(PaymentActions.CREATE_PAYMENT_ERROR),\n tap(() => {\n this.snackbarService.queueSnackBar(Notifications.PaygateUnexpected);\n this.router.navigate([AppRoutes.CreditBundleChoice]);\n }),\n ), { dispatch: false });\n\n public catchErrorISICPaygate = createEffect(() => this.storeActions.pipe(\n ofType(PaymentActions.CREATE_ISIC_PAYMENT_ERROR),\n tap(() => {\n this.snackbarService.queueSnackBar(Notifications.PaygateInvalidISIC);\n this.router.navigate([AppRoutes.Settings]);\n }),\n ), { dispatch: false });\n\n public catchErrorISICBuyingStandard = createEffect(() => this.storeActions.pipe(\n ofType(PaymentActions.CREATE_ISIC_BUYING_STANDARD_ERROR),\n tap(() => {\n this.snackbarService.queueSnackBar(Notifications.PaygateISICBuyingStandard);\n this.router.navigate([AppRoutes.CreditBundleChoice]);\n }),\n ), { dispatch: false });\n\n\n constructor(\n @Optional() private gopayPaymentService: GopayPaymentService,\n private storeActions: Actions,\n private billingServiceClient: BillingServiceClient,\n private snackbarService: SnackbarService,\n private router: Router,\n ) {\n }\n}\n","// Signer entity locks name and email of the signing user at the time of transaction\nimport { HttpErrorResponse } from '@angular/common/http';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { MytitleError } from 'src/app/client/models/client.models';\nimport {\n CreateDocumentsDeletionParams,\n Document,\n FinishDocumentsDeletionResponse,\n} from 'src/app/client/models/mytitle-service.models';\nimport { FileOrderRequestParams } from 'src/app/client/models/order.models';\nimport { LoginRoutes } from 'src/app/pages/login/login.routes.misc';\nimport { SignUpRoutes } from 'src/app/pages/sign-up/sign-up.routes.misc';\n\nexport interface FileState {\n /**\n * File selected for upload.\n */\n file: File;\n folder: string;\n /**\n * Document created out of uploaded file.\n */\n document: Document;\n isFileUploading: boolean;\n canBePatched: boolean;\n fileError: HttpErrorResponse;\n /** Indicates that document should be signed as free */\n is_free: boolean;\n percentUploaded: number;\n isFileUpgrading: boolean;\n upgradingDocument: FileOrderRequestParams;\n fileParentGuid: string;\n\n documentsBeingDeleting: boolean;\n documentsToDelete: CreateDocumentsDeletionParams;\n finishingDocumentsDeleting: boolean;\n deletedDocuments: FinishDocumentsDeletionResponse;\n error: MytitleError[];\n}\n\nexport const progressRoutes: string[] = [\n `/${AppRoutes.PaymentConfirmation}`,\n `/${AppRoutes.DocumentCredentials}`,\n `/${AppRoutes.WatermarkSelection}`,\n `/${AppRoutes.DocumentProgress}`,\n `/${AppRoutes.CreditBundleChoice}?fileFlow=true`,\n `/${AppRoutes.CreditOrderSummary}?fileFlow=true`,\n `/${AppRoutes.SignUp}?fileFlow=true`,\n `/${AppRoutes.SignUp}?creditFlow=true`,\n `/${AppRoutes.SignUp}/${SignUpRoutes.Country}?fileFlow=true`,\n `/${AppRoutes.SignUp}/${SignUpRoutes.Country}?creditFlow=true`,\n `/${AppRoutes.Login}?fileFlow=true`,\n `/${AppRoutes.Login}?creditFlow=true`,\n `/${AppRoutes.Login}/${LoginRoutes.TwoFA}?fileFlow=true`,\n `/${AppRoutes.Login}/${LoginRoutes.TwoFA}?creditFlow=true`,\n `/${AppRoutes.EmailConfirmation}?fileFlow=true`,\n `/${AppRoutes.EmailConfirmation}?creditFlow=true`,\n];\n","import { Injectable } from '@angular/core';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport {\n RouterNavigatedAction,\n RouterNavigatedPayload,\n ROUTER_NAVIGATED,\n} from '@ngrx/router-store';\nimport { select, Store } from '@ngrx/store';\n\nimport { filter, first, map, switchMap } from 'rxjs/operators';\nimport { progressRoutes } from '../models/file.models';\nimport { getAppLayoutSettings } from '../reducers/layout.reducers';\nimport { getFileState } from '../selectors/file.selectors';\nimport { ClearFileState } from './../actions/file.action';\nimport { ChangeLayoutState } from './../actions/layout.actions';\nimport { AppState } from './../models/app.models';\n\n@Injectable()\nexport class RouterEffects {\n\n /**\n * When user uploads a file which is stored in app state and is redirected out\n * of file flow/uploading process, stored file is being removed.\n */\n\n public readonly cleanFileFromStoreOnFileflowCancel = createEffect(() => this.storeActions.pipe(\n ofType(ROUTER_NAVIGATED),\n map(payloadObject => payloadObject.payload),\n filter((payload: RouterNavigatedPayload) => !progressRoutes.includes(payload.routerState.url)),\n switchMap(() => this.store.pipe(\n select(getFileState),\n first(),\n )),\n filter(fileState => !!fileState.file),\n map(() => new ClearFileState()),\n ));\n\n /**\n * On route change apply specific layout setting for given route.\n * If there is no state specified for given route, default state will be applied.\n */\n\n public readonly changeAppLayoutStateAccordingToRoute = createEffect(() => this.storeActions.pipe(\n ofType(ROUTER_NAVIGATED),\n map(action => {\n const newLayoutState = getAppLayoutSettings(action.payload.routerState.url);\n return new ChangeLayoutState(newLayoutState);\n }),\n ));\n\n constructor(\n private store: Store,\n private storeActions: Actions,\n ) {}\n\n}\n","import * as uuid from 'uuid';\n\nimport {\n FileExt,\n FolderExt,\n ParsedFolderStructure,\n} from 'src/app/app/states/reducers/upload-folder.reducer';\n\n/**\n * Return complete folder hierarchy\n */\nexport function parseFilesIntoFolderStructure(files: FileExt[]): ParsedFolderStructure {\n // Parse file relative string paths and create unique folder structure\n const paths = files.map(x => x.webkitRelativePath.replace(x.name, ''));\n const folderStructureToReturn = {\n files,\n ...getUniqueFolderStructure(paths),\n };\n\n return folderStructureToReturn;\n }\n\n/**\n * Return unique folder structure of all uploaded files/folders inside of a folder\n */\nfunction getUniqueFolderStructure(paths: string[]):\n { folders: FolderExt[]; foldersInTotal: number } {\n\n const foldersToReturn: FolderExt[] = [];\n let foldersInTotal = 0;\n\n paths.forEach(path => {\n const parsedPath = path.split('/');\n parsedPath.pop(); // remove last element (file name itself)\n\n let folders = foldersToReturn;\n parsedPath.forEach(pathSegment => {\n const index = folders.findIndex(x => x.folderName === pathSegment);\n // create new folder and step inside of it\n if (index === -1) {\n foldersInTotal++;\n const newLength = folders.push({\n storeGuid: uuid.v4(),\n folderGuid: null,\n parentFolderGuid: null,\n folderName: pathSegment,\n childFolders: [],\n });\n folders = folders[newLength - 1].childFolders;\n // otherwise step directly into it\n } else folders = folders[index].childFolders;\n });\n });\n\n return { folders: foldersToReturn, foldersInTotal };\n}\n","import { HttpErrorResponse, HttpEventType } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Router } from '@angular/router';\n\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { select, Store } from '@ngrx/store';\nimport { forkJoin, Observable, of } from 'rxjs';\nimport {\n catchError,\n concatMap,\n delay,\n filter,\n first,\n map,\n mapTo,\n mergeMap,\n mergeMapTo,\n switchMap,\n switchMapTo,\n takeWhile,\n tap,\n} from 'rxjs/operators';\n\nimport { AppRoutes } from 'src/app/app/app.routes.misc';\nimport { GetCreditBalance } from 'src/app/auth/store/actions/getCreditBalance.actions';\nimport { CreateDocumentParams } from 'src/app/client/models/mytitle-service.models';\nimport { FileOrderRequestParams } from 'src/app/client/models/order.models';\nimport { BillingServiceClient } from 'src/app/client/services/billing-service.client';\nimport { MytitleServiceClient } from 'src/app/client/services/mytitle-service.client';\nimport { Notifications } from 'src/app/shared/models/notifications';\nimport { ErrorHelperService } from 'src/app/shared/services/error-helper.service';\nimport { SnackbarService } from 'src/app/shared/services/snackbar.service';\nimport { parseFilesIntoFolderStructure } from 'src/app/shared/utils/folder-parser';\nimport {\n FileExt,\n FileUploadingStatus,\n FolderExt,\n ParsedFolderStructure,\n} from '../reducers/upload-folder.reducer';\nimport {\n CreateFolderFileOrdersStart,\n CreateFolderFileOrdersSuccess,\n CreateFolderStructureBuffer,\n CreateFolderStructureStart,\n CreateFolderStructureSuccess,\n DisplayFolderCreditConfirmation,\n PatchFolderFiles,\n PatchFolderFileStart,\n PatchFolderFileSuccess,\n UpdateFolderStructureBuffer,\n UploadFilesIntoFolderStart,\n UploadFilesIntoFolderSuccess,\n UploadFolderAction,\n UploadFolderActions,\n UploadFolderFileError,\n UploadFolderFileProgress,\n UploadFolderFileStart,\n UploadFolderFileSuccess,\n UploadFolderFinished,\n UploadFolderReset,\n UploadFolderStart,\n WaitUntilFolderStructureIsCreated,\n} from './../actions/upload-folder.actions';\nimport { AppState } from './../models/app.models';\nimport {\n allFilesPatched,\n areAllFilesUploaded,\n areAllFoldersCreated,\n filesInWaitingState,\n getAllUploadedFiles,\n getFolderCredentials,\n getParentFolderGuid,\n numberOfCurrentlyUploadedFiles,\n uploadFolderState,\n} from './../selectors/upload-folder.selectors';\n\n@Injectable()\nexport class UploadFolderEffects {\n\n /**\n * Display credit checkout to user for whole transaction\n */\n\n public readonly displayFolderCreditConfirmation = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.DISPLAY_FOLDER_CREDIT_CONFIRMATION),\n map(action => [\n parseFilesIntoFolderStructure(action.payload.files),\n action.payload.parentGuid,\n ] as [ParsedFolderStructure, string]),\n filter(([folderStructure, _]) => {\n if (!folderStructure.folders.length && !folderStructure.files.length) {\n this.snackbarService\n .queueSnackBar(Notifications.NothingSelected);\n return false;\n } else if (!folderStructure.folders.length && folderStructure.files.length) {\n this.snackbarService\n .queueSnackBar(Notifications.WrongButton);\n return false;\n } else return true;\n }),\n map(([folderStructure, parentGuid]) => new CreateFolderStructureBuffer({\n structure: folderStructure,\n parentGuid,\n })),\n tap(() => this.router.navigate(['/', AppRoutes.FolderUploadConfirmation])),\n ));\n\n /**\n * Triggered whenever user wants to upload a folder.\n * First of all we need to create all subfolders in folder\n * hierarchy for this submitted folder. As soon as all folders are created\n * we can start uploading these files into submitted folder and its subfolders.\n */\n\n public readonly uploadFolder = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.UPLOAD_FOLDER_START),\n switchMapTo(this.store.pipe(\n select(uploadFolderState),\n first(),\n )),\n concatMap(folderState => [\n new WaitUntilFolderStructureIsCreated(),\n new CreateFolderStructureStart({\n folders: folderState.folders,\n parentGuid: folderState.parentGuid,\n }),\n ]),\n ));\n\n /**\n * To create every single folder level in folder user wants to upload\n * and prepare folder structure before files are uploaded into these\n * sub folders\n */\n\n public readonly createFolderStructure = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.CREATE_FOLDER_STRUCTURE_START),\n mergeMap(action => {\n const xhrRequests: Observable[] = [];\n\n action.payload.folders.forEach(folder => {\n xhrRequests.push(this.mytitleServiceClient.createFolder({\n name: folder.folderName || Notifications.WithoutName,\n parent: action.payload.parentGuid,\n }).pipe(\n map(savedFolder => {\n const folderExt: FolderExt = {\n folderGuid: savedFolder.guid,\n parentFolderGuid: savedFolder.parent,\n folderName: savedFolder.name,\n childFolders: folder.childFolders,\n storeGuid: folder.storeGuid, // assign same store guid to saved folder to pair them\n };\n\n return folderExt;\n }),\n ));\n });\n\n return forkJoin(xhrRequests).pipe(\n map(results => new CreateFolderStructureSuccess(results)),\n this.errorHelperService.raiseError(),\n );\n }),\n ));\n\n /**\n * If created folder level has also children folders,\n * repeat whole process again for sub folders\n */\n\n public readonly handleFolderStructure = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.CREATE_FOLDER_STRUCTURE_SUCCESS),\n concatMap(action => {\n const createSubFolders: CreateFolderStructureStart[] = [];\n\n action.payload.forEach(folder => {\n if (folder.childFolders && folder.childFolders.length) {\n createSubFolders.push(new CreateFolderStructureStart({\n folders: folder.childFolders,\n parentGuid: folder.folderGuid,\n }));\n }\n });\n\n return [\n new UpdateFolderStructureBuffer(action.payload),\n ...createSubFolders,\n ];\n }),\n ));\n\n /**\n * Wait until whole folder structure is created,\n * then prepare files before uploading them\n */\n\n public readonly waitUntilFolderStructureIsReady = createEffect(() => this.storeActions.pipe(\n ofType\n (UploadFolderActions.WAIT_UNTIL_FOLDER_STRUCTURE_IS_READY),\n switchMapTo(this.store.pipe(\n select(areAllFoldersCreated),\n takeWhile(isFolderStructureReady => !isFolderStructureReady, true),\n filter(Boolean),\n )),\n map(() => new UploadFilesIntoFolderStart()),\n ));\n\n /**\n * File Upload buffer\n * Uploading all files and runs until all files are successfully uploaded\n * i.e. have their uploading status === 'success'. Also allows to upload\n * only 10 files at the time and allows to repeat uploading for files\n * which ended up in error status.\n */\n\n public readonly uploadFilesIntoFolders = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.UPLOAD_FILES_INTO_FOLDER_START),\n // Repeat this until all files are successfully uploaded\n switchMapTo(this.store.pipe(\n select(areAllFilesUploaded),\n takeWhile(allFilesUploaded => !allFilesUploaded, false))),\n // Trigger pipeline whenever number of files with waiting to upload status changes\n switchMapTo(this.store.pipe(\n select(filesInWaitingState),\n takeWhile(files => !!files, false))),\n // Allow to upload only 10 files at the time\n switchMap(files => this.store.pipe(\n select(numberOfCurrentlyUploadedFiles),\n first(),\n filter(filesUploading => filesUploading < 10),\n map(() => {\n const file = files.find(x => x.uploadingStatus === FileUploadingStatus.WAITING);\n return file as FileExt;\n }),\n )),\n filter(file => !!file),\n map(file => new UploadFolderFileStart(file)),\n ));\n\n /**\n * Uploads every file individually. Reports success/progress/error state.\n */\n\n public readonly uploadFileStart = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.UPLOAD_FOLDER_FILE_START),\n mergeMap(action => {\n const params: CreateDocumentParams = {\n file: action.payload,\n is_free: false,\n folder: action.payload.parentGuid ? action.payload.parentGuid : null,\n };\n\n return this.mytitleServiceClient\n .uploadFile(params)\n .pipe(\n map(event => {\n switch (event.type) {\n case HttpEventType.UploadProgress: {\n const percentDone = Math.round(100 * event.loaded / event.total);\n return new UploadFolderFileProgress({\n percentDone,\n storeGuid: action.payload.storeGuid,\n });\n }\n\n case HttpEventType.Response: {\n event.body.is_free = false;\n return new UploadFolderFileSuccess({\n file: event.body,\n storeGuid: action.payload.storeGuid,\n });\n }\n\n default: return null;\n }\n }),\n filter(response => !!response),\n catchError((error: HttpErrorResponse) => of(new UploadFolderFileError({\n error: error.status,\n storeGuid: action.payload.storeGuid,\n }))),\n );\n }),\n ));\n\n /**\n * As soon as all files are successfully uploaded, flow continues with\n * creating file orders.\n */\n\n public readonly waitUntilAllFilesAreUploaded = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.UPLOAD_FILES_INTO_FOLDER_START),\n switchMapTo(this.store.pipe(\n select(areAllFilesUploaded),\n takeWhile(allFilesUploaded => !allFilesUploaded, true),\n filter(Boolean))),\n mapTo(new UploadFilesIntoFolderSuccess()),\n ));\n\n /**\n * If user entered credentials, patch files with these credentials first\n * otherwise create file orders\n */\n\n public readonly decideWhereToStart = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.UPLOAD_FILES_INTO_FOLDER_SUCCESS),\n switchMapTo(this.store.pipe(\n select(getFolderCredentials),\n first(),\n map(credentials => Object.keys(credentials).length !== 0))),\n map(areCredentialsFilled => areCredentialsFilled ? new PatchFolderFiles() : new CreateFolderFileOrdersStart()),\n ));\n\n /**\n * Creating file orders for every uploaded file\n */\n\n public readonly createAllFileOrders = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.CREATE_FOLDER_FILE_ORDERS_START),\n switchMapTo(this.store.pipe(\n select(getAllUploadedFiles),\n first())),\n switchMap(uploadedFiles => {\n const params: FileOrderRequestParams = {\n order_items: [],\n };\n\n uploadedFiles.forEach(file => {\n params.order_items.push({\n is_free: file.is_free,\n document_guid: file.guid,\n });\n });\n\n return this.billingServiceClient\n .createFileOrder(params)\n .pipe(\n map(res => new CreateFolderFileOrdersSuccess(res)),\n this.errorHelperService.raiseError(),\n );\n }),\n ));\n\n /**\n * In case files have to be patched first, wait until all files\n * are patched, then start creating file orders\n */\n\n public readonly waitUntilAllFilesArePatched = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.PATCH_FOLDER_FILES),\n switchMapTo(this.store.pipe(\n select(allFilesPatched),\n takeWhile(patchingDone => !patchingDone, true),\n filter(Boolean))),\n mapTo(new CreateFolderFileOrdersStart()),\n ));\n\n /**\n * Patch every uploaded file with credentials provided by user\n */\n\n public readonly patchAllFiles = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.PATCH_FOLDER_FILES),\n switchMapTo(forkJoin([\n this.store.pipe(\n select(getAllUploadedFiles),\n first()),\n this.store.pipe(\n select(getFolderCredentials),\n first())])),\n concatMap(([uploadedFiles, credentials]) => {\n const patchFolderFileRequests: PatchFolderFileStart[] = [];\n\n uploadedFiles.forEach(file => {\n patchFolderFileRequests.push(new PatchFolderFileStart({\n guid: file.guid,\n params: credentials,\n }));\n });\n\n return patchFolderFileRequests;\n }),\n ));\n\n\n public readonly patchFolderFile = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.PATCH_FOLDER_FILE_START),\n map(action => action.payload),\n mergeMap(request => this.mytitleServiceClient\n .patchDocument(request.guid, request.params)\n .pipe(\n map(() => new PatchFolderFileSuccess()),\n this.errorHelperService.raiseError(),\n )),\n ));\n\n /**\n * Final action trigger as all folders are created, all files uploaded and all file orders created\n */\n\n public readonly allFileOrdersCreated = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.CREATE_FOLDER_FILE_ORDERS_SUCCESS),\n delay(1500),\n mapTo(new UploadFolderFinished()),\n ));\n\n /* Navigate user back to MyDocuments after folder is successfully uploaded with delay */\n\n public readonly redirectOnUploadFolderSuccess = createEffect(() => this.storeActions.pipe(\n ofType(UploadFolderActions.UPLOAD_FOLDER_FINISHED),\n delay(2500),\n switchMapTo(this.store.pipe(\n select(getParentFolderGuid),\n first())),\n tap(parentGuid => {\n if (parentGuid) {\n this.router.navigate(['/', AppRoutes.MyDocuments],\n { queryParams: { folder: parentGuid } });\n } else this.router.navigate(['/', AppRoutes.MyDocuments]);\n }),\n delay(1000),\n mergeMapTo([\n new UploadFolderReset(),\n new GetCreditBalance(),\n ]),\n ));\n\n constructor(\n private storeActions: Actions,\n private snackbarService: SnackbarService,\n private mytitleServiceClient: MytitleServiceClient,\n private billingServiceClient: BillingServiceClient,\n private errorHelperService: ErrorHelperService,\n private store: Store,\n private router: Router,\n ) {}\n}\n","import { CreditBundleChoiceEffects } from './effects/credit-bundle-choice.effects';\nimport { FileRoutingEffects } from './effects/file-routing.effects';\nimport { FileEffects } from './effects/file.effects';\nimport { CreditOrderEffects } from './effects/order-credit.effects';\nimport { FileOrderEffects } from './effects/order-file.effects';\nimport { PaymentEffects } from './effects/payment.effects';\nimport { RouterEffects } from './effects/router.effects';\nimport { UploadFolderEffects } from './effects/upload-folder.effects';\nimport { VoucherEffects } from './effects/voucher.effects';\n\nexport const appEffects = [\n CreditOrderEffects,\n FileEffects,\n FileRoutingEffects,\n PaymentEffects,\n FileOrderEffects,\n CreditBundleChoiceEffects,\n RouterEffects,\n UploadFolderEffects,\n VoucherEffects,\n];\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Injectable } from '@angular/core';\nimport { Actions, createEffect, ofType } from '@ngrx/effects';\nimport { of } from 'rxjs';\nimport { catchError, map, switchMap } from 'rxjs/operators';\nimport { BillingServiceClient } from 'src/app/client/services/billing-service.client';\nimport {\n ValidateVoucher,\n ValidateVoucherError,\n ValidateVoucherSuccess,\n VoucherActions,\n} from '../actions/voucher.actions';\n\n@Injectable()\nexport class VoucherEffects {\n\n\n public readonly validateVoucher = createEffect(() => this.storeActions.pipe(\n ofType(VoucherActions.VALIDATE_VOUCHER),\n switchMap(action => this.billingServiceClient.validateVoucher(action.payload)\n .pipe(\n map(result => new ValidateVoucherSuccess(result)),\n catchError((error: HttpErrorResponse) => of(new ValidateVoucherError(error.error))),\n ),\n ),\n ));\n\n constructor(\n private storeActions: Actions,\n private billingServiceClient: BillingServiceClient,\n ) {\n }\n}\n","import { Action } from '@ngrx/store';\nimport { CreditConfig } from 'src/app/client/models/credit.models';\nimport {\n CreditBundleChoiceAction,\n CreditBundleChoiceActions,\n} from '../actions/credit-bundle-choice.actions';\nimport {\n OrderCreditAction,\n OrderCreditActions,\n} from '../actions/order-credit.actions';\nimport {\n PaymentAction,\n PaymentActions,\n} from '../actions/payment.actions';\n\nexport interface CreditBundleChoiceState {\n bundles: CreditConfig[];\n isLoadingBundles: boolean;\n isCreatingOrder: boolean;\n hasPricingChanged: boolean;\n selectedBundle: string;\n isBundleAcademy: boolean;\n priceRange: string[];\n voucherCode: string;\n}\n\nexport const initialCreditBundleChoiceState: CreditBundleChoiceState = {\n bundles: null,\n isLoadingBundles: null,\n isCreatingOrder: null,\n hasPricingChanged: null,\n selectedBundle: null,\n isBundleAcademy: null,\n priceRange: null,\n voucherCode: null,\n};\n\nexport function creditBundleChoiceReducer(\n state = initialCreditBundleChoiceState,\n generic: Action): CreditBundleChoiceState {\n\n const action = generic as\n CreditBundleChoiceAction | OrderCreditAction | PaymentAction;\n\n switch (action.type) {\n case CreditBundleChoiceActions.GET_PRICE_RANGE_SUCCESS: {\n return {\n ...state,\n priceRange: action.payload,\n };\n }\n\n case CreditBundleChoiceActions.GET_CREDIT_BUNDLES: {\n return {\n ...state,\n isLoadingBundles: true,\n };\n }\n\n case CreditBundleChoiceActions.GET_CREDIT_BUNDLES_SUCCESS: {\n return {\n ...state,\n isLoadingBundles: false,\n bundles: action.payload.results,\n };\n }\n\n case CreditBundleChoiceActions.GET_CREDIT_ORDER_SUMMARY: {\n return {\n ...state,\n selectedBundle: action.payload.config_guid,\n };\n }\n\n case CreditBundleChoiceActions.USER_PRICING_CHANGED: {\n return {\n ...state,\n hasPricingChanged: true,\n };\n }\n\n case CreditBundleChoiceActions.REPEAT_CREDIT_CHOICE: {\n return {\n ...state,\n isCreatingOrder: false,\n };\n }\n\n case OrderCreditActions.QUEUE_CREDIT_ORDER:\n case OrderCreditActions.CREATE_CREDIT_ORDER: {\n return {\n ...state,\n isCreatingOrder: true,\n hasPricingChanged: false,\n voucherCode: action.payload.voucher_code,\n isBundleAcademy: action.payload.is_academy,\n };\n }\n\n case PaymentActions.CREATE_PAYMENT_SUCCESS: {\n return {\n ...state,\n isCreatingOrder: true,\n };\n }\n case PaymentActions.CREATE_PAYMENT_ERROR: {\n return {\n ...state,\n isCreatingOrder: false,\n };\n }\n }\n\n return state;\n}\n","import { Action } from '@ngrx/store';\nimport {\n ChangeDocumentAction,\n DeleteDocumentsAction,\n DeleteDocumentsActions,\n LoadDocumentsActions,\n} from 'src/app/pages/my-documents/store/actions/my-documents.actions';\nimport { FileAction, FileActions } from '../actions/file.action';\nimport { FileState } from '../models/file.models';\n\nexport const initialState: FileState = {\n file: null,\n folder: null,\n document: null,\n isFileUploading: false,\n canBePatched: false,\n percentUploaded: 0,\n fileError: null,\n isFileUpgrading: false,\n /** Indicates that document should be signed as free */\n is_free: false,\n upgradingDocument: null,\n fileParentGuid: null,\n\n documentsBeingDeleting: false,\n documentsToDelete: null,\n finishingDocumentsDeleting: false,\n deletedDocuments: null,\n error: null,\n};\n\nexport function fileReducer(state: FileState = initialState, genericAction: Action): FileState {\n\n const action = genericAction as FileAction | ChangeDocumentAction | DeleteDocumentsAction;\n\n switch (action.type) {\n\n case LoadDocumentsActions.UPDATE_MY_DOCUMENTS: {\n return {\n ...state,\n fileParentGuid: action.payload.folderGuid,\n };\n }\n\n case FileActions.FILE_UPDATED:\n return {\n ...state,\n file: action.payload.file,\n folder: action.payload.folder,\n is_free: action.payload.is_free,\n // reset document if there was one already\n document: null,\n };\n\n case FileActions.ADDRESS_UPDATED:\n return { ...state, document: { ...state.document, address: action.payload } };\n\n case FileActions.ID_CARD_UPDATED:\n return { ...state, document: { ...state.document, id_card: action.payload } };\n\n case FileActions.FILE_UPLOAD_START:\n return {\n ...state, isFileUploading: true, is_free: action.payload.is_free, percentUploaded: 0,\n };\n\n case FileActions.FILE_UPLOAD_PROGRESS:\n return { ...state, percentUploaded: action.payload.percentDone };\n\n case FileActions.FILE_UPLOAD_SUCCESS:\n return {\n ...state,\n document: action.payload,\n is_free: action.payload.is_free,\n isFileUploading: false,\n canBePatched: true,\n };\n\n case FileActions.FILE_UPGRADE:\n return {\n ...state,\n upgradingDocument: action.payload,\n isFileUpgrading: true,\n };\n\n case FileActions.FILE_UPLOAD_ERROR:\n return { ...state, fileError: action.payload, isFileUploading: false };\n\n case FileActions.SELECT_DOCUMENT_PRICE:\n return { ...state, ...action.payload };\n\n case FileActions.CLEAR_FILE_STATE:\n return { ...initialState };\n\n case (DeleteDocumentsActions.CREATE_DELETION_DOCUMENTS_START):\n return {\n ...state,\n documentsBeingDeleting: true,\n documentsToDelete: action.payload,\n };\n\n case (DeleteDocumentsActions.CREATE_DELETION_DOCUMENTS_SUCCESS):\n return {\n ...state,\n documentsBeingDeleting: false,\n };\n\n case (DeleteDocumentsActions.CREATE_DELETION_DOCUMENTS_ERROR):\n return {\n ...state,\n documentsBeingDeleting: false,\n };\n\n case (DeleteDocumentsActions.FINISH_DELETION_DOCUMENTS_START):\n return {\n ...state,\n finishingDocumentsDeleting: true,\n };\n\n case (DeleteDocumentsActions.FINISH_DELETION_DOCUMENTS_SUCCESS):\n return {\n ...state,\n finishingDocumentsDeleting: false,\n deletedDocuments: action.payload,\n error: null,\n };\n\n case (FileActions.PATCH_DOCUMENT_ERROR):\n return { ...state, isFileUploading: false, fileError: action.payload };\n\n case (DeleteDocumentsActions.FINISH_DELETION_DOCUMENTS_ERROR):\n return { ...state, finishingDocumentsDeleting: false, error: action.payload };\n\n default:\n return state;\n }\n}\n","import { HttpErrorResponse } from '@angular/common/http';\nimport { Action, createFeatureSelector } from '@ngrx/store';\nimport { GopayPaymentCreated } from '../../../client/models/gopay.models';\nimport { PaymentAction, PaymentActions } from '../actions/payment.actions';\n\nexport interface PaymentState {\n gopay: GopayPaymentCreated;\n paymentLoading: boolean;\n paymentError: HttpErrorResponse;\n}\n\nexport const initialPaymentState: PaymentState = {\n gopay: null,\n paymentLoading: false,\n paymentError: null,\n};\n\nexport const paymentSelectorName = 'payment';\nexport const getPaymentStateSelector = createFeatureSelector(\n paymentSelectorName);\n\nexport function paymentReducer(\n state: PaymentState = initialPaymentState,\n generic: Action,\n): PaymentState {\n const action = generic as PaymentAction;\n switch (action.type) {\n case PaymentActions.CREATE_PAYMENT_START:\n return {\n ...state,\n paymentLoading: true,\n gopay: null,\n };\n case PaymentActions.CREATE_PAYMENT_SUCCESS:\n return {\n ...state,\n gopay: action.payload.gopay,\n paymentLoading: false,\n };\n case PaymentActions.CREATE_PAYMENT_ERROR:\n return {\n ...state,\n paymentError: action.payload,\n gopay: null,\n paymentLoading: false,\n };\n default:\n return state;\n }\n}\n","import { Action } from '@ngrx/store';\nimport { VoucherError } from 'src/app/client/models/credit.models';\nimport { VoucherAction, VoucherActions } from '../actions/voucher.actions';\n\nexport interface VoucherState {\n isValidating: boolean;\n discount_percentage: number;\n voucherError: VoucherError;\n hasVoucherError: boolean;\n code: string;\n}\n\nexport const initialVoucherState: VoucherState = {\n isValidating: false,\n discount_percentage: null,\n code: null,\n voucherError: null,\n hasVoucherError: false,\n};\n\nexport function voucherReducer(\n state = initialVoucherState,\n generic: Action): VoucherState {\n\n const action = generic as VoucherAction;\n\n switch (action.type) {\n case VoucherActions.VALIDATE_VOUCHER: {\n return {\n ...state,\n isValidating: true,\n code: action.payload.code,\n };\n }\n case VoucherActions.VALIDATE_VOUCHER_SUCCESS: {\n return {\n ...state,\n isValidating: false,\n discount_percentage: action.payload.discount_percentage,\n };\n }\n case VoucherActions.VALIDATE_VOUCHER_ERROR: {\n return {\n ...state,\n isValidating: false,\n voucherError: action.payload,\n hasVoucherError: true,\n };\n }\n case VoucherActions.CLEAR_VOUCHER: {\n return {\n ...initialVoucherState,\n };\n }\n }\n\n return state;\n}\n","import { routerReducer } from '@ngrx/router-store';\nimport { ActionReducerMap, MetaReducer } from '@ngrx/store';\nimport { importSsrStateMetaReducer,\n} from '../../shared/universal/transfer-state/browser-import-state/import.reducers';\nimport { validateStateReducer } from '../../shared/universal/validate-state/validate-state.reducer';\nimport { AppState } from './models/app.models';\nimport { creditBundleChoiceReducer } from './reducers/credit-bundle-choice.reducer';\nimport * as file from './reducers/file.reducers';\nimport { layoutReducer } from './reducers/layout.reducers';\nimport { fileOrderReducer } from './reducers/order-file.reducers';\nimport { paymentReducer } from './reducers/payment.reducers';\nimport { uploadFolderStateReducer } from './reducers/upload-folder.reducer';\nimport { voucherReducer } from './reducers/voucher.reducer';\n\nexport const appReducers: ActionReducerMap = {\n layout: layoutReducer,\n file: file.fileReducer,\n router: routerReducer,\n creditBundle: creditBundleChoiceReducer,\n fileOrder: fileOrderReducer,\n payment: paymentReducer,\n uploadFolder: uploadFolderStateReducer,\n voucher: voucherReducer,\n};\n\n// eslint-disable-next-line @typescript-eslint/array-type\nexport const metaReducers: MetaReducer[] = [\n // actionLoggerReducer,\n importSsrStateMetaReducer,\n validateStateReducer,\n];\n","import { Action, ActionReducer } from '@ngrx/store';\nimport { AppState } from '../../../../app/states/models/app.models';\nimport { ImportAction, ImportActions } from './import.actions';\n\n// eslint-disable-next-line max-len\nexport function importSsrStateMetaReducer(reducer: ActionReducer): ActionReducer {\n return (state: AppState, generic: Action): AppState => {\n const action = generic as ImportAction;\n\n switch (action.type) {\n case ImportActions.IMPORT_SSR_STATE:\n return action.payload ? { ...action.payload } : reducer(state, action);\n default:\n return reducer(state, action);\n }\n };\n}\n","import { ActionReducer } from '@ngrx/store';\nimport { AppState } from '../../../app/states/models/app.models';\n\n/**\n * Validates state and action payload whether it can be stringified.\n * In order to successfully transfer state from server to browser JSON.stringify(state) must work.\n */\nexport function validateStateReducer(reducer: ActionReducer): ActionReducer {\n return (state: AppState, action: any): AppState => {\n try {\n JSON.stringify(state);\n } catch (err) {\n throw new Error('Unable to stringify state.');\n }\n\n if (action.payload) {\n try {\n JSON.stringify(action.payload);\n } catch (err) {\n throw new Error(`Unable to stringify payload of action '${action.type}'.`);\n }\n }\n\n return reducer(state, action);\n };\n}\n","import { ActivatedRouteSnapshot, RouterStateSnapshot } from '@angular/router';\nimport { RouterStateSerializer } from '@ngrx/router-store';\nimport { RouterStateUrl } from './models/app.models';\n\nexport class RouterSerializer implements RouterStateSerializer {\n public serialize(routerState: RouterStateSnapshot): RouterStateUrl {\n const { url } = routerState;\n\n let state: ActivatedRouteSnapshot = routerState.root;\n\n while (state.firstChild) state = state.firstChild;\n\n const { params } = state;\n const { queryParams } = state;\n const { component } = state;\n\n return {\n url,\n component,\n queryParams,\n params,\n };\n }\n}\n","import { CommonModule, registerLocaleData } from '@angular/common';\r\nimport { HttpClientModule } from '@angular/common/http';\r\nimport localeCs from '@angular/common/locales/cs';\r\nimport { ErrorHandler, NgModule } from '@angular/core';\r\nimport { BrowserModule } from '@angular/platform-browser';\r\nimport { RouterModule } from '@angular/router';\r\n\r\nimport { EffectsModule } from '@ngrx/effects';\r\nimport { RouterState, StoreRouterConnectingModule } from '@ngrx/router-store';\r\nimport { StoreModule } from '@ngrx/store';\r\nimport { StoreDevtoolsModule } from '@ngrx/store-devtools';\r\n\r\nimport { GopayPaymentService, GOPAY_PAYMENT_COUNTRIES } from 'src/app/app/services/gopay-payment.service';\r\nimport { FooterModule } from 'src/app/partials/footer/footer.module';\r\nimport * as Sentry from '@sentry/angular-ivy';\r\nimport { environment } from '../../environments/environment';\r\nimport { AuthModule } from '../auth/auth.module';\r\nimport {\r\n ConfirmationDialogModule,\r\n} from '../partials/confirmation-dialog/confirmation-dialog.module';\r\nimport { VideoDialogModule } from '../partials/video-dialog/video-dialog.module';\r\nimport { NavbarModule } from '../partials/navbar/navbar.module';\r\nimport { AppComponent } from './app.component';\r\nimport { appRoutes } from './app.routes';\r\nimport {\r\n ConfirmationCodeDirective,\r\n} from './directives/confirmation-code.directive';\r\nimport { ScrollModule } from './directives/scroll/scroll.module';\r\nimport { HomeModule } from './home/home.module';\r\nimport { appEffects } from './states/app.effects';\r\nimport { appReducers, metaReducers } from './states/app.reducers';\r\nimport { RouterSerializer } from './states/router.serializer';\r\n\r\n\r\nregisterLocaleData(localeCs, 'cs');\r\n\r\n// avoid logging errors on localhost and SSR\r\nif (typeof window !== 'undefined' && location.hostname.includes('mytitle.com')) {\r\n Sentry.init({\r\n dsn: 'https://e5ca0119bee145fa8a750d73c9dd9e0b@o222939.ingest.sentry.io/1425188',\r\n environment: environment.production ? 'production' : 'dev',\r\n release: environment.version,\r\n });\r\n}\r\n\r\n@NgModule({\r\n declarations: [\r\n AppComponent,\r\n ConfirmationCodeDirective,\r\n ],\r\n imports: [\r\n CommonModule,\r\n HttpClientModule,\r\n BrowserModule.withServerTransition({appId: 'serverApp'}),\r\n AuthModule,\r\n HomeModule,\r\n NavbarModule,\r\n FooterModule,\r\n ConfirmationDialogModule,\r\n VideoDialogModule,\r\n ScrollModule,\r\n RouterModule.forRoot(appRoutes, {\r\n initialNavigation: 'enabledBlocking',\r\n anchorScrolling: 'enabled',\r\n scrollOffset: [0, 100],\r\n }),\r\n StoreModule.forRoot(appReducers, {\r\n metaReducers,\r\n runtimeChecks: {\r\n strictStateImmutability: false,\r\n strictActionImmutability: false,\r\n strictStateSerializability: false,\r\n strictActionSerializability: false,\r\n },\r\n }),\r\n StoreRouterConnectingModule.forRoot({\r\n serializer: RouterSerializer,\r\n routerState: RouterState.Minimal,\r\n }),\r\n EffectsModule.forRoot(appEffects),\r\n !environment.production ? StoreDevtoolsModule.instrument({maxAge: 25}) : [],\r\n ],\r\n providers: [\r\n environment.production ? {\r\n provide: ErrorHandler,\r\n useValue: Sentry.createErrorHandler({\r\n showDialog: false,\r\n }),\r\n } : [],\r\n GOPAY_PAYMENT_COUNTRIES.includes(environment.language) ? GopayPaymentService : [],\r\n ],\r\n bootstrap: [AppComponent],\r\n})\r\nexport class AppModule {\r\n}\r\n","import { logger } from '@sentry/utils';\nimport { getCurrentHub } from './hub.js';\n\n/** A class object that can instantiate Client objects. */\n\n/**\n * Internal function to create a new SDK client instance. The client is\n * installed and then bound to the current scope.\n *\n * @param clientClass The client class to instantiate.\n * @param options Options to pass to the client.\n */\nfunction initAndBind(\n clientClass,\n options,\n) {\n if (options.debug === true) {\n if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {\n logger.enable();\n } else {\n // use `console.warn` rather than `logger.warn` since by non-debug bundles have all `logger.x` statements stripped\n // eslint-disable-next-line no-console\n console.warn('[Sentry] Cannot initialize SDK with `debug` option using a non-debug bundle.');\n }\n }\n const hub = getCurrentHub();\n const scope = hub.getScope();\n scope.update(options.initialScope);\n\n const client = new clientClass(options);\n hub.bindClient(client);\n}\n\nexport { initAndBind };\n","import { NgModule } from '@angular/core';\nimport { BrowserTransferStateModule } from '@angular/platform-browser';\nimport { BrowserImportSsrStateModule,\n} from '../shared/universal/transfer-state/browser-import-state/browser-import-ssr-state.module';\nimport { AppComponent } from './app.component';\nimport { AppModule } from './app.module';\n\n@NgModule({\n imports: [\n AppModule,\n BrowserTransferStateModule,\n BrowserImportSsrStateModule,\n ],\n bootstrap: [AppComponent],\n})\nexport class AppBrowserModule {\n}\n","/// \n\nimport { enableProdMode } from '@angular/core';\nimport { platformBrowserDynamic } from '@angular/platform-browser-dynamic';\nimport 'zone.js';\nimport { AppBrowserModule } from './app/app/app.browser.module';\nimport { environment } from './environments/environment';\n\nif (environment.production) {\n enableProdMode();\n}\n\nconst bootstrap = () => platformBrowserDynamic().bootstrapModule(AppBrowserModule);\n\ndocument.addEventListener('DOMContentLoaded', bootstrap);\n\n","const DEFAULT_ENVIRONMENT = 'production';\n\nexport { DEFAULT_ENVIRONMENT };\n","import { logger, uuid4 } from '@sentry/utils';\nimport { getCurrentHub } from './hub.js';\n\n// Note: All functions in this file are typed with a return value of `ReturnType`,\n// where HUB_FUNCTION is some method on the Hub class.\n//\n// This is done to make sure the top level SDK methods stay in sync with the hub methods.\n// Although every method here has an explicit return type, some of them (that map to void returns) do not\n// contain `return` keywords. This is done to save on bundle size, as `return` is not minifiable.\n\n/**\n * Captures an exception event and sends it to Sentry.\n *\n * @param exception An exception-like object.\n * @param captureContext Additional scope data to apply to exception event.\n * @returns The generated eventId.\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/explicit-module-boundary-types\nfunction captureException(exception, captureContext) {\n return getCurrentHub().captureException(exception, { captureContext });\n}\n\n/**\n * Captures a message event and sends it to Sentry.\n *\n * @param message The message to send to Sentry.\n * @param Severity Define the level of the message.\n * @returns The generated eventId.\n */\nfunction captureMessage(\n message,\n // eslint-disable-next-line deprecation/deprecation\n captureContext,\n) {\n // This is necessary to provide explicit scopes upgrade, without changing the original\n // arity of the `captureMessage(message, level)` method.\n const level = typeof captureContext === 'string' ? captureContext : undefined;\n const context = typeof captureContext !== 'string' ? { captureContext } : undefined;\n return getCurrentHub().captureMessage(message, level, context);\n}\n\n/**\n * Captures a manually created event and sends it to Sentry.\n *\n * @param event The event to send to Sentry.\n * @returns The generated eventId.\n */\nfunction captureEvent(event, hint) {\n return getCurrentHub().captureEvent(event, hint);\n}\n\n/**\n * Callback to set context information onto the scope.\n * @param callback Callback function that receives Scope.\n */\nfunction configureScope(callback) {\n getCurrentHub().configureScope(callback);\n}\n\n/**\n * Records a new breadcrumb which will be attached to future events.\n *\n * Breadcrumbs will be added to subsequent events to provide more context on\n * user's actions prior to an error or crash.\n *\n * @param breadcrumb The breadcrumb to record.\n */\nfunction addBreadcrumb(breadcrumb) {\n getCurrentHub().addBreadcrumb(breadcrumb);\n}\n\n/**\n * Sets context data with the given name.\n * @param name of the context\n * @param context Any kind of data. This data will be normalized.\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction setContext(name, context) {\n getCurrentHub().setContext(name, context);\n}\n\n/**\n * Set an object that will be merged sent as extra data with the event.\n * @param extras Extras object to merge into current context.\n */\nfunction setExtras(extras) {\n getCurrentHub().setExtras(extras);\n}\n\n/**\n * Set key:value that will be sent as extra data with the event.\n * @param key String of extra\n * @param extra Any kind of data. This data will be normalized.\n */\nfunction setExtra(key, extra) {\n getCurrentHub().setExtra(key, extra);\n}\n\n/**\n * Set an object that will be merged sent as tags data with the event.\n * @param tags Tags context object to merge into current context.\n */\nfunction setTags(tags) {\n getCurrentHub().setTags(tags);\n}\n\n/**\n * Set key:value that will be sent as tags data with the event.\n *\n * Can also be used to unset a tag, by passing `undefined`.\n *\n * @param key String key of tag\n * @param value Value of tag\n */\nfunction setTag(key, value) {\n getCurrentHub().setTag(key, value);\n}\n\n/**\n * Updates user context information for future events.\n *\n * @param user User context object to be set in the current context. Pass `null` to unset the user.\n */\nfunction setUser(user) {\n getCurrentHub().setUser(user);\n}\n\n/**\n * Creates a new scope with and executes the given operation within.\n * The scope is automatically removed once the operation\n * finishes or throws.\n *\n * This is essentially a convenience function for:\n *\n * pushScope();\n * callback();\n * popScope();\n *\n * @param callback that will be enclosed into push/popScope.\n */\nfunction withScope(callback) {\n getCurrentHub().withScope(callback);\n}\n\n/**\n * Starts a new `Transaction` and returns it. This is the entry point to manual tracing instrumentation.\n *\n * A tree structure can be built by adding child spans to the transaction, and child spans to other spans. To start a\n * new child span within the transaction or any span, call the respective `.startChild()` method.\n *\n * Every child span must be finished before the transaction is finished, otherwise the unfinished spans are discarded.\n *\n * The transaction must be finished with a call to its `.finish()` method, at which point the transaction with all its\n * finished child spans will be sent to Sentry.\n *\n * NOTE: This function should only be used for *manual* instrumentation. Auto-instrumentation should call\n * `startTransaction` directly on the hub.\n *\n * @param context Properties of the new `Transaction`.\n * @param customSamplingContext Information given to the transaction sampling function (along with context-dependent\n * default values). See {@link Options.tracesSampler}.\n *\n * @returns The transaction which was just started\n */\nfunction startTransaction(\n context,\n customSamplingContext,\n) {\n return getCurrentHub().startTransaction({ ...context }, customSamplingContext);\n}\n\n/**\n * Create a cron monitor check in and send it to Sentry.\n *\n * @param checkIn An object that describes a check in.\n * @param upsertMonitorConfig An optional object that describes a monitor config. Use this if you want\n * to create a monitor automatically when sending a check in.\n */\nfunction captureCheckIn(checkIn, upsertMonitorConfig) {\n const hub = getCurrentHub();\n const scope = hub.getScope();\n const client = hub.getClient();\n if (!client) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Cannot capture check-in. No client defined.');\n } else if (!client.captureCheckIn) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Cannot capture check-in. Client does not support sending check-ins.');\n } else {\n return client.captureCheckIn(checkIn, upsertMonitorConfig, scope);\n }\n\n return uuid4();\n}\n\n/**\n * Call `flush()` on the current client, if there is one. See {@link Client.flush}.\n *\n * @param timeout Maximum time in ms the client should wait to flush its event queue. Omitting this parameter will cause\n * the client to wait until all events are sent before resolving the promise.\n * @returns A promise which resolves to `true` if the queue successfully drains before the timeout, or `false` if it\n * doesn't (or if there's no client defined).\n */\nasync function flush(timeout) {\n const client = getCurrentHub().getClient();\n if (client) {\n return client.flush(timeout);\n }\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Cannot flush events. No client defined.');\n return Promise.resolve(false);\n}\n\n/**\n * Call `close()` on the current client, if there is one. See {@link Client.close}.\n *\n * @param timeout Maximum time in ms the client should wait to flush its event queue before shutting down. Omitting this\n * parameter will cause the client to wait until all events are sent before disabling itself.\n * @returns A promise which resolves to `true` if the queue successfully drains before the timeout, or `false` if it\n * doesn't (or if there's no client defined).\n */\nasync function close(timeout) {\n const client = getCurrentHub().getClient();\n if (client) {\n return client.close(timeout);\n }\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Cannot flush events and disable SDK. No client defined.');\n return Promise.resolve(false);\n}\n\n/**\n * This is the getter for lastEventId.\n *\n * @returns The last event id of a captured event.\n */\nfunction lastEventId() {\n return getCurrentHub().lastEventId();\n}\n\nexport { addBreadcrumb, captureCheckIn, captureEvent, captureException, captureMessage, close, configureScope, flush, lastEventId, setContext, setExtra, setExtras, setTag, setTags, setUser, startTransaction, withScope };\n","import { uuid4, dateTimestampInSeconds, consoleSandbox, logger, GLOBAL_OBJ, getGlobalSingleton } from '@sentry/utils';\nimport { DEFAULT_ENVIRONMENT } from './constants.js';\nimport { Scope } from './scope.js';\nimport { closeSession, makeSession, updateSession } from './session.js';\n\n/**\n * API compatibility version of this hub.\n *\n * WARNING: This number should only be increased when the global interface\n * changes and new methods are introduced.\n *\n * @hidden\n */\nconst API_VERSION = 4;\n\n/**\n * Default maximum number of breadcrumbs added to an event. Can be overwritten\n * with {@link Options.maxBreadcrumbs}.\n */\nconst DEFAULT_BREADCRUMBS = 100;\n\n/**\n * @inheritDoc\n */\nclass Hub {\n /** Is a {@link Layer}[] containing the client and scope */\n\n /** Contains the last event id of a captured event. */\n\n /**\n * Creates a new instance of the hub, will push one {@link Layer} into the\n * internal stack on creation.\n *\n * @param client bound to the hub.\n * @param scope bound to the hub.\n * @param version number, higher number means higher priority.\n */\n constructor(client, scope = new Scope(), _version = API_VERSION) {this._version = _version;\n this._stack = [{ scope }];\n if (client) {\n this.bindClient(client);\n }\n }\n\n /**\n * @inheritDoc\n */\n isOlderThan(version) {\n return this._version < version;\n }\n\n /**\n * @inheritDoc\n */\n bindClient(client) {\n const top = this.getStackTop();\n top.client = client;\n if (client && client.setupIntegrations) {\n client.setupIntegrations();\n }\n }\n\n /**\n * @inheritDoc\n */\n pushScope() {\n // We want to clone the content of prev scope\n const scope = Scope.clone(this.getScope());\n this.getStack().push({\n client: this.getClient(),\n scope,\n });\n return scope;\n }\n\n /**\n * @inheritDoc\n */\n popScope() {\n if (this.getStack().length <= 1) return false;\n return !!this.getStack().pop();\n }\n\n /**\n * @inheritDoc\n */\n withScope(callback) {\n const scope = this.pushScope();\n try {\n callback(scope);\n } finally {\n this.popScope();\n }\n }\n\n /**\n * @inheritDoc\n */\n getClient() {\n return this.getStackTop().client ;\n }\n\n /** Returns the scope of the top stack. */\n getScope() {\n return this.getStackTop().scope;\n }\n\n /** Returns the scope stack for domains or the process. */\n getStack() {\n return this._stack;\n }\n\n /** Returns the topmost scope layer in the order domain > local > process. */\n getStackTop() {\n return this._stack[this._stack.length - 1];\n }\n\n /**\n * @inheritDoc\n */\n captureException(exception, hint) {\n const eventId = (this._lastEventId = hint && hint.event_id ? hint.event_id : uuid4());\n const syntheticException = new Error('Sentry syntheticException');\n this._withClient((client, scope) => {\n client.captureException(\n exception,\n {\n originalException: exception,\n syntheticException,\n ...hint,\n event_id: eventId,\n },\n scope,\n );\n });\n return eventId;\n }\n\n /**\n * @inheritDoc\n */\n captureMessage(\n message,\n // eslint-disable-next-line deprecation/deprecation\n level,\n hint,\n ) {\n const eventId = (this._lastEventId = hint && hint.event_id ? hint.event_id : uuid4());\n const syntheticException = new Error(message);\n this._withClient((client, scope) => {\n client.captureMessage(\n message,\n level,\n {\n originalException: message,\n syntheticException,\n ...hint,\n event_id: eventId,\n },\n scope,\n );\n });\n return eventId;\n }\n\n /**\n * @inheritDoc\n */\n captureEvent(event, hint) {\n const eventId = hint && hint.event_id ? hint.event_id : uuid4();\n if (!event.type) {\n this._lastEventId = eventId;\n }\n\n this._withClient((client, scope) => {\n client.captureEvent(event, { ...hint, event_id: eventId }, scope);\n });\n return eventId;\n }\n\n /**\n * @inheritDoc\n */\n lastEventId() {\n return this._lastEventId;\n }\n\n /**\n * @inheritDoc\n */\n addBreadcrumb(breadcrumb, hint) {\n const { scope, client } = this.getStackTop();\n\n if (!client) return;\n\n const { beforeBreadcrumb = null, maxBreadcrumbs = DEFAULT_BREADCRUMBS } =\n (client.getOptions && client.getOptions()) || {};\n\n if (maxBreadcrumbs <= 0) return;\n\n const timestamp = dateTimestampInSeconds();\n const mergedBreadcrumb = { timestamp, ...breadcrumb };\n const finalBreadcrumb = beforeBreadcrumb\n ? (consoleSandbox(() => beforeBreadcrumb(mergedBreadcrumb, hint)) )\n : mergedBreadcrumb;\n\n if (finalBreadcrumb === null) return;\n\n if (client.emit) {\n client.emit('beforeAddBreadcrumb', finalBreadcrumb, hint);\n }\n\n scope.addBreadcrumb(finalBreadcrumb, maxBreadcrumbs);\n }\n\n /**\n * @inheritDoc\n */\n setUser(user) {\n this.getScope().setUser(user);\n }\n\n /**\n * @inheritDoc\n */\n setTags(tags) {\n this.getScope().setTags(tags);\n }\n\n /**\n * @inheritDoc\n */\n setExtras(extras) {\n this.getScope().setExtras(extras);\n }\n\n /**\n * @inheritDoc\n */\n setTag(key, value) {\n this.getScope().setTag(key, value);\n }\n\n /**\n * @inheritDoc\n */\n setExtra(key, extra) {\n this.getScope().setExtra(key, extra);\n }\n\n /**\n * @inheritDoc\n */\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n setContext(name, context) {\n this.getScope().setContext(name, context);\n }\n\n /**\n * @inheritDoc\n */\n configureScope(callback) {\n const { scope, client } = this.getStackTop();\n if (client) {\n callback(scope);\n }\n }\n\n /**\n * @inheritDoc\n */\n run(callback) {\n const oldHub = makeMain(this);\n try {\n callback(this);\n } finally {\n makeMain(oldHub);\n }\n }\n\n /**\n * @inheritDoc\n */\n getIntegration(integration) {\n const client = this.getClient();\n if (!client) return null;\n try {\n return client.getIntegration(integration);\n } catch (_oO) {\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn(`Cannot retrieve integration ${integration.id} from the current Hub`);\n return null;\n }\n }\n\n /**\n * @inheritDoc\n */\n startTransaction(context, customSamplingContext) {\n const result = this._callExtensionMethod('startTransaction', context, customSamplingContext);\n\n if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && !result) {\n // eslint-disable-next-line no-console\n console.warn(`Tracing extension 'startTransaction' has not been added. Call 'addTracingExtensions' before calling 'init':\nSentry.addTracingExtensions();\nSentry.init({...});\n`);\n }\n\n return result;\n }\n\n /**\n * @inheritDoc\n */\n traceHeaders() {\n return this._callExtensionMethod('traceHeaders');\n }\n\n /**\n * @inheritDoc\n */\n captureSession(endSession = false) {\n // both send the update and pull the session from the scope\n if (endSession) {\n return this.endSession();\n }\n\n // only send the update\n this._sendSessionUpdate();\n }\n\n /**\n * @inheritDoc\n */\n endSession() {\n const layer = this.getStackTop();\n const scope = layer.scope;\n const session = scope.getSession();\n if (session) {\n closeSession(session);\n }\n this._sendSessionUpdate();\n\n // the session is over; take it off of the scope\n scope.setSession();\n }\n\n /**\n * @inheritDoc\n */\n startSession(context) {\n const { scope, client } = this.getStackTop();\n const { release, environment = DEFAULT_ENVIRONMENT } = (client && client.getOptions()) || {};\n\n // Will fetch userAgent if called from browser sdk\n const { userAgent } = GLOBAL_OBJ.navigator || {};\n\n const session = makeSession({\n release,\n environment,\n user: scope.getUser(),\n ...(userAgent && { userAgent }),\n ...context,\n });\n\n // End existing session if there's one\n const currentSession = scope.getSession && scope.getSession();\n if (currentSession && currentSession.status === 'ok') {\n updateSession(currentSession, { status: 'exited' });\n }\n this.endSession();\n\n // Afterwards we set the new session on the scope\n scope.setSession(session);\n\n return session;\n }\n\n /**\n * Returns if default PII should be sent to Sentry and propagated in ourgoing requests\n * when Tracing is used.\n */\n shouldSendDefaultPii() {\n const client = this.getClient();\n const options = client && client.getOptions();\n return Boolean(options && options.sendDefaultPii);\n }\n\n /**\n * Sends the current Session on the scope\n */\n _sendSessionUpdate() {\n const { scope, client } = this.getStackTop();\n\n const session = scope.getSession();\n if (session && client && client.captureSession) {\n client.captureSession(session);\n }\n }\n\n /**\n * Internal helper function to call a method on the top client if it exists.\n *\n * @param method The method to call on the client.\n * @param args Arguments to pass to the client function.\n */\n _withClient(callback) {\n const { scope, client } = this.getStackTop();\n if (client) {\n callback(client, scope);\n }\n }\n\n /**\n * Calls global extension method and binding current instance to the function call\n */\n // @ts-ignore Function lacks ending return statement and return type does not include 'undefined'. ts(2366)\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n _callExtensionMethod(method, ...args) {\n const carrier = getMainCarrier();\n const sentry = carrier.__SENTRY__;\n if (sentry && sentry.extensions && typeof sentry.extensions[method] === 'function') {\n return sentry.extensions[method].apply(this, args);\n }\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn(`Extension method ${method} couldn't be found, doing nothing.`);\n }\n}\n\n/**\n * Returns the global shim registry.\n *\n * FIXME: This function is problematic, because despite always returning a valid Carrier,\n * it has an optional `__SENTRY__` property, which then in turn requires us to always perform an unnecessary check\n * at the call-site. We always access the carrier through this function, so we can guarantee that `__SENTRY__` is there.\n **/\nfunction getMainCarrier() {\n GLOBAL_OBJ.__SENTRY__ = GLOBAL_OBJ.__SENTRY__ || {\n extensions: {},\n hub: undefined,\n };\n return GLOBAL_OBJ;\n}\n\n/**\n * Replaces the current main hub with the passed one on the global object\n *\n * @returns The old replaced hub\n */\nfunction makeMain(hub) {\n const registry = getMainCarrier();\n const oldHub = getHubFromCarrier(registry);\n setHubOnCarrier(registry, hub);\n return oldHub;\n}\n\n/**\n * Returns the default hub instance.\n *\n * If a hub is already registered in the global carrier but this module\n * contains a more recent version, it replaces the registered version.\n * Otherwise, the currently registered hub will be returned.\n */\nfunction getCurrentHub() {\n // Get main carrier (global for every environment)\n const registry = getMainCarrier();\n\n if (registry.__SENTRY__ && registry.__SENTRY__.acs) {\n const hub = registry.__SENTRY__.acs.getCurrentHub();\n\n if (hub) {\n return hub;\n }\n }\n\n // Return hub that lives on a global object\n return getGlobalHub(registry);\n}\n\nfunction getGlobalHub(registry = getMainCarrier()) {\n // If there's no hub, or its an old API, assign a new one\n if (!hasHubOnCarrier(registry) || getHubFromCarrier(registry).isOlderThan(API_VERSION)) {\n setHubOnCarrier(registry, new Hub());\n }\n\n // Return hub that lives on a global object\n return getHubFromCarrier(registry);\n}\n\n/**\n * @private Private API with no semver guarantees!\n *\n * If the carrier does not contain a hub, a new hub is created with the global hub client and scope.\n */\nfunction ensureHubOnCarrier(carrier, parent = getGlobalHub()) {\n // If there's no hub on current domain, or it's an old API, assign a new one\n if (!hasHubOnCarrier(carrier) || getHubFromCarrier(carrier).isOlderThan(API_VERSION)) {\n const globalHubTopStack = parent.getStackTop();\n setHubOnCarrier(carrier, new Hub(globalHubTopStack.client, Scope.clone(globalHubTopStack.scope)));\n }\n}\n\n/**\n * @private Private API with no semver guarantees!\n *\n * Sets the global async context strategy\n */\nfunction setAsyncContextStrategy(strategy) {\n // Get main carrier (global for every environment)\n const registry = getMainCarrier();\n registry.__SENTRY__ = registry.__SENTRY__ || {};\n registry.__SENTRY__.acs = strategy;\n}\n\n/**\n * Runs the supplied callback in its own async context. Async Context strategies are defined per SDK.\n *\n * @param callback The callback to run in its own async context\n * @param options Options to pass to the async context strategy\n * @returns The result of the callback\n */\nfunction runWithAsyncContext(callback, options = {}) {\n const registry = getMainCarrier();\n\n if (registry.__SENTRY__ && registry.__SENTRY__.acs) {\n return registry.__SENTRY__.acs.runWithAsyncContext(callback, options);\n }\n\n // if there was no strategy, fallback to just calling the callback\n return callback();\n}\n\n/**\n * This will tell whether a carrier has a hub on it or not\n * @param carrier object\n */\nfunction hasHubOnCarrier(carrier) {\n return !!(carrier && carrier.__SENTRY__ && carrier.__SENTRY__.hub);\n}\n\n/**\n * This will create a new {@link Hub} and add to the passed object on\n * __SENTRY__.hub.\n * @param carrier object\n * @hidden\n */\nfunction getHubFromCarrier(carrier) {\n return getGlobalSingleton('hub', () => new Hub(), carrier);\n}\n\n/**\n * This will set passed {@link Hub} on the passed object's __SENTRY__.hub attribute\n * @param carrier object\n * @param hub Hub\n * @returns A boolean indicating success or failure\n */\nfunction setHubOnCarrier(carrier, hub) {\n if (!carrier) return false;\n const __SENTRY__ = (carrier.__SENTRY__ = carrier.__SENTRY__ || {});\n __SENTRY__.hub = hub;\n return true;\n}\n\nexport { API_VERSION, Hub, ensureHubOnCarrier, getCurrentHub, getHubFromCarrier, getMainCarrier, makeMain, runWithAsyncContext, setAsyncContextStrategy, setHubOnCarrier };\n","import { isPlainObject, dateTimestampInSeconds, SyncPromise, logger, isThenable, arrayify, getGlobalSingleton, uuid4 } from '@sentry/utils';\nimport { updateSession } from './session.js';\n\n/**\n * Default value for maximum number of breadcrumbs added to an event.\n */\nconst DEFAULT_MAX_BREADCRUMBS = 100;\n\n/**\n * Holds additional event information. {@link Scope.applyToEvent} will be\n * called by the client before an event will be sent.\n */\nclass Scope {\n /** Flag if notifying is happening. */\n\n /** Callback for client to receive scope changes. */\n\n /** Callback list that will be called after {@link applyToEvent}. */\n\n /** Array of breadcrumbs. */\n\n /** User */\n\n /** Tags */\n\n /** Extra */\n\n /** Contexts */\n\n /** Attachments */\n\n /** Propagation Context for distributed tracing */\n\n /**\n * A place to stash data which is needed at some point in the SDK's event processing pipeline but which shouldn't get\n * sent to Sentry\n */\n\n /** Fingerprint */\n\n /** Severity */\n // eslint-disable-next-line deprecation/deprecation\n\n /** Transaction Name */\n\n /** Span */\n\n /** Session */\n\n /** Request Mode Session Status */\n\n // NOTE: Any field which gets added here should get added not only to the constructor but also to the `clone` method.\n\n constructor() {\n this._notifyingListeners = false;\n this._scopeListeners = [];\n this._eventProcessors = [];\n this._breadcrumbs = [];\n this._attachments = [];\n this._user = {};\n this._tags = {};\n this._extra = {};\n this._contexts = {};\n this._sdkProcessingMetadata = {};\n this._propagationContext = generatePropagationContext();\n }\n\n /**\n * Inherit values from the parent scope.\n * @param scope to clone.\n */\n static clone(scope) {\n const newScope = new Scope();\n if (scope) {\n newScope._breadcrumbs = [...scope._breadcrumbs];\n newScope._tags = { ...scope._tags };\n newScope._extra = { ...scope._extra };\n newScope._contexts = { ...scope._contexts };\n newScope._user = scope._user;\n newScope._level = scope._level;\n newScope._span = scope._span;\n newScope._session = scope._session;\n newScope._transactionName = scope._transactionName;\n newScope._fingerprint = scope._fingerprint;\n newScope._eventProcessors = [...scope._eventProcessors];\n newScope._requestSession = scope._requestSession;\n newScope._attachments = [...scope._attachments];\n newScope._sdkProcessingMetadata = { ...scope._sdkProcessingMetadata };\n newScope._propagationContext = { ...scope._propagationContext };\n }\n return newScope;\n }\n\n /**\n * Add internal on change listener. Used for sub SDKs that need to store the scope.\n * @hidden\n */\n addScopeListener(callback) {\n this._scopeListeners.push(callback);\n }\n\n /**\n * @inheritDoc\n */\n addEventProcessor(callback) {\n this._eventProcessors.push(callback);\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setUser(user) {\n this._user = user || {};\n if (this._session) {\n updateSession(this._session, { user });\n }\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getUser() {\n return this._user;\n }\n\n /**\n * @inheritDoc\n */\n getRequestSession() {\n return this._requestSession;\n }\n\n /**\n * @inheritDoc\n */\n setRequestSession(requestSession) {\n this._requestSession = requestSession;\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setTags(tags) {\n this._tags = {\n ...this._tags,\n ...tags,\n };\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setTag(key, value) {\n this._tags = { ...this._tags, [key]: value };\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setExtras(extras) {\n this._extra = {\n ...this._extra,\n ...extras,\n };\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setExtra(key, extra) {\n this._extra = { ...this._extra, [key]: extra };\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setFingerprint(fingerprint) {\n this._fingerprint = fingerprint;\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setLevel(\n // eslint-disable-next-line deprecation/deprecation\n level,\n ) {\n this._level = level;\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setTransactionName(name) {\n this._transactionName = name;\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setContext(key, context) {\n if (context === null) {\n // eslint-disable-next-line @typescript-eslint/no-dynamic-delete\n delete this._contexts[key];\n } else {\n this._contexts[key] = context;\n }\n\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setSpan(span) {\n this._span = span;\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getSpan() {\n return this._span;\n }\n\n /**\n * @inheritDoc\n */\n getTransaction() {\n // Often, this span (if it exists at all) will be a transaction, but it's not guaranteed to be. Regardless, it will\n // have a pointer to the currently-active transaction.\n const span = this.getSpan();\n return span && span.transaction;\n }\n\n /**\n * @inheritDoc\n */\n setSession(session) {\n if (!session) {\n delete this._session;\n } else {\n this._session = session;\n }\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getSession() {\n return this._session;\n }\n\n /**\n * @inheritDoc\n */\n update(captureContext) {\n if (!captureContext) {\n return this;\n }\n\n if (typeof captureContext === 'function') {\n const updatedScope = (captureContext )(this);\n return updatedScope instanceof Scope ? updatedScope : this;\n }\n\n if (captureContext instanceof Scope) {\n this._tags = { ...this._tags, ...captureContext._tags };\n this._extra = { ...this._extra, ...captureContext._extra };\n this._contexts = { ...this._contexts, ...captureContext._contexts };\n if (captureContext._user && Object.keys(captureContext._user).length) {\n this._user = captureContext._user;\n }\n if (captureContext._level) {\n this._level = captureContext._level;\n }\n if (captureContext._fingerprint) {\n this._fingerprint = captureContext._fingerprint;\n }\n if (captureContext._requestSession) {\n this._requestSession = captureContext._requestSession;\n }\n if (captureContext._propagationContext) {\n this._propagationContext = captureContext._propagationContext;\n }\n } else if (isPlainObject(captureContext)) {\n // eslint-disable-next-line no-param-reassign\n captureContext = captureContext ;\n this._tags = { ...this._tags, ...captureContext.tags };\n this._extra = { ...this._extra, ...captureContext.extra };\n this._contexts = { ...this._contexts, ...captureContext.contexts };\n if (captureContext.user) {\n this._user = captureContext.user;\n }\n if (captureContext.level) {\n this._level = captureContext.level;\n }\n if (captureContext.fingerprint) {\n this._fingerprint = captureContext.fingerprint;\n }\n if (captureContext.requestSession) {\n this._requestSession = captureContext.requestSession;\n }\n if (captureContext.propagationContext) {\n this._propagationContext = captureContext.propagationContext;\n }\n }\n\n return this;\n }\n\n /**\n * @inheritDoc\n */\n clear() {\n this._breadcrumbs = [];\n this._tags = {};\n this._extra = {};\n this._user = {};\n this._contexts = {};\n this._level = undefined;\n this._transactionName = undefined;\n this._fingerprint = undefined;\n this._requestSession = undefined;\n this._span = undefined;\n this._session = undefined;\n this._notifyScopeListeners();\n this._attachments = [];\n this._propagationContext = generatePropagationContext();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n addBreadcrumb(breadcrumb, maxBreadcrumbs) {\n const maxCrumbs = typeof maxBreadcrumbs === 'number' ? maxBreadcrumbs : DEFAULT_MAX_BREADCRUMBS;\n\n // No data has been changed, so don't notify scope listeners\n if (maxCrumbs <= 0) {\n return this;\n }\n\n const mergedBreadcrumb = {\n timestamp: dateTimestampInSeconds(),\n ...breadcrumb,\n };\n this._breadcrumbs = [...this._breadcrumbs, mergedBreadcrumb].slice(-maxCrumbs);\n this._notifyScopeListeners();\n\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getLastBreadcrumb() {\n return this._breadcrumbs[this._breadcrumbs.length - 1];\n }\n\n /**\n * @inheritDoc\n */\n clearBreadcrumbs() {\n this._breadcrumbs = [];\n this._notifyScopeListeners();\n return this;\n }\n\n /**\n * @inheritDoc\n */\n addAttachment(attachment) {\n this._attachments.push(attachment);\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getAttachments() {\n return this._attachments;\n }\n\n /**\n * @inheritDoc\n */\n clearAttachments() {\n this._attachments = [];\n return this;\n }\n\n /**\n * Applies data from the scope to the event and runs all event processors on it.\n *\n * @param event Event\n * @param hint Object containing additional information about the original exception, for use by the event processors.\n * @hidden\n */\n applyToEvent(event, hint = {}) {\n if (this._extra && Object.keys(this._extra).length) {\n event.extra = { ...this._extra, ...event.extra };\n }\n if (this._tags && Object.keys(this._tags).length) {\n event.tags = { ...this._tags, ...event.tags };\n }\n if (this._user && Object.keys(this._user).length) {\n event.user = { ...this._user, ...event.user };\n }\n if (this._contexts && Object.keys(this._contexts).length) {\n event.contexts = { ...this._contexts, ...event.contexts };\n }\n if (this._level) {\n event.level = this._level;\n }\n if (this._transactionName) {\n event.transaction = this._transactionName;\n }\n\n // We want to set the trace context for normal events only if there isn't already\n // a trace context on the event. There is a product feature in place where we link\n // errors with transaction and it relies on that.\n if (this._span) {\n event.contexts = { trace: this._span.getTraceContext(), ...event.contexts };\n const transaction = this._span.transaction;\n if (transaction) {\n event.sdkProcessingMetadata = {\n dynamicSamplingContext: transaction.getDynamicSamplingContext(),\n ...event.sdkProcessingMetadata,\n };\n const transactionName = transaction.name;\n if (transactionName) {\n event.tags = { transaction: transactionName, ...event.tags };\n }\n }\n }\n\n this._applyFingerprint(event);\n\n event.breadcrumbs = [...(event.breadcrumbs || []), ...this._breadcrumbs];\n event.breadcrumbs = event.breadcrumbs.length > 0 ? event.breadcrumbs : undefined;\n\n event.sdkProcessingMetadata = {\n ...event.sdkProcessingMetadata,\n ...this._sdkProcessingMetadata,\n propagationContext: this._propagationContext,\n };\n\n return this._notifyEventProcessors([...getGlobalEventProcessors(), ...this._eventProcessors], event, hint);\n }\n\n /**\n * Add data which will be accessible during event processing but won't get sent to Sentry\n */\n setSDKProcessingMetadata(newData) {\n this._sdkProcessingMetadata = { ...this._sdkProcessingMetadata, ...newData };\n\n return this;\n }\n\n /**\n * @inheritDoc\n */\n setPropagationContext(context) {\n this._propagationContext = context;\n return this;\n }\n\n /**\n * @inheritDoc\n */\n getPropagationContext() {\n return this._propagationContext;\n }\n\n /**\n * This will be called after {@link applyToEvent} is finished.\n */\n _notifyEventProcessors(\n processors,\n event,\n hint,\n index = 0,\n ) {\n return new SyncPromise((resolve, reject) => {\n const processor = processors[index];\n if (event === null || typeof processor !== 'function') {\n resolve(event);\n } else {\n const result = processor({ ...event }, hint) ;\n\n (typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&\n processor.id &&\n result === null &&\n logger.log(`Event processor \"${processor.id}\" dropped event`);\n\n if (isThenable(result)) {\n void result\n .then(final => this._notifyEventProcessors(processors, final, hint, index + 1).then(resolve))\n .then(null, reject);\n } else {\n void this._notifyEventProcessors(processors, result, hint, index + 1)\n .then(resolve)\n .then(null, reject);\n }\n }\n });\n }\n\n /**\n * This will be called on every set call.\n */\n _notifyScopeListeners() {\n // We need this check for this._notifyingListeners to be able to work on scope during updates\n // If this check is not here we'll produce endless recursion when something is done with the scope\n // during the callback.\n if (!this._notifyingListeners) {\n this._notifyingListeners = true;\n this._scopeListeners.forEach(callback => {\n callback(this);\n });\n this._notifyingListeners = false;\n }\n }\n\n /**\n * Applies fingerprint from the scope to the event if there's one,\n * uses message if there's one instead or get rid of empty fingerprint\n */\n _applyFingerprint(event) {\n // Make sure it's an array first and we actually have something in place\n event.fingerprint = event.fingerprint ? arrayify(event.fingerprint) : [];\n\n // If we have something on the scope, then merge it with event\n if (this._fingerprint) {\n event.fingerprint = event.fingerprint.concat(this._fingerprint);\n }\n\n // If we have no data at all, remove empty array default\n if (event.fingerprint && !event.fingerprint.length) {\n delete event.fingerprint;\n }\n }\n}\n\n/**\n * Returns the global event processors.\n */\nfunction getGlobalEventProcessors() {\n return getGlobalSingleton('globalEventProcessors', () => []);\n}\n\n/**\n * Add a EventProcessor to be kept globally.\n * @param callback EventProcessor to add\n */\nfunction addGlobalEventProcessor(callback) {\n getGlobalEventProcessors().push(callback);\n}\n\nfunction generatePropagationContext() {\n return {\n traceId: uuid4(),\n spanId: uuid4().substring(16),\n sampled: false,\n };\n}\n\nexport { Scope, addGlobalEventProcessor };\n","import { timestampInSeconds, uuid4, dropUndefinedKeys } from '@sentry/utils';\n\n/**\n * Creates a new `Session` object by setting certain default parameters. If optional @param context\n * is passed, the passed properties are applied to the session object.\n *\n * @param context (optional) additional properties to be applied to the returned session object\n *\n * @returns a new `Session` object\n */\nfunction makeSession(context) {\n // Both timestamp and started are in seconds since the UNIX epoch.\n const startingTime = timestampInSeconds();\n\n const session = {\n sid: uuid4(),\n init: true,\n timestamp: startingTime,\n started: startingTime,\n duration: 0,\n status: 'ok',\n errors: 0,\n ignoreDuration: false,\n toJSON: () => sessionToJSON(session),\n };\n\n if (context) {\n updateSession(session, context);\n }\n\n return session;\n}\n\n/**\n * Updates a session object with the properties passed in the context.\n *\n * Note that this function mutates the passed object and returns void.\n * (Had to do this instead of returning a new and updated session because closing and sending a session\n * makes an update to the session after it was passed to the sending logic.\n * @see BaseClient.captureSession )\n *\n * @param session the `Session` to update\n * @param context the `SessionContext` holding the properties that should be updated in @param session\n */\n// eslint-disable-next-line complexity\nfunction updateSession(session, context = {}) {\n if (context.user) {\n if (!session.ipAddress && context.user.ip_address) {\n session.ipAddress = context.user.ip_address;\n }\n\n if (!session.did && !context.did) {\n session.did = context.user.id || context.user.email || context.user.username;\n }\n }\n\n session.timestamp = context.timestamp || timestampInSeconds();\n\n if (context.ignoreDuration) {\n session.ignoreDuration = context.ignoreDuration;\n }\n if (context.sid) {\n // Good enough uuid validation. — Kamil\n session.sid = context.sid.length === 32 ? context.sid : uuid4();\n }\n if (context.init !== undefined) {\n session.init = context.init;\n }\n if (!session.did && context.did) {\n session.did = `${context.did}`;\n }\n if (typeof context.started === 'number') {\n session.started = context.started;\n }\n if (session.ignoreDuration) {\n session.duration = undefined;\n } else if (typeof context.duration === 'number') {\n session.duration = context.duration;\n } else {\n const duration = session.timestamp - session.started;\n session.duration = duration >= 0 ? duration : 0;\n }\n if (context.release) {\n session.release = context.release;\n }\n if (context.environment) {\n session.environment = context.environment;\n }\n if (!session.ipAddress && context.ipAddress) {\n session.ipAddress = context.ipAddress;\n }\n if (!session.userAgent && context.userAgent) {\n session.userAgent = context.userAgent;\n }\n if (typeof context.errors === 'number') {\n session.errors = context.errors;\n }\n if (context.status) {\n session.status = context.status;\n }\n}\n\n/**\n * Closes a session by setting its status and updating the session object with it.\n * Internally calls `updateSession` to update the passed session object.\n *\n * Note that this function mutates the passed session (@see updateSession for explanation).\n *\n * @param session the `Session` object to be closed\n * @param status the `SessionStatus` with which the session was closed. If you don't pass a status,\n * this function will keep the previously set status, unless it was `'ok'` in which case\n * it is changed to `'exited'`.\n */\nfunction closeSession(session, status) {\n let context = {};\n if (status) {\n context = { status };\n } else if (session.status === 'ok') {\n context = { status: 'exited' };\n }\n\n updateSession(session, context);\n}\n\n/**\n * Serializes a passed session object to a JSON object with a slightly different structure.\n * This is necessary because the Sentry backend requires a slightly different schema of a session\n * than the one the JS SDKs use internally.\n *\n * @param session the session to be converted\n *\n * @returns a JSON object of the passed session\n */\nfunction sessionToJSON(session) {\n return dropUndefinedKeys({\n sid: `${session.sid}`,\n init: session.init,\n // Make sure that sec is converted to ms for date constructor\n started: new Date(session.started * 1000).toISOString(),\n timestamp: new Date(session.timestamp * 1000).toISOString(),\n status: session.status,\n errors: session.errors,\n did: typeof session.did === 'number' || typeof session.did === 'string' ? `${session.did}` : undefined,\n duration: session.duration,\n attrs: {\n release: session.release,\n environment: session.environment,\n ip_address: session.ipAddress,\n user_agent: session.userAgent,\n },\n });\n}\n\nexport { closeSession, makeSession, updateSession };\n","import { isString } from './is.js';\nimport { getGlobalObject } from './worldwide.js';\n\n// eslint-disable-next-line deprecation/deprecation\nconst WINDOW = getGlobalObject();\n\nconst DEFAULT_MAX_STRING_LENGTH = 80;\n\n/**\n * Given a child DOM element, returns a query-selector statement describing that\n * and its ancestors\n * e.g. [HTMLElement] => body > div > input#foo.btn[name=baz]\n * @returns generated DOM path\n */\nfunction htmlTreeAsString(\n elem,\n options = {},\n) {\n\n // try/catch both:\n // - accessing event.target (see getsentry/raven-js#838, #768)\n // - `htmlTreeAsString` because it's complex, and just accessing the DOM incorrectly\n // - can throw an exception in some circumstances.\n try {\n let currentElem = elem ;\n const MAX_TRAVERSE_HEIGHT = 5;\n const out = [];\n let height = 0;\n let len = 0;\n const separator = ' > ';\n const sepLength = separator.length;\n let nextStr;\n const keyAttrs = Array.isArray(options) ? options : options.keyAttrs;\n const maxStringLength = (!Array.isArray(options) && options.maxStringLength) || DEFAULT_MAX_STRING_LENGTH;\n\n while (currentElem && height++ < MAX_TRAVERSE_HEIGHT) {\n nextStr = _htmlElementAsString(currentElem, keyAttrs);\n // bail out if\n // - nextStr is the 'html' element\n // - the length of the string that would be created exceeds maxStringLength\n // (ignore this limit if we are on the first iteration)\n if (nextStr === 'html' || (height > 1 && len + out.length * sepLength + nextStr.length >= maxStringLength)) {\n break;\n }\n\n out.push(nextStr);\n\n len += nextStr.length;\n currentElem = currentElem.parentNode;\n }\n\n return out.reverse().join(separator);\n } catch (_oO) {\n return '';\n }\n}\n\n/**\n * Returns a simple, query-selector representation of a DOM element\n * e.g. [HTMLElement] => input#foo.btn[name=baz]\n * @returns generated DOM path\n */\nfunction _htmlElementAsString(el, keyAttrs) {\n const elem = el\n\n;\n\n const out = [];\n let className;\n let classes;\n let key;\n let attr;\n let i;\n\n if (!elem || !elem.tagName) {\n return '';\n }\n\n out.push(elem.tagName.toLowerCase());\n\n // Pairs of attribute keys defined in `serializeAttribute` and their values on element.\n const keyAttrPairs =\n keyAttrs && keyAttrs.length\n ? keyAttrs.filter(keyAttr => elem.getAttribute(keyAttr)).map(keyAttr => [keyAttr, elem.getAttribute(keyAttr)])\n : null;\n\n if (keyAttrPairs && keyAttrPairs.length) {\n keyAttrPairs.forEach(keyAttrPair => {\n out.push(`[${keyAttrPair[0]}=\"${keyAttrPair[1]}\"]`);\n });\n } else {\n if (elem.id) {\n out.push(`#${elem.id}`);\n }\n\n // eslint-disable-next-line prefer-const\n className = elem.className;\n if (className && isString(className)) {\n classes = className.split(/\\s+/);\n for (i = 0; i < classes.length; i++) {\n out.push(`.${classes[i]}`);\n }\n }\n }\n const allowedAttrs = ['aria-label', 'type', 'name', 'title', 'alt'];\n for (i = 0; i < allowedAttrs.length; i++) {\n key = allowedAttrs[i];\n attr = elem.getAttribute(key);\n if (attr) {\n out.push(`[${key}=\"${attr}\"]`);\n }\n }\n return out.join('');\n}\n\n/**\n * A safe form of location.href\n */\nfunction getLocationHref() {\n try {\n return WINDOW.document.location.href;\n } catch (oO) {\n return '';\n }\n}\n\n/**\n * Gets a DOM element by using document.querySelector.\n *\n * This wrapper will first check for the existance of the function before\n * actually calling it so that we don't have to take care of this check,\n * every time we want to access the DOM.\n *\n * Reason: DOM/querySelector is not available in all environments.\n *\n * We have to cast to any because utils can be consumed by a variety of environments,\n * and we don't want to break TS users. If you know what element will be selected by\n * `document.querySelector`, specify it as part of the generic call. For example,\n * `const element = getDomElement('selector');`\n *\n * @param selector the selector string passed on to document.querySelector\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction getDomElement(selector) {\n if (WINDOW.document && WINDOW.document.querySelector) {\n return WINDOW.document.querySelector(selector) ;\n }\n return null;\n}\n\nexport { getDomElement, getLocationHref, htmlTreeAsString };\n","/*\n * This module exists for optimizations in the build process through rollup and terser. We define some global\n * constants, which can be overridden during build. By guarding certain pieces of code with functions that return these\n * constants, we can control whether or not they appear in the final bundle. (Any code guarded by a false condition will\n * never run, and will hence be dropped during treeshaking.) The two primary uses for this are stripping out calls to\n * `logger` and preventing node-related code from appearing in browser bundles.\n *\n * Attention:\n * This file should not be used to define constants/flags that are intended to be used for tree-shaking conducted by\n * users. These flags should live in their respective packages, as we identified user tooling (specifically webpack)\n * having issues tree-shaking these constants across package boundaries.\n * An example for this is the __SENTRY_DEBUG__ constant. It is declared in each package individually because we want\n * users to be able to shake away expressions that it guards.\n */\n\n/**\n * Figures out if we're building a browser bundle.\n *\n * @returns true if this is a browser bundle build.\n */\nfunction isBrowserBundle() {\n return typeof __SENTRY_BROWSER_BUNDLE__ !== 'undefined' && !!__SENTRY_BROWSER_BUNDLE__;\n}\n\n/**\n * Get source of SDK.\n */\nfunction getSDKSource() {\n // @ts-ignore \"npm\" is injected by rollup during build process\n return \"npm\";\n}\n\nexport { getSDKSource, isBrowserBundle };\n","// eslint-disable-next-line @typescript-eslint/unbound-method\nconst objectToString = Object.prototype.toString;\n\n/**\n * Checks whether given value's type is one of a few Error or Error-like\n * {@link isError}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isError(wat) {\n switch (objectToString.call(wat)) {\n case '[object Error]':\n case '[object Exception]':\n case '[object DOMException]':\n return true;\n default:\n return isInstanceOf(wat, Error);\n }\n}\n/**\n * Checks whether given value is an instance of the given built-in class.\n *\n * @param wat The value to be checked\n * @param className\n * @returns A boolean representing the result.\n */\nfunction isBuiltin(wat, className) {\n return objectToString.call(wat) === `[object ${className}]`;\n}\n\n/**\n * Checks whether given value's type is ErrorEvent\n * {@link isErrorEvent}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isErrorEvent(wat) {\n return isBuiltin(wat, 'ErrorEvent');\n}\n\n/**\n * Checks whether given value's type is DOMError\n * {@link isDOMError}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isDOMError(wat) {\n return isBuiltin(wat, 'DOMError');\n}\n\n/**\n * Checks whether given value's type is DOMException\n * {@link isDOMException}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isDOMException(wat) {\n return isBuiltin(wat, 'DOMException');\n}\n\n/**\n * Checks whether given value's type is a string\n * {@link isString}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isString(wat) {\n return isBuiltin(wat, 'String');\n}\n\n/**\n * Checks whether given value is a primitive (undefined, null, number, boolean, string, bigint, symbol)\n * {@link isPrimitive}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isPrimitive(wat) {\n return wat === null || (typeof wat !== 'object' && typeof wat !== 'function');\n}\n\n/**\n * Checks whether given value's type is an object literal\n * {@link isPlainObject}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isPlainObject(wat) {\n return isBuiltin(wat, 'Object');\n}\n\n/**\n * Checks whether given value's type is an Event instance\n * {@link isEvent}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isEvent(wat) {\n return typeof Event !== 'undefined' && isInstanceOf(wat, Event);\n}\n\n/**\n * Checks whether given value's type is an Element instance\n * {@link isElement}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isElement(wat) {\n return typeof Element !== 'undefined' && isInstanceOf(wat, Element);\n}\n\n/**\n * Checks whether given value's type is an regexp\n * {@link isRegExp}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isRegExp(wat) {\n return isBuiltin(wat, 'RegExp');\n}\n\n/**\n * Checks whether given value has a then function.\n * @param wat A value to be checked.\n */\nfunction isThenable(wat) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return Boolean(wat && wat.then && typeof wat.then === 'function');\n}\n\n/**\n * Checks whether given value's type is a SyntheticEvent\n * {@link isSyntheticEvent}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isSyntheticEvent(wat) {\n return isPlainObject(wat) && 'nativeEvent' in wat && 'preventDefault' in wat && 'stopPropagation' in wat;\n}\n\n/**\n * Checks whether given value is NaN\n * {@link isNaN}.\n *\n * @param wat A value to be checked.\n * @returns A boolean representing the result.\n */\nfunction isNaN(wat) {\n return typeof wat === 'number' && wat !== wat;\n}\n\n/**\n * Checks whether given value's type is an instance of provided constructor.\n * {@link isInstanceOf}.\n *\n * @param wat A value to be checked.\n * @param base A constructor to be used in a check.\n * @returns A boolean representing the result.\n */\nfunction isInstanceOf(wat, base) {\n try {\n return wat instanceof base;\n } catch (_e) {\n return false;\n }\n}\n\nexport { isDOMError, isDOMException, isElement, isError, isErrorEvent, isEvent, isInstanceOf, isNaN, isPlainObject, isPrimitive, isRegExp, isString, isSyntheticEvent, isThenable };\n","import { getGlobalSingleton, GLOBAL_OBJ } from './worldwide.js';\n\n/** Prefix for logging strings */\nconst PREFIX = 'Sentry Logger ';\n\nconst CONSOLE_LEVELS = ['debug', 'info', 'warn', 'error', 'log', 'assert', 'trace'] ;\n\n/**\n * Temporarily disable sentry console instrumentations.\n *\n * @param callback The function to run against the original `console` messages\n * @returns The results of the callback\n */\nfunction consoleSandbox(callback) {\n if (!('console' in GLOBAL_OBJ)) {\n return callback();\n }\n\n const originalConsole = GLOBAL_OBJ.console ;\n const wrappedLevels = {};\n\n // Restore all wrapped console methods\n CONSOLE_LEVELS.forEach(level => {\n // TODO(v7): Remove this check as it's only needed for Node 6\n const originalWrappedFunc =\n originalConsole[level] && (originalConsole[level] ).__sentry_original__;\n if (level in originalConsole && originalWrappedFunc) {\n wrappedLevels[level] = originalConsole[level] ;\n originalConsole[level] = originalWrappedFunc ;\n }\n });\n\n try {\n return callback();\n } finally {\n // Revert restoration to wrapped state\n Object.keys(wrappedLevels).forEach(level => {\n originalConsole[level] = wrappedLevels[level ];\n });\n }\n}\n\nfunction makeLogger() {\n let enabled = false;\n const logger = {\n enable: () => {\n enabled = true;\n },\n disable: () => {\n enabled = false;\n },\n };\n\n if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {\n CONSOLE_LEVELS.forEach(name => {\n // eslint-disable-next-line @typescript-eslint/no-explicit-any\n logger[name] = (...args) => {\n if (enabled) {\n consoleSandbox(() => {\n GLOBAL_OBJ.console[name](`${PREFIX}[${name}]:`, ...args);\n });\n }\n };\n });\n } else {\n CONSOLE_LEVELS.forEach(name => {\n logger[name] = () => undefined;\n });\n }\n\n return logger ;\n}\n\n// Ensure we only have a single logger instance, even if multiple versions of @sentry/utils are being used\nlet logger;\nif ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {\n logger = getGlobalSingleton('logger', makeLogger);\n} else {\n logger = makeLogger();\n}\n\nexport { CONSOLE_LEVELS, consoleSandbox, logger };\n","import { addNonEnumerableProperty } from './object.js';\nimport { snipLine } from './string.js';\nimport { GLOBAL_OBJ } from './worldwide.js';\n\n/**\n * UUID4 generator\n *\n * @returns string Generated UUID4.\n */\nfunction uuid4() {\n const gbl = GLOBAL_OBJ ;\n const crypto = gbl.crypto || gbl.msCrypto;\n\n if (crypto && crypto.randomUUID) {\n return crypto.randomUUID().replace(/-/g, '');\n }\n\n const getRandomByte =\n crypto && crypto.getRandomValues ? () => crypto.getRandomValues(new Uint8Array(1))[0] : () => Math.random() * 16;\n\n // http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#2117523\n // Concatenating the following numbers as strings results in '10000000100040008000100000000000'\n return (([1e7] ) + 1e3 + 4e3 + 8e3 + 1e11).replace(/[018]/g, c =>\n // eslint-disable-next-line no-bitwise\n ((c ) ^ ((getRandomByte() & 15) >> ((c ) / 4))).toString(16),\n );\n}\n\nfunction getFirstException(event) {\n return event.exception && event.exception.values ? event.exception.values[0] : undefined;\n}\n\n/**\n * Extracts either message or type+value from an event that can be used for user-facing logs\n * @returns event's description\n */\nfunction getEventDescription(event) {\n const { message, event_id: eventId } = event;\n if (message) {\n return message;\n }\n\n const firstException = getFirstException(event);\n if (firstException) {\n if (firstException.type && firstException.value) {\n return `${firstException.type}: ${firstException.value}`;\n }\n return firstException.type || firstException.value || eventId || '';\n }\n return eventId || '';\n}\n\n/**\n * Adds exception values, type and value to an synthetic Exception.\n * @param event The event to modify.\n * @param value Value of the exception.\n * @param type Type of the exception.\n * @hidden\n */\nfunction addExceptionTypeValue(event, value, type) {\n const exception = (event.exception = event.exception || {});\n const values = (exception.values = exception.values || []);\n const firstException = (values[0] = values[0] || {});\n if (!firstException.value) {\n firstException.value = value || '';\n }\n if (!firstException.type) {\n firstException.type = type || 'Error';\n }\n}\n\n/**\n * Adds exception mechanism data to a given event. Uses defaults if the second parameter is not passed.\n *\n * @param event The event to modify.\n * @param newMechanism Mechanism data to add to the event.\n * @hidden\n */\nfunction addExceptionMechanism(event, newMechanism) {\n const firstException = getFirstException(event);\n if (!firstException) {\n return;\n }\n\n const defaultMechanism = { type: 'generic', handled: true };\n const currentMechanism = firstException.mechanism;\n firstException.mechanism = { ...defaultMechanism, ...currentMechanism, ...newMechanism };\n\n if (newMechanism && 'data' in newMechanism) {\n const mergedData = { ...(currentMechanism && currentMechanism.data), ...newMechanism.data };\n firstException.mechanism.data = mergedData;\n }\n}\n\n// https://semver.org/#is-there-a-suggested-regular-expression-regex-to-check-a-semver-string\nconst SEMVER_REGEXP =\n /^(0|[1-9]\\d*)\\.(0|[1-9]\\d*)\\.(0|[1-9]\\d*)(?:-((?:0|[1-9]\\d*|\\d*[a-zA-Z-][0-9a-zA-Z-]*)(?:\\.(?:0|[1-9]\\d*|\\d*[a-zA-Z-][0-9a-zA-Z-]*))*))?(?:\\+([0-9a-zA-Z-]+(?:\\.[0-9a-zA-Z-]+)*))?$/;\n\n/**\n * Represents Semantic Versioning object\n */\n\n/**\n * Parses input into a SemVer interface\n * @param input string representation of a semver version\n */\nfunction parseSemver(input) {\n const match = input.match(SEMVER_REGEXP) || [];\n const major = parseInt(match[1], 10);\n const minor = parseInt(match[2], 10);\n const patch = parseInt(match[3], 10);\n return {\n buildmetadata: match[5],\n major: isNaN(major) ? undefined : major,\n minor: isNaN(minor) ? undefined : minor,\n patch: isNaN(patch) ? undefined : patch,\n prerelease: match[4],\n };\n}\n\n/**\n * This function adds context (pre/post/line) lines to the provided frame\n *\n * @param lines string[] containing all lines\n * @param frame StackFrame that will be mutated\n * @param linesOfContext number of context lines we want to add pre/post\n */\nfunction addContextToFrame(lines, frame, linesOfContext = 5) {\n // When there is no line number in the frame, attaching context is nonsensical and will even break grouping\n if (frame.lineno === undefined) {\n return;\n }\n\n const maxLines = lines.length;\n const sourceLine = Math.max(Math.min(maxLines - 1, frame.lineno - 1), 0);\n\n frame.pre_context = lines\n .slice(Math.max(0, sourceLine - linesOfContext), sourceLine)\n .map((line) => snipLine(line, 0));\n\n frame.context_line = snipLine(lines[Math.min(maxLines - 1, sourceLine)], frame.colno || 0);\n\n frame.post_context = lines\n .slice(Math.min(sourceLine + 1, maxLines), sourceLine + 1 + linesOfContext)\n .map((line) => snipLine(line, 0));\n}\n\n/**\n * Checks whether or not we've already captured the given exception (note: not an identical exception - the very object\n * in question), and marks it captured if not.\n *\n * This is useful because it's possible for an error to get captured by more than one mechanism. After we intercept and\n * record an error, we rethrow it (assuming we've intercepted it before it's reached the top-level global handlers), so\n * that we don't interfere with whatever effects the error might have had were the SDK not there. At that point, because\n * the error has been rethrown, it's possible for it to bubble up to some other code we've instrumented. If it's not\n * caught after that, it will bubble all the way up to the global handlers (which of course we also instrument). This\n * function helps us ensure that even if we encounter the same error more than once, we only record it the first time we\n * see it.\n *\n * Note: It will ignore primitives (always return `false` and not mark them as seen), as properties can't be set on\n * them. {@link: Object.objectify} can be used on exceptions to convert any that are primitives into their equivalent\n * object wrapper forms so that this check will always work. However, because we need to flag the exact object which\n * will get rethrown, and because that rethrowing happens outside of the event processing pipeline, the objectification\n * must be done before the exception captured.\n *\n * @param A thrown exception to check or flag as having been seen\n * @returns `true` if the exception has already been captured, `false` if not (with the side effect of marking it seen)\n */\nfunction checkOrSetAlreadyCaught(exception) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n if (exception && (exception ).__sentry_captured__) {\n return true;\n }\n\n try {\n // set it this way rather than by assignment so that it's not ennumerable and therefore isn't recorded by the\n // `ExtraErrorData` integration\n addNonEnumerableProperty(exception , '__sentry_captured__', true);\n } catch (err) {\n // `exception` is a primitive, so we can't mark it seen\n }\n\n return false;\n}\n\n/**\n * Checks whether the given input is already an array, and if it isn't, wraps it in one.\n *\n * @param maybeArray Input to turn into an array, if necessary\n * @returns The input, if already an array, or an array with the input as the only element, if not\n */\nfunction arrayify(maybeArray) {\n return Array.isArray(maybeArray) ? maybeArray : [maybeArray];\n}\n\nexport { addContextToFrame, addExceptionMechanism, addExceptionTypeValue, arrayify, checkOrSetAlreadyCaught, getEventDescription, parseSemver, uuid4 };\n","import { isBrowserBundle } from './env.js';\n\n/**\n * NOTE: In order to avoid circular dependencies, if you add a function to this module and it needs to print something,\n * you must either a) use `console.log` rather than the logger, or b) put your function elsewhere.\n */\n\n/**\n * Checks whether we're in the Node.js or Browser environment\n *\n * @returns Answer to given question\n */\nfunction isNodeEnv() {\n // explicitly check for browser bundles as those can be optimized statically\n // by terser/rollup.\n return (\n !isBrowserBundle() &&\n Object.prototype.toString.call(typeof process !== 'undefined' ? process : 0) === '[object process]'\n );\n}\n\n/**\n * Requires a module which is protected against bundler minification.\n *\n * @param request The module path to resolve\n */\n// eslint-disable-next-line @typescript-eslint/explicit-module-boundary-types, @typescript-eslint/no-explicit-any\nfunction dynamicRequire(mod, request) {\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n return mod.require(request);\n}\n\n/**\n * Helper for dynamically loading module that should work with linked dependencies.\n * The problem is that we _should_ be using `require(require.resolve(moduleName, { paths: [cwd()] }))`\n * However it's _not possible_ to do that with Webpack, as it has to know all the dependencies during\n * build time. `require.resolve` is also not available in any other way, so we cannot create,\n * a fake helper like we do with `dynamicRequire`.\n *\n * We always prefer to use local package, thus the value is not returned early from each `try/catch` block.\n * That is to mimic the behavior of `require.resolve` exactly.\n *\n * @param moduleName module name to require\n * @returns possibly required module\n */\nfunction loadModule(moduleName) {\n let mod;\n\n try {\n mod = dynamicRequire(module, moduleName);\n } catch (e) {\n // no-empty\n }\n\n try {\n const { cwd } = dynamicRequire(module, 'process');\n mod = dynamicRequire(module, `${cwd()}/node_modules/${moduleName}`) ;\n } catch (e) {\n // no-empty\n }\n\n return mod;\n}\n\nexport { dynamicRequire, isNodeEnv, loadModule };\n","import { htmlTreeAsString } from './browser.js';\nimport { isError, isEvent, isInstanceOf, isElement, isPlainObject, isPrimitive } from './is.js';\nimport { truncate } from './string.js';\n\n/**\n * Replace a method in an object with a wrapped version of itself.\n *\n * @param source An object that contains a method to be wrapped.\n * @param name The name of the method to be wrapped.\n * @param replacementFactory A higher-order function that takes the original version of the given method and returns a\n * wrapped version. Note: The function returned by `replacementFactory` needs to be a non-arrow function, in order to\n * preserve the correct value of `this`, and the original method must be called using `origMethod.call(this, )` or `origMethod.apply(this, [])` (rather than being called directly), again to preserve `this`.\n * @returns void\n */\nfunction fill(source, name, replacementFactory) {\n if (!(name in source)) {\n return;\n }\n\n const original = source[name] ;\n const wrapped = replacementFactory(original) ;\n\n // Make sure it's a function first, as we need to attach an empty prototype for `defineProperties` to work\n // otherwise it'll throw \"TypeError: Object.defineProperties called on non-object\"\n if (typeof wrapped === 'function') {\n try {\n markFunctionWrapped(wrapped, original);\n } catch (_Oo) {\n // This can throw if multiple fill happens on a global object like XMLHttpRequest\n // Fixes https://github.com/getsentry/sentry-javascript/issues/2043\n }\n }\n\n source[name] = wrapped;\n}\n\n/**\n * Defines a non-enumerable property on the given object.\n *\n * @param obj The object on which to set the property\n * @param name The name of the property to be set\n * @param value The value to which to set the property\n */\nfunction addNonEnumerableProperty(obj, name, value) {\n Object.defineProperty(obj, name, {\n // enumerable: false, // the default, so we can save on bundle size by not explicitly setting it\n value: value,\n writable: true,\n configurable: true,\n });\n}\n\n/**\n * Remembers the original function on the wrapped function and\n * patches up the prototype.\n *\n * @param wrapped the wrapper function\n * @param original the original function that gets wrapped\n */\nfunction markFunctionWrapped(wrapped, original) {\n const proto = original.prototype || {};\n wrapped.prototype = original.prototype = proto;\n addNonEnumerableProperty(wrapped, '__sentry_original__', original);\n}\n\n/**\n * This extracts the original function if available. See\n * `markFunctionWrapped` for more information.\n *\n * @param func the function to unwrap\n * @returns the unwrapped version of the function if available.\n */\nfunction getOriginalFunction(func) {\n return func.__sentry_original__;\n}\n\n/**\n * Encodes given object into url-friendly format\n *\n * @param object An object that contains serializable values\n * @returns string Encoded\n */\nfunction urlEncode(object) {\n return Object.keys(object)\n .map(key => `${encodeURIComponent(key)}=${encodeURIComponent(object[key])}`)\n .join('&');\n}\n\n/**\n * Transforms any `Error` or `Event` into a plain object with all of their enumerable properties, and some of their\n * non-enumerable properties attached.\n *\n * @param value Initial source that we have to transform in order for it to be usable by the serializer\n * @returns An Event or Error turned into an object - or the value argurment itself, when value is neither an Event nor\n * an Error.\n */\nfunction convertToPlainObject(value)\n\n {\n if (isError(value)) {\n return {\n message: value.message,\n name: value.name,\n stack: value.stack,\n ...getOwnProperties(value),\n };\n } else if (isEvent(value)) {\n const newObj\n\n = {\n type: value.type,\n target: serializeEventTarget(value.target),\n currentTarget: serializeEventTarget(value.currentTarget),\n ...getOwnProperties(value),\n };\n\n if (typeof CustomEvent !== 'undefined' && isInstanceOf(value, CustomEvent)) {\n newObj.detail = value.detail;\n }\n\n return newObj;\n } else {\n return value;\n }\n}\n\n/** Creates a string representation of the target of an `Event` object */\nfunction serializeEventTarget(target) {\n try {\n return isElement(target) ? htmlTreeAsString(target) : Object.prototype.toString.call(target);\n } catch (_oO) {\n return '';\n }\n}\n\n/** Filters out all but an object's own properties */\nfunction getOwnProperties(obj) {\n if (typeof obj === 'object' && obj !== null) {\n const extractedProps = {};\n for (const property in obj) {\n if (Object.prototype.hasOwnProperty.call(obj, property)) {\n extractedProps[property] = (obj )[property];\n }\n }\n return extractedProps;\n } else {\n return {};\n }\n}\n\n/**\n * Given any captured exception, extract its keys and create a sorted\n * and truncated list that will be used inside the event message.\n * eg. `Non-error exception captured with keys: foo, bar, baz`\n */\nfunction extractExceptionKeysForMessage(exception, maxLength = 40) {\n const keys = Object.keys(convertToPlainObject(exception));\n keys.sort();\n\n if (!keys.length) {\n return '[object has no keys]';\n }\n\n if (keys[0].length >= maxLength) {\n return truncate(keys[0], maxLength);\n }\n\n for (let includedKeys = keys.length; includedKeys > 0; includedKeys--) {\n const serialized = keys.slice(0, includedKeys).join(', ');\n if (serialized.length > maxLength) {\n continue;\n }\n if (includedKeys === keys.length) {\n return serialized;\n }\n return truncate(serialized, maxLength);\n }\n\n return '';\n}\n\n/**\n * Given any object, return a new object having removed all fields whose value was `undefined`.\n * Works recursively on objects and arrays.\n *\n * Attention: This function keeps circular references in the returned object.\n */\nfunction dropUndefinedKeys(inputValue) {\n // This map keeps track of what already visited nodes map to.\n // Our Set - based memoBuilder doesn't work here because we want to the output object to have the same circular\n // references as the input object.\n const memoizationMap = new Map();\n\n // This function just proxies `_dropUndefinedKeys` to keep the `memoBuilder` out of this function's API\n return _dropUndefinedKeys(inputValue, memoizationMap);\n}\n\nfunction _dropUndefinedKeys(inputValue, memoizationMap) {\n if (isPlainObject(inputValue)) {\n // If this node has already been visited due to a circular reference, return the object it was mapped to in the new object\n const memoVal = memoizationMap.get(inputValue);\n if (memoVal !== undefined) {\n return memoVal ;\n }\n\n const returnValue = {};\n // Store the mapping of this value in case we visit it again, in case of circular data\n memoizationMap.set(inputValue, returnValue);\n\n for (const key of Object.keys(inputValue)) {\n if (typeof inputValue[key] !== 'undefined') {\n returnValue[key] = _dropUndefinedKeys(inputValue[key], memoizationMap);\n }\n }\n\n return returnValue ;\n }\n\n if (Array.isArray(inputValue)) {\n // If this node has already been visited due to a circular reference, return the array it was mapped to in the new object\n const memoVal = memoizationMap.get(inputValue);\n if (memoVal !== undefined) {\n return memoVal ;\n }\n\n const returnValue = [];\n // Store the mapping of this value in case we visit it again, in case of circular data\n memoizationMap.set(inputValue, returnValue);\n\n inputValue.forEach((item) => {\n returnValue.push(_dropUndefinedKeys(item, memoizationMap));\n });\n\n return returnValue ;\n }\n\n return inputValue;\n}\n\n/**\n * Ensure that something is an object.\n *\n * Turns `undefined` and `null` into `String`s and all other primitives into instances of their respective wrapper\n * classes (String, Boolean, Number, etc.). Acts as the identity function on non-primitives.\n *\n * @param wat The subject of the objectification\n * @returns A version of `wat` which can safely be used with `Object` class methods\n */\nfunction objectify(wat) {\n let objectified;\n switch (true) {\n case wat === undefined || wat === null:\n objectified = new String(wat);\n break;\n\n // Though symbols and bigints do have wrapper classes (`Symbol` and `BigInt`, respectively), for whatever reason\n // those classes don't have constructors which can be used with the `new` keyword. We therefore need to cast each as\n // an object in order to wrap it.\n case typeof wat === 'symbol' || typeof wat === 'bigint':\n objectified = Object(wat);\n break;\n\n // this will catch the remaining primitives: `String`, `Number`, and `Boolean`\n case isPrimitive(wat):\n // eslint-disable-next-line @typescript-eslint/no-unsafe-member-access\n objectified = new (wat ).constructor(wat);\n break;\n\n // by process of elimination, at this point we know that `wat` must already be an object\n default:\n objectified = wat;\n break;\n }\n return objectified;\n}\n\nexport { addNonEnumerableProperty, convertToPlainObject, dropUndefinedKeys, extractExceptionKeysForMessage, fill, getOriginalFunction, markFunctionWrapped, objectify, urlEncode };\n","import { isString, isRegExp } from './is.js';\n\n/**\n * Truncates given string to the maximum characters count\n *\n * @param str An object that contains serializable values\n * @param max Maximum number of characters in truncated string (0 = unlimited)\n * @returns string Encoded\n */\nfunction truncate(str, max = 0) {\n if (typeof str !== 'string' || max === 0) {\n return str;\n }\n return str.length <= max ? str : `${str.slice(0, max)}...`;\n}\n\n/**\n * This is basically just `trim_line` from\n * https://github.com/getsentry/sentry/blob/master/src/sentry/lang/javascript/processor.py#L67\n *\n * @param str An object that contains serializable values\n * @param max Maximum number of characters in truncated string\n * @returns string Encoded\n */\nfunction snipLine(line, colno) {\n let newLine = line;\n const lineLength = newLine.length;\n if (lineLength <= 150) {\n return newLine;\n }\n if (colno > lineLength) {\n // eslint-disable-next-line no-param-reassign\n colno = lineLength;\n }\n\n let start = Math.max(colno - 60, 0);\n if (start < 5) {\n start = 0;\n }\n\n let end = Math.min(start + 140, lineLength);\n if (end > lineLength - 5) {\n end = lineLength;\n }\n if (end === lineLength) {\n start = Math.max(end - 140, 0);\n }\n\n newLine = newLine.slice(start, end);\n if (start > 0) {\n newLine = `'{snip} ${newLine}`;\n }\n if (end < lineLength) {\n newLine += ' {snip}';\n }\n\n return newLine;\n}\n\n/**\n * Join values in array\n * @param input array of values to be joined together\n * @param delimiter string to be placed in-between values\n * @returns Joined values\n */\n// eslint-disable-next-line @typescript-eslint/no-explicit-any\nfunction safeJoin(input, delimiter) {\n if (!Array.isArray(input)) {\n return '';\n }\n\n const output = [];\n // eslint-disable-next-line @typescript-eslint/prefer-for-of\n for (let i = 0; i < input.length; i++) {\n const value = input[i];\n try {\n output.push(String(value));\n } catch (e) {\n output.push('[value cannot be serialized]');\n }\n }\n\n return output.join(delimiter);\n}\n\n/**\n * Checks if the given value matches a regex or string\n *\n * @param value The string to test\n * @param pattern Either a regex or a string against which `value` will be matched\n * @param requireExactStringMatch If true, `value` must match `pattern` exactly. If false, `value` will match\n * `pattern` if it contains `pattern`. Only applies to string-type patterns.\n */\nfunction isMatchingPattern(\n value,\n pattern,\n requireExactStringMatch = false,\n) {\n if (!isString(value)) {\n return false;\n }\n\n if (isRegExp(pattern)) {\n return pattern.test(value);\n }\n if (isString(pattern)) {\n return requireExactStringMatch ? value === pattern : value.includes(pattern);\n }\n\n return false;\n}\n\n/**\n * Test the given string against an array of strings and regexes. By default, string matching is done on a\n * substring-inclusion basis rather than a strict equality basis\n *\n * @param testString The string to test\n * @param patterns The patterns against which to test the string\n * @param requireExactStringMatch If true, `testString` must match one of the given string patterns exactly in order to\n * count. If false, `testString` will match a string pattern if it contains that pattern.\n * @returns\n */\nfunction stringMatchesSomePattern(\n testString,\n patterns = [],\n requireExactStringMatch = false,\n) {\n return patterns.some(pattern => isMatchingPattern(testString, pattern, requireExactStringMatch));\n}\n\nexport { isMatchingPattern, safeJoin, snipLine, stringMatchesSomePattern, truncate };\n","import { isThenable } from './is.js';\n\n/* eslint-disable @typescript-eslint/explicit-function-return-type */\n\n/** SyncPromise internal states */\nvar States; (function (States) {\n /** Pending */\n const PENDING = 0; States[States[\"PENDING\"] = PENDING] = \"PENDING\";\n /** Resolved / OK */\n const RESOLVED = 1; States[States[\"RESOLVED\"] = RESOLVED] = \"RESOLVED\";\n /** Rejected / Error */\n const REJECTED = 2; States[States[\"REJECTED\"] = REJECTED] = \"REJECTED\";\n})(States || (States = {}));\n\n// Overloads so we can call resolvedSyncPromise without arguments and generic argument\n\n/**\n * Creates a resolved sync promise.\n *\n * @param value the value to resolve the promise with\n * @returns the resolved sync promise\n */\nfunction resolvedSyncPromise(value) {\n return new SyncPromise(resolve => {\n resolve(value);\n });\n}\n\n/**\n * Creates a rejected sync promise.\n *\n * @param value the value to reject the promise with\n * @returns the rejected sync promise\n */\nfunction rejectedSyncPromise(reason) {\n return new SyncPromise((_, reject) => {\n reject(reason);\n });\n}\n\n/**\n * Thenable class that behaves like a Promise and follows it's interface\n * but is not async internally\n */\nclass SyncPromise {\n\n constructor(\n executor,\n ) {SyncPromise.prototype.__init.call(this);SyncPromise.prototype.__init2.call(this);SyncPromise.prototype.__init3.call(this);SyncPromise.prototype.__init4.call(this);\n this._state = States.PENDING;\n this._handlers = [];\n\n try {\n executor(this._resolve, this._reject);\n } catch (e) {\n this._reject(e);\n }\n }\n\n /** JSDoc */\n then(\n onfulfilled,\n onrejected,\n ) {\n return new SyncPromise((resolve, reject) => {\n this._handlers.push([\n false,\n result => {\n if (!onfulfilled) {\n // TODO: ¯\\_(ツ)_/¯\n // TODO: FIXME\n resolve(result );\n } else {\n try {\n resolve(onfulfilled(result));\n } catch (e) {\n reject(e);\n }\n }\n },\n reason => {\n if (!onrejected) {\n reject(reason);\n } else {\n try {\n resolve(onrejected(reason));\n } catch (e) {\n reject(e);\n }\n }\n },\n ]);\n this._executeHandlers();\n });\n }\n\n /** JSDoc */\n catch(\n onrejected,\n ) {\n return this.then(val => val, onrejected);\n }\n\n /** JSDoc */\n finally(onfinally) {\n return new SyncPromise((resolve, reject) => {\n let val;\n let isRejected;\n\n return this.then(\n value => {\n isRejected = false;\n val = value;\n if (onfinally) {\n onfinally();\n }\n },\n reason => {\n isRejected = true;\n val = reason;\n if (onfinally) {\n onfinally();\n }\n },\n ).then(() => {\n if (isRejected) {\n reject(val);\n return;\n }\n\n resolve(val );\n });\n });\n }\n\n /** JSDoc */\n __init() {this._resolve = (value) => {\n this._setResult(States.RESOLVED, value);\n };}\n\n /** JSDoc */\n __init2() {this._reject = (reason) => {\n this._setResult(States.REJECTED, reason);\n };}\n\n /** JSDoc */\n __init3() {this._setResult = (state, value) => {\n if (this._state !== States.PENDING) {\n return;\n }\n\n if (isThenable(value)) {\n void (value ).then(this._resolve, this._reject);\n return;\n }\n\n this._state = state;\n this._value = value;\n\n this._executeHandlers();\n };}\n\n /** JSDoc */\n __init4() {this._executeHandlers = () => {\n if (this._state === States.PENDING) {\n return;\n }\n\n const cachedHandlers = this._handlers.slice();\n this._handlers = [];\n\n cachedHandlers.forEach(handler => {\n if (handler[0]) {\n return;\n }\n\n if (this._state === States.RESOLVED) {\n // eslint-disable-next-line @typescript-eslint/no-floating-promises\n handler[1](this._value );\n }\n\n if (this._state === States.REJECTED) {\n handler[2](this._value);\n }\n\n handler[0] = true;\n });\n };}\n}\n\nexport { SyncPromise, rejectedSyncPromise, resolvedSyncPromise };\n","import { isNodeEnv, dynamicRequire } from './node.js';\nimport { getGlobalObject } from './worldwide.js';\n\n// eslint-disable-next-line deprecation/deprecation\nconst WINDOW = getGlobalObject();\n\n/**\n * An object that can return the current timestamp in seconds since the UNIX epoch.\n */\n\n/**\n * A TimestampSource implementation for environments that do not support the Performance Web API natively.\n *\n * Note that this TimestampSource does not use a monotonic clock. A call to `nowSeconds` may return a timestamp earlier\n * than a previously returned value. We do not try to emulate a monotonic behavior in order to facilitate debugging. It\n * is more obvious to explain \"why does my span have negative duration\" than \"why my spans have zero duration\".\n */\nconst dateTimestampSource = {\n nowSeconds: () => Date.now() / 1000,\n};\n\n/**\n * A partial definition of the [Performance Web API]{@link https://developer.mozilla.org/en-US/docs/Web/API/Performance}\n * for accessing a high-resolution monotonic clock.\n */\n\n/**\n * Returns a wrapper around the native Performance API browser implementation, or undefined for browsers that do not\n * support the API.\n *\n * Wrapping the native API works around differences in behavior from different browsers.\n */\nfunction getBrowserPerformance() {\n const { performance } = WINDOW;\n if (!performance || !performance.now) {\n return undefined;\n }\n\n // Replace performance.timeOrigin with our own timeOrigin based on Date.now().\n //\n // This is a partial workaround for browsers reporting performance.timeOrigin such that performance.timeOrigin +\n // performance.now() gives a date arbitrarily in the past.\n //\n // Additionally, computing timeOrigin in this way fills the gap for browsers where performance.timeOrigin is\n // undefined.\n //\n // The assumption that performance.timeOrigin + performance.now() ~= Date.now() is flawed, but we depend on it to\n // interact with data coming out of performance entries.\n //\n // Note that despite recommendations against it in the spec, browsers implement the Performance API with a clock that\n // might stop when the computer is asleep (and perhaps under other circumstances). Such behavior causes\n // performance.timeOrigin + performance.now() to have an arbitrary skew over Date.now(). In laptop computers, we have\n // observed skews that can be as long as days, weeks or months.\n //\n // See https://github.com/getsentry/sentry-javascript/issues/2590.\n //\n // BUG: despite our best intentions, this workaround has its limitations. It mostly addresses timings of pageload\n // transactions, but ignores the skew built up over time that can aversely affect timestamps of navigation\n // transactions of long-lived web pages.\n const timeOrigin = Date.now() - performance.now();\n\n return {\n now: () => performance.now(),\n timeOrigin,\n };\n}\n\n/**\n * Returns the native Performance API implementation from Node.js. Returns undefined in old Node.js versions that don't\n * implement the API.\n */\nfunction getNodePerformance() {\n try {\n const perfHooks = dynamicRequire(module, 'perf_hooks') ;\n return perfHooks.performance;\n } catch (_) {\n return undefined;\n }\n}\n\n/**\n * The Performance API implementation for the current platform, if available.\n */\nconst platformPerformance = isNodeEnv() ? getNodePerformance() : getBrowserPerformance();\n\nconst timestampSource =\n platformPerformance === undefined\n ? dateTimestampSource\n : {\n nowSeconds: () => (platformPerformance.timeOrigin + platformPerformance.now()) / 1000,\n };\n\n/**\n * Returns a timestamp in seconds since the UNIX epoch using the Date API.\n */\nconst dateTimestampInSeconds = dateTimestampSource.nowSeconds.bind(dateTimestampSource);\n\n/**\n * Returns a timestamp in seconds since the UNIX epoch using either the Performance or Date APIs, depending on the\n * availability of the Performance API.\n *\n * See `usingPerformanceAPI` to test whether the Performance API is used.\n *\n * BUG: Note that because of how browsers implement the Performance API, the clock might stop when the computer is\n * asleep. This creates a skew between `dateTimestampInSeconds` and `timestampInSeconds`. The\n * skew can grow to arbitrary amounts like days, weeks or months.\n * See https://github.com/getsentry/sentry-javascript/issues/2590.\n */\nconst timestampInSeconds = timestampSource.nowSeconds.bind(timestampSource);\n\n/**\n * Re-exported with an old name for backwards-compatibility.\n * TODO (v8): Remove this\n *\n * @deprecated Use `timestampInSeconds` instead.\n */\nconst timestampWithMs = timestampInSeconds;\n\n/**\n * A boolean that is true when timestampInSeconds uses the Performance API to produce monotonic timestamps.\n */\nconst usingPerformanceAPI = platformPerformance !== undefined;\n\n/**\n * Internal helper to store what is the source of browserPerformanceTimeOrigin below. For debugging only.\n */\nlet _browserPerformanceTimeOriginMode;\n\n/**\n * The number of milliseconds since the UNIX epoch. This value is only usable in a browser, and only when the\n * performance API is available.\n */\nconst browserPerformanceTimeOrigin = (() => {\n // Unfortunately browsers may report an inaccurate time origin data, through either performance.timeOrigin or\n // performance.timing.navigationStart, which results in poor results in performance data. We only treat time origin\n // data as reliable if they are within a reasonable threshold of the current time.\n\n const { performance } = WINDOW;\n if (!performance || !performance.now) {\n _browserPerformanceTimeOriginMode = 'none';\n return undefined;\n }\n\n const threshold = 3600 * 1000;\n const performanceNow = performance.now();\n const dateNow = Date.now();\n\n // if timeOrigin isn't available set delta to threshold so it isn't used\n const timeOriginDelta = performance.timeOrigin\n ? Math.abs(performance.timeOrigin + performanceNow - dateNow)\n : threshold;\n const timeOriginIsReliable = timeOriginDelta < threshold;\n\n // While performance.timing.navigationStart is deprecated in favor of performance.timeOrigin, performance.timeOrigin\n // is not as widely supported. Namely, performance.timeOrigin is undefined in Safari as of writing.\n // Also as of writing, performance.timing is not available in Web Workers in mainstream browsers, so it is not always\n // a valid fallback. In the absence of an initial time provided by the browser, fallback to the current time from the\n // Date API.\n // eslint-disable-next-line deprecation/deprecation\n const navigationStart = performance.timing && performance.timing.navigationStart;\n const hasNavigationStart = typeof navigationStart === 'number';\n // if navigationStart isn't available set delta to threshold so it isn't used\n const navigationStartDelta = hasNavigationStart ? Math.abs(navigationStart + performanceNow - dateNow) : threshold;\n const navigationStartIsReliable = navigationStartDelta < threshold;\n\n if (timeOriginIsReliable || navigationStartIsReliable) {\n // Use the more reliable time origin\n if (timeOriginDelta <= navigationStartDelta) {\n _browserPerformanceTimeOriginMode = 'timeOrigin';\n return performance.timeOrigin;\n } else {\n _browserPerformanceTimeOriginMode = 'navigationStart';\n return navigationStart;\n }\n }\n\n // Either both timeOrigin and navigationStart are skewed or neither is available, fallback to Date.\n _browserPerformanceTimeOriginMode = 'dateNow';\n return dateNow;\n})();\n\nexport { _browserPerformanceTimeOriginMode, browserPerformanceTimeOrigin, dateTimestampInSeconds, timestampInSeconds, timestampWithMs, usingPerformanceAPI };\n","/** Internal global with common properties and Sentry extensions */\n\n// The code below for 'isGlobalObj' and 'GLOBAL_OBJ' was copied from core-js before modification\n// https://github.com/zloirock/core-js/blob/1b944df55282cdc99c90db5f49eb0b6eda2cc0a3/packages/core-js/internals/global.js\n// core-js has the following licence:\n//\n// Copyright (c) 2014-2022 Denis Pushkarev\n//\n// Permission is hereby granted, free of charge, to any person obtaining a copy\n// of this software and associated documentation files (the \"Software\"), to deal\n// in the Software without restriction, including without limitation the rights\n// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell\n// copies of the Software, and to permit persons to whom the Software is\n// furnished to do so, subject to the following conditions:\n//\n// The above copyright notice and this permission notice shall be included in\n// all copies or substantial portions of the Software.\n//\n// THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\n// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\n// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\n// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\n// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN\n// THE SOFTWARE.\n\n/** Returns 'obj' if it's the global object, otherwise returns undefined */\nfunction isGlobalObj(obj) {\n return obj && obj.Math == Math ? obj : undefined;\n}\n\n/** Get's the global object for the current JavaScript runtime */\nconst GLOBAL_OBJ =\n (typeof globalThis == 'object' && isGlobalObj(globalThis)) ||\n // eslint-disable-next-line no-restricted-globals\n (typeof window == 'object' && isGlobalObj(window)) ||\n (typeof self == 'object' && isGlobalObj(self)) ||\n (typeof global == 'object' && isGlobalObj(global)) ||\n (function () {\n return this;\n })() ||\n {};\n\n/**\n * @deprecated Use GLOBAL_OBJ instead or WINDOW from @sentry/browser. This will be removed in v8\n */\nfunction getGlobalObject() {\n return GLOBAL_OBJ ;\n}\n\n/**\n * Returns a global singleton contained in the global `__SENTRY__` object.\n *\n * If the singleton doesn't already exist in `__SENTRY__`, it will be created using the given factory\n * function and added to the `__SENTRY__` object.\n *\n * @param name name of the global singleton on __SENTRY__\n * @param creator creator Factory function to create the singleton if it doesn't already exist on `__SENTRY__`\n * @param obj (Optional) The global object on which to look for `__SENTRY__`, if not `GLOBAL_OBJ`'s return value\n * @returns the singleton\n */\nfunction getGlobalSingleton(name, creator, obj) {\n const gbl = (obj || GLOBAL_OBJ) ;\n const __SENTRY__ = (gbl.__SENTRY__ = gbl.__SENTRY__ || {});\n const singleton = __SENTRY__[name] || (__SENTRY__[name] = creator());\n return singleton;\n}\n\nexport { GLOBAL_OBJ, getGlobalObject, getGlobalSingleton };\n","/**\n * The code was extracted from:\n * https://github.com/davidchambers/Base64.js\n */\n\nvar chars = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=';\n\nfunction InvalidCharacterError(message) {\n this.message = message;\n}\n\nInvalidCharacterError.prototype = new Error();\nInvalidCharacterError.prototype.name = 'InvalidCharacterError';\n\nfunction polyfill (input) {\n var str = String(input).replace(/=+$/, '');\n if (str.length % 4 == 1) {\n throw new InvalidCharacterError(\"'atob' failed: The string to be decoded is not correctly encoded.\");\n }\n for (\n // initialize result and counters\n var bc = 0, bs, buffer, idx = 0, output = '';\n // get next character\n buffer = str.charAt(idx++);\n // character found in table? initialize bit storage and add its ascii value;\n ~buffer && (bs = bc % 4 ? bs * 64 + buffer : buffer,\n // and if not first of each 4 characters,\n // convert the first 8 bits to one ascii character\n bc++ % 4) ? output += String.fromCharCode(255 & bs >> (-2 * bc & 6)) : 0\n ) {\n // try to find character in table (0-63, not found => -1)\n buffer = chars.indexOf(buffer);\n }\n return output;\n}\n\n\nmodule.exports = typeof window !== 'undefined' && window.atob && window.atob.bind(window) || polyfill;\n","var atob = require('./atob');\n\nfunction b64DecodeUnicode(str) {\n return decodeURIComponent(atob(str).replace(/(.)/g, function (m, p) {\n var code = p.charCodeAt(0).toString(16).toUpperCase();\n if (code.length < 2) {\n code = '0' + code;\n }\n return '%' + code;\n }));\n}\n\nmodule.exports = function(str) {\n var output = str.replace(/-/g, \"+\").replace(/_/g, \"/\");\n switch (output.length % 4) {\n case 0:\n break;\n case 2:\n output += \"==\";\n break;\n case 3:\n output += \"=\";\n break;\n default:\n throw \"Illegal base64url string!\";\n }\n\n try{\n return b64DecodeUnicode(output);\n } catch (err) {\n return atob(output);\n }\n};\n","'use strict';\n\nvar base64_url_decode = require('./base64_url_decode');\n\nfunction InvalidTokenError(message) {\n this.message = message;\n}\n\nInvalidTokenError.prototype = new Error();\nInvalidTokenError.prototype.name = 'InvalidTokenError';\n\nmodule.exports = function (token,options) {\n if (typeof token !== 'string') {\n throw new InvalidTokenError('Invalid token specified');\n }\n\n options = options || {};\n var pos = options.header === true ? 0 : 1;\n try {\n return JSON.parse(base64_url_decode(token.split('.')[pos]));\n } catch (e) {\n throw new InvalidTokenError('Invalid token specified: ' + e.message);\n }\n};\n\nmodule.exports.InvalidTokenError = InvalidTokenError;\n","import { Subject } from './Subject';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nexport class BehaviorSubject extends Subject {\n constructor(_value) {\n super();\n this._value = _value;\n }\n get value() {\n return this.getValue();\n }\n _subscribe(subscriber) {\n const subscription = super._subscribe(subscriber);\n if (subscription && !subscription.closed) {\n subscriber.next(this._value);\n }\n return subscription;\n }\n getValue() {\n if (this.hasError) {\n throw this.thrownError;\n }\n else if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return this._value;\n }\n }\n next(value) {\n super.next(this._value = value);\n }\n}\n","import { empty } from './observable/empty';\nimport { of } from './observable/of';\nimport { throwError } from './observable/throwError';\nexport var NotificationKind;\n(function (NotificationKind) {\n NotificationKind[\"NEXT\"] = \"N\";\n NotificationKind[\"ERROR\"] = \"E\";\n NotificationKind[\"COMPLETE\"] = \"C\";\n})(NotificationKind || (NotificationKind = {}));\nexport class Notification {\n constructor(kind, value, error) {\n this.kind = kind;\n this.value = value;\n this.error = error;\n this.hasValue = kind === 'N';\n }\n observe(observer) {\n switch (this.kind) {\n case 'N':\n return observer.next && observer.next(this.value);\n case 'E':\n return observer.error && observer.error(this.error);\n case 'C':\n return observer.complete && observer.complete();\n }\n }\n do(next, error, complete) {\n const kind = this.kind;\n switch (kind) {\n case 'N':\n return next && next(this.value);\n case 'E':\n return error && error(this.error);\n case 'C':\n return complete && complete();\n }\n }\n accept(nextOrObserver, error, complete) {\n if (nextOrObserver && typeof nextOrObserver.next === 'function') {\n return this.observe(nextOrObserver);\n }\n else {\n return this.do(nextOrObserver, error, complete);\n }\n }\n toObservable() {\n const kind = this.kind;\n switch (kind) {\n case 'N':\n return of(this.value);\n case 'E':\n return throwError(this.error);\n case 'C':\n return empty();\n }\n throw new Error('unexpected notification kind value');\n }\n static createNext(value) {\n if (typeof value !== 'undefined') {\n return new Notification('N', value);\n }\n return Notification.undefinedValueNotification;\n }\n static createError(err) {\n return new Notification('E', undefined, err);\n }\n static createComplete() {\n return Notification.completeNotification;\n }\n}\nNotification.completeNotification = new Notification('C');\nNotification.undefinedValueNotification = new Notification('N', undefined);\n","import { canReportError } from './util/canReportError';\nimport { toSubscriber } from './util/toSubscriber';\nimport { observable as Symbol_observable } from './symbol/observable';\nimport { pipeFromArray } from './util/pipe';\nimport { config } from './config';\nexport class Observable {\n constructor(subscribe) {\n this._isScalar = false;\n if (subscribe) {\n this._subscribe = subscribe;\n }\n }\n lift(operator) {\n const observable = new Observable();\n observable.source = this;\n observable.operator = operator;\n return observable;\n }\n subscribe(observerOrNext, error, complete) {\n const { operator } = this;\n const sink = toSubscriber(observerOrNext, error, complete);\n if (operator) {\n sink.add(operator.call(sink, this.source));\n }\n else {\n sink.add(this.source || (config.useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ?\n this._subscribe(sink) :\n this._trySubscribe(sink));\n }\n if (config.useDeprecatedSynchronousErrorHandling) {\n if (sink.syncErrorThrowable) {\n sink.syncErrorThrowable = false;\n if (sink.syncErrorThrown) {\n throw sink.syncErrorValue;\n }\n }\n }\n return sink;\n }\n _trySubscribe(sink) {\n try {\n return this._subscribe(sink);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n sink.syncErrorThrown = true;\n sink.syncErrorValue = err;\n }\n if (canReportError(sink)) {\n sink.error(err);\n }\n else {\n console.warn(err);\n }\n }\n }\n forEach(next, promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let subscription;\n subscription = this.subscribe((value) => {\n try {\n next(value);\n }\n catch (err) {\n reject(err);\n if (subscription) {\n subscription.unsubscribe();\n }\n }\n }, reject, resolve);\n });\n }\n _subscribe(subscriber) {\n const { source } = this;\n return source && source.subscribe(subscriber);\n }\n [Symbol_observable]() {\n return this;\n }\n pipe(...operations) {\n if (operations.length === 0) {\n return this;\n }\n return pipeFromArray(operations)(this);\n }\n toPromise(promiseCtor) {\n promiseCtor = getPromiseCtor(promiseCtor);\n return new promiseCtor((resolve, reject) => {\n let value;\n this.subscribe((x) => value = x, (err) => reject(err), () => resolve(value));\n });\n }\n}\nObservable.create = (subscribe) => {\n return new Observable(subscribe);\n};\nfunction getPromiseCtor(promiseCtor) {\n if (!promiseCtor) {\n promiseCtor = config.Promise || Promise;\n }\n if (!promiseCtor) {\n throw new Error('no Promise impl found');\n }\n return promiseCtor;\n}\n","import { Subscriber } from '../Subscriber';\nimport { rxSubscriber as rxSubscriberSymbol } from '../symbol/rxSubscriber';\nimport { empty as emptyObserver } from '../Observer';\nexport function toSubscriber(nextOrObserver, error, complete) {\n if (nextOrObserver) {\n if (nextOrObserver instanceof Subscriber) {\n return nextOrObserver;\n }\n if (nextOrObserver[rxSubscriberSymbol]) {\n return nextOrObserver[rxSubscriberSymbol]();\n }\n }\n if (!nextOrObserver && !error && !complete) {\n return new Subscriber(emptyObserver);\n }\n return new Subscriber(nextOrObserver, error, complete);\n}\n","import { Subscriber } from '../Subscriber';\nexport function canReportError(observer) {\n while (observer) {\n const { closed, destination, isStopped } = observer;\n if (closed || isStopped) {\n return false;\n }\n else if (destination && destination instanceof Subscriber) {\n observer = destination;\n }\n else {\n observer = null;\n }\n }\n return true;\n}\n","import { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport const empty = {\n closed: true,\n next(value) { },\n error(err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n },\n complete() { }\n};\n","import { Subscriber } from './Subscriber';\nexport class OuterSubscriber extends Subscriber {\n notifyNext(outerValue, innerValue, outerIndex, innerIndex, innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error, innerSub) {\n this.destination.error(error);\n }\n notifyComplete(innerSub) {\n this.destination.complete();\n }\n}\n","import { Subject } from './Subject';\nimport { queue } from './scheduler/queue';\nimport { Subscription } from './Subscription';\nimport { ObserveOnSubscriber } from './operators/observeOn';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { SubjectSubscription } from './SubjectSubscription';\nexport class ReplaySubject extends Subject {\n constructor(bufferSize = Number.POSITIVE_INFINITY, windowTime = Number.POSITIVE_INFINITY, scheduler) {\n super();\n this.scheduler = scheduler;\n this._events = [];\n this._infiniteTimeWindow = false;\n this._bufferSize = bufferSize < 1 ? 1 : bufferSize;\n this._windowTime = windowTime < 1 ? 1 : windowTime;\n if (windowTime === Number.POSITIVE_INFINITY) {\n this._infiniteTimeWindow = true;\n this.next = this.nextInfiniteTimeWindow;\n }\n else {\n this.next = this.nextTimeWindow;\n }\n }\n nextInfiniteTimeWindow(value) {\n if (!this.isStopped) {\n const _events = this._events;\n _events.push(value);\n if (_events.length > this._bufferSize) {\n _events.shift();\n }\n }\n super.next(value);\n }\n nextTimeWindow(value) {\n if (!this.isStopped) {\n this._events.push(new ReplayEvent(this._getNow(), value));\n this._trimBufferThenGetEvents();\n }\n super.next(value);\n }\n _subscribe(subscriber) {\n const _infiniteTimeWindow = this._infiniteTimeWindow;\n const _events = _infiniteTimeWindow ? this._events : this._trimBufferThenGetEvents();\n const scheduler = this.scheduler;\n const len = _events.length;\n let subscription;\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else if (this.isStopped || this.hasError) {\n subscription = Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n subscription = new SubjectSubscription(this, subscriber);\n }\n if (scheduler) {\n subscriber.add(subscriber = new ObserveOnSubscriber(subscriber, scheduler));\n }\n if (_infiniteTimeWindow) {\n for (let i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i]);\n }\n }\n else {\n for (let i = 0; i < len && !subscriber.closed; i++) {\n subscriber.next(_events[i].value);\n }\n }\n if (this.hasError) {\n subscriber.error(this.thrownError);\n }\n else if (this.isStopped) {\n subscriber.complete();\n }\n return subscription;\n }\n _getNow() {\n return (this.scheduler || queue).now();\n }\n _trimBufferThenGetEvents() {\n const now = this._getNow();\n const _bufferSize = this._bufferSize;\n const _windowTime = this._windowTime;\n const _events = this._events;\n const eventsCount = _events.length;\n let spliceCount = 0;\n while (spliceCount < eventsCount) {\n if ((now - _events[spliceCount].time) < _windowTime) {\n break;\n }\n spliceCount++;\n }\n if (eventsCount > _bufferSize) {\n spliceCount = Math.max(spliceCount, eventsCount - _bufferSize);\n }\n if (spliceCount > 0) {\n _events.splice(0, spliceCount);\n }\n return _events;\n }\n}\nclass ReplayEvent {\n constructor(time, value) {\n this.time = time;\n this.value = value;\n }\n}\n","import { Observable } from './Observable';\nimport { Subscriber } from './Subscriber';\nimport { Subscription } from './Subscription';\nimport { ObjectUnsubscribedError } from './util/ObjectUnsubscribedError';\nimport { SubjectSubscription } from './SubjectSubscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nexport class SubjectSubscriber extends Subscriber {\n constructor(destination) {\n super(destination);\n this.destination = destination;\n }\n}\nexport class Subject extends Observable {\n constructor() {\n super();\n this.observers = [];\n this.closed = false;\n this.isStopped = false;\n this.hasError = false;\n this.thrownError = null;\n }\n [rxSubscriberSymbol]() {\n return new SubjectSubscriber(this);\n }\n lift(operator) {\n const subject = new AnonymousSubject(this, this);\n subject.operator = operator;\n return subject;\n }\n next(value) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n if (!this.isStopped) {\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].next(value);\n }\n }\n }\n error(err) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.hasError = true;\n this.thrownError = err;\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].error(err);\n }\n this.observers.length = 0;\n }\n complete() {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n this.isStopped = true;\n const { observers } = this;\n const len = observers.length;\n const copy = observers.slice();\n for (let i = 0; i < len; i++) {\n copy[i].complete();\n }\n this.observers.length = 0;\n }\n unsubscribe() {\n this.isStopped = true;\n this.closed = true;\n this.observers = null;\n }\n _trySubscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else {\n return super._trySubscribe(subscriber);\n }\n }\n _subscribe(subscriber) {\n if (this.closed) {\n throw new ObjectUnsubscribedError();\n }\n else if (this.hasError) {\n subscriber.error(this.thrownError);\n return Subscription.EMPTY;\n }\n else if (this.isStopped) {\n subscriber.complete();\n return Subscription.EMPTY;\n }\n else {\n this.observers.push(subscriber);\n return new SubjectSubscription(this, subscriber);\n }\n }\n asObservable() {\n const observable = new Observable();\n observable.source = this;\n return observable;\n }\n}\nSubject.create = (destination, source) => {\n return new AnonymousSubject(destination, source);\n};\nexport class AnonymousSubject extends Subject {\n constructor(destination, source) {\n super();\n this.destination = destination;\n this.source = source;\n }\n next(value) {\n const { destination } = this;\n if (destination && destination.next) {\n destination.next(value);\n }\n }\n error(err) {\n const { destination } = this;\n if (destination && destination.error) {\n this.destination.error(err);\n }\n }\n complete() {\n const { destination } = this;\n if (destination && destination.complete) {\n this.destination.complete();\n }\n }\n _subscribe(subscriber) {\n const { source } = this;\n if (source) {\n return this.source.subscribe(subscriber);\n }\n else {\n return Subscription.EMPTY;\n }\n }\n}\n","import { Subscription } from './Subscription';\nexport class SubjectSubscription extends Subscription {\n constructor(subject, subscriber) {\n super();\n this.subject = subject;\n this.subscriber = subscriber;\n this.closed = false;\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.closed = true;\n const subject = this.subject;\n const observers = subject.observers;\n this.subject = null;\n if (!observers || observers.length === 0 || subject.isStopped || subject.closed) {\n return;\n }\n const subscriberIndex = observers.indexOf(this.subscriber);\n if (subscriberIndex !== -1) {\n observers.splice(subscriberIndex, 1);\n }\n }\n}\n","import { isFunction } from './util/isFunction';\nimport { empty as emptyObserver } from './Observer';\nimport { Subscription } from './Subscription';\nimport { rxSubscriber as rxSubscriberSymbol } from '../internal/symbol/rxSubscriber';\nimport { config } from './config';\nimport { hostReportError } from './util/hostReportError';\nexport class Subscriber extends Subscription {\n constructor(destinationOrNext, error, complete) {\n super();\n this.syncErrorValue = null;\n this.syncErrorThrown = false;\n this.syncErrorThrowable = false;\n this.isStopped = false;\n switch (arguments.length) {\n case 0:\n this.destination = emptyObserver;\n break;\n case 1:\n if (!destinationOrNext) {\n this.destination = emptyObserver;\n break;\n }\n if (typeof destinationOrNext === 'object') {\n if (destinationOrNext instanceof Subscriber) {\n this.syncErrorThrowable = destinationOrNext.syncErrorThrowable;\n this.destination = destinationOrNext;\n destinationOrNext.add(this);\n }\n else {\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext);\n }\n break;\n }\n default:\n this.syncErrorThrowable = true;\n this.destination = new SafeSubscriber(this, destinationOrNext, error, complete);\n break;\n }\n }\n [rxSubscriberSymbol]() { return this; }\n static create(next, error, complete) {\n const subscriber = new Subscriber(next, error, complete);\n subscriber.syncErrorThrowable = false;\n return subscriber;\n }\n next(value) {\n if (!this.isStopped) {\n this._next(value);\n }\n }\n error(err) {\n if (!this.isStopped) {\n this.isStopped = true;\n this._error(err);\n }\n }\n complete() {\n if (!this.isStopped) {\n this.isStopped = true;\n this._complete();\n }\n }\n unsubscribe() {\n if (this.closed) {\n return;\n }\n this.isStopped = true;\n super.unsubscribe();\n }\n _next(value) {\n this.destination.next(value);\n }\n _error(err) {\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.destination.complete();\n this.unsubscribe();\n }\n _unsubscribeAndRecycle() {\n const { _parentOrParents } = this;\n this._parentOrParents = null;\n this.unsubscribe();\n this.closed = false;\n this.isStopped = false;\n this._parentOrParents = _parentOrParents;\n return this;\n }\n}\nexport class SafeSubscriber extends Subscriber {\n constructor(_parentSubscriber, observerOrNext, error, complete) {\n super();\n this._parentSubscriber = _parentSubscriber;\n let next;\n let context = this;\n if (isFunction(observerOrNext)) {\n next = observerOrNext;\n }\n else if (observerOrNext) {\n next = observerOrNext.next;\n error = observerOrNext.error;\n complete = observerOrNext.complete;\n if (observerOrNext !== emptyObserver) {\n context = Object.create(observerOrNext);\n if (isFunction(context.unsubscribe)) {\n this.add(context.unsubscribe.bind(context));\n }\n context.unsubscribe = this.unsubscribe.bind(this);\n }\n }\n this._context = context;\n this._next = next;\n this._error = error;\n this._complete = complete;\n }\n next(value) {\n if (!this.isStopped && this._next) {\n const { _parentSubscriber } = this;\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._next, value);\n }\n else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) {\n this.unsubscribe();\n }\n }\n }\n error(err) {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n const { useDeprecatedSynchronousErrorHandling } = config;\n if (this._error) {\n if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(this._error, err);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, this._error, err);\n this.unsubscribe();\n }\n }\n else if (!_parentSubscriber.syncErrorThrowable) {\n this.unsubscribe();\n if (useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n hostReportError(err);\n }\n else {\n if (useDeprecatedSynchronousErrorHandling) {\n _parentSubscriber.syncErrorValue = err;\n _parentSubscriber.syncErrorThrown = true;\n }\n else {\n hostReportError(err);\n }\n this.unsubscribe();\n }\n }\n }\n complete() {\n if (!this.isStopped) {\n const { _parentSubscriber } = this;\n if (this._complete) {\n const wrappedComplete = () => this._complete.call(this._context);\n if (!config.useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) {\n this.__tryOrUnsub(wrappedComplete);\n this.unsubscribe();\n }\n else {\n this.__tryOrSetError(_parentSubscriber, wrappedComplete);\n this.unsubscribe();\n }\n }\n else {\n this.unsubscribe();\n }\n }\n }\n __tryOrUnsub(fn, value) {\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n this.unsubscribe();\n if (config.useDeprecatedSynchronousErrorHandling) {\n throw err;\n }\n else {\n hostReportError(err);\n }\n }\n }\n __tryOrSetError(parent, fn, value) {\n if (!config.useDeprecatedSynchronousErrorHandling) {\n throw new Error('bad call');\n }\n try {\n fn.call(this._context, value);\n }\n catch (err) {\n if (config.useDeprecatedSynchronousErrorHandling) {\n parent.syncErrorValue = err;\n parent.syncErrorThrown = true;\n return true;\n }\n else {\n hostReportError(err);\n return true;\n }\n }\n return false;\n }\n _unsubscribe() {\n const { _parentSubscriber } = this;\n this._context = null;\n this._parentSubscriber = null;\n _parentSubscriber.unsubscribe();\n }\n}\n","const UnsubscriptionErrorImpl = (() => {\n function UnsubscriptionErrorImpl(errors) {\n Error.call(this);\n this.message = errors ?\n `${errors.length} errors occurred during unsubscription:\n${errors.map((err, i) => `${i + 1}) ${err.toString()}`).join('\\n ')}` : '';\n this.name = 'UnsubscriptionError';\n this.errors = errors;\n return this;\n }\n UnsubscriptionErrorImpl.prototype = Object.create(Error.prototype);\n return UnsubscriptionErrorImpl;\n})();\nexport const UnsubscriptionError = UnsubscriptionErrorImpl;\n","import { isArray } from './util/isArray';\nimport { isObject } from './util/isObject';\nimport { isFunction } from './util/isFunction';\nimport { UnsubscriptionError } from './util/UnsubscriptionError';\nexport class Subscription {\n constructor(unsubscribe) {\n this.closed = false;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (unsubscribe) {\n this._ctorUnsubscribe = true;\n this._unsubscribe = unsubscribe;\n }\n }\n unsubscribe() {\n let errors;\n if (this.closed) {\n return;\n }\n let { _parentOrParents, _ctorUnsubscribe, _unsubscribe, _subscriptions } = this;\n this.closed = true;\n this._parentOrParents = null;\n this._subscriptions = null;\n if (_parentOrParents instanceof Subscription) {\n _parentOrParents.remove(this);\n }\n else if (_parentOrParents !== null) {\n for (let index = 0; index < _parentOrParents.length; ++index) {\n const parent = _parentOrParents[index];\n parent.remove(this);\n }\n }\n if (isFunction(_unsubscribe)) {\n if (_ctorUnsubscribe) {\n this._unsubscribe = undefined;\n }\n try {\n _unsubscribe.call(this);\n }\n catch (e) {\n errors = e instanceof UnsubscriptionError ? flattenUnsubscriptionErrors(e.errors) : [e];\n }\n }\n if (isArray(_subscriptions)) {\n let index = -1;\n let len = _subscriptions.length;\n while (++index < len) {\n const sub = _subscriptions[index];\n if (isObject(sub)) {\n try {\n sub.unsubscribe();\n }\n catch (e) {\n errors = errors || [];\n if (e instanceof UnsubscriptionError) {\n errors = errors.concat(flattenUnsubscriptionErrors(e.errors));\n }\n else {\n errors.push(e);\n }\n }\n }\n }\n }\n if (errors) {\n throw new UnsubscriptionError(errors);\n }\n }\n add(teardown) {\n let subscription = teardown;\n if (!teardown) {\n return Subscription.EMPTY;\n }\n switch (typeof teardown) {\n case 'function':\n subscription = new Subscription(teardown);\n case 'object':\n if (subscription === this || subscription.closed || typeof subscription.unsubscribe !== 'function') {\n return subscription;\n }\n else if (this.closed) {\n subscription.unsubscribe();\n return subscription;\n }\n else if (!(subscription instanceof Subscription)) {\n const tmp = subscription;\n subscription = new Subscription();\n subscription._subscriptions = [tmp];\n }\n break;\n default: {\n throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.');\n }\n }\n let { _parentOrParents } = subscription;\n if (_parentOrParents === null) {\n subscription._parentOrParents = this;\n }\n else if (_parentOrParents instanceof Subscription) {\n if (_parentOrParents === this) {\n return subscription;\n }\n subscription._parentOrParents = [_parentOrParents, this];\n }\n else if (_parentOrParents.indexOf(this) === -1) {\n _parentOrParents.push(this);\n }\n else {\n return subscription;\n }\n const subscriptions = this._subscriptions;\n if (subscriptions === null) {\n this._subscriptions = [subscription];\n }\n else {\n subscriptions.push(subscription);\n }\n return subscription;\n }\n remove(subscription) {\n const subscriptions = this._subscriptions;\n if (subscriptions) {\n const subscriptionIndex = subscriptions.indexOf(subscription);\n if (subscriptionIndex !== -1) {\n subscriptions.splice(subscriptionIndex, 1);\n }\n }\n }\n}\nSubscription.EMPTY = (function (empty) {\n empty.closed = true;\n return empty;\n}(new Subscription()));\nfunction flattenUnsubscriptionErrors(errors) {\n return errors.reduce((errs, err) => errs.concat((err instanceof UnsubscriptionError) ? err.errors : err), []);\n}\n","let _enable_super_gross_mode_that_will_cause_bad_things = false;\nexport const config = {\n Promise: undefined,\n set useDeprecatedSynchronousErrorHandling(value) {\n if (value) {\n const error = new Error();\n console.warn('DEPRECATED! RxJS was set to use deprecated synchronous error handling behavior by code at: \\n' + error.stack);\n }\n else if (_enable_super_gross_mode_that_will_cause_bad_things) {\n console.log('RxJS: Back to a better error behavior. Thank you. <3');\n }\n _enable_super_gross_mode_that_will_cause_bad_things = value;\n },\n get useDeprecatedSynchronousErrorHandling() {\n return _enable_super_gross_mode_that_will_cause_bad_things;\n },\n};\n","import { Subscriber } from './Subscriber';\nimport { Observable } from './Observable';\nimport { subscribeTo } from './util/subscribeTo';\nexport class SimpleInnerSubscriber extends Subscriber {\n constructor(parent) {\n super();\n this.parent = parent;\n }\n _next(value) {\n this.parent.notifyNext(value);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete();\n this.unsubscribe();\n }\n}\nexport class ComplexInnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this);\n }\n _error(error) {\n this.parent.notifyError(error);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\nexport class SimpleOuterSubscriber extends Subscriber {\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyError(err) {\n this.destination.error(err);\n }\n notifyComplete() {\n this.destination.complete();\n }\n}\nexport class ComplexOuterSubscriber extends Subscriber {\n notifyNext(_outerValue, innerValue, _outerIndex, _innerSub) {\n this.destination.next(innerValue);\n }\n notifyError(error) {\n this.destination.error(error);\n }\n notifyComplete(_innerSub) {\n this.destination.complete();\n }\n}\nexport function innerSubscribe(result, innerSubscriber) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n let subscription;\n try {\n subscription = subscribeTo(result)(innerSubscriber);\n }\n catch (error) {\n innerSubscriber.error(error);\n }\n return subscription;\n}\n","import { SubjectSubscriber } from '../Subject';\nimport { Observable } from '../Observable';\nimport { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nimport { refCount as higherOrderRefCount } from '../operators/refCount';\nexport class ConnectableObservable extends Observable {\n constructor(source, subjectFactory) {\n super();\n this.source = source;\n this.subjectFactory = subjectFactory;\n this._refCount = 0;\n this._isComplete = false;\n }\n _subscribe(subscriber) {\n return this.getSubject().subscribe(subscriber);\n }\n getSubject() {\n const subject = this._subject;\n if (!subject || subject.isStopped) {\n this._subject = this.subjectFactory();\n }\n return this._subject;\n }\n connect() {\n let connection = this._connection;\n if (!connection) {\n this._isComplete = false;\n connection = this._connection = new Subscription();\n connection.add(this.source\n .subscribe(new ConnectableSubscriber(this.getSubject(), this)));\n if (connection.closed) {\n this._connection = null;\n connection = Subscription.EMPTY;\n }\n }\n return connection;\n }\n refCount() {\n return higherOrderRefCount()(this);\n }\n}\nexport const connectableObservableDescriptor = (() => {\n const connectableProto = ConnectableObservable.prototype;\n return {\n operator: { value: null },\n _refCount: { value: 0, writable: true },\n _subject: { value: null, writable: true },\n _connection: { value: null, writable: true },\n _subscribe: { value: connectableProto._subscribe },\n _isComplete: { value: connectableProto._isComplete, writable: true },\n getSubject: { value: connectableProto.getSubject },\n connect: { value: connectableProto.connect },\n refCount: { value: connectableProto.refCount }\n };\n})();\nclass ConnectableSubscriber extends SubjectSubscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _error(err) {\n this._unsubscribe();\n super._error(err);\n }\n _complete() {\n this.connectable._isComplete = true;\n this._unsubscribe();\n super._complete();\n }\n _unsubscribe() {\n const connectable = this.connectable;\n if (connectable) {\n this.connectable = null;\n const connection = connectable._connection;\n connectable._refCount = 0;\n connectable._subject = null;\n connectable._connection = null;\n if (connection) {\n connection.unsubscribe();\n }\n }\n }\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { isArray } from '../util/isArray';\nimport { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nimport { fromArray } from './fromArray';\nconst NONE = {};\nexport function combineLatest(...observables) {\n let resultSelector = undefined;\n let scheduler = undefined;\n if (isScheduler(observables[observables.length - 1])) {\n scheduler = observables.pop();\n }\n if (typeof observables[observables.length - 1] === 'function') {\n resultSelector = observables.pop();\n }\n if (observables.length === 1 && isArray(observables[0])) {\n observables = observables[0];\n }\n return fromArray(observables, scheduler).lift(new CombineLatestOperator(resultSelector));\n}\nexport class CombineLatestOperator {\n constructor(resultSelector) {\n this.resultSelector = resultSelector;\n }\n call(subscriber, source) {\n return source.subscribe(new CombineLatestSubscriber(subscriber, this.resultSelector));\n }\n}\nexport class CombineLatestSubscriber extends OuterSubscriber {\n constructor(destination, resultSelector) {\n super(destination);\n this.resultSelector = resultSelector;\n this.active = 0;\n this.values = [];\n this.observables = [];\n }\n _next(observable) {\n this.values.push(NONE);\n this.observables.push(observable);\n }\n _complete() {\n const observables = this.observables;\n const len = observables.length;\n if (len === 0) {\n this.destination.complete();\n }\n else {\n this.active = len;\n this.toRespond = len;\n for (let i = 0; i < len; i++) {\n const observable = observables[i];\n this.add(subscribeToResult(this, observable, undefined, i));\n }\n }\n }\n notifyComplete(unused) {\n if ((this.active -= 1) === 0) {\n this.destination.complete();\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n const values = this.values;\n const oldVal = values[outerIndex];\n const toRespond = !this.toRespond\n ? 0\n : oldVal === NONE ? --this.toRespond : this.toRespond;\n values[outerIndex] = innerValue;\n if (toRespond === 0) {\n if (this.resultSelector) {\n this._tryResultSelector(values);\n }\n else {\n this.destination.next(values.slice());\n }\n }\n }\n _tryResultSelector(values) {\n let result;\n try {\n result = this.resultSelector.apply(this, values);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { of } from './of';\nimport { concatAll } from '../operators/concatAll';\nexport function concat(...observables) {\n return concatAll()(of(...observables));\n}\n","import { mergeAll } from './mergeAll';\nexport function concatAll() {\n return mergeAll(1);\n}\n","import { Observable } from '../Observable';\nimport { from } from './from';\nimport { empty } from './empty';\nexport function defer(observableFactory) {\n return new Observable(subscriber => {\n let input;\n try {\n input = observableFactory();\n }\n catch (err) {\n subscriber.error(err);\n return undefined;\n }\n const source = input ? from(input) : empty();\n return source.subscribe(subscriber);\n });\n}\n","import { Observable } from '../Observable';\nexport const EMPTY = new Observable(subscriber => subscriber.complete());\nexport function empty(scheduler) {\n return scheduler ? emptyScheduled(scheduler) : EMPTY;\n}\nfunction emptyScheduled(scheduler) {\n return new Observable(subscriber => scheduler.schedule(() => subscriber.complete()));\n}\n","import { Observable } from '../Observable';\nimport { isArray } from '../util/isArray';\nimport { map } from '../operators/map';\nimport { isObject } from '../util/isObject';\nimport { from } from './from';\nexport function forkJoin(...sources) {\n if (sources.length === 1) {\n const first = sources[0];\n if (isArray(first)) {\n return forkJoinInternal(first, null);\n }\n if (isObject(first) && Object.getPrototypeOf(first) === Object.prototype) {\n const keys = Object.keys(first);\n return forkJoinInternal(keys.map(key => first[key]), keys);\n }\n }\n if (typeof sources[sources.length - 1] === 'function') {\n const resultSelector = sources.pop();\n sources = (sources.length === 1 && isArray(sources[0])) ? sources[0] : sources;\n return forkJoinInternal(sources, null).pipe(map((args) => resultSelector(...args)));\n }\n return forkJoinInternal(sources, null);\n}\nfunction forkJoinInternal(sources, keys) {\n return new Observable(subscriber => {\n const len = sources.length;\n if (len === 0) {\n subscriber.complete();\n return;\n }\n const values = new Array(len);\n let completed = 0;\n let emitted = 0;\n for (let i = 0; i < len; i++) {\n const source = from(sources[i]);\n let hasValue = false;\n subscriber.add(source.subscribe({\n next: value => {\n if (!hasValue) {\n hasValue = true;\n emitted++;\n }\n values[i] = value;\n },\n error: err => subscriber.error(err),\n complete: () => {\n completed++;\n if (completed === len || !hasValue) {\n if (emitted === len) {\n subscriber.next(keys ?\n keys.reduce((result, key, i) => (result[key] = values[i], result), {}) :\n values);\n }\n subscriber.complete();\n }\n }\n }));\n }\n });\n}\n","import { Observable } from '../Observable';\nimport { subscribeTo } from '../util/subscribeTo';\nimport { scheduled } from '../scheduled/scheduled';\nexport function from(input, scheduler) {\n if (!scheduler) {\n if (input instanceof Observable) {\n return input;\n }\n return new Observable(subscribeTo(input));\n }\n else {\n return scheduled(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { subscribeToArray } from '../util/subscribeToArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function fromArray(input, scheduler) {\n if (!scheduler) {\n return new Observable(subscribeToArray(input));\n }\n else {\n return scheduleArray(input, scheduler);\n }\n}\n","import { Observable } from '../Observable';\nimport { isArray } from '../util/isArray';\nimport { isFunction } from '../util/isFunction';\nimport { map } from '../operators/map';\nconst toString = (() => Object.prototype.toString)();\nexport function fromEvent(target, eventName, options, resultSelector) {\n if (isFunction(options)) {\n resultSelector = options;\n options = undefined;\n }\n if (resultSelector) {\n return fromEvent(target, eventName, options).pipe(map(args => isArray(args) ? resultSelector(...args) : resultSelector(args)));\n }\n return new Observable(subscriber => {\n function handler(e) {\n if (arguments.length > 1) {\n subscriber.next(Array.prototype.slice.call(arguments));\n }\n else {\n subscriber.next(e);\n }\n }\n setupSubscription(target, eventName, handler, subscriber, options);\n });\n}\nfunction setupSubscription(sourceObj, eventName, handler, subscriber, options) {\n let unsubscribe;\n if (isEventTarget(sourceObj)) {\n const source = sourceObj;\n sourceObj.addEventListener(eventName, handler, options);\n unsubscribe = () => source.removeEventListener(eventName, handler, options);\n }\n else if (isJQueryStyleEventEmitter(sourceObj)) {\n const source = sourceObj;\n sourceObj.on(eventName, handler);\n unsubscribe = () => source.off(eventName, handler);\n }\n else if (isNodeStyleEventEmitter(sourceObj)) {\n const source = sourceObj;\n sourceObj.addListener(eventName, handler);\n unsubscribe = () => source.removeListener(eventName, handler);\n }\n else if (sourceObj && sourceObj.length) {\n for (let i = 0, len = sourceObj.length; i < len; i++) {\n setupSubscription(sourceObj[i], eventName, handler, subscriber, options);\n }\n }\n else {\n throw new TypeError('Invalid event target');\n }\n subscriber.add(unsubscribe);\n}\nfunction isNodeStyleEventEmitter(sourceObj) {\n return sourceObj && typeof sourceObj.addListener === 'function' && typeof sourceObj.removeListener === 'function';\n}\nfunction isJQueryStyleEventEmitter(sourceObj) {\n return sourceObj && typeof sourceObj.on === 'function' && typeof sourceObj.off === 'function';\n}\nfunction isEventTarget(sourceObj) {\n return sourceObj && typeof sourceObj.addEventListener === 'function' && typeof sourceObj.removeEventListener === 'function';\n}\n","import { Observable } from '../Observable';\nimport { isScheduler } from '../util/isScheduler';\nimport { mergeAll } from '../operators/mergeAll';\nimport { fromArray } from './fromArray';\nexport function merge(...observables) {\n let concurrent = Number.POSITIVE_INFINITY;\n let scheduler = null;\n let last = observables[observables.length - 1];\n if (isScheduler(last)) {\n scheduler = observables.pop();\n if (observables.length > 1 && typeof observables[observables.length - 1] === 'number') {\n concurrent = observables.pop();\n }\n }\n else if (typeof last === 'number') {\n concurrent = observables.pop();\n }\n if (scheduler === null && observables.length === 1 && observables[0] instanceof Observable) {\n return observables[0];\n }\n return mergeAll(concurrent)(fromArray(observables, scheduler));\n}\n","import { isScheduler } from '../util/isScheduler';\nimport { fromArray } from './fromArray';\nimport { scheduleArray } from '../scheduled/scheduleArray';\nexport function of(...args) {\n let scheduler = args[args.length - 1];\n if (isScheduler(scheduler)) {\n args.pop();\n return scheduleArray(args, scheduler);\n }\n else {\n return fromArray(args);\n }\n}\n","import { Observable } from '../Observable';\nexport function throwError(error, scheduler) {\n if (!scheduler) {\n return new Observable(subscriber => subscriber.error(error));\n }\n else {\n return new Observable(subscriber => scheduler.schedule(dispatch, 0, { error, subscriber }));\n }\n}\nfunction dispatch({ error, subscriber }) {\n subscriber.error(error);\n}\n","import { Observable } from '../Observable';\nimport { async } from '../scheduler/async';\nimport { isNumeric } from '../util/isNumeric';\nimport { isScheduler } from '../util/isScheduler';\nexport function timer(dueTime = 0, periodOrScheduler, scheduler) {\n let period = -1;\n if (isNumeric(periodOrScheduler)) {\n period = Number(periodOrScheduler) < 1 && 1 || Number(periodOrScheduler);\n }\n else if (isScheduler(periodOrScheduler)) {\n scheduler = periodOrScheduler;\n }\n if (!isScheduler(scheduler)) {\n scheduler = async;\n }\n return new Observable(subscriber => {\n const due = isNumeric(dueTime)\n ? dueTime\n : (+dueTime - scheduler.now());\n return scheduler.schedule(dispatch, due, {\n index: 0, period, subscriber\n });\n });\n}\nfunction dispatch(state) {\n const { index, period, subscriber } = state;\n subscriber.next(index);\n if (subscriber.closed) {\n return;\n }\n else if (period === -1) {\n return subscriber.complete();\n }\n state.index = index + 1;\n this.schedule(state, period);\n}\n","import { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function catchError(selector) {\n return function catchErrorOperatorFunction(source) {\n const operator = new CatchOperator(selector);\n const caught = source.lift(operator);\n return (operator.caught = caught);\n };\n}\nclass CatchOperator {\n constructor(selector) {\n this.selector = selector;\n }\n call(subscriber, source) {\n return source.subscribe(new CatchSubscriber(subscriber, this.selector, this.caught));\n }\n}\nclass CatchSubscriber extends SimpleOuterSubscriber {\n constructor(destination, selector, caught) {\n super(destination);\n this.selector = selector;\n this.caught = caught;\n }\n error(err) {\n if (!this.isStopped) {\n let result;\n try {\n result = this.selector(err, this.caught);\n }\n catch (err2) {\n super.error(err2);\n return;\n }\n this._unsubscribeAndRecycle();\n const innerSubscriber = new SimpleInnerSubscriber(this);\n this.add(innerSubscriber);\n const innerSubscription = innerSubscribe(result, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n this.add(innerSubscription);\n }\n }\n }\n}\n","import { mergeMap } from './mergeMap';\nexport function concatMap(project, resultSelector) {\n return mergeMap(project, resultSelector, 1);\n}\n","import { Subscriber } from '../Subscriber';\nimport { async } from '../scheduler/async';\nexport function debounceTime(dueTime, scheduler = async) {\n return (source) => source.lift(new DebounceTimeOperator(dueTime, scheduler));\n}\nclass DebounceTimeOperator {\n constructor(dueTime, scheduler) {\n this.dueTime = dueTime;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new DebounceTimeSubscriber(subscriber, this.dueTime, this.scheduler));\n }\n}\nclass DebounceTimeSubscriber extends Subscriber {\n constructor(destination, dueTime, scheduler) {\n super(destination);\n this.dueTime = dueTime;\n this.scheduler = scheduler;\n this.debouncedSubscription = null;\n this.lastValue = null;\n this.hasValue = false;\n }\n _next(value) {\n this.clearDebounce();\n this.lastValue = value;\n this.hasValue = true;\n this.add(this.debouncedSubscription = this.scheduler.schedule(dispatchNext, this.dueTime, this));\n }\n _complete() {\n this.debouncedNext();\n this.destination.complete();\n }\n debouncedNext() {\n this.clearDebounce();\n if (this.hasValue) {\n const { lastValue } = this;\n this.lastValue = null;\n this.hasValue = false;\n this.destination.next(lastValue);\n }\n }\n clearDebounce() {\n const debouncedSubscription = this.debouncedSubscription;\n if (debouncedSubscription !== null) {\n this.remove(debouncedSubscription);\n debouncedSubscription.unsubscribe();\n this.debouncedSubscription = null;\n }\n }\n}\nfunction dispatchNext(subscriber) {\n subscriber.debouncedNext();\n}\n","import { Subscriber } from '../Subscriber';\nexport function defaultIfEmpty(defaultValue = null) {\n return (source) => source.lift(new DefaultIfEmptyOperator(defaultValue));\n}\nclass DefaultIfEmptyOperator {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n call(subscriber, source) {\n return source.subscribe(new DefaultIfEmptySubscriber(subscriber, this.defaultValue));\n }\n}\nclass DefaultIfEmptySubscriber extends Subscriber {\n constructor(destination, defaultValue) {\n super(destination);\n this.defaultValue = defaultValue;\n this.isEmpty = true;\n }\n _next(value) {\n this.isEmpty = false;\n this.destination.next(value);\n }\n _complete() {\n if (this.isEmpty) {\n this.destination.next(this.defaultValue);\n }\n this.destination.complete();\n }\n}\n","import { async } from '../scheduler/async';\nimport { isDate } from '../util/isDate';\nimport { Subscriber } from '../Subscriber';\nimport { Notification } from '../Notification';\nexport function delay(delay, scheduler = async) {\n const absoluteDelay = isDate(delay);\n const delayFor = absoluteDelay ? (+delay - scheduler.now()) : Math.abs(delay);\n return (source) => source.lift(new DelayOperator(delayFor, scheduler));\n}\nclass DelayOperator {\n constructor(delay, scheduler) {\n this.delay = delay;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new DelaySubscriber(subscriber, this.delay, this.scheduler));\n }\n}\nclass DelaySubscriber extends Subscriber {\n constructor(destination, delay, scheduler) {\n super(destination);\n this.delay = delay;\n this.scheduler = scheduler;\n this.queue = [];\n this.active = false;\n this.errored = false;\n }\n static dispatch(state) {\n const source = state.source;\n const queue = source.queue;\n const scheduler = state.scheduler;\n const destination = state.destination;\n while (queue.length > 0 && (queue[0].time - scheduler.now()) <= 0) {\n queue.shift().notification.observe(destination);\n }\n if (queue.length > 0) {\n const delay = Math.max(0, queue[0].time - scheduler.now());\n this.schedule(state, delay);\n }\n else {\n this.unsubscribe();\n source.active = false;\n }\n }\n _schedule(scheduler) {\n this.active = true;\n const destination = this.destination;\n destination.add(scheduler.schedule(DelaySubscriber.dispatch, this.delay, {\n source: this, destination: this.destination, scheduler: scheduler\n }));\n }\n scheduleNotification(notification) {\n if (this.errored === true) {\n return;\n }\n const scheduler = this.scheduler;\n const message = new DelayMessage(scheduler.now() + this.delay, notification);\n this.queue.push(message);\n if (this.active === false) {\n this._schedule(scheduler);\n }\n }\n _next(value) {\n this.scheduleNotification(Notification.createNext(value));\n }\n _error(err) {\n this.errored = true;\n this.queue = [];\n this.destination.error(err);\n this.unsubscribe();\n }\n _complete() {\n this.scheduleNotification(Notification.createComplete());\n this.unsubscribe();\n }\n}\nclass DelayMessage {\n constructor(time, notification) {\n this.time = time;\n this.notification = notification;\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function distinctUntilChanged(compare, keySelector) {\n return (source) => source.lift(new DistinctUntilChangedOperator(compare, keySelector));\n}\nclass DistinctUntilChangedOperator {\n constructor(compare, keySelector) {\n this.compare = compare;\n this.keySelector = keySelector;\n }\n call(subscriber, source) {\n return source.subscribe(new DistinctUntilChangedSubscriber(subscriber, this.compare, this.keySelector));\n }\n}\nclass DistinctUntilChangedSubscriber extends Subscriber {\n constructor(destination, compare, keySelector) {\n super(destination);\n this.keySelector = keySelector;\n this.hasKey = false;\n if (typeof compare === 'function') {\n this.compare = compare;\n }\n }\n compare(x, y) {\n return x === y;\n }\n _next(value) {\n let key;\n try {\n const { keySelector } = this;\n key = keySelector ? keySelector(value) : value;\n }\n catch (err) {\n return this.destination.error(err);\n }\n let result = false;\n if (this.hasKey) {\n try {\n const { compare } = this;\n result = compare(this.key, key);\n }\n catch (err) {\n return this.destination.error(err);\n }\n }\n else {\n this.hasKey = true;\n }\n if (!result) {\n this.key = key;\n this.destination.next(value);\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function filter(predicate, thisArg) {\n return function filterOperatorFunction(source) {\n return source.lift(new FilterOperator(predicate, thisArg));\n };\n}\nclass FilterOperator {\n constructor(predicate, thisArg) {\n this.predicate = predicate;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new FilterSubscriber(subscriber, this.predicate, this.thisArg));\n }\n}\nclass FilterSubscriber extends Subscriber {\n constructor(destination, predicate, thisArg) {\n super(destination);\n this.predicate = predicate;\n this.thisArg = thisArg;\n this.count = 0;\n }\n _next(value) {\n let result;\n try {\n result = this.predicate.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n if (result) {\n this.destination.next(value);\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nimport { Subscription } from '../Subscription';\nexport function finalize(callback) {\n return (source) => source.lift(new FinallyOperator(callback));\n}\nclass FinallyOperator {\n constructor(callback) {\n this.callback = callback;\n }\n call(subscriber, source) {\n return source.subscribe(new FinallySubscriber(subscriber, this.callback));\n }\n}\nclass FinallySubscriber extends Subscriber {\n constructor(destination, callback) {\n super(destination);\n this.add(new Subscription(callback));\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { filter } from './filter';\nimport { take } from './take';\nimport { defaultIfEmpty } from './defaultIfEmpty';\nimport { throwIfEmpty } from './throwIfEmpty';\nimport { identity } from '../util/identity';\nexport function first(predicate, defaultValue) {\n const hasDefaultValue = arguments.length >= 2;\n return (source) => source.pipe(predicate ? filter((v, i) => predicate(v, i, source)) : identity, take(1), hasDefaultValue ? defaultIfEmpty(defaultValue) : throwIfEmpty(() => new EmptyError()));\n}\n","import { Subscriber } from '../Subscriber';\nexport function map(project, thisArg) {\n return function mapOperation(source) {\n if (typeof project !== 'function') {\n throw new TypeError('argument is not a function. Are you looking for `mapTo()`?');\n }\n return source.lift(new MapOperator(project, thisArg));\n };\n}\nexport class MapOperator {\n constructor(project, thisArg) {\n this.project = project;\n this.thisArg = thisArg;\n }\n call(subscriber, source) {\n return source.subscribe(new MapSubscriber(subscriber, this.project, this.thisArg));\n }\n}\nclass MapSubscriber extends Subscriber {\n constructor(destination, project, thisArg) {\n super(destination);\n this.project = project;\n this.count = 0;\n this.thisArg = thisArg || this;\n }\n _next(value) {\n let result;\n try {\n result = this.project.call(this.thisArg, value, this.count++);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function mapTo(value) {\n return (source) => source.lift(new MapToOperator(value));\n}\nclass MapToOperator {\n constructor(value) {\n this.value = value;\n }\n call(subscriber, source) {\n return source.subscribe(new MapToSubscriber(subscriber, this.value));\n }\n}\nclass MapToSubscriber extends Subscriber {\n constructor(destination, value) {\n super(destination);\n this.value = value;\n }\n _next(x) {\n this.destination.next(this.value);\n }\n}\n","import { mergeMap } from './mergeMap';\nimport { identity } from '../util/identity';\nexport function mergeAll(concurrent = Number.POSITIVE_INFINITY) {\n return mergeMap(identity, concurrent);\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function mergeMap(project, resultSelector, concurrent = Number.POSITIVE_INFINITY) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(mergeMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii))), concurrent));\n }\n else if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return (source) => source.lift(new MergeMapOperator(project, concurrent));\n}\nexport class MergeMapOperator {\n constructor(project, concurrent = Number.POSITIVE_INFINITY) {\n this.project = project;\n this.concurrent = concurrent;\n }\n call(observer, source) {\n return source.subscribe(new MergeMapSubscriber(observer, this.project, this.concurrent));\n }\n}\nexport class MergeMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project, concurrent = Number.POSITIVE_INFINITY) {\n super(destination);\n this.project = project;\n this.concurrent = concurrent;\n this.hasCompleted = false;\n this.buffer = [];\n this.active = 0;\n this.index = 0;\n }\n _next(value) {\n if (this.active < this.concurrent) {\n this._tryNext(value);\n }\n else {\n this.buffer.push(value);\n }\n }\n _tryNext(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.active++;\n this._innerSub(result);\n }\n _innerSub(ish) {\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n const innerSubscription = innerSubscribe(ish, innerSubscriber);\n if (innerSubscription !== innerSubscriber) {\n destination.add(innerSubscription);\n }\n }\n _complete() {\n this.hasCompleted = true;\n if (this.active === 0 && this.buffer.length === 0) {\n this.destination.complete();\n }\n this.unsubscribe();\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n notifyComplete() {\n const buffer = this.buffer;\n this.active--;\n if (buffer.length > 0) {\n this._next(buffer.shift());\n }\n else if (this.active === 0 && this.hasCompleted) {\n this.destination.complete();\n }\n }\n}\nexport const flatMap = mergeMap;\n","import { mergeMap } from './mergeMap';\nexport function mergeMapTo(innerObservable, resultSelector, concurrent = Number.POSITIVE_INFINITY) {\n if (typeof resultSelector === 'function') {\n return mergeMap(() => innerObservable, resultSelector, concurrent);\n }\n if (typeof resultSelector === 'number') {\n concurrent = resultSelector;\n }\n return mergeMap(() => innerObservable, concurrent);\n}\n","import { Subscriber } from '../Subscriber';\nimport { Notification } from '../Notification';\nexport function observeOn(scheduler, delay = 0) {\n return function observeOnOperatorFunction(source) {\n return source.lift(new ObserveOnOperator(scheduler, delay));\n };\n}\nexport class ObserveOnOperator {\n constructor(scheduler, delay = 0) {\n this.scheduler = scheduler;\n this.delay = delay;\n }\n call(subscriber, source) {\n return source.subscribe(new ObserveOnSubscriber(subscriber, this.scheduler, this.delay));\n }\n}\nexport class ObserveOnSubscriber extends Subscriber {\n constructor(destination, scheduler, delay = 0) {\n super(destination);\n this.scheduler = scheduler;\n this.delay = delay;\n }\n static dispatch(arg) {\n const { notification, destination } = arg;\n notification.observe(destination);\n this.unsubscribe();\n }\n scheduleMessage(notification) {\n const destination = this.destination;\n destination.add(this.scheduler.schedule(ObserveOnSubscriber.dispatch, this.delay, new ObserveOnMessage(notification, this.destination)));\n }\n _next(value) {\n this.scheduleMessage(Notification.createNext(value));\n }\n _error(err) {\n this.scheduleMessage(Notification.createError(err));\n this.unsubscribe();\n }\n _complete() {\n this.scheduleMessage(Notification.createComplete());\n this.unsubscribe();\n }\n}\nexport class ObserveOnMessage {\n constructor(notification, destination) {\n this.notification = notification;\n this.destination = destination;\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function refCount() {\n return function refCountOperatorFunction(source) {\n return source.lift(new RefCountOperator(source));\n };\n}\nclass RefCountOperator {\n constructor(connectable) {\n this.connectable = connectable;\n }\n call(subscriber, source) {\n const { connectable } = this;\n connectable._refCount++;\n const refCounter = new RefCountSubscriber(subscriber, connectable);\n const subscription = source.subscribe(refCounter);\n if (!refCounter.closed) {\n refCounter.connection = connectable.connect();\n }\n return subscription;\n }\n}\nclass RefCountSubscriber extends Subscriber {\n constructor(destination, connectable) {\n super(destination);\n this.connectable = connectable;\n }\n _unsubscribe() {\n const { connectable } = this;\n if (!connectable) {\n this.connection = null;\n return;\n }\n this.connectable = null;\n const refCount = connectable._refCount;\n if (refCount <= 0) {\n this.connection = null;\n return;\n }\n connectable._refCount = refCount - 1;\n if (refCount > 1) {\n this.connection = null;\n return;\n }\n const { connection } = this;\n const sharedConnection = connectable._connection;\n this.connection = null;\n if (sharedConnection && (!connection || sharedConnection === connection)) {\n sharedConnection.unsubscribe();\n }\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function scan(accumulator, seed) {\n let hasSeed = false;\n if (arguments.length >= 2) {\n hasSeed = true;\n }\n return function scanOperatorFunction(source) {\n return source.lift(new ScanOperator(accumulator, seed, hasSeed));\n };\n}\nclass ScanOperator {\n constructor(accumulator, seed, hasSeed = false) {\n this.accumulator = accumulator;\n this.seed = seed;\n this.hasSeed = hasSeed;\n }\n call(subscriber, source) {\n return source.subscribe(new ScanSubscriber(subscriber, this.accumulator, this.seed, this.hasSeed));\n }\n}\nclass ScanSubscriber extends Subscriber {\n constructor(destination, accumulator, _seed, hasSeed) {\n super(destination);\n this.accumulator = accumulator;\n this._seed = _seed;\n this.hasSeed = hasSeed;\n this.index = 0;\n }\n get seed() {\n return this._seed;\n }\n set seed(value) {\n this.hasSeed = true;\n this._seed = value;\n }\n _next(value) {\n if (!this.hasSeed) {\n this.seed = value;\n this.destination.next(value);\n }\n else {\n return this._tryNext(value);\n }\n }\n _tryNext(value) {\n const index = this.index++;\n let result;\n try {\n result = this.accumulator(this.seed, value, index);\n }\n catch (err) {\n this.destination.error(err);\n }\n this.seed = result;\n this.destination.next(result);\n }\n}\n","import { connectableObservableDescriptor } from '../observable/ConnectableObservable';\nexport function multicast(subjectOrSubjectFactory, selector) {\n return function multicastOperatorFunction(source) {\n let subjectFactory;\n if (typeof subjectOrSubjectFactory === 'function') {\n subjectFactory = subjectOrSubjectFactory;\n }\n else {\n subjectFactory = function subjectFactory() {\n return subjectOrSubjectFactory;\n };\n }\n if (typeof selector === 'function') {\n return source.lift(new MulticastOperator(subjectFactory, selector));\n }\n const connectable = Object.create(source, connectableObservableDescriptor);\n connectable.source = source;\n connectable.subjectFactory = subjectFactory;\n return connectable;\n };\n}\nexport class MulticastOperator {\n constructor(subjectFactory, selector) {\n this.subjectFactory = subjectFactory;\n this.selector = selector;\n }\n call(subscriber, source) {\n const { selector } = this;\n const subject = this.subjectFactory();\n const subscription = selector(subject).subscribe(subscriber);\n subscription.add(source.subscribe(subject));\n return subscription;\n }\n}\n","import { multicast } from './multicast';\nimport { refCount } from './refCount';\nimport { Subject } from '../Subject';\nfunction shareSubjectFactory() {\n return new Subject();\n}\nexport function share() {\n return (source) => refCount()(multicast(shareSubjectFactory)(source));\n}\n","import { Subscriber } from '../Subscriber';\nexport function skip(count) {\n return (source) => source.lift(new SkipOperator(count));\n}\nclass SkipOperator {\n constructor(total) {\n this.total = total;\n }\n call(subscriber, source) {\n return source.subscribe(new SkipSubscriber(subscriber, this.total));\n }\n}\nclass SkipSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.count = 0;\n }\n _next(x) {\n if (++this.count > this.total) {\n this.destination.next(x);\n }\n }\n}\n","import { concat } from '../observable/concat';\nimport { isScheduler } from '../util/isScheduler';\nexport function startWith(...array) {\n const scheduler = array[array.length - 1];\n if (isScheduler(scheduler)) {\n array.pop();\n return (source) => concat(array, source, scheduler);\n }\n else {\n return (source) => concat(array, source);\n }\n}\n","import { map } from './map';\nimport { from } from '../observable/from';\nimport { SimpleOuterSubscriber, SimpleInnerSubscriber, innerSubscribe } from '../innerSubscribe';\nexport function switchMap(project, resultSelector) {\n if (typeof resultSelector === 'function') {\n return (source) => source.pipe(switchMap((a, i) => from(project(a, i)).pipe(map((b, ii) => resultSelector(a, b, i, ii)))));\n }\n return (source) => source.lift(new SwitchMapOperator(project));\n}\nclass SwitchMapOperator {\n constructor(project) {\n this.project = project;\n }\n call(subscriber, source) {\n return source.subscribe(new SwitchMapSubscriber(subscriber, this.project));\n }\n}\nclass SwitchMapSubscriber extends SimpleOuterSubscriber {\n constructor(destination, project) {\n super(destination);\n this.project = project;\n this.index = 0;\n }\n _next(value) {\n let result;\n const index = this.index++;\n try {\n result = this.project(value, index);\n }\n catch (error) {\n this.destination.error(error);\n return;\n }\n this._innerSub(result);\n }\n _innerSub(result) {\n const innerSubscription = this.innerSubscription;\n if (innerSubscription) {\n innerSubscription.unsubscribe();\n }\n const innerSubscriber = new SimpleInnerSubscriber(this);\n const destination = this.destination;\n destination.add(innerSubscriber);\n this.innerSubscription = innerSubscribe(result, innerSubscriber);\n if (this.innerSubscription !== innerSubscriber) {\n destination.add(this.innerSubscription);\n }\n }\n _complete() {\n const { innerSubscription } = this;\n if (!innerSubscription || innerSubscription.closed) {\n super._complete();\n }\n this.unsubscribe();\n }\n _unsubscribe() {\n this.innerSubscription = undefined;\n }\n notifyComplete() {\n this.innerSubscription = undefined;\n if (this.isStopped) {\n super._complete();\n }\n }\n notifyNext(innerValue) {\n this.destination.next(innerValue);\n }\n}\n","import { switchMap } from './switchMap';\nexport function switchMapTo(innerObservable, resultSelector) {\n return resultSelector ? switchMap(() => innerObservable, resultSelector) : switchMap(() => innerObservable);\n}\n","import { Subscriber } from '../Subscriber';\nimport { ArgumentOutOfRangeError } from '../util/ArgumentOutOfRangeError';\nimport { empty } from '../observable/empty';\nexport function take(count) {\n return (source) => {\n if (count === 0) {\n return empty();\n }\n else {\n return source.lift(new TakeOperator(count));\n }\n };\n}\nclass TakeOperator {\n constructor(total) {\n this.total = total;\n if (this.total < 0) {\n throw new ArgumentOutOfRangeError;\n }\n }\n call(subscriber, source) {\n return source.subscribe(new TakeSubscriber(subscriber, this.total));\n }\n}\nclass TakeSubscriber extends Subscriber {\n constructor(destination, total) {\n super(destination);\n this.total = total;\n this.count = 0;\n }\n _next(value) {\n const total = this.total;\n const count = ++this.count;\n if (count <= total) {\n this.destination.next(value);\n if (count === total) {\n this.destination.complete();\n this.unsubscribe();\n }\n }\n }\n}\n","import { innerSubscribe, SimpleInnerSubscriber, SimpleOuterSubscriber } from '../innerSubscribe';\nexport function takeUntil(notifier) {\n return (source) => source.lift(new TakeUntilOperator(notifier));\n}\nclass TakeUntilOperator {\n constructor(notifier) {\n this.notifier = notifier;\n }\n call(subscriber, source) {\n const takeUntilSubscriber = new TakeUntilSubscriber(subscriber);\n const notifierSubscription = innerSubscribe(this.notifier, new SimpleInnerSubscriber(takeUntilSubscriber));\n if (notifierSubscription && !takeUntilSubscriber.seenValue) {\n takeUntilSubscriber.add(notifierSubscription);\n return source.subscribe(takeUntilSubscriber);\n }\n return takeUntilSubscriber;\n }\n}\nclass TakeUntilSubscriber extends SimpleOuterSubscriber {\n constructor(destination) {\n super(destination);\n this.seenValue = false;\n }\n notifyNext() {\n this.seenValue = true;\n this.complete();\n }\n notifyComplete() {\n }\n}\n","import { Subscriber } from '../Subscriber';\nexport function takeWhile(predicate, inclusive = false) {\n return (source) => source.lift(new TakeWhileOperator(predicate, inclusive));\n}\nclass TakeWhileOperator {\n constructor(predicate, inclusive) {\n this.predicate = predicate;\n this.inclusive = inclusive;\n }\n call(subscriber, source) {\n return source.subscribe(new TakeWhileSubscriber(subscriber, this.predicate, this.inclusive));\n }\n}\nclass TakeWhileSubscriber extends Subscriber {\n constructor(destination, predicate, inclusive) {\n super(destination);\n this.predicate = predicate;\n this.inclusive = inclusive;\n this.index = 0;\n }\n _next(value) {\n const destination = this.destination;\n let result;\n try {\n result = this.predicate(value, this.index++);\n }\n catch (err) {\n destination.error(err);\n return;\n }\n this.nextOrComplete(value, result);\n }\n nextOrComplete(value, predicateResult) {\n const destination = this.destination;\n if (Boolean(predicateResult)) {\n destination.next(value);\n }\n else {\n if (this.inclusive) {\n destination.next(value);\n }\n destination.complete();\n }\n }\n}\n","export function noop() { }\n","import { Subscriber } from '../Subscriber';\nimport { noop } from '../util/noop';\nimport { isFunction } from '../util/isFunction';\nexport function tap(nextOrObserver, error, complete) {\n return function tapOperatorFunction(source) {\n return source.lift(new DoOperator(nextOrObserver, error, complete));\n };\n}\nclass DoOperator {\n constructor(nextOrObserver, error, complete) {\n this.nextOrObserver = nextOrObserver;\n this.error = error;\n this.complete = complete;\n }\n call(subscriber, source) {\n return source.subscribe(new TapSubscriber(subscriber, this.nextOrObserver, this.error, this.complete));\n }\n}\nclass TapSubscriber extends Subscriber {\n constructor(destination, observerOrNext, error, complete) {\n super(destination);\n this._tapNext = noop;\n this._tapError = noop;\n this._tapComplete = noop;\n this._tapError = error || noop;\n this._tapComplete = complete || noop;\n if (isFunction(observerOrNext)) {\n this._context = this;\n this._tapNext = observerOrNext;\n }\n else if (observerOrNext) {\n this._context = observerOrNext;\n this._tapNext = observerOrNext.next || noop;\n this._tapError = observerOrNext.error || noop;\n this._tapComplete = observerOrNext.complete || noop;\n }\n }\n _next(value) {\n try {\n this._tapNext.call(this._context, value);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(value);\n }\n _error(err) {\n try {\n this._tapError.call(this._context, err);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.error(err);\n }\n _complete() {\n try {\n this._tapComplete.call(this._context);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n return this.destination.complete();\n }\n}\n","import { EmptyError } from '../util/EmptyError';\nimport { Subscriber } from '../Subscriber';\nexport function throwIfEmpty(errorFactory = defaultErrorFactory) {\n return (source) => {\n return source.lift(new ThrowIfEmptyOperator(errorFactory));\n };\n}\nclass ThrowIfEmptyOperator {\n constructor(errorFactory) {\n this.errorFactory = errorFactory;\n }\n call(subscriber, source) {\n return source.subscribe(new ThrowIfEmptySubscriber(subscriber, this.errorFactory));\n }\n}\nclass ThrowIfEmptySubscriber extends Subscriber {\n constructor(destination, errorFactory) {\n super(destination);\n this.errorFactory = errorFactory;\n this.hasValue = false;\n }\n _next(value) {\n this.hasValue = true;\n this.destination.next(value);\n }\n _complete() {\n if (!this.hasValue) {\n let err;\n try {\n err = this.errorFactory();\n }\n catch (e) {\n err = e;\n }\n this.destination.error(err);\n }\n else {\n return this.destination.complete();\n }\n }\n}\nfunction defaultErrorFactory() {\n return new EmptyError();\n}\n","const TimeoutErrorImpl = (() => {\n function TimeoutErrorImpl() {\n Error.call(this);\n this.message = 'Timeout has occurred';\n this.name = 'TimeoutError';\n return this;\n }\n TimeoutErrorImpl.prototype = Object.create(Error.prototype);\n return TimeoutErrorImpl;\n})();\nexport const TimeoutError = TimeoutErrorImpl;\n","import { async } from '../scheduler/async';\nimport { isDate } from '../util/isDate';\nimport { SimpleOuterSubscriber, innerSubscribe, SimpleInnerSubscriber } from '../innerSubscribe';\nexport function timeoutWith(due, withObservable, scheduler = async) {\n return (source) => {\n let absoluteTimeout = isDate(due);\n let waitFor = absoluteTimeout ? (+due - scheduler.now()) : Math.abs(due);\n return source.lift(new TimeoutWithOperator(waitFor, absoluteTimeout, withObservable, scheduler));\n };\n}\nclass TimeoutWithOperator {\n constructor(waitFor, absoluteTimeout, withObservable, scheduler) {\n this.waitFor = waitFor;\n this.absoluteTimeout = absoluteTimeout;\n this.withObservable = withObservable;\n this.scheduler = scheduler;\n }\n call(subscriber, source) {\n return source.subscribe(new TimeoutWithSubscriber(subscriber, this.absoluteTimeout, this.waitFor, this.withObservable, this.scheduler));\n }\n}\nclass TimeoutWithSubscriber extends SimpleOuterSubscriber {\n constructor(destination, absoluteTimeout, waitFor, withObservable, scheduler) {\n super(destination);\n this.absoluteTimeout = absoluteTimeout;\n this.waitFor = waitFor;\n this.withObservable = withObservable;\n this.scheduler = scheduler;\n this.scheduleTimeout();\n }\n static dispatchTimeout(subscriber) {\n const { withObservable } = subscriber;\n subscriber._unsubscribeAndRecycle();\n subscriber.add(innerSubscribe(withObservable, new SimpleInnerSubscriber(subscriber)));\n }\n scheduleTimeout() {\n const { action } = this;\n if (action) {\n this.action = action.schedule(this, this.waitFor);\n }\n else {\n this.add(this.action = this.scheduler.schedule(TimeoutWithSubscriber.dispatchTimeout, this.waitFor, this));\n }\n }\n _next(value) {\n if (!this.absoluteTimeout) {\n this.scheduleTimeout();\n }\n super._next(value);\n }\n _unsubscribe() {\n this.action = undefined;\n this.scheduler = null;\n this.withObservable = null;\n }\n}\n","import { async } from '../scheduler/async';\nimport { TimeoutError } from '../util/TimeoutError';\nimport { timeoutWith } from './timeoutWith';\nimport { throwError } from '../observable/throwError';\nexport function timeout(due, scheduler = async) {\n return timeoutWith(due, throwError(new TimeoutError()), scheduler);\n}\n","import { OuterSubscriber } from '../OuterSubscriber';\nimport { subscribeToResult } from '../util/subscribeToResult';\nexport function withLatestFrom(...args) {\n return (source) => {\n let project;\n if (typeof args[args.length - 1] === 'function') {\n project = args.pop();\n }\n const observables = args;\n return source.lift(new WithLatestFromOperator(observables, project));\n };\n}\nclass WithLatestFromOperator {\n constructor(observables, project) {\n this.observables = observables;\n this.project = project;\n }\n call(subscriber, source) {\n return source.subscribe(new WithLatestFromSubscriber(subscriber, this.observables, this.project));\n }\n}\nclass WithLatestFromSubscriber extends OuterSubscriber {\n constructor(destination, observables, project) {\n super(destination);\n this.observables = observables;\n this.project = project;\n this.toRespond = [];\n const len = observables.length;\n this.values = new Array(len);\n for (let i = 0; i < len; i++) {\n this.toRespond.push(i);\n }\n for (let i = 0; i < len; i++) {\n let observable = observables[i];\n this.add(subscribeToResult(this, observable, undefined, i));\n }\n }\n notifyNext(_outerValue, innerValue, outerIndex) {\n this.values[outerIndex] = innerValue;\n const toRespond = this.toRespond;\n if (toRespond.length > 0) {\n const found = toRespond.indexOf(outerIndex);\n if (found !== -1) {\n toRespond.splice(found, 1);\n }\n }\n }\n notifyComplete() {\n }\n _next(value) {\n if (this.toRespond.length === 0) {\n const args = [value, ...this.values];\n if (this.project) {\n this._tryProject(args);\n }\n else {\n this.destination.next(args);\n }\n }\n }\n _tryProject(args) {\n let result;\n try {\n result = this.project.apply(this, args);\n }\n catch (err) {\n this.destination.error(err);\n return;\n }\n this.destination.next(result);\n }\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function scheduleArray(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n let i = 0;\n sub.add(scheduler.schedule(function () {\n if (i === input.length) {\n subscriber.complete();\n return;\n }\n subscriber.next(input[i++]);\n if (!subscriber.closed) {\n sub.add(this.schedule());\n }\n }));\n return sub;\n });\n}\n","import { scheduleObservable } from './scheduleObservable';\nimport { schedulePromise } from './schedulePromise';\nimport { scheduleArray } from './scheduleArray';\nimport { scheduleIterable } from './scheduleIterable';\nimport { isInteropObservable } from '../util/isInteropObservable';\nimport { isPromise } from '../util/isPromise';\nimport { isArrayLike } from '../util/isArrayLike';\nimport { isIterable } from '../util/isIterable';\nexport function scheduled(input, scheduler) {\n if (input != null) {\n if (isInteropObservable(input)) {\n return scheduleObservable(input, scheduler);\n }\n else if (isPromise(input)) {\n return schedulePromise(input, scheduler);\n }\n else if (isArrayLike(input)) {\n return scheduleArray(input, scheduler);\n }\n else if (isIterable(input) || typeof input === 'string') {\n return scheduleIterable(input, scheduler);\n }\n }\n throw new TypeError((input !== null && typeof input || input) + ' is not observable');\n}\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport function isInteropObservable(input) {\n return input && typeof input[Symbol_observable] === 'function';\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport function scheduleObservable(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => {\n const observable = input[Symbol_observable]();\n sub.add(observable.subscribe({\n next(value) { sub.add(scheduler.schedule(() => subscriber.next(value))); },\n error(err) { sub.add(scheduler.schedule(() => subscriber.error(err))); },\n complete() { sub.add(scheduler.schedule(() => subscriber.complete())); },\n }));\n }));\n return sub;\n });\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nexport function schedulePromise(input, scheduler) {\n return new Observable(subscriber => {\n const sub = new Subscription();\n sub.add(scheduler.schedule(() => input.then(value => {\n sub.add(scheduler.schedule(() => {\n subscriber.next(value);\n sub.add(scheduler.schedule(() => subscriber.complete()));\n }));\n }, err => {\n sub.add(scheduler.schedule(() => subscriber.error(err)));\n })));\n return sub;\n });\n}\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function isIterable(input) {\n return input && typeof input[Symbol_iterator] === 'function';\n}\n","import { Observable } from '../Observable';\nimport { Subscription } from '../Subscription';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nexport function scheduleIterable(input, scheduler) {\n if (!input) {\n throw new Error('Iterable cannot be null');\n }\n return new Observable(subscriber => {\n const sub = new Subscription();\n let iterator;\n sub.add(() => {\n if (iterator && typeof iterator.return === 'function') {\n iterator.return();\n }\n });\n sub.add(scheduler.schedule(() => {\n iterator = input[Symbol_iterator]();\n sub.add(scheduler.schedule(function () {\n if (subscriber.closed) {\n return;\n }\n let value;\n let done;\n try {\n const result = iterator.next();\n value = result.value;\n done = result.done;\n }\n catch (err) {\n subscriber.error(err);\n return;\n }\n if (done) {\n subscriber.complete();\n }\n else {\n subscriber.next(value);\n this.schedule();\n }\n }));\n }));\n return sub;\n });\n}\n","import { Subscription } from '../Subscription';\nexport class Action extends Subscription {\n constructor(scheduler, work) {\n super();\n }\n schedule(state, delay = 0) {\n return this;\n }\n}\n","import { Action } from './Action';\nexport class AsyncAction extends Action {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n this.pending = false;\n }\n schedule(state, delay = 0) {\n if (this.closed) {\n return this;\n }\n this.state = state;\n const id = this.id;\n const scheduler = this.scheduler;\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, delay);\n }\n this.pending = true;\n this.delay = delay;\n this.id = this.id || this.requestAsyncId(scheduler, this.id, delay);\n return this;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n return setInterval(scheduler.flush.bind(scheduler, this), delay);\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && this.delay === delay && this.pending === false) {\n return id;\n }\n clearInterval(id);\n return undefined;\n }\n execute(state, delay) {\n if (this.closed) {\n return new Error('executing a cancelled action');\n }\n this.pending = false;\n const error = this._execute(state, delay);\n if (error) {\n return error;\n }\n else if (this.pending === false && this.id != null) {\n this.id = this.recycleAsyncId(this.scheduler, this.id, null);\n }\n }\n _execute(state, delay) {\n let errored = false;\n let errorValue = undefined;\n try {\n this.work(state);\n }\n catch (e) {\n errored = true;\n errorValue = !!e && e || new Error(e);\n }\n if (errored) {\n this.unsubscribe();\n return errorValue;\n }\n }\n _unsubscribe() {\n const id = this.id;\n const scheduler = this.scheduler;\n const actions = scheduler.actions;\n const index = actions.indexOf(this);\n this.work = null;\n this.state = null;\n this.pending = false;\n this.scheduler = null;\n if (index !== -1) {\n actions.splice(index, 1);\n }\n if (id != null) {\n this.id = this.recycleAsyncId(scheduler, id, null);\n }\n this.delay = null;\n }\n}\n","export class Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n this.SchedulerAction = SchedulerAction;\n this.now = now;\n }\n schedule(work, delay = 0, state) {\n return new this.SchedulerAction(this, work).schedule(state, delay);\n }\n}\nScheduler.now = () => Date.now();\n","import { Scheduler } from '../Scheduler';\nexport class AsyncScheduler extends Scheduler {\n constructor(SchedulerAction, now = Scheduler.now) {\n super(SchedulerAction, () => {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.now();\n }\n else {\n return now();\n }\n });\n this.actions = [];\n this.active = false;\n this.scheduled = undefined;\n }\n schedule(work, delay = 0, state) {\n if (AsyncScheduler.delegate && AsyncScheduler.delegate !== this) {\n return AsyncScheduler.delegate.schedule(work, delay, state);\n }\n else {\n return super.schedule(work, delay, state);\n }\n }\n flush(action) {\n const { actions } = this;\n if (this.active) {\n actions.push(action);\n return;\n }\n let error;\n this.active = true;\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (action = actions.shift());\n this.active = false;\n if (error) {\n while (action = actions.shift()) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { AnimationFrameAction } from './AnimationFrameAction';\nimport { AnimationFrameScheduler } from './AnimationFrameScheduler';\nexport const animationFrameScheduler = new AnimationFrameScheduler(AnimationFrameAction);\nexport const animationFrame = animationFrameScheduler;\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class AnimationFrameScheduler extends AsyncScheduler {\n flush(action) {\n this.active = true;\n this.scheduled = undefined;\n const { actions } = this;\n let error;\n let index = -1;\n let count = actions.length;\n action = action || actions.shift();\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (++index < count && (action = actions.shift()));\n this.active = false;\n if (error) {\n while (++index < count && (action = actions.shift())) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { AsyncAction } from './AsyncAction';\nexport class AnimationFrameAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && delay > 0) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n scheduler.actions.push(this);\n return scheduler.scheduled || (scheduler.scheduled = requestAnimationFrame(() => scheduler.flush(null)));\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.recycleAsyncId(scheduler, id, delay);\n }\n if (scheduler.actions.length === 0) {\n cancelAnimationFrame(id);\n scheduler.scheduled = undefined;\n }\n return undefined;\n }\n}\n","let nextHandle = 1;\nconst RESOLVED = (() => Promise.resolve())();\nconst activeHandles = {};\nfunction findAndClearHandle(handle) {\n if (handle in activeHandles) {\n delete activeHandles[handle];\n return true;\n }\n return false;\n}\nexport const Immediate = {\n setImmediate(cb) {\n const handle = nextHandle++;\n activeHandles[handle] = true;\n RESOLVED.then(() => findAndClearHandle(handle) && cb());\n return handle;\n },\n clearImmediate(handle) {\n findAndClearHandle(handle);\n },\n};\nexport const TestTools = {\n pending() {\n return Object.keys(activeHandles).length;\n }\n};\n","import { AsapAction } from './AsapAction';\nimport { AsapScheduler } from './AsapScheduler';\nexport const asapScheduler = new AsapScheduler(AsapAction);\nexport const asap = asapScheduler;\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class AsapScheduler extends AsyncScheduler {\n flush(action) {\n this.active = true;\n this.scheduled = undefined;\n const { actions } = this;\n let error;\n let index = -1;\n let count = actions.length;\n action = action || actions.shift();\n do {\n if (error = action.execute(action.state, action.delay)) {\n break;\n }\n } while (++index < count && (action = actions.shift()));\n this.active = false;\n if (error) {\n while (++index < count && (action = actions.shift())) {\n action.unsubscribe();\n }\n throw error;\n }\n }\n}\n","import { Immediate } from '../util/Immediate';\nimport { AsyncAction } from './AsyncAction';\nexport class AsapAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if (delay !== null && delay > 0) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n scheduler.actions.push(this);\n return scheduler.scheduled || (scheduler.scheduled = Immediate.setImmediate(scheduler.flush.bind(scheduler, null)));\n }\n recycleAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.recycleAsyncId(scheduler, id, delay);\n }\n if (scheduler.actions.length === 0) {\n Immediate.clearImmediate(id);\n scheduler.scheduled = undefined;\n }\n return undefined;\n }\n}\n","import { AsyncAction } from './AsyncAction';\nimport { AsyncScheduler } from './AsyncScheduler';\nexport const asyncScheduler = new AsyncScheduler(AsyncAction);\nexport const async = asyncScheduler;\n","import { QueueAction } from './QueueAction';\nimport { QueueScheduler } from './QueueScheduler';\nexport const queueScheduler = new QueueScheduler(QueueAction);\nexport const queue = queueScheduler;\n","import { AsyncScheduler } from './AsyncScheduler';\nexport class QueueScheduler extends AsyncScheduler {\n}\n","import { AsyncAction } from './AsyncAction';\nexport class QueueAction extends AsyncAction {\n constructor(scheduler, work) {\n super(scheduler, work);\n this.scheduler = scheduler;\n this.work = work;\n }\n schedule(state, delay = 0) {\n if (delay > 0) {\n return super.schedule(state, delay);\n }\n this.delay = delay;\n this.state = state;\n this.scheduler.flush(this);\n return this;\n }\n execute(state, delay) {\n return (delay > 0 || this.closed) ?\n super.execute(state, delay) :\n this._execute(state, delay);\n }\n requestAsyncId(scheduler, id, delay = 0) {\n if ((delay !== null && delay > 0) || (delay === null && this.delay > 0)) {\n return super.requestAsyncId(scheduler, id, delay);\n }\n return scheduler.flush(this);\n }\n}\n","export function getSymbolIterator() {\n if (typeof Symbol !== 'function' || !Symbol.iterator) {\n return '@@iterator';\n }\n return Symbol.iterator;\n}\nexport const iterator = getSymbolIterator();\nexport const $$iterator = iterator;\n","export const observable = (() => typeof Symbol === 'function' && Symbol.observable || '@@observable')();\n","export const rxSubscriber = (() => typeof Symbol === 'function'\n ? Symbol('rxSubscriber')\n : '@@rxSubscriber_' + Math.random())();\nexport const $$rxSubscriber = rxSubscriber;\n","const ArgumentOutOfRangeErrorImpl = (() => {\n function ArgumentOutOfRangeErrorImpl() {\n Error.call(this);\n this.message = 'argument out of range';\n this.name = 'ArgumentOutOfRangeError';\n return this;\n }\n ArgumentOutOfRangeErrorImpl.prototype = Object.create(Error.prototype);\n return ArgumentOutOfRangeErrorImpl;\n})();\nexport const ArgumentOutOfRangeError = ArgumentOutOfRangeErrorImpl;\n","const EmptyErrorImpl = (() => {\n function EmptyErrorImpl() {\n Error.call(this);\n this.message = 'no elements in sequence';\n this.name = 'EmptyError';\n return this;\n }\n EmptyErrorImpl.prototype = Object.create(Error.prototype);\n return EmptyErrorImpl;\n})();\nexport const EmptyError = EmptyErrorImpl;\n","const ObjectUnsubscribedErrorImpl = (() => {\n function ObjectUnsubscribedErrorImpl() {\n Error.call(this);\n this.message = 'object unsubscribed';\n this.name = 'ObjectUnsubscribedError';\n return this;\n }\n ObjectUnsubscribedErrorImpl.prototype = Object.create(Error.prototype);\n return ObjectUnsubscribedErrorImpl;\n})();\nexport const ObjectUnsubscribedError = ObjectUnsubscribedErrorImpl;\n","export function hostReportError(err) {\n setTimeout(() => { throw err; }, 0);\n}\n","export function identity(x) {\n return x;\n}\n","export const isArray = (() => Array.isArray || ((x) => x && typeof x.length === 'number'))();\n","export const isArrayLike = ((x) => x && typeof x.length === 'number' && typeof x !== 'function');\n","export function isDate(value) {\n return value instanceof Date && !isNaN(+value);\n}\n","export function isFunction(x) {\n return typeof x === 'function';\n}\n","import { isArray } from './isArray';\nexport function isNumeric(val) {\n return !isArray(val) && (val - parseFloat(val) + 1) >= 0;\n}\n","export function isObject(x) {\n return x !== null && typeof x === 'object';\n}\n","export function isPromise(value) {\n return !!value && typeof value.subscribe !== 'function' && typeof value.then === 'function';\n}\n","export function isScheduler(value) {\n return value && typeof value.schedule === 'function';\n}\n","import { identity } from './identity';\nexport function pipe(...fns) {\n return pipeFromArray(fns);\n}\nexport function pipeFromArray(fns) {\n if (fns.length === 0) {\n return identity;\n }\n if (fns.length === 1) {\n return fns[0];\n }\n return function piped(input) {\n return fns.reduce((prev, fn) => fn(prev), input);\n };\n}\n","import { subscribeToArray } from './subscribeToArray';\nimport { subscribeToPromise } from './subscribeToPromise';\nimport { subscribeToIterable } from './subscribeToIterable';\nimport { subscribeToObservable } from './subscribeToObservable';\nimport { isArrayLike } from './isArrayLike';\nimport { isPromise } from './isPromise';\nimport { isObject } from './isObject';\nimport { iterator as Symbol_iterator } from '../symbol/iterator';\nimport { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeTo = (result) => {\n if (!!result && typeof result[Symbol_observable] === 'function') {\n return subscribeToObservable(result);\n }\n else if (isArrayLike(result)) {\n return subscribeToArray(result);\n }\n else if (isPromise(result)) {\n return subscribeToPromise(result);\n }\n else if (!!result && typeof result[Symbol_iterator] === 'function') {\n return subscribeToIterable(result);\n }\n else {\n const value = isObject(result) ? 'an invalid object' : `'${result}'`;\n const msg = `You provided ${value} where a stream was expected.`\n + ' You can provide an Observable, Promise, Array, or Iterable.';\n throw new TypeError(msg);\n }\n};\n","import { observable as Symbol_observable } from '../symbol/observable';\nexport const subscribeToObservable = (obj) => (subscriber) => {\n const obs = obj[Symbol_observable]();\n if (typeof obs.subscribe !== 'function') {\n throw new TypeError('Provided object does not correctly implement Symbol.observable');\n }\n else {\n return obs.subscribe(subscriber);\n }\n};\n","import { hostReportError } from './hostReportError';\nexport const subscribeToPromise = (promise) => (subscriber) => {\n promise.then((value) => {\n if (!subscriber.closed) {\n subscriber.next(value);\n subscriber.complete();\n }\n }, (err) => subscriber.error(err))\n .then(null, hostReportError);\n return subscriber;\n};\n","import { iterator as Symbol_iterator } from '../symbol/iterator';\nexport const subscribeToIterable = (iterable) => (subscriber) => {\n const iterator = iterable[Symbol_iterator]();\n do {\n let item;\n try {\n item = iterator.next();\n }\n catch (err) {\n subscriber.error(err);\n return subscriber;\n }\n if (item.done) {\n subscriber.complete();\n break;\n }\n subscriber.next(item.value);\n if (subscriber.closed) {\n break;\n }\n } while (true);\n if (typeof iterator.return === 'function') {\n subscriber.add(() => {\n if (iterator.return) {\n iterator.return();\n }\n });\n }\n return subscriber;\n};\n","export const subscribeToArray = (array) => (subscriber) => {\n for (let i = 0, len = array.length; i < len && !subscriber.closed; i++) {\n subscriber.next(array[i]);\n }\n subscriber.complete();\n};\n","import { Subscriber } from './Subscriber';\nexport class InnerSubscriber extends Subscriber {\n constructor(parent, outerValue, outerIndex) {\n super();\n this.parent = parent;\n this.outerValue = outerValue;\n this.outerIndex = outerIndex;\n this.index = 0;\n }\n _next(value) {\n this.parent.notifyNext(this.outerValue, value, this.outerIndex, this.index++, this);\n }\n _error(error) {\n this.parent.notifyError(error, this);\n this.unsubscribe();\n }\n _complete() {\n this.parent.notifyComplete(this);\n this.unsubscribe();\n }\n}\n","import { InnerSubscriber } from '../InnerSubscriber';\nimport { subscribeTo } from './subscribeTo';\nimport { Observable } from '../Observable';\nexport function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, innerSubscriber = new InnerSubscriber(outerSubscriber, outerValue, outerIndex)) {\n if (innerSubscriber.closed) {\n return undefined;\n }\n if (result instanceof Observable) {\n return result.subscribe(innerSubscriber);\n }\n return subscribeTo(result)(innerSubscriber);\n}\n","const randomUUID = typeof crypto !== 'undefined' && crypto.randomUUID && crypto.randomUUID.bind(crypto);\nexport default {\n randomUUID\n};","// Unique ID creation requires a high quality random # generator. In the browser we therefore\n// require the crypto API and do not support built-in fallback to lower quality random number\n// generators (like Math.random()).\nlet getRandomValues;\nconst rnds8 = new Uint8Array(16);\nexport default function rng() {\n // lazy load so that environments that need to polyfill have a chance to do so\n if (!getRandomValues) {\n // getRandomValues needs to be invoked in a context where \"this\" is a Crypto implementation.\n getRandomValues = typeof crypto !== 'undefined' && crypto.getRandomValues && crypto.getRandomValues.bind(crypto);\n\n if (!getRandomValues) {\n throw new Error('crypto.getRandomValues() not supported. See https://github.com/uuidjs/uuid#getrandomvalues-not-supported');\n }\n }\n\n return getRandomValues(rnds8);\n}","import validate from './validate.js';\n/**\n * Convert array of 16 byte values to UUID string format of the form:\n * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX\n */\n\nconst byteToHex = [];\n\nfor (let i = 0; i < 256; ++i) {\n byteToHex.push((i + 0x100).toString(16).slice(1));\n}\n\nexport function unsafeStringify(arr, offset = 0) {\n // Note: Be careful editing this code! It's been tuned for performance\n // and works in ways you may not expect. See https://github.com/uuidjs/uuid/pull/434\n return (byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + '-' + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + '-' + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + '-' + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + '-' + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]).toLowerCase();\n}\n\nfunction stringify(arr, offset = 0) {\n const uuid = unsafeStringify(arr, offset); // Consistency check for valid UUID. If this throws, it's likely due to one\n // of the following:\n // - One or more input array values don't map to a hex octet (leading to\n // \"undefined\" in the uuid)\n // - Invalid input values for the RFC `version` or `variant` fields\n\n if (!validate(uuid)) {\n throw TypeError('Stringified UUID is invalid');\n }\n\n return uuid;\n}\n\nexport default stringify;","import native from './native.js';\nimport rng from './rng.js';\nimport { unsafeStringify } from './stringify.js';\n\nfunction v4(options, buf, offset) {\n if (native.randomUUID && !buf && !options) {\n return native.randomUUID();\n }\n\n options = options || {};\n const rnds = options.random || (options.rng || rng)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved`\n\n rnds[6] = rnds[6] & 0x0f | 0x40;\n rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided\n\n if (buf) {\n offset = offset || 0;\n\n for (let i = 0; i < 16; ++i) {\n buf[offset + i] = rnds[i];\n }\n\n return buf;\n }\n\n return unsafeStringify(rnds);\n}\n\nexport default v4;","'use strict';\n/**\n * @license Angular v\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n((function (global) {\n const performance = global['performance'];\n function mark(name) {\n performance && performance['mark'] && performance['mark'](name);\n }\n function performanceMeasure(name, label) {\n performance && performance['measure'] && performance['measure'](name, label);\n }\n mark('Zone');\n // Initialize before it's accessed below.\n // __Zone_symbol_prefix global can be used to override the default zone\n // symbol prefix with a custom one if needed.\n const symbolPrefix = global['__Zone_symbol_prefix'] || '__zone_symbol__';\n function __symbol__(name) {\n return symbolPrefix + name;\n }\n const checkDuplicate = global[__symbol__('forceDuplicateZoneCheck')] === true;\n if (global['Zone']) {\n // if global['Zone'] already exists (maybe zone.js was already loaded or\n // some other lib also registered a global object named Zone), we may need\n // to throw an error, but sometimes user may not want this error.\n // For example,\n // we have two web pages, page1 includes zone.js, page2 doesn't.\n // and the 1st time user load page1 and page2, everything work fine,\n // but when user load page2 again, error occurs because global['Zone'] already exists.\n // so we add a flag to let user choose whether to throw this error or not.\n // By default, if existing Zone is from zone.js, we will not throw the error.\n if (checkDuplicate || typeof global['Zone'].__symbol__ !== 'function') {\n throw new Error('Zone already loaded.');\n }\n else {\n return global['Zone'];\n }\n }\n class Zone {\n // tslint:disable-next-line:require-internal-with-underscore\n static { this.__symbol__ = __symbol__; }\n static assertZonePatched() {\n if (global['Promise'] !== patches['ZoneAwarePromise']) {\n throw new Error('Zone.js has detected that ZoneAwarePromise `(window|global).Promise` ' +\n 'has been overwritten.\\n' +\n 'Most likely cause is that a Promise polyfill has been loaded ' +\n 'after Zone.js (Polyfilling Promise api is not necessary when zone.js is loaded. ' +\n 'If you must load one, do so before loading zone.js.)');\n }\n }\n static get root() {\n let zone = Zone.current;\n while (zone.parent) {\n zone = zone.parent;\n }\n return zone;\n }\n static get current() {\n return _currentZoneFrame.zone;\n }\n static get currentTask() {\n return _currentTask;\n }\n // tslint:disable-next-line:require-internal-with-underscore\n static __load_patch(name, fn, ignoreDuplicate = false) {\n if (patches.hasOwnProperty(name)) {\n // `checkDuplicate` option is defined from global variable\n // so it works for all modules.\n // `ignoreDuplicate` can work for the specified module\n if (!ignoreDuplicate && checkDuplicate) {\n throw Error('Already loaded patch: ' + name);\n }\n }\n else if (!global['__Zone_disable_' + name]) {\n const perfName = 'Zone:' + name;\n mark(perfName);\n patches[name] = fn(global, Zone, _api);\n performanceMeasure(perfName, perfName);\n }\n }\n get parent() {\n return this._parent;\n }\n get name() {\n return this._name;\n }\n constructor(parent, zoneSpec) {\n this._parent = parent;\n this._name = zoneSpec ? zoneSpec.name || 'unnamed' : '';\n this._properties = zoneSpec && zoneSpec.properties || {};\n this._zoneDelegate =\n new _ZoneDelegate(this, this._parent && this._parent._zoneDelegate, zoneSpec);\n }\n get(key) {\n const zone = this.getZoneWith(key);\n if (zone)\n return zone._properties[key];\n }\n getZoneWith(key) {\n let current = this;\n while (current) {\n if (current._properties.hasOwnProperty(key)) {\n return current;\n }\n current = current._parent;\n }\n return null;\n }\n fork(zoneSpec) {\n if (!zoneSpec)\n throw new Error('ZoneSpec required!');\n return this._zoneDelegate.fork(this, zoneSpec);\n }\n wrap(callback, source) {\n if (typeof callback !== 'function') {\n throw new Error('Expecting function got: ' + callback);\n }\n const _callback = this._zoneDelegate.intercept(this, callback, source);\n const zone = this;\n return function () {\n return zone.runGuarded(_callback, this, arguments, source);\n };\n }\n run(callback, applyThis, applyArgs, source) {\n _currentZoneFrame = { parent: _currentZoneFrame, zone: this };\n try {\n return this._zoneDelegate.invoke(this, callback, applyThis, applyArgs, source);\n }\n finally {\n _currentZoneFrame = _currentZoneFrame.parent;\n }\n }\n runGuarded(callback, applyThis = null, applyArgs, source) {\n _currentZoneFrame = { parent: _currentZoneFrame, zone: this };\n try {\n try {\n return this._zoneDelegate.invoke(this, callback, applyThis, applyArgs, source);\n }\n catch (error) {\n if (this._zoneDelegate.handleError(this, error)) {\n throw error;\n }\n }\n }\n finally {\n _currentZoneFrame = _currentZoneFrame.parent;\n }\n }\n runTask(task, applyThis, applyArgs) {\n if (task.zone != this) {\n throw new Error('A task can only be run in the zone of creation! (Creation: ' +\n (task.zone || NO_ZONE).name + '; Execution: ' + this.name + ')');\n }\n // https://github.com/angular/zone.js/issues/778, sometimes eventTask\n // will run in notScheduled(canceled) state, we should not try to\n // run such kind of task but just return\n if (task.state === notScheduled && (task.type === eventTask || task.type === macroTask)) {\n return;\n }\n const reEntryGuard = task.state != running;\n reEntryGuard && task._transitionTo(running, scheduled);\n task.runCount++;\n const previousTask = _currentTask;\n _currentTask = task;\n _currentZoneFrame = { parent: _currentZoneFrame, zone: this };\n try {\n if (task.type == macroTask && task.data && !task.data.isPeriodic) {\n task.cancelFn = undefined;\n }\n try {\n return this._zoneDelegate.invokeTask(this, task, applyThis, applyArgs);\n }\n catch (error) {\n if (this._zoneDelegate.handleError(this, error)) {\n throw error;\n }\n }\n }\n finally {\n // if the task's state is notScheduled or unknown, then it has already been cancelled\n // we should not reset the state to scheduled\n if (task.state !== notScheduled && task.state !== unknown) {\n if (task.type == eventTask || (task.data && task.data.isPeriodic)) {\n reEntryGuard && task._transitionTo(scheduled, running);\n }\n else {\n task.runCount = 0;\n this._updateTaskCount(task, -1);\n reEntryGuard &&\n task._transitionTo(notScheduled, running, notScheduled);\n }\n }\n _currentZoneFrame = _currentZoneFrame.parent;\n _currentTask = previousTask;\n }\n }\n scheduleTask(task) {\n if (task.zone && task.zone !== this) {\n // check if the task was rescheduled, the newZone\n // should not be the children of the original zone\n let newZone = this;\n while (newZone) {\n if (newZone === task.zone) {\n throw Error(`can not reschedule task to ${this.name} which is descendants of the original zone ${task.zone.name}`);\n }\n newZone = newZone.parent;\n }\n }\n task._transitionTo(scheduling, notScheduled);\n const zoneDelegates = [];\n task._zoneDelegates = zoneDelegates;\n task._zone = this;\n try {\n task = this._zoneDelegate.scheduleTask(this, task);\n }\n catch (err) {\n // should set task's state to unknown when scheduleTask throw error\n // because the err may from reschedule, so the fromState maybe notScheduled\n task._transitionTo(unknown, scheduling, notScheduled);\n // TODO: @JiaLiPassion, should we check the result from handleError?\n this._zoneDelegate.handleError(this, err);\n throw err;\n }\n if (task._zoneDelegates === zoneDelegates) {\n // we have to check because internally the delegate can reschedule the task.\n this._updateTaskCount(task, 1);\n }\n if (task.state == scheduling) {\n task._transitionTo(scheduled, scheduling);\n }\n return task;\n }\n scheduleMicroTask(source, callback, data, customSchedule) {\n return this.scheduleTask(new ZoneTask(microTask, source, callback, data, customSchedule, undefined));\n }\n scheduleMacroTask(source, callback, data, customSchedule, customCancel) {\n return this.scheduleTask(new ZoneTask(macroTask, source, callback, data, customSchedule, customCancel));\n }\n scheduleEventTask(source, callback, data, customSchedule, customCancel) {\n return this.scheduleTask(new ZoneTask(eventTask, source, callback, data, customSchedule, customCancel));\n }\n cancelTask(task) {\n if (task.zone != this)\n throw new Error('A task can only be cancelled in the zone of creation! (Creation: ' +\n (task.zone || NO_ZONE).name + '; Execution: ' + this.name + ')');\n if (task.state !== scheduled && task.state !== running) {\n return;\n }\n task._transitionTo(canceling, scheduled, running);\n try {\n this._zoneDelegate.cancelTask(this, task);\n }\n catch (err) {\n // if error occurs when cancelTask, transit the state to unknown\n task._transitionTo(unknown, canceling);\n this._zoneDelegate.handleError(this, err);\n throw err;\n }\n this._updateTaskCount(task, -1);\n task._transitionTo(notScheduled, canceling);\n task.runCount = 0;\n return task;\n }\n _updateTaskCount(task, count) {\n const zoneDelegates = task._zoneDelegates;\n if (count == -1) {\n task._zoneDelegates = null;\n }\n for (let i = 0; i < zoneDelegates.length; i++) {\n zoneDelegates[i]._updateTaskCount(task.type, count);\n }\n }\n }\n const DELEGATE_ZS = {\n name: '',\n onHasTask: (delegate, _, target, hasTaskState) => delegate.hasTask(target, hasTaskState),\n onScheduleTask: (delegate, _, target, task) => delegate.scheduleTask(target, task),\n onInvokeTask: (delegate, _, target, task, applyThis, applyArgs) => delegate.invokeTask(target, task, applyThis, applyArgs),\n onCancelTask: (delegate, _, target, task) => delegate.cancelTask(target, task)\n };\n class _ZoneDelegate {\n constructor(zone, parentDelegate, zoneSpec) {\n this._taskCounts = { 'microTask': 0, 'macroTask': 0, 'eventTask': 0 };\n this.zone = zone;\n this._parentDelegate = parentDelegate;\n this._forkZS = zoneSpec && (zoneSpec && zoneSpec.onFork ? zoneSpec : parentDelegate._forkZS);\n this._forkDlgt = zoneSpec && (zoneSpec.onFork ? parentDelegate : parentDelegate._forkDlgt);\n this._forkCurrZone =\n zoneSpec && (zoneSpec.onFork ? this.zone : parentDelegate._forkCurrZone);\n this._interceptZS =\n zoneSpec && (zoneSpec.onIntercept ? zoneSpec : parentDelegate._interceptZS);\n this._interceptDlgt =\n zoneSpec && (zoneSpec.onIntercept ? parentDelegate : parentDelegate._interceptDlgt);\n this._interceptCurrZone =\n zoneSpec && (zoneSpec.onIntercept ? this.zone : parentDelegate._interceptCurrZone);\n this._invokeZS = zoneSpec && (zoneSpec.onInvoke ? zoneSpec : parentDelegate._invokeZS);\n this._invokeDlgt =\n zoneSpec && (zoneSpec.onInvoke ? parentDelegate : parentDelegate._invokeDlgt);\n this._invokeCurrZone =\n zoneSpec && (zoneSpec.onInvoke ? this.zone : parentDelegate._invokeCurrZone);\n this._handleErrorZS =\n zoneSpec && (zoneSpec.onHandleError ? zoneSpec : parentDelegate._handleErrorZS);\n this._handleErrorDlgt =\n zoneSpec && (zoneSpec.onHandleError ? parentDelegate : parentDelegate._handleErrorDlgt);\n this._handleErrorCurrZone =\n zoneSpec && (zoneSpec.onHandleError ? this.zone : parentDelegate._handleErrorCurrZone);\n this._scheduleTaskZS =\n zoneSpec && (zoneSpec.onScheduleTask ? zoneSpec : parentDelegate._scheduleTaskZS);\n this._scheduleTaskDlgt = zoneSpec &&\n (zoneSpec.onScheduleTask ? parentDelegate : parentDelegate._scheduleTaskDlgt);\n this._scheduleTaskCurrZone =\n zoneSpec && (zoneSpec.onScheduleTask ? this.zone : parentDelegate._scheduleTaskCurrZone);\n this._invokeTaskZS =\n zoneSpec && (zoneSpec.onInvokeTask ? zoneSpec : parentDelegate._invokeTaskZS);\n this._invokeTaskDlgt =\n zoneSpec && (zoneSpec.onInvokeTask ? parentDelegate : parentDelegate._invokeTaskDlgt);\n this._invokeTaskCurrZone =\n zoneSpec && (zoneSpec.onInvokeTask ? this.zone : parentDelegate._invokeTaskCurrZone);\n this._cancelTaskZS =\n zoneSpec && (zoneSpec.onCancelTask ? zoneSpec : parentDelegate._cancelTaskZS);\n this._cancelTaskDlgt =\n zoneSpec && (zoneSpec.onCancelTask ? parentDelegate : parentDelegate._cancelTaskDlgt);\n this._cancelTaskCurrZone =\n zoneSpec && (zoneSpec.onCancelTask ? this.zone : parentDelegate._cancelTaskCurrZone);\n this._hasTaskZS = null;\n this._hasTaskDlgt = null;\n this._hasTaskDlgtOwner = null;\n this._hasTaskCurrZone = null;\n const zoneSpecHasTask = zoneSpec && zoneSpec.onHasTask;\n const parentHasTask = parentDelegate && parentDelegate._hasTaskZS;\n if (zoneSpecHasTask || parentHasTask) {\n // If we need to report hasTask, than this ZS needs to do ref counting on tasks. In such\n // a case all task related interceptors must go through this ZD. We can't short circuit it.\n this._hasTaskZS = zoneSpecHasTask ? zoneSpec : DELEGATE_ZS;\n this._hasTaskDlgt = parentDelegate;\n this._hasTaskDlgtOwner = this;\n this._hasTaskCurrZone = zone;\n if (!zoneSpec.onScheduleTask) {\n this._scheduleTaskZS = DELEGATE_ZS;\n this._scheduleTaskDlgt = parentDelegate;\n this._scheduleTaskCurrZone = this.zone;\n }\n if (!zoneSpec.onInvokeTask) {\n this._invokeTaskZS = DELEGATE_ZS;\n this._invokeTaskDlgt = parentDelegate;\n this._invokeTaskCurrZone = this.zone;\n }\n if (!zoneSpec.onCancelTask) {\n this._cancelTaskZS = DELEGATE_ZS;\n this._cancelTaskDlgt = parentDelegate;\n this._cancelTaskCurrZone = this.zone;\n }\n }\n }\n fork(targetZone, zoneSpec) {\n return this._forkZS ? this._forkZS.onFork(this._forkDlgt, this.zone, targetZone, zoneSpec) :\n new Zone(targetZone, zoneSpec);\n }\n intercept(targetZone, callback, source) {\n return this._interceptZS ?\n this._interceptZS.onIntercept(this._interceptDlgt, this._interceptCurrZone, targetZone, callback, source) :\n callback;\n }\n invoke(targetZone, callback, applyThis, applyArgs, source) {\n return this._invokeZS ? this._invokeZS.onInvoke(this._invokeDlgt, this._invokeCurrZone, targetZone, callback, applyThis, applyArgs, source) :\n callback.apply(applyThis, applyArgs);\n }\n handleError(targetZone, error) {\n return this._handleErrorZS ?\n this._handleErrorZS.onHandleError(this._handleErrorDlgt, this._handleErrorCurrZone, targetZone, error) :\n true;\n }\n scheduleTask(targetZone, task) {\n let returnTask = task;\n if (this._scheduleTaskZS) {\n if (this._hasTaskZS) {\n returnTask._zoneDelegates.push(this._hasTaskDlgtOwner);\n }\n // clang-format off\n returnTask = this._scheduleTaskZS.onScheduleTask(this._scheduleTaskDlgt, this._scheduleTaskCurrZone, targetZone, task);\n // clang-format on\n if (!returnTask)\n returnTask = task;\n }\n else {\n if (task.scheduleFn) {\n task.scheduleFn(task);\n }\n else if (task.type == microTask) {\n scheduleMicroTask(task);\n }\n else {\n throw new Error('Task is missing scheduleFn.');\n }\n }\n return returnTask;\n }\n invokeTask(targetZone, task, applyThis, applyArgs) {\n return this._invokeTaskZS ? this._invokeTaskZS.onInvokeTask(this._invokeTaskDlgt, this._invokeTaskCurrZone, targetZone, task, applyThis, applyArgs) :\n task.callback.apply(applyThis, applyArgs);\n }\n cancelTask(targetZone, task) {\n let value;\n if (this._cancelTaskZS) {\n value = this._cancelTaskZS.onCancelTask(this._cancelTaskDlgt, this._cancelTaskCurrZone, targetZone, task);\n }\n else {\n if (!task.cancelFn) {\n throw Error('Task is not cancelable');\n }\n value = task.cancelFn(task);\n }\n return value;\n }\n hasTask(targetZone, isEmpty) {\n // hasTask should not throw error so other ZoneDelegate\n // can still trigger hasTask callback\n try {\n this._hasTaskZS &&\n this._hasTaskZS.onHasTask(this._hasTaskDlgt, this._hasTaskCurrZone, targetZone, isEmpty);\n }\n catch (err) {\n this.handleError(targetZone, err);\n }\n }\n // tslint:disable-next-line:require-internal-with-underscore\n _updateTaskCount(type, count) {\n const counts = this._taskCounts;\n const prev = counts[type];\n const next = counts[type] = prev + count;\n if (next < 0) {\n throw new Error('More tasks executed then were scheduled.');\n }\n if (prev == 0 || next == 0) {\n const isEmpty = {\n microTask: counts['microTask'] > 0,\n macroTask: counts['macroTask'] > 0,\n eventTask: counts['eventTask'] > 0,\n change: type\n };\n this.hasTask(this.zone, isEmpty);\n }\n }\n }\n class ZoneTask {\n constructor(type, source, callback, options, scheduleFn, cancelFn) {\n // tslint:disable-next-line:require-internal-with-underscore\n this._zone = null;\n this.runCount = 0;\n // tslint:disable-next-line:require-internal-with-underscore\n this._zoneDelegates = null;\n // tslint:disable-next-line:require-internal-with-underscore\n this._state = 'notScheduled';\n this.type = type;\n this.source = source;\n this.data = options;\n this.scheduleFn = scheduleFn;\n this.cancelFn = cancelFn;\n if (!callback) {\n throw new Error('callback is not defined');\n }\n this.callback = callback;\n const self = this;\n // TODO: @JiaLiPassion options should have interface\n if (type === eventTask && options && options.useG) {\n this.invoke = ZoneTask.invokeTask;\n }\n else {\n this.invoke = function () {\n return ZoneTask.invokeTask.call(global, self, this, arguments);\n };\n }\n }\n static invokeTask(task, target, args) {\n if (!task) {\n task = this;\n }\n _numberOfNestedTaskFrames++;\n try {\n task.runCount++;\n return task.zone.runTask(task, target, args);\n }\n finally {\n if (_numberOfNestedTaskFrames == 1) {\n drainMicroTaskQueue();\n }\n _numberOfNestedTaskFrames--;\n }\n }\n get zone() {\n return this._zone;\n }\n get state() {\n return this._state;\n }\n cancelScheduleRequest() {\n this._transitionTo(notScheduled, scheduling);\n }\n // tslint:disable-next-line:require-internal-with-underscore\n _transitionTo(toState, fromState1, fromState2) {\n if (this._state === fromState1 || this._state === fromState2) {\n this._state = toState;\n if (toState == notScheduled) {\n this._zoneDelegates = null;\n }\n }\n else {\n throw new Error(`${this.type} '${this.source}': can not transition to '${toState}', expecting state '${fromState1}'${fromState2 ? ' or \\'' + fromState2 + '\\'' : ''}, was '${this._state}'.`);\n }\n }\n toString() {\n if (this.data && typeof this.data.handleId !== 'undefined') {\n return this.data.handleId.toString();\n }\n else {\n return Object.prototype.toString.call(this);\n }\n }\n // add toJSON method to prevent cyclic error when\n // call JSON.stringify(zoneTask)\n toJSON() {\n return {\n type: this.type,\n state: this.state,\n source: this.source,\n zone: this.zone.name,\n runCount: this.runCount\n };\n }\n }\n //////////////////////////////////////////////////////\n //////////////////////////////////////////////////////\n /// MICROTASK QUEUE\n //////////////////////////////////////////////////////\n //////////////////////////////////////////////////////\n const symbolSetTimeout = __symbol__('setTimeout');\n const symbolPromise = __symbol__('Promise');\n const symbolThen = __symbol__('then');\n let _microTaskQueue = [];\n let _isDrainingMicrotaskQueue = false;\n let nativeMicroTaskQueuePromise;\n function nativeScheduleMicroTask(func) {\n if (!nativeMicroTaskQueuePromise) {\n if (global[symbolPromise]) {\n nativeMicroTaskQueuePromise = global[symbolPromise].resolve(0);\n }\n }\n if (nativeMicroTaskQueuePromise) {\n let nativeThen = nativeMicroTaskQueuePromise[symbolThen];\n if (!nativeThen) {\n // native Promise is not patchable, we need to use `then` directly\n // issue 1078\n nativeThen = nativeMicroTaskQueuePromise['then'];\n }\n nativeThen.call(nativeMicroTaskQueuePromise, func);\n }\n else {\n global[symbolSetTimeout](func, 0);\n }\n }\n function scheduleMicroTask(task) {\n // if we are not running in any task, and there has not been anything scheduled\n // we must bootstrap the initial task creation by manually scheduling the drain\n if (_numberOfNestedTaskFrames === 0 && _microTaskQueue.length === 0) {\n // We are not running in Task, so we need to kickstart the microtask queue.\n nativeScheduleMicroTask(drainMicroTaskQueue);\n }\n task && _microTaskQueue.push(task);\n }\n function drainMicroTaskQueue() {\n if (!_isDrainingMicrotaskQueue) {\n _isDrainingMicrotaskQueue = true;\n while (_microTaskQueue.length) {\n const queue = _microTaskQueue;\n _microTaskQueue = [];\n for (let i = 0; i < queue.length; i++) {\n const task = queue[i];\n try {\n task.zone.runTask(task, null, null);\n }\n catch (error) {\n _api.onUnhandledError(error);\n }\n }\n }\n _api.microtaskDrainDone();\n _isDrainingMicrotaskQueue = false;\n }\n }\n //////////////////////////////////////////////////////\n //////////////////////////////////////////////////////\n /// BOOTSTRAP\n //////////////////////////////////////////////////////\n //////////////////////////////////////////////////////\n const NO_ZONE = { name: 'NO ZONE' };\n const notScheduled = 'notScheduled', scheduling = 'scheduling', scheduled = 'scheduled', running = 'running', canceling = 'canceling', unknown = 'unknown';\n const microTask = 'microTask', macroTask = 'macroTask', eventTask = 'eventTask';\n const patches = {};\n const _api = {\n symbol: __symbol__,\n currentZoneFrame: () => _currentZoneFrame,\n onUnhandledError: noop,\n microtaskDrainDone: noop,\n scheduleMicroTask: scheduleMicroTask,\n showUncaughtError: () => !Zone[__symbol__('ignoreConsoleErrorUncaughtError')],\n patchEventTarget: () => [],\n patchOnProperties: noop,\n patchMethod: () => noop,\n bindArguments: () => [],\n patchThen: () => noop,\n patchMacroTask: () => noop,\n patchEventPrototype: () => noop,\n isIEOrEdge: () => false,\n getGlobalObjects: () => undefined,\n ObjectDefineProperty: () => noop,\n ObjectGetOwnPropertyDescriptor: () => undefined,\n ObjectCreate: () => undefined,\n ArraySlice: () => [],\n patchClass: () => noop,\n wrapWithCurrentZone: () => noop,\n filterProperties: () => [],\n attachOriginToPatched: () => noop,\n _redefineProperty: () => noop,\n patchCallbacks: () => noop,\n nativeScheduleMicroTask: nativeScheduleMicroTask\n };\n let _currentZoneFrame = { parent: null, zone: new Zone(null, null) };\n let _currentTask = null;\n let _numberOfNestedTaskFrames = 0;\n function noop() { }\n performanceMeasure('Zone', 'Zone');\n return global['Zone'] = Zone;\n}))(typeof window !== 'undefined' && window || typeof self !== 'undefined' && self || global);\n\n/**\n * Suppress closure compiler errors about unknown 'Zone' variable\n * @fileoverview\n * @suppress {undefinedVars,globalThis,missingRequire}\n */\n/// \n// issue #989, to reduce bundle size, use short name\n/** Object.getOwnPropertyDescriptor */\nconst ObjectGetOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;\n/** Object.defineProperty */\nconst ObjectDefineProperty = Object.defineProperty;\n/** Object.getPrototypeOf */\nconst ObjectGetPrototypeOf = Object.getPrototypeOf;\n/** Object.create */\nconst ObjectCreate = Object.create;\n/** Array.prototype.slice */\nconst ArraySlice = Array.prototype.slice;\n/** addEventListener string const */\nconst ADD_EVENT_LISTENER_STR = 'addEventListener';\n/** removeEventListener string const */\nconst REMOVE_EVENT_LISTENER_STR = 'removeEventListener';\n/** zoneSymbol addEventListener */\nconst ZONE_SYMBOL_ADD_EVENT_LISTENER = Zone.__symbol__(ADD_EVENT_LISTENER_STR);\n/** zoneSymbol removeEventListener */\nconst ZONE_SYMBOL_REMOVE_EVENT_LISTENER = Zone.__symbol__(REMOVE_EVENT_LISTENER_STR);\n/** true string const */\nconst TRUE_STR = 'true';\n/** false string const */\nconst FALSE_STR = 'false';\n/** Zone symbol prefix string const. */\nconst ZONE_SYMBOL_PREFIX = Zone.__symbol__('');\nfunction wrapWithCurrentZone(callback, source) {\n return Zone.current.wrap(callback, source);\n}\nfunction scheduleMacroTaskWithCurrentZone(source, callback, data, customSchedule, customCancel) {\n return Zone.current.scheduleMacroTask(source, callback, data, customSchedule, customCancel);\n}\nconst zoneSymbol = Zone.__symbol__;\nconst isWindowExists = typeof window !== 'undefined';\nconst internalWindow = isWindowExists ? window : undefined;\nconst _global = isWindowExists && internalWindow || typeof self === 'object' && self || global;\nconst REMOVE_ATTRIBUTE = 'removeAttribute';\nfunction bindArguments(args, source) {\n for (let i = args.length - 1; i >= 0; i--) {\n if (typeof args[i] === 'function') {\n args[i] = wrapWithCurrentZone(args[i], source + '_' + i);\n }\n }\n return args;\n}\nfunction patchPrototype(prototype, fnNames) {\n const source = prototype.constructor['name'];\n for (let i = 0; i < fnNames.length; i++) {\n const name = fnNames[i];\n const delegate = prototype[name];\n if (delegate) {\n const prototypeDesc = ObjectGetOwnPropertyDescriptor(prototype, name);\n if (!isPropertyWritable(prototypeDesc)) {\n continue;\n }\n prototype[name] = ((delegate) => {\n const patched = function () {\n return delegate.apply(this, bindArguments(arguments, source + '.' + name));\n };\n attachOriginToPatched(patched, delegate);\n return patched;\n })(delegate);\n }\n }\n}\nfunction isPropertyWritable(propertyDesc) {\n if (!propertyDesc) {\n return true;\n }\n if (propertyDesc.writable === false) {\n return false;\n }\n return !(typeof propertyDesc.get === 'function' && typeof propertyDesc.set === 'undefined');\n}\nconst isWebWorker = (typeof WorkerGlobalScope !== 'undefined' && self instanceof WorkerGlobalScope);\n// Make sure to access `process` through `_global` so that WebPack does not accidentally browserify\n// this code.\nconst isNode = (!('nw' in _global) && typeof _global.process !== 'undefined' &&\n {}.toString.call(_global.process) === '[object process]');\nconst isBrowser = !isNode && !isWebWorker && !!(isWindowExists && internalWindow['HTMLElement']);\n// we are in electron of nw, so we are both browser and nodejs\n// Make sure to access `process` through `_global` so that WebPack does not accidentally browserify\n// this code.\nconst isMix = typeof _global.process !== 'undefined' &&\n {}.toString.call(_global.process) === '[object process]' && !isWebWorker &&\n !!(isWindowExists && internalWindow['HTMLElement']);\nconst zoneSymbolEventNames$1 = {};\nconst wrapFn = function (event) {\n // https://github.com/angular/zone.js/issues/911, in IE, sometimes\n // event will be undefined, so we need to use window.event\n event = event || _global.event;\n if (!event) {\n return;\n }\n let eventNameSymbol = zoneSymbolEventNames$1[event.type];\n if (!eventNameSymbol) {\n eventNameSymbol = zoneSymbolEventNames$1[event.type] = zoneSymbol('ON_PROPERTY' + event.type);\n }\n const target = this || event.target || _global;\n const listener = target[eventNameSymbol];\n let result;\n if (isBrowser && target === internalWindow && event.type === 'error') {\n // window.onerror have different signature\n // https://developer.mozilla.org/en-US/docs/Web/API/GlobalEventHandlers/onerror#window.onerror\n // and onerror callback will prevent default when callback return true\n const errorEvent = event;\n result = listener &&\n listener.call(this, errorEvent.message, errorEvent.filename, errorEvent.lineno, errorEvent.colno, errorEvent.error);\n if (result === true) {\n event.preventDefault();\n }\n }\n else {\n result = listener && listener.apply(this, arguments);\n if (result != undefined && !result) {\n event.preventDefault();\n }\n }\n return result;\n};\nfunction patchProperty(obj, prop, prototype) {\n let desc = ObjectGetOwnPropertyDescriptor(obj, prop);\n if (!desc && prototype) {\n // when patch window object, use prototype to check prop exist or not\n const prototypeDesc = ObjectGetOwnPropertyDescriptor(prototype, prop);\n if (prototypeDesc) {\n desc = { enumerable: true, configurable: true };\n }\n }\n // if the descriptor not exists or is not configurable\n // just return\n if (!desc || !desc.configurable) {\n return;\n }\n const onPropPatchedSymbol = zoneSymbol('on' + prop + 'patched');\n if (obj.hasOwnProperty(onPropPatchedSymbol) && obj[onPropPatchedSymbol]) {\n return;\n }\n // A property descriptor cannot have getter/setter and be writable\n // deleting the writable and value properties avoids this error:\n //\n // TypeError: property descriptors must not specify a value or be writable when a\n // getter or setter has been specified\n delete desc.writable;\n delete desc.value;\n const originalDescGet = desc.get;\n const originalDescSet = desc.set;\n // slice(2) cuz 'onclick' -> 'click', etc\n const eventName = prop.slice(2);\n let eventNameSymbol = zoneSymbolEventNames$1[eventName];\n if (!eventNameSymbol) {\n eventNameSymbol = zoneSymbolEventNames$1[eventName] = zoneSymbol('ON_PROPERTY' + eventName);\n }\n desc.set = function (newValue) {\n // in some of windows's onproperty callback, this is undefined\n // so we need to check it\n let target = this;\n if (!target && obj === _global) {\n target = _global;\n }\n if (!target) {\n return;\n }\n const previousValue = target[eventNameSymbol];\n if (typeof previousValue === 'function') {\n target.removeEventListener(eventName, wrapFn);\n }\n // issue #978, when onload handler was added before loading zone.js\n // we should remove it with originalDescSet\n originalDescSet && originalDescSet.call(target, null);\n target[eventNameSymbol] = newValue;\n if (typeof newValue === 'function') {\n target.addEventListener(eventName, wrapFn, false);\n }\n };\n // The getter would return undefined for unassigned properties but the default value of an\n // unassigned property is null\n desc.get = function () {\n // in some of windows's onproperty callback, this is undefined\n // so we need to check it\n let target = this;\n if (!target && obj === _global) {\n target = _global;\n }\n if (!target) {\n return null;\n }\n const listener = target[eventNameSymbol];\n if (listener) {\n return listener;\n }\n else if (originalDescGet) {\n // result will be null when use inline event attribute,\n // such as \n // because the onclick function is internal raw uncompiled handler\n // the onclick will be evaluated when first time event was triggered or\n // the property is accessed, https://github.com/angular/zone.js/issues/525\n // so we should use original native get to retrieve the handler\n let value = originalDescGet.call(this);\n if (value) {\n desc.set.call(this, value);\n if (typeof target[REMOVE_ATTRIBUTE] === 'function') {\n target.removeAttribute(prop);\n }\n return value;\n }\n }\n return null;\n };\n ObjectDefineProperty(obj, prop, desc);\n obj[onPropPatchedSymbol] = true;\n}\nfunction patchOnProperties(obj, properties, prototype) {\n if (properties) {\n for (let i = 0; i < properties.length; i++) {\n patchProperty(obj, 'on' + properties[i], prototype);\n }\n }\n else {\n const onProperties = [];\n for (const prop in obj) {\n if (prop.slice(0, 2) == 'on') {\n onProperties.push(prop);\n }\n }\n for (let j = 0; j < onProperties.length; j++) {\n patchProperty(obj, onProperties[j], prototype);\n }\n }\n}\nconst originalInstanceKey = zoneSymbol('originalInstance');\n// wrap some native API on `window`\nfunction patchClass(className) {\n const OriginalClass = _global[className];\n if (!OriginalClass)\n return;\n // keep original class in global\n _global[zoneSymbol(className)] = OriginalClass;\n _global[className] = function () {\n const a = bindArguments(arguments, className);\n switch (a.length) {\n case 0:\n this[originalInstanceKey] = new OriginalClass();\n break;\n case 1:\n this[originalInstanceKey] = new OriginalClass(a[0]);\n break;\n case 2:\n this[originalInstanceKey] = new OriginalClass(a[0], a[1]);\n break;\n case 3:\n this[originalInstanceKey] = new OriginalClass(a[0], a[1], a[2]);\n break;\n case 4:\n this[originalInstanceKey] = new OriginalClass(a[0], a[1], a[2], a[3]);\n break;\n default:\n throw new Error('Arg list too long.');\n }\n };\n // attach original delegate to patched function\n attachOriginToPatched(_global[className], OriginalClass);\n const instance = new OriginalClass(function () { });\n let prop;\n for (prop in instance) {\n // https://bugs.webkit.org/show_bug.cgi?id=44721\n if (className === 'XMLHttpRequest' && prop === 'responseBlob')\n continue;\n (function (prop) {\n if (typeof instance[prop] === 'function') {\n _global[className].prototype[prop] = function () {\n return this[originalInstanceKey][prop].apply(this[originalInstanceKey], arguments);\n };\n }\n else {\n ObjectDefineProperty(_global[className].prototype, prop, {\n set: function (fn) {\n if (typeof fn === 'function') {\n this[originalInstanceKey][prop] = wrapWithCurrentZone(fn, className + '.' + prop);\n // keep callback in wrapped function so we can\n // use it in Function.prototype.toString to return\n // the native one.\n attachOriginToPatched(this[originalInstanceKey][prop], fn);\n }\n else {\n this[originalInstanceKey][prop] = fn;\n }\n },\n get: function () {\n return this[originalInstanceKey][prop];\n }\n });\n }\n }(prop));\n }\n for (prop in OriginalClass) {\n if (prop !== 'prototype' && OriginalClass.hasOwnProperty(prop)) {\n _global[className][prop] = OriginalClass[prop];\n }\n }\n}\nfunction patchMethod(target, name, patchFn) {\n let proto = target;\n while (proto && !proto.hasOwnProperty(name)) {\n proto = ObjectGetPrototypeOf(proto);\n }\n if (!proto && target[name]) {\n // somehow we did not find it, but we can see it. This happens on IE for Window properties.\n proto = target;\n }\n const delegateName = zoneSymbol(name);\n let delegate = null;\n if (proto && (!(delegate = proto[delegateName]) || !proto.hasOwnProperty(delegateName))) {\n delegate = proto[delegateName] = proto[name];\n // check whether proto[name] is writable\n // some property is readonly in safari, such as HtmlCanvasElement.prototype.toBlob\n const desc = proto && ObjectGetOwnPropertyDescriptor(proto, name);\n if (isPropertyWritable(desc)) {\n const patchDelegate = patchFn(delegate, delegateName, name);\n proto[name] = function () {\n return patchDelegate(this, arguments);\n };\n attachOriginToPatched(proto[name], delegate);\n }\n }\n return delegate;\n}\n// TODO: @JiaLiPassion, support cancel task later if necessary\nfunction patchMacroTask(obj, funcName, metaCreator) {\n let setNative = null;\n function scheduleTask(task) {\n const data = task.data;\n data.args[data.cbIdx] = function () {\n task.invoke.apply(this, arguments);\n };\n setNative.apply(data.target, data.args);\n return task;\n }\n setNative = patchMethod(obj, funcName, (delegate) => function (self, args) {\n const meta = metaCreator(self, args);\n if (meta.cbIdx >= 0 && typeof args[meta.cbIdx] === 'function') {\n return scheduleMacroTaskWithCurrentZone(meta.name, args[meta.cbIdx], meta, scheduleTask);\n }\n else {\n // cause an error by calling it directly.\n return delegate.apply(self, args);\n }\n });\n}\nfunction attachOriginToPatched(patched, original) {\n patched[zoneSymbol('OriginalDelegate')] = original;\n}\nlet isDetectedIEOrEdge = false;\nlet ieOrEdge = false;\nfunction isIE() {\n try {\n const ua = internalWindow.navigator.userAgent;\n if (ua.indexOf('MSIE ') !== -1 || ua.indexOf('Trident/') !== -1) {\n return true;\n }\n }\n catch (error) {\n }\n return false;\n}\nfunction isIEOrEdge() {\n if (isDetectedIEOrEdge) {\n return ieOrEdge;\n }\n isDetectedIEOrEdge = true;\n try {\n const ua = internalWindow.navigator.userAgent;\n if (ua.indexOf('MSIE ') !== -1 || ua.indexOf('Trident/') !== -1 || ua.indexOf('Edge/') !== -1) {\n ieOrEdge = true;\n }\n }\n catch (error) {\n }\n return ieOrEdge;\n}\n\nZone.__load_patch('ZoneAwarePromise', (global, Zone, api) => {\n const ObjectGetOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;\n const ObjectDefineProperty = Object.defineProperty;\n function readableObjectToString(obj) {\n if (obj && obj.toString === Object.prototype.toString) {\n const className = obj.constructor && obj.constructor.name;\n return (className ? className : '') + ': ' + JSON.stringify(obj);\n }\n return obj ? obj.toString() : Object.prototype.toString.call(obj);\n }\n const __symbol__ = api.symbol;\n const _uncaughtPromiseErrors = [];\n const isDisableWrappingUncaughtPromiseRejection = global[__symbol__('DISABLE_WRAPPING_UNCAUGHT_PROMISE_REJECTION')] === true;\n const symbolPromise = __symbol__('Promise');\n const symbolThen = __symbol__('then');\n const creationTrace = '__creationTrace__';\n api.onUnhandledError = (e) => {\n if (api.showUncaughtError()) {\n const rejection = e && e.rejection;\n if (rejection) {\n console.error('Unhandled Promise rejection:', rejection instanceof Error ? rejection.message : rejection, '; Zone:', e.zone.name, '; Task:', e.task && e.task.source, '; Value:', rejection, rejection instanceof Error ? rejection.stack : undefined);\n }\n else {\n console.error(e);\n }\n }\n };\n api.microtaskDrainDone = () => {\n while (_uncaughtPromiseErrors.length) {\n const uncaughtPromiseError = _uncaughtPromiseErrors.shift();\n try {\n uncaughtPromiseError.zone.runGuarded(() => {\n if (uncaughtPromiseError.throwOriginal) {\n throw uncaughtPromiseError.rejection;\n }\n throw uncaughtPromiseError;\n });\n }\n catch (error) {\n handleUnhandledRejection(error);\n }\n }\n };\n const UNHANDLED_PROMISE_REJECTION_HANDLER_SYMBOL = __symbol__('unhandledPromiseRejectionHandler');\n function handleUnhandledRejection(e) {\n api.onUnhandledError(e);\n try {\n const handler = Zone[UNHANDLED_PROMISE_REJECTION_HANDLER_SYMBOL];\n if (typeof handler === 'function') {\n handler.call(this, e);\n }\n }\n catch (err) {\n }\n }\n function isThenable(value) {\n return value && value.then;\n }\n function forwardResolution(value) {\n return value;\n }\n function forwardRejection(rejection) {\n return ZoneAwarePromise.reject(rejection);\n }\n const symbolState = __symbol__('state');\n const symbolValue = __symbol__('value');\n const symbolFinally = __symbol__('finally');\n const symbolParentPromiseValue = __symbol__('parentPromiseValue');\n const symbolParentPromiseState = __symbol__('parentPromiseState');\n const source = 'Promise.then';\n const UNRESOLVED = null;\n const RESOLVED = true;\n const REJECTED = false;\n const REJECTED_NO_CATCH = 0;\n function makeResolver(promise, state) {\n return (v) => {\n try {\n resolvePromise(promise, state, v);\n }\n catch (err) {\n resolvePromise(promise, false, err);\n }\n // Do not return value or you will break the Promise spec.\n };\n }\n const once = function () {\n let wasCalled = false;\n return function wrapper(wrappedFunction) {\n return function () {\n if (wasCalled) {\n return;\n }\n wasCalled = true;\n wrappedFunction.apply(null, arguments);\n };\n };\n };\n const TYPE_ERROR = 'Promise resolved with itself';\n const CURRENT_TASK_TRACE_SYMBOL = __symbol__('currentTaskTrace');\n // Promise Resolution\n function resolvePromise(promise, state, value) {\n const onceWrapper = once();\n if (promise === value) {\n throw new TypeError(TYPE_ERROR);\n }\n if (promise[symbolState] === UNRESOLVED) {\n // should only get value.then once based on promise spec.\n let then = null;\n try {\n if (typeof value === 'object' || typeof value === 'function') {\n then = value && value.then;\n }\n }\n catch (err) {\n onceWrapper(() => {\n resolvePromise(promise, false, err);\n })();\n return promise;\n }\n // if (value instanceof ZoneAwarePromise) {\n if (state !== REJECTED && value instanceof ZoneAwarePromise &&\n value.hasOwnProperty(symbolState) && value.hasOwnProperty(symbolValue) &&\n value[symbolState] !== UNRESOLVED) {\n clearRejectedNoCatch(value);\n resolvePromise(promise, value[symbolState], value[symbolValue]);\n }\n else if (state !== REJECTED && typeof then === 'function') {\n try {\n then.call(value, onceWrapper(makeResolver(promise, state)), onceWrapper(makeResolver(promise, false)));\n }\n catch (err) {\n onceWrapper(() => {\n resolvePromise(promise, false, err);\n })();\n }\n }\n else {\n promise[symbolState] = state;\n const queue = promise[symbolValue];\n promise[symbolValue] = value;\n if (promise[symbolFinally] === symbolFinally) {\n // the promise is generated by Promise.prototype.finally\n if (state === RESOLVED) {\n // the state is resolved, should ignore the value\n // and use parent promise value\n promise[symbolState] = promise[symbolParentPromiseState];\n promise[symbolValue] = promise[symbolParentPromiseValue];\n }\n }\n // record task information in value when error occurs, so we can\n // do some additional work such as render longStackTrace\n if (state === REJECTED && value instanceof Error) {\n // check if longStackTraceZone is here\n const trace = Zone.currentTask && Zone.currentTask.data &&\n Zone.currentTask.data[creationTrace];\n if (trace) {\n // only keep the long stack trace into error when in longStackTraceZone\n ObjectDefineProperty(value, CURRENT_TASK_TRACE_SYMBOL, { configurable: true, enumerable: false, writable: true, value: trace });\n }\n }\n for (let i = 0; i < queue.length;) {\n scheduleResolveOrReject(promise, queue[i++], queue[i++], queue[i++], queue[i++]);\n }\n if (queue.length == 0 && state == REJECTED) {\n promise[symbolState] = REJECTED_NO_CATCH;\n let uncaughtPromiseError = value;\n try {\n // Here we throws a new Error to print more readable error log\n // and if the value is not an error, zone.js builds an `Error`\n // Object here to attach the stack information.\n throw new Error('Uncaught (in promise): ' + readableObjectToString(value) +\n (value && value.stack ? '\\n' + value.stack : ''));\n }\n catch (err) {\n uncaughtPromiseError = err;\n }\n if (isDisableWrappingUncaughtPromiseRejection) {\n // If disable wrapping uncaught promise reject\n // use the value instead of wrapping it.\n uncaughtPromiseError.throwOriginal = true;\n }\n uncaughtPromiseError.rejection = value;\n uncaughtPromiseError.promise = promise;\n uncaughtPromiseError.zone = Zone.current;\n uncaughtPromiseError.task = Zone.currentTask;\n _uncaughtPromiseErrors.push(uncaughtPromiseError);\n api.scheduleMicroTask(); // to make sure that it is running\n }\n }\n }\n // Resolving an already resolved promise is a noop.\n return promise;\n }\n const REJECTION_HANDLED_HANDLER = __symbol__('rejectionHandledHandler');\n function clearRejectedNoCatch(promise) {\n if (promise[symbolState] === REJECTED_NO_CATCH) {\n // if the promise is rejected no catch status\n // and queue.length > 0, means there is a error handler\n // here to handle the rejected promise, we should trigger\n // windows.rejectionhandled eventHandler or nodejs rejectionHandled\n // eventHandler\n try {\n const handler = Zone[REJECTION_HANDLED_HANDLER];\n if (handler && typeof handler === 'function') {\n handler.call(this, { rejection: promise[symbolValue], promise: promise });\n }\n }\n catch (err) {\n }\n promise[symbolState] = REJECTED;\n for (let i = 0; i < _uncaughtPromiseErrors.length; i++) {\n if (promise === _uncaughtPromiseErrors[i].promise) {\n _uncaughtPromiseErrors.splice(i, 1);\n }\n }\n }\n }\n function scheduleResolveOrReject(promise, zone, chainPromise, onFulfilled, onRejected) {\n clearRejectedNoCatch(promise);\n const promiseState = promise[symbolState];\n const delegate = promiseState ?\n (typeof onFulfilled === 'function') ? onFulfilled : forwardResolution :\n (typeof onRejected === 'function') ? onRejected :\n forwardRejection;\n zone.scheduleMicroTask(source, () => {\n try {\n const parentPromiseValue = promise[symbolValue];\n const isFinallyPromise = !!chainPromise && symbolFinally === chainPromise[symbolFinally];\n if (isFinallyPromise) {\n // if the promise is generated from finally call, keep parent promise's state and value\n chainPromise[symbolParentPromiseValue] = parentPromiseValue;\n chainPromise[symbolParentPromiseState] = promiseState;\n }\n // should not pass value to finally callback\n const value = zone.run(delegate, undefined, isFinallyPromise && delegate !== forwardRejection && delegate !== forwardResolution ?\n [] :\n [parentPromiseValue]);\n resolvePromise(chainPromise, true, value);\n }\n catch (error) {\n // if error occurs, should always return this error\n resolvePromise(chainPromise, false, error);\n }\n }, chainPromise);\n }\n const ZONE_AWARE_PROMISE_TO_STRING = 'function ZoneAwarePromise() { [native code] }';\n const noop = function () { };\n const AggregateError = global.AggregateError;\n class ZoneAwarePromise {\n static toString() {\n return ZONE_AWARE_PROMISE_TO_STRING;\n }\n static resolve(value) {\n return resolvePromise(new this(null), RESOLVED, value);\n }\n static reject(error) {\n return resolvePromise(new this(null), REJECTED, error);\n }\n static any(values) {\n if (!values || typeof values[Symbol.iterator] !== 'function') {\n return Promise.reject(new AggregateError([], 'All promises were rejected'));\n }\n const promises = [];\n let count = 0;\n try {\n for (let v of values) {\n count++;\n promises.push(ZoneAwarePromise.resolve(v));\n }\n }\n catch (err) {\n return Promise.reject(new AggregateError([], 'All promises were rejected'));\n }\n if (count === 0) {\n return Promise.reject(new AggregateError([], 'All promises were rejected'));\n }\n let finished = false;\n const errors = [];\n return new ZoneAwarePromise((resolve, reject) => {\n for (let i = 0; i < promises.length; i++) {\n promises[i].then(v => {\n if (finished) {\n return;\n }\n finished = true;\n resolve(v);\n }, err => {\n errors.push(err);\n count--;\n if (count === 0) {\n finished = true;\n reject(new AggregateError(errors, 'All promises were rejected'));\n }\n });\n }\n });\n }\n ;\n static race(values) {\n let resolve;\n let reject;\n let promise = new this((res, rej) => {\n resolve = res;\n reject = rej;\n });\n function onResolve(value) {\n resolve(value);\n }\n function onReject(error) {\n reject(error);\n }\n for (let value of values) {\n if (!isThenable(value)) {\n value = this.resolve(value);\n }\n value.then(onResolve, onReject);\n }\n return promise;\n }\n static all(values) {\n return ZoneAwarePromise.allWithCallback(values);\n }\n static allSettled(values) {\n const P = this && this.prototype instanceof ZoneAwarePromise ? this : ZoneAwarePromise;\n return P.allWithCallback(values, {\n thenCallback: (value) => ({ status: 'fulfilled', value }),\n errorCallback: (err) => ({ status: 'rejected', reason: err })\n });\n }\n static allWithCallback(values, callback) {\n let resolve;\n let reject;\n let promise = new this((res, rej) => {\n resolve = res;\n reject = rej;\n });\n // Start at 2 to prevent prematurely resolving if .then is called immediately.\n let unresolvedCount = 2;\n let valueIndex = 0;\n const resolvedValues = [];\n for (let value of values) {\n if (!isThenable(value)) {\n value = this.resolve(value);\n }\n const curValueIndex = valueIndex;\n try {\n value.then((value) => {\n resolvedValues[curValueIndex] = callback ? callback.thenCallback(value) : value;\n unresolvedCount--;\n if (unresolvedCount === 0) {\n resolve(resolvedValues);\n }\n }, (err) => {\n if (!callback) {\n reject(err);\n }\n else {\n resolvedValues[curValueIndex] = callback.errorCallback(err);\n unresolvedCount--;\n if (unresolvedCount === 0) {\n resolve(resolvedValues);\n }\n }\n });\n }\n catch (thenErr) {\n reject(thenErr);\n }\n unresolvedCount++;\n valueIndex++;\n }\n // Make the unresolvedCount zero-based again.\n unresolvedCount -= 2;\n if (unresolvedCount === 0) {\n resolve(resolvedValues);\n }\n return promise;\n }\n constructor(executor) {\n const promise = this;\n if (!(promise instanceof ZoneAwarePromise)) {\n throw new Error('Must be an instanceof Promise.');\n }\n promise[symbolState] = UNRESOLVED;\n promise[symbolValue] = []; // queue;\n try {\n const onceWrapper = once();\n executor &&\n executor(onceWrapper(makeResolver(promise, RESOLVED)), onceWrapper(makeResolver(promise, REJECTED)));\n }\n catch (error) {\n resolvePromise(promise, false, error);\n }\n }\n get [Symbol.toStringTag]() {\n return 'Promise';\n }\n get [Symbol.species]() {\n return ZoneAwarePromise;\n }\n then(onFulfilled, onRejected) {\n // We must read `Symbol.species` safely because `this` may be anything. For instance, `this`\n // may be an object without a prototype (created through `Object.create(null)`); thus\n // `this.constructor` will be undefined. One of the use cases is SystemJS creating\n // prototype-less objects (modules) via `Object.create(null)`. The SystemJS creates an empty\n // object and copies promise properties into that object (within the `getOrCreateLoad`\n // function). The zone.js then checks if the resolved value has the `then` method and invokes\n // it with the `value` context. Otherwise, this will throw an error: `TypeError: Cannot read\n // properties of undefined (reading 'Symbol(Symbol.species)')`.\n let C = this.constructor?.[Symbol.species];\n if (!C || typeof C !== 'function') {\n C = this.constructor || ZoneAwarePromise;\n }\n const chainPromise = new C(noop);\n const zone = Zone.current;\n if (this[symbolState] == UNRESOLVED) {\n this[symbolValue].push(zone, chainPromise, onFulfilled, onRejected);\n }\n else {\n scheduleResolveOrReject(this, zone, chainPromise, onFulfilled, onRejected);\n }\n return chainPromise;\n }\n catch(onRejected) {\n return this.then(null, onRejected);\n }\n finally(onFinally) {\n // See comment on the call to `then` about why thee `Symbol.species` is safely accessed.\n let C = this.constructor?.[Symbol.species];\n if (!C || typeof C !== 'function') {\n C = ZoneAwarePromise;\n }\n const chainPromise = new C(noop);\n chainPromise[symbolFinally] = symbolFinally;\n const zone = Zone.current;\n if (this[symbolState] == UNRESOLVED) {\n this[symbolValue].push(zone, chainPromise, onFinally, onFinally);\n }\n else {\n scheduleResolveOrReject(this, zone, chainPromise, onFinally, onFinally);\n }\n return chainPromise;\n }\n }\n // Protect against aggressive optimizers dropping seemingly unused properties.\n // E.g. Closure Compiler in advanced mode.\n ZoneAwarePromise['resolve'] = ZoneAwarePromise.resolve;\n ZoneAwarePromise['reject'] = ZoneAwarePromise.reject;\n ZoneAwarePromise['race'] = ZoneAwarePromise.race;\n ZoneAwarePromise['all'] = ZoneAwarePromise.all;\n const NativePromise = global[symbolPromise] = global['Promise'];\n global['Promise'] = ZoneAwarePromise;\n const symbolThenPatched = __symbol__('thenPatched');\n function patchThen(Ctor) {\n const proto = Ctor.prototype;\n const prop = ObjectGetOwnPropertyDescriptor(proto, 'then');\n if (prop && (prop.writable === false || !prop.configurable)) {\n // check Ctor.prototype.then propertyDescriptor is writable or not\n // in meteor env, writable is false, we should ignore such case\n return;\n }\n const originalThen = proto.then;\n // Keep a reference to the original method.\n proto[symbolThen] = originalThen;\n Ctor.prototype.then = function (onResolve, onReject) {\n const wrapped = new ZoneAwarePromise((resolve, reject) => {\n originalThen.call(this, resolve, reject);\n });\n return wrapped.then(onResolve, onReject);\n };\n Ctor[symbolThenPatched] = true;\n }\n api.patchThen = patchThen;\n function zoneify(fn) {\n return function (self, args) {\n let resultPromise = fn.apply(self, args);\n if (resultPromise instanceof ZoneAwarePromise) {\n return resultPromise;\n }\n let ctor = resultPromise.constructor;\n if (!ctor[symbolThenPatched]) {\n patchThen(ctor);\n }\n return resultPromise;\n };\n }\n if (NativePromise) {\n patchThen(NativePromise);\n patchMethod(global, 'fetch', delegate => zoneify(delegate));\n }\n // This is not part of public API, but it is useful for tests, so we expose it.\n Promise[Zone.__symbol__('uncaughtPromiseErrors')] = _uncaughtPromiseErrors;\n return ZoneAwarePromise;\n});\n\n// override Function.prototype.toString to make zone.js patched function\n// look like native function\nZone.__load_patch('toString', (global) => {\n // patch Func.prototype.toString to let them look like native\n const originalFunctionToString = Function.prototype.toString;\n const ORIGINAL_DELEGATE_SYMBOL = zoneSymbol('OriginalDelegate');\n const PROMISE_SYMBOL = zoneSymbol('Promise');\n const ERROR_SYMBOL = zoneSymbol('Error');\n const newFunctionToString = function toString() {\n if (typeof this === 'function') {\n const originalDelegate = this[ORIGINAL_DELEGATE_SYMBOL];\n if (originalDelegate) {\n if (typeof originalDelegate === 'function') {\n return originalFunctionToString.call(originalDelegate);\n }\n else {\n return Object.prototype.toString.call(originalDelegate);\n }\n }\n if (this === Promise) {\n const nativePromise = global[PROMISE_SYMBOL];\n if (nativePromise) {\n return originalFunctionToString.call(nativePromise);\n }\n }\n if (this === Error) {\n const nativeError = global[ERROR_SYMBOL];\n if (nativeError) {\n return originalFunctionToString.call(nativeError);\n }\n }\n }\n return originalFunctionToString.call(this);\n };\n newFunctionToString[ORIGINAL_DELEGATE_SYMBOL] = originalFunctionToString;\n Function.prototype.toString = newFunctionToString;\n // patch Object.prototype.toString to let them look like native\n const originalObjectToString = Object.prototype.toString;\n const PROMISE_OBJECT_TO_STRING = '[object Promise]';\n Object.prototype.toString = function () {\n if (typeof Promise === 'function' && this instanceof Promise) {\n return PROMISE_OBJECT_TO_STRING;\n }\n return originalObjectToString.call(this);\n };\n});\n\n/**\n * @fileoverview\n * @suppress {missingRequire}\n */\nlet passiveSupported = false;\nif (typeof window !== 'undefined') {\n try {\n const options = Object.defineProperty({}, 'passive', {\n get: function () {\n passiveSupported = true;\n }\n });\n // Note: We pass the `options` object as the event handler too. This is not compatible with the\n // signature of `addEventListener` or `removeEventListener` but enables us to remove the handler\n // without an actual handler.\n window.addEventListener('test', options, options);\n window.removeEventListener('test', options, options);\n }\n catch (err) {\n passiveSupported = false;\n }\n}\n// an identifier to tell ZoneTask do not create a new invoke closure\nconst OPTIMIZED_ZONE_EVENT_TASK_DATA = {\n useG: true\n};\nconst zoneSymbolEventNames = {};\nconst globalSources = {};\nconst EVENT_NAME_SYMBOL_REGX = new RegExp('^' + ZONE_SYMBOL_PREFIX + '(\\\\w+)(true|false)$');\nconst IMMEDIATE_PROPAGATION_SYMBOL = zoneSymbol('propagationStopped');\nfunction prepareEventNames(eventName, eventNameToString) {\n const falseEventName = (eventNameToString ? eventNameToString(eventName) : eventName) + FALSE_STR;\n const trueEventName = (eventNameToString ? eventNameToString(eventName) : eventName) + TRUE_STR;\n const symbol = ZONE_SYMBOL_PREFIX + falseEventName;\n const symbolCapture = ZONE_SYMBOL_PREFIX + trueEventName;\n zoneSymbolEventNames[eventName] = {};\n zoneSymbolEventNames[eventName][FALSE_STR] = symbol;\n zoneSymbolEventNames[eventName][TRUE_STR] = symbolCapture;\n}\nfunction patchEventTarget(_global, api, apis, patchOptions) {\n const ADD_EVENT_LISTENER = (patchOptions && patchOptions.add) || ADD_EVENT_LISTENER_STR;\n const REMOVE_EVENT_LISTENER = (patchOptions && patchOptions.rm) || REMOVE_EVENT_LISTENER_STR;\n const LISTENERS_EVENT_LISTENER = (patchOptions && patchOptions.listeners) || 'eventListeners';\n const REMOVE_ALL_LISTENERS_EVENT_LISTENER = (patchOptions && patchOptions.rmAll) || 'removeAllListeners';\n const zoneSymbolAddEventListener = zoneSymbol(ADD_EVENT_LISTENER);\n const ADD_EVENT_LISTENER_SOURCE = '.' + ADD_EVENT_LISTENER + ':';\n const PREPEND_EVENT_LISTENER = 'prependListener';\n const PREPEND_EVENT_LISTENER_SOURCE = '.' + PREPEND_EVENT_LISTENER + ':';\n const invokeTask = function (task, target, event) {\n // for better performance, check isRemoved which is set\n // by removeEventListener\n if (task.isRemoved) {\n return;\n }\n const delegate = task.callback;\n if (typeof delegate === 'object' && delegate.handleEvent) {\n // create the bind version of handleEvent when invoke\n task.callback = (event) => delegate.handleEvent(event);\n task.originalDelegate = delegate;\n }\n // invoke static task.invoke\n // need to try/catch error here, otherwise, the error in one event listener\n // will break the executions of the other event listeners. Also error will\n // not remove the event listener when `once` options is true.\n let error;\n try {\n task.invoke(task, target, [event]);\n }\n catch (err) {\n error = err;\n }\n const options = task.options;\n if (options && typeof options === 'object' && options.once) {\n // if options.once is true, after invoke once remove listener here\n // only browser need to do this, nodejs eventEmitter will cal removeListener\n // inside EventEmitter.once\n const delegate = task.originalDelegate ? task.originalDelegate : task.callback;\n target[REMOVE_EVENT_LISTENER].call(target, event.type, delegate, options);\n }\n return error;\n };\n function globalCallback(context, event, isCapture) {\n // https://github.com/angular/zone.js/issues/911, in IE, sometimes\n // event will be undefined, so we need to use window.event\n event = event || _global.event;\n if (!event) {\n return;\n }\n // event.target is needed for Samsung TV and SourceBuffer\n // || global is needed https://github.com/angular/zone.js/issues/190\n const target = context || event.target || _global;\n const tasks = target[zoneSymbolEventNames[event.type][isCapture ? TRUE_STR : FALSE_STR]];\n if (tasks) {\n const errors = [];\n // invoke all tasks which attached to current target with given event.type and capture = false\n // for performance concern, if task.length === 1, just invoke\n if (tasks.length === 1) {\n const err = invokeTask(tasks[0], target, event);\n err && errors.push(err);\n }\n else {\n // https://github.com/angular/zone.js/issues/836\n // copy the tasks array before invoke, to avoid\n // the callback will remove itself or other listener\n const copyTasks = tasks.slice();\n for (let i = 0; i < copyTasks.length; i++) {\n if (event && event[IMMEDIATE_PROPAGATION_SYMBOL] === true) {\n break;\n }\n const err = invokeTask(copyTasks[i], target, event);\n err && errors.push(err);\n }\n }\n // Since there is only one error, we don't need to schedule microTask\n // to throw the error.\n if (errors.length === 1) {\n throw errors[0];\n }\n else {\n for (let i = 0; i < errors.length; i++) {\n const err = errors[i];\n api.nativeScheduleMicroTask(() => {\n throw err;\n });\n }\n }\n }\n }\n // global shared zoneAwareCallback to handle all event callback with capture = false\n const globalZoneAwareCallback = function (event) {\n return globalCallback(this, event, false);\n };\n // global shared zoneAwareCallback to handle all event callback with capture = true\n const globalZoneAwareCaptureCallback = function (event) {\n return globalCallback(this, event, true);\n };\n function patchEventTargetMethods(obj, patchOptions) {\n if (!obj) {\n return false;\n }\n let useGlobalCallback = true;\n if (patchOptions && patchOptions.useG !== undefined) {\n useGlobalCallback = patchOptions.useG;\n }\n const validateHandler = patchOptions && patchOptions.vh;\n let checkDuplicate = true;\n if (patchOptions && patchOptions.chkDup !== undefined) {\n checkDuplicate = patchOptions.chkDup;\n }\n let returnTarget = false;\n if (patchOptions && patchOptions.rt !== undefined) {\n returnTarget = patchOptions.rt;\n }\n let proto = obj;\n while (proto && !proto.hasOwnProperty(ADD_EVENT_LISTENER)) {\n proto = ObjectGetPrototypeOf(proto);\n }\n if (!proto && obj[ADD_EVENT_LISTENER]) {\n // somehow we did not find it, but we can see it. This happens on IE for Window properties.\n proto = obj;\n }\n if (!proto) {\n return false;\n }\n if (proto[zoneSymbolAddEventListener]) {\n return false;\n }\n const eventNameToString = patchOptions && patchOptions.eventNameToString;\n // a shared global taskData to pass data for scheduleEventTask\n // so we do not need to create a new object just for pass some data\n const taskData = {};\n const nativeAddEventListener = proto[zoneSymbolAddEventListener] = proto[ADD_EVENT_LISTENER];\n const nativeRemoveEventListener = proto[zoneSymbol(REMOVE_EVENT_LISTENER)] =\n proto[REMOVE_EVENT_LISTENER];\n const nativeListeners = proto[zoneSymbol(LISTENERS_EVENT_LISTENER)] =\n proto[LISTENERS_EVENT_LISTENER];\n const nativeRemoveAllListeners = proto[zoneSymbol(REMOVE_ALL_LISTENERS_EVENT_LISTENER)] =\n proto[REMOVE_ALL_LISTENERS_EVENT_LISTENER];\n let nativePrependEventListener;\n if (patchOptions && patchOptions.prepend) {\n nativePrependEventListener = proto[zoneSymbol(patchOptions.prepend)] =\n proto[patchOptions.prepend];\n }\n /**\n * This util function will build an option object with passive option\n * to handle all possible input from the user.\n */\n function buildEventListenerOptions(options, passive) {\n if (!passiveSupported && typeof options === 'object' && options) {\n // doesn't support passive but user want to pass an object as options.\n // this will not work on some old browser, so we just pass a boolean\n // as useCapture parameter\n return !!options.capture;\n }\n if (!passiveSupported || !passive) {\n return options;\n }\n if (typeof options === 'boolean') {\n return { capture: options, passive: true };\n }\n if (!options) {\n return { passive: true };\n }\n if (typeof options === 'object' && options.passive !== false) {\n return { ...options, passive: true };\n }\n return options;\n }\n const customScheduleGlobal = function (task) {\n // if there is already a task for the eventName + capture,\n // just return, because we use the shared globalZoneAwareCallback here.\n if (taskData.isExisting) {\n return;\n }\n return nativeAddEventListener.call(taskData.target, taskData.eventName, taskData.capture ? globalZoneAwareCaptureCallback : globalZoneAwareCallback, taskData.options);\n };\n const customCancelGlobal = function (task) {\n // if task is not marked as isRemoved, this call is directly\n // from Zone.prototype.cancelTask, we should remove the task\n // from tasksList of target first\n if (!task.isRemoved) {\n const symbolEventNames = zoneSymbolEventNames[task.eventName];\n let symbolEventName;\n if (symbolEventNames) {\n symbolEventName = symbolEventNames[task.capture ? TRUE_STR : FALSE_STR];\n }\n const existingTasks = symbolEventName && task.target[symbolEventName];\n if (existingTasks) {\n for (let i = 0; i < existingTasks.length; i++) {\n const existingTask = existingTasks[i];\n if (existingTask === task) {\n existingTasks.splice(i, 1);\n // set isRemoved to data for faster invokeTask check\n task.isRemoved = true;\n if (existingTasks.length === 0) {\n // all tasks for the eventName + capture have gone,\n // remove globalZoneAwareCallback and remove the task cache from target\n task.allRemoved = true;\n task.target[symbolEventName] = null;\n }\n break;\n }\n }\n }\n }\n // if all tasks for the eventName + capture have gone,\n // we will really remove the global event callback,\n // if not, return\n if (!task.allRemoved) {\n return;\n }\n return nativeRemoveEventListener.call(task.target, task.eventName, task.capture ? globalZoneAwareCaptureCallback : globalZoneAwareCallback, task.options);\n };\n const customScheduleNonGlobal = function (task) {\n return nativeAddEventListener.call(taskData.target, taskData.eventName, task.invoke, taskData.options);\n };\n const customSchedulePrepend = function (task) {\n return nativePrependEventListener.call(taskData.target, taskData.eventName, task.invoke, taskData.options);\n };\n const customCancelNonGlobal = function (task) {\n return nativeRemoveEventListener.call(task.target, task.eventName, task.invoke, task.options);\n };\n const customSchedule = useGlobalCallback ? customScheduleGlobal : customScheduleNonGlobal;\n const customCancel = useGlobalCallback ? customCancelGlobal : customCancelNonGlobal;\n const compareTaskCallbackVsDelegate = function (task, delegate) {\n const typeOfDelegate = typeof delegate;\n return (typeOfDelegate === 'function' && task.callback === delegate) ||\n (typeOfDelegate === 'object' && task.originalDelegate === delegate);\n };\n const compare = (patchOptions && patchOptions.diff) ? patchOptions.diff : compareTaskCallbackVsDelegate;\n const unpatchedEvents = Zone[zoneSymbol('UNPATCHED_EVENTS')];\n const passiveEvents = _global[zoneSymbol('PASSIVE_EVENTS')];\n const makeAddListener = function (nativeListener, addSource, customScheduleFn, customCancelFn, returnTarget = false, prepend = false) {\n return function () {\n const target = this || _global;\n let eventName = arguments[0];\n if (patchOptions && patchOptions.transferEventName) {\n eventName = patchOptions.transferEventName(eventName);\n }\n let delegate = arguments[1];\n if (!delegate) {\n return nativeListener.apply(this, arguments);\n }\n if (isNode && eventName === 'uncaughtException') {\n // don't patch uncaughtException of nodejs to prevent endless loop\n return nativeListener.apply(this, arguments);\n }\n // don't create the bind delegate function for handleEvent\n // case here to improve addEventListener performance\n // we will create the bind delegate when invoke\n let isHandleEvent = false;\n if (typeof delegate !== 'function') {\n if (!delegate.handleEvent) {\n return nativeListener.apply(this, arguments);\n }\n isHandleEvent = true;\n }\n if (validateHandler && !validateHandler(nativeListener, delegate, target, arguments)) {\n return;\n }\n const passive = passiveSupported && !!passiveEvents && passiveEvents.indexOf(eventName) !== -1;\n const options = buildEventListenerOptions(arguments[2], passive);\n if (unpatchedEvents) {\n // check unpatched list\n for (let i = 0; i < unpatchedEvents.length; i++) {\n if (eventName === unpatchedEvents[i]) {\n if (passive) {\n return nativeListener.call(target, eventName, delegate, options);\n }\n else {\n return nativeListener.apply(this, arguments);\n }\n }\n }\n }\n const capture = !options ? false : typeof options === 'boolean' ? true : options.capture;\n const once = options && typeof options === 'object' ? options.once : false;\n const zone = Zone.current;\n let symbolEventNames = zoneSymbolEventNames[eventName];\n if (!symbolEventNames) {\n prepareEventNames(eventName, eventNameToString);\n symbolEventNames = zoneSymbolEventNames[eventName];\n }\n const symbolEventName = symbolEventNames[capture ? TRUE_STR : FALSE_STR];\n let existingTasks = target[symbolEventName];\n let isExisting = false;\n if (existingTasks) {\n // already have task registered\n isExisting = true;\n if (checkDuplicate) {\n for (let i = 0; i < existingTasks.length; i++) {\n if (compare(existingTasks[i], delegate)) {\n // same callback, same capture, same event name, just return\n return;\n }\n }\n }\n }\n else {\n existingTasks = target[symbolEventName] = [];\n }\n let source;\n const constructorName = target.constructor['name'];\n const targetSource = globalSources[constructorName];\n if (targetSource) {\n source = targetSource[eventName];\n }\n if (!source) {\n source = constructorName + addSource +\n (eventNameToString ? eventNameToString(eventName) : eventName);\n }\n // do not create a new object as task.data to pass those things\n // just use the global shared one\n taskData.options = options;\n if (once) {\n // if addEventListener with once options, we don't pass it to\n // native addEventListener, instead we keep the once setting\n // and handle ourselves.\n taskData.options.once = false;\n }\n taskData.target = target;\n taskData.capture = capture;\n taskData.eventName = eventName;\n taskData.isExisting = isExisting;\n const data = useGlobalCallback ? OPTIMIZED_ZONE_EVENT_TASK_DATA : undefined;\n // keep taskData into data to allow onScheduleEventTask to access the task information\n if (data) {\n data.taskData = taskData;\n }\n const task = zone.scheduleEventTask(source, delegate, data, customScheduleFn, customCancelFn);\n // should clear taskData.target to avoid memory leak\n // issue, https://github.com/angular/angular/issues/20442\n taskData.target = null;\n // need to clear up taskData because it is a global object\n if (data) {\n data.taskData = null;\n }\n // have to save those information to task in case\n // application may call task.zone.cancelTask() directly\n if (once) {\n options.once = true;\n }\n if (!(!passiveSupported && typeof task.options === 'boolean')) {\n // if not support passive, and we pass an option object\n // to addEventListener, we should save the options to task\n task.options = options;\n }\n task.target = target;\n task.capture = capture;\n task.eventName = eventName;\n if (isHandleEvent) {\n // save original delegate for compare to check duplicate\n task.originalDelegate = delegate;\n }\n if (!prepend) {\n existingTasks.push(task);\n }\n else {\n existingTasks.unshift(task);\n }\n if (returnTarget) {\n return target;\n }\n };\n };\n proto[ADD_EVENT_LISTENER] = makeAddListener(nativeAddEventListener, ADD_EVENT_LISTENER_SOURCE, customSchedule, customCancel, returnTarget);\n if (nativePrependEventListener) {\n proto[PREPEND_EVENT_LISTENER] = makeAddListener(nativePrependEventListener, PREPEND_EVENT_LISTENER_SOURCE, customSchedulePrepend, customCancel, returnTarget, true);\n }\n proto[REMOVE_EVENT_LISTENER] = function () {\n const target = this || _global;\n let eventName = arguments[0];\n if (patchOptions && patchOptions.transferEventName) {\n eventName = patchOptions.transferEventName(eventName);\n }\n const options = arguments[2];\n const capture = !options ? false : typeof options === 'boolean' ? true : options.capture;\n const delegate = arguments[1];\n if (!delegate) {\n return nativeRemoveEventListener.apply(this, arguments);\n }\n if (validateHandler &&\n !validateHandler(nativeRemoveEventListener, delegate, target, arguments)) {\n return;\n }\n const symbolEventNames = zoneSymbolEventNames[eventName];\n let symbolEventName;\n if (symbolEventNames) {\n symbolEventName = symbolEventNames[capture ? TRUE_STR : FALSE_STR];\n }\n const existingTasks = symbolEventName && target[symbolEventName];\n if (existingTasks) {\n for (let i = 0; i < existingTasks.length; i++) {\n const existingTask = existingTasks[i];\n if (compare(existingTask, delegate)) {\n existingTasks.splice(i, 1);\n // set isRemoved to data for faster invokeTask check\n existingTask.isRemoved = true;\n if (existingTasks.length === 0) {\n // all tasks for the eventName + capture have gone,\n // remove globalZoneAwareCallback and remove the task cache from target\n existingTask.allRemoved = true;\n target[symbolEventName] = null;\n // in the target, we have an event listener which is added by on_property\n // such as target.onclick = function() {}, so we need to clear this internal\n // property too if all delegates all removed\n if (typeof eventName === 'string') {\n const onPropertySymbol = ZONE_SYMBOL_PREFIX + 'ON_PROPERTY' + eventName;\n target[onPropertySymbol] = null;\n }\n }\n existingTask.zone.cancelTask(existingTask);\n if (returnTarget) {\n return target;\n }\n return;\n }\n }\n }\n // issue 930, didn't find the event name or callback\n // from zone kept existingTasks, the callback maybe\n // added outside of zone, we need to call native removeEventListener\n // to try to remove it.\n return nativeRemoveEventListener.apply(this, arguments);\n };\n proto[LISTENERS_EVENT_LISTENER] = function () {\n const target = this || _global;\n let eventName = arguments[0];\n if (patchOptions && patchOptions.transferEventName) {\n eventName = patchOptions.transferEventName(eventName);\n }\n const listeners = [];\n const tasks = findEventTasks(target, eventNameToString ? eventNameToString(eventName) : eventName);\n for (let i = 0; i < tasks.length; i++) {\n const task = tasks[i];\n let delegate = task.originalDelegate ? task.originalDelegate : task.callback;\n listeners.push(delegate);\n }\n return listeners;\n };\n proto[REMOVE_ALL_LISTENERS_EVENT_LISTENER] = function () {\n const target = this || _global;\n let eventName = arguments[0];\n if (!eventName) {\n const keys = Object.keys(target);\n for (let i = 0; i < keys.length; i++) {\n const prop = keys[i];\n const match = EVENT_NAME_SYMBOL_REGX.exec(prop);\n let evtName = match && match[1];\n // in nodejs EventEmitter, removeListener event is\n // used for monitoring the removeListener call,\n // so just keep removeListener eventListener until\n // all other eventListeners are removed\n if (evtName && evtName !== 'removeListener') {\n this[REMOVE_ALL_LISTENERS_EVENT_LISTENER].call(this, evtName);\n }\n }\n // remove removeListener listener finally\n this[REMOVE_ALL_LISTENERS_EVENT_LISTENER].call(this, 'removeListener');\n }\n else {\n if (patchOptions && patchOptions.transferEventName) {\n eventName = patchOptions.transferEventName(eventName);\n }\n const symbolEventNames = zoneSymbolEventNames[eventName];\n if (symbolEventNames) {\n const symbolEventName = symbolEventNames[FALSE_STR];\n const symbolCaptureEventName = symbolEventNames[TRUE_STR];\n const tasks = target[symbolEventName];\n const captureTasks = target[symbolCaptureEventName];\n if (tasks) {\n const removeTasks = tasks.slice();\n for (let i = 0; i < removeTasks.length; i++) {\n const task = removeTasks[i];\n let delegate = task.originalDelegate ? task.originalDelegate : task.callback;\n this[REMOVE_EVENT_LISTENER].call(this, eventName, delegate, task.options);\n }\n }\n if (captureTasks) {\n const removeTasks = captureTasks.slice();\n for (let i = 0; i < removeTasks.length; i++) {\n const task = removeTasks[i];\n let delegate = task.originalDelegate ? task.originalDelegate : task.callback;\n this[REMOVE_EVENT_LISTENER].call(this, eventName, delegate, task.options);\n }\n }\n }\n }\n if (returnTarget) {\n return this;\n }\n };\n // for native toString patch\n attachOriginToPatched(proto[ADD_EVENT_LISTENER], nativeAddEventListener);\n attachOriginToPatched(proto[REMOVE_EVENT_LISTENER], nativeRemoveEventListener);\n if (nativeRemoveAllListeners) {\n attachOriginToPatched(proto[REMOVE_ALL_LISTENERS_EVENT_LISTENER], nativeRemoveAllListeners);\n }\n if (nativeListeners) {\n attachOriginToPatched(proto[LISTENERS_EVENT_LISTENER], nativeListeners);\n }\n return true;\n }\n let results = [];\n for (let i = 0; i < apis.length; i++) {\n results[i] = patchEventTargetMethods(apis[i], patchOptions);\n }\n return results;\n}\nfunction findEventTasks(target, eventName) {\n if (!eventName) {\n const foundTasks = [];\n for (let prop in target) {\n const match = EVENT_NAME_SYMBOL_REGX.exec(prop);\n let evtName = match && match[1];\n if (evtName && (!eventName || evtName === eventName)) {\n const tasks = target[prop];\n if (tasks) {\n for (let i = 0; i < tasks.length; i++) {\n foundTasks.push(tasks[i]);\n }\n }\n }\n }\n return foundTasks;\n }\n let symbolEventName = zoneSymbolEventNames[eventName];\n if (!symbolEventName) {\n prepareEventNames(eventName);\n symbolEventName = zoneSymbolEventNames[eventName];\n }\n const captureFalseTasks = target[symbolEventName[FALSE_STR]];\n const captureTrueTasks = target[symbolEventName[TRUE_STR]];\n if (!captureFalseTasks) {\n return captureTrueTasks ? captureTrueTasks.slice() : [];\n }\n else {\n return captureTrueTasks ? captureFalseTasks.concat(captureTrueTasks) :\n captureFalseTasks.slice();\n }\n}\nfunction patchEventPrototype(global, api) {\n const Event = global['Event'];\n if (Event && Event.prototype) {\n api.patchMethod(Event.prototype, 'stopImmediatePropagation', (delegate) => function (self, args) {\n self[IMMEDIATE_PROPAGATION_SYMBOL] = true;\n // we need to call the native stopImmediatePropagation\n // in case in some hybrid application, some part of\n // application will be controlled by zone, some are not\n delegate && delegate.apply(self, args);\n });\n }\n}\n\nfunction patchCallbacks(api, target, targetName, method, callbacks) {\n const symbol = Zone.__symbol__(method);\n if (target[symbol]) {\n return;\n }\n const nativeDelegate = target[symbol] = target[method];\n target[method] = function (name, opts, options) {\n if (opts && opts.prototype) {\n callbacks.forEach(function (callback) {\n const source = `${targetName}.${method}::` + callback;\n const prototype = opts.prototype;\n // Note: the `patchCallbacks` is used for patching the `document.registerElement` and\n // `customElements.define`. We explicitly wrap the patching code into try-catch since\n // callbacks may be already patched by other web components frameworks (e.g. LWC), and they\n // make those properties non-writable. This means that patching callback will throw an error\n // `cannot assign to read-only property`. See this code as an example:\n // https://github.com/salesforce/lwc/blob/master/packages/@lwc/engine-core/src/framework/base-bridge-element.ts#L180-L186\n // We don't want to stop the application rendering if we couldn't patch some\n // callback, e.g. `attributeChangedCallback`.\n try {\n if (prototype.hasOwnProperty(callback)) {\n const descriptor = api.ObjectGetOwnPropertyDescriptor(prototype, callback);\n if (descriptor && descriptor.value) {\n descriptor.value = api.wrapWithCurrentZone(descriptor.value, source);\n api._redefineProperty(opts.prototype, callback, descriptor);\n }\n else if (prototype[callback]) {\n prototype[callback] = api.wrapWithCurrentZone(prototype[callback], source);\n }\n }\n else if (prototype[callback]) {\n prototype[callback] = api.wrapWithCurrentZone(prototype[callback], source);\n }\n }\n catch {\n // Note: we leave the catch block empty since there's no way to handle the error related\n // to non-writable property.\n }\n });\n }\n return nativeDelegate.call(target, name, opts, options);\n };\n api.attachOriginToPatched(target[method], nativeDelegate);\n}\n\n/**\n * @fileoverview\n * @suppress {globalThis}\n */\nfunction filterProperties(target, onProperties, ignoreProperties) {\n if (!ignoreProperties || ignoreProperties.length === 0) {\n return onProperties;\n }\n const tip = ignoreProperties.filter(ip => ip.target === target);\n if (!tip || tip.length === 0) {\n return onProperties;\n }\n const targetIgnoreProperties = tip[0].ignoreProperties;\n return onProperties.filter(op => targetIgnoreProperties.indexOf(op) === -1);\n}\nfunction patchFilteredProperties(target, onProperties, ignoreProperties, prototype) {\n // check whether target is available, sometimes target will be undefined\n // because different browser or some 3rd party plugin.\n if (!target) {\n return;\n }\n const filteredProperties = filterProperties(target, onProperties, ignoreProperties);\n patchOnProperties(target, filteredProperties, prototype);\n}\n/**\n * Get all event name properties which the event name startsWith `on`\n * from the target object itself, inherited properties are not considered.\n */\nfunction getOnEventNames(target) {\n return Object.getOwnPropertyNames(target)\n .filter(name => name.startsWith('on') && name.length > 2)\n .map(name => name.substring(2));\n}\nfunction propertyDescriptorPatch(api, _global) {\n if (isNode && !isMix) {\n return;\n }\n if (Zone[api.symbol('patchEvents')]) {\n // events are already been patched by legacy patch.\n return;\n }\n const ignoreProperties = _global['__Zone_ignore_on_properties'];\n // for browsers that we can patch the descriptor: Chrome & Firefox\n let patchTargets = [];\n if (isBrowser) {\n const internalWindow = window;\n patchTargets = patchTargets.concat([\n 'Document', 'SVGElement', 'Element', 'HTMLElement', 'HTMLBodyElement', 'HTMLMediaElement',\n 'HTMLFrameSetElement', 'HTMLFrameElement', 'HTMLIFrameElement', 'HTMLMarqueeElement', 'Worker'\n ]);\n const ignoreErrorProperties = isIE() ? [{ target: internalWindow, ignoreProperties: ['error'] }] : [];\n // in IE/Edge, onProp not exist in window object, but in WindowPrototype\n // so we need to pass WindowPrototype to check onProp exist or not\n patchFilteredProperties(internalWindow, getOnEventNames(internalWindow), ignoreProperties ? ignoreProperties.concat(ignoreErrorProperties) : ignoreProperties, ObjectGetPrototypeOf(internalWindow));\n }\n patchTargets = patchTargets.concat([\n 'XMLHttpRequest', 'XMLHttpRequestEventTarget', 'IDBIndex', 'IDBRequest', 'IDBOpenDBRequest',\n 'IDBDatabase', 'IDBTransaction', 'IDBCursor', 'WebSocket'\n ]);\n for (let i = 0; i < patchTargets.length; i++) {\n const target = _global[patchTargets[i]];\n target && target.prototype &&\n patchFilteredProperties(target.prototype, getOnEventNames(target.prototype), ignoreProperties);\n }\n}\n\nZone.__load_patch('util', (global, Zone, api) => {\n // Collect native event names by looking at properties\n // on the global namespace, e.g. 'onclick'.\n const eventNames = getOnEventNames(global);\n api.patchOnProperties = patchOnProperties;\n api.patchMethod = patchMethod;\n api.bindArguments = bindArguments;\n api.patchMacroTask = patchMacroTask;\n // In earlier version of zone.js (<0.9.0), we use env name `__zone_symbol__BLACK_LISTED_EVENTS` to\n // define which events will not be patched by `Zone.js`.\n // In newer version (>=0.9.0), we change the env name to `__zone_symbol__UNPATCHED_EVENTS` to keep\n // the name consistent with angular repo.\n // The `__zone_symbol__BLACK_LISTED_EVENTS` is deprecated, but it is still be supported for\n // backwards compatibility.\n const SYMBOL_BLACK_LISTED_EVENTS = Zone.__symbol__('BLACK_LISTED_EVENTS');\n const SYMBOL_UNPATCHED_EVENTS = Zone.__symbol__('UNPATCHED_EVENTS');\n if (global[SYMBOL_UNPATCHED_EVENTS]) {\n global[SYMBOL_BLACK_LISTED_EVENTS] = global[SYMBOL_UNPATCHED_EVENTS];\n }\n if (global[SYMBOL_BLACK_LISTED_EVENTS]) {\n Zone[SYMBOL_BLACK_LISTED_EVENTS] = Zone[SYMBOL_UNPATCHED_EVENTS] =\n global[SYMBOL_BLACK_LISTED_EVENTS];\n }\n api.patchEventPrototype = patchEventPrototype;\n api.patchEventTarget = patchEventTarget;\n api.isIEOrEdge = isIEOrEdge;\n api.ObjectDefineProperty = ObjectDefineProperty;\n api.ObjectGetOwnPropertyDescriptor = ObjectGetOwnPropertyDescriptor;\n api.ObjectCreate = ObjectCreate;\n api.ArraySlice = ArraySlice;\n api.patchClass = patchClass;\n api.wrapWithCurrentZone = wrapWithCurrentZone;\n api.filterProperties = filterProperties;\n api.attachOriginToPatched = attachOriginToPatched;\n api._redefineProperty = Object.defineProperty;\n api.patchCallbacks = patchCallbacks;\n api.getGlobalObjects = () => ({\n globalSources,\n zoneSymbolEventNames,\n eventNames,\n isBrowser,\n isMix,\n isNode,\n TRUE_STR,\n FALSE_STR,\n ZONE_SYMBOL_PREFIX,\n ADD_EVENT_LISTENER_STR,\n REMOVE_EVENT_LISTENER_STR\n });\n});\n\n/**\n * @fileoverview\n * @suppress {missingRequire}\n */\nfunction patchQueueMicrotask(global, api) {\n api.patchMethod(global, 'queueMicrotask', (delegate) => {\n return function (self, args) {\n Zone.current.scheduleMicroTask('queueMicrotask', args[0]);\n };\n });\n}\n\n/**\n * @fileoverview\n * @suppress {missingRequire}\n */\nconst taskSymbol = zoneSymbol('zoneTask');\nfunction patchTimer(window, setName, cancelName, nameSuffix) {\n let setNative = null;\n let clearNative = null;\n setName += nameSuffix;\n cancelName += nameSuffix;\n const tasksByHandleId = {};\n function scheduleTask(task) {\n const data = task.data;\n data.args[0] = function () {\n return task.invoke.apply(this, arguments);\n };\n data.handleId = setNative.apply(window, data.args);\n return task;\n }\n function clearTask(task) {\n return clearNative.call(window, task.data.handleId);\n }\n setNative =\n patchMethod(window, setName, (delegate) => function (self, args) {\n if (typeof args[0] === 'function') {\n const options = {\n isPeriodic: nameSuffix === 'Interval',\n delay: (nameSuffix === 'Timeout' || nameSuffix === 'Interval') ? args[1] || 0 :\n undefined,\n args: args\n };\n const callback = args[0];\n args[0] = function timer() {\n try {\n return callback.apply(this, arguments);\n }\n finally {\n // issue-934, task will be cancelled\n // even it is a periodic task such as\n // setInterval\n // https://github.com/angular/angular/issues/40387\n // Cleanup tasksByHandleId should be handled before scheduleTask\n // Since some zoneSpec may intercept and doesn't trigger\n // scheduleFn(scheduleTask) provided here.\n if (!(options.isPeriodic)) {\n if (typeof options.handleId === 'number') {\n // in non-nodejs env, we remove timerId\n // from local cache\n delete tasksByHandleId[options.handleId];\n }\n else if (options.handleId) {\n // Node returns complex objects as handleIds\n // we remove task reference from timer object\n options.handleId[taskSymbol] = null;\n }\n }\n }\n };\n const task = scheduleMacroTaskWithCurrentZone(setName, args[0], options, scheduleTask, clearTask);\n if (!task) {\n return task;\n }\n // Node.js must additionally support the ref and unref functions.\n const handle = task.data.handleId;\n if (typeof handle === 'number') {\n // for non nodejs env, we save handleId: task\n // mapping in local cache for clearTimeout\n tasksByHandleId[handle] = task;\n }\n else if (handle) {\n // for nodejs env, we save task\n // reference in timerId Object for clearTimeout\n handle[taskSymbol] = task;\n }\n // check whether handle is null, because some polyfill or browser\n // may return undefined from setTimeout/setInterval/setImmediate/requestAnimationFrame\n if (handle && handle.ref && handle.unref && typeof handle.ref === 'function' &&\n typeof handle.unref === 'function') {\n task.ref = handle.ref.bind(handle);\n task.unref = handle.unref.bind(handle);\n }\n if (typeof handle === 'number' || handle) {\n return handle;\n }\n return task;\n }\n else {\n // cause an error by calling it directly.\n return delegate.apply(window, args);\n }\n });\n clearNative =\n patchMethod(window, cancelName, (delegate) => function (self, args) {\n const id = args[0];\n let task;\n if (typeof id === 'number') {\n // non nodejs env.\n task = tasksByHandleId[id];\n }\n else {\n // nodejs env.\n task = id && id[taskSymbol];\n // other environments.\n if (!task) {\n task = id;\n }\n }\n if (task && typeof task.type === 'string') {\n if (task.state !== 'notScheduled' &&\n (task.cancelFn && task.data.isPeriodic || task.runCount === 0)) {\n if (typeof id === 'number') {\n delete tasksByHandleId[id];\n }\n else if (id) {\n id[taskSymbol] = null;\n }\n // Do not cancel already canceled functions\n task.zone.cancelTask(task);\n }\n }\n else {\n // cause an error by calling it directly.\n delegate.apply(window, args);\n }\n });\n}\n\nfunction patchCustomElements(_global, api) {\n const { isBrowser, isMix } = api.getGlobalObjects();\n if ((!isBrowser && !isMix) || !_global['customElements'] || !('customElements' in _global)) {\n return;\n }\n const callbacks = ['connectedCallback', 'disconnectedCallback', 'adoptedCallback', 'attributeChangedCallback'];\n api.patchCallbacks(api, _global.customElements, 'customElements', 'define', callbacks);\n}\n\nfunction eventTargetPatch(_global, api) {\n if (Zone[api.symbol('patchEventTarget')]) {\n // EventTarget is already patched.\n return;\n }\n const { eventNames, zoneSymbolEventNames, TRUE_STR, FALSE_STR, ZONE_SYMBOL_PREFIX } = api.getGlobalObjects();\n // predefine all __zone_symbol__ + eventName + true/false string\n for (let i = 0; i < eventNames.length; i++) {\n const eventName = eventNames[i];\n const falseEventName = eventName + FALSE_STR;\n const trueEventName = eventName + TRUE_STR;\n const symbol = ZONE_SYMBOL_PREFIX + falseEventName;\n const symbolCapture = ZONE_SYMBOL_PREFIX + trueEventName;\n zoneSymbolEventNames[eventName] = {};\n zoneSymbolEventNames[eventName][FALSE_STR] = symbol;\n zoneSymbolEventNames[eventName][TRUE_STR] = symbolCapture;\n }\n const EVENT_TARGET = _global['EventTarget'];\n if (!EVENT_TARGET || !EVENT_TARGET.prototype) {\n return;\n }\n api.patchEventTarget(_global, api, [EVENT_TARGET && EVENT_TARGET.prototype]);\n return true;\n}\nfunction patchEvent(global, api) {\n api.patchEventPrototype(global, api);\n}\n\n/**\n * @fileoverview\n * @suppress {missingRequire}\n */\nZone.__load_patch('legacy', (global) => {\n const legacyPatch = global[Zone.__symbol__('legacyPatch')];\n if (legacyPatch) {\n legacyPatch();\n }\n});\nZone.__load_patch('timers', (global) => {\n const set = 'set';\n const clear = 'clear';\n patchTimer(global, set, clear, 'Timeout');\n patchTimer(global, set, clear, 'Interval');\n patchTimer(global, set, clear, 'Immediate');\n});\nZone.__load_patch('requestAnimationFrame', (global) => {\n patchTimer(global, 'request', 'cancel', 'AnimationFrame');\n patchTimer(global, 'mozRequest', 'mozCancel', 'AnimationFrame');\n patchTimer(global, 'webkitRequest', 'webkitCancel', 'AnimationFrame');\n});\nZone.__load_patch('blocking', (global, Zone) => {\n const blockingMethods = ['alert', 'prompt', 'confirm'];\n for (let i = 0; i < blockingMethods.length; i++) {\n const name = blockingMethods[i];\n patchMethod(global, name, (delegate, symbol, name) => {\n return function (s, args) {\n return Zone.current.run(delegate, global, args, name);\n };\n });\n }\n});\nZone.__load_patch('EventTarget', (global, Zone, api) => {\n patchEvent(global, api);\n eventTargetPatch(global, api);\n // patch XMLHttpRequestEventTarget's addEventListener/removeEventListener\n const XMLHttpRequestEventTarget = global['XMLHttpRequestEventTarget'];\n if (XMLHttpRequestEventTarget && XMLHttpRequestEventTarget.prototype) {\n api.patchEventTarget(global, api, [XMLHttpRequestEventTarget.prototype]);\n }\n});\nZone.__load_patch('MutationObserver', (global, Zone, api) => {\n patchClass('MutationObserver');\n patchClass('WebKitMutationObserver');\n});\nZone.__load_patch('IntersectionObserver', (global, Zone, api) => {\n patchClass('IntersectionObserver');\n});\nZone.__load_patch('FileReader', (global, Zone, api) => {\n patchClass('FileReader');\n});\nZone.__load_patch('on_property', (global, Zone, api) => {\n propertyDescriptorPatch(api, global);\n});\nZone.__load_patch('customElements', (global, Zone, api) => {\n patchCustomElements(global, api);\n});\nZone.__load_patch('XHR', (global, Zone) => {\n // Treat XMLHttpRequest as a macrotask.\n patchXHR(global);\n const XHR_TASK = zoneSymbol('xhrTask');\n const XHR_SYNC = zoneSymbol('xhrSync');\n const XHR_LISTENER = zoneSymbol('xhrListener');\n const XHR_SCHEDULED = zoneSymbol('xhrScheduled');\n const XHR_URL = zoneSymbol('xhrURL');\n const XHR_ERROR_BEFORE_SCHEDULED = zoneSymbol('xhrErrorBeforeScheduled');\n function patchXHR(window) {\n const XMLHttpRequest = window['XMLHttpRequest'];\n if (!XMLHttpRequest) {\n // XMLHttpRequest is not available in service worker\n return;\n }\n const XMLHttpRequestPrototype = XMLHttpRequest.prototype;\n function findPendingTask(target) {\n return target[XHR_TASK];\n }\n let oriAddListener = XMLHttpRequestPrototype[ZONE_SYMBOL_ADD_EVENT_LISTENER];\n let oriRemoveListener = XMLHttpRequestPrototype[ZONE_SYMBOL_REMOVE_EVENT_LISTENER];\n if (!oriAddListener) {\n const XMLHttpRequestEventTarget = window['XMLHttpRequestEventTarget'];\n if (XMLHttpRequestEventTarget) {\n const XMLHttpRequestEventTargetPrototype = XMLHttpRequestEventTarget.prototype;\n oriAddListener = XMLHttpRequestEventTargetPrototype[ZONE_SYMBOL_ADD_EVENT_LISTENER];\n oriRemoveListener = XMLHttpRequestEventTargetPrototype[ZONE_SYMBOL_REMOVE_EVENT_LISTENER];\n }\n }\n const READY_STATE_CHANGE = 'readystatechange';\n const SCHEDULED = 'scheduled';\n function scheduleTask(task) {\n const data = task.data;\n const target = data.target;\n target[XHR_SCHEDULED] = false;\n target[XHR_ERROR_BEFORE_SCHEDULED] = false;\n // remove existing event listener\n const listener = target[XHR_LISTENER];\n if (!oriAddListener) {\n oriAddListener = target[ZONE_SYMBOL_ADD_EVENT_LISTENER];\n oriRemoveListener = target[ZONE_SYMBOL_REMOVE_EVENT_LISTENER];\n }\n if (listener) {\n oriRemoveListener.call(target, READY_STATE_CHANGE, listener);\n }\n const newListener = target[XHR_LISTENER] = () => {\n if (target.readyState === target.DONE) {\n // sometimes on some browsers XMLHttpRequest will fire onreadystatechange with\n // readyState=4 multiple times, so we need to check task state here\n if (!data.aborted && target[XHR_SCHEDULED] && task.state === SCHEDULED) {\n // check whether the xhr has registered onload listener\n // if that is the case, the task should invoke after all\n // onload listeners finish.\n // Also if the request failed without response (status = 0), the load event handler\n // will not be triggered, in that case, we should also invoke the placeholder callback\n // to close the XMLHttpRequest::send macroTask.\n // https://github.com/angular/angular/issues/38795\n const loadTasks = target[Zone.__symbol__('loadfalse')];\n if (target.status !== 0 && loadTasks && loadTasks.length > 0) {\n const oriInvoke = task.invoke;\n task.invoke = function () {\n // need to load the tasks again, because in other\n // load listener, they may remove themselves\n const loadTasks = target[Zone.__symbol__('loadfalse')];\n for (let i = 0; i < loadTasks.length; i++) {\n if (loadTasks[i] === task) {\n loadTasks.splice(i, 1);\n }\n }\n if (!data.aborted && task.state === SCHEDULED) {\n oriInvoke.call(task);\n }\n };\n loadTasks.push(task);\n }\n else {\n task.invoke();\n }\n }\n else if (!data.aborted && target[XHR_SCHEDULED] === false) {\n // error occurs when xhr.send()\n target[XHR_ERROR_BEFORE_SCHEDULED] = true;\n }\n }\n };\n oriAddListener.call(target, READY_STATE_CHANGE, newListener);\n const storedTask = target[XHR_TASK];\n if (!storedTask) {\n target[XHR_TASK] = task;\n }\n sendNative.apply(target, data.args);\n target[XHR_SCHEDULED] = true;\n return task;\n }\n function placeholderCallback() { }\n function clearTask(task) {\n const data = task.data;\n // Note - ideally, we would call data.target.removeEventListener here, but it's too late\n // to prevent it from firing. So instead, we store info for the event listener.\n data.aborted = true;\n return abortNative.apply(data.target, data.args);\n }\n const openNative = patchMethod(XMLHttpRequestPrototype, 'open', () => function (self, args) {\n self[XHR_SYNC] = args[2] == false;\n self[XHR_URL] = args[1];\n return openNative.apply(self, args);\n });\n const XMLHTTPREQUEST_SOURCE = 'XMLHttpRequest.send';\n const fetchTaskAborting = zoneSymbol('fetchTaskAborting');\n const fetchTaskScheduling = zoneSymbol('fetchTaskScheduling');\n const sendNative = patchMethod(XMLHttpRequestPrototype, 'send', () => function (self, args) {\n if (Zone.current[fetchTaskScheduling] === true) {\n // a fetch is scheduling, so we are using xhr to polyfill fetch\n // and because we already schedule macroTask for fetch, we should\n // not schedule a macroTask for xhr again\n return sendNative.apply(self, args);\n }\n if (self[XHR_SYNC]) {\n // if the XHR is sync there is no task to schedule, just execute the code.\n return sendNative.apply(self, args);\n }\n else {\n const options = { target: self, url: self[XHR_URL], isPeriodic: false, args: args, aborted: false };\n const task = scheduleMacroTaskWithCurrentZone(XMLHTTPREQUEST_SOURCE, placeholderCallback, options, scheduleTask, clearTask);\n if (self && self[XHR_ERROR_BEFORE_SCHEDULED] === true && !options.aborted &&\n task.state === SCHEDULED) {\n // xhr request throw error when send\n // we should invoke task instead of leaving a scheduled\n // pending macroTask\n task.invoke();\n }\n }\n });\n const abortNative = patchMethod(XMLHttpRequestPrototype, 'abort', () => function (self, args) {\n const task = findPendingTask(self);\n if (task && typeof task.type == 'string') {\n // If the XHR has already completed, do nothing.\n // If the XHR has already been aborted, do nothing.\n // Fix #569, call abort multiple times before done will cause\n // macroTask task count be negative number\n if (task.cancelFn == null || (task.data && task.data.aborted)) {\n return;\n }\n task.zone.cancelTask(task);\n }\n else if (Zone.current[fetchTaskAborting] === true) {\n // the abort is called from fetch polyfill, we need to call native abort of XHR.\n return abortNative.apply(self, args);\n }\n // Otherwise, we are trying to abort an XHR which has not yet been sent, so there is no\n // task\n // to cancel. Do nothing.\n });\n }\n});\nZone.__load_patch('geolocation', (global) => {\n /// GEO_LOCATION\n if (global['navigator'] && global['navigator'].geolocation) {\n patchPrototype(global['navigator'].geolocation, ['getCurrentPosition', 'watchPosition']);\n }\n});\nZone.__load_patch('PromiseRejectionEvent', (global, Zone) => {\n // handle unhandled promise rejection\n function findPromiseRejectionHandler(evtName) {\n return function (e) {\n const eventTasks = findEventTasks(global, evtName);\n eventTasks.forEach(eventTask => {\n // windows has added unhandledrejection event listener\n // trigger the event listener\n const PromiseRejectionEvent = global['PromiseRejectionEvent'];\n if (PromiseRejectionEvent) {\n const evt = new PromiseRejectionEvent(evtName, { promise: e.promise, reason: e.rejection });\n eventTask.invoke(evt);\n }\n });\n };\n }\n if (global['PromiseRejectionEvent']) {\n Zone[zoneSymbol('unhandledPromiseRejectionHandler')] =\n findPromiseRejectionHandler('unhandledrejection');\n Zone[zoneSymbol('rejectionHandledHandler')] =\n findPromiseRejectionHandler('rejectionhandled');\n }\n});\nZone.__load_patch('queueMicrotask', (global, Zone, api) => {\n patchQueueMicrotask(global, api);\n});\n","/**\n * @license Angular v15.2.9\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\n/**\n * An injectable service that produces an animation sequence programmatically within an\n * Angular component or directive.\n * Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`.\n *\n * @usageNotes\n *\n * To use this service, add it to your component or directive as a dependency.\n * The service is instantiated along with your component.\n *\n * Apps do not typically need to create their own animation players, but if you\n * do need to, follow these steps:\n *\n * 1. Use the [AnimationBuilder.build](api/animations/AnimationBuilder#build)() method\n * to create a programmatic animation. The method returns an `AnimationFactory` instance.\n *\n * 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element.\n *\n * 3. Use the player object to control the animation programmatically.\n *\n * For example:\n *\n * ```ts\n * // import the service from BrowserAnimationsModule\n * import {AnimationBuilder} from '@angular/animations';\n * // require the service as a dependency\n * class MyCmp {\n * constructor(private _builder: AnimationBuilder) {}\n *\n * makeAnimation(element: any) {\n * // first define a reusable animation\n * const myAnimation = this._builder.build([\n * style({ width: 0 }),\n * animate(1000, style({ width: '100px' }))\n * ]);\n *\n * // use the returned factory object to create a player\n * const player = myAnimation.create(element);\n *\n * player.play();\n * }\n * }\n * ```\n *\n * @publicApi\n */\nclass AnimationBuilder {\n}\n/**\n * A factory object returned from the\n * [AnimationBuilder.build](api/animations/AnimationBuilder#build)()\n * method.\n *\n * @publicApi\n */\nclass AnimationFactory {\n}\n\n/**\n * Specifies automatic styling.\n *\n * @publicApi\n */\nconst AUTO_STYLE = '*';\n/**\n * Creates a named animation trigger, containing a list of [`state()`](api/animations/state)\n * and `transition()` entries to be evaluated when the expression\n * bound to the trigger changes.\n *\n * @param name An identifying string.\n * @param definitions An animation definition object, containing an array of\n * [`state()`](api/animations/state) and `transition()` declarations.\n *\n * @return An object that encapsulates the trigger data.\n *\n * @usageNotes\n * Define an animation trigger in the `animations` section of `@Component` metadata.\n * In the template, reference the trigger by name and bind it to a trigger expression that\n * evaluates to a defined animation state, using the following format:\n *\n * `[@triggerName]=\"expression\"`\n *\n * Animation trigger bindings convert all values to strings, and then match the\n * previous and current values against any linked transitions.\n * Booleans can be specified as `1` or `true` and `0` or `false`.\n *\n * ### Usage Example\n *\n * The following example creates an animation trigger reference based on the provided\n * name value.\n * The provided animation value is expected to be an array consisting of state and\n * transition declarations.\n *\n * ```typescript\n * @Component({\n * selector: \"my-component\",\n * templateUrl: \"my-component-tpl.html\",\n * animations: [\n * trigger(\"myAnimationTrigger\", [\n * state(...),\n * state(...),\n * transition(...),\n * transition(...)\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"something\";\n * }\n * ```\n *\n * The template associated with this component makes use of the defined trigger\n * by binding to an element within its template code.\n *\n * ```html\n * \n *
...
\n * ```\n *\n * ### Using an inline function\n * The `transition` animation method also supports reading an inline function which can decide\n * if its associated animation should be run.\n *\n * ```typescript\n * // this method is run each time the `myAnimationTrigger` trigger value changes.\n * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key:\n string]: any}): boolean {\n * // notice that `element` and `params` are also available here\n * return toState == 'yes-please-animate';\n * }\n *\n * @Component({\n * selector: 'my-component',\n * templateUrl: 'my-component-tpl.html',\n * animations: [\n * trigger('myAnimationTrigger', [\n * transition(myInlineMatcherFn, [\n * // the animation sequence code\n * ]),\n * ])\n * ]\n * })\n * class MyComponent {\n * myStatusExp = \"yes-please-animate\";\n * }\n * ```\n *\n * ### Disabling Animations\n * When true, the special animation control binding `@.disabled` binding prevents\n * all animations from rendering.\n * Place the `@.disabled` binding on an element to disable\n * animations on the element itself, as well as any inner animation triggers\n * within the element.\n *\n * The following example shows how to use this feature:\n *\n * ```typescript\n * @Component({\n * selector: 'my-component',\n * template: `\n *
\n *
\n *
\n * `,\n * animations: [\n * trigger(\"childAnimation\", [\n * // ...\n * ])\n * ]\n * })\n * class MyComponent {\n * isDisabled = true;\n * exp = '...';\n * }\n * ```\n *\n * When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating,\n * along with any inner animations.\n *\n * ### Disable animations application-wide\n * When an area of the template is set to have animations disabled,\n * **all** inner components have their animations disabled as well.\n * This means that you can disable all animations for an app\n * by placing a host binding set on `@.disabled` on the topmost Angular component.\n *\n * ```typescript\n * import {Component, HostBinding} from '@angular/core';\n *\n * @Component({\n * selector: 'app-component',\n * templateUrl: 'app.component.html',\n * })\n * class AppComponent {\n * @HostBinding('@.disabled')\n * public animationsDisabled = true;\n * }\n * ```\n *\n * ### Overriding disablement of inner animations\n * Despite inner animations being disabled, a parent animation can `query()`\n * for inner elements located in disabled areas of the template and still animate\n * them if needed. This is also the case for when a sub animation is\n * queried by a parent and then later animated using `animateChild()`.\n *\n * ### Detecting when an animation is disabled\n * If a region of the DOM (or the entire application) has its animations disabled, the animation\n * trigger callbacks still fire, but for zero seconds. When the callback fires, it provides\n * an instance of an `AnimationEvent`. If animations are disabled,\n * the `.disabled` flag on the event is true.\n *\n * @publicApi\n */\nfunction trigger(name, definitions) {\n return { type: 7 /* AnimationMetadataType.Trigger */, name, definitions, options: {} };\n}\n/**\n * Defines an animation step that combines styling information with timing information.\n *\n * @param timings Sets `AnimateTimings` for the parent animation.\n * A string in the format \"duration [delay] [easing]\".\n * - Duration and delay are expressed as a number and optional time unit,\n * such as \"1s\" or \"10ms\" for one second and 10 milliseconds, respectively.\n * The default unit is milliseconds.\n * - The easing value controls how the animation accelerates and decelerates\n * during its runtime. Value is one of `ease`, `ease-in`, `ease-out`,\n * `ease-in-out`, or a `cubic-bezier()` function call.\n * If not supplied, no easing is applied.\n *\n * For example, the string \"1s 100ms ease-out\" specifies a duration of\n * 1000 milliseconds, and delay of 100 ms, and the \"ease-out\" easing style,\n * which decelerates near the end of the duration.\n * @param styles Sets AnimationStyles for the parent animation.\n * A function call to either `style()` or `keyframes()`\n * that returns a collection of CSS style entries to be applied to the parent animation.\n * When null, uses the styles from the destination state.\n * This is useful when describing an animation step that will complete an animation;\n * see \"Animating to the final state\" in `transitions()`.\n * @returns An object that encapsulates the animation step.\n *\n * @usageNotes\n * Call within an animation `sequence()`, `{@link animations/group group()}`, or\n * `transition()` call to specify an animation step\n * that applies given style data to the parent animation for a given amount of time.\n *\n * ### Syntax Examples\n * **Timing examples**\n *\n * The following examples show various `timings` specifications.\n * - `animate(500)` : Duration is 500 milliseconds.\n * - `animate(\"1s\")` : Duration is 1000 milliseconds.\n * - `animate(\"100ms 0.5s\")` : Duration is 100 milliseconds, delay is 500 milliseconds.\n * - `animate(\"5s ease-in\")` : Duration is 5000 milliseconds, easing in.\n * - `animate(\"5s 10ms cubic-bezier(.17,.67,.88,.1)\")` : Duration is 5000 milliseconds, delay is 10\n * milliseconds, easing according to a bezier curve.\n *\n * **Style examples**\n *\n * The following example calls `style()` to set a single CSS style.\n * ```typescript\n * animate(500, style({ background: \"red\" }))\n * ```\n * The following example calls `keyframes()` to set a CSS style\n * to different values for successive keyframes.\n * ```typescript\n * animate(500, keyframes(\n * [\n * style({ background: \"blue\" }),\n * style({ background: \"red\" })\n * ])\n * ```\n *\n * @publicApi\n */\nfunction animate(timings, styles = null) {\n return { type: 4 /* AnimationMetadataType.Animate */, styles, timings };\n}\n/**\n * @description Defines a list of animation steps to be run in parallel.\n *\n * @param steps An array of animation step objects.\n * - When steps are defined by `style()` or `animate()`\n * function calls, each call within the group is executed instantly.\n * - To specify offset styles to be applied at a later time, define steps with\n * `keyframes()`, or use `animate()` calls with a delay value.\n * For example:\n *\n * ```typescript\n * group([\n * animate(\"1s\", style({ background: \"black\" })),\n * animate(\"2s\", style({ color: \"white\" }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the group data.\n *\n * @usageNotes\n * Grouped animations are useful when a series of styles must be\n * animated at different starting times and closed off at different ending times.\n *\n * When called within a `sequence()` or a\n * `transition()` call, does not continue to the next\n * instruction until all of the inner animation steps have completed.\n *\n * @publicApi\n */\nfunction group(steps, options = null) {\n return { type: 3 /* AnimationMetadataType.Group */, steps, options };\n}\n/**\n * Defines a list of animation steps to be run sequentially, one by one.\n *\n * @param steps An array of animation step objects.\n * - Steps defined by `style()` calls apply the styling data immediately.\n * - Steps defined by `animate()` calls apply the styling data over time\n * as specified by the timing data.\n *\n * ```typescript\n * sequence([\n * style({ opacity: 0 }),\n * animate(\"1s\", style({ opacity: 1 }))\n * ])\n * ```\n *\n * @param options An options object containing a delay and\n * developer-defined parameters that provide styling defaults and\n * can be overridden on invocation.\n *\n * @return An object that encapsulates the sequence data.\n *\n * @usageNotes\n * When you pass an array of steps to a\n * `transition()` call, the steps run sequentially by default.\n * Compare this to the `{@link animations/group group()}` call, which runs animation steps in\n *parallel.\n *\n * When a sequence is used within a `{@link animations/group group()}` or a `transition()` call,\n * execution continues to the next instruction only after each of the inner animation\n * steps have completed.\n *\n * @publicApi\n **/\nfunction sequence(steps, options = null) {\n return { type: 2 /* AnimationMetadataType.Sequence */, steps, options };\n}\n/**\n * Declares a key/value object containing CSS properties/styles that\n * can then be used for an animation [`state`](api/animations/state), within an animation\n *`sequence`, or as styling data for calls to `animate()` and `keyframes()`.\n *\n * @param tokens A set of CSS styles or HTML styles associated with an animation state.\n * The value can be any of the following:\n * - A key-value style pair associating a CSS property with a value.\n * - An array of key-value style pairs.\n * - An asterisk (*), to use auto-styling, where styles are derived from the element\n * being animated and applied to the animation when it starts.\n *\n * Auto-styling can be used to define a state that depends on layout or other\n * environmental factors.\n *\n * @return An object that encapsulates the style data.\n *\n * @usageNotes\n * The following examples create animation styles that collect a set of\n * CSS property values:\n *\n * ```typescript\n * // string values for CSS properties\n * style({ background: \"red\", color: \"blue\" })\n *\n * // numerical pixel values\n * style({ width: 100, height: 0 })\n * ```\n *\n * The following example uses auto-styling to allow an element to animate from\n * a height of 0 up to its full height:\n *\n * ```\n * style({ height: 0 }),\n * animate(\"1s\", style({ height: \"*\" }))\n * ```\n *\n * @publicApi\n **/\nfunction style(tokens) {\n return { type: 6 /* AnimationMetadataType.Style */, styles: tokens, offset: null };\n}\n/**\n * Declares an animation state within a trigger attached to an element.\n *\n * @param name One or more names for the defined state in a comma-separated string.\n * The following reserved state names can be supplied to define a style for specific use\n * cases:\n *\n * - `void` You can associate styles with this name to be used when\n * the element is detached from the application. For example, when an `ngIf` evaluates\n * to false, the state of the associated element is void.\n * - `*` (asterisk) Indicates the default state. You can associate styles with this name\n * to be used as the fallback when the state that is being animated is not declared\n * within the trigger.\n *\n * @param styles A set of CSS styles associated with this state, created using the\n * `style()` function.\n * This set of styles persists on the element once the state has been reached.\n * @param options Parameters that can be passed to the state when it is invoked.\n * 0 or more key-value pairs.\n * @return An object that encapsulates the new state data.\n *\n * @usageNotes\n * Use the `trigger()` function to register states to an animation trigger.\n * Use the `transition()` function to animate between states.\n * When a state is active within a component, its associated styles persist on the element,\n * even when the animation ends.\n *\n * @publicApi\n **/\nfunction state(name, styles, options) {\n return { type: 0 /* AnimationMetadataType.State */, name, styles, options };\n}\n/**\n * Defines a set of animation styles, associating each style with an optional `offset` value.\n *\n * @param steps A set of animation styles with optional offset data.\n * The optional `offset` value for a style specifies a percentage of the total animation\n * time at which that style is applied.\n * @returns An object that encapsulates the keyframes data.\n *\n * @usageNotes\n * Use with the `animate()` call. Instead of applying animations\n * from the current state\n * to the destination state, keyframes describe how each style entry is applied and at what point\n * within the animation arc.\n * Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp).\n *\n * ### Usage\n *\n * In the following example, the offset values describe\n * when each `backgroundColor` value is applied. The color is red at the start, and changes to\n * blue when 20% of the total time has elapsed.\n *\n * ```typescript\n * // the provided offset values\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\", offset: 0 }),\n * style({ backgroundColor: \"blue\", offset: 0.2 }),\n * style({ backgroundColor: \"orange\", offset: 0.3 }),\n * style({ backgroundColor: \"black\", offset: 1 })\n * ]))\n * ```\n *\n * If there are no `offset` values specified in the style entries, the offsets\n * are calculated automatically.\n *\n * ```typescript\n * animate(\"5s\", keyframes([\n * style({ backgroundColor: \"red\" }) // offset = 0\n * style({ backgroundColor: \"blue\" }) // offset = 0.33\n * style({ backgroundColor: \"orange\" }) // offset = 0.66\n * style({ backgroundColor: \"black\" }) // offset = 1\n * ]))\n *```\n\n * @publicApi\n */\nfunction keyframes(steps) {\n return { type: 5 /* AnimationMetadataType.Keyframes */, steps };\n}\n/**\n * Declares an animation transition which is played when a certain specified condition is met.\n *\n * @param stateChangeExpr A string with a specific format or a function that specifies when the\n * animation transition should occur (see [State Change Expression](#state-change-expression)).\n *\n * @param steps One or more animation objects that represent the animation's instructions.\n *\n * @param options An options object that can be used to specify a delay for the animation or provide\n * custom parameters for it.\n *\n * @returns An object that encapsulates the transition data.\n *\n * @usageNotes\n *\n * ### State Change Expression\n *\n * The State Change Expression instructs Angular when to run the transition's animations, it can\n *either be\n * - a string with a specific syntax\n * - or a function that compares the previous and current state (value of the expression bound to\n * the element's trigger) and returns `true` if the transition should occur or `false` otherwise\n *\n * The string format can be:\n * - `fromState => toState`, which indicates that the transition's animations should occur then the\n * expression bound to the trigger's element goes from `fromState` to `toState`\n *\n * _Example:_\n * ```typescript\n * transition('open => closed', animate('.5s ease-out', style({ height: 0 }) ))\n * ```\n *\n * - `fromState <=> toState`, which indicates that the transition's animations should occur then\n * the expression bound to the trigger's element goes from `fromState` to `toState` or vice versa\n *\n * _Example:_\n * ```typescript\n * transition('enabled <=> disabled', animate('1s cubic-bezier(0.8,0.3,0,1)'))\n * ```\n *\n * - `:enter`/`:leave`, which indicates that the transition's animations should occur when the\n * element enters or exists the DOM\n *\n * _Example:_\n * ```typescript\n * transition(':enter', [\n * style({ opacity: 0 }),\n * animate('500ms', style({ opacity: 1 }))\n * ])\n * ```\n *\n * - `:increment`/`:decrement`, which indicates that the transition's animations should occur when\n * the numerical expression bound to the trigger's element has increased in value or decreased\n *\n * _Example:_\n * ```typescript\n * transition(':increment', query('@counter', animateChild()))\n * ```\n *\n * - a sequence of any of the above divided by commas, which indicates that transition's animations\n * should occur whenever one of the state change expressions matches\n *\n * _Example:_\n * ```typescript\n * transition(':increment, * => enabled, :enter', animate('1s ease', keyframes([\n * style({ transform: 'scale(1)', offset: 0}),\n * style({ transform: 'scale(1.1)', offset: 0.7}),\n * style({ transform: 'scale(1)', offset: 1})\n * ]))),\n * ```\n *\n * Also note that in such context:\n * - `void` can be used to indicate the absence of the element\n * - asterisks can be used as wildcards that match any state\n * - (as a consequence of the above, `void => *` is equivalent to `:enter` and `* => void` is\n * equivalent to `:leave`)\n * - `true` and `false` also match expression values of `1` and `0` respectively (but do not match\n * _truthy_ and _falsy_ values)\n *\n *
\n *\n * Be careful about entering end leaving elements as their transitions present a common\n * pitfall for developers.\n *\n * Note that when an element with a trigger enters the DOM its `:enter` transition always\n * gets executed, but its `:leave` transition will not be executed if the element is removed\n * alongside its parent (as it will be removed \"without warning\" before its transition has\n * a chance to be executed, the only way that such transition can occur is if the element\n * is exiting the DOM on its own).\n *\n *\n *
\n *\n * ### Animating to a Final State\n *\n * If the final step in a transition is a call to `animate()` that uses a timing value\n * with no `style` data, that step is automatically considered the final animation arc,\n * for the element to reach the final state, in such case Angular automatically adds or removes\n * CSS styles to ensure that the element is in the correct final state.\n *\n *\n * ### Usage Examples\n *\n * - Transition animations applied based on\n * the trigger's expression value\n *\n * ```HTML\n *
\n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\"on => off, open => closed\", animate(500)),\n * transition(\"* <=> error\", query('.indicator', animateChild()))\n * ])\n * ```\n *\n * - Transition animations applied based on custom logic dependent\n * on the trigger's expression value and provided parameters\n *\n * ```HTML\n *
\n * ...\n *
\n * ```\n *\n * ```typescript\n * trigger(\"myAnimationTrigger\", [\n * ..., // states\n * transition(\n * (fromState, toState, _element, params) =>\n * ['firststep', 'laststep'].includes(fromState.toLowerCase())\n * && toState === params?.['target'],\n * animate('1s')\n * )\n * ])\n * ```\n *\n * @publicApi\n **/\nfunction transition(stateChangeExpr, steps, options = null) {\n return { type: 1 /* AnimationMetadataType.Transition */, expr: stateChangeExpr, animation: steps, options };\n}\n/**\n * Produces a reusable animation that can be invoked in another animation or sequence,\n * by calling the `useAnimation()` function.\n *\n * @param steps One or more animation objects, as returned by the `animate()`\n * or `sequence()` function, that form a transformation from one state to another.\n * A sequence is used by default when you pass an array.\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional developer-defined parameters.\n * Provided values for additional parameters are used as defaults,\n * and override values can be passed to the caller on invocation.\n * @returns An object that encapsulates the animation data.\n *\n * @usageNotes\n * The following example defines a reusable animation, providing some default parameter\n * values.\n *\n * ```typescript\n * var fadeAnimation = animation([\n * style({ opacity: '{{ start }}' }),\n * animate('{{ time }}',\n * style({ opacity: '{{ end }}'}))\n * ],\n * { params: { time: '1000ms', start: 0, end: 1 }});\n * ```\n *\n * The following invokes the defined animation with a call to `useAnimation()`,\n * passing in override parameter values.\n *\n * ```js\n * useAnimation(fadeAnimation, {\n * params: {\n * time: '2s',\n * start: 1,\n * end: 0\n * }\n * })\n * ```\n *\n * If any of the passed-in parameter values are missing from this call,\n * the default values are used. If one or more parameter values are missing before a step is\n * animated, `useAnimation()` throws an error.\n *\n * @publicApi\n */\nfunction animation(steps, options = null) {\n return { type: 8 /* AnimationMetadataType.Reference */, animation: steps, options };\n}\n/**\n * Executes a queried inner animation element within an animation sequence.\n *\n * @param options An options object that can contain a delay value for the start of the\n * animation, and additional override values for developer-defined parameters.\n * @return An object that encapsulates the child animation data.\n *\n * @usageNotes\n * Each time an animation is triggered in Angular, the parent animation\n * has priority and any child animations are blocked. In order\n * for a child animation to run, the parent animation must query each of the elements\n * containing child animations, and run them using this function.\n *\n * Note that this feature is designed to be used with `query()` and it will only work\n * with animations that are assigned using the Angular animation library. CSS keyframes\n * and transitions are not handled by this API.\n *\n * @publicApi\n */\nfunction animateChild(options = null) {\n return { type: 9 /* AnimationMetadataType.AnimateChild */, options };\n}\n/**\n * Starts a reusable animation that is created using the `animation()` function.\n *\n * @param animation The reusable animation to start.\n * @param options An options object that can contain a delay value for the start of\n * the animation, and additional override values for developer-defined parameters.\n * @return An object that contains the animation parameters.\n *\n * @publicApi\n */\nfunction useAnimation(animation, options = null) {\n return { type: 10 /* AnimationMetadataType.AnimateRef */, animation, options };\n}\n/**\n * Finds one or more inner elements within the current element that is\n * being animated within a sequence. Use with `animate()`.\n *\n * @param selector The element to query, or a set of elements that contain Angular-specific\n * characteristics, specified with one or more of the following tokens.\n * - `query(\":enter\")` or `query(\":leave\")` : Query for newly inserted/removed elements (not\n * all elements can be queried via these tokens, see\n * [Entering and Leaving Elements](#entering-and-leaving-elements))\n * - `query(\":animating\")` : Query all currently animating elements.\n * - `query(\"@triggerName\")` : Query elements that contain an animation trigger.\n * - `query(\"@*\")` : Query all elements that contain an animation triggers.\n * - `query(\":self\")` : Include the current element into the animation sequence.\n *\n * @param animation One or more animation steps to apply to the queried element or elements.\n * An array is treated as an animation sequence.\n * @param options An options object. Use the 'limit' field to limit the total number of\n * items to collect.\n * @return An object that encapsulates the query data.\n *\n * @usageNotes\n *\n * ### Multiple Tokens\n *\n * Tokens can be merged into a combined query selector string. For example:\n *\n * ```typescript\n * query(':self, .record:enter, .record:leave, @subTrigger', [...])\n * ```\n *\n * The `query()` function collects multiple elements and works internally by using\n * `element.querySelectorAll`. Use the `limit` field of an options object to limit\n * the total number of items to be collected. For example:\n *\n * ```js\n * query('div', [\n * animate(...),\n * animate(...)\n * ], { limit: 1 })\n * ```\n *\n * By default, throws an error when zero items are found. Set the\n * `optional` flag to ignore this error. For example:\n *\n * ```js\n * query('.some-element-that-may-not-be-there', [\n * animate(...),\n * animate(...)\n * ], { optional: true })\n * ```\n *\n * ### Entering and Leaving Elements\n *\n * Not all elements can be queried via the `:enter` and `:leave` tokens, the only ones\n * that can are those that Angular assumes can enter/leave based on their own logic\n * (if their insertion/removal is simply a consequence of that of their parent they\n * should be queried via a different token in their parent's `:enter`/`:leave` transitions).\n *\n * The only elements Angular assumes can enter/leave based on their own logic (thus the only\n * ones that can be queried via the `:enter` and `:leave` tokens) are:\n * - Those inserted dynamically (via `ViewContainerRef`)\n * - Those that have a structural directive (which, under the hood, are a subset of the above ones)\n *\n *
\n *\n * Note that elements will be successfully queried via `:enter`/`:leave` even if their\n * insertion/removal is not done manually via `ViewContainerRef`or caused by their structural\n * directive (e.g. they enter/exit alongside their parent).\n *\n *
\n *\n *
\n *\n * There is an exception to what previously mentioned, besides elements entering/leaving based on\n * their own logic, elements with an animation trigger can always be queried via `:leave` when\n * their parent is also leaving.\n *\n *
\n *\n * ### Usage Example\n *\n * The following example queries for inner elements and animates them\n * individually using `animate()`.\n *\n * ```typescript\n * @Component({\n * selector: 'inner',\n * template: `\n *
\n *

Title

\n *
\n * Blah blah blah\n *
\n *
\n * `,\n * animations: [\n * trigger('queryAnimation', [\n * transition('* => goAnimate', [\n * // hide the inner elements\n * query('h1', style({ opacity: 0 })),\n * query('.content', style({ opacity: 0 })),\n *\n * // animate the inner elements in, one by one\n * query('h1', animate(1000, style({ opacity: 1 }))),\n * query('.content', animate(1000, style({ opacity: 1 }))),\n * ])\n * ])\n * ]\n * })\n * class Cmp {\n * exp = '';\n *\n * goAnimate() {\n * this.exp = 'goAnimate';\n * }\n * }\n * ```\n *\n * @publicApi\n */\nfunction query(selector, animation, options = null) {\n return { type: 11 /* AnimationMetadataType.Query */, selector, animation, options };\n}\n/**\n * Use within an animation `query()` call to issue a timing gap after\n * each queried item is animated.\n *\n * @param timings A delay value.\n * @param animation One ore more animation steps.\n * @returns An object that encapsulates the stagger data.\n *\n * @usageNotes\n * In the following example, a container element wraps a list of items stamped out\n * by an `ngFor`. The container element contains an animation trigger that will later be set\n * to query for each of the inner items.\n *\n * Each time items are added, the opacity fade-in animation runs,\n * and each removed item is faded out.\n * When either of these animations occur, the stagger effect is\n * applied after each item's animation is started.\n *\n * ```html\n * \n * \n *
\n *
\n *
\n * {{ item }}\n *
\n *
\n * ```\n *\n * Here is the component code:\n *\n * ```typescript\n * import {trigger, transition, style, animate, query, stagger} from '@angular/animations';\n * @Component({\n * templateUrl: 'list.component.html',\n * animations: [\n * trigger('listAnimation', [\n * ...\n * ])\n * ]\n * })\n * class ListComponent {\n * items = [];\n *\n * showItems() {\n * this.items = [0,1,2,3,4];\n * }\n *\n * hideItems() {\n * this.items = [];\n * }\n *\n * toggle() {\n * this.items.length ? this.hideItems() : this.showItems();\n * }\n * }\n * ```\n *\n * Here is the animation trigger code:\n *\n * ```typescript\n * trigger('listAnimation', [\n * transition('* => *', [ // each time the binding value changes\n * query(':leave', [\n * stagger(100, [\n * animate('0.5s', style({ opacity: 0 }))\n * ])\n * ]),\n * query(':enter', [\n * style({ opacity: 0 }),\n * stagger(100, [\n * animate('0.5s', style({ opacity: 1 }))\n * ])\n * ])\n * ])\n * ])\n * ```\n *\n * @publicApi\n */\nfunction stagger(timings, animation) {\n return { type: 12 /* AnimationMetadataType.Stagger */, timings, animation };\n}\n\nfunction scheduleMicroTask(cb) {\n Promise.resolve().then(cb);\n}\n\n/**\n * An empty programmatic controller for reusable animations.\n * Used internally when animations are disabled, to avoid\n * checking for the null case when an animation player is expected.\n *\n * @see `animate()`\n * @see `AnimationPlayer`\n * @see `GroupPlayer`\n *\n * @publicApi\n */\nclass NoopAnimationPlayer {\n constructor(duration = 0, delay = 0) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._onDestroyFns = [];\n this._originalOnDoneFns = [];\n this._originalOnStartFns = [];\n this._started = false;\n this._destroyed = false;\n this._finished = false;\n this._position = 0;\n this.parentPlayer = null;\n this.totalTime = duration + delay;\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n onStart(fn) {\n this._originalOnStartFns.push(fn);\n this._onStartFns.push(fn);\n }\n onDone(fn) {\n this._originalOnDoneFns.push(fn);\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n init() { }\n play() {\n if (!this.hasStarted()) {\n this._onStart();\n this.triggerMicrotask();\n }\n this._started = true;\n }\n /** @internal */\n triggerMicrotask() {\n scheduleMicroTask(() => this._onFinish());\n }\n _onStart() {\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n pause() { }\n restart() { }\n finish() {\n this._onFinish();\n }\n destroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n if (!this.hasStarted()) {\n this._onStart();\n }\n this.finish();\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this._started = false;\n this._finished = false;\n this._onStartFns = this._originalOnStartFns;\n this._onDoneFns = this._originalOnDoneFns;\n }\n setPosition(position) {\n this._position = this.totalTime ? position * this.totalTime : 1;\n }\n getPosition() {\n return this.totalTime ? this._position / this.totalTime : 1;\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\n/**\n * A programmatic controller for a group of reusable animations.\n * Used internally to control animations.\n *\n * @see `AnimationPlayer`\n * @see `{@link animations/group group()}`\n *\n */\nclass AnimationGroupPlayer {\n constructor(_players) {\n this._onDoneFns = [];\n this._onStartFns = [];\n this._finished = false;\n this._started = false;\n this._destroyed = false;\n this._onDestroyFns = [];\n this.parentPlayer = null;\n this.totalTime = 0;\n this.players = _players;\n let doneCount = 0;\n let destroyCount = 0;\n let startCount = 0;\n const total = this.players.length;\n if (total == 0) {\n scheduleMicroTask(() => this._onFinish());\n }\n else {\n this.players.forEach(player => {\n player.onDone(() => {\n if (++doneCount == total) {\n this._onFinish();\n }\n });\n player.onDestroy(() => {\n if (++destroyCount == total) {\n this._onDestroy();\n }\n });\n player.onStart(() => {\n if (++startCount == total) {\n this._onStart();\n }\n });\n });\n }\n this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0);\n }\n _onFinish() {\n if (!this._finished) {\n this._finished = true;\n this._onDoneFns.forEach(fn => fn());\n this._onDoneFns = [];\n }\n }\n init() {\n this.players.forEach(player => player.init());\n }\n onStart(fn) {\n this._onStartFns.push(fn);\n }\n _onStart() {\n if (!this.hasStarted()) {\n this._started = true;\n this._onStartFns.forEach(fn => fn());\n this._onStartFns = [];\n }\n }\n onDone(fn) {\n this._onDoneFns.push(fn);\n }\n onDestroy(fn) {\n this._onDestroyFns.push(fn);\n }\n hasStarted() {\n return this._started;\n }\n play() {\n if (!this.parentPlayer) {\n this.init();\n }\n this._onStart();\n this.players.forEach(player => player.play());\n }\n pause() {\n this.players.forEach(player => player.pause());\n }\n restart() {\n this.players.forEach(player => player.restart());\n }\n finish() {\n this._onFinish();\n this.players.forEach(player => player.finish());\n }\n destroy() {\n this._onDestroy();\n }\n _onDestroy() {\n if (!this._destroyed) {\n this._destroyed = true;\n this._onFinish();\n this.players.forEach(player => player.destroy());\n this._onDestroyFns.forEach(fn => fn());\n this._onDestroyFns = [];\n }\n }\n reset() {\n this.players.forEach(player => player.reset());\n this._destroyed = false;\n this._finished = false;\n this._started = false;\n }\n setPosition(p) {\n const timeAtPosition = p * this.totalTime;\n this.players.forEach(player => {\n const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1;\n player.setPosition(position);\n });\n }\n getPosition() {\n const longestPlayer = this.players.reduce((longestSoFar, player) => {\n const newPlayerIsLongest = longestSoFar === null || player.totalTime > longestSoFar.totalTime;\n return newPlayerIsLongest ? player : longestSoFar;\n }, null);\n return longestPlayer != null ? longestPlayer.getPosition() : 0;\n }\n beforeDestroy() {\n this.players.forEach(player => {\n if (player.beforeDestroy) {\n player.beforeDestroy();\n }\n });\n }\n /** @internal */\n triggerCallback(phaseName) {\n const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns;\n methods.forEach(fn => fn());\n methods.length = 0;\n }\n}\n\nconst ɵPRE_STYLE = '!';\n\n/**\n * @module\n * @description\n * Entry point for all animation APIs of the animation package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { AUTO_STYLE, AnimationBuilder, AnimationFactory, NoopAnimationPlayer, animate, animateChild, animation, group, keyframes, query, sequence, stagger, state, style, transition, trigger, useAnimation, AnimationGroupPlayer as ɵAnimationGroupPlayer, ɵPRE_STYLE };\n","import { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { inject, APP_ID, Injectable, Inject, QueryList, Directive, Input, InjectionToken, Optional, EventEmitter, Output, NgModule } from '@angular/core';\nimport * as i1 from '@angular/cdk/platform';\nimport { _getFocusedElementPierceShadowDom, normalizePassiveListenerOptions, _getEventTarget, _getShadowRoot } from '@angular/cdk/platform';\nimport { Subject, Subscription, BehaviorSubject, of } from 'rxjs';\nimport { hasModifierKey, A, Z, ZERO, NINE, PAGE_DOWN, PAGE_UP, END, HOME, LEFT_ARROW, RIGHT_ARROW, UP_ARROW, DOWN_ARROW, TAB, ALT, CONTROL, MAC_META, META, SHIFT } from '@angular/cdk/keycodes';\nimport { tap, debounceTime, filter, map, take, skip, distinctUntilChanged, takeUntil } from 'rxjs/operators';\nimport { coerceBooleanProperty, coerceElement } from '@angular/cdk/coercion';\nimport * as i1$1 from '@angular/cdk/observers';\nimport { ObserversModule } from '@angular/cdk/observers';\nimport { BreakpointObserver } from '@angular/cdk/layout';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** IDs are delimited by an empty space, as per the spec. */\nconst ID_DELIMITER = ' ';\n/**\n * Adds the given ID to the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction addAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n if (ids.some(existingId => existingId.trim() == id.trim())) {\n return;\n }\n ids.push(id.trim());\n el.setAttribute(attr, ids.join(ID_DELIMITER));\n}\n/**\n * Removes the given ID from the specified ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction removeAriaReferencedId(el, attr, id) {\n const ids = getAriaReferenceIds(el, attr);\n const filteredIds = ids.filter(val => val != id.trim());\n if (filteredIds.length) {\n el.setAttribute(attr, filteredIds.join(ID_DELIMITER));\n }\n else {\n el.removeAttribute(attr);\n }\n}\n/**\n * Gets the list of IDs referenced by the given ARIA attribute on an element.\n * Used for attributes such as aria-labelledby, aria-owns, etc.\n */\nfunction getAriaReferenceIds(el, attr) {\n // Get string array of all individual ids (whitespace delimited) in the attribute value\n return (el.getAttribute(attr) || '').match(/\\S+/g) || [];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * ID used for the body container where all messages are appended.\n * @deprecated No longer being used. To be removed.\n * @breaking-change 14.0.0\n */\nconst MESSAGES_CONTAINER_ID = 'cdk-describedby-message-container';\n/**\n * ID prefix used for each created message element.\n * @deprecated To be turned into a private variable.\n * @breaking-change 14.0.0\n */\nconst CDK_DESCRIBEDBY_ID_PREFIX = 'cdk-describedby-message';\n/**\n * Attribute given to each host element that is described by a message element.\n * @deprecated To be turned into a private variable.\n * @breaking-change 14.0.0\n */\nconst CDK_DESCRIBEDBY_HOST_ATTRIBUTE = 'cdk-describedby-host';\n/** Global incremental identifier for each registered message element. */\nlet nextId = 0;\n/**\n * Utility that creates visually hidden elements with a message content. Useful for elements that\n * want to use aria-describedby to further describe themselves without adding additional visual\n * content.\n */\nclass AriaDescriber {\n constructor(_document, \n /**\n * @deprecated To be turned into a required parameter.\n * @breaking-change 14.0.0\n */\n _platform) {\n this._platform = _platform;\n /** Map of all registered message elements that have been placed into the document. */\n this._messageRegistry = new Map();\n /** Container for all registered messages. */\n this._messagesContainer = null;\n /** Unique ID for the service. */\n this._id = `${nextId++}`;\n this._document = _document;\n this._id = inject(APP_ID) + '-' + nextId++;\n }\n describe(hostElement, message, role) {\n if (!this._canBeDescribed(hostElement, message)) {\n return;\n }\n const key = getKey(message, role);\n if (typeof message !== 'string') {\n // We need to ensure that the element has an ID.\n setMessageId(message, this._id);\n this._messageRegistry.set(key, { messageElement: message, referenceCount: 0 });\n }\n else if (!this._messageRegistry.has(key)) {\n this._createMessageElement(message, role);\n }\n if (!this._isElementDescribedByMessage(hostElement, key)) {\n this._addMessageReference(hostElement, key);\n }\n }\n removeDescription(hostElement, message, role) {\n if (!message || !this._isElementNode(hostElement)) {\n return;\n }\n const key = getKey(message, role);\n if (this._isElementDescribedByMessage(hostElement, key)) {\n this._removeMessageReference(hostElement, key);\n }\n // If the message is a string, it means that it's one that we created for the\n // consumer so we can remove it safely, otherwise we should leave it in place.\n if (typeof message === 'string') {\n const registeredMessage = this._messageRegistry.get(key);\n if (registeredMessage && registeredMessage.referenceCount === 0) {\n this._deleteMessageElement(key);\n }\n }\n if (this._messagesContainer?.childNodes.length === 0) {\n this._messagesContainer.remove();\n this._messagesContainer = null;\n }\n }\n /** Unregisters all created message elements and removes the message container. */\n ngOnDestroy() {\n const describedElements = this._document.querySelectorAll(`[${CDK_DESCRIBEDBY_HOST_ATTRIBUTE}=\"${this._id}\"]`);\n for (let i = 0; i < describedElements.length; i++) {\n this._removeCdkDescribedByReferenceIds(describedElements[i]);\n describedElements[i].removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n this._messagesContainer?.remove();\n this._messagesContainer = null;\n this._messageRegistry.clear();\n }\n /**\n * Creates a new element in the visually hidden message container element with the message\n * as its content and adds it to the message registry.\n */\n _createMessageElement(message, role) {\n const messageElement = this._document.createElement('div');\n setMessageId(messageElement, this._id);\n messageElement.textContent = message;\n if (role) {\n messageElement.setAttribute('role', role);\n }\n this._createMessagesContainer();\n this._messagesContainer.appendChild(messageElement);\n this._messageRegistry.set(getKey(message, role), { messageElement, referenceCount: 0 });\n }\n /** Deletes the message element from the global messages container. */\n _deleteMessageElement(key) {\n this._messageRegistry.get(key)?.messageElement?.remove();\n this._messageRegistry.delete(key);\n }\n /** Creates the global container for all aria-describedby messages. */\n _createMessagesContainer() {\n if (this._messagesContainer) {\n return;\n }\n const containerClassName = 'cdk-describedby-message-container';\n const serverContainers = this._document.querySelectorAll(`.${containerClassName}[platform=\"server\"]`);\n for (let i = 0; i < serverContainers.length; i++) {\n // When going from the server to the client, we may end up in a situation where there's\n // already a container on the page, but we don't have a reference to it. Clear the\n // old container so we don't get duplicates. Doing this, instead of emptying the previous\n // container, should be slightly faster.\n serverContainers[i].remove();\n }\n const messagesContainer = this._document.createElement('div');\n // We add `visibility: hidden` in order to prevent text in this container from\n // being searchable by the browser's Ctrl + F functionality.\n // Screen-readers will still read the description for elements with aria-describedby even\n // when the description element is not visible.\n messagesContainer.style.visibility = 'hidden';\n // Even though we use `visibility: hidden`, we still apply `cdk-visually-hidden` so that\n // the description element doesn't impact page layout.\n messagesContainer.classList.add(containerClassName);\n messagesContainer.classList.add('cdk-visually-hidden');\n // @breaking-change 14.0.0 Remove null check for `_platform`.\n if (this._platform && !this._platform.isBrowser) {\n messagesContainer.setAttribute('platform', 'server');\n }\n this._document.body.appendChild(messagesContainer);\n this._messagesContainer = messagesContainer;\n }\n /** Removes all cdk-describedby messages that are hosted through the element. */\n _removeCdkDescribedByReferenceIds(element) {\n // Remove all aria-describedby reference IDs that are prefixed by CDK_DESCRIBEDBY_ID_PREFIX\n const originalReferenceIds = getAriaReferenceIds(element, 'aria-describedby').filter(id => id.indexOf(CDK_DESCRIBEDBY_ID_PREFIX) != 0);\n element.setAttribute('aria-describedby', originalReferenceIds.join(' '));\n }\n /**\n * Adds a message reference to the element using aria-describedby and increments the registered\n * message's reference count.\n */\n _addMessageReference(element, key) {\n const registeredMessage = this._messageRegistry.get(key);\n // Add the aria-describedby reference and set the\n // describedby_host attribute to mark the element.\n addAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.setAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE, this._id);\n registeredMessage.referenceCount++;\n }\n /**\n * Removes a message reference from the element using aria-describedby\n * and decrements the registered message's reference count.\n */\n _removeMessageReference(element, key) {\n const registeredMessage = this._messageRegistry.get(key);\n registeredMessage.referenceCount--;\n removeAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id);\n element.removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE);\n }\n /** Returns true if the element has been described by the provided message ID. */\n _isElementDescribedByMessage(element, key) {\n const referenceIds = getAriaReferenceIds(element, 'aria-describedby');\n const registeredMessage = this._messageRegistry.get(key);\n const messageId = registeredMessage && registeredMessage.messageElement.id;\n return !!messageId && referenceIds.indexOf(messageId) != -1;\n }\n /** Determines whether a message can be described on a particular element. */\n _canBeDescribed(element, message) {\n if (!this._isElementNode(element)) {\n return false;\n }\n if (message && typeof message === 'object') {\n // We'd have to make some assumptions about the description element's text, if the consumer\n // passed in an element. Assume that if an element is passed in, the consumer has verified\n // that it can be used as a description.\n return true;\n }\n const trimmedMessage = message == null ? '' : `${message}`.trim();\n const ariaLabel = element.getAttribute('aria-label');\n // We shouldn't set descriptions if they're exactly the same as the `aria-label` of the\n // element, because screen readers will end up reading out the same text twice in a row.\n return trimmedMessage ? !ariaLabel || ariaLabel.trim() !== trimmedMessage : false;\n }\n /** Checks whether a node is an Element node. */\n _isElementNode(element) {\n return element.nodeType === this._document.ELEMENT_NODE;\n }\n}\nAriaDescriber.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: AriaDescriber, deps: [{ token: DOCUMENT }, { token: i1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nAriaDescriber.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: AriaDescriber, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: AriaDescriber, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1.Platform }]; } });\n/** Gets a key that can be used to look messages up in the registry. */\nfunction getKey(message, role) {\n return typeof message === 'string' ? `${role || ''}/${message}` : message;\n}\n/** Assigns a unique ID to an element, if it doesn't have one already. */\nfunction setMessageId(element, serviceId) {\n if (!element.id) {\n element.id = `${CDK_DESCRIBEDBY_ID_PREFIX}-${serviceId}-${nextId++}`;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * This class manages keyboard events for selectable lists. If you pass it a query list\n * of items, it will set the active item correctly when arrow events occur.\n */\nclass ListKeyManager {\n constructor(_items) {\n this._items = _items;\n this._activeItemIndex = -1;\n this._activeItem = null;\n this._wrap = false;\n this._letterKeyStream = new Subject();\n this._typeaheadSubscription = Subscription.EMPTY;\n this._vertical = true;\n this._allowedModifierKeys = [];\n this._homeAndEnd = false;\n this._pageUpAndDown = { enabled: false, delta: 10 };\n /**\n * Predicate function that can be used to check whether an item should be skipped\n * by the key manager. By default, disabled items are skipped.\n */\n this._skipPredicateFn = (item) => item.disabled;\n // Buffer for the letters that the user has pressed when the typeahead option is turned on.\n this._pressedLetters = [];\n /**\n * Stream that emits any time the TAB key is pressed, so components can react\n * when focus is shifted off of the list.\n */\n this.tabOut = new Subject();\n /** Stream that emits whenever the active item of the list manager changes. */\n this.change = new Subject();\n // We allow for the items to be an array because, in some cases, the consumer may\n // not have access to a QueryList of the items they want to manage (e.g. when the\n // items aren't being collected via `ViewChildren` or `ContentChildren`).\n if (_items instanceof QueryList) {\n this._itemChangesSubscription = _items.changes.subscribe((newItems) => {\n if (this._activeItem) {\n const itemArray = newItems.toArray();\n const newIndex = itemArray.indexOf(this._activeItem);\n if (newIndex > -1 && newIndex !== this._activeItemIndex) {\n this._activeItemIndex = newIndex;\n }\n }\n });\n }\n }\n /**\n * Sets the predicate function that determines which items should be skipped by the\n * list key manager.\n * @param predicate Function that determines whether the given item should be skipped.\n */\n skipPredicate(predicate) {\n this._skipPredicateFn = predicate;\n return this;\n }\n /**\n * Configures wrapping mode, which determines whether the active item will wrap to\n * the other end of list when there are no more items in the given direction.\n * @param shouldWrap Whether the list should wrap when reaching the end.\n */\n withWrap(shouldWrap = true) {\n this._wrap = shouldWrap;\n return this;\n }\n /**\n * Configures whether the key manager should be able to move the selection vertically.\n * @param enabled Whether vertical selection should be enabled.\n */\n withVerticalOrientation(enabled = true) {\n this._vertical = enabled;\n return this;\n }\n /**\n * Configures the key manager to move the selection horizontally.\n * Passing in `null` will disable horizontal movement.\n * @param direction Direction in which the selection can be moved.\n */\n withHorizontalOrientation(direction) {\n this._horizontal = direction;\n return this;\n }\n /**\n * Modifier keys which are allowed to be held down and whose default actions will be prevented\n * as the user is pressing the arrow keys. Defaults to not allowing any modifier keys.\n */\n withAllowedModifierKeys(keys) {\n this._allowedModifierKeys = keys;\n return this;\n }\n /**\n * Turns on typeahead mode which allows users to set the active item by typing.\n * @param debounceInterval Time to wait after the last keystroke before setting the active item.\n */\n withTypeAhead(debounceInterval = 200) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n this._items.length &&\n this._items.some(item => typeof item.getLabel !== 'function')) {\n throw Error('ListKeyManager items in typeahead mode must implement the `getLabel` method.');\n }\n this._typeaheadSubscription.unsubscribe();\n // Debounce the presses of non-navigational keys, collect the ones that correspond to letters\n // and convert those letters back into a string. Afterwards find the first item that starts\n // with that string and select it.\n this._typeaheadSubscription = this._letterKeyStream\n .pipe(tap(letter => this._pressedLetters.push(letter)), debounceTime(debounceInterval), filter(() => this._pressedLetters.length > 0), map(() => this._pressedLetters.join('')))\n .subscribe(inputString => {\n const items = this._getItemsArray();\n // Start at 1 because we want to start searching at the item immediately\n // following the current active item.\n for (let i = 1; i < items.length + 1; i++) {\n const index = (this._activeItemIndex + i) % items.length;\n const item = items[index];\n if (!this._skipPredicateFn(item) &&\n item.getLabel().toUpperCase().trim().indexOf(inputString) === 0) {\n this.setActiveItem(index);\n break;\n }\n }\n this._pressedLetters = [];\n });\n return this;\n }\n /** Cancels the current typeahead sequence. */\n cancelTypeahead() {\n this._pressedLetters = [];\n return this;\n }\n /**\n * Configures the key manager to activate the first and last items\n * respectively when the Home or End key is pressed.\n * @param enabled Whether pressing the Home or End key activates the first/last item.\n */\n withHomeAndEnd(enabled = true) {\n this._homeAndEnd = enabled;\n return this;\n }\n /**\n * Configures the key manager to activate every 10th, configured or first/last element in up/down direction\n * respectively when the Page-Up or Page-Down key is pressed.\n * @param enabled Whether pressing the Page-Up or Page-Down key activates the first/last item.\n * @param delta Whether pressing the Home or End key activates the first/last item.\n */\n withPageUpDown(enabled = true, delta = 10) {\n this._pageUpAndDown = { enabled, delta };\n return this;\n }\n setActiveItem(item) {\n const previousActiveItem = this._activeItem;\n this.updateActiveItem(item);\n if (this._activeItem !== previousActiveItem) {\n this.change.next(this._activeItemIndex);\n }\n }\n /**\n * Sets the active item depending on the key event passed in.\n * @param event Keyboard event to be used for determining which element should be active.\n */\n onKeydown(event) {\n const keyCode = event.keyCode;\n const modifiers = ['altKey', 'ctrlKey', 'metaKey', 'shiftKey'];\n const isModifierAllowed = modifiers.every(modifier => {\n return !event[modifier] || this._allowedModifierKeys.indexOf(modifier) > -1;\n });\n switch (keyCode) {\n case TAB:\n this.tabOut.next();\n return;\n case DOWN_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case UP_ARROW:\n if (this._vertical && isModifierAllowed) {\n this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case RIGHT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setPreviousItemActive() : this.setNextItemActive();\n break;\n }\n else {\n return;\n }\n case LEFT_ARROW:\n if (this._horizontal && isModifierAllowed) {\n this._horizontal === 'rtl' ? this.setNextItemActive() : this.setPreviousItemActive();\n break;\n }\n else {\n return;\n }\n case HOME:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setFirstItemActive();\n break;\n }\n else {\n return;\n }\n case END:\n if (this._homeAndEnd && isModifierAllowed) {\n this.setLastItemActive();\n break;\n }\n else {\n return;\n }\n case PAGE_UP:\n if (this._pageUpAndDown.enabled && isModifierAllowed) {\n const targetIndex = this._activeItemIndex - this._pageUpAndDown.delta;\n this._setActiveItemByIndex(targetIndex > 0 ? targetIndex : 0, 1);\n break;\n }\n else {\n return;\n }\n case PAGE_DOWN:\n if (this._pageUpAndDown.enabled && isModifierAllowed) {\n const targetIndex = this._activeItemIndex + this._pageUpAndDown.delta;\n const itemsLength = this._getItemsArray().length;\n this._setActiveItemByIndex(targetIndex < itemsLength ? targetIndex : itemsLength - 1, -1);\n break;\n }\n else {\n return;\n }\n default:\n if (isModifierAllowed || hasModifierKey(event, 'shiftKey')) {\n // Attempt to use the `event.key` which also maps it to the user's keyboard language,\n // otherwise fall back to resolving alphanumeric characters via the keyCode.\n if (event.key && event.key.length === 1) {\n this._letterKeyStream.next(event.key.toLocaleUpperCase());\n }\n else if ((keyCode >= A && keyCode <= Z) || (keyCode >= ZERO && keyCode <= NINE)) {\n this._letterKeyStream.next(String.fromCharCode(keyCode));\n }\n }\n // Note that we return here, in order to avoid preventing\n // the default action of non-navigational keys.\n return;\n }\n this._pressedLetters = [];\n event.preventDefault();\n }\n /** Index of the currently active item. */\n get activeItemIndex() {\n return this._activeItemIndex;\n }\n /** The active item. */\n get activeItem() {\n return this._activeItem;\n }\n /** Gets whether the user is currently typing into the manager using the typeahead feature. */\n isTyping() {\n return this._pressedLetters.length > 0;\n }\n /** Sets the active item to the first enabled item in the list. */\n setFirstItemActive() {\n this._setActiveItemByIndex(0, 1);\n }\n /** Sets the active item to the last enabled item in the list. */\n setLastItemActive() {\n this._setActiveItemByIndex(this._items.length - 1, -1);\n }\n /** Sets the active item to the next enabled item in the list. */\n setNextItemActive() {\n this._activeItemIndex < 0 ? this.setFirstItemActive() : this._setActiveItemByDelta(1);\n }\n /** Sets the active item to a previous enabled item in the list. */\n setPreviousItemActive() {\n this._activeItemIndex < 0 && this._wrap\n ? this.setLastItemActive()\n : this._setActiveItemByDelta(-1);\n }\n updateActiveItem(item) {\n const itemArray = this._getItemsArray();\n const index = typeof item === 'number' ? item : itemArray.indexOf(item);\n const activeItem = itemArray[index];\n // Explicitly check for `null` and `undefined` because other falsy values are valid.\n this._activeItem = activeItem == null ? null : activeItem;\n this._activeItemIndex = index;\n }\n /** Cleans up the key manager. */\n destroy() {\n this._typeaheadSubscription.unsubscribe();\n this._itemChangesSubscription?.unsubscribe();\n this._letterKeyStream.complete();\n this.tabOut.complete();\n this.change.complete();\n this._pressedLetters = [];\n }\n /**\n * This method sets the active item, given a list of items and the delta between the\n * currently active item and the new active item. It will calculate differently\n * depending on whether wrap mode is turned on.\n */\n _setActiveItemByDelta(delta) {\n this._wrap ? this._setActiveInWrapMode(delta) : this._setActiveInDefaultMode(delta);\n }\n /**\n * Sets the active item properly given \"wrap\" mode. In other words, it will continue to move\n * down the list until it finds an item that is not disabled, and it will wrap if it\n * encounters either end of the list.\n */\n _setActiveInWrapMode(delta) {\n const items = this._getItemsArray();\n for (let i = 1; i <= items.length; i++) {\n const index = (this._activeItemIndex + delta * i + items.length) % items.length;\n const item = items[index];\n if (!this._skipPredicateFn(item)) {\n this.setActiveItem(index);\n return;\n }\n }\n }\n /**\n * Sets the active item properly given the default mode. In other words, it will\n * continue to move down the list until it finds an item that is not disabled. If\n * it encounters either end of the list, it will stop and not wrap.\n */\n _setActiveInDefaultMode(delta) {\n this._setActiveItemByIndex(this._activeItemIndex + delta, delta);\n }\n /**\n * Sets the active item to the first enabled item starting at the index specified. If the\n * item is disabled, it will move in the fallbackDelta direction until it either\n * finds an enabled item or encounters the end of the list.\n */\n _setActiveItemByIndex(index, fallbackDelta) {\n const items = this._getItemsArray();\n if (!items[index]) {\n return;\n }\n while (this._skipPredicateFn(items[index])) {\n index += fallbackDelta;\n if (!items[index]) {\n return;\n }\n }\n this.setActiveItem(index);\n }\n /** Returns the items as an array. */\n _getItemsArray() {\n return this._items instanceof QueryList ? this._items.toArray() : this._items;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass ActiveDescendantKeyManager extends ListKeyManager {\n setActiveItem(index) {\n if (this.activeItem) {\n this.activeItem.setInactiveStyles();\n }\n super.setActiveItem(index);\n if (this.activeItem) {\n this.activeItem.setActiveStyles();\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass FocusKeyManager extends ListKeyManager {\n constructor() {\n super(...arguments);\n this._origin = 'program';\n }\n /**\n * Sets the focus origin that will be passed in to the items for any subsequent `focus` calls.\n * @param origin Focus origin to be used when focusing items.\n */\n setFocusOrigin(origin) {\n this._origin = origin;\n return this;\n }\n setActiveItem(item) {\n super.setActiveItem(item);\n if (this.activeItem) {\n this.activeItem.focus(this._origin);\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Configuration for the isFocusable method.\n */\nclass IsFocusableConfig {\n constructor() {\n /**\n * Whether to count an element as focusable even if it is not currently visible.\n */\n this.ignoreVisibility = false;\n }\n}\n// The InteractivityChecker leans heavily on the ally.js accessibility utilities.\n// Methods like `isTabbable` are only covering specific edge-cases for the browsers which are\n// supported.\n/**\n * Utility for checking the interactivity of an element, such as whether is is focusable or\n * tabbable.\n */\nclass InteractivityChecker {\n constructor(_platform) {\n this._platform = _platform;\n }\n /**\n * Gets whether an element is disabled.\n *\n * @param element Element to be checked.\n * @returns Whether the element is disabled.\n */\n isDisabled(element) {\n // This does not capture some cases, such as a non-form control with a disabled attribute or\n // a form control inside of a disabled form, but should capture the most common cases.\n return element.hasAttribute('disabled');\n }\n /**\n * Gets whether an element is visible for the purposes of interactivity.\n *\n * This will capture states like `display: none` and `visibility: hidden`, but not things like\n * being clipped by an `overflow: hidden` parent or being outside the viewport.\n *\n * @returns Whether the element is visible.\n */\n isVisible(element) {\n return hasGeometry(element) && getComputedStyle(element).visibility === 'visible';\n }\n /**\n * Gets whether an element can be reached via Tab key.\n * Assumes that the element has already been checked with isFocusable.\n *\n * @param element Element to be checked.\n * @returns Whether the element is tabbable.\n */\n isTabbable(element) {\n // Nothing is tabbable on the server 😎\n if (!this._platform.isBrowser) {\n return false;\n }\n const frameElement = getFrameElement(getWindow(element));\n if (frameElement) {\n // Frame elements inherit their tabindex onto all child elements.\n if (getTabIndexValue(frameElement) === -1) {\n return false;\n }\n // Browsers disable tabbing to an element inside of an invisible frame.\n if (!this.isVisible(frameElement)) {\n return false;\n }\n }\n let nodeName = element.nodeName.toLowerCase();\n let tabIndexValue = getTabIndexValue(element);\n if (element.hasAttribute('contenteditable')) {\n return tabIndexValue !== -1;\n }\n if (nodeName === 'iframe' || nodeName === 'object') {\n // The frame or object's content may be tabbable depending on the content, but it's\n // not possibly to reliably detect the content of the frames. We always consider such\n // elements as non-tabbable.\n return false;\n }\n // In iOS, the browser only considers some specific elements as tabbable.\n if (this._platform.WEBKIT && this._platform.IOS && !isPotentiallyTabbableIOS(element)) {\n return false;\n }\n if (nodeName === 'audio') {\n // Audio elements without controls enabled are never tabbable, regardless\n // of the tabindex attribute explicitly being set.\n if (!element.hasAttribute('controls')) {\n return false;\n }\n // Audio elements with controls are by default tabbable unless the\n // tabindex attribute is set to `-1` explicitly.\n return tabIndexValue !== -1;\n }\n if (nodeName === 'video') {\n // For all video elements, if the tabindex attribute is set to `-1`, the video\n // is not tabbable. Note: We cannot rely on the default `HTMLElement.tabIndex`\n // property as that one is set to `-1` in Chrome, Edge and Safari v13.1. The\n // tabindex attribute is the source of truth here.\n if (tabIndexValue === -1) {\n return false;\n }\n // If the tabindex is explicitly set, and not `-1` (as per check before), the\n // video element is always tabbable (regardless of whether it has controls or not).\n if (tabIndexValue !== null) {\n return true;\n }\n // Otherwise (when no explicit tabindex is set), a video is only tabbable if it\n // has controls enabled. Firefox is special as videos are always tabbable regardless\n // of whether there are controls or not.\n return this._platform.FIREFOX || element.hasAttribute('controls');\n }\n return element.tabIndex >= 0;\n }\n /**\n * Gets whether an element can be focused by the user.\n *\n * @param element Element to be checked.\n * @param config The config object with options to customize this method's behavior\n * @returns Whether the element is focusable.\n */\n isFocusable(element, config) {\n // Perform checks in order of left to most expensive.\n // Again, naive approach that does not capture many edge cases and browser quirks.\n return (isPotentiallyFocusable(element) &&\n !this.isDisabled(element) &&\n (config?.ignoreVisibility || this.isVisible(element)));\n }\n}\nInteractivityChecker.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: InteractivityChecker, deps: [{ token: i1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nInteractivityChecker.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: InteractivityChecker, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: InteractivityChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }]; } });\n/**\n * Returns the frame element from a window object. Since browsers like MS Edge throw errors if\n * the frameElement property is being accessed from a different host address, this property\n * should be accessed carefully.\n */\nfunction getFrameElement(window) {\n try {\n return window.frameElement;\n }\n catch {\n return null;\n }\n}\n/** Checks whether the specified element has any geometry / rectangles. */\nfunction hasGeometry(element) {\n // Use logic from jQuery to check for an invisible element.\n // See https://github.com/jquery/jquery/blob/master/src/css/hiddenVisibleSelectors.js#L12\n return !!(element.offsetWidth ||\n element.offsetHeight ||\n (typeof element.getClientRects === 'function' && element.getClientRects().length));\n}\n/** Gets whether an element's */\nfunction isNativeFormElement(element) {\n let nodeName = element.nodeName.toLowerCase();\n return (nodeName === 'input' ||\n nodeName === 'select' ||\n nodeName === 'button' ||\n nodeName === 'textarea');\n}\n/** Gets whether an element is an ``. */\nfunction isHiddenInput(element) {\n return isInputElement(element) && element.type == 'hidden';\n}\n/** Gets whether an element is an anchor that has an href attribute. */\nfunction isAnchorWithHref(element) {\n return isAnchorElement(element) && element.hasAttribute('href');\n}\n/** Gets whether an element is an input element. */\nfunction isInputElement(element) {\n return element.nodeName.toLowerCase() == 'input';\n}\n/** Gets whether an element is an anchor element. */\nfunction isAnchorElement(element) {\n return element.nodeName.toLowerCase() == 'a';\n}\n/** Gets whether an element has a valid tabindex. */\nfunction hasValidTabIndex(element) {\n if (!element.hasAttribute('tabindex') || element.tabIndex === undefined) {\n return false;\n }\n let tabIndex = element.getAttribute('tabindex');\n return !!(tabIndex && !isNaN(parseInt(tabIndex, 10)));\n}\n/**\n * Returns the parsed tabindex from the element attributes instead of returning the\n * evaluated tabindex from the browsers defaults.\n */\nfunction getTabIndexValue(element) {\n if (!hasValidTabIndex(element)) {\n return null;\n }\n // See browser issue in Gecko https://bugzilla.mozilla.org/show_bug.cgi?id=1128054\n const tabIndex = parseInt(element.getAttribute('tabindex') || '', 10);\n return isNaN(tabIndex) ? -1 : tabIndex;\n}\n/** Checks whether the specified element is potentially tabbable on iOS */\nfunction isPotentiallyTabbableIOS(element) {\n let nodeName = element.nodeName.toLowerCase();\n let inputType = nodeName === 'input' && element.type;\n return (inputType === 'text' ||\n inputType === 'password' ||\n nodeName === 'select' ||\n nodeName === 'textarea');\n}\n/**\n * Gets whether an element is potentially focusable without taking current visible/disabled state\n * into account.\n */\nfunction isPotentiallyFocusable(element) {\n // Inputs are potentially focusable *unless* they're type=\"hidden\".\n if (isHiddenInput(element)) {\n return false;\n }\n return (isNativeFormElement(element) ||\n isAnchorWithHref(element) ||\n element.hasAttribute('contenteditable') ||\n hasValidTabIndex(element));\n}\n/** Gets the parent window of a DOM node with regards of being inside of an iframe. */\nfunction getWindow(node) {\n // ownerDocument is null if `node` itself *is* a document.\n return (node.ownerDocument && node.ownerDocument.defaultView) || window;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class currently uses a relatively simple approach to focus trapping.\n * It assumes that the tab order is the same as DOM order, which is not necessarily true.\n * Things like `tabIndex > 0`, flex `order`, and shadow roots can cause the two to be misaligned.\n *\n * @deprecated Use `ConfigurableFocusTrap` instead.\n * @breaking-change 11.0.0\n */\nclass FocusTrap {\n /** Whether the focus trap is active. */\n get enabled() {\n return this._enabled;\n }\n set enabled(value) {\n this._enabled = value;\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(value, this._startAnchor);\n this._toggleAnchorTabIndex(value, this._endAnchor);\n }\n }\n constructor(_element, _checker, _ngZone, _document, deferAnchors = false) {\n this._element = _element;\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._document = _document;\n this._hasAttached = false;\n // Event listeners for the anchors. Need to be regular functions so that we can unbind them later.\n this.startAnchorListener = () => this.focusLastTabbableElement();\n this.endAnchorListener = () => this.focusFirstTabbableElement();\n this._enabled = true;\n if (!deferAnchors) {\n this.attachAnchors();\n }\n }\n /** Destroys the focus trap by cleaning up the anchors. */\n destroy() {\n const startAnchor = this._startAnchor;\n const endAnchor = this._endAnchor;\n if (startAnchor) {\n startAnchor.removeEventListener('focus', this.startAnchorListener);\n startAnchor.remove();\n }\n if (endAnchor) {\n endAnchor.removeEventListener('focus', this.endAnchorListener);\n endAnchor.remove();\n }\n this._startAnchor = this._endAnchor = null;\n this._hasAttached = false;\n }\n /**\n * Inserts the anchors into the DOM. This is usually done automatically\n * in the constructor, but can be deferred for cases like directives with `*ngIf`.\n * @returns Whether the focus trap managed to attach successfully. This may not be the case\n * if the target element isn't currently in the DOM.\n */\n attachAnchors() {\n // If we're not on the browser, there can be no focus to trap.\n if (this._hasAttached) {\n return true;\n }\n this._ngZone.runOutsideAngular(() => {\n if (!this._startAnchor) {\n this._startAnchor = this._createAnchor();\n this._startAnchor.addEventListener('focus', this.startAnchorListener);\n }\n if (!this._endAnchor) {\n this._endAnchor = this._createAnchor();\n this._endAnchor.addEventListener('focus', this.endAnchorListener);\n }\n });\n if (this._element.parentNode) {\n this._element.parentNode.insertBefore(this._startAnchor, this._element);\n this._element.parentNode.insertBefore(this._endAnchor, this._element.nextSibling);\n this._hasAttached = true;\n }\n return this._hasAttached;\n }\n /**\n * Waits for the zone to stabilize, then focuses the first tabbable element.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusInitialElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusInitialElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the first tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusFirstTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusFirstTabbableElement(options)));\n });\n }\n /**\n * Waits for the zone to stabilize, then focuses\n * the last tabbable element within the focus trap region.\n * @returns Returns a promise that resolves with a boolean, depending\n * on whether focus was moved successfully.\n */\n focusLastTabbableElementWhenReady(options) {\n return new Promise(resolve => {\n this._executeOnStable(() => resolve(this.focusLastTabbableElement(options)));\n });\n }\n /**\n * Get the specified boundary element of the trapped region.\n * @param bound The boundary to get (start or end of trapped region).\n * @returns The boundary element.\n */\n _getRegionBoundary(bound) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n const markers = this._element.querySelectorAll(`[cdk-focus-region-${bound}], ` + `[cdkFocusRegion${bound}], ` + `[cdk-focus-${bound}]`);\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n for (let i = 0; i < markers.length; i++) {\n // @breaking-change 8.0.0\n if (markers[i].hasAttribute(`cdk-focus-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated ` +\n `attribute will be removed in 8.0.0.`, markers[i]);\n }\n else if (markers[i].hasAttribute(`cdk-focus-region-${bound}`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-region-${bound}', ` +\n `use 'cdkFocusRegion${bound}' instead. The deprecated attribute ` +\n `will be removed in 8.0.0.`, markers[i]);\n }\n }\n }\n if (bound == 'start') {\n return markers.length ? markers[0] : this._getFirstTabbableElement(this._element);\n }\n return markers.length\n ? markers[markers.length - 1]\n : this._getLastTabbableElement(this._element);\n }\n /**\n * Focuses the element that should be focused when the focus trap is initialized.\n * @returns Whether focus was moved successfully.\n */\n focusInitialElement(options) {\n // Contains the deprecated version of selector, for temporary backwards comparability.\n const redirectToElement = this._element.querySelector(`[cdk-focus-initial], ` + `[cdkFocusInitial]`);\n if (redirectToElement) {\n // @breaking-change 8.0.0\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n redirectToElement.hasAttribute(`cdk-focus-initial`)) {\n console.warn(`Found use of deprecated attribute 'cdk-focus-initial', ` +\n `use 'cdkFocusInitial' instead. The deprecated attribute ` +\n `will be removed in 8.0.0`, redirectToElement);\n }\n // Warn the consumer if the element they've pointed to\n // isn't focusable, when not in production mode.\n if ((typeof ngDevMode === 'undefined' || ngDevMode) &&\n !this._checker.isFocusable(redirectToElement)) {\n console.warn(`Element matching '[cdkFocusInitial]' is not focusable.`, redirectToElement);\n }\n if (!this._checker.isFocusable(redirectToElement)) {\n const focusableChild = this._getFirstTabbableElement(redirectToElement);\n focusableChild?.focus(options);\n return !!focusableChild;\n }\n redirectToElement.focus(options);\n return true;\n }\n return this.focusFirstTabbableElement(options);\n }\n /**\n * Focuses the first tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusFirstTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('start');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Focuses the last tabbable element within the focus trap region.\n * @returns Whether focus was moved successfully.\n */\n focusLastTabbableElement(options) {\n const redirectToElement = this._getRegionBoundary('end');\n if (redirectToElement) {\n redirectToElement.focus(options);\n }\n return !!redirectToElement;\n }\n /**\n * Checks whether the focus trap has successfully been attached.\n */\n hasAttached() {\n return this._hasAttached;\n }\n /** Get the first tabbable element from a DOM subtree (inclusive). */\n _getFirstTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n const children = root.children;\n for (let i = 0; i < children.length; i++) {\n const tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE\n ? this._getFirstTabbableElement(children[i])\n : null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Get the last tabbable element from a DOM subtree (inclusive). */\n _getLastTabbableElement(root) {\n if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) {\n return root;\n }\n // Iterate in reverse DOM order.\n const children = root.children;\n for (let i = children.length - 1; i >= 0; i--) {\n const tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE\n ? this._getLastTabbableElement(children[i])\n : null;\n if (tabbableChild) {\n return tabbableChild;\n }\n }\n return null;\n }\n /** Creates an anchor element. */\n _createAnchor() {\n const anchor = this._document.createElement('div');\n this._toggleAnchorTabIndex(this._enabled, anchor);\n anchor.classList.add('cdk-visually-hidden');\n anchor.classList.add('cdk-focus-trap-anchor');\n anchor.setAttribute('aria-hidden', 'true');\n return anchor;\n }\n /**\n * Toggles the `tabindex` of an anchor, based on the enabled state of the focus trap.\n * @param isEnabled Whether the focus trap is enabled.\n * @param anchor Anchor on which to toggle the tabindex.\n */\n _toggleAnchorTabIndex(isEnabled, anchor) {\n // Remove the tabindex completely, rather than setting it to -1, because if the\n // element has a tabindex, the user might still hit it when navigating with the arrow keys.\n isEnabled ? anchor.setAttribute('tabindex', '0') : anchor.removeAttribute('tabindex');\n }\n /**\n * Toggles the`tabindex` of both anchors to either trap Tab focus or allow it to escape.\n * @param enabled: Whether the anchors should trap Tab.\n */\n toggleAnchors(enabled) {\n if (this._startAnchor && this._endAnchor) {\n this._toggleAnchorTabIndex(enabled, this._startAnchor);\n this._toggleAnchorTabIndex(enabled, this._endAnchor);\n }\n }\n /** Executes a function when the zone is stable. */\n _executeOnStable(fn) {\n if (this._ngZone.isStable) {\n fn();\n }\n else {\n this._ngZone.onStable.pipe(take(1)).subscribe(fn);\n }\n }\n}\n/**\n * Factory that allows easy instantiation of focus traps.\n * @deprecated Use `ConfigurableFocusTrapFactory` instead.\n * @breaking-change 11.0.0\n */\nclass FocusTrapFactory {\n constructor(_checker, _ngZone, _document) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._document = _document;\n }\n /**\n * Creates a focus-trapped region around the given element.\n * @param element The element around which focus will be trapped.\n * @param deferCaptureElements Defers the creation of focus-capturing elements to be done\n * manually by the user.\n * @returns The created focus trap instance.\n */\n create(element, deferCaptureElements = false) {\n return new FocusTrap(element, this._checker, this._ngZone, this._document, deferCaptureElements);\n }\n}\nFocusTrapFactory.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FocusTrapFactory, deps: [{ token: InteractivityChecker }, { token: i0.NgZone }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nFocusTrapFactory.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FocusTrapFactory, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FocusTrapFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: InteractivityChecker }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n/** Directive for trapping focus within a region. */\nclass CdkTrapFocus {\n /** Whether the focus trap is active. */\n get enabled() {\n return this.focusTrap.enabled;\n }\n set enabled(value) {\n this.focusTrap.enabled = coerceBooleanProperty(value);\n }\n /**\n * Whether the directive should automatically move focus into the trapped region upon\n * initialization and return focus to the previous activeElement upon destruction.\n */\n get autoCapture() {\n return this._autoCapture;\n }\n set autoCapture(value) {\n this._autoCapture = coerceBooleanProperty(value);\n }\n constructor(_elementRef, _focusTrapFactory, \n /**\n * @deprecated No longer being used. To be removed.\n * @breaking-change 13.0.0\n */\n _document) {\n this._elementRef = _elementRef;\n this._focusTrapFactory = _focusTrapFactory;\n /** Previously focused element to restore focus to upon destroy when using autoCapture. */\n this._previouslyFocusedElement = null;\n this.focusTrap = this._focusTrapFactory.create(this._elementRef.nativeElement, true);\n }\n ngOnDestroy() {\n this.focusTrap.destroy();\n // If we stored a previously focused element when using autoCapture, return focus to that\n // element now that the trapped region is being destroyed.\n if (this._previouslyFocusedElement) {\n this._previouslyFocusedElement.focus();\n this._previouslyFocusedElement = null;\n }\n }\n ngAfterContentInit() {\n this.focusTrap.attachAnchors();\n if (this.autoCapture) {\n this._captureFocus();\n }\n }\n ngDoCheck() {\n if (!this.focusTrap.hasAttached()) {\n this.focusTrap.attachAnchors();\n }\n }\n ngOnChanges(changes) {\n const autoCaptureChange = changes['autoCapture'];\n if (autoCaptureChange &&\n !autoCaptureChange.firstChange &&\n this.autoCapture &&\n this.focusTrap.hasAttached()) {\n this._captureFocus();\n }\n }\n _captureFocus() {\n this._previouslyFocusedElement = _getFocusedElementPierceShadowDom();\n this.focusTrap.focusInitialElementWhenReady();\n }\n}\nCdkTrapFocus.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkTrapFocus, deps: [{ token: i0.ElementRef }, { token: FocusTrapFactory }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive });\nCdkTrapFocus.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkTrapFocus, selector: \"[cdkTrapFocus]\", inputs: { enabled: [\"cdkTrapFocus\", \"enabled\"], autoCapture: [\"cdkTrapFocusAutoCapture\", \"autoCapture\"] }, exportAs: [\"cdkTrapFocus\"], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkTrapFocus, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkTrapFocus]',\n exportAs: 'cdkTrapFocus',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: FocusTrapFactory }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, propDecorators: { enabled: [{\n type: Input,\n args: ['cdkTrapFocus']\n }], autoCapture: [{\n type: Input,\n args: ['cdkTrapFocusAutoCapture']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class that allows for trapping focus within a DOM element.\n *\n * This class uses a strategy pattern that determines how it traps focus.\n * See FocusTrapInertStrategy.\n */\nclass ConfigurableFocusTrap extends FocusTrap {\n /** Whether the FocusTrap is enabled. */\n get enabled() {\n return this._enabled;\n }\n set enabled(value) {\n this._enabled = value;\n if (this._enabled) {\n this._focusTrapManager.register(this);\n }\n else {\n this._focusTrapManager.deregister(this);\n }\n }\n constructor(_element, _checker, _ngZone, _document, _focusTrapManager, _inertStrategy, config) {\n super(_element, _checker, _ngZone, _document, config.defer);\n this._focusTrapManager = _focusTrapManager;\n this._inertStrategy = _inertStrategy;\n this._focusTrapManager.register(this);\n }\n /** Notifies the FocusTrapManager that this FocusTrap will be destroyed. */\n destroy() {\n this._focusTrapManager.deregister(this);\n super.destroy();\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _enable() {\n this._inertStrategy.preventFocus(this);\n this.toggleAnchors(true);\n }\n /** @docs-private Implemented as part of ManagedFocusTrap. */\n _disable() {\n this._inertStrategy.allowFocus(this);\n this.toggleAnchors(false);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the inert strategy. */\nconst FOCUS_TRAP_INERT_STRATEGY = new InjectionToken('FOCUS_TRAP_INERT_STRATEGY');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Lightweight FocusTrapInertStrategy that adds a document focus event\n * listener to redirect focus back inside the FocusTrap.\n */\nclass EventListenerFocusTrapInertStrategy {\n constructor() {\n /** Focus event handler. */\n this._listener = null;\n }\n /** Adds a document event listener that keeps focus inside the FocusTrap. */\n preventFocus(focusTrap) {\n // Ensure there's only one listener per document\n if (this._listener) {\n focusTrap._document.removeEventListener('focus', this._listener, true);\n }\n this._listener = (e) => this._trapFocus(focusTrap, e);\n focusTrap._ngZone.runOutsideAngular(() => {\n focusTrap._document.addEventListener('focus', this._listener, true);\n });\n }\n /** Removes the event listener added in preventFocus. */\n allowFocus(focusTrap) {\n if (!this._listener) {\n return;\n }\n focusTrap._document.removeEventListener('focus', this._listener, true);\n this._listener = null;\n }\n /**\n * Refocuses the first element in the FocusTrap if the focus event target was outside\n * the FocusTrap.\n *\n * This is an event listener callback. The event listener is added in runOutsideAngular,\n * so all this code runs outside Angular as well.\n */\n _trapFocus(focusTrap, event) {\n const target = event.target;\n const focusTrapRoot = focusTrap._element;\n // Don't refocus if target was in an overlay, because the overlay might be associated\n // with an element inside the FocusTrap, ex. mat-select.\n if (target && !focusTrapRoot.contains(target) && !target.closest?.('div.cdk-overlay-pane')) {\n // Some legacy FocusTrap usages have logic that focuses some element on the page\n // just before FocusTrap is destroyed. For backwards compatibility, wait\n // to be sure FocusTrap is still enabled before refocusing.\n setTimeout(() => {\n // Check whether focus wasn't put back into the focus trap while the timeout was pending.\n if (focusTrap.enabled && !focusTrapRoot.contains(focusTrap._document.activeElement)) {\n focusTrap.focusFirstTabbableElement();\n }\n });\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Injectable that ensures only the most recently enabled FocusTrap is active. */\nclass FocusTrapManager {\n constructor() {\n // A stack of the FocusTraps on the page. Only the FocusTrap at the\n // top of the stack is active.\n this._focusTrapStack = [];\n }\n /**\n * Disables the FocusTrap at the top of the stack, and then pushes\n * the new FocusTrap onto the stack.\n */\n register(focusTrap) {\n // Dedupe focusTraps that register multiple times.\n this._focusTrapStack = this._focusTrapStack.filter(ft => ft !== focusTrap);\n let stack = this._focusTrapStack;\n if (stack.length) {\n stack[stack.length - 1]._disable();\n }\n stack.push(focusTrap);\n focusTrap._enable();\n }\n /**\n * Removes the FocusTrap from the stack, and activates the\n * FocusTrap that is the new top of the stack.\n */\n deregister(focusTrap) {\n focusTrap._disable();\n const stack = this._focusTrapStack;\n const i = stack.indexOf(focusTrap);\n if (i !== -1) {\n stack.splice(i, 1);\n if (stack.length) {\n stack[stack.length - 1]._enable();\n }\n }\n }\n}\nFocusTrapManager.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FocusTrapManager, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nFocusTrapManager.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FocusTrapManager, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FocusTrapManager, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Factory that allows easy instantiation of configurable focus traps. */\nclass ConfigurableFocusTrapFactory {\n constructor(_checker, _ngZone, _focusTrapManager, _document, _inertStrategy) {\n this._checker = _checker;\n this._ngZone = _ngZone;\n this._focusTrapManager = _focusTrapManager;\n this._document = _document;\n // TODO split up the strategies into different modules, similar to DateAdapter.\n this._inertStrategy = _inertStrategy || new EventListenerFocusTrapInertStrategy();\n }\n create(element, config = { defer: false }) {\n let configObject;\n if (typeof config === 'boolean') {\n configObject = { defer: config };\n }\n else {\n configObject = config;\n }\n return new ConfigurableFocusTrap(element, this._checker, this._ngZone, this._document, this._focusTrapManager, this._inertStrategy, configObject);\n }\n}\nConfigurableFocusTrapFactory.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ConfigurableFocusTrapFactory, deps: [{ token: InteractivityChecker }, { token: i0.NgZone }, { token: FocusTrapManager }, { token: DOCUMENT }, { token: FOCUS_TRAP_INERT_STRATEGY, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nConfigurableFocusTrapFactory.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ConfigurableFocusTrapFactory, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ConfigurableFocusTrapFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: InteractivityChecker }, { type: i0.NgZone }, { type: FocusTrapManager }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_TRAP_INERT_STRATEGY]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Gets whether an event could be a faked `mousedown` event dispatched by a screen reader. */\nfunction isFakeMousedownFromScreenReader(event) {\n // Some screen readers will dispatch a fake `mousedown` event when pressing enter or space on\n // a clickable element. We can distinguish these events when both `offsetX` and `offsetY` are\n // zero or `event.buttons` is zero, depending on the browser:\n // - `event.buttons` works on Firefox, but fails on Chrome.\n // - `offsetX` and `offsetY` work on Chrome, but fail on Firefox.\n // Note that there's an edge case where the user could click the 0x0 spot of the\n // screen themselves, but that is unlikely to contain interactive elements.\n return event.buttons === 0 || (event.offsetX === 0 && event.offsetY === 0);\n}\n/** Gets whether an event could be a faked `touchstart` event dispatched by a screen reader. */\nfunction isFakeTouchstartFromScreenReader(event) {\n const touch = (event.touches && event.touches[0]) || (event.changedTouches && event.changedTouches[0]);\n // A fake `touchstart` can be distinguished from a real one by looking at the `identifier`\n // which is typically >= 0 on a real device versus -1 from a screen reader. Just to be safe,\n // we can also look at `radiusX` and `radiusY`. This behavior was observed against a Windows 10\n // device with a touch screen running NVDA v2020.4 and Firefox 85 or Chrome 88.\n return (!!touch &&\n touch.identifier === -1 &&\n (touch.radiusX == null || touch.radiusX === 1) &&\n (touch.radiusY == null || touch.radiusY === 1));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injectable options for the InputModalityDetector. These are shallowly merged with the default\n * options.\n */\nconst INPUT_MODALITY_DETECTOR_OPTIONS = new InjectionToken('cdk-input-modality-detector-options');\n/**\n * Default options for the InputModalityDetector.\n *\n * Modifier keys are ignored by default (i.e. when pressed won't cause the service to detect\n * keyboard input modality) for two reasons:\n *\n * 1. Modifier keys are commonly used with mouse to perform actions such as 'right click' or 'open\n * in new tab', and are thus less representative of actual keyboard interaction.\n * 2. VoiceOver triggers some keyboard events when linearly navigating with Control + Option (but\n * confusingly not with Caps Lock). Thus, to have parity with other screen readers, we ignore\n * these keys so as to not update the input modality.\n *\n * Note that we do not by default ignore the right Meta key on Safari because it has the same key\n * code as the ContextMenu key on other browsers. When we switch to using event.key, we can\n * distinguish between the two.\n */\nconst INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS = {\n ignoreKeys: [ALT, CONTROL, MAC_META, META, SHIFT],\n};\n/**\n * The amount of time needed to pass after a touchstart event in order for a subsequent mousedown\n * event to be attributed as mouse and not touch.\n *\n * This is the value used by AngularJS Material. Through trial and error (on iPhone 6S) they found\n * that a value of around 650ms seems appropriate.\n */\nconst TOUCH_BUFFER_MS = 650;\n/**\n * Event listener options that enable capturing and also mark the listener as passive if the browser\n * supports it.\n */\nconst modalityEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true,\n});\n/**\n * Service that detects the user's input modality.\n *\n * This service does not update the input modality when a user navigates with a screen reader\n * (e.g. linear navigation with VoiceOver, object navigation / browse mode with NVDA, virtual PC\n * cursor mode with JAWS). This is in part due to technical limitations (i.e. keyboard events do not\n * fire as expected in these modes) but is also arguably the correct behavior. Navigating with a\n * screen reader is akin to visually scanning a page, and should not be interpreted as actual user\n * input interaction.\n *\n * When a user is not navigating but *interacting* with a screen reader, this service attempts to\n * update the input modality to keyboard, but in general this service's behavior is largely\n * undefined.\n */\nclass InputModalityDetector {\n /** The most recently detected input modality. */\n get mostRecentModality() {\n return this._modality.value;\n }\n constructor(_platform, ngZone, document, options) {\n this._platform = _platform;\n /**\n * The most recently detected input modality event target. Is null if no input modality has been\n * detected or if the associated event target is null for some unknown reason.\n */\n this._mostRecentTarget = null;\n /** The underlying BehaviorSubject that emits whenever an input modality is detected. */\n this._modality = new BehaviorSubject(null);\n /**\n * The timestamp of the last touch input modality. Used to determine whether mousedown events\n * should be attributed to mouse or touch.\n */\n this._lastTouchMs = 0;\n /**\n * Handles keydown events. Must be an arrow function in order to preserve the context when it gets\n * bound.\n */\n this._onKeydown = (event) => {\n // If this is one of the keys we should ignore, then ignore it and don't update the input\n // modality to keyboard.\n if (this._options?.ignoreKeys?.some(keyCode => keyCode === event.keyCode)) {\n return;\n }\n this._modality.next('keyboard');\n this._mostRecentTarget = _getEventTarget(event);\n };\n /**\n * Handles mousedown events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onMousedown = (event) => {\n // Touches trigger both touch and mouse events, so we need to distinguish between mouse events\n // that were triggered via mouse vs touch. To do so, check if the mouse event occurs closely\n // after the previous touch event.\n if (Date.now() - this._lastTouchMs < TOUCH_BUFFER_MS) {\n return;\n }\n // Fake mousedown events are fired by some screen readers when controls are activated by the\n // screen reader. Attribute them to keyboard input modality.\n this._modality.next(isFakeMousedownFromScreenReader(event) ? 'keyboard' : 'mouse');\n this._mostRecentTarget = _getEventTarget(event);\n };\n /**\n * Handles touchstart events. Must be an arrow function in order to preserve the context when it\n * gets bound.\n */\n this._onTouchstart = (event) => {\n // Same scenario as mentioned in _onMousedown, but on touch screen devices, fake touchstart\n // events are fired. Again, attribute to keyboard input modality.\n if (isFakeTouchstartFromScreenReader(event)) {\n this._modality.next('keyboard');\n return;\n }\n // Store the timestamp of this touch event, as it's used to distinguish between mouse events\n // triggered via mouse vs touch.\n this._lastTouchMs = Date.now();\n this._modality.next('touch');\n this._mostRecentTarget = _getEventTarget(event);\n };\n this._options = {\n ...INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS,\n ...options,\n };\n // Skip the first emission as it's null.\n this.modalityDetected = this._modality.pipe(skip(1));\n this.modalityChanged = this.modalityDetected.pipe(distinctUntilChanged());\n // If we're not in a browser, this service should do nothing, as there's no relevant input\n // modality to detect.\n if (_platform.isBrowser) {\n ngZone.runOutsideAngular(() => {\n document.addEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.addEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.addEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n });\n }\n }\n ngOnDestroy() {\n this._modality.complete();\n if (this._platform.isBrowser) {\n document.removeEventListener('keydown', this._onKeydown, modalityEventListenerOptions);\n document.removeEventListener('mousedown', this._onMousedown, modalityEventListenerOptions);\n document.removeEventListener('touchstart', this._onTouchstart, modalityEventListenerOptions);\n }\n }\n}\nInputModalityDetector.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: InputModalityDetector, deps: [{ token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT }, { token: INPUT_MODALITY_DETECTOR_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nInputModalityDetector.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: InputModalityDetector, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: InputModalityDetector, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }, { type: i0.NgZone }, { type: Document, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [INPUT_MODALITY_DETECTOR_OPTIONS]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst LIVE_ANNOUNCER_ELEMENT_TOKEN = new InjectionToken('liveAnnouncerElement', {\n providedIn: 'root',\n factory: LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY,\n});\n/** @docs-private */\nfunction LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY() {\n return null;\n}\n/** Injection token that can be used to configure the default options for the LiveAnnouncer. */\nconst LIVE_ANNOUNCER_DEFAULT_OPTIONS = new InjectionToken('LIVE_ANNOUNCER_DEFAULT_OPTIONS');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet uniqueIds = 0;\nclass LiveAnnouncer {\n constructor(elementToken, _ngZone, _document, _defaultOptions) {\n this._ngZone = _ngZone;\n this._defaultOptions = _defaultOptions;\n // We inject the live element and document as `any` because the constructor signature cannot\n // reference browser globals (HTMLElement, Document) on non-browser environments, since having\n // a class decorator causes TypeScript to preserve the constructor signature types.\n this._document = _document;\n this._liveElement = elementToken || this._createLiveElement();\n }\n announce(message, ...args) {\n const defaultOptions = this._defaultOptions;\n let politeness;\n let duration;\n if (args.length === 1 && typeof args[0] === 'number') {\n duration = args[0];\n }\n else {\n [politeness, duration] = args;\n }\n this.clear();\n clearTimeout(this._previousTimeout);\n if (!politeness) {\n politeness =\n defaultOptions && defaultOptions.politeness ? defaultOptions.politeness : 'polite';\n }\n if (duration == null && defaultOptions) {\n duration = defaultOptions.duration;\n }\n // TODO: ensure changing the politeness works on all environments we support.\n this._liveElement.setAttribute('aria-live', politeness);\n if (this._liveElement.id) {\n this._exposeAnnouncerToModals(this._liveElement.id);\n }\n // This 100ms timeout is necessary for some browser + screen-reader combinations:\n // - Both JAWS and NVDA over IE11 will not announce anything without a non-zero timeout.\n // - With Chrome and IE11 with NVDA or JAWS, a repeated (identical) message won't be read a\n // second time without clearing and then using a non-zero delay.\n // (using JAWS 17 at time of this writing).\n return this._ngZone.runOutsideAngular(() => {\n if (!this._currentPromise) {\n this._currentPromise = new Promise(resolve => (this._currentResolve = resolve));\n }\n clearTimeout(this._previousTimeout);\n this._previousTimeout = setTimeout(() => {\n this._liveElement.textContent = message;\n if (typeof duration === 'number') {\n this._previousTimeout = setTimeout(() => this.clear(), duration);\n }\n this._currentResolve();\n this._currentPromise = this._currentResolve = undefined;\n }, 100);\n return this._currentPromise;\n });\n }\n /**\n * Clears the current text from the announcer element. Can be used to prevent\n * screen readers from reading the text out again while the user is going\n * through the page landmarks.\n */\n clear() {\n if (this._liveElement) {\n this._liveElement.textContent = '';\n }\n }\n ngOnDestroy() {\n clearTimeout(this._previousTimeout);\n this._liveElement?.remove();\n this._liveElement = null;\n this._currentResolve?.();\n this._currentPromise = this._currentResolve = undefined;\n }\n _createLiveElement() {\n const elementClass = 'cdk-live-announcer-element';\n const previousElements = this._document.getElementsByClassName(elementClass);\n const liveEl = this._document.createElement('div');\n // Remove any old containers. This can happen when coming in from a server-side-rendered page.\n for (let i = 0; i < previousElements.length; i++) {\n previousElements[i].remove();\n }\n liveEl.classList.add(elementClass);\n liveEl.classList.add('cdk-visually-hidden');\n liveEl.setAttribute('aria-atomic', 'true');\n liveEl.setAttribute('aria-live', 'polite');\n liveEl.id = `cdk-live-announcer-${uniqueIds++}`;\n this._document.body.appendChild(liveEl);\n return liveEl;\n }\n /**\n * Some browsers won't expose the accessibility node of the live announcer element if there is an\n * `aria-modal` and the live announcer is outside of it. This method works around the issue by\n * pointing the `aria-owns` of all modals to the live announcer element.\n */\n _exposeAnnouncerToModals(id) {\n // Note that the selector here is limited to CDK overlays at the moment in order to reduce the\n // section of the DOM we need to look through. This should cover all the cases we support, but\n // the selector can be expanded if it turns out to be too narrow.\n const modals = this._document.querySelectorAll('body > .cdk-overlay-container [aria-modal=\"true\"]');\n for (let i = 0; i < modals.length; i++) {\n const modal = modals[i];\n const ariaOwns = modal.getAttribute('aria-owns');\n if (!ariaOwns) {\n modal.setAttribute('aria-owns', id);\n }\n else if (ariaOwns.indexOf(id) === -1) {\n modal.setAttribute('aria-owns', ariaOwns + ' ' + id);\n }\n }\n }\n}\nLiveAnnouncer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: LiveAnnouncer, deps: [{ token: LIVE_ANNOUNCER_ELEMENT_TOKEN, optional: true }, { token: i0.NgZone }, { token: DOCUMENT }, { token: LIVE_ANNOUNCER_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nLiveAnnouncer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: LiveAnnouncer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: LiveAnnouncer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_ELEMENT_TOKEN]\n }] }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [LIVE_ANNOUNCER_DEFAULT_OPTIONS]\n }] }]; } });\n/**\n * A directive that works similarly to aria-live, but uses the LiveAnnouncer to ensure compatibility\n * with a wider range of browsers and screen readers.\n */\nclass CdkAriaLive {\n /** The aria-live politeness level to use when announcing messages. */\n get politeness() {\n return this._politeness;\n }\n set politeness(value) {\n this._politeness = value === 'off' || value === 'assertive' ? value : 'polite';\n if (this._politeness === 'off') {\n if (this._subscription) {\n this._subscription.unsubscribe();\n this._subscription = null;\n }\n }\n else if (!this._subscription) {\n this._subscription = this._ngZone.runOutsideAngular(() => {\n return this._contentObserver.observe(this._elementRef).subscribe(() => {\n // Note that we use textContent here, rather than innerText, in order to avoid a reflow.\n const elementText = this._elementRef.nativeElement.textContent;\n // The `MutationObserver` fires also for attribute\n // changes which we don't want to announce.\n if (elementText !== this._previousAnnouncedText) {\n this._liveAnnouncer.announce(elementText, this._politeness, this.duration);\n this._previousAnnouncedText = elementText;\n }\n });\n });\n }\n }\n constructor(_elementRef, _liveAnnouncer, _contentObserver, _ngZone) {\n this._elementRef = _elementRef;\n this._liveAnnouncer = _liveAnnouncer;\n this._contentObserver = _contentObserver;\n this._ngZone = _ngZone;\n this._politeness = 'polite';\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._subscription.unsubscribe();\n }\n }\n}\nCdkAriaLive.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkAriaLive, deps: [{ token: i0.ElementRef }, { token: LiveAnnouncer }, { token: i1$1.ContentObserver }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive });\nCdkAriaLive.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkAriaLive, selector: \"[cdkAriaLive]\", inputs: { politeness: [\"cdkAriaLive\", \"politeness\"], duration: [\"cdkAriaLiveDuration\", \"duration\"] }, exportAs: [\"cdkAriaLive\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkAriaLive, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkAriaLive]',\n exportAs: 'cdkAriaLive',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: LiveAnnouncer }, { type: i1$1.ContentObserver }, { type: i0.NgZone }]; }, propDecorators: { politeness: [{\n type: Input,\n args: ['cdkAriaLive']\n }], duration: [{\n type: Input,\n args: ['cdkAriaLiveDuration']\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** InjectionToken for FocusMonitorOptions. */\nconst FOCUS_MONITOR_DEFAULT_OPTIONS = new InjectionToken('cdk-focus-monitor-default-options');\n/**\n * Event listener options that enable capturing and also\n * mark the listener as passive if the browser supports it.\n */\nconst captureEventListenerOptions = normalizePassiveListenerOptions({\n passive: true,\n capture: true,\n});\n/** Monitors mouse and keyboard events to determine the cause of focus events. */\nclass FocusMonitor {\n constructor(_ngZone, _platform, _inputModalityDetector, \n /** @breaking-change 11.0.0 make document required */\n document, options) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n this._inputModalityDetector = _inputModalityDetector;\n /** The focus origin that the next focus event is a result of. */\n this._origin = null;\n /** Whether the window has just been focused. */\n this._windowFocused = false;\n /**\n * Whether the origin was determined via a touch interaction. Necessary as properly attributing\n * focus events to touch interactions requires special logic.\n */\n this._originFromTouchInteraction = false;\n /** Map of elements being monitored to their info. */\n this._elementInfo = new Map();\n /** The number of elements currently being monitored. */\n this._monitoredElementCount = 0;\n /**\n * Keeps track of the root nodes to which we've currently bound a focus/blur handler,\n * as well as the number of monitored elements that they contain. We have to treat focus/blur\n * handlers differently from the rest of the events, because the browser won't emit events\n * to the document when focus moves inside of a shadow root.\n */\n this._rootNodeFocusListenerCount = new Map();\n /**\n * Event listener for `focus` events on the window.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._windowFocusListener = () => {\n // Make a note of when the window regains focus, so we can\n // restore the origin info for the focused element.\n this._windowFocused = true;\n this._windowFocusTimeoutId = window.setTimeout(() => (this._windowFocused = false));\n };\n /** Subject for stopping our InputModalityDetector subscription. */\n this._stopInputModalityDetector = new Subject();\n /**\n * Event listener for `focus` and 'blur' events on the document.\n * Needs to be an arrow function in order to preserve the context when it gets bound.\n */\n this._rootNodeFocusAndBlurListener = (event) => {\n const target = _getEventTarget(event);\n // We need to walk up the ancestor chain in order to support `checkChildren`.\n for (let element = target; element; element = element.parentElement) {\n if (event.type === 'focus') {\n this._onFocus(event, element);\n }\n else {\n this._onBlur(event, element);\n }\n }\n };\n this._document = document;\n this._detectionMode = options?.detectionMode || 0 /* FocusMonitorDetectionMode.IMMEDIATE */;\n }\n monitor(element, checkChildren = false) {\n const nativeElement = coerceElement(element);\n // Do nothing if we're not on the browser platform or the passed in node isn't an element.\n if (!this._platform.isBrowser || nativeElement.nodeType !== 1) {\n return of(null);\n }\n // If the element is inside the shadow DOM, we need to bind our focus/blur listeners to\n // the shadow root, rather than the `document`, because the browser won't emit focus events\n // to the `document`, if focus is moving within the same shadow root.\n const rootNode = _getShadowRoot(nativeElement) || this._getDocument();\n const cachedInfo = this._elementInfo.get(nativeElement);\n // Check if we're already monitoring this element.\n if (cachedInfo) {\n if (checkChildren) {\n // TODO(COMP-318): this can be problematic, because it'll turn all non-checkChildren\n // observers into ones that behave as if `checkChildren` was turned on. We need a more\n // robust solution.\n cachedInfo.checkChildren = true;\n }\n return cachedInfo.subject;\n }\n // Create monitored element info.\n const info = {\n checkChildren: checkChildren,\n subject: new Subject(),\n rootNode,\n };\n this._elementInfo.set(nativeElement, info);\n this._registerGlobalListeners(info);\n return info.subject;\n }\n stopMonitoring(element) {\n const nativeElement = coerceElement(element);\n const elementInfo = this._elementInfo.get(nativeElement);\n if (elementInfo) {\n elementInfo.subject.complete();\n this._setClasses(nativeElement);\n this._elementInfo.delete(nativeElement);\n this._removeGlobalListeners(elementInfo);\n }\n }\n focusVia(element, origin, options) {\n const nativeElement = coerceElement(element);\n const focusedElement = this._getDocument().activeElement;\n // If the element is focused already, calling `focus` again won't trigger the event listener\n // which means that the focus classes won't be updated. If that's the case, update the classes\n // directly without waiting for an event.\n if (nativeElement === focusedElement) {\n this._getClosestElementsInfo(nativeElement).forEach(([currentElement, info]) => this._originChanged(currentElement, origin, info));\n }\n else {\n this._setOrigin(origin);\n // `focus` isn't available on the server\n if (typeof nativeElement.focus === 'function') {\n nativeElement.focus(options);\n }\n }\n }\n ngOnDestroy() {\n this._elementInfo.forEach((_info, element) => this.stopMonitoring(element));\n }\n /** Access injected document if available or fallback to global document reference */\n _getDocument() {\n return this._document || document;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n const doc = this._getDocument();\n return doc.defaultView || window;\n }\n _getFocusOrigin(focusEventTarget) {\n if (this._origin) {\n // If the origin was realized via a touch interaction, we need to perform additional checks\n // to determine whether the focus origin should be attributed to touch or program.\n if (this._originFromTouchInteraction) {\n return this._shouldBeAttributedToTouch(focusEventTarget) ? 'touch' : 'program';\n }\n else {\n return this._origin;\n }\n }\n // If the window has just regained focus, we can restore the most recent origin from before the\n // window blurred. Otherwise, we've reached the point where we can't identify the source of the\n // focus. This typically means one of two things happened:\n //\n // 1) The element was programmatically focused, or\n // 2) The element was focused via screen reader navigation (which generally doesn't fire\n // events).\n //\n // Because we can't distinguish between these two cases, we default to setting `program`.\n if (this._windowFocused && this._lastFocusOrigin) {\n return this._lastFocusOrigin;\n }\n // If the interaction is coming from an input label, we consider it a mouse interactions.\n // This is a special case where focus moves on `click`, rather than `mousedown` which breaks\n // our detection, because all our assumptions are for `mousedown`. We need to handle this\n // special case, because it's very common for checkboxes and radio buttons.\n if (focusEventTarget && this._isLastInteractionFromInputLabel(focusEventTarget)) {\n return 'mouse';\n }\n return 'program';\n }\n /**\n * Returns whether the focus event should be attributed to touch. Recall that in IMMEDIATE mode, a\n * touch origin isn't immediately reset at the next tick (see _setOrigin). This means that when we\n * handle a focus event following a touch interaction, we need to determine whether (1) the focus\n * event was directly caused by the touch interaction or (2) the focus event was caused by a\n * subsequent programmatic focus call triggered by the touch interaction.\n * @param focusEventTarget The target of the focus event under examination.\n */\n _shouldBeAttributedToTouch(focusEventTarget) {\n // Please note that this check is not perfect. Consider the following edge case:\n //\n //
\n //
\n //
\n //\n // Suppose there is a FocusMonitor in IMMEDIATE mode attached to #parent. When the user touches\n // #child, #parent is programmatically focused. This code will attribute the focus to touch\n // instead of program. This is a relatively minor edge-case that can be worked around by using\n // focusVia(parent, 'program') to focus #parent.\n return (this._detectionMode === 1 /* FocusMonitorDetectionMode.EVENTUAL */ ||\n !!focusEventTarget?.contains(this._inputModalityDetector._mostRecentTarget));\n }\n /**\n * Sets the focus classes on the element based on the given focus origin.\n * @param element The element to update the classes on.\n * @param origin The focus origin.\n */\n _setClasses(element, origin) {\n element.classList.toggle('cdk-focused', !!origin);\n element.classList.toggle('cdk-touch-focused', origin === 'touch');\n element.classList.toggle('cdk-keyboard-focused', origin === 'keyboard');\n element.classList.toggle('cdk-mouse-focused', origin === 'mouse');\n element.classList.toggle('cdk-program-focused', origin === 'program');\n }\n /**\n * Updates the focus origin. If we're using immediate detection mode, we schedule an async\n * function to clear the origin at the end of a timeout. The duration of the timeout depends on\n * the origin being set.\n * @param origin The origin to set.\n * @param isFromInteraction Whether we are setting the origin from an interaction event.\n */\n _setOrigin(origin, isFromInteraction = false) {\n this._ngZone.runOutsideAngular(() => {\n this._origin = origin;\n this._originFromTouchInteraction = origin === 'touch' && isFromInteraction;\n // If we're in IMMEDIATE mode, reset the origin at the next tick (or in `TOUCH_BUFFER_MS` ms\n // for a touch event). We reset the origin at the next tick because Firefox focuses one tick\n // after the interaction event. We wait `TOUCH_BUFFER_MS` ms before resetting the origin for\n // a touch event because when a touch event is fired, the associated focus event isn't yet in\n // the event queue. Before doing so, clear any pending timeouts.\n if (this._detectionMode === 0 /* FocusMonitorDetectionMode.IMMEDIATE */) {\n clearTimeout(this._originTimeoutId);\n const ms = this._originFromTouchInteraction ? TOUCH_BUFFER_MS : 1;\n this._originTimeoutId = setTimeout(() => (this._origin = null), ms);\n }\n });\n }\n /**\n * Handles focus events on a registered element.\n * @param event The focus event.\n * @param element The monitored element.\n */\n _onFocus(event, element) {\n // NOTE(mmalerba): We currently set the classes based on the focus origin of the most recent\n // focus event affecting the monitored element. If we want to use the origin of the first event\n // instead we should check for the cdk-focused class here and return if the element already has\n // it. (This only matters for elements that have includesChildren = true).\n // If we are not counting child-element-focus as focused, make sure that the event target is the\n // monitored element itself.\n const elementInfo = this._elementInfo.get(element);\n const focusEventTarget = _getEventTarget(event);\n if (!elementInfo || (!elementInfo.checkChildren && element !== focusEventTarget)) {\n return;\n }\n this._originChanged(element, this._getFocusOrigin(focusEventTarget), elementInfo);\n }\n /**\n * Handles blur events on a registered element.\n * @param event The blur event.\n * @param element The monitored element.\n */\n _onBlur(event, element) {\n // If we are counting child-element-focus as focused, make sure that we aren't just blurring in\n // order to focus another child of the monitored element.\n const elementInfo = this._elementInfo.get(element);\n if (!elementInfo ||\n (elementInfo.checkChildren &&\n event.relatedTarget instanceof Node &&\n element.contains(event.relatedTarget))) {\n return;\n }\n this._setClasses(element);\n this._emitOrigin(elementInfo, null);\n }\n _emitOrigin(info, origin) {\n if (info.subject.observers.length) {\n this._ngZone.run(() => info.subject.next(origin));\n }\n }\n _registerGlobalListeners(elementInfo) {\n if (!this._platform.isBrowser) {\n return;\n }\n const rootNode = elementInfo.rootNode;\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode) || 0;\n if (!rootNodeFocusListeners) {\n this._ngZone.runOutsideAngular(() => {\n rootNode.addEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.addEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n });\n }\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners + 1);\n // Register global listeners when first element is monitored.\n if (++this._monitoredElementCount === 1) {\n // Note: we listen to events in the capture phase so we\n // can detect them even if the user stops propagation.\n this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n window.addEventListener('focus', this._windowFocusListener);\n });\n // The InputModalityDetector is also just a collection of global listeners.\n this._inputModalityDetector.modalityDetected\n .pipe(takeUntil(this._stopInputModalityDetector))\n .subscribe(modality => {\n this._setOrigin(modality, true /* isFromInteraction */);\n });\n }\n }\n _removeGlobalListeners(elementInfo) {\n const rootNode = elementInfo.rootNode;\n if (this._rootNodeFocusListenerCount.has(rootNode)) {\n const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode);\n if (rootNodeFocusListeners > 1) {\n this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners - 1);\n }\n else {\n rootNode.removeEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n rootNode.removeEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions);\n this._rootNodeFocusListenerCount.delete(rootNode);\n }\n }\n // Unregister global listeners when last element is unmonitored.\n if (!--this._monitoredElementCount) {\n const window = this._getWindow();\n window.removeEventListener('focus', this._windowFocusListener);\n // Equivalently, stop our InputModalityDetector subscription.\n this._stopInputModalityDetector.next();\n // Clear timeouts for all potentially pending timeouts to prevent the leaks.\n clearTimeout(this._windowFocusTimeoutId);\n clearTimeout(this._originTimeoutId);\n }\n }\n /** Updates all the state on an element once its focus origin has changed. */\n _originChanged(element, origin, elementInfo) {\n this._setClasses(element, origin);\n this._emitOrigin(elementInfo, origin);\n this._lastFocusOrigin = origin;\n }\n /**\n * Collects the `MonitoredElementInfo` of a particular element and\n * all of its ancestors that have enabled `checkChildren`.\n * @param element Element from which to start the search.\n */\n _getClosestElementsInfo(element) {\n const results = [];\n this._elementInfo.forEach((info, currentElement) => {\n if (currentElement === element || (info.checkChildren && currentElement.contains(element))) {\n results.push([currentElement, info]);\n }\n });\n return results;\n }\n /**\n * Returns whether an interaction is likely to have come from the user clicking the `label` of\n * an `input` or `textarea` in order to focus it.\n * @param focusEventTarget Target currently receiving focus.\n */\n _isLastInteractionFromInputLabel(focusEventTarget) {\n const { _mostRecentTarget: mostRecentTarget, mostRecentModality } = this._inputModalityDetector;\n // If the last interaction used the mouse on an element contained by one of the labels\n // of an `input`/`textarea` that is currently focused, it is very likely that the\n // user redirected focus using the label.\n if (mostRecentModality !== 'mouse' ||\n !mostRecentTarget ||\n mostRecentTarget === focusEventTarget ||\n (focusEventTarget.nodeName !== 'INPUT' && focusEventTarget.nodeName !== 'TEXTAREA') ||\n focusEventTarget.disabled) {\n return false;\n }\n const labels = focusEventTarget.labels;\n if (labels) {\n for (let i = 0; i < labels.length; i++) {\n if (labels[i].contains(mostRecentTarget)) {\n return true;\n }\n }\n }\n return false;\n }\n}\nFocusMonitor.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FocusMonitor, deps: [{ token: i0.NgZone }, { token: i1.Platform }, { token: InputModalityDetector }, { token: DOCUMENT, optional: true }, { token: FOCUS_MONITOR_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nFocusMonitor.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FocusMonitor, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FocusMonitor, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i0.NgZone }, { type: i1.Platform }, { type: InputModalityDetector }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [FOCUS_MONITOR_DEFAULT_OPTIONS]\n }] }]; } });\n/**\n * Directive that determines how a particular element was focused (via keyboard, mouse, touch, or\n * programmatically) and adds corresponding classes to the element.\n *\n * There are two variants of this directive:\n * 1) cdkMonitorElementFocus: does not consider an element to be focused if one of its children is\n * focused.\n * 2) cdkMonitorSubtreeFocus: considers an element focused if it or any of its children are focused.\n */\nclass CdkMonitorFocus {\n constructor(_elementRef, _focusMonitor) {\n this._elementRef = _elementRef;\n this._focusMonitor = _focusMonitor;\n this._focusOrigin = null;\n this.cdkFocusChange = new EventEmitter();\n }\n get focusOrigin() {\n return this._focusOrigin;\n }\n ngAfterViewInit() {\n const element = this._elementRef.nativeElement;\n this._monitorSubscription = this._focusMonitor\n .monitor(element, element.nodeType === 1 && element.hasAttribute('cdkMonitorSubtreeFocus'))\n .subscribe(origin => {\n this._focusOrigin = origin;\n this.cdkFocusChange.emit(origin);\n });\n }\n ngOnDestroy() {\n this._focusMonitor.stopMonitoring(this._elementRef);\n if (this._monitorSubscription) {\n this._monitorSubscription.unsubscribe();\n }\n }\n}\nCdkMonitorFocus.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkMonitorFocus, deps: [{ token: i0.ElementRef }, { token: FocusMonitor }], target: i0.ɵɵFactoryTarget.Directive });\nCdkMonitorFocus.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkMonitorFocus, selector: \"[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]\", outputs: { cdkFocusChange: \"cdkFocusChange\" }, exportAs: [\"cdkMonitorFocus\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkMonitorFocus, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]',\n exportAs: 'cdkMonitorFocus',\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: FocusMonitor }]; }, propDecorators: { cdkFocusChange: [{\n type: Output\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** CSS class applied to the document body when in black-on-white high-contrast mode. */\nconst BLACK_ON_WHITE_CSS_CLASS = 'cdk-high-contrast-black-on-white';\n/** CSS class applied to the document body when in white-on-black high-contrast mode. */\nconst WHITE_ON_BLACK_CSS_CLASS = 'cdk-high-contrast-white-on-black';\n/** CSS class applied to the document body when in high-contrast mode. */\nconst HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS = 'cdk-high-contrast-active';\n/**\n * Service to determine whether the browser is currently in a high-contrast-mode environment.\n *\n * Microsoft Windows supports an accessibility feature called \"High Contrast Mode\". This mode\n * changes the appearance of all applications, including web applications, to dramatically increase\n * contrast.\n *\n * IE, Edge, and Firefox currently support this mode. Chrome does not support Windows High Contrast\n * Mode. This service does not detect high-contrast mode as added by the Chrome \"High Contrast\"\n * browser extension.\n */\nclass HighContrastModeDetector {\n constructor(_platform, document) {\n this._platform = _platform;\n this._document = document;\n this._breakpointSubscription = inject(BreakpointObserver)\n .observe('(forced-colors: active)')\n .subscribe(() => {\n if (this._hasCheckedHighContrastMode) {\n this._hasCheckedHighContrastMode = false;\n this._applyBodyHighContrastModeCssClasses();\n }\n });\n }\n /** Gets the current high-contrast-mode for the page. */\n getHighContrastMode() {\n if (!this._platform.isBrowser) {\n return 0 /* HighContrastMode.NONE */;\n }\n // Create a test element with an arbitrary background-color that is neither black nor\n // white; high-contrast mode will coerce the color to either black or white. Also ensure that\n // appending the test element to the DOM does not affect layout by absolutely positioning it\n const testElement = this._document.createElement('div');\n testElement.style.backgroundColor = 'rgb(1,2,3)';\n testElement.style.position = 'absolute';\n this._document.body.appendChild(testElement);\n // Get the computed style for the background color, collapsing spaces to normalize between\n // browsers. Once we get this color, we no longer need the test element. Access the `window`\n // via the document so we can fake it in tests. Note that we have extra null checks, because\n // this logic will likely run during app bootstrap and throwing can break the entire app.\n const documentWindow = this._document.defaultView || window;\n const computedStyle = documentWindow && documentWindow.getComputedStyle\n ? documentWindow.getComputedStyle(testElement)\n : null;\n const computedColor = ((computedStyle && computedStyle.backgroundColor) || '').replace(/ /g, '');\n testElement.remove();\n switch (computedColor) {\n // Pre Windows 11 dark theme.\n case 'rgb(0,0,0)':\n // Windows 11 dark themes.\n case 'rgb(45,50,54)':\n case 'rgb(32,32,32)':\n return 2 /* HighContrastMode.WHITE_ON_BLACK */;\n // Pre Windows 11 light theme.\n case 'rgb(255,255,255)':\n // Windows 11 light theme.\n case 'rgb(255,250,239)':\n return 1 /* HighContrastMode.BLACK_ON_WHITE */;\n }\n return 0 /* HighContrastMode.NONE */;\n }\n ngOnDestroy() {\n this._breakpointSubscription.unsubscribe();\n }\n /** Applies CSS classes indicating high-contrast mode to document body (browser-only). */\n _applyBodyHighContrastModeCssClasses() {\n if (!this._hasCheckedHighContrastMode && this._platform.isBrowser && this._document.body) {\n const bodyClasses = this._document.body.classList;\n bodyClasses.remove(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS, BLACK_ON_WHITE_CSS_CLASS, WHITE_ON_BLACK_CSS_CLASS);\n this._hasCheckedHighContrastMode = true;\n const mode = this.getHighContrastMode();\n if (mode === 1 /* HighContrastMode.BLACK_ON_WHITE */) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS, BLACK_ON_WHITE_CSS_CLASS);\n }\n else if (mode === 2 /* HighContrastMode.WHITE_ON_BLACK */) {\n bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS, WHITE_ON_BLACK_CSS_CLASS);\n }\n }\n }\n}\nHighContrastModeDetector.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: HighContrastModeDetector, deps: [{ token: i1.Platform }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nHighContrastModeDetector.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: HighContrastModeDetector, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: HighContrastModeDetector, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass A11yModule {\n constructor(highContrastModeDetector) {\n highContrastModeDetector._applyBodyHighContrastModeCssClasses();\n }\n}\nA11yModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: A11yModule, deps: [{ token: HighContrastModeDetector }], target: i0.ɵɵFactoryTarget.NgModule });\nA11yModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: A11yModule, declarations: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus], imports: [ObserversModule], exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus] });\nA11yModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: A11yModule, imports: [ObserversModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: A11yModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [ObserversModule],\n declarations: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus],\n exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus],\n }]\n }], ctorParameters: function () { return [{ type: HighContrastModeDetector }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { A11yModule, ActiveDescendantKeyManager, AriaDescriber, CDK_DESCRIBEDBY_HOST_ATTRIBUTE, CDK_DESCRIBEDBY_ID_PREFIX, CdkAriaLive, CdkMonitorFocus, CdkTrapFocus, ConfigurableFocusTrap, ConfigurableFocusTrapFactory, EventListenerFocusTrapInertStrategy, FOCUS_MONITOR_DEFAULT_OPTIONS, FOCUS_TRAP_INERT_STRATEGY, FocusKeyManager, FocusMonitor, FocusTrap, FocusTrapFactory, HighContrastModeDetector, INPUT_MODALITY_DETECTOR_DEFAULT_OPTIONS, INPUT_MODALITY_DETECTOR_OPTIONS, InputModalityDetector, InteractivityChecker, IsFocusableConfig, LIVE_ANNOUNCER_DEFAULT_OPTIONS, LIVE_ANNOUNCER_ELEMENT_TOKEN, LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY, ListKeyManager, LiveAnnouncer, MESSAGES_CONTAINER_ID, isFakeMousedownFromScreenReader, isFakeTouchstartFromScreenReader };\n","import * as i0 from '@angular/core';\nimport { InjectionToken, inject, EventEmitter, Injectable, Optional, Inject, Directive, Output, Input, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token used to inject the document into Directionality.\n * This is used so that the value can be faked in tests.\n *\n * We can't use the real document in tests because changing the real `dir` causes geometry-based\n * tests in Safari to fail.\n *\n * We also can't re-provide the DOCUMENT token from platform-browser because the unit tests\n * themselves use things like `querySelector` in test code.\n *\n * This token is defined in a separate file from Directionality as a workaround for\n * https://github.com/angular/angular/issues/22559\n *\n * @docs-private\n */\nconst DIR_DOCUMENT = new InjectionToken('cdk-dir-doc', {\n providedIn: 'root',\n factory: DIR_DOCUMENT_FACTORY,\n});\n/** @docs-private */\nfunction DIR_DOCUMENT_FACTORY() {\n return inject(DOCUMENT);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Regex that matches locales with an RTL script. Taken from `goog.i18n.bidi.isRtlLanguage`. */\nconst RTL_LOCALE_PATTERN = /^(ar|ckb|dv|he|iw|fa|nqo|ps|sd|ug|ur|yi|.*[-_](Adlm|Arab|Hebr|Nkoo|Rohg|Thaa))(?!.*[-_](Latn|Cyrl)($|-|_))($|-|_)/i;\n/** Resolves a string value to a specific direction. */\nfunction _resolveDirectionality(rawValue) {\n const value = rawValue?.toLowerCase() || '';\n if (value === 'auto' && typeof navigator !== 'undefined' && navigator?.language) {\n return RTL_LOCALE_PATTERN.test(navigator.language) ? 'rtl' : 'ltr';\n }\n return value === 'rtl' ? 'rtl' : 'ltr';\n}\n/**\n * The directionality (LTR / RTL) context for the application (or a subtree of it).\n * Exposes the current direction and a stream of direction changes.\n */\nclass Directionality {\n constructor(_document) {\n /** The current 'ltr' or 'rtl' value. */\n this.value = 'ltr';\n /** Stream that emits whenever the 'ltr' / 'rtl' state changes. */\n this.change = new EventEmitter();\n if (_document) {\n const bodyDir = _document.body ? _document.body.dir : null;\n const htmlDir = _document.documentElement ? _document.documentElement.dir : null;\n this.value = _resolveDirectionality(bodyDir || htmlDir || 'ltr');\n }\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDirectionality.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Directionality, deps: [{ token: DIR_DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nDirectionality.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Directionality, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Directionality, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DIR_DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive to listen for changes of direction of part of the DOM.\n *\n * Provides itself as Directionality such that descendant directives only need to ever inject\n * Directionality to get the closest direction.\n */\nclass Dir {\n constructor() {\n /** Normalized direction that accounts for invalid/unsupported values. */\n this._dir = 'ltr';\n /** Whether the `value` has been set to its initial value. */\n this._isInitialized = false;\n /** Event emitted when the direction changes. */\n this.change = new EventEmitter();\n }\n /** @docs-private */\n get dir() {\n return this._dir;\n }\n set dir(value) {\n const previousValue = this._dir;\n // Note: `_resolveDirectionality` resolves the language based on the browser's language,\n // whereas the browser does it based on the content of the element. Since doing so based\n // on the content can be expensive, for now we're doing the simpler matching.\n this._dir = _resolveDirectionality(value);\n this._rawDir = value;\n if (previousValue !== this._dir && this._isInitialized) {\n this.change.emit(this._dir);\n }\n }\n /** Current layout direction of the element. */\n get value() {\n return this.dir;\n }\n /** Initialize once default value has been set. */\n ngAfterContentInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n this.change.complete();\n }\n}\nDir.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Dir, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nDir.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: Dir, selector: \"[dir]\", inputs: { dir: \"dir\" }, outputs: { change: \"dirChange\" }, host: { properties: { \"attr.dir\": \"_rawDir\" } }, providers: [{ provide: Directionality, useExisting: Dir }], exportAs: [\"dir\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Dir, decorators: [{\n type: Directive,\n args: [{\n selector: '[dir]',\n providers: [{ provide: Directionality, useExisting: Dir }],\n host: { '[attr.dir]': '_rawDir' },\n exportAs: 'dir',\n }]\n }], propDecorators: { change: [{\n type: Output,\n args: ['dirChange']\n }], dir: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass BidiModule {\n}\nBidiModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BidiModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nBidiModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BidiModule, declarations: [Dir], exports: [Dir] });\nBidiModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BidiModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BidiModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [Dir],\n declarations: [Dir],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BidiModule, DIR_DOCUMENT, Dir, Directionality };\n","import { ElementRef } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a data-bound value (typically a string) to a boolean. */\nfunction coerceBooleanProperty(value) {\n return value != null && `${value}` !== 'false';\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceNumberProperty(value, fallbackValue = 0) {\n return _isNumberValue(value) ? Number(value) : fallbackValue;\n}\n/**\n * Whether the provided value is considered a number.\n * @docs-private\n */\nfunction _isNumberValue(value) {\n // parseFloat(value) handles most of the cases we're interested in (it treats null, empty string,\n // and other non-number values as NaN, where Number just uses 0) but it considers the string\n // '123hello' to be a valid number. Therefore we also check if Number(value) is NaN.\n return !isNaN(parseFloat(value)) && !isNaN(Number(value));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nfunction coerceArray(value) {\n return Array.isArray(value) ? value : [value];\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Coerces a value to a CSS pixel value. */\nfunction coerceCssPixelValue(value) {\n if (value == null) {\n return '';\n }\n return typeof value === 'string' ? value : `${value}px`;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces an ElementRef or an Element into an element.\n * Useful for APIs that can accept either a ref or the native element itself.\n */\nfunction coerceElement(elementOrRef) {\n return elementOrRef instanceof ElementRef ? elementOrRef.nativeElement : elementOrRef;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Coerces a value to an array of trimmed non-empty strings.\n * Any input that is not an array, `null` or `undefined` will be turned into a string\n * via `toString()` and subsequently split with the given separator.\n * `null` and `undefined` will result in an empty array.\n * This results in the following outcomes:\n * - `null` -> `[]`\n * - `[null]` -> `[\"null\"]`\n * - `[\"a\", \"b \", \" \"]` -> `[\"a\", \"b\"]`\n * - `[1, [2, 3]]` -> `[\"1\", \"2,3\"]`\n * - `[{ a: 0 }]` -> `[\"[object Object]\"]`\n * - `{ a: 0 }` -> `[\"[object\", \"Object]\"]`\n *\n * Useful for defining CSS classes or table columns.\n * @param value the value to coerce into an array of strings\n * @param separator split-separator if value isn't an array\n */\nfunction coerceStringArray(value, separator = /\\s+/) {\n const result = [];\n if (value != null) {\n const sourceValues = Array.isArray(value) ? value : `${value}`.split(separator);\n for (const sourceValue of sourceValues) {\n const trimmedString = `${sourceValue}`.trim();\n if (trimmedString) {\n result.push(trimmedString);\n }\n }\n }\n return result;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\nexport { _isNumberValue, coerceArray, coerceBooleanProperty, coerceCssPixelValue, coerceElement, coerceNumberProperty, coerceStringArray };\n","import { ConnectableObservable, isObservable, of, Subject } from 'rxjs';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken } from '@angular/core';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass DataSource {\n}\n/** Checks whether an object is a data source. */\nfunction isDataSource(value) {\n // Check if the value is a DataSource by observing if it has a connect function. Cannot\n // be checked as an `instanceof DataSource` since people could create their own sources\n // that match the interface, but don't extend DataSource. We also can't use `isObservable`\n // here, because of some internal apps.\n return value && typeof value.connect === 'function' && !(value instanceof ConnectableObservable);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** DataSource wrapper for a native array. */\nclass ArrayDataSource extends DataSource {\n constructor(_data) {\n super();\n this._data = _data;\n }\n connect() {\n return isObservable(this._data) ? this._data : of(this._data);\n }\n disconnect() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A repeater that destroys views when they are removed from a\n * {@link ViewContainerRef}. When new items are inserted into the container,\n * the repeater will always construct a new embedded view for each item.\n *\n * @template T The type for the embedded view's $implicit property.\n * @template R The type for the item in each IterableDiffer change record.\n * @template C The type for the context passed to each embedded view.\n */\nclass _DisposeViewRepeaterStrategy {\n applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) {\n changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => {\n let view;\n let operation;\n if (record.previousIndex == null) {\n const insertContext = itemContextFactory(record, adjustedPreviousIndex, currentIndex);\n view = viewContainerRef.createEmbeddedView(insertContext.templateRef, insertContext.context, insertContext.index);\n operation = 1 /* _ViewRepeaterOperation.INSERTED */;\n }\n else if (currentIndex == null) {\n viewContainerRef.remove(adjustedPreviousIndex);\n operation = 3 /* _ViewRepeaterOperation.REMOVED */;\n }\n else {\n view = viewContainerRef.get(adjustedPreviousIndex);\n viewContainerRef.move(view, currentIndex);\n operation = 2 /* _ViewRepeaterOperation.MOVED */;\n }\n if (itemViewChanged) {\n itemViewChanged({\n context: view?.context,\n operation,\n record,\n });\n }\n });\n }\n detach() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A repeater that caches views when they are removed from a\n * {@link ViewContainerRef}. When new items are inserted into the container,\n * the repeater will reuse one of the cached views instead of creating a new\n * embedded view. Recycling cached views reduces the quantity of expensive DOM\n * inserts.\n *\n * @template T The type for the embedded view's $implicit property.\n * @template R The type for the item in each IterableDiffer change record.\n * @template C The type for the context passed to each embedded view.\n */\nclass _RecycleViewRepeaterStrategy {\n constructor() {\n /**\n * The size of the cache used to store unused views.\n * Setting the cache size to `0` will disable caching. Defaults to 20 views.\n */\n this.viewCacheSize = 20;\n /**\n * View cache that stores embedded view instances that have been previously stamped out,\n * but don't are not currently rendered. The view repeater will reuse these views rather than\n * creating brand new ones.\n *\n * TODO(michaeljamesparsons) Investigate whether using a linked list would improve performance.\n */\n this._viewCache = [];\n }\n /** Apply changes to the DOM. */\n applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) {\n // Rearrange the views to put them in the right location.\n changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => {\n let view;\n let operation;\n if (record.previousIndex == null) {\n // Item added.\n const viewArgsFactory = () => itemContextFactory(record, adjustedPreviousIndex, currentIndex);\n view = this._insertView(viewArgsFactory, currentIndex, viewContainerRef, itemValueResolver(record));\n operation = view ? 1 /* _ViewRepeaterOperation.INSERTED */ : 0 /* _ViewRepeaterOperation.REPLACED */;\n }\n else if (currentIndex == null) {\n // Item removed.\n this._detachAndCacheView(adjustedPreviousIndex, viewContainerRef);\n operation = 3 /* _ViewRepeaterOperation.REMOVED */;\n }\n else {\n // Item moved.\n view = this._moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, itemValueResolver(record));\n operation = 2 /* _ViewRepeaterOperation.MOVED */;\n }\n if (itemViewChanged) {\n itemViewChanged({\n context: view?.context,\n operation,\n record,\n });\n }\n });\n }\n detach() {\n for (const view of this._viewCache) {\n view.destroy();\n }\n this._viewCache = [];\n }\n /**\n * Inserts a view for a new item, either from the cache or by creating a new\n * one. Returns `undefined` if the item was inserted into a cached view.\n */\n _insertView(viewArgsFactory, currentIndex, viewContainerRef, value) {\n const cachedView = this._insertViewFromCache(currentIndex, viewContainerRef);\n if (cachedView) {\n cachedView.context.$implicit = value;\n return undefined;\n }\n const viewArgs = viewArgsFactory();\n return viewContainerRef.createEmbeddedView(viewArgs.templateRef, viewArgs.context, viewArgs.index);\n }\n /** Detaches the view at the given index and inserts into the view cache. */\n _detachAndCacheView(index, viewContainerRef) {\n const detachedView = viewContainerRef.detach(index);\n this._maybeCacheView(detachedView, viewContainerRef);\n }\n /** Moves view at the previous index to the current index. */\n _moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, value) {\n const view = viewContainerRef.get(adjustedPreviousIndex);\n viewContainerRef.move(view, currentIndex);\n view.context.$implicit = value;\n return view;\n }\n /**\n * Cache the given detached view. If the cache is full, the view will be\n * destroyed.\n */\n _maybeCacheView(view, viewContainerRef) {\n if (this._viewCache.length < this.viewCacheSize) {\n this._viewCache.push(view);\n }\n else {\n const index = viewContainerRef.indexOf(view);\n // The host component could remove views from the container outside of\n // the view repeater. It's unlikely this will occur, but just in case,\n // destroy the view on its own, otherwise destroy it through the\n // container to ensure that all the references are removed.\n if (index === -1) {\n view.destroy();\n }\n else {\n viewContainerRef.remove(index);\n }\n }\n }\n /** Inserts a recycled view from the cache at the given index. */\n _insertViewFromCache(index, viewContainerRef) {\n const cachedView = this._viewCache.pop();\n if (cachedView) {\n viewContainerRef.insert(cachedView, index);\n }\n return cachedView || null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class to be used to power selecting one or more options from a list.\n */\nclass SelectionModel {\n /** Selected values. */\n get selected() {\n if (!this._selected) {\n this._selected = Array.from(this._selection.values());\n }\n return this._selected;\n }\n constructor(_multiple = false, initiallySelectedValues, _emitChanges = true, compareWith) {\n this._multiple = _multiple;\n this._emitChanges = _emitChanges;\n this.compareWith = compareWith;\n /** Currently-selected values. */\n this._selection = new Set();\n /** Keeps track of the deselected options that haven't been emitted by the change event. */\n this._deselectedToEmit = [];\n /** Keeps track of the selected options that haven't been emitted by the change event. */\n this._selectedToEmit = [];\n /** Event emitted when the value has changed. */\n this.changed = new Subject();\n if (initiallySelectedValues && initiallySelectedValues.length) {\n if (_multiple) {\n initiallySelectedValues.forEach(value => this._markSelected(value));\n }\n else {\n this._markSelected(initiallySelectedValues[0]);\n }\n // Clear the array in order to avoid firing the change event for preselected values.\n this._selectedToEmit.length = 0;\n }\n }\n /**\n * Selects a value or an array of values.\n * @param values The values to select\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n select(...values) {\n this._verifyValueAssignment(values);\n values.forEach(value => this._markSelected(value));\n const changed = this._hasQueuedChanges();\n this._emitChangeEvent();\n return changed;\n }\n /**\n * Deselects a value or an array of values.\n * @param values The values to deselect\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n deselect(...values) {\n this._verifyValueAssignment(values);\n values.forEach(value => this._unmarkSelected(value));\n const changed = this._hasQueuedChanges();\n this._emitChangeEvent();\n return changed;\n }\n /**\n * Sets the selected values\n * @param values The new selected values\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n setSelection(...values) {\n this._verifyValueAssignment(values);\n const oldValues = this.selected;\n const newSelectedSet = new Set(values);\n values.forEach(value => this._markSelected(value));\n oldValues\n .filter(value => !newSelectedSet.has(value))\n .forEach(value => this._unmarkSelected(value));\n const changed = this._hasQueuedChanges();\n this._emitChangeEvent();\n return changed;\n }\n /**\n * Toggles a value between selected and deselected.\n * @param value The value to toggle\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n toggle(value) {\n return this.isSelected(value) ? this.deselect(value) : this.select(value);\n }\n /**\n * Clears all of the selected values.\n * @param flushEvent Whether to flush the changes in an event.\n * If false, the changes to the selection will be flushed along with the next event.\n * @return Whether the selection changed as a result of this call\n * @breaking-change 16.0.0 make return type boolean\n */\n clear(flushEvent = true) {\n this._unmarkAll();\n const changed = this._hasQueuedChanges();\n if (flushEvent) {\n this._emitChangeEvent();\n }\n return changed;\n }\n /**\n * Determines whether a value is selected.\n */\n isSelected(value) {\n return this._selection.has(this._getConcreteValue(value));\n }\n /**\n * Determines whether the model does not have a value.\n */\n isEmpty() {\n return this._selection.size === 0;\n }\n /**\n * Determines whether the model has a value.\n */\n hasValue() {\n return !this.isEmpty();\n }\n /**\n * Sorts the selected values based on a predicate function.\n */\n sort(predicate) {\n if (this._multiple && this.selected) {\n this._selected.sort(predicate);\n }\n }\n /**\n * Gets whether multiple values can be selected.\n */\n isMultipleSelection() {\n return this._multiple;\n }\n /** Emits a change event and clears the records of selected and deselected values. */\n _emitChangeEvent() {\n // Clear the selected values so they can be re-cached.\n this._selected = null;\n if (this._selectedToEmit.length || this._deselectedToEmit.length) {\n this.changed.next({\n source: this,\n added: this._selectedToEmit,\n removed: this._deselectedToEmit,\n });\n this._deselectedToEmit = [];\n this._selectedToEmit = [];\n }\n }\n /** Selects a value. */\n _markSelected(value) {\n value = this._getConcreteValue(value);\n if (!this.isSelected(value)) {\n if (!this._multiple) {\n this._unmarkAll();\n }\n if (!this.isSelected(value)) {\n this._selection.add(value);\n }\n if (this._emitChanges) {\n this._selectedToEmit.push(value);\n }\n }\n }\n /** Deselects a value. */\n _unmarkSelected(value) {\n value = this._getConcreteValue(value);\n if (this.isSelected(value)) {\n this._selection.delete(value);\n if (this._emitChanges) {\n this._deselectedToEmit.push(value);\n }\n }\n }\n /** Clears out the selected values. */\n _unmarkAll() {\n if (!this.isEmpty()) {\n this._selection.forEach(value => this._unmarkSelected(value));\n }\n }\n /**\n * Verifies the value assignment and throws an error if the specified value array is\n * including multiple values while the selection model is not supporting multiple values.\n */\n _verifyValueAssignment(values) {\n if (values.length > 1 && !this._multiple && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMultipleValuesInSingleSelectionError();\n }\n }\n /** Whether there are queued up change to be emitted. */\n _hasQueuedChanges() {\n return !!(this._deselectedToEmit.length || this._selectedToEmit.length);\n }\n /** Returns a value that is comparable to inputValue by applying compareWith function, returns the same inputValue otherwise. */\n _getConcreteValue(inputValue) {\n if (!this.compareWith) {\n return inputValue;\n }\n else {\n for (let selectedValue of this._selection) {\n if (this.compareWith(inputValue, selectedValue)) {\n return selectedValue;\n }\n }\n return inputValue;\n }\n }\n}\n/**\n * Returns an error that reports that multiple values are passed into a selection model\n * with a single value.\n * @docs-private\n */\nfunction getMultipleValuesInSingleSelectionError() {\n return Error('Cannot pass multiple values into SelectionModel with single-value mode.');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Class to coordinate unique selection based on name.\n * Intended to be consumed as an Angular service.\n * This service is needed because native radio change events are only fired on the item currently\n * being selected, and we still need to uncheck the previous selection.\n *\n * This service does not *store* any IDs and names because they may change at any time, so it is\n * less error-prone if they are simply passed through when the events occur.\n */\nclass UniqueSelectionDispatcher {\n constructor() {\n this._listeners = [];\n }\n /**\n * Notify other items that selection for the given name has been set.\n * @param id ID of the item.\n * @param name Name of the item.\n */\n notify(id, name) {\n for (let listener of this._listeners) {\n listener(id, name);\n }\n }\n /**\n * Listen for future changes to item selection.\n * @return Function used to deregister listener\n */\n listen(listener) {\n this._listeners.push(listener);\n return () => {\n this._listeners = this._listeners.filter((registered) => {\n return listener !== registered;\n });\n };\n }\n ngOnDestroy() {\n this._listeners = [];\n }\n}\nUniqueSelectionDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: UniqueSelectionDispatcher, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nUniqueSelectionDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: UniqueSelectionDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: UniqueSelectionDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Injection token for {@link _ViewRepeater}. This token is for use by Angular Material only.\n * @docs-private\n */\nconst _VIEW_REPEATER_STRATEGY = new InjectionToken('_ViewRepeater');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { ArrayDataSource, DataSource, SelectionModel, UniqueSelectionDispatcher, _DisposeViewRepeaterStrategy, _RecycleViewRepeaterStrategy, _VIEW_REPEATER_STRATEGY, getMultipleValuesInSingleSelectionError, isDataSource };\n","/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst MAC_ENTER = 3;\nconst BACKSPACE = 8;\nconst TAB = 9;\nconst NUM_CENTER = 12;\nconst ENTER = 13;\nconst SHIFT = 16;\nconst CONTROL = 17;\nconst ALT = 18;\nconst PAUSE = 19;\nconst CAPS_LOCK = 20;\nconst ESCAPE = 27;\nconst SPACE = 32;\nconst PAGE_UP = 33;\nconst PAGE_DOWN = 34;\nconst END = 35;\nconst HOME = 36;\nconst LEFT_ARROW = 37;\nconst UP_ARROW = 38;\nconst RIGHT_ARROW = 39;\nconst DOWN_ARROW = 40;\nconst PLUS_SIGN = 43;\nconst PRINT_SCREEN = 44;\nconst INSERT = 45;\nconst DELETE = 46;\nconst ZERO = 48;\nconst ONE = 49;\nconst TWO = 50;\nconst THREE = 51;\nconst FOUR = 52;\nconst FIVE = 53;\nconst SIX = 54;\nconst SEVEN = 55;\nconst EIGHT = 56;\nconst NINE = 57;\nconst FF_SEMICOLON = 59; // Firefox (Gecko) fires this for semicolon instead of 186\nconst FF_EQUALS = 61; // Firefox (Gecko) fires this for equals instead of 187\nconst QUESTION_MARK = 63;\nconst AT_SIGN = 64;\nconst A = 65;\nconst B = 66;\nconst C = 67;\nconst D = 68;\nconst E = 69;\nconst F = 70;\nconst G = 71;\nconst H = 72;\nconst I = 73;\nconst J = 74;\nconst K = 75;\nconst L = 76;\nconst M = 77;\nconst N = 78;\nconst O = 79;\nconst P = 80;\nconst Q = 81;\nconst R = 82;\nconst S = 83;\nconst T = 84;\nconst U = 85;\nconst V = 86;\nconst W = 87;\nconst X = 88;\nconst Y = 89;\nconst Z = 90;\nconst META = 91; // WIN_KEY_LEFT\nconst MAC_WK_CMD_LEFT = 91;\nconst MAC_WK_CMD_RIGHT = 93;\nconst CONTEXT_MENU = 93;\nconst NUMPAD_ZERO = 96;\nconst NUMPAD_ONE = 97;\nconst NUMPAD_TWO = 98;\nconst NUMPAD_THREE = 99;\nconst NUMPAD_FOUR = 100;\nconst NUMPAD_FIVE = 101;\nconst NUMPAD_SIX = 102;\nconst NUMPAD_SEVEN = 103;\nconst NUMPAD_EIGHT = 104;\nconst NUMPAD_NINE = 105;\nconst NUMPAD_MULTIPLY = 106;\nconst NUMPAD_PLUS = 107;\nconst NUMPAD_MINUS = 109;\nconst NUMPAD_PERIOD = 110;\nconst NUMPAD_DIVIDE = 111;\nconst F1 = 112;\nconst F2 = 113;\nconst F3 = 114;\nconst F4 = 115;\nconst F5 = 116;\nconst F6 = 117;\nconst F7 = 118;\nconst F8 = 119;\nconst F9 = 120;\nconst F10 = 121;\nconst F11 = 122;\nconst F12 = 123;\nconst NUM_LOCK = 144;\nconst SCROLL_LOCK = 145;\nconst FIRST_MEDIA = 166;\nconst FF_MINUS = 173;\nconst MUTE = 173; // Firefox (Gecko) fires 181 for MUTE\nconst VOLUME_DOWN = 174; // Firefox (Gecko) fires 182 for VOLUME_DOWN\nconst VOLUME_UP = 175; // Firefox (Gecko) fires 183 for VOLUME_UP\nconst FF_MUTE = 181;\nconst FF_VOLUME_DOWN = 182;\nconst LAST_MEDIA = 183;\nconst FF_VOLUME_UP = 183;\nconst SEMICOLON = 186; // Firefox (Gecko) fires 59 for SEMICOLON\nconst EQUALS = 187; // Firefox (Gecko) fires 61 for EQUALS\nconst COMMA = 188;\nconst DASH = 189; // Firefox (Gecko) fires 173 for DASH/MINUS\nconst PERIOD = 190;\nconst SLASH = 191;\nconst APOSTROPHE = 192;\nconst TILDE = 192;\nconst OPEN_SQUARE_BRACKET = 219;\nconst BACKSLASH = 220;\nconst CLOSE_SQUARE_BRACKET = 221;\nconst SINGLE_QUOTE = 222;\nconst MAC_META = 224;\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Checks whether a modifier key is pressed.\n * @param event Event to be checked.\n */\nfunction hasModifierKey(event, ...modifiers) {\n if (modifiers.length) {\n return modifiers.some(modifier => event[modifier]);\n }\n return event.altKey || event.shiftKey || event.ctrlKey || event.metaKey;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { A, ALT, APOSTROPHE, AT_SIGN, B, BACKSLASH, BACKSPACE, C, CAPS_LOCK, CLOSE_SQUARE_BRACKET, COMMA, CONTEXT_MENU, CONTROL, D, DASH, DELETE, DOWN_ARROW, E, EIGHT, END, ENTER, EQUALS, ESCAPE, F, F1, F10, F11, F12, F2, F3, F4, F5, F6, F7, F8, F9, FF_EQUALS, FF_MINUS, FF_MUTE, FF_SEMICOLON, FF_VOLUME_DOWN, FF_VOLUME_UP, FIRST_MEDIA, FIVE, FOUR, G, H, HOME, I, INSERT, J, K, L, LAST_MEDIA, LEFT_ARROW, M, MAC_ENTER, MAC_META, MAC_WK_CMD_LEFT, MAC_WK_CMD_RIGHT, META, MUTE, N, NINE, NUMPAD_DIVIDE, NUMPAD_EIGHT, NUMPAD_FIVE, NUMPAD_FOUR, NUMPAD_MINUS, NUMPAD_MULTIPLY, NUMPAD_NINE, NUMPAD_ONE, NUMPAD_PERIOD, NUMPAD_PLUS, NUMPAD_SEVEN, NUMPAD_SIX, NUMPAD_THREE, NUMPAD_TWO, NUMPAD_ZERO, NUM_CENTER, NUM_LOCK, O, ONE, OPEN_SQUARE_BRACKET, P, PAGE_DOWN, PAGE_UP, PAUSE, PERIOD, PLUS_SIGN, PRINT_SCREEN, Q, QUESTION_MARK, R, RIGHT_ARROW, S, SCROLL_LOCK, SEMICOLON, SEVEN, SHIFT, SINGLE_QUOTE, SIX, SLASH, SPACE, T, TAB, THREE, TILDE, TWO, U, UP_ARROW, V, VOLUME_DOWN, VOLUME_UP, W, X, Y, Z, ZERO, hasModifierKey };\n","import * as i0 from '@angular/core';\nimport { NgModule, Injectable } from '@angular/core';\nimport { coerceArray } from '@angular/cdk/coercion';\nimport { Subject, combineLatest, concat, Observable } from 'rxjs';\nimport { take, skip, debounceTime, map, startWith, takeUntil } from 'rxjs/operators';\nimport * as i1 from '@angular/cdk/platform';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass LayoutModule {\n}\nLayoutModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: LayoutModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nLayoutModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: LayoutModule });\nLayoutModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: LayoutModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: LayoutModule, decorators: [{\n type: NgModule,\n args: [{}]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Global registry for all dynamically-created, injected media queries. */\nconst mediaQueriesForWebkitCompatibility = new Set();\n/** Style tag that holds all of the dynamically-created media queries. */\nlet mediaQueryStyleNode;\n/** A utility for calling matchMedia queries. */\nclass MediaMatcher {\n constructor(_platform) {\n this._platform = _platform;\n this._matchMedia =\n this._platform.isBrowser && window.matchMedia\n ? // matchMedia is bound to the window scope intentionally as it is an illegal invocation to\n // call it from a different scope.\n window.matchMedia.bind(window)\n : noopMatchMedia;\n }\n /**\n * Evaluates the given media query and returns the native MediaQueryList from which results\n * can be retrieved.\n * Confirms the layout engine will trigger for the selector query provided and returns the\n * MediaQueryList for the query provided.\n */\n matchMedia(query) {\n if (this._platform.WEBKIT || this._platform.BLINK) {\n createEmptyStyleRule(query);\n }\n return this._matchMedia(query);\n }\n}\nMediaMatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: MediaMatcher, deps: [{ token: i1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nMediaMatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: MediaMatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: MediaMatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }]; } });\n/**\n * Creates an empty stylesheet that is used to work around browser inconsistencies related to\n * `matchMedia`. At the time of writing, it handles the following cases:\n * 1. On WebKit browsers, a media query has to have at least one rule in order for `matchMedia`\n * to fire. We work around it by declaring a dummy stylesheet with a `@media` declaration.\n * 2. In some cases Blink browsers will stop firing the `matchMedia` listener if none of the rules\n * inside the `@media` match existing elements on the page. We work around it by having one rule\n * targeting the `body`. See https://github.com/angular/components/issues/23546.\n */\nfunction createEmptyStyleRule(query) {\n if (mediaQueriesForWebkitCompatibility.has(query)) {\n return;\n }\n try {\n if (!mediaQueryStyleNode) {\n mediaQueryStyleNode = document.createElement('style');\n mediaQueryStyleNode.setAttribute('type', 'text/css');\n document.head.appendChild(mediaQueryStyleNode);\n }\n if (mediaQueryStyleNode.sheet) {\n mediaQueryStyleNode.sheet.insertRule(`@media ${query} {body{ }}`, 0);\n mediaQueriesForWebkitCompatibility.add(query);\n }\n }\n catch (e) {\n console.error(e);\n }\n}\n/** No-op matchMedia replacement for non-browser platforms. */\nfunction noopMatchMedia(query) {\n // Use `as any` here to avoid adding additional necessary properties for\n // the noop matcher.\n return {\n matches: query === 'all' || query === '',\n media: query,\n addListener: () => { },\n removeListener: () => { },\n };\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Utility for checking the matching state of @media queries. */\nclass BreakpointObserver {\n constructor(_mediaMatcher, _zone) {\n this._mediaMatcher = _mediaMatcher;\n this._zone = _zone;\n /** A map of all media queries currently being listened for. */\n this._queries = new Map();\n /** A subject for all other observables to takeUntil based on. */\n this._destroySubject = new Subject();\n }\n /** Completes the active subject, signalling to all other observables to complete. */\n ngOnDestroy() {\n this._destroySubject.next();\n this._destroySubject.complete();\n }\n /**\n * Whether one or more media queries match the current viewport size.\n * @param value One or more media queries to check.\n * @returns Whether any of the media queries match.\n */\n isMatched(value) {\n const queries = splitQueries(coerceArray(value));\n return queries.some(mediaQuery => this._registerQuery(mediaQuery).mql.matches);\n }\n /**\n * Gets an observable of results for the given queries that will emit new results for any changes\n * in matching of the given queries.\n * @param value One or more media queries to check.\n * @returns A stream of matches for the given queries.\n */\n observe(value) {\n const queries = splitQueries(coerceArray(value));\n const observables = queries.map(query => this._registerQuery(query).observable);\n let stateObservable = combineLatest(observables);\n // Emit the first state immediately, and then debounce the subsequent emissions.\n stateObservable = concat(stateObservable.pipe(take(1)), stateObservable.pipe(skip(1), debounceTime(0)));\n return stateObservable.pipe(map(breakpointStates => {\n const response = {\n matches: false,\n breakpoints: {},\n };\n breakpointStates.forEach(({ matches, query }) => {\n response.matches = response.matches || matches;\n response.breakpoints[query] = matches;\n });\n return response;\n }));\n }\n /** Registers a specific query to be listened for. */\n _registerQuery(query) {\n // Only set up a new MediaQueryList if it is not already being listened for.\n if (this._queries.has(query)) {\n return this._queries.get(query);\n }\n const mql = this._mediaMatcher.matchMedia(query);\n // Create callback for match changes and add it is as a listener.\n const queryObservable = new Observable((observer) => {\n // Listener callback methods are wrapped to be placed back in ngZone. Callbacks must be placed\n // back into the zone because matchMedia is only included in Zone.js by loading the\n // webapis-media-query.js file alongside the zone.js file. Additionally, some browsers do not\n // have MediaQueryList inherit from EventTarget, which causes inconsistencies in how Zone.js\n // patches it.\n const handler = (e) => this._zone.run(() => observer.next(e));\n mql.addListener(handler);\n return () => {\n mql.removeListener(handler);\n };\n }).pipe(startWith(mql), map(({ matches }) => ({ query, matches })), takeUntil(this._destroySubject));\n // Add the MediaQueryList to the set of queries.\n const output = { observable: queryObservable, mql };\n this._queries.set(query, output);\n return output;\n }\n}\nBreakpointObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BreakpointObserver, deps: [{ token: MediaMatcher }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Injectable });\nBreakpointObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BreakpointObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BreakpointObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: MediaMatcher }, { type: i0.NgZone }]; } });\n/**\n * Split each query string into separate query strings if two queries are provided as comma\n * separated.\n */\nfunction splitQueries(queries) {\n return queries\n .map(query => query.split(','))\n .reduce((a1, a2) => a1.concat(a2))\n .map(query => query.trim());\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// PascalCase is being used as Breakpoints is used like an enum.\n// tslint:disable-next-line:variable-name\nconst Breakpoints = {\n XSmall: '(max-width: 599.98px)',\n Small: '(min-width: 600px) and (max-width: 959.98px)',\n Medium: '(min-width: 960px) and (max-width: 1279.98px)',\n Large: '(min-width: 1280px) and (max-width: 1919.98px)',\n XLarge: '(min-width: 1920px)',\n Handset: '(max-width: 599.98px) and (orientation: portrait), ' +\n '(max-width: 959.98px) and (orientation: landscape)',\n Tablet: '(min-width: 600px) and (max-width: 839.98px) and (orientation: portrait), ' +\n '(min-width: 960px) and (max-width: 1279.98px) and (orientation: landscape)',\n Web: '(min-width: 840px) and (orientation: portrait), ' +\n '(min-width: 1280px) and (orientation: landscape)',\n HandsetPortrait: '(max-width: 599.98px) and (orientation: portrait)',\n TabletPortrait: '(min-width: 600px) and (max-width: 839.98px) and (orientation: portrait)',\n WebPortrait: '(min-width: 840px) and (orientation: portrait)',\n HandsetLandscape: '(max-width: 959.98px) and (orientation: landscape)',\n TabletLandscape: '(min-width: 960px) and (max-width: 1279.98px) and (orientation: landscape)',\n WebLandscape: '(min-width: 1280px) and (orientation: landscape)',\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BreakpointObserver, Breakpoints, LayoutModule, MediaMatcher };\n","import { coerceElement, coerceBooleanProperty, coerceNumberProperty } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { Injectable, EventEmitter, Directive, Output, Input, NgModule } from '@angular/core';\nimport { Observable, Subject } from 'rxjs';\nimport { debounceTime } from 'rxjs/operators';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Factory that creates a new MutationObserver and allows us to stub it out in unit tests.\n * @docs-private\n */\nclass MutationObserverFactory {\n create(callback) {\n return typeof MutationObserver === 'undefined' ? null : new MutationObserver(callback);\n }\n}\nMutationObserverFactory.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: MutationObserverFactory, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nMutationObserverFactory.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: MutationObserverFactory, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: MutationObserverFactory, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n/** An injectable service that allows watching elements for changes to their content. */\nclass ContentObserver {\n constructor(_mutationObserverFactory) {\n this._mutationObserverFactory = _mutationObserverFactory;\n /** Keeps track of the existing MutationObservers so they can be reused. */\n this._observedElements = new Map();\n }\n ngOnDestroy() {\n this._observedElements.forEach((_, element) => this._cleanupObserver(element));\n }\n observe(elementOrRef) {\n const element = coerceElement(elementOrRef);\n return new Observable((observer) => {\n const stream = this._observeElement(element);\n const subscription = stream.subscribe(observer);\n return () => {\n subscription.unsubscribe();\n this._unobserveElement(element);\n };\n });\n }\n /**\n * Observes the given element by using the existing MutationObserver if available, or creating a\n * new one if not.\n */\n _observeElement(element) {\n if (!this._observedElements.has(element)) {\n const stream = new Subject();\n const observer = this._mutationObserverFactory.create(mutations => stream.next(mutations));\n if (observer) {\n observer.observe(element, {\n characterData: true,\n childList: true,\n subtree: true,\n });\n }\n this._observedElements.set(element, { observer, stream, count: 1 });\n }\n else {\n this._observedElements.get(element).count++;\n }\n return this._observedElements.get(element).stream;\n }\n /**\n * Un-observes the given element and cleans up the underlying MutationObserver if nobody else is\n * observing this element.\n */\n _unobserveElement(element) {\n if (this._observedElements.has(element)) {\n this._observedElements.get(element).count--;\n if (!this._observedElements.get(element).count) {\n this._cleanupObserver(element);\n }\n }\n }\n /** Clean up the underlying MutationObserver for the specified element. */\n _cleanupObserver(element) {\n if (this._observedElements.has(element)) {\n const { observer, stream } = this._observedElements.get(element);\n if (observer) {\n observer.disconnect();\n }\n stream.complete();\n this._observedElements.delete(element);\n }\n }\n}\nContentObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ContentObserver, deps: [{ token: MutationObserverFactory }], target: i0.ɵɵFactoryTarget.Injectable });\nContentObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ContentObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ContentObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: MutationObserverFactory }]; } });\n/**\n * Directive that triggers a callback whenever the content of\n * its associated element has changed.\n */\nclass CdkObserveContent {\n /**\n * Whether observing content is disabled. This option can be used\n * to disconnect the underlying MutationObserver until it is needed.\n */\n get disabled() {\n return this._disabled;\n }\n set disabled(value) {\n this._disabled = coerceBooleanProperty(value);\n this._disabled ? this._unsubscribe() : this._subscribe();\n }\n /** Debounce interval for emitting the changes. */\n get debounce() {\n return this._debounce;\n }\n set debounce(value) {\n this._debounce = coerceNumberProperty(value);\n this._subscribe();\n }\n constructor(_contentObserver, _elementRef, _ngZone) {\n this._contentObserver = _contentObserver;\n this._elementRef = _elementRef;\n this._ngZone = _ngZone;\n /** Event emitted for each change in the element's content. */\n this.event = new EventEmitter();\n this._disabled = false;\n this._currentSubscription = null;\n }\n ngAfterContentInit() {\n if (!this._currentSubscription && !this.disabled) {\n this._subscribe();\n }\n }\n ngOnDestroy() {\n this._unsubscribe();\n }\n _subscribe() {\n this._unsubscribe();\n const stream = this._contentObserver.observe(this._elementRef);\n // TODO(mmalerba): We shouldn't be emitting on this @Output() outside the zone.\n // Consider brining it back inside the zone next time we're making breaking changes.\n // Bringing it back inside can cause things like infinite change detection loops and changed\n // after checked errors if people's code isn't handling it properly.\n this._ngZone.runOutsideAngular(() => {\n this._currentSubscription = (this.debounce ? stream.pipe(debounceTime(this.debounce)) : stream).subscribe(this.event);\n });\n }\n _unsubscribe() {\n this._currentSubscription?.unsubscribe();\n }\n}\nCdkObserveContent.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkObserveContent, deps: [{ token: ContentObserver }, { token: i0.ElementRef }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive });\nCdkObserveContent.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkObserveContent, selector: \"[cdkObserveContent]\", inputs: { disabled: [\"cdkObserveContentDisabled\", \"disabled\"], debounce: \"debounce\" }, outputs: { event: \"cdkObserveContent\" }, exportAs: [\"cdkObserveContent\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkObserveContent, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkObserveContent]',\n exportAs: 'cdkObserveContent',\n }]\n }], ctorParameters: function () { return [{ type: ContentObserver }, { type: i0.ElementRef }, { type: i0.NgZone }]; }, propDecorators: { event: [{\n type: Output,\n args: ['cdkObserveContent']\n }], disabled: [{\n type: Input,\n args: ['cdkObserveContentDisabled']\n }], debounce: [{\n type: Input\n }] } });\nclass ObserversModule {\n}\nObserversModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ObserversModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nObserversModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ObserversModule, declarations: [CdkObserveContent], exports: [CdkObserveContent] });\nObserversModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ObserversModule, providers: [MutationObserverFactory] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ObserversModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkObserveContent],\n declarations: [CdkObserveContent],\n providers: [MutationObserverFactory],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkObserveContent, ContentObserver, MutationObserverFactory, ObserversModule };\n","import * as i1 from '@angular/cdk/scrolling';\nimport { ScrollingModule } from '@angular/cdk/scrolling';\nexport { CdkScrollable, ScrollDispatcher, ViewportRuler } from '@angular/cdk/scrolling';\nimport * as i6 from '@angular/common';\nimport { DOCUMENT } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, Inject, Optional, ElementRef, ApplicationRef, ANIMATION_MODULE_TYPE, InjectionToken, Directive, EventEmitter, Input, Output, NgModule } from '@angular/core';\nimport { coerceCssPixelValue, coerceArray, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport * as i1$1 from '@angular/cdk/platform';\nimport { supportsScrollBehavior, _getEventTarget, _isTestEnvironment } from '@angular/cdk/platform';\nimport { filter, take, takeUntil, takeWhile } from 'rxjs/operators';\nimport * as i5 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport { DomPortalOutlet, TemplatePortal, PortalModule } from '@angular/cdk/portal';\nimport { Subject, Subscription, merge } from 'rxjs';\nimport { ESCAPE, hasModifierKey } from '@angular/cdk/keycodes';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst scrollBehaviorSupported = supportsScrollBehavior();\n/**\n * Strategy that will prevent the user from scrolling while the overlay is visible.\n */\nclass BlockScrollStrategy {\n constructor(_viewportRuler, document) {\n this._viewportRuler = _viewportRuler;\n this._previousHTMLStyles = { top: '', left: '' };\n this._isEnabled = false;\n this._document = document;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach() { }\n /** Blocks page-level scroll while the attached overlay is open. */\n enable() {\n if (this._canBeEnabled()) {\n const root = this._document.documentElement;\n this._previousScrollPosition = this._viewportRuler.getViewportScrollPosition();\n // Cache the previous inline styles in case the user had set them.\n this._previousHTMLStyles.left = root.style.left || '';\n this._previousHTMLStyles.top = root.style.top || '';\n // Note: we're using the `html` node, instead of the `body`, because the `body` may\n // have the user agent margin, whereas the `html` is guaranteed not to have one.\n root.style.left = coerceCssPixelValue(-this._previousScrollPosition.left);\n root.style.top = coerceCssPixelValue(-this._previousScrollPosition.top);\n root.classList.add('cdk-global-scrollblock');\n this._isEnabled = true;\n }\n }\n /** Unblocks page-level scroll while the attached overlay is open. */\n disable() {\n if (this._isEnabled) {\n const html = this._document.documentElement;\n const body = this._document.body;\n const htmlStyle = html.style;\n const bodyStyle = body.style;\n const previousHtmlScrollBehavior = htmlStyle.scrollBehavior || '';\n const previousBodyScrollBehavior = bodyStyle.scrollBehavior || '';\n this._isEnabled = false;\n htmlStyle.left = this._previousHTMLStyles.left;\n htmlStyle.top = this._previousHTMLStyles.top;\n html.classList.remove('cdk-global-scrollblock');\n // Disable user-defined smooth scrolling temporarily while we restore the scroll position.\n // See https://developer.mozilla.org/en-US/docs/Web/CSS/scroll-behavior\n // Note that we don't mutate the property if the browser doesn't support `scroll-behavior`,\n // because it can throw off feature detections in `supportsScrollBehavior` which\n // checks for `'scrollBehavior' in documentElement.style`.\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = bodyStyle.scrollBehavior = 'auto';\n }\n window.scroll(this._previousScrollPosition.left, this._previousScrollPosition.top);\n if (scrollBehaviorSupported) {\n htmlStyle.scrollBehavior = previousHtmlScrollBehavior;\n bodyStyle.scrollBehavior = previousBodyScrollBehavior;\n }\n }\n }\n _canBeEnabled() {\n // Since the scroll strategies can't be singletons, we have to use a global CSS class\n // (`cdk-global-scrollblock`) to make sure that we don't try to disable global\n // scrolling multiple times.\n const html = this._document.documentElement;\n if (html.classList.contains('cdk-global-scrollblock') || this._isEnabled) {\n return false;\n }\n const body = this._document.body;\n const viewport = this._viewportRuler.getViewportSize();\n return body.scrollHeight > viewport.height || body.scrollWidth > viewport.width;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Returns an error to be thrown when attempting to attach an already-attached scroll strategy.\n */\nfunction getMatScrollStrategyAlreadyAttachedError() {\n return Error(`Scroll strategy has already been attached.`);\n}\n\n/**\n * Strategy that will close the overlay as soon as the user starts scrolling.\n */\nclass CloseScrollStrategy {\n constructor(_scrollDispatcher, _ngZone, _viewportRuler, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._ngZone = _ngZone;\n this._viewportRuler = _viewportRuler;\n this._config = _config;\n this._scrollSubscription = null;\n /** Detaches the overlay ref and disables the scroll strategy. */\n this._detach = () => {\n this.disable();\n if (this._overlayRef.hasAttached()) {\n this._ngZone.run(() => this._overlayRef.detach());\n }\n };\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables the closing of the attached overlay on scroll. */\n enable() {\n if (this._scrollSubscription) {\n return;\n }\n const stream = this._scrollDispatcher.scrolled(0).pipe(filter(scrollable => {\n return (!scrollable ||\n !this._overlayRef.overlayElement.contains(scrollable.getElementRef().nativeElement));\n }));\n if (this._config && this._config.threshold && this._config.threshold > 1) {\n this._initialScrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n this._scrollSubscription = stream.subscribe(() => {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition().top;\n if (Math.abs(scrollPosition - this._initialScrollPosition) > this._config.threshold) {\n this._detach();\n }\n else {\n this._overlayRef.updatePosition();\n }\n });\n }\n else {\n this._scrollSubscription = stream.subscribe(this._detach);\n }\n }\n /** Disables the closing the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Scroll strategy that doesn't do anything. */\nclass NoopScrollStrategy {\n /** Does nothing, as this scroll strategy is a no-op. */\n enable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n disable() { }\n /** Does nothing, as this scroll strategy is a no-op. */\n attach() { }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Gets whether an element is scrolled outside of view by any of its parent scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is scrolled out of view\n * @docs-private\n */\nfunction isElementScrolledOutsideView(element, scrollContainers) {\n return scrollContainers.some(containerBounds => {\n const outsideAbove = element.bottom < containerBounds.top;\n const outsideBelow = element.top > containerBounds.bottom;\n const outsideLeft = element.right < containerBounds.left;\n const outsideRight = element.left > containerBounds.right;\n return outsideAbove || outsideBelow || outsideLeft || outsideRight;\n });\n}\n/**\n * Gets whether an element is clipped by any of its scrolling containers.\n * @param element Dimensions of the element (from getBoundingClientRect)\n * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect)\n * @returns Whether the element is clipped\n * @docs-private\n */\nfunction isElementClippedByScrolling(element, scrollContainers) {\n return scrollContainers.some(scrollContainerRect => {\n const clippedAbove = element.top < scrollContainerRect.top;\n const clippedBelow = element.bottom > scrollContainerRect.bottom;\n const clippedLeft = element.left < scrollContainerRect.left;\n const clippedRight = element.right > scrollContainerRect.right;\n return clippedAbove || clippedBelow || clippedLeft || clippedRight;\n });\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Strategy that will update the element position as the user is scrolling.\n */\nclass RepositionScrollStrategy {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, _config) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n this._config = _config;\n this._scrollSubscription = null;\n }\n /** Attaches this scroll strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw getMatScrollStrategyAlreadyAttachedError();\n }\n this._overlayRef = overlayRef;\n }\n /** Enables repositioning of the attached overlay on scroll. */\n enable() {\n if (!this._scrollSubscription) {\n const throttle = this._config ? this._config.scrollThrottle : 0;\n this._scrollSubscription = this._scrollDispatcher.scrolled(throttle).subscribe(() => {\n this._overlayRef.updatePosition();\n // TODO(crisbeto): make `close` on by default once all components can handle it.\n if (this._config && this._config.autoClose) {\n const overlayRect = this._overlayRef.overlayElement.getBoundingClientRect();\n const { width, height } = this._viewportRuler.getViewportSize();\n // TODO(crisbeto): include all ancestor scroll containers here once\n // we have a way of exposing the trigger element to the scroll strategy.\n const parentRects = [{ width, height, bottom: height, right: width, top: 0, left: 0 }];\n if (isElementScrolledOutsideView(overlayRect, parentRects)) {\n this.disable();\n this._ngZone.run(() => this._overlayRef.detach());\n }\n }\n });\n }\n }\n /** Disables repositioning of the attached overlay on scroll. */\n disable() {\n if (this._scrollSubscription) {\n this._scrollSubscription.unsubscribe();\n this._scrollSubscription = null;\n }\n }\n detach() {\n this.disable();\n this._overlayRef = null;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Options for how an overlay will handle scrolling.\n *\n * Users can provide a custom value for `ScrollStrategyOptions` to replace the default\n * behaviors. This class primarily acts as a factory for ScrollStrategy instances.\n */\nclass ScrollStrategyOptions {\n constructor(_scrollDispatcher, _viewportRuler, _ngZone, document) {\n this._scrollDispatcher = _scrollDispatcher;\n this._viewportRuler = _viewportRuler;\n this._ngZone = _ngZone;\n /** Do nothing on scroll. */\n this.noop = () => new NoopScrollStrategy();\n /**\n * Close the overlay as soon as the user scrolls.\n * @param config Configuration to be used inside the scroll strategy.\n */\n this.close = (config) => new CloseScrollStrategy(this._scrollDispatcher, this._ngZone, this._viewportRuler, config);\n /** Block scrolling. */\n this.block = () => new BlockScrollStrategy(this._viewportRuler, this._document);\n /**\n * Update the overlay's position on scroll.\n * @param config Configuration to be used inside the scroll strategy.\n * Allows debouncing the reposition calls.\n */\n this.reposition = (config) => new RepositionScrollStrategy(this._scrollDispatcher, this._viewportRuler, this._ngZone, config);\n this._document = document;\n }\n}\nScrollStrategyOptions.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollStrategyOptions, deps: [{ token: i1.ScrollDispatcher }, { token: i1.ViewportRuler }, { token: i0.NgZone }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nScrollStrategyOptions.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollStrategyOptions, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollStrategyOptions, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.ScrollDispatcher }, { type: i1.ViewportRuler }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Initial configuration used when creating an overlay. */\nclass OverlayConfig {\n constructor(config) {\n /** Strategy to be used when handling scroll events while the overlay is open. */\n this.scrollStrategy = new NoopScrollStrategy();\n /** Custom class to add to the overlay pane. */\n this.panelClass = '';\n /** Whether the overlay has a backdrop. */\n this.hasBackdrop = false;\n /** Custom class to add to the backdrop */\n this.backdropClass = 'cdk-overlay-dark-backdrop';\n /**\n * Whether the overlay should be disposed of when the user goes backwards/forwards in history.\n * Note that this usually doesn't include clicking on links (unless the user is using\n * the `HashLocationStrategy`).\n */\n this.disposeOnNavigation = false;\n if (config) {\n // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3,\n // loses the array generic type in the `for of`. But we *also* have to use `Array` because\n // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration`\n const configKeys = Object.keys(config);\n for (const key of configKeys) {\n if (config[key] !== undefined) {\n // TypeScript, as of version 3.5, sees the left-hand-side of this expression\n // as \"I don't know *which* key this is, so the only valid value is the intersection\n // of all the possible values.\" In this case, that happens to be `undefined`. TypeScript\n // is not smart enough to see that the right-hand-side is actually an access of the same\n // exact type with the same exact key, meaning that the value type must be identical.\n // So we use `any` to work around this.\n this[key] = config[key];\n }\n }\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The points of the origin element and the overlay element to connect. */\nclass ConnectionPositionPair {\n constructor(origin, overlay, \n /** Offset along the X axis. */\n offsetX, \n /** Offset along the Y axis. */\n offsetY, \n /** Class(es) to be applied to the panel while this position is active. */\n panelClass) {\n this.offsetX = offsetX;\n this.offsetY = offsetY;\n this.panelClass = panelClass;\n this.originX = origin.originX;\n this.originY = origin.originY;\n this.overlayX = overlay.overlayX;\n this.overlayY = overlay.overlayY;\n }\n}\n/**\n * Set of properties regarding the position of the origin and overlay relative to the viewport\n * with respect to the containing Scrollable elements.\n *\n * The overlay and origin are clipped if any part of their bounding client rectangle exceeds the\n * bounds of any one of the strategy's Scrollable's bounding client rectangle.\n *\n * The overlay and origin are outside view if there is no overlap between their bounding client\n * rectangle and any one of the strategy's Scrollable's bounding client rectangle.\n *\n * ----------- -----------\n * | outside | | clipped |\n * | view | --------------------------\n * | | | | | |\n * ---------- | ----------- |\n * -------------------------- | |\n * | | | Scrollable |\n * | | | |\n * | | --------------------------\n * | Scrollable |\n * | |\n * --------------------------\n *\n * @docs-private\n */\nclass ScrollingVisibility {\n}\n/** The change event emitted by the strategy when a fallback position is used. */\nclass ConnectedOverlayPositionChange {\n constructor(\n /** The position used as a result of this change. */\n connectionPair, \n /** @docs-private */\n scrollableViewProperties) {\n this.connectionPair = connectionPair;\n this.scrollableViewProperties = scrollableViewProperties;\n }\n}\n/**\n * Validates whether a vertical position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateVerticalPosition(property, value) {\n if (value !== 'top' && value !== 'bottom' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"top\", \"bottom\" or \"center\".`);\n }\n}\n/**\n * Validates whether a horizontal position property matches the expected values.\n * @param property Name of the property being validated.\n * @param value Value of the property being validated.\n * @docs-private\n */\nfunction validateHorizontalPosition(property, value) {\n if (value !== 'start' && value !== 'end' && value !== 'center') {\n throw Error(`ConnectedPosition: Invalid ${property} \"${value}\". ` +\n `Expected \"start\", \"end\" or \"center\".`);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass BaseOverlayDispatcher {\n constructor(document) {\n /** Currently attached overlays in the order they were attached. */\n this._attachedOverlays = [];\n this._document = document;\n }\n ngOnDestroy() {\n this.detach();\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n // Ensure that we don't get the same overlay multiple times.\n this.remove(overlayRef);\n this._attachedOverlays.push(overlayRef);\n }\n /** Remove an overlay from the list of attached overlay refs. */\n remove(overlayRef) {\n const index = this._attachedOverlays.indexOf(overlayRef);\n if (index > -1) {\n this._attachedOverlays.splice(index, 1);\n }\n // Remove the global listener once there are no more overlays.\n if (this._attachedOverlays.length === 0) {\n this.detach();\n }\n }\n}\nBaseOverlayDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BaseOverlayDispatcher, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBaseOverlayDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BaseOverlayDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: BaseOverlayDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching keyboard events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayKeyboardDispatcher extends BaseOverlayDispatcher {\n constructor(document, \n /** @breaking-change 14.0.0 _ngZone will be required. */\n _ngZone) {\n super(document);\n this._ngZone = _ngZone;\n /** Keyboard event listener that will be attached to the body. */\n this._keydownListener = (event) => {\n const overlays = this._attachedOverlays;\n for (let i = overlays.length - 1; i > -1; i--) {\n // Dispatch the keydown event to the top overlay which has subscribers to its keydown events.\n // We want to target the most recent overlay, rather than trying to match where the event came\n // from, because some components might open an overlay, but keep focus on a trigger element\n // (e.g. for select and autocomplete). We skip overlays without keydown event subscriptions,\n // because we don't want overlays that don't handle keyboard events to block the ones below\n // them that do.\n if (overlays[i]._keydownEvents.observers.length > 0) {\n const keydownEvents = overlays[i]._keydownEvents;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.run(() => keydownEvents.next(event));\n }\n else {\n keydownEvents.next(event);\n }\n break;\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Lazily start dispatcher once first overlay is added\n if (!this._isAttached) {\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.runOutsideAngular(() => this._document.body.addEventListener('keydown', this._keydownListener));\n }\n else {\n this._document.body.addEventListener('keydown', this._keydownListener);\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n this._document.body.removeEventListener('keydown', this._keydownListener);\n this._isAttached = false;\n }\n }\n}\nOverlayKeyboardDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayKeyboardDispatcher, deps: [{ token: DOCUMENT }, { token: i0.NgZone, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayKeyboardDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayKeyboardDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayKeyboardDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i0.NgZone, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Service for dispatching mouse click events that land on the body to appropriate overlay ref,\n * if any. It maintains a list of attached overlays to determine best suited overlay based\n * on event target and order of overlay opens.\n */\nclass OverlayOutsideClickDispatcher extends BaseOverlayDispatcher {\n constructor(document, _platform, \n /** @breaking-change 14.0.0 _ngZone will be required. */\n _ngZone) {\n super(document);\n this._platform = _platform;\n this._ngZone = _ngZone;\n this._cursorStyleIsSet = false;\n /** Store pointerdown event target to track origin of click. */\n this._pointerDownListener = (event) => {\n this._pointerDownEventTarget = _getEventTarget(event);\n };\n /** Click event listener that will be attached to the body propagate phase. */\n this._clickListener = (event) => {\n const target = _getEventTarget(event);\n // In case of a click event, we want to check the origin of the click\n // (e.g. in case where a user starts a click inside the overlay and\n // releases the click outside of it).\n // This is done by using the event target of the preceding pointerdown event.\n // Every click event caused by a pointer device has a preceding pointerdown\n // event, unless the click was programmatically triggered (e.g. in a unit test).\n const origin = event.type === 'click' && this._pointerDownEventTarget\n ? this._pointerDownEventTarget\n : target;\n // Reset the stored pointerdown event target, to avoid having it interfere\n // in subsequent events.\n this._pointerDownEventTarget = null;\n // We copy the array because the original may be modified asynchronously if the\n // outsidePointerEvents listener decides to detach overlays resulting in index errors inside\n // the for loop.\n const overlays = this._attachedOverlays.slice();\n // Dispatch the mouse event to the top overlay which has subscribers to its mouse events.\n // We want to target all overlays for which the click could be considered as outside click.\n // As soon as we reach an overlay for which the click is not outside click we break off\n // the loop.\n for (let i = overlays.length - 1; i > -1; i--) {\n const overlayRef = overlays[i];\n if (overlayRef._outsidePointerEvents.observers.length < 1 || !overlayRef.hasAttached()) {\n continue;\n }\n // If it's a click inside the overlay, just break - we should do nothing\n // If it's an outside click (both origin and target of the click) dispatch the mouse event,\n // and proceed with the next overlay\n if (overlayRef.overlayElement.contains(target) ||\n overlayRef.overlayElement.contains(origin)) {\n break;\n }\n const outsidePointerEvents = overlayRef._outsidePointerEvents;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.run(() => outsidePointerEvents.next(event));\n }\n else {\n outsidePointerEvents.next(event);\n }\n }\n };\n }\n /** Add a new overlay to the list of attached overlay refs. */\n add(overlayRef) {\n super.add(overlayRef);\n // Safari on iOS does not generate click events for non-interactive\n // elements. However, we want to receive a click for any element outside\n // the overlay. We can force a \"clickable\" state by setting\n // `cursor: pointer` on the document body. See:\n // https://developer.mozilla.org/en-US/docs/Web/API/Element/click_event#Safari_Mobile\n // https://developer.apple.com/library/archive/documentation/AppleApplications/Reference/SafariWebContent/HandlingEvents/HandlingEvents.html\n if (!this._isAttached) {\n const body = this._document.body;\n /** @breaking-change 14.0.0 _ngZone will be required. */\n if (this._ngZone) {\n this._ngZone.runOutsideAngular(() => this._addEventListeners(body));\n }\n else {\n this._addEventListeners(body);\n }\n // click event is not fired on iOS. To make element \"clickable\" we are\n // setting the cursor to pointer\n if (this._platform.IOS && !this._cursorStyleIsSet) {\n this._cursorOriginalValue = body.style.cursor;\n body.style.cursor = 'pointer';\n this._cursorStyleIsSet = true;\n }\n this._isAttached = true;\n }\n }\n /** Detaches the global keyboard event listener. */\n detach() {\n if (this._isAttached) {\n const body = this._document.body;\n body.removeEventListener('pointerdown', this._pointerDownListener, true);\n body.removeEventListener('click', this._clickListener, true);\n body.removeEventListener('auxclick', this._clickListener, true);\n body.removeEventListener('contextmenu', this._clickListener, true);\n if (this._platform.IOS && this._cursorStyleIsSet) {\n body.style.cursor = this._cursorOriginalValue;\n this._cursorStyleIsSet = false;\n }\n this._isAttached = false;\n }\n }\n _addEventListeners(body) {\n body.addEventListener('pointerdown', this._pointerDownListener, true);\n body.addEventListener('click', this._clickListener, true);\n body.addEventListener('auxclick', this._clickListener, true);\n body.addEventListener('contextmenu', this._clickListener, true);\n }\n}\nOverlayOutsideClickDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }, { token: i0.NgZone, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayOutsideClickDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayOutsideClickDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }, { type: i0.NgZone, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Container inside which all overlays will render. */\nclass OverlayContainer {\n constructor(document, _platform) {\n this._platform = _platform;\n this._document = document;\n }\n ngOnDestroy() {\n this._containerElement?.remove();\n }\n /**\n * This method returns the overlay container element. It will lazily\n * create the element the first time it is called to facilitate using\n * the container in non-browser environments.\n * @returns the container element\n */\n getContainerElement() {\n if (!this._containerElement) {\n this._createContainer();\n }\n return this._containerElement;\n }\n /**\n * Create the overlay container element, which is simply a div\n * with the 'cdk-overlay-container' class on the document body.\n */\n _createContainer() {\n const containerClass = 'cdk-overlay-container';\n // TODO(crisbeto): remove the testing check once we have an overlay testing\n // module or Angular starts tearing down the testing `NgModule`. See:\n // https://github.com/angular/angular/issues/18831\n if (this._platform.isBrowser || _isTestEnvironment()) {\n const oppositePlatformContainers = this._document.querySelectorAll(`.${containerClass}[platform=\"server\"], ` + `.${containerClass}[platform=\"test\"]`);\n // Remove any old containers from the opposite platform.\n // This can happen when transitioning from the server to the client.\n for (let i = 0; i < oppositePlatformContainers.length; i++) {\n oppositePlatformContainers[i].remove();\n }\n }\n const container = this._document.createElement('div');\n container.classList.add(containerClass);\n // A long time ago we kept adding new overlay containers whenever a new app was instantiated,\n // but at some point we added logic which clears the duplicate ones in order to avoid leaks.\n // The new logic was a little too aggressive since it was breaking some legitimate use cases.\n // To mitigate the problem we made it so that only containers from a different platform are\n // cleared, but the side-effect was that people started depending on the overly-aggressive\n // logic to clean up their tests for them. Until we can introduce an overlay-specific testing\n // module which does the cleanup, we try to detect that we're in a test environment and we\n // always clear the container. See #17006.\n // TODO(crisbeto): remove the test environment check once we have an overlay testing module.\n if (_isTestEnvironment()) {\n container.setAttribute('platform', 'test');\n }\n else if (!this._platform.isBrowser) {\n container.setAttribute('platform', 'server');\n }\n this._document.body.appendChild(container);\n this._containerElement = container;\n }\n}\nOverlayContainer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayContainer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayContainer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Reference to an overlay that has been created with the Overlay service.\n * Used to manipulate or dispose of said overlay.\n */\nclass OverlayRef {\n constructor(_portalOutlet, _host, _pane, _config, _ngZone, _keyboardDispatcher, _document, _location, _outsideClickDispatcher, _animationsDisabled = false) {\n this._portalOutlet = _portalOutlet;\n this._host = _host;\n this._pane = _pane;\n this._config = _config;\n this._ngZone = _ngZone;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._document = _document;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n this._animationsDisabled = _animationsDisabled;\n this._backdropElement = null;\n this._backdropClick = new Subject();\n this._attachments = new Subject();\n this._detachments = new Subject();\n this._locationChanges = Subscription.EMPTY;\n this._backdropClickHandler = (event) => this._backdropClick.next(event);\n this._backdropTransitionendHandler = (event) => {\n this._disposeBackdrop(event.target);\n };\n /** Stream of keydown events dispatched to this overlay. */\n this._keydownEvents = new Subject();\n /** Stream of mouse outside events dispatched to this overlay. */\n this._outsidePointerEvents = new Subject();\n if (_config.scrollStrategy) {\n this._scrollStrategy = _config.scrollStrategy;\n this._scrollStrategy.attach(this);\n }\n this._positionStrategy = _config.positionStrategy;\n }\n /** The overlay's HTML element */\n get overlayElement() {\n return this._pane;\n }\n /** The overlay's backdrop HTML element. */\n get backdropElement() {\n return this._backdropElement;\n }\n /**\n * Wrapper around the panel element. Can be used for advanced\n * positioning where a wrapper with specific styling is\n * required around the overlay pane.\n */\n get hostElement() {\n return this._host;\n }\n /**\n * Attaches content, given via a Portal, to the overlay.\n * If the overlay is configured to have a backdrop, it will be created.\n *\n * @param portal Portal instance to which to attach the overlay.\n * @returns The portal attachment result.\n */\n attach(portal) {\n // Insert the host into the DOM before attaching the portal, otherwise\n // the animations module will skip animations on repeat attachments.\n if (!this._host.parentElement && this._previousHostParent) {\n this._previousHostParent.appendChild(this._host);\n }\n const attachResult = this._portalOutlet.attach(portal);\n if (this._positionStrategy) {\n this._positionStrategy.attach(this);\n }\n this._updateStackingOrder();\n this._updateElementSize();\n this._updateElementDirection();\n if (this._scrollStrategy) {\n this._scrollStrategy.enable();\n }\n // Update the position once the zone is stable so that the overlay will be fully rendered\n // before attempting to position it, as the position may depend on the size of the rendered\n // content.\n this._ngZone.onStable.pipe(take(1)).subscribe(() => {\n // The overlay could've been detached before the zone has stabilized.\n if (this.hasAttached()) {\n this.updatePosition();\n }\n });\n // Enable pointer events for the overlay pane element.\n this._togglePointerEvents(true);\n if (this._config.hasBackdrop) {\n this._attachBackdrop();\n }\n if (this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, true);\n }\n // Only emit the `attachments` event once all other setup is done.\n this._attachments.next();\n // Track this overlay by the keyboard dispatcher\n this._keyboardDispatcher.add(this);\n if (this._config.disposeOnNavigation) {\n this._locationChanges = this._location.subscribe(() => this.dispose());\n }\n this._outsideClickDispatcher.add(this);\n // TODO(crisbeto): the null check is here, because the portal outlet returns `any`.\n // We should be guaranteed for the result to be `ComponentRef | EmbeddedViewRef`, but\n // `instanceof EmbeddedViewRef` doesn't appear to work at the moment.\n if (typeof attachResult?.onDestroy === 'function') {\n // In most cases we control the portal and we know when it is being detached so that\n // we can finish the disposal process. The exception is if the user passes in a custom\n // `ViewContainerRef` that isn't destroyed through the overlay API. Note that we use\n // `detach` here instead of `dispose`, because we don't know if the user intends to\n // reattach the overlay at a later point. It also has the advantage of waiting for animations.\n attachResult.onDestroy(() => {\n if (this.hasAttached()) {\n // We have to delay the `detach` call, because detaching immediately prevents\n // other destroy hooks from running. This is likely a framework bug similar to\n // https://github.com/angular/angular/issues/46119\n this._ngZone.runOutsideAngular(() => Promise.resolve().then(() => this.detach()));\n }\n });\n }\n return attachResult;\n }\n /**\n * Detaches an overlay from a portal.\n * @returns The portal detachment result.\n */\n detach() {\n if (!this.hasAttached()) {\n return;\n }\n this.detachBackdrop();\n // When the overlay is detached, the pane element should disable pointer events.\n // This is necessary because otherwise the pane element will cover the page and disable\n // pointer events therefore. Depends on the position strategy and the applied pane boundaries.\n this._togglePointerEvents(false);\n if (this._positionStrategy && this._positionStrategy.detach) {\n this._positionStrategy.detach();\n }\n if (this._scrollStrategy) {\n this._scrollStrategy.disable();\n }\n const detachmentResult = this._portalOutlet.detach();\n // Only emit after everything is detached.\n this._detachments.next();\n // Remove this overlay from keyboard dispatcher tracking.\n this._keyboardDispatcher.remove(this);\n // Keeping the host element in the DOM can cause scroll jank, because it still gets\n // rendered, even though it's transparent and unclickable which is why we remove it.\n this._detachContentWhenStable();\n this._locationChanges.unsubscribe();\n this._outsideClickDispatcher.remove(this);\n return detachmentResult;\n }\n /** Cleans up the overlay from the DOM. */\n dispose() {\n const isAttached = this.hasAttached();\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._disposeScrollStrategy();\n this._disposeBackdrop(this._backdropElement);\n this._locationChanges.unsubscribe();\n this._keyboardDispatcher.remove(this);\n this._portalOutlet.dispose();\n this._attachments.complete();\n this._backdropClick.complete();\n this._keydownEvents.complete();\n this._outsidePointerEvents.complete();\n this._outsideClickDispatcher.remove(this);\n this._host?.remove();\n this._previousHostParent = this._pane = this._host = null;\n if (isAttached) {\n this._detachments.next();\n }\n this._detachments.complete();\n }\n /** Whether the overlay has attached content. */\n hasAttached() {\n return this._portalOutlet.hasAttached();\n }\n /** Gets an observable that emits when the backdrop has been clicked. */\n backdropClick() {\n return this._backdropClick;\n }\n /** Gets an observable that emits when the overlay has been attached. */\n attachments() {\n return this._attachments;\n }\n /** Gets an observable that emits when the overlay has been detached. */\n detachments() {\n return this._detachments;\n }\n /** Gets an observable of keydown events targeted to this overlay. */\n keydownEvents() {\n return this._keydownEvents;\n }\n /** Gets an observable of pointer events targeted outside this overlay. */\n outsidePointerEvents() {\n return this._outsidePointerEvents;\n }\n /** Gets the current overlay configuration, which is immutable. */\n getConfig() {\n return this._config;\n }\n /** Updates the position of the overlay based on the position strategy. */\n updatePosition() {\n if (this._positionStrategy) {\n this._positionStrategy.apply();\n }\n }\n /** Switches to a new position strategy and updates the overlay position. */\n updatePositionStrategy(strategy) {\n if (strategy === this._positionStrategy) {\n return;\n }\n if (this._positionStrategy) {\n this._positionStrategy.dispose();\n }\n this._positionStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n this.updatePosition();\n }\n }\n /** Update the size properties of the overlay. */\n updateSize(sizeConfig) {\n this._config = { ...this._config, ...sizeConfig };\n this._updateElementSize();\n }\n /** Sets the LTR/RTL direction for the overlay. */\n setDirection(dir) {\n this._config = { ...this._config, direction: dir };\n this._updateElementDirection();\n }\n /** Add a CSS class or an array of classes to the overlay pane. */\n addPanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, true);\n }\n }\n /** Remove a CSS class or an array of classes from the overlay pane. */\n removePanelClass(classes) {\n if (this._pane) {\n this._toggleClasses(this._pane, classes, false);\n }\n }\n /**\n * Returns the layout direction of the overlay panel.\n */\n getDirection() {\n const direction = this._config.direction;\n if (!direction) {\n return 'ltr';\n }\n return typeof direction === 'string' ? direction : direction.value;\n }\n /** Switches to a new scroll strategy. */\n updateScrollStrategy(strategy) {\n if (strategy === this._scrollStrategy) {\n return;\n }\n this._disposeScrollStrategy();\n this._scrollStrategy = strategy;\n if (this.hasAttached()) {\n strategy.attach(this);\n strategy.enable();\n }\n }\n /** Updates the text direction of the overlay panel. */\n _updateElementDirection() {\n this._host.setAttribute('dir', this.getDirection());\n }\n /** Updates the size of the overlay element based on the overlay config. */\n _updateElementSize() {\n if (!this._pane) {\n return;\n }\n const style = this._pane.style;\n style.width = coerceCssPixelValue(this._config.width);\n style.height = coerceCssPixelValue(this._config.height);\n style.minWidth = coerceCssPixelValue(this._config.minWidth);\n style.minHeight = coerceCssPixelValue(this._config.minHeight);\n style.maxWidth = coerceCssPixelValue(this._config.maxWidth);\n style.maxHeight = coerceCssPixelValue(this._config.maxHeight);\n }\n /** Toggles the pointer events for the overlay pane element. */\n _togglePointerEvents(enablePointer) {\n this._pane.style.pointerEvents = enablePointer ? '' : 'none';\n }\n /** Attaches a backdrop for this overlay. */\n _attachBackdrop() {\n const showingClass = 'cdk-overlay-backdrop-showing';\n this._backdropElement = this._document.createElement('div');\n this._backdropElement.classList.add('cdk-overlay-backdrop');\n if (this._animationsDisabled) {\n this._backdropElement.classList.add('cdk-overlay-backdrop-noop-animation');\n }\n if (this._config.backdropClass) {\n this._toggleClasses(this._backdropElement, this._config.backdropClass, true);\n }\n // Insert the backdrop before the pane in the DOM order,\n // in order to handle stacked overlays properly.\n this._host.parentElement.insertBefore(this._backdropElement, this._host);\n // Forward backdrop clicks such that the consumer of the overlay can perform whatever\n // action desired when such a click occurs (usually closing the overlay).\n this._backdropElement.addEventListener('click', this._backdropClickHandler);\n // Add class to fade-in the backdrop after one frame.\n if (!this._animationsDisabled && typeof requestAnimationFrame !== 'undefined') {\n this._ngZone.runOutsideAngular(() => {\n requestAnimationFrame(() => {\n if (this._backdropElement) {\n this._backdropElement.classList.add(showingClass);\n }\n });\n });\n }\n else {\n this._backdropElement.classList.add(showingClass);\n }\n }\n /**\n * Updates the stacking order of the element, moving it to the top if necessary.\n * This is required in cases where one overlay was detached, while another one,\n * that should be behind it, was destroyed. The next time both of them are opened,\n * the stacking will be wrong, because the detached element's pane will still be\n * in its original DOM position.\n */\n _updateStackingOrder() {\n if (this._host.nextSibling) {\n this._host.parentNode.appendChild(this._host);\n }\n }\n /** Detaches the backdrop (if any) associated with the overlay. */\n detachBackdrop() {\n const backdropToDetach = this._backdropElement;\n if (!backdropToDetach) {\n return;\n }\n if (this._animationsDisabled) {\n this._disposeBackdrop(backdropToDetach);\n return;\n }\n backdropToDetach.classList.remove('cdk-overlay-backdrop-showing');\n this._ngZone.runOutsideAngular(() => {\n backdropToDetach.addEventListener('transitionend', this._backdropTransitionendHandler);\n });\n // If the backdrop doesn't have a transition, the `transitionend` event won't fire.\n // In this case we make it unclickable and we try to remove it after a delay.\n backdropToDetach.style.pointerEvents = 'none';\n // Run this outside the Angular zone because there's nothing that Angular cares about.\n // If it were to run inside the Angular zone, every test that used Overlay would have to be\n // either async or fakeAsync.\n this._backdropTimeout = this._ngZone.runOutsideAngular(() => setTimeout(() => {\n this._disposeBackdrop(backdropToDetach);\n }, 500));\n }\n /** Toggles a single CSS class or an array of classes on an element. */\n _toggleClasses(element, cssClasses, isAdd) {\n const classes = coerceArray(cssClasses || []).filter(c => !!c);\n if (classes.length) {\n isAdd ? element.classList.add(...classes) : element.classList.remove(...classes);\n }\n }\n /** Detaches the overlay content next time the zone stabilizes. */\n _detachContentWhenStable() {\n // Normally we wouldn't have to explicitly run this outside the `NgZone`, however\n // if the consumer is using `zone-patch-rxjs`, the `Subscription.unsubscribe` call will\n // be patched to run inside the zone, which will throw us into an infinite loop.\n this._ngZone.runOutsideAngular(() => {\n // We can't remove the host here immediately, because the overlay pane's content\n // might still be animating. This stream helps us avoid interrupting the animation\n // by waiting for the pane to become empty.\n const subscription = this._ngZone.onStable\n .pipe(takeUntil(merge(this._attachments, this._detachments)))\n .subscribe(() => {\n // Needs a couple of checks for the pane and host, because\n // they may have been removed by the time the zone stabilizes.\n if (!this._pane || !this._host || this._pane.children.length === 0) {\n if (this._pane && this._config.panelClass) {\n this._toggleClasses(this._pane, this._config.panelClass, false);\n }\n if (this._host && this._host.parentElement) {\n this._previousHostParent = this._host.parentElement;\n this._host.remove();\n }\n subscription.unsubscribe();\n }\n });\n });\n }\n /** Disposes of a scroll strategy. */\n _disposeScrollStrategy() {\n const scrollStrategy = this._scrollStrategy;\n if (scrollStrategy) {\n scrollStrategy.disable();\n if (scrollStrategy.detach) {\n scrollStrategy.detach();\n }\n }\n }\n /** Removes a backdrop element from the DOM. */\n _disposeBackdrop(backdrop) {\n if (backdrop) {\n backdrop.removeEventListener('click', this._backdropClickHandler);\n backdrop.removeEventListener('transitionend', this._backdropTransitionendHandler);\n backdrop.remove();\n // It is possible that a new portal has been attached to this overlay since we started\n // removing the backdrop. If that is the case, only clear the backdrop reference if it\n // is still the same instance that we started to remove.\n if (this._backdropElement === backdrop) {\n this._backdropElement = null;\n }\n }\n if (this._backdropTimeout) {\n clearTimeout(this._backdropTimeout);\n this._backdropTimeout = undefined;\n }\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// TODO: refactor clipping detection into a separate thing (part of scrolling module)\n// TODO: doesn't handle both flexible width and height when it has to scroll along both axis.\n/** Class to be added to the overlay bounding box. */\nconst boundingBoxClass = 'cdk-overlay-connected-position-bounding-box';\n/** Regex used to split a string on its CSS units. */\nconst cssUnitPattern = /([A-Za-z%]+)$/;\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * implicit position relative some origin element. The relative position is defined in terms of\n * a point on the origin element that is connected to a point on the overlay element. For example,\n * a basic dropdown is connecting the bottom-left corner of the origin to the top-left corner\n * of the overlay.\n */\nclass FlexibleConnectedPositionStrategy {\n /** Ordered list of preferred positions, from most to least desirable. */\n get positions() {\n return this._preferredPositions;\n }\n constructor(connectedTo, _viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n /** Last size used for the bounding box. Used to avoid resizing the overlay after open. */\n this._lastBoundingBoxSize = { width: 0, height: 0 };\n /** Whether the overlay was pushed in a previous positioning. */\n this._isPushed = false;\n /** Whether the overlay can be pushed on-screen on the initial open. */\n this._canPush = true;\n /** Whether the overlay can grow via flexible width/height after the initial open. */\n this._growAfterOpen = false;\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n this._hasFlexibleDimensions = true;\n /** Whether the overlay position is locked. */\n this._positionLocked = false;\n /** Amount of space that must be maintained between the overlay and the edge of the viewport. */\n this._viewportMargin = 0;\n /** The Scrollable containers used to check scrollable view properties on position change. */\n this._scrollables = [];\n /** Ordered list of preferred positions, from most to least desirable. */\n this._preferredPositions = [];\n /** Subject that emits whenever the position changes. */\n this._positionChanges = new Subject();\n /** Subscription to viewport size changes. */\n this._resizeSubscription = Subscription.EMPTY;\n /** Default offset for the overlay along the x axis. */\n this._offsetX = 0;\n /** Default offset for the overlay along the y axis. */\n this._offsetY = 0;\n /** Keeps track of the CSS classes that the position strategy has applied on the overlay panel. */\n this._appliedPanelClasses = [];\n /** Observable sequence of position changes. */\n this.positionChanges = this._positionChanges;\n this.setOrigin(connectedTo);\n }\n /** Attaches this position strategy to an overlay. */\n attach(overlayRef) {\n if (this._overlayRef &&\n overlayRef !== this._overlayRef &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('This position strategy is already attached to an overlay');\n }\n this._validatePositions();\n overlayRef.hostElement.classList.add(boundingBoxClass);\n this._overlayRef = overlayRef;\n this._boundingBox = overlayRef.hostElement;\n this._pane = overlayRef.overlayElement;\n this._isDisposed = false;\n this._isInitialRender = true;\n this._lastPosition = null;\n this._resizeSubscription.unsubscribe();\n this._resizeSubscription = this._viewportRuler.change().subscribe(() => {\n // When the window is resized, we want to trigger the next reposition as if it\n // was an initial render, in order for the strategy to pick a new optimal position,\n // otherwise position locking will cause it to stay at the old one.\n this._isInitialRender = true;\n this.apply();\n });\n }\n /**\n * Updates the position of the overlay element, using whichever preferred position relative\n * to the origin best fits on-screen.\n *\n * The selection of a position goes as follows:\n * - If any positions fit completely within the viewport as-is,\n * choose the first position that does so.\n * - If flexible dimensions are enabled and at least one satisfies the given minimum width/height,\n * choose the position with the greatest available size modified by the positions' weight.\n * - If pushing is enabled, take the position that went off-screen the least and push it\n * on-screen.\n * - If none of the previous criteria were met, use the position that goes off-screen the least.\n * @docs-private\n */\n apply() {\n // We shouldn't do anything if the strategy was disposed or we're on the server.\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n // If the position has been applied already (e.g. when the overlay was opened) and the\n // consumer opted into locking in the position, re-use the old position, in order to\n // prevent the overlay from jumping around.\n if (!this._isInitialRender && this._positionLocked && this._lastPosition) {\n this.reapplyLastPosition();\n return;\n }\n this._clearPanelClasses();\n this._resetOverlayElementStyles();\n this._resetBoundingBoxStyles();\n // We need the bounding rects for the origin, the overlay and the container to determine how to position\n // the overlay relative to the origin.\n // We use the viewport rect to determine whether a position would go off-screen.\n this._viewportRect = this._getNarrowedViewportRect();\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const originRect = this._originRect;\n const overlayRect = this._overlayRect;\n const viewportRect = this._viewportRect;\n const containerRect = this._containerRect;\n // Positions where the overlay will fit with flexible dimensions.\n const flexibleFits = [];\n // Fallback if none of the preferred positions fit within the viewport.\n let fallback;\n // Go through each of the preferred positions looking for a good fit.\n // If a good fit is found, it will be applied immediately.\n for (let pos of this._preferredPositions) {\n // Get the exact (x, y) coordinate for the point-of-origin on the origin element.\n let originPoint = this._getOriginPoint(originRect, containerRect, pos);\n // From that point-of-origin, get the exact (x, y) coordinate for the top-left corner of the\n // overlay in this position. We use the top-left corner for calculations and later translate\n // this into an appropriate (top, left, bottom, right) style.\n let overlayPoint = this._getOverlayPoint(originPoint, overlayRect, pos);\n // Calculate how well the overlay would fit into the viewport with this point.\n let overlayFit = this._getOverlayFit(overlayPoint, overlayRect, viewportRect, pos);\n // If the overlay, without any further work, fits into the viewport, use this position.\n if (overlayFit.isCompletelyWithinViewport) {\n this._isPushed = false;\n this._applyPosition(pos, originPoint);\n return;\n }\n // If the overlay has flexible dimensions, we can use this position\n // so long as there's enough space for the minimum dimensions.\n if (this._canFitWithFlexibleDimensions(overlayFit, overlayPoint, viewportRect)) {\n // Save positions where the overlay will fit with flexible dimensions. We will use these\n // if none of the positions fit *without* flexible dimensions.\n flexibleFits.push({\n position: pos,\n origin: originPoint,\n overlayRect,\n boundingBoxRect: this._calculateBoundingBoxRect(originPoint, pos),\n });\n continue;\n }\n // If the current preferred position does not fit on the screen, remember the position\n // if it has more visible area on-screen than we've seen and move onto the next preferred\n // position.\n if (!fallback || fallback.overlayFit.visibleArea < overlayFit.visibleArea) {\n fallback = { overlayFit, overlayPoint, originPoint, position: pos, overlayRect };\n }\n }\n // If there are any positions where the overlay would fit with flexible dimensions, choose the\n // one that has the greatest area available modified by the position's weight\n if (flexibleFits.length) {\n let bestFit = null;\n let bestScore = -1;\n for (const fit of flexibleFits) {\n const score = fit.boundingBoxRect.width * fit.boundingBoxRect.height * (fit.position.weight || 1);\n if (score > bestScore) {\n bestScore = score;\n bestFit = fit;\n }\n }\n this._isPushed = false;\n this._applyPosition(bestFit.position, bestFit.origin);\n return;\n }\n // When none of the preferred positions fit within the viewport, take the position\n // that went off-screen the least and attempt to push it on-screen.\n if (this._canPush) {\n // TODO(jelbourn): after pushing, the opening \"direction\" of the overlay might not make sense.\n this._isPushed = true;\n this._applyPosition(fallback.position, fallback.originPoint);\n return;\n }\n // All options for getting the overlay within the viewport have been exhausted, so go with the\n // position that went off-screen the least.\n this._applyPosition(fallback.position, fallback.originPoint);\n }\n detach() {\n this._clearPanelClasses();\n this._lastPosition = null;\n this._previousPushAmount = null;\n this._resizeSubscription.unsubscribe();\n }\n /** Cleanup after the element gets destroyed. */\n dispose() {\n if (this._isDisposed) {\n return;\n }\n // We can't use `_resetBoundingBoxStyles` here, because it resets\n // some properties to zero, rather than removing them.\n if (this._boundingBox) {\n extendStyles(this._boundingBox.style, {\n top: '',\n left: '',\n right: '',\n bottom: '',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n if (this._pane) {\n this._resetOverlayElementStyles();\n }\n if (this._overlayRef) {\n this._overlayRef.hostElement.classList.remove(boundingBoxClass);\n }\n this.detach();\n this._positionChanges.complete();\n this._overlayRef = this._boundingBox = null;\n this._isDisposed = true;\n }\n /**\n * This re-aligns the overlay element with the trigger in its last calculated position,\n * even if a position higher in the \"preferred positions\" list would now fit. This\n * allows one to re-align the panel without changing the orientation of the panel.\n */\n reapplyLastPosition() {\n if (this._isDisposed || !this._platform.isBrowser) {\n return;\n }\n const lastPosition = this._lastPosition;\n if (lastPosition) {\n this._originRect = this._getOriginRect();\n this._overlayRect = this._pane.getBoundingClientRect();\n this._viewportRect = this._getNarrowedViewportRect();\n this._containerRect = this._overlayContainer.getContainerElement().getBoundingClientRect();\n const originPoint = this._getOriginPoint(this._originRect, this._containerRect, lastPosition);\n this._applyPosition(lastPosition, originPoint);\n }\n else {\n this.apply();\n }\n }\n /**\n * Sets the list of Scrollable containers that host the origin element so that\n * on reposition we can evaluate if it or the overlay has been clipped or outside view. Every\n * Scrollable must be an ancestor element of the strategy's origin element.\n */\n withScrollableContainers(scrollables) {\n this._scrollables = scrollables;\n return this;\n }\n /**\n * Adds new preferred positions.\n * @param positions List of positions options for this overlay.\n */\n withPositions(positions) {\n this._preferredPositions = positions;\n // If the last calculated position object isn't part of the positions anymore, clear\n // it in order to avoid it being picked up if the consumer tries to re-apply.\n if (positions.indexOf(this._lastPosition) === -1) {\n this._lastPosition = null;\n }\n this._validatePositions();\n return this;\n }\n /**\n * Sets a minimum distance the overlay may be positioned to the edge of the viewport.\n * @param margin Required margin between the overlay and the viewport edge in pixels.\n */\n withViewportMargin(margin) {\n this._viewportMargin = margin;\n return this;\n }\n /** Sets whether the overlay's width and height can be constrained to fit within the viewport. */\n withFlexibleDimensions(flexibleDimensions = true) {\n this._hasFlexibleDimensions = flexibleDimensions;\n return this;\n }\n /** Sets whether the overlay can grow after the initial open via flexible width/height. */\n withGrowAfterOpen(growAfterOpen = true) {\n this._growAfterOpen = growAfterOpen;\n return this;\n }\n /** Sets whether the overlay can be pushed on-screen if none of the provided positions fit. */\n withPush(canPush = true) {\n this._canPush = canPush;\n return this;\n }\n /**\n * Sets whether the overlay's position should be locked in after it is positioned\n * initially. When an overlay is locked in, it won't attempt to reposition itself\n * when the position is re-applied (e.g. when the user scrolls away).\n * @param isLocked Whether the overlay should locked in.\n */\n withLockedPosition(isLocked = true) {\n this._positionLocked = isLocked;\n return this;\n }\n /**\n * Sets the origin, relative to which to position the overlay.\n * Using an element origin is useful for building components that need to be positioned\n * relatively to a trigger (e.g. dropdown menus or tooltips), whereas using a point can be\n * used for cases like contextual menus which open relative to the user's pointer.\n * @param origin Reference to the new origin.\n */\n setOrigin(origin) {\n this._origin = origin;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the x-axis.\n * @param offset New offset in the X axis.\n */\n withDefaultOffsetX(offset) {\n this._offsetX = offset;\n return this;\n }\n /**\n * Sets the default offset for the overlay's connection point on the y-axis.\n * @param offset New offset in the Y axis.\n */\n withDefaultOffsetY(offset) {\n this._offsetY = offset;\n return this;\n }\n /**\n * Configures that the position strategy should set a `transform-origin` on some elements\n * inside the overlay, depending on the current position that is being applied. This is\n * useful for the cases where the origin of an animation can change depending on the\n * alignment of the overlay.\n * @param selector CSS selector that will be used to find the target\n * elements onto which to set the transform origin.\n */\n withTransformOriginOn(selector) {\n this._transformOriginSelector = selector;\n return this;\n }\n /**\n * Gets the (x, y) coordinate of a connection point on the origin based on a relative position.\n */\n _getOriginPoint(originRect, containerRect, pos) {\n let x;\n if (pos.originX == 'center') {\n // Note: when centering we should always use the `left`\n // offset, otherwise the position will be wrong in RTL.\n x = originRect.left + originRect.width / 2;\n }\n else {\n const startX = this._isRtl() ? originRect.right : originRect.left;\n const endX = this._isRtl() ? originRect.left : originRect.right;\n x = pos.originX == 'start' ? startX : endX;\n }\n // When zooming in Safari the container rectangle contains negative values for the position\n // and we need to re-add them to the calculated coordinates.\n if (containerRect.left < 0) {\n x -= containerRect.left;\n }\n let y;\n if (pos.originY == 'center') {\n y = originRect.top + originRect.height / 2;\n }\n else {\n y = pos.originY == 'top' ? originRect.top : originRect.bottom;\n }\n // Normally the containerRect's top value would be zero, however when the overlay is attached to an input\n // (e.g. in an autocomplete), mobile browsers will shift everything in order to put the input in the middle\n // of the screen and to make space for the virtual keyboard. We need to account for this offset,\n // otherwise our positioning will be thrown off.\n // Additionally, when zooming in Safari this fixes the vertical position.\n if (containerRect.top < 0) {\n y -= containerRect.top;\n }\n return { x, y };\n }\n /**\n * Gets the (x, y) coordinate of the top-left corner of the overlay given a given position and\n * origin point to which the overlay should be connected.\n */\n _getOverlayPoint(originPoint, overlayRect, pos) {\n // Calculate the (overlayStartX, overlayStartY), the start of the\n // potential overlay position relative to the origin point.\n let overlayStartX;\n if (pos.overlayX == 'center') {\n overlayStartX = -overlayRect.width / 2;\n }\n else if (pos.overlayX === 'start') {\n overlayStartX = this._isRtl() ? -overlayRect.width : 0;\n }\n else {\n overlayStartX = this._isRtl() ? 0 : -overlayRect.width;\n }\n let overlayStartY;\n if (pos.overlayY == 'center') {\n overlayStartY = -overlayRect.height / 2;\n }\n else {\n overlayStartY = pos.overlayY == 'top' ? 0 : -overlayRect.height;\n }\n // The (x, y) coordinates of the overlay.\n return {\n x: originPoint.x + overlayStartX,\n y: originPoint.y + overlayStartY,\n };\n }\n /** Gets how well an overlay at the given point will fit within the viewport. */\n _getOverlayFit(point, rawOverlayRect, viewport, position) {\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n let { x, y } = point;\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n // Account for the offsets since they could push the overlay out of the viewport.\n if (offsetX) {\n x += offsetX;\n }\n if (offsetY) {\n y += offsetY;\n }\n // How much the overlay would overflow at this position, on each side.\n let leftOverflow = 0 - x;\n let rightOverflow = x + overlay.width - viewport.width;\n let topOverflow = 0 - y;\n let bottomOverflow = y + overlay.height - viewport.height;\n // Visible parts of the element on each axis.\n let visibleWidth = this._subtractOverflows(overlay.width, leftOverflow, rightOverflow);\n let visibleHeight = this._subtractOverflows(overlay.height, topOverflow, bottomOverflow);\n let visibleArea = visibleWidth * visibleHeight;\n return {\n visibleArea,\n isCompletelyWithinViewport: overlay.width * overlay.height === visibleArea,\n fitsInViewportVertically: visibleHeight === overlay.height,\n fitsInViewportHorizontally: visibleWidth == overlay.width,\n };\n }\n /**\n * Whether the overlay can fit within the viewport when it may resize either its width or height.\n * @param fit How well the overlay fits in the viewport at some position.\n * @param point The (x, y) coordinates of the overlay at some position.\n * @param viewport The geometry of the viewport.\n */\n _canFitWithFlexibleDimensions(fit, point, viewport) {\n if (this._hasFlexibleDimensions) {\n const availableHeight = viewport.bottom - point.y;\n const availableWidth = viewport.right - point.x;\n const minHeight = getPixelValue(this._overlayRef.getConfig().minHeight);\n const minWidth = getPixelValue(this._overlayRef.getConfig().minWidth);\n const verticalFit = fit.fitsInViewportVertically || (minHeight != null && minHeight <= availableHeight);\n const horizontalFit = fit.fitsInViewportHorizontally || (minWidth != null && minWidth <= availableWidth);\n return verticalFit && horizontalFit;\n }\n return false;\n }\n /**\n * Gets the point at which the overlay can be \"pushed\" on-screen. If the overlay is larger than\n * the viewport, the top-left corner will be pushed on-screen (with overflow occurring on the\n * right and bottom).\n *\n * @param start Starting point from which the overlay is pushed.\n * @param rawOverlayRect Dimensions of the overlay.\n * @param scrollPosition Current viewport scroll position.\n * @returns The point at which to position the overlay after pushing. This is effectively a new\n * originPoint.\n */\n _pushOverlayOnScreen(start, rawOverlayRect, scrollPosition) {\n // If the position is locked and we've pushed the overlay already, reuse the previous push\n // amount, rather than pushing it again. If we were to continue pushing, the element would\n // remain in the viewport, which goes against the expectations when position locking is enabled.\n if (this._previousPushAmount && this._positionLocked) {\n return {\n x: start.x + this._previousPushAmount.x,\n y: start.y + this._previousPushAmount.y,\n };\n }\n // Round the overlay rect when comparing against the\n // viewport, because the viewport is always rounded.\n const overlay = getRoundedBoundingClientRect(rawOverlayRect);\n const viewport = this._viewportRect;\n // Determine how much the overlay goes outside the viewport on each\n // side, which we'll use to decide which direction to push it.\n const overflowRight = Math.max(start.x + overlay.width - viewport.width, 0);\n const overflowBottom = Math.max(start.y + overlay.height - viewport.height, 0);\n const overflowTop = Math.max(viewport.top - scrollPosition.top - start.y, 0);\n const overflowLeft = Math.max(viewport.left - scrollPosition.left - start.x, 0);\n // Amount by which to push the overlay in each axis such that it remains on-screen.\n let pushX = 0;\n let pushY = 0;\n // If the overlay fits completely within the bounds of the viewport, push it from whichever\n // direction is goes off-screen. Otherwise, push the top-left corner such that its in the\n // viewport and allow for the trailing end of the overlay to go out of bounds.\n if (overlay.width <= viewport.width) {\n pushX = overflowLeft || -overflowRight;\n }\n else {\n pushX = start.x < this._viewportMargin ? viewport.left - scrollPosition.left - start.x : 0;\n }\n if (overlay.height <= viewport.height) {\n pushY = overflowTop || -overflowBottom;\n }\n else {\n pushY = start.y < this._viewportMargin ? viewport.top - scrollPosition.top - start.y : 0;\n }\n this._previousPushAmount = { x: pushX, y: pushY };\n return {\n x: start.x + pushX,\n y: start.y + pushY,\n };\n }\n /**\n * Applies a computed position to the overlay and emits a position change.\n * @param position The position preference\n * @param originPoint The point on the origin element where the overlay is connected.\n */\n _applyPosition(position, originPoint) {\n this._setTransformOrigin(position);\n this._setOverlayElementStyles(originPoint, position);\n this._setBoundingBoxStyles(originPoint, position);\n if (position.panelClass) {\n this._addPanelClasses(position.panelClass);\n }\n // Save the last connected position in case the position needs to be re-calculated.\n this._lastPosition = position;\n // Notify that the position has been changed along with its change properties.\n // We only emit if we've got any subscriptions, because the scroll visibility\n // calculations can be somewhat expensive.\n if (this._positionChanges.observers.length) {\n const scrollableViewProperties = this._getScrollVisibility();\n const changeEvent = new ConnectedOverlayPositionChange(position, scrollableViewProperties);\n this._positionChanges.next(changeEvent);\n }\n this._isInitialRender = false;\n }\n /** Sets the transform origin based on the configured selector and the passed-in position. */\n _setTransformOrigin(position) {\n if (!this._transformOriginSelector) {\n return;\n }\n const elements = this._boundingBox.querySelectorAll(this._transformOriginSelector);\n let xOrigin;\n let yOrigin = position.overlayY;\n if (position.overlayX === 'center') {\n xOrigin = 'center';\n }\n else if (this._isRtl()) {\n xOrigin = position.overlayX === 'start' ? 'right' : 'left';\n }\n else {\n xOrigin = position.overlayX === 'start' ? 'left' : 'right';\n }\n for (let i = 0; i < elements.length; i++) {\n elements[i].style.transformOrigin = `${xOrigin} ${yOrigin}`;\n }\n }\n /**\n * Gets the position and size of the overlay's sizing container.\n *\n * This method does no measuring and applies no styles so that we can cheaply compute the\n * bounds for all positions and choose the best fit based on these results.\n */\n _calculateBoundingBoxRect(origin, position) {\n const viewport = this._viewportRect;\n const isRtl = this._isRtl();\n let height, top, bottom;\n if (position.overlayY === 'top') {\n // Overlay is opening \"downward\" and thus is bound by the bottom viewport edge.\n top = origin.y;\n height = viewport.height - top + this._viewportMargin;\n }\n else if (position.overlayY === 'bottom') {\n // Overlay is opening \"upward\" and thus is bound by the top viewport edge. We need to add\n // the viewport margin back in, because the viewport rect is narrowed down to remove the\n // margin, whereas the `origin` position is calculated based on its `ClientRect`.\n bottom = viewport.height - origin.y + this._viewportMargin * 2;\n height = viewport.height - bottom + this._viewportMargin;\n }\n else {\n // If neither top nor bottom, it means that the overlay is vertically centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.bottom - origin.y` and\n // `origin.y - viewport.top`.\n const smallestDistanceToViewportEdge = Math.min(viewport.bottom - origin.y + viewport.top, origin.y);\n const previousHeight = this._lastBoundingBoxSize.height;\n height = smallestDistanceToViewportEdge * 2;\n top = origin.y - smallestDistanceToViewportEdge;\n if (height > previousHeight && !this._isInitialRender && !this._growAfterOpen) {\n top = origin.y - previousHeight / 2;\n }\n }\n // The overlay is opening 'right-ward' (the content flows to the right).\n const isBoundedByRightViewportEdge = (position.overlayX === 'start' && !isRtl) || (position.overlayX === 'end' && isRtl);\n // The overlay is opening 'left-ward' (the content flows to the left).\n const isBoundedByLeftViewportEdge = (position.overlayX === 'end' && !isRtl) || (position.overlayX === 'start' && isRtl);\n let width, left, right;\n if (isBoundedByLeftViewportEdge) {\n right = viewport.width - origin.x + this._viewportMargin;\n width = origin.x - this._viewportMargin;\n }\n else if (isBoundedByRightViewportEdge) {\n left = origin.x;\n width = viewport.right - origin.x;\n }\n else {\n // If neither start nor end, it means that the overlay is horizontally centered on the\n // origin point. Note that we want the position relative to the viewport, rather than\n // the page, which is why we don't use something like `viewport.right - origin.x` and\n // `origin.x - viewport.left`.\n const smallestDistanceToViewportEdge = Math.min(viewport.right - origin.x + viewport.left, origin.x);\n const previousWidth = this._lastBoundingBoxSize.width;\n width = smallestDistanceToViewportEdge * 2;\n left = origin.x - smallestDistanceToViewportEdge;\n if (width > previousWidth && !this._isInitialRender && !this._growAfterOpen) {\n left = origin.x - previousWidth / 2;\n }\n }\n return { top: top, left: left, bottom: bottom, right: right, width, height };\n }\n /**\n * Sets the position and size of the overlay's sizing wrapper. The wrapper is positioned on the\n * origin's connection point and stretches to the bounds of the viewport.\n *\n * @param origin The point on the origin element where the overlay is connected.\n * @param position The position preference\n */\n _setBoundingBoxStyles(origin, position) {\n const boundingBoxRect = this._calculateBoundingBoxRect(origin, position);\n // It's weird if the overlay *grows* while scrolling, so we take the last size into account\n // when applying a new size.\n if (!this._isInitialRender && !this._growAfterOpen) {\n boundingBoxRect.height = Math.min(boundingBoxRect.height, this._lastBoundingBoxSize.height);\n boundingBoxRect.width = Math.min(boundingBoxRect.width, this._lastBoundingBoxSize.width);\n }\n const styles = {};\n if (this._hasExactPosition()) {\n styles.top = styles.left = '0';\n styles.bottom = styles.right = styles.maxHeight = styles.maxWidth = '';\n styles.width = styles.height = '100%';\n }\n else {\n const maxHeight = this._overlayRef.getConfig().maxHeight;\n const maxWidth = this._overlayRef.getConfig().maxWidth;\n styles.height = coerceCssPixelValue(boundingBoxRect.height);\n styles.top = coerceCssPixelValue(boundingBoxRect.top);\n styles.bottom = coerceCssPixelValue(boundingBoxRect.bottom);\n styles.width = coerceCssPixelValue(boundingBoxRect.width);\n styles.left = coerceCssPixelValue(boundingBoxRect.left);\n styles.right = coerceCssPixelValue(boundingBoxRect.right);\n // Push the pane content towards the proper direction.\n if (position.overlayX === 'center') {\n styles.alignItems = 'center';\n }\n else {\n styles.alignItems = position.overlayX === 'end' ? 'flex-end' : 'flex-start';\n }\n if (position.overlayY === 'center') {\n styles.justifyContent = 'center';\n }\n else {\n styles.justifyContent = position.overlayY === 'bottom' ? 'flex-end' : 'flex-start';\n }\n if (maxHeight) {\n styles.maxHeight = coerceCssPixelValue(maxHeight);\n }\n if (maxWidth) {\n styles.maxWidth = coerceCssPixelValue(maxWidth);\n }\n }\n this._lastBoundingBoxSize = boundingBoxRect;\n extendStyles(this._boundingBox.style, styles);\n }\n /** Resets the styles for the bounding box so that a new positioning can be computed. */\n _resetBoundingBoxStyles() {\n extendStyles(this._boundingBox.style, {\n top: '0',\n left: '0',\n right: '0',\n bottom: '0',\n height: '',\n width: '',\n alignItems: '',\n justifyContent: '',\n });\n }\n /** Resets the styles for the overlay pane so that a new positioning can be computed. */\n _resetOverlayElementStyles() {\n extendStyles(this._pane.style, {\n top: '',\n left: '',\n bottom: '',\n right: '',\n position: '',\n transform: '',\n });\n }\n /** Sets positioning styles to the overlay element. */\n _setOverlayElementStyles(originPoint, position) {\n const styles = {};\n const hasExactPosition = this._hasExactPosition();\n const hasFlexibleDimensions = this._hasFlexibleDimensions;\n const config = this._overlayRef.getConfig();\n if (hasExactPosition) {\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n extendStyles(styles, this._getExactOverlayY(position, originPoint, scrollPosition));\n extendStyles(styles, this._getExactOverlayX(position, originPoint, scrollPosition));\n }\n else {\n styles.position = 'static';\n }\n // Use a transform to apply the offsets. We do this because the `center` positions rely on\n // being in the normal flex flow and setting a `top` / `left` at all will completely throw\n // off the position. We also can't use margins, because they won't have an effect in some\n // cases where the element doesn't have anything to \"push off of\". Finally, this works\n // better both with flexible and non-flexible positioning.\n let transformString = '';\n let offsetX = this._getOffset(position, 'x');\n let offsetY = this._getOffset(position, 'y');\n if (offsetX) {\n transformString += `translateX(${offsetX}px) `;\n }\n if (offsetY) {\n transformString += `translateY(${offsetY}px)`;\n }\n styles.transform = transformString.trim();\n // If a maxWidth or maxHeight is specified on the overlay, we remove them. We do this because\n // we need these values to both be set to \"100%\" for the automatic flexible sizing to work.\n // The maxHeight and maxWidth are set on the boundingBox in order to enforce the constraint.\n // Note that this doesn't apply when we have an exact position, in which case we do want to\n // apply them because they'll be cleared from the bounding box.\n if (config.maxHeight) {\n if (hasExactPosition) {\n styles.maxHeight = coerceCssPixelValue(config.maxHeight);\n }\n else if (hasFlexibleDimensions) {\n styles.maxHeight = '';\n }\n }\n if (config.maxWidth) {\n if (hasExactPosition) {\n styles.maxWidth = coerceCssPixelValue(config.maxWidth);\n }\n else if (hasFlexibleDimensions) {\n styles.maxWidth = '';\n }\n }\n extendStyles(this._pane.style, styles);\n }\n /** Gets the exact top/bottom for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayY(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the\n // preferred position has changed since the last `apply`.\n let styles = { top: '', bottom: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `top` or `bottom` based on whether the overlay wants to appear\n // above or below the origin and the direction in which the element will expand.\n if (position.overlayY === 'bottom') {\n // When using `bottom`, we adjust the y position such that it is the distance\n // from the bottom of the viewport rather than the top.\n const documentHeight = this._document.documentElement.clientHeight;\n styles.bottom = `${documentHeight - (overlayPoint.y + this._overlayRect.height)}px`;\n }\n else {\n styles.top = coerceCssPixelValue(overlayPoint.y);\n }\n return styles;\n }\n /** Gets the exact left/right for the overlay when not using flexible sizing or when pushing. */\n _getExactOverlayX(position, originPoint, scrollPosition) {\n // Reset any existing styles. This is necessary in case the preferred position has\n // changed since the last `apply`.\n let styles = { left: '', right: '' };\n let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position);\n if (this._isPushed) {\n overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition);\n }\n // We want to set either `left` or `right` based on whether the overlay wants to appear \"before\"\n // or \"after\" the origin, which determines the direction in which the element will expand.\n // For the horizontal axis, the meaning of \"before\" and \"after\" change based on whether the\n // page is in RTL or LTR.\n let horizontalStyleProperty;\n if (this._isRtl()) {\n horizontalStyleProperty = position.overlayX === 'end' ? 'left' : 'right';\n }\n else {\n horizontalStyleProperty = position.overlayX === 'end' ? 'right' : 'left';\n }\n // When we're setting `right`, we adjust the x position such that it is the distance\n // from the right edge of the viewport rather than the left edge.\n if (horizontalStyleProperty === 'right') {\n const documentWidth = this._document.documentElement.clientWidth;\n styles.right = `${documentWidth - (overlayPoint.x + this._overlayRect.width)}px`;\n }\n else {\n styles.left = coerceCssPixelValue(overlayPoint.x);\n }\n return styles;\n }\n /**\n * Gets the view properties of the trigger and overlay, including whether they are clipped\n * or completely outside the view of any of the strategy's scrollables.\n */\n _getScrollVisibility() {\n // Note: needs fresh rects since the position could've changed.\n const originBounds = this._getOriginRect();\n const overlayBounds = this._pane.getBoundingClientRect();\n // TODO(jelbourn): instead of needing all of the client rects for these scrolling containers\n // every time, we should be able to use the scrollTop of the containers if the size of those\n // containers hasn't changed.\n const scrollContainerBounds = this._scrollables.map(scrollable => {\n return scrollable.getElementRef().nativeElement.getBoundingClientRect();\n });\n return {\n isOriginClipped: isElementClippedByScrolling(originBounds, scrollContainerBounds),\n isOriginOutsideView: isElementScrolledOutsideView(originBounds, scrollContainerBounds),\n isOverlayClipped: isElementClippedByScrolling(overlayBounds, scrollContainerBounds),\n isOverlayOutsideView: isElementScrolledOutsideView(overlayBounds, scrollContainerBounds),\n };\n }\n /** Subtracts the amount that an element is overflowing on an axis from its length. */\n _subtractOverflows(length, ...overflows) {\n return overflows.reduce((currentValue, currentOverflow) => {\n return currentValue - Math.max(currentOverflow, 0);\n }, length);\n }\n /** Narrows the given viewport rect by the current _viewportMargin. */\n _getNarrowedViewportRect() {\n // We recalculate the viewport rect here ourselves, rather than using the ViewportRuler,\n // because we want to use the `clientWidth` and `clientHeight` as the base. The difference\n // being that the client properties don't include the scrollbar, as opposed to `innerWidth`\n // and `innerHeight` that do. This is necessary, because the overlay container uses\n // 100% `width` and `height` which don't include the scrollbar either.\n const width = this._document.documentElement.clientWidth;\n const height = this._document.documentElement.clientHeight;\n const scrollPosition = this._viewportRuler.getViewportScrollPosition();\n return {\n top: scrollPosition.top + this._viewportMargin,\n left: scrollPosition.left + this._viewportMargin,\n right: scrollPosition.left + width - this._viewportMargin,\n bottom: scrollPosition.top + height - this._viewportMargin,\n width: width - 2 * this._viewportMargin,\n height: height - 2 * this._viewportMargin,\n };\n }\n /** Whether the we're dealing with an RTL context */\n _isRtl() {\n return this._overlayRef.getDirection() === 'rtl';\n }\n /** Determines whether the overlay uses exact or flexible positioning. */\n _hasExactPosition() {\n return !this._hasFlexibleDimensions || this._isPushed;\n }\n /** Retrieves the offset of a position along the x or y axis. */\n _getOffset(position, axis) {\n if (axis === 'x') {\n // We don't do something like `position['offset' + axis]` in\n // order to avoid breaking minifiers that rename properties.\n return position.offsetX == null ? this._offsetX : position.offsetX;\n }\n return position.offsetY == null ? this._offsetY : position.offsetY;\n }\n /** Validates that the current position match the expected values. */\n _validatePositions() {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!this._preferredPositions.length) {\n throw Error('FlexibleConnectedPositionStrategy: At least one position is required.');\n }\n // TODO(crisbeto): remove these once Angular's template type\n // checking is advanced enough to catch these cases.\n this._preferredPositions.forEach(pair => {\n validateHorizontalPosition('originX', pair.originX);\n validateVerticalPosition('originY', pair.originY);\n validateHorizontalPosition('overlayX', pair.overlayX);\n validateVerticalPosition('overlayY', pair.overlayY);\n });\n }\n }\n /** Adds a single CSS class or an array of classes on the overlay panel. */\n _addPanelClasses(cssClasses) {\n if (this._pane) {\n coerceArray(cssClasses).forEach(cssClass => {\n if (cssClass !== '' && this._appliedPanelClasses.indexOf(cssClass) === -1) {\n this._appliedPanelClasses.push(cssClass);\n this._pane.classList.add(cssClass);\n }\n });\n }\n }\n /** Clears the classes that the position strategy has applied from the overlay panel. */\n _clearPanelClasses() {\n if (this._pane) {\n this._appliedPanelClasses.forEach(cssClass => {\n this._pane.classList.remove(cssClass);\n });\n this._appliedPanelClasses = [];\n }\n }\n /** Returns the ClientRect of the current origin. */\n _getOriginRect() {\n const origin = this._origin;\n if (origin instanceof ElementRef) {\n return origin.nativeElement.getBoundingClientRect();\n }\n // Check for Element so SVG elements are also supported.\n if (origin instanceof Element) {\n return origin.getBoundingClientRect();\n }\n const width = origin.width || 0;\n const height = origin.height || 0;\n // If the origin is a point, return a client rect as if it was a 0x0 element at the point.\n return {\n top: origin.y,\n bottom: origin.y + height,\n left: origin.x,\n right: origin.x + width,\n height,\n width,\n };\n }\n}\n/** Shallow-extends a stylesheet object with another stylesheet object. */\nfunction extendStyles(destination, source) {\n for (let key in source) {\n if (source.hasOwnProperty(key)) {\n destination[key] = source[key];\n }\n }\n return destination;\n}\n/**\n * Extracts the pixel value as a number from a value, if it's a number\n * or a CSS pixel string (e.g. `1337px`). Otherwise returns null.\n */\nfunction getPixelValue(input) {\n if (typeof input !== 'number' && input != null) {\n const [value, units] = input.split(cssUnitPattern);\n return !units || units === 'px' ? parseFloat(value) : null;\n }\n return input || null;\n}\n/**\n * Gets a version of an element's bounding `ClientRect` where all the values are rounded down to\n * the nearest pixel. This allows us to account for the cases where there may be sub-pixel\n * deviations in the `ClientRect` returned by the browser (e.g. when zoomed in with a percentage\n * size, see #21350).\n */\nfunction getRoundedBoundingClientRect(clientRect) {\n return {\n top: Math.floor(clientRect.top),\n right: Math.floor(clientRect.right),\n bottom: Math.floor(clientRect.bottom),\n left: Math.floor(clientRect.left),\n width: Math.floor(clientRect.width),\n height: Math.floor(clientRect.height),\n };\n}\nconst STANDARD_DROPDOWN_BELOW_POSITIONS = [\n { originX: 'start', originY: 'bottom', overlayX: 'start', overlayY: 'top' },\n { originX: 'start', originY: 'top', overlayX: 'start', overlayY: 'bottom' },\n { originX: 'end', originY: 'bottom', overlayX: 'end', overlayY: 'top' },\n { originX: 'end', originY: 'top', overlayX: 'end', overlayY: 'bottom' },\n];\nconst STANDARD_DROPDOWN_ADJACENT_POSITIONS = [\n { originX: 'end', originY: 'top', overlayX: 'start', overlayY: 'top' },\n { originX: 'end', originY: 'bottom', overlayX: 'start', overlayY: 'bottom' },\n { originX: 'start', originY: 'top', overlayX: 'end', overlayY: 'top' },\n { originX: 'start', originY: 'bottom', overlayX: 'end', overlayY: 'bottom' },\n];\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Class to be added to the overlay pane wrapper. */\nconst wrapperClass = 'cdk-global-overlay-wrapper';\n/**\n * A strategy for positioning overlays. Using this strategy, an overlay is given an\n * explicit position relative to the browser's viewport. We use flexbox, instead of\n * transforms, in order to avoid issues with subpixel rendering which can cause the\n * element to become blurry.\n */\nclass GlobalPositionStrategy {\n constructor() {\n this._cssPosition = 'static';\n this._topOffset = '';\n this._bottomOffset = '';\n this._alignItems = '';\n this._xPosition = '';\n this._xOffset = '';\n this._width = '';\n this._height = '';\n this._isDisposed = false;\n }\n attach(overlayRef) {\n const config = overlayRef.getConfig();\n this._overlayRef = overlayRef;\n if (this._width && !config.width) {\n overlayRef.updateSize({ width: this._width });\n }\n if (this._height && !config.height) {\n overlayRef.updateSize({ height: this._height });\n }\n overlayRef.hostElement.classList.add(wrapperClass);\n this._isDisposed = false;\n }\n /**\n * Sets the top position of the overlay. Clears any previously set vertical position.\n * @param value New top offset.\n */\n top(value = '') {\n this._bottomOffset = '';\n this._topOffset = value;\n this._alignItems = 'flex-start';\n return this;\n }\n /**\n * Sets the left position of the overlay. Clears any previously set horizontal position.\n * @param value New left offset.\n */\n left(value = '') {\n this._xOffset = value;\n this._xPosition = 'left';\n return this;\n }\n /**\n * Sets the bottom position of the overlay. Clears any previously set vertical position.\n * @param value New bottom offset.\n */\n bottom(value = '') {\n this._topOffset = '';\n this._bottomOffset = value;\n this._alignItems = 'flex-end';\n return this;\n }\n /**\n * Sets the right position of the overlay. Clears any previously set horizontal position.\n * @param value New right offset.\n */\n right(value = '') {\n this._xOffset = value;\n this._xPosition = 'right';\n return this;\n }\n /**\n * Sets the overlay to the start of the viewport, depending on the overlay direction.\n * This will be to the left in LTR layouts and to the right in RTL.\n * @param offset Offset from the edge of the screen.\n */\n start(value = '') {\n this._xOffset = value;\n this._xPosition = 'start';\n return this;\n }\n /**\n * Sets the overlay to the end of the viewport, depending on the overlay direction.\n * This will be to the right in LTR layouts and to the left in RTL.\n * @param offset Offset from the edge of the screen.\n */\n end(value = '') {\n this._xOffset = value;\n this._xPosition = 'end';\n return this;\n }\n /**\n * Sets the overlay width and clears any previously set width.\n * @param value New width for the overlay\n * @deprecated Pass the `width` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n width(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ width: value });\n }\n else {\n this._width = value;\n }\n return this;\n }\n /**\n * Sets the overlay height and clears any previously set height.\n * @param value New height for the overlay\n * @deprecated Pass the `height` through the `OverlayConfig`.\n * @breaking-change 8.0.0\n */\n height(value = '') {\n if (this._overlayRef) {\n this._overlayRef.updateSize({ height: value });\n }\n else {\n this._height = value;\n }\n return this;\n }\n /**\n * Centers the overlay horizontally with an optional offset.\n * Clears any previously set horizontal position.\n *\n * @param offset Overlay offset from the horizontal center.\n */\n centerHorizontally(offset = '') {\n this.left(offset);\n this._xPosition = 'center';\n return this;\n }\n /**\n * Centers the overlay vertically with an optional offset.\n * Clears any previously set vertical position.\n *\n * @param offset Overlay offset from the vertical center.\n */\n centerVertically(offset = '') {\n this.top(offset);\n this._alignItems = 'center';\n return this;\n }\n /**\n * Apply the position to the element.\n * @docs-private\n */\n apply() {\n // Since the overlay ref applies the strategy asynchronously, it could\n // have been disposed before it ends up being applied. If that is the\n // case, we shouldn't do anything.\n if (!this._overlayRef || !this._overlayRef.hasAttached()) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parentStyles = this._overlayRef.hostElement.style;\n const config = this._overlayRef.getConfig();\n const { width, height, maxWidth, maxHeight } = config;\n const shouldBeFlushHorizontally = (width === '100%' || width === '100vw') &&\n (!maxWidth || maxWidth === '100%' || maxWidth === '100vw');\n const shouldBeFlushVertically = (height === '100%' || height === '100vh') &&\n (!maxHeight || maxHeight === '100%' || maxHeight === '100vh');\n const xPosition = this._xPosition;\n const xOffset = this._xOffset;\n const isRtl = this._overlayRef.getConfig().direction === 'rtl';\n let marginLeft = '';\n let marginRight = '';\n let justifyContent = '';\n if (shouldBeFlushHorizontally) {\n justifyContent = 'flex-start';\n }\n else if (xPosition === 'center') {\n justifyContent = 'center';\n if (isRtl) {\n marginRight = xOffset;\n }\n else {\n marginLeft = xOffset;\n }\n }\n else if (isRtl) {\n if (xPosition === 'left' || xPosition === 'end') {\n justifyContent = 'flex-end';\n marginLeft = xOffset;\n }\n else if (xPosition === 'right' || xPosition === 'start') {\n justifyContent = 'flex-start';\n marginRight = xOffset;\n }\n }\n else if (xPosition === 'left' || xPosition === 'start') {\n justifyContent = 'flex-start';\n marginLeft = xOffset;\n }\n else if (xPosition === 'right' || xPosition === 'end') {\n justifyContent = 'flex-end';\n marginRight = xOffset;\n }\n styles.position = this._cssPosition;\n styles.marginLeft = shouldBeFlushHorizontally ? '0' : marginLeft;\n styles.marginTop = shouldBeFlushVertically ? '0' : this._topOffset;\n styles.marginBottom = this._bottomOffset;\n styles.marginRight = shouldBeFlushHorizontally ? '0' : marginRight;\n parentStyles.justifyContent = justifyContent;\n parentStyles.alignItems = shouldBeFlushVertically ? 'flex-start' : this._alignItems;\n }\n /**\n * Cleans up the DOM changes from the position strategy.\n * @docs-private\n */\n dispose() {\n if (this._isDisposed || !this._overlayRef) {\n return;\n }\n const styles = this._overlayRef.overlayElement.style;\n const parent = this._overlayRef.hostElement;\n const parentStyles = parent.style;\n parent.classList.remove(wrapperClass);\n parentStyles.justifyContent =\n parentStyles.alignItems =\n styles.marginTop =\n styles.marginBottom =\n styles.marginLeft =\n styles.marginRight =\n styles.position =\n '';\n this._overlayRef = null;\n this._isDisposed = true;\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Builder for overlay position strategy. */\nclass OverlayPositionBuilder {\n constructor(_viewportRuler, _document, _platform, _overlayContainer) {\n this._viewportRuler = _viewportRuler;\n this._document = _document;\n this._platform = _platform;\n this._overlayContainer = _overlayContainer;\n }\n /**\n * Creates a global position strategy.\n */\n global() {\n return new GlobalPositionStrategy();\n }\n /**\n * Creates a flexible position strategy.\n * @param origin Origin relative to which to position the overlay.\n */\n flexibleConnectedTo(origin) {\n return new FlexibleConnectedPositionStrategy(origin, this._viewportRuler, this._document, this._platform, this._overlayContainer);\n }\n}\nOverlayPositionBuilder.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayPositionBuilder, deps: [{ token: i1.ViewportRuler }, { token: DOCUMENT }, { token: i1$1.Platform }, { token: OverlayContainer }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlayPositionBuilder.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayPositionBuilder, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayPositionBuilder, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.ViewportRuler }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }, { type: OverlayContainer }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Next overlay unique ID. */\nlet nextUniqueId = 0;\n// Note that Overlay is *not* scoped to the app root because of the ComponentFactoryResolver\n// which needs to be different depending on where OverlayModule is imported.\n/**\n * Service to create Overlays. Overlays are dynamically added pieces of floating UI, meant to be\n * used as a low-level building block for other components. Dialogs, tooltips, menus,\n * selects, etc. can all be built using overlays. The service should primarily be used by authors\n * of re-usable components rather than developers building end-user applications.\n *\n * An overlay *is* a PortalOutlet, so any kind of Portal can be loaded into one.\n */\nclass Overlay {\n constructor(\n /** Scrolling strategies that can be used when creating an overlay. */\n scrollStrategies, _overlayContainer, _componentFactoryResolver, _positionBuilder, _keyboardDispatcher, _injector, _ngZone, _document, _directionality, _location, _outsideClickDispatcher, _animationsModuleType) {\n this.scrollStrategies = scrollStrategies;\n this._overlayContainer = _overlayContainer;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._positionBuilder = _positionBuilder;\n this._keyboardDispatcher = _keyboardDispatcher;\n this._injector = _injector;\n this._ngZone = _ngZone;\n this._document = _document;\n this._directionality = _directionality;\n this._location = _location;\n this._outsideClickDispatcher = _outsideClickDispatcher;\n this._animationsModuleType = _animationsModuleType;\n }\n /**\n * Creates an overlay.\n * @param config Configuration applied to the overlay.\n * @returns Reference to the created overlay.\n */\n create(config) {\n const host = this._createHostElement();\n const pane = this._createPaneElement(host);\n const portalOutlet = this._createPortalOutlet(pane);\n const overlayConfig = new OverlayConfig(config);\n overlayConfig.direction = overlayConfig.direction || this._directionality.value;\n return new OverlayRef(portalOutlet, host, pane, overlayConfig, this._ngZone, this._keyboardDispatcher, this._document, this._location, this._outsideClickDispatcher, this._animationsModuleType === 'NoopAnimations');\n }\n /**\n * Gets a position builder that can be used, via fluent API,\n * to construct and configure a position strategy.\n * @returns An overlay position builder.\n */\n position() {\n return this._positionBuilder;\n }\n /**\n * Creates the DOM element for an overlay and appends it to the overlay container.\n * @returns Newly-created pane element\n */\n _createPaneElement(host) {\n const pane = this._document.createElement('div');\n pane.id = `cdk-overlay-${nextUniqueId++}`;\n pane.classList.add('cdk-overlay-pane');\n host.appendChild(pane);\n return pane;\n }\n /**\n * Creates the host element that wraps around an overlay\n * and can be used for advanced positioning.\n * @returns Newly-create host element.\n */\n _createHostElement() {\n const host = this._document.createElement('div');\n this._overlayContainer.getContainerElement().appendChild(host);\n return host;\n }\n /**\n * Create a DomPortalOutlet into which the overlay content can be loaded.\n * @param pane The DOM element to turn into a portal outlet.\n * @returns A portal outlet for the given DOM element.\n */\n _createPortalOutlet(pane) {\n // We have to resolve the ApplicationRef later in order to allow people\n // to use overlay-based providers during app initialization.\n if (!this._appRef) {\n this._appRef = this._injector.get(ApplicationRef);\n }\n return new DomPortalOutlet(pane, this._componentFactoryResolver, this._appRef, this._injector, this._document);\n }\n}\nOverlay.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Overlay, deps: [{ token: ScrollStrategyOptions }, { token: OverlayContainer }, { token: i0.ComponentFactoryResolver }, { token: OverlayPositionBuilder }, { token: OverlayKeyboardDispatcher }, { token: i0.Injector }, { token: i0.NgZone }, { token: DOCUMENT }, { token: i5.Directionality }, { token: i6.Location }, { token: OverlayOutsideClickDispatcher }, { token: ANIMATION_MODULE_TYPE, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nOverlay.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Overlay, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Overlay, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: ScrollStrategyOptions }, { type: OverlayContainer }, { type: i0.ComponentFactoryResolver }, { type: OverlayPositionBuilder }, { type: OverlayKeyboardDispatcher }, { type: i0.Injector }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i5.Directionality }, { type: i6.Location }, { type: OverlayOutsideClickDispatcher }, { type: undefined, decorators: [{\n type: Inject,\n args: [ANIMATION_MODULE_TYPE]\n }, {\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Default set of positions for the overlay. Follows the behavior of a dropdown. */\nconst defaultPositionList = [\n {\n originX: 'start',\n originY: 'bottom',\n overlayX: 'start',\n overlayY: 'top',\n },\n {\n originX: 'start',\n originY: 'top',\n overlayX: 'start',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'top',\n overlayX: 'end',\n overlayY: 'bottom',\n },\n {\n originX: 'end',\n originY: 'bottom',\n overlayX: 'end',\n overlayY: 'top',\n },\n];\n/** Injection token that determines the scroll handling while the connected overlay is open. */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY = new InjectionToken('cdk-connected-overlay-scroll-strategy');\n/**\n * Directive applied to an element to make it usable as an origin for an Overlay using a\n * ConnectedPositionStrategy.\n */\nclass CdkOverlayOrigin {\n constructor(\n /** Reference to the element on which the directive is applied. */\n elementRef) {\n this.elementRef = elementRef;\n }\n}\nCdkOverlayOrigin.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkOverlayOrigin, deps: [{ token: i0.ElementRef }], target: i0.ɵɵFactoryTarget.Directive });\nCdkOverlayOrigin.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkOverlayOrigin, isStandalone: true, selector: \"[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]\", exportAs: [\"cdkOverlayOrigin\"], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkOverlayOrigin, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]',\n exportAs: 'cdkOverlayOrigin',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }]; } });\n/**\n * Directive to facilitate declarative creation of an\n * Overlay using a FlexibleConnectedPositionStrategy.\n */\nclass CdkConnectedOverlay {\n /** The offset in pixels for the overlay connection point on the x-axis */\n get offsetX() {\n return this._offsetX;\n }\n set offsetX(offsetX) {\n this._offsetX = offsetX;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** The offset in pixels for the overlay connection point on the y-axis */\n get offsetY() {\n return this._offsetY;\n }\n set offsetY(offsetY) {\n this._offsetY = offsetY;\n if (this._position) {\n this._updatePositionStrategy(this._position);\n }\n }\n /** Whether or not the overlay should attach a backdrop. */\n get hasBackdrop() {\n return this._hasBackdrop;\n }\n set hasBackdrop(value) {\n this._hasBackdrop = coerceBooleanProperty(value);\n }\n /** Whether or not the overlay should be locked when scrolling. */\n get lockPosition() {\n return this._lockPosition;\n }\n set lockPosition(value) {\n this._lockPosition = coerceBooleanProperty(value);\n }\n /** Whether the overlay's width and height can be constrained to fit within the viewport. */\n get flexibleDimensions() {\n return this._flexibleDimensions;\n }\n set flexibleDimensions(value) {\n this._flexibleDimensions = coerceBooleanProperty(value);\n }\n /** Whether the overlay can grow after the initial open when flexible positioning is turned on. */\n get growAfterOpen() {\n return this._growAfterOpen;\n }\n set growAfterOpen(value) {\n this._growAfterOpen = coerceBooleanProperty(value);\n }\n /** Whether the overlay can be pushed on-screen if none of the provided positions fit. */\n get push() {\n return this._push;\n }\n set push(value) {\n this._push = coerceBooleanProperty(value);\n }\n // TODO(jelbourn): inputs for size, scroll behavior, animation, etc.\n constructor(_overlay, templateRef, viewContainerRef, scrollStrategyFactory, _dir) {\n this._overlay = _overlay;\n this._dir = _dir;\n this._hasBackdrop = false;\n this._lockPosition = false;\n this._growAfterOpen = false;\n this._flexibleDimensions = false;\n this._push = false;\n this._backdropSubscription = Subscription.EMPTY;\n this._attachSubscription = Subscription.EMPTY;\n this._detachSubscription = Subscription.EMPTY;\n this._positionSubscription = Subscription.EMPTY;\n /** Margin between the overlay and the viewport edges. */\n this.viewportMargin = 0;\n /** Whether the overlay is open. */\n this.open = false;\n /** Whether the overlay can be closed by user interaction. */\n this.disableClose = false;\n /** Event emitted when the backdrop is clicked. */\n this.backdropClick = new EventEmitter();\n /** Event emitted when the position has changed. */\n this.positionChange = new EventEmitter();\n /** Event emitted when the overlay has been attached. */\n this.attach = new EventEmitter();\n /** Event emitted when the overlay has been detached. */\n this.detach = new EventEmitter();\n /** Emits when there are keyboard events that are targeted at the overlay. */\n this.overlayKeydown = new EventEmitter();\n /** Emits when there are mouse outside click events that are targeted at the overlay. */\n this.overlayOutsideClick = new EventEmitter();\n this._templatePortal = new TemplatePortal(templateRef, viewContainerRef);\n this._scrollStrategyFactory = scrollStrategyFactory;\n this.scrollStrategy = this._scrollStrategyFactory();\n }\n /** The associated overlay reference. */\n get overlayRef() {\n return this._overlayRef;\n }\n /** The element's layout direction. */\n get dir() {\n return this._dir ? this._dir.value : 'ltr';\n }\n ngOnDestroy() {\n this._attachSubscription.unsubscribe();\n this._detachSubscription.unsubscribe();\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n if (this._overlayRef) {\n this._overlayRef.dispose();\n }\n }\n ngOnChanges(changes) {\n if (this._position) {\n this._updatePositionStrategy(this._position);\n this._overlayRef.updateSize({\n width: this.width,\n minWidth: this.minWidth,\n height: this.height,\n minHeight: this.minHeight,\n });\n if (changes['origin'] && this.open) {\n this._position.apply();\n }\n }\n if (changes['open']) {\n this.open ? this._attachOverlay() : this._detachOverlay();\n }\n }\n /** Creates an overlay */\n _createOverlay() {\n if (!this.positions || !this.positions.length) {\n this.positions = defaultPositionList;\n }\n const overlayRef = (this._overlayRef = this._overlay.create(this._buildConfig()));\n this._attachSubscription = overlayRef.attachments().subscribe(() => this.attach.emit());\n this._detachSubscription = overlayRef.detachments().subscribe(() => this.detach.emit());\n overlayRef.keydownEvents().subscribe((event) => {\n this.overlayKeydown.next(event);\n if (event.keyCode === ESCAPE && !this.disableClose && !hasModifierKey(event)) {\n event.preventDefault();\n this._detachOverlay();\n }\n });\n this._overlayRef.outsidePointerEvents().subscribe((event) => {\n this.overlayOutsideClick.next(event);\n });\n }\n /** Builds the overlay config based on the directive's inputs */\n _buildConfig() {\n const positionStrategy = (this._position =\n this.positionStrategy || this._createPositionStrategy());\n const overlayConfig = new OverlayConfig({\n direction: this._dir,\n positionStrategy,\n scrollStrategy: this.scrollStrategy,\n hasBackdrop: this.hasBackdrop,\n });\n if (this.width || this.width === 0) {\n overlayConfig.width = this.width;\n }\n if (this.height || this.height === 0) {\n overlayConfig.height = this.height;\n }\n if (this.minWidth || this.minWidth === 0) {\n overlayConfig.minWidth = this.minWidth;\n }\n if (this.minHeight || this.minHeight === 0) {\n overlayConfig.minHeight = this.minHeight;\n }\n if (this.backdropClass) {\n overlayConfig.backdropClass = this.backdropClass;\n }\n if (this.panelClass) {\n overlayConfig.panelClass = this.panelClass;\n }\n return overlayConfig;\n }\n /** Updates the state of a position strategy, based on the values of the directive inputs. */\n _updatePositionStrategy(positionStrategy) {\n const positions = this.positions.map(currentPosition => ({\n originX: currentPosition.originX,\n originY: currentPosition.originY,\n overlayX: currentPosition.overlayX,\n overlayY: currentPosition.overlayY,\n offsetX: currentPosition.offsetX || this.offsetX,\n offsetY: currentPosition.offsetY || this.offsetY,\n panelClass: currentPosition.panelClass || undefined,\n }));\n return positionStrategy\n .setOrigin(this._getFlexibleConnectedPositionStrategyOrigin())\n .withPositions(positions)\n .withFlexibleDimensions(this.flexibleDimensions)\n .withPush(this.push)\n .withGrowAfterOpen(this.growAfterOpen)\n .withViewportMargin(this.viewportMargin)\n .withLockedPosition(this.lockPosition)\n .withTransformOriginOn(this.transformOriginSelector);\n }\n /** Returns the position strategy of the overlay to be set on the overlay config */\n _createPositionStrategy() {\n const strategy = this._overlay\n .position()\n .flexibleConnectedTo(this._getFlexibleConnectedPositionStrategyOrigin());\n this._updatePositionStrategy(strategy);\n return strategy;\n }\n _getFlexibleConnectedPositionStrategyOrigin() {\n if (this.origin instanceof CdkOverlayOrigin) {\n return this.origin.elementRef;\n }\n else {\n return this.origin;\n }\n }\n /** Attaches the overlay and subscribes to backdrop clicks if backdrop exists */\n _attachOverlay() {\n if (!this._overlayRef) {\n this._createOverlay();\n }\n else {\n // Update the overlay size, in case the directive's inputs have changed\n this._overlayRef.getConfig().hasBackdrop = this.hasBackdrop;\n }\n if (!this._overlayRef.hasAttached()) {\n this._overlayRef.attach(this._templatePortal);\n }\n if (this.hasBackdrop) {\n this._backdropSubscription = this._overlayRef.backdropClick().subscribe(event => {\n this.backdropClick.emit(event);\n });\n }\n else {\n this._backdropSubscription.unsubscribe();\n }\n this._positionSubscription.unsubscribe();\n // Only subscribe to `positionChanges` if requested, because putting\n // together all the information for it can be expensive.\n if (this.positionChange.observers.length > 0) {\n this._positionSubscription = this._position.positionChanges\n .pipe(takeWhile(() => this.positionChange.observers.length > 0))\n .subscribe(position => {\n this.positionChange.emit(position);\n if (this.positionChange.observers.length === 0) {\n this._positionSubscription.unsubscribe();\n }\n });\n }\n }\n /** Detaches the overlay and unsubscribes to backdrop clicks if backdrop exists */\n _detachOverlay() {\n if (this._overlayRef) {\n this._overlayRef.detach();\n }\n this._backdropSubscription.unsubscribe();\n this._positionSubscription.unsubscribe();\n }\n}\nCdkConnectedOverlay.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkConnectedOverlay, deps: [{ token: Overlay }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY }, { token: i5.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkConnectedOverlay.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkConnectedOverlay, isStandalone: true, selector: \"[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]\", inputs: { origin: [\"cdkConnectedOverlayOrigin\", \"origin\"], positions: [\"cdkConnectedOverlayPositions\", \"positions\"], positionStrategy: [\"cdkConnectedOverlayPositionStrategy\", \"positionStrategy\"], offsetX: [\"cdkConnectedOverlayOffsetX\", \"offsetX\"], offsetY: [\"cdkConnectedOverlayOffsetY\", \"offsetY\"], width: [\"cdkConnectedOverlayWidth\", \"width\"], height: [\"cdkConnectedOverlayHeight\", \"height\"], minWidth: [\"cdkConnectedOverlayMinWidth\", \"minWidth\"], minHeight: [\"cdkConnectedOverlayMinHeight\", \"minHeight\"], backdropClass: [\"cdkConnectedOverlayBackdropClass\", \"backdropClass\"], panelClass: [\"cdkConnectedOverlayPanelClass\", \"panelClass\"], viewportMargin: [\"cdkConnectedOverlayViewportMargin\", \"viewportMargin\"], scrollStrategy: [\"cdkConnectedOverlayScrollStrategy\", \"scrollStrategy\"], open: [\"cdkConnectedOverlayOpen\", \"open\"], disableClose: [\"cdkConnectedOverlayDisableClose\", \"disableClose\"], transformOriginSelector: [\"cdkConnectedOverlayTransformOriginOn\", \"transformOriginSelector\"], hasBackdrop: [\"cdkConnectedOverlayHasBackdrop\", \"hasBackdrop\"], lockPosition: [\"cdkConnectedOverlayLockPosition\", \"lockPosition\"], flexibleDimensions: [\"cdkConnectedOverlayFlexibleDimensions\", \"flexibleDimensions\"], growAfterOpen: [\"cdkConnectedOverlayGrowAfterOpen\", \"growAfterOpen\"], push: [\"cdkConnectedOverlayPush\", \"push\"] }, outputs: { backdropClick: \"backdropClick\", positionChange: \"positionChange\", attach: \"attach\", detach: \"detach\", overlayKeydown: \"overlayKeydown\", overlayOutsideClick: \"overlayOutsideClick\" }, exportAs: [\"cdkConnectedOverlay\"], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkConnectedOverlay, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]',\n exportAs: 'cdkConnectedOverlay',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: Overlay }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY]\n }] }, { type: i5.Directionality, decorators: [{\n type: Optional\n }] }]; }, propDecorators: { origin: [{\n type: Input,\n args: ['cdkConnectedOverlayOrigin']\n }], positions: [{\n type: Input,\n args: ['cdkConnectedOverlayPositions']\n }], positionStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayPositionStrategy']\n }], offsetX: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetX']\n }], offsetY: [{\n type: Input,\n args: ['cdkConnectedOverlayOffsetY']\n }], width: [{\n type: Input,\n args: ['cdkConnectedOverlayWidth']\n }], height: [{\n type: Input,\n args: ['cdkConnectedOverlayHeight']\n }], minWidth: [{\n type: Input,\n args: ['cdkConnectedOverlayMinWidth']\n }], minHeight: [{\n type: Input,\n args: ['cdkConnectedOverlayMinHeight']\n }], backdropClass: [{\n type: Input,\n args: ['cdkConnectedOverlayBackdropClass']\n }], panelClass: [{\n type: Input,\n args: ['cdkConnectedOverlayPanelClass']\n }], viewportMargin: [{\n type: Input,\n args: ['cdkConnectedOverlayViewportMargin']\n }], scrollStrategy: [{\n type: Input,\n args: ['cdkConnectedOverlayScrollStrategy']\n }], open: [{\n type: Input,\n args: ['cdkConnectedOverlayOpen']\n }], disableClose: [{\n type: Input,\n args: ['cdkConnectedOverlayDisableClose']\n }], transformOriginSelector: [{\n type: Input,\n args: ['cdkConnectedOverlayTransformOriginOn']\n }], hasBackdrop: [{\n type: Input,\n args: ['cdkConnectedOverlayHasBackdrop']\n }], lockPosition: [{\n type: Input,\n args: ['cdkConnectedOverlayLockPosition']\n }], flexibleDimensions: [{\n type: Input,\n args: ['cdkConnectedOverlayFlexibleDimensions']\n }], growAfterOpen: [{\n type: Input,\n args: ['cdkConnectedOverlayGrowAfterOpen']\n }], push: [{\n type: Input,\n args: ['cdkConnectedOverlayPush']\n }], backdropClick: [{\n type: Output\n }], positionChange: [{\n type: Output\n }], attach: [{\n type: Output\n }], detach: [{\n type: Output\n }], overlayKeydown: [{\n type: Output\n }], overlayOutsideClick: [{\n type: Output\n }] } });\n/** @docs-private */\nfunction CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY(overlay) {\n return () => overlay.scrollStrategies.reposition();\n}\n/** @docs-private */\nconst CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER = {\n provide: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY,\n deps: [Overlay],\n useFactory: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY,\n};\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass OverlayModule {\n}\nOverlayModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nOverlayModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayModule, imports: [BidiModule, PortalModule, ScrollingModule, CdkConnectedOverlay, CdkOverlayOrigin], exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule] });\nOverlayModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayModule, providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER], imports: [BidiModule, PortalModule, ScrollingModule, ScrollingModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: OverlayModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [BidiModule, PortalModule, ScrollingModule, CdkConnectedOverlay, CdkOverlayOrigin],\n exports: [CdkConnectedOverlay, CdkOverlayOrigin, ScrollingModule],\n providers: [Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Alternative to OverlayContainer that supports correct displaying of overlay elements in\n * Fullscreen mode\n * https://developer.mozilla.org/en-US/docs/Web/API/Element/requestFullScreen\n *\n * Should be provided in the root component.\n */\nclass FullscreenOverlayContainer extends OverlayContainer {\n constructor(_document, platform) {\n super(_document, platform);\n }\n ngOnDestroy() {\n super.ngOnDestroy();\n if (this._fullScreenEventName && this._fullScreenListener) {\n this._document.removeEventListener(this._fullScreenEventName, this._fullScreenListener);\n }\n }\n _createContainer() {\n super._createContainer();\n this._adjustParentForFullscreenChange();\n this._addFullscreenChangeListener(() => this._adjustParentForFullscreenChange());\n }\n _adjustParentForFullscreenChange() {\n if (!this._containerElement) {\n return;\n }\n const fullscreenElement = this.getFullscreenElement();\n const parent = fullscreenElement || this._document.body;\n parent.appendChild(this._containerElement);\n }\n _addFullscreenChangeListener(fn) {\n const eventName = this._getEventName();\n if (eventName) {\n if (this._fullScreenListener) {\n this._document.removeEventListener(eventName, this._fullScreenListener);\n }\n this._document.addEventListener(eventName, fn);\n this._fullScreenListener = fn;\n }\n }\n _getEventName() {\n if (!this._fullScreenEventName) {\n const _document = this._document;\n if (_document.fullscreenEnabled) {\n this._fullScreenEventName = 'fullscreenchange';\n }\n else if (_document.webkitFullscreenEnabled) {\n this._fullScreenEventName = 'webkitfullscreenchange';\n }\n else if (_document.mozFullScreenEnabled) {\n this._fullScreenEventName = 'mozfullscreenchange';\n }\n else if (_document.msFullscreenEnabled) {\n this._fullScreenEventName = 'MSFullscreenChange';\n }\n }\n return this._fullScreenEventName;\n }\n /**\n * When the page is put into fullscreen mode, a specific element is specified.\n * Only that element and its children are visible when in fullscreen mode.\n */\n getFullscreenElement() {\n const _document = this._document;\n return (_document.fullscreenElement ||\n _document.webkitFullscreenElement ||\n _document.mozFullScreenElement ||\n _document.msFullscreenElement ||\n null);\n }\n}\nFullscreenOverlayContainer.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FullscreenOverlayContainer, deps: [{ token: DOCUMENT }, { token: i1$1.Platform }], target: i0.ɵɵFactoryTarget.Injectable });\nFullscreenOverlayContainer.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FullscreenOverlayContainer, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: FullscreenOverlayContainer, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }, { type: i1$1.Platform }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BlockScrollStrategy, CdkConnectedOverlay, CdkOverlayOrigin, CloseScrollStrategy, ConnectedOverlayPositionChange, ConnectionPositionPair, FlexibleConnectedPositionStrategy, FullscreenOverlayContainer, GlobalPositionStrategy, NoopScrollStrategy, Overlay, OverlayConfig, OverlayContainer, OverlayKeyboardDispatcher, OverlayModule, OverlayOutsideClickDispatcher, OverlayPositionBuilder, OverlayRef, RepositionScrollStrategy, STANDARD_DROPDOWN_ADJACENT_POSITIONS, STANDARD_DROPDOWN_BELOW_POSITIONS, ScrollStrategyOptions, ScrollingVisibility, validateHorizontalPosition, validateVerticalPosition };\n","import * as i0 from '@angular/core';\nimport { PLATFORM_ID, Injectable, Inject, NgModule } from '@angular/core';\nimport { isPlatformBrowser } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n// Whether the current platform supports the V8 Break Iterator. The V8 check\n// is necessary to detect all Blink based browsers.\nlet hasV8BreakIterator;\n// We need a try/catch around the reference to `Intl`, because accessing it in some cases can\n// cause IE to throw. These cases are tied to particular versions of Windows and can happen if\n// the consumer is providing a polyfilled `Map`. See:\n// https://github.com/Microsoft/ChakraCore/issues/3189\n// https://github.com/angular/components/issues/15687\ntry {\n hasV8BreakIterator = typeof Intl !== 'undefined' && Intl.v8BreakIterator;\n}\ncatch {\n hasV8BreakIterator = false;\n}\n/**\n * Service to detect the current platform by comparing the userAgent strings and\n * checking browser-specific global properties.\n */\nclass Platform {\n constructor(_platformId) {\n this._platformId = _platformId;\n // We want to use the Angular platform check because if the Document is shimmed\n // without the navigator, the following checks will fail. This is preferred because\n // sometimes the Document may be shimmed without the user's knowledge or intention\n /** Whether the Angular application is being rendered in the browser. */\n this.isBrowser = this._platformId\n ? isPlatformBrowser(this._platformId)\n : typeof document === 'object' && !!document;\n /** Whether the current browser is Microsoft Edge. */\n this.EDGE = this.isBrowser && /(edge)/i.test(navigator.userAgent);\n /** Whether the current rendering engine is Microsoft Trident. */\n this.TRIDENT = this.isBrowser && /(msie|trident)/i.test(navigator.userAgent);\n // EdgeHTML and Trident mock Blink specific things and need to be excluded from this check.\n /** Whether the current rendering engine is Blink. */\n this.BLINK = this.isBrowser &&\n !!(window.chrome || hasV8BreakIterator) &&\n typeof CSS !== 'undefined' &&\n !this.EDGE &&\n !this.TRIDENT;\n // Webkit is part of the userAgent in EdgeHTML, Blink and Trident. Therefore we need to\n // ensure that Webkit runs standalone and is not used as another engine's base.\n /** Whether the current rendering engine is WebKit. */\n this.WEBKIT = this.isBrowser &&\n /AppleWebKit/i.test(navigator.userAgent) &&\n !this.BLINK &&\n !this.EDGE &&\n !this.TRIDENT;\n /** Whether the current platform is Apple iOS. */\n this.IOS = this.isBrowser && /iPad|iPhone|iPod/.test(navigator.userAgent) && !('MSStream' in window);\n // It's difficult to detect the plain Gecko engine, because most of the browsers identify\n // them self as Gecko-like browsers and modify the userAgent's according to that.\n // Since we only cover one explicit Firefox case, we can simply check for Firefox\n // instead of having an unstable check for Gecko.\n /** Whether the current browser is Firefox. */\n this.FIREFOX = this.isBrowser && /(firefox|minefield)/i.test(navigator.userAgent);\n /** Whether the current platform is Android. */\n // Trident on mobile adds the android platform to the userAgent to trick detections.\n this.ANDROID = this.isBrowser && /android/i.test(navigator.userAgent) && !this.TRIDENT;\n // Safari browsers will include the Safari keyword in their userAgent. Some browsers may fake\n // this and just place the Safari keyword in the userAgent. To be more safe about Safari every\n // Safari browser should also use Webkit as its layout engine.\n /** Whether the current browser is Safari. */\n this.SAFARI = this.isBrowser && /safari/i.test(navigator.userAgent) && this.WEBKIT;\n }\n}\nPlatform.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Platform, deps: [{ token: PLATFORM_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nPlatform.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Platform, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: Platform, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: Object, decorators: [{\n type: Inject,\n args: [PLATFORM_ID]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass PlatformModule {\n}\nPlatformModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PlatformModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nPlatformModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PlatformModule });\nPlatformModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PlatformModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PlatformModule, decorators: [{\n type: NgModule,\n args: [{}]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result Set of input types support by the current browser. */\nlet supportedInputTypes;\n/** Types of `` that *might* be supported. */\nconst candidateInputTypes = [\n // `color` must come first. Chrome 56 shows a warning if we change the type to `color` after\n // first changing it to something else:\n // The specified value \"\" does not conform to the required format.\n // The format is \"#rrggbb\" where rr, gg, bb are two-digit hexadecimal numbers.\n 'color',\n 'button',\n 'checkbox',\n 'date',\n 'datetime-local',\n 'email',\n 'file',\n 'hidden',\n 'image',\n 'month',\n 'number',\n 'password',\n 'radio',\n 'range',\n 'reset',\n 'search',\n 'submit',\n 'tel',\n 'text',\n 'time',\n 'url',\n 'week',\n];\n/** @returns The input types supported by this browser. */\nfunction getSupportedInputTypes() {\n // Result is cached.\n if (supportedInputTypes) {\n return supportedInputTypes;\n }\n // We can't check if an input type is not supported until we're on the browser, so say that\n // everything is supported when not on the browser. We don't use `Platform` here since it's\n // just a helper function and can't inject it.\n if (typeof document !== 'object' || !document) {\n supportedInputTypes = new Set(candidateInputTypes);\n return supportedInputTypes;\n }\n let featureTestInput = document.createElement('input');\n supportedInputTypes = new Set(candidateInputTypes.filter(value => {\n featureTestInput.setAttribute('type', value);\n return featureTestInput.type === value;\n }));\n return supportedInputTypes;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of whether the user's browser supports passive event listeners. */\nlet supportsPassiveEvents;\n/**\n * Checks whether the user's browser supports passive event listeners.\n * See: https://github.com/WICG/EventListenerOptions/blob/gh-pages/explainer.md\n */\nfunction supportsPassiveEventListeners() {\n if (supportsPassiveEvents == null && typeof window !== 'undefined') {\n try {\n window.addEventListener('test', null, Object.defineProperty({}, 'passive', {\n get: () => (supportsPassiveEvents = true),\n }));\n }\n finally {\n supportsPassiveEvents = supportsPassiveEvents || false;\n }\n }\n return supportsPassiveEvents;\n}\n/**\n * Normalizes an `AddEventListener` object to something that can be passed\n * to `addEventListener` on any browser, no matter whether it supports the\n * `options` parameter.\n * @param options Object to be normalized.\n */\nfunction normalizePassiveListenerOptions(options) {\n return supportsPassiveEventListeners() ? options : !!options.capture;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Cached result of the way the browser handles the horizontal scroll axis in RTL mode. */\nlet rtlScrollAxisType;\n/** Cached result of the check that indicates whether the browser supports scroll behaviors. */\nlet scrollBehaviorSupported;\n/** Check whether the browser supports scroll behaviors. */\nfunction supportsScrollBehavior() {\n if (scrollBehaviorSupported == null) {\n // If we're not in the browser, it can't be supported. Also check for `Element`, because\n // some projects stub out the global `document` during SSR which can throw us off.\n if (typeof document !== 'object' || !document || typeof Element !== 'function' || !Element) {\n scrollBehaviorSupported = false;\n return scrollBehaviorSupported;\n }\n // If the element can have a `scrollBehavior` style, we can be sure that it's supported.\n if ('scrollBehavior' in document.documentElement.style) {\n scrollBehaviorSupported = true;\n }\n else {\n // At this point we have 3 possibilities: `scrollTo` isn't supported at all, it's\n // supported but it doesn't handle scroll behavior, or it has been polyfilled.\n const scrollToFunction = Element.prototype.scrollTo;\n if (scrollToFunction) {\n // We can detect if the function has been polyfilled by calling `toString` on it. Native\n // functions are obfuscated using `[native code]`, whereas if it was overwritten we'd get\n // the actual function source. Via https://davidwalsh.name/detect-native-function. Consider\n // polyfilled functions as supporting scroll behavior.\n scrollBehaviorSupported = !/\\{\\s*\\[native code\\]\\s*\\}/.test(scrollToFunction.toString());\n }\n else {\n scrollBehaviorSupported = false;\n }\n }\n }\n return scrollBehaviorSupported;\n}\n/**\n * Checks the type of RTL scroll axis used by this browser. As of time of writing, Chrome is NORMAL,\n * Firefox & Safari are NEGATED, and IE & Edge are INVERTED.\n */\nfunction getRtlScrollAxisType() {\n // We can't check unless we're on the browser. Just assume 'normal' if we're not.\n if (typeof document !== 'object' || !document) {\n return 0 /* RtlScrollAxisType.NORMAL */;\n }\n if (rtlScrollAxisType == null) {\n // Create a 1px wide scrolling container and a 2px wide content element.\n const scrollContainer = document.createElement('div');\n const containerStyle = scrollContainer.style;\n scrollContainer.dir = 'rtl';\n containerStyle.width = '1px';\n containerStyle.overflow = 'auto';\n containerStyle.visibility = 'hidden';\n containerStyle.pointerEvents = 'none';\n containerStyle.position = 'absolute';\n const content = document.createElement('div');\n const contentStyle = content.style;\n contentStyle.width = '2px';\n contentStyle.height = '1px';\n scrollContainer.appendChild(content);\n document.body.appendChild(scrollContainer);\n rtlScrollAxisType = 0 /* RtlScrollAxisType.NORMAL */;\n // The viewport starts scrolled all the way to the right in RTL mode. If we are in a NORMAL\n // browser this would mean that the scrollLeft should be 1. If it's zero instead we know we're\n // dealing with one of the other two types of browsers.\n if (scrollContainer.scrollLeft === 0) {\n // In a NEGATED browser the scrollLeft is always somewhere in [-maxScrollAmount, 0]. For an\n // INVERTED browser it is always somewhere in [0, maxScrollAmount]. We can determine which by\n // setting to the scrollLeft to 1. This is past the max for a NEGATED browser, so it will\n // return 0 when we read it again.\n scrollContainer.scrollLeft = 1;\n rtlScrollAxisType =\n scrollContainer.scrollLeft === 0 ? 1 /* RtlScrollAxisType.NEGATED */ : 2 /* RtlScrollAxisType.INVERTED */;\n }\n scrollContainer.remove();\n }\n return rtlScrollAxisType;\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nlet shadowDomIsSupported;\n/** Checks whether the user's browser support Shadow DOM. */\nfunction _supportsShadowDom() {\n if (shadowDomIsSupported == null) {\n const head = typeof document !== 'undefined' ? document.head : null;\n shadowDomIsSupported = !!(head && (head.createShadowRoot || head.attachShadow));\n }\n return shadowDomIsSupported;\n}\n/** Gets the shadow root of an element, if supported and the element is inside the Shadow DOM. */\nfunction _getShadowRoot(element) {\n if (_supportsShadowDom()) {\n const rootNode = element.getRootNode ? element.getRootNode() : null;\n // Note that this should be caught by `_supportsShadowDom`, but some\n // teams have been able to hit this code path on unsupported browsers.\n if (typeof ShadowRoot !== 'undefined' && ShadowRoot && rootNode instanceof ShadowRoot) {\n return rootNode;\n }\n }\n return null;\n}\n/**\n * Gets the currently-focused element on the page while\n * also piercing through Shadow DOM boundaries.\n */\nfunction _getFocusedElementPierceShadowDom() {\n let activeElement = typeof document !== 'undefined' && document\n ? document.activeElement\n : null;\n while (activeElement && activeElement.shadowRoot) {\n const newActiveElement = activeElement.shadowRoot.activeElement;\n if (newActiveElement === activeElement) {\n break;\n }\n else {\n activeElement = newActiveElement;\n }\n }\n return activeElement;\n}\n/** Gets the target of an event while accounting for Shadow DOM. */\nfunction _getEventTarget(event) {\n // If an event is bound outside the Shadow DOM, the `event.target` will\n // point to the shadow root so we have to use `composedPath` instead.\n return (event.composedPath ? event.composedPath()[0] : event.target);\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Gets whether the code is currently running in a test environment. */\nfunction _isTestEnvironment() {\n // We can't use `declare const` because it causes conflicts inside Google with the real typings\n // for these symbols and we can't read them off the global object, because they don't appear to\n // be attached there for some runners like Jest.\n // (see: https://github.com/angular/components/issues/23365#issuecomment-938146643)\n return (\n // @ts-ignore\n (typeof __karma__ !== 'undefined' && !!__karma__) ||\n // @ts-ignore\n (typeof jasmine !== 'undefined' && !!jasmine) ||\n // @ts-ignore\n (typeof jest !== 'undefined' && !!jest) ||\n // @ts-ignore\n (typeof Mocha !== 'undefined' && !!Mocha));\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { Platform, PlatformModule, _getEventTarget, _getFocusedElementPierceShadowDom, _getShadowRoot, _isTestEnvironment, _supportsShadowDom, getRtlScrollAxisType, getSupportedInputTypes, normalizePassiveListenerOptions, supportsPassiveEventListeners, supportsScrollBehavior };\n","import * as i0 from '@angular/core';\nimport { ElementRef, Injector, Directive, EventEmitter, Inject, Output, NgModule } from '@angular/core';\nimport { DOCUMENT } from '@angular/common';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Throws an exception when attempting to attach a null portal to a host.\n * @docs-private\n */\nfunction throwNullPortalError() {\n throw Error('Must provide a portal to attach');\n}\n/**\n * Throws an exception when attempting to attach a portal to a host that is already attached.\n * @docs-private\n */\nfunction throwPortalAlreadyAttachedError() {\n throw Error('Host already has a portal attached');\n}\n/**\n * Throws an exception when attempting to attach a portal to an already-disposed host.\n * @docs-private\n */\nfunction throwPortalOutletAlreadyDisposedError() {\n throw Error('This PortalOutlet has already been disposed');\n}\n/**\n * Throws an exception when attempting to attach an unknown portal type.\n * @docs-private\n */\nfunction throwUnknownPortalTypeError() {\n throw Error('Attempting to attach an unknown Portal type. BasePortalOutlet accepts either ' +\n 'a ComponentPortal or a TemplatePortal.');\n}\n/**\n * Throws an exception when attempting to attach a portal to a null host.\n * @docs-private\n */\nfunction throwNullPortalOutletError() {\n throw Error('Attempting to attach a portal to a null PortalOutlet');\n}\n/**\n * Throws an exception when attempting to detach a portal that is not attached.\n * @docs-private\n */\nfunction throwNoPortalAttachedError() {\n throw Error('Attempting to detach a portal that is not attached to a host');\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A `Portal` is something that you want to render somewhere else.\n * It can be attach to / detached from a `PortalOutlet`.\n */\nclass Portal {\n /** Attach this portal to a host. */\n attach(host) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (host == null) {\n throwNullPortalOutletError();\n }\n if (host.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n }\n this._attachedHost = host;\n return host.attach(this);\n }\n /** Detach this portal from its host */\n detach() {\n let host = this._attachedHost;\n if (host != null) {\n this._attachedHost = null;\n host.detach();\n }\n else if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwNoPortalAttachedError();\n }\n }\n /** Whether this portal is attached to a host. */\n get isAttached() {\n return this._attachedHost != null;\n }\n /**\n * Sets the PortalOutlet reference without performing `attach()`. This is used directly by\n * the PortalOutlet when it is performing an `attach()` or `detach()`.\n */\n setAttachedHost(host) {\n this._attachedHost = host;\n }\n}\n/**\n * A `ComponentPortal` is a portal that instantiates some Component upon attachment.\n */\nclass ComponentPortal extends Portal {\n constructor(component, viewContainerRef, injector, componentFactoryResolver, projectableNodes) {\n super();\n this.component = component;\n this.viewContainerRef = viewContainerRef;\n this.injector = injector;\n this.componentFactoryResolver = componentFactoryResolver;\n this.projectableNodes = projectableNodes;\n }\n}\n/**\n * A `TemplatePortal` is a portal that represents some embedded template (TemplateRef).\n */\nclass TemplatePortal extends Portal {\n constructor(\n /** The embedded template that will be used to instantiate an embedded View in the host. */\n templateRef, \n /** Reference to the ViewContainer into which the template will be stamped out. */\n viewContainerRef, \n /** Contextual data to be passed in to the embedded view. */\n context, \n /** The injector to use for the embedded view. */\n injector) {\n super();\n this.templateRef = templateRef;\n this.viewContainerRef = viewContainerRef;\n this.context = context;\n this.injector = injector;\n }\n get origin() {\n return this.templateRef.elementRef;\n }\n /**\n * Attach the portal to the provided `PortalOutlet`.\n * When a context is provided it will override the `context` property of the `TemplatePortal`\n * instance.\n */\n attach(host, context = this.context) {\n this.context = context;\n return super.attach(host);\n }\n detach() {\n this.context = undefined;\n return super.detach();\n }\n}\n/**\n * A `DomPortal` is a portal whose DOM element will be taken from its current position\n * in the DOM and moved into a portal outlet, when it is attached. On detach, the content\n * will be restored to its original position.\n */\nclass DomPortal extends Portal {\n constructor(element) {\n super();\n this.element = element instanceof ElementRef ? element.nativeElement : element;\n }\n}\n/**\n * Partial implementation of PortalOutlet that handles attaching\n * ComponentPortal and TemplatePortal.\n */\nclass BasePortalOutlet {\n constructor() {\n /** Whether this host has already been permanently disposed. */\n this._isDisposed = false;\n // @breaking-change 10.0.0 `attachDomPortal` to become a required abstract method.\n this.attachDomPortal = null;\n }\n /** Whether this host has an attached portal. */\n hasAttached() {\n return !!this._attachedPortal;\n }\n /** Attaches a portal. */\n attach(portal) {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n if (!portal) {\n throwNullPortalError();\n }\n if (this.hasAttached()) {\n throwPortalAlreadyAttachedError();\n }\n if (this._isDisposed) {\n throwPortalOutletAlreadyDisposedError();\n }\n }\n if (portal instanceof ComponentPortal) {\n this._attachedPortal = portal;\n return this.attachComponentPortal(portal);\n }\n else if (portal instanceof TemplatePortal) {\n this._attachedPortal = portal;\n return this.attachTemplatePortal(portal);\n // @breaking-change 10.0.0 remove null check for `this.attachDomPortal`.\n }\n else if (this.attachDomPortal && portal instanceof DomPortal) {\n this._attachedPortal = portal;\n return this.attachDomPortal(portal);\n }\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n throwUnknownPortalTypeError();\n }\n }\n /** Detaches a previously attached portal. */\n detach() {\n if (this._attachedPortal) {\n this._attachedPortal.setAttachedHost(null);\n this._attachedPortal = null;\n }\n this._invokeDisposeFn();\n }\n /** Permanently dispose of this portal host. */\n dispose() {\n if (this.hasAttached()) {\n this.detach();\n }\n this._invokeDisposeFn();\n this._isDisposed = true;\n }\n /** @docs-private */\n setDisposeFn(fn) {\n this._disposeFn = fn;\n }\n _invokeDisposeFn() {\n if (this._disposeFn) {\n this._disposeFn();\n this._disposeFn = null;\n }\n }\n}\n/**\n * @deprecated Use `BasePortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass BasePortalHost extends BasePortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * A PortalOutlet for attaching portals to an arbitrary DOM element outside of the Angular\n * application context.\n */\nclass DomPortalOutlet extends BasePortalOutlet {\n /**\n * @param outletElement Element into which the content is projected.\n * @param _componentFactoryResolver Used to resolve the component factory.\n * Only required when attaching component portals.\n * @param _appRef Reference to the application. Only used in component portals when there\n * is no `ViewContainerRef` available.\n * @param _defaultInjector Injector to use as a fallback when the portal being attached doesn't\n * have one. Only used for component portals.\n * @param _document Reference to the document. Used when attaching a DOM portal. Will eventually\n * become a required parameter.\n */\n constructor(\n /** Element into which the content is projected. */\n outletElement, _componentFactoryResolver, _appRef, _defaultInjector, \n /**\n * @deprecated `_document` Parameter to be made required.\n * @breaking-change 10.0.0\n */\n _document) {\n super();\n this.outletElement = outletElement;\n this._componentFactoryResolver = _componentFactoryResolver;\n this._appRef = _appRef;\n this._defaultInjector = _defaultInjector;\n /**\n * Attaches a DOM portal by transferring its content into the outlet.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 10.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n element.parentNode.insertBefore(anchorNode, element);\n this.outletElement.appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n // We can't use `replaceWith` here because IE doesn't support it.\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /**\n * Attach the given ComponentPortal to DOM element using the ComponentFactoryResolver.\n * @param portal Portal to be attached\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n const resolver = (portal.componentFactoryResolver || this._componentFactoryResolver);\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !resolver) {\n throw Error('Cannot attach component portal to outlet without a ComponentFactoryResolver.');\n }\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n let componentRef;\n // If the portal specifies a ViewContainerRef, we will use that as the attachment point\n // for the component (in terms of Angular's component tree, not rendering).\n // When the ViewContainerRef is missing, we use the factory to create the component directly\n // and then manually attach the view to the application.\n if (portal.viewContainerRef) {\n componentRef = portal.viewContainerRef.createComponent(componentFactory, portal.viewContainerRef.length, portal.injector || portal.viewContainerRef.injector, portal.projectableNodes || undefined);\n this.setDisposeFn(() => componentRef.destroy());\n }\n else {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !this._appRef) {\n throw Error('Cannot attach component portal to outlet without an ApplicationRef.');\n }\n componentRef = componentFactory.create(portal.injector || this._defaultInjector || Injector.NULL);\n this._appRef.attachView(componentRef.hostView);\n this.setDisposeFn(() => {\n // Verify that the ApplicationRef has registered views before trying to detach a host view.\n // This check also protects the `detachView` from being called on a destroyed ApplicationRef.\n if (this._appRef.viewCount > 0) {\n this._appRef.detachView(componentRef.hostView);\n }\n componentRef.destroy();\n });\n }\n // At this point the component has been instantiated, so we move it to the location in the DOM\n // where we want it to be rendered.\n this.outletElement.appendChild(this._getComponentRootNode(componentRef));\n this._attachedPortal = portal;\n return componentRef;\n }\n /**\n * Attaches a template portal to the DOM as an embedded view.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n let viewContainer = portal.viewContainerRef;\n let viewRef = viewContainer.createEmbeddedView(portal.templateRef, portal.context, {\n injector: portal.injector,\n });\n // The method `createEmbeddedView` will add the view as a child of the viewContainer.\n // But for the DomPortalOutlet the view can be added everywhere in the DOM\n // (e.g Overlay Container) To move the view to the specified host element. We just\n // re-append the existing root nodes.\n viewRef.rootNodes.forEach(rootNode => this.outletElement.appendChild(rootNode));\n // Note that we want to detect changes after the nodes have been moved so that\n // any directives inside the portal that are looking at the DOM inside a lifecycle\n // hook won't be invoked too early.\n viewRef.detectChanges();\n this.setDisposeFn(() => {\n let index = viewContainer.indexOf(viewRef);\n if (index !== -1) {\n viewContainer.remove(index);\n }\n });\n this._attachedPortal = portal;\n // TODO(jelbourn): Return locals from view.\n return viewRef;\n }\n /**\n * Clears out a portal from the DOM.\n */\n dispose() {\n super.dispose();\n this.outletElement.remove();\n }\n /** Gets the root HTMLElement for an instantiated component. */\n _getComponentRootNode(componentRef) {\n return componentRef.hostView.rootNodes[0];\n }\n}\n/**\n * @deprecated Use `DomPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass DomPortalHost extends DomPortalOutlet {\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Directive version of a `TemplatePortal`. Because the directive *is* a TemplatePortal,\n * the directive instance itself can be attached to a host, enabling declarative use of portals.\n */\nclass CdkPortal extends TemplatePortal {\n constructor(templateRef, viewContainerRef) {\n super(templateRef, viewContainerRef);\n }\n}\nCdkPortal.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkPortal, deps: [{ token: i0.TemplateRef }, { token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nCdkPortal.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkPortal, selector: \"[cdkPortal]\", exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkPortal, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortal]',\n exportAs: 'cdkPortal',\n }]\n }], ctorParameters: function () { return [{ type: i0.TemplateRef }, { type: i0.ViewContainerRef }]; } });\n/**\n * @deprecated Use `CdkPortal` instead.\n * @breaking-change 9.0.0\n */\nclass TemplatePortalDirective extends CdkPortal {\n}\nTemplatePortalDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: TemplatePortalDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\nTemplatePortalDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: TemplatePortalDirective, selector: \"[cdk-portal], [portal]\", providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ], exportAs: [\"cdkPortal\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: TemplatePortalDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-portal], [portal]',\n exportAs: 'cdkPortal',\n providers: [\n {\n provide: CdkPortal,\n useExisting: TemplatePortalDirective,\n },\n ],\n }]\n }] });\n/**\n * Directive version of a PortalOutlet. Because the directive *is* a PortalOutlet, portals can be\n * directly attached to it, enabling declarative use.\n *\n * Usage:\n * ``\n */\nclass CdkPortalOutlet extends BasePortalOutlet {\n constructor(_componentFactoryResolver, _viewContainerRef, \n /**\n * @deprecated `_document` parameter to be made required.\n * @breaking-change 9.0.0\n */\n _document) {\n super();\n this._componentFactoryResolver = _componentFactoryResolver;\n this._viewContainerRef = _viewContainerRef;\n /** Whether the portal component is initialized. */\n this._isInitialized = false;\n /** Emits when a portal is attached to the outlet. */\n this.attached = new EventEmitter();\n /**\n * Attaches the given DomPortal to this PortalHost by moving all of the portal content into it.\n * @param portal Portal to be attached.\n * @deprecated To be turned into a method.\n * @breaking-change 10.0.0\n */\n this.attachDomPortal = (portal) => {\n // @breaking-change 9.0.0 Remove check and error once the\n // `_document` constructor parameter is required.\n if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Cannot attach DOM portal without _document constructor parameter');\n }\n const element = portal.element;\n if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('DOM portal content must be attached to a parent node.');\n }\n // Anchor used to save the element's previous position so\n // that we can restore it when the portal is detached.\n const anchorNode = this._document.createComment('dom-portal');\n portal.setAttachedHost(this);\n element.parentNode.insertBefore(anchorNode, element);\n this._getRootNode().appendChild(element);\n this._attachedPortal = portal;\n super.setDisposeFn(() => {\n if (anchorNode.parentNode) {\n anchorNode.parentNode.replaceChild(element, anchorNode);\n }\n });\n };\n this._document = _document;\n }\n /** Portal associated with the Portal outlet. */\n get portal() {\n return this._attachedPortal;\n }\n set portal(portal) {\n // Ignore the cases where the `portal` is set to a falsy value before the lifecycle hooks have\n // run. This handles the cases where the user might do something like `
`\n // and attach a portal programmatically in the parent component. When Angular does the first CD\n // round, it will fire the setter with empty string, causing the user's content to be cleared.\n if (this.hasAttached() && !portal && !this._isInitialized) {\n return;\n }\n if (this.hasAttached()) {\n super.detach();\n }\n if (portal) {\n super.attach(portal);\n }\n this._attachedPortal = portal || null;\n }\n /** Component or view reference that is attached to the portal. */\n get attachedRef() {\n return this._attachedRef;\n }\n ngOnInit() {\n this._isInitialized = true;\n }\n ngOnDestroy() {\n super.dispose();\n this._attachedRef = this._attachedPortal = null;\n }\n /**\n * Attach the given ComponentPortal to this PortalOutlet using the ComponentFactoryResolver.\n *\n * @param portal Portal to be attached to the portal outlet.\n * @returns Reference to the created component.\n */\n attachComponentPortal(portal) {\n portal.setAttachedHost(this);\n // If the portal specifies an origin, use that as the logical location of the component\n // in the application tree. Otherwise use the location of this PortalOutlet.\n const viewContainerRef = portal.viewContainerRef != null ? portal.viewContainerRef : this._viewContainerRef;\n const resolver = portal.componentFactoryResolver || this._componentFactoryResolver;\n const componentFactory = resolver.resolveComponentFactory(portal.component);\n const ref = viewContainerRef.createComponent(componentFactory, viewContainerRef.length, portal.injector || viewContainerRef.injector, portal.projectableNodes || undefined);\n // If we're using a view container that's different from the injected one (e.g. when the portal\n // specifies its own) we need to move the component into the outlet, otherwise it'll be rendered\n // inside of the alternate view container.\n if (viewContainerRef !== this._viewContainerRef) {\n this._getRootNode().appendChild(ref.hostView.rootNodes[0]);\n }\n super.setDisposeFn(() => ref.destroy());\n this._attachedPortal = portal;\n this._attachedRef = ref;\n this.attached.emit(ref);\n return ref;\n }\n /**\n * Attach the given TemplatePortal to this PortalHost as an embedded View.\n * @param portal Portal to be attached.\n * @returns Reference to the created embedded view.\n */\n attachTemplatePortal(portal) {\n portal.setAttachedHost(this);\n const viewRef = this._viewContainerRef.createEmbeddedView(portal.templateRef, portal.context, {\n injector: portal.injector,\n });\n super.setDisposeFn(() => this._viewContainerRef.clear());\n this._attachedPortal = portal;\n this._attachedRef = viewRef;\n this.attached.emit(viewRef);\n return viewRef;\n }\n /** Gets the root node of the portal outlet. */\n _getRootNode() {\n const nativeElement = this._viewContainerRef.element.nativeElement;\n // The directive could be set on a template which will result in a comment\n // node being the root. Use the comment's parent node if that is the case.\n return (nativeElement.nodeType === nativeElement.ELEMENT_NODE\n ? nativeElement\n : nativeElement.parentNode);\n }\n}\nCdkPortalOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkPortalOutlet, deps: [{ token: i0.ComponentFactoryResolver }, { token: i0.ViewContainerRef }, { token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Directive });\nCdkPortalOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkPortalOutlet, selector: \"[cdkPortalOutlet]\", inputs: { portal: [\"cdkPortalOutlet\", \"portal\"] }, outputs: { attached: \"attached\" }, exportAs: [\"cdkPortalOutlet\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkPortalOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalOutlet]',\n exportAs: 'cdkPortalOutlet',\n inputs: ['portal: cdkPortalOutlet'],\n }]\n }], ctorParameters: function () { return [{ type: i0.ComponentFactoryResolver }, { type: i0.ViewContainerRef }, { type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; }, propDecorators: { attached: [{\n type: Output\n }] } });\n/**\n * @deprecated Use `CdkPortalOutlet` instead.\n * @breaking-change 9.0.0\n */\nclass PortalHostDirective extends CdkPortalOutlet {\n}\nPortalHostDirective.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalHostDirective, deps: null, target: i0.ɵɵFactoryTarget.Directive });\nPortalHostDirective.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: PortalHostDirective, selector: \"[cdkPortalHost], [portalHost]\", inputs: { portal: [\"cdkPortalHost\", \"portal\"] }, providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ], exportAs: [\"cdkPortalHost\"], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalHostDirective, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkPortalHost], [portalHost]',\n exportAs: 'cdkPortalHost',\n inputs: ['portal: cdkPortalHost'],\n providers: [\n {\n provide: CdkPortalOutlet,\n useExisting: PortalHostDirective,\n },\n ],\n }]\n }] });\nclass PortalModule {\n}\nPortalModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nPortalModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalModule, declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective], exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective] });\nPortalModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: PortalModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Custom injector to be used when providing custom\n * injection tokens to components inside a portal.\n * @docs-private\n * @deprecated Use `Injector.create` instead.\n * @breaking-change 11.0.0\n */\nclass PortalInjector {\n constructor(_parentInjector, _customTokens) {\n this._parentInjector = _parentInjector;\n this._customTokens = _customTokens;\n }\n get(token, notFoundValue) {\n const value = this._customTokens.get(token);\n if (typeof value !== 'undefined') {\n return value;\n }\n return this._parentInjector.get(token, notFoundValue);\n }\n}\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { BasePortalHost, BasePortalOutlet, CdkPortal, CdkPortalOutlet, ComponentPortal, DomPortal, DomPortalHost, DomPortalOutlet, Portal, PortalHostDirective, PortalInjector, PortalModule, TemplatePortal, TemplatePortalDirective };\n","import { SimpleOuterSubscriber, innerSubscribe, SimpleInnerSubscriber } from '../innerSubscribe';\nexport function audit(durationSelector) {\n return function auditOperatorFunction(source) {\n return source.lift(new AuditOperator(durationSelector));\n };\n}\nclass AuditOperator {\n constructor(durationSelector) {\n this.durationSelector = durationSelector;\n }\n call(subscriber, source) {\n return source.subscribe(new AuditSubscriber(subscriber, this.durationSelector));\n }\n}\nclass AuditSubscriber extends SimpleOuterSubscriber {\n constructor(destination, durationSelector) {\n super(destination);\n this.durationSelector = durationSelector;\n this.hasValue = false;\n }\n _next(value) {\n this.value = value;\n this.hasValue = true;\n if (!this.throttled) {\n let duration;\n try {\n const { durationSelector } = this;\n duration = durationSelector(value);\n }\n catch (err) {\n return this.destination.error(err);\n }\n const innerSubscription = innerSubscribe(duration, new SimpleInnerSubscriber(this));\n if (!innerSubscription || innerSubscription.closed) {\n this.clearThrottle();\n }\n else {\n this.add(this.throttled = innerSubscription);\n }\n }\n }\n clearThrottle() {\n const { value, hasValue, throttled } = this;\n if (throttled) {\n this.remove(throttled);\n this.throttled = undefined;\n throttled.unsubscribe();\n }\n if (hasValue) {\n this.value = undefined;\n this.hasValue = false;\n this.destination.next(value);\n }\n }\n notifyNext() {\n this.clearThrottle();\n }\n notifyComplete() {\n this.clearThrottle();\n }\n}\n","import { async } from '../scheduler/async';\nimport { audit } from './audit';\nimport { timer } from '../observable/timer';\nexport function auditTime(duration, scheduler = async) {\n return audit(() => timer(duration, scheduler));\n}\n","import { coerceNumberProperty, coerceElement, coerceBooleanProperty } from '@angular/cdk/coercion';\nimport * as i0 from '@angular/core';\nimport { InjectionToken, forwardRef, Directive, Input, Injectable, Optional, Inject, inject, Component, ViewEncapsulation, ChangeDetectionStrategy, Output, ViewChild, SkipSelf, ElementRef, NgModule } from '@angular/core';\nimport { Subject, of, Observable, fromEvent, animationFrameScheduler, asapScheduler, Subscription, isObservable } from 'rxjs';\nimport { distinctUntilChanged, auditTime, filter, takeUntil, startWith, pairwise, switchMap, shareReplay } from 'rxjs/operators';\nimport * as i1 from '@angular/cdk/platform';\nimport { getRtlScrollAxisType, supportsScrollBehavior, Platform } from '@angular/cdk/platform';\nimport { DOCUMENT } from '@angular/common';\nimport * as i2 from '@angular/cdk/bidi';\nimport { BidiModule } from '@angular/cdk/bidi';\nimport * as i2$1 from '@angular/cdk/collections';\nimport { isDataSource, ArrayDataSource, _VIEW_REPEATER_STRATEGY, _RecycleViewRepeaterStrategy } from '@angular/cdk/collections';\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** The injection token used to specify the virtual scrolling strategy. */\nconst VIRTUAL_SCROLL_STRATEGY = new InjectionToken('VIRTUAL_SCROLL_STRATEGY');\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Virtual scrolling strategy for lists with items of known fixed size. */\nclass FixedSizeVirtualScrollStrategy {\n /**\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n constructor(itemSize, minBufferPx, maxBufferPx) {\n this._scrolledIndexChange = new Subject();\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n this.scrolledIndexChange = this._scrolledIndexChange.pipe(distinctUntilChanged());\n /** The attached viewport. */\n this._viewport = null;\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n }\n /**\n * Attaches this scroll strategy to a viewport.\n * @param viewport The viewport to attach this strategy to.\n */\n attach(viewport) {\n this._viewport = viewport;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** Detaches this scroll strategy from the currently attached viewport. */\n detach() {\n this._scrolledIndexChange.complete();\n this._viewport = null;\n }\n /**\n * Update the item size and buffer size.\n * @param itemSize The size of the items in the virtually scrolling list.\n * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more\n * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more.\n */\n updateItemAndBufferSize(itemSize, minBufferPx, maxBufferPx) {\n if (maxBufferPx < minBufferPx && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CDK virtual scroll: maxBufferPx must be greater than or equal to minBufferPx');\n }\n this._itemSize = itemSize;\n this._minBufferPx = minBufferPx;\n this._maxBufferPx = maxBufferPx;\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentScrolled() {\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onDataLengthChanged() {\n this._updateTotalContentSize();\n this._updateRenderedRange();\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onContentRendered() {\n /* no-op */\n }\n /** @docs-private Implemented as part of VirtualScrollStrategy. */\n onRenderedOffsetChanged() {\n /* no-op */\n }\n /**\n * Scroll to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling.\n */\n scrollToIndex(index, behavior) {\n if (this._viewport) {\n this._viewport.scrollToOffset(index * this._itemSize, behavior);\n }\n }\n /** Update the viewport's total content size. */\n _updateTotalContentSize() {\n if (!this._viewport) {\n return;\n }\n this._viewport.setTotalContentSize(this._viewport.getDataLength() * this._itemSize);\n }\n /** Update the viewport's rendered range. */\n _updateRenderedRange() {\n if (!this._viewport) {\n return;\n }\n const renderedRange = this._viewport.getRenderedRange();\n const newRange = { start: renderedRange.start, end: renderedRange.end };\n const viewportSize = this._viewport.getViewportSize();\n const dataLength = this._viewport.getDataLength();\n let scrollOffset = this._viewport.measureScrollOffset();\n // Prevent NaN as result when dividing by zero.\n let firstVisibleIndex = this._itemSize > 0 ? scrollOffset / this._itemSize : 0;\n // If user scrolls to the bottom of the list and data changes to a smaller list\n if (newRange.end > dataLength) {\n // We have to recalculate the first visible index based on new data length and viewport size.\n const maxVisibleItems = Math.ceil(viewportSize / this._itemSize);\n const newVisibleIndex = Math.max(0, Math.min(firstVisibleIndex, dataLength - maxVisibleItems));\n // If first visible index changed we must update scroll offset to handle start/end buffers\n // Current range must also be adjusted to cover the new position (bottom of new list).\n if (firstVisibleIndex != newVisibleIndex) {\n firstVisibleIndex = newVisibleIndex;\n scrollOffset = newVisibleIndex * this._itemSize;\n newRange.start = Math.floor(firstVisibleIndex);\n }\n newRange.end = Math.max(0, Math.min(dataLength, newRange.start + maxVisibleItems));\n }\n const startBuffer = scrollOffset - newRange.start * this._itemSize;\n if (startBuffer < this._minBufferPx && newRange.start != 0) {\n const expandStart = Math.ceil((this._maxBufferPx - startBuffer) / this._itemSize);\n newRange.start = Math.max(0, newRange.start - expandStart);\n newRange.end = Math.min(dataLength, Math.ceil(firstVisibleIndex + (viewportSize + this._minBufferPx) / this._itemSize));\n }\n else {\n const endBuffer = newRange.end * this._itemSize - (scrollOffset + viewportSize);\n if (endBuffer < this._minBufferPx && newRange.end != dataLength) {\n const expandEnd = Math.ceil((this._maxBufferPx - endBuffer) / this._itemSize);\n if (expandEnd > 0) {\n newRange.end = Math.min(dataLength, newRange.end + expandEnd);\n newRange.start = Math.max(0, Math.floor(firstVisibleIndex - this._minBufferPx / this._itemSize));\n }\n }\n }\n this._viewport.setRenderedRange(newRange);\n this._viewport.setRenderedContentOffset(this._itemSize * newRange.start);\n this._scrolledIndexChange.next(Math.floor(firstVisibleIndex));\n }\n}\n/**\n * Provider factory for `FixedSizeVirtualScrollStrategy` that simply extracts the already created\n * `FixedSizeVirtualScrollStrategy` from the given directive.\n * @param fixedSizeDir The instance of `CdkFixedSizeVirtualScroll` to extract the\n * `FixedSizeVirtualScrollStrategy` from.\n */\nfunction _fixedSizeVirtualScrollStrategyFactory(fixedSizeDir) {\n return fixedSizeDir._scrollStrategy;\n}\n/** A virtual scroll strategy that supports fixed-size items. */\nclass CdkFixedSizeVirtualScroll {\n constructor() {\n this._itemSize = 20;\n this._minBufferPx = 100;\n this._maxBufferPx = 200;\n /** The scroll strategy used by this directive. */\n this._scrollStrategy = new FixedSizeVirtualScrollStrategy(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n /** The size of the items in the list (in pixels). */\n get itemSize() {\n return this._itemSize;\n }\n set itemSize(value) {\n this._itemSize = coerceNumberProperty(value);\n }\n /**\n * The minimum amount of buffer rendered beyond the viewport (in pixels).\n * If the amount of buffer dips below this number, more items will be rendered. Defaults to 100px.\n */\n get minBufferPx() {\n return this._minBufferPx;\n }\n set minBufferPx(value) {\n this._minBufferPx = coerceNumberProperty(value);\n }\n /**\n * The number of pixels worth of buffer to render for when rendering new items. Defaults to 200px.\n */\n get maxBufferPx() {\n return this._maxBufferPx;\n }\n set maxBufferPx(value) {\n this._maxBufferPx = coerceNumberProperty(value);\n }\n ngOnChanges() {\n this._scrollStrategy.updateItemAndBufferSize(this.itemSize, this.minBufferPx, this.maxBufferPx);\n }\n}\nCdkFixedSizeVirtualScroll.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkFixedSizeVirtualScroll, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nCdkFixedSizeVirtualScroll.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkFixedSizeVirtualScroll, isStandalone: true, selector: \"cdk-virtual-scroll-viewport[itemSize]\", inputs: { itemSize: \"itemSize\", minBufferPx: \"minBufferPx\", maxBufferPx: \"maxBufferPx\" }, providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ], usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkFixedSizeVirtualScroll, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[itemSize]',\n standalone: true,\n providers: [\n {\n provide: VIRTUAL_SCROLL_STRATEGY,\n useFactory: _fixedSizeVirtualScrollStrategyFactory,\n deps: [forwardRef(() => CdkFixedSizeVirtualScroll)],\n },\n ],\n }]\n }], propDecorators: { itemSize: [{\n type: Input\n }], minBufferPx: [{\n type: Input\n }], maxBufferPx: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Time in ms to throttle the scrolling events by default. */\nconst DEFAULT_SCROLL_TIME = 20;\n/**\n * Service contained all registered Scrollable references and emits an event when any one of the\n * Scrollable references emit a scrolled event.\n */\nclass ScrollDispatcher {\n constructor(_ngZone, _platform, document) {\n this._ngZone = _ngZone;\n this._platform = _platform;\n /** Subject for notifying that a registered scrollable reference element has been scrolled. */\n this._scrolled = new Subject();\n /** Keeps track of the global `scroll` and `resize` subscriptions. */\n this._globalSubscription = null;\n /** Keeps track of the amount of subscriptions to `scrolled`. Used for cleaning up afterwards. */\n this._scrolledCount = 0;\n /**\n * Map of all the scrollable references that are registered with the service and their\n * scroll event subscriptions.\n */\n this.scrollContainers = new Map();\n this._document = document;\n }\n /**\n * Registers a scrollable instance with the service and listens for its scrolled events. When the\n * scrollable is scrolled, the service emits the event to its scrolled observable.\n * @param scrollable Scrollable instance to be registered.\n */\n register(scrollable) {\n if (!this.scrollContainers.has(scrollable)) {\n this.scrollContainers.set(scrollable, scrollable.elementScrolled().subscribe(() => this._scrolled.next(scrollable)));\n }\n }\n /**\n * De-registers a Scrollable reference and unsubscribes from its scroll event observable.\n * @param scrollable Scrollable instance to be deregistered.\n */\n deregister(scrollable) {\n const scrollableReference = this.scrollContainers.get(scrollable);\n if (scrollableReference) {\n scrollableReference.unsubscribe();\n this.scrollContainers.delete(scrollable);\n }\n }\n /**\n * Returns an observable that emits an event whenever any of the registered Scrollable\n * references (or window, document, or body) fire a scrolled event. Can provide a time in ms\n * to override the default \"throttle\" time.\n *\n * **Note:** in order to avoid hitting change detection for every scroll event,\n * all of the events emitted from this stream will be run outside the Angular zone.\n * If you need to update any data bindings as a result of a scroll event, you have\n * to run the callback using `NgZone.run`.\n */\n scrolled(auditTimeInMs = DEFAULT_SCROLL_TIME) {\n if (!this._platform.isBrowser) {\n return of();\n }\n return new Observable((observer) => {\n if (!this._globalSubscription) {\n this._addGlobalListener();\n }\n // In the case of a 0ms delay, use an observable without auditTime\n // since it does add a perceptible delay in processing overhead.\n const subscription = auditTimeInMs > 0\n ? this._scrolled.pipe(auditTime(auditTimeInMs)).subscribe(observer)\n : this._scrolled.subscribe(observer);\n this._scrolledCount++;\n return () => {\n subscription.unsubscribe();\n this._scrolledCount--;\n if (!this._scrolledCount) {\n this._removeGlobalListener();\n }\n };\n });\n }\n ngOnDestroy() {\n this._removeGlobalListener();\n this.scrollContainers.forEach((_, container) => this.deregister(container));\n this._scrolled.complete();\n }\n /**\n * Returns an observable that emits whenever any of the\n * scrollable ancestors of an element are scrolled.\n * @param elementOrElementRef Element whose ancestors to listen for.\n * @param auditTimeInMs Time to throttle the scroll events.\n */\n ancestorScrolled(elementOrElementRef, auditTimeInMs) {\n const ancestors = this.getAncestorScrollContainers(elementOrElementRef);\n return this.scrolled(auditTimeInMs).pipe(filter(target => {\n return !target || ancestors.indexOf(target) > -1;\n }));\n }\n /** Returns all registered Scrollables that contain the provided element. */\n getAncestorScrollContainers(elementOrElementRef) {\n const scrollingContainers = [];\n this.scrollContainers.forEach((_subscription, scrollable) => {\n if (this._scrollableContainsElement(scrollable, elementOrElementRef)) {\n scrollingContainers.push(scrollable);\n }\n });\n return scrollingContainers;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Returns true if the element is contained within the provided Scrollable. */\n _scrollableContainsElement(scrollable, elementOrElementRef) {\n let element = coerceElement(elementOrElementRef);\n let scrollableElement = scrollable.getElementRef().nativeElement;\n // Traverse through the element parents until we reach null, checking if any of the elements\n // are the scrollable's element.\n do {\n if (element == scrollableElement) {\n return true;\n }\n } while ((element = element.parentElement));\n return false;\n }\n /** Sets up the global scroll listeners. */\n _addGlobalListener() {\n this._globalSubscription = this._ngZone.runOutsideAngular(() => {\n const window = this._getWindow();\n return fromEvent(window.document, 'scroll').subscribe(() => this._scrolled.next());\n });\n }\n /** Cleans up the global scroll listener. */\n _removeGlobalListener() {\n if (this._globalSubscription) {\n this._globalSubscription.unsubscribe();\n this._globalSubscription = null;\n }\n }\n}\nScrollDispatcher.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollDispatcher, deps: [{ token: i0.NgZone }, { token: i1.Platform }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nScrollDispatcher.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollDispatcher, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollDispatcher, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i0.NgZone }, { type: i1.Platform }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Sends an event when the directive's element is scrolled. Registers itself with the\n * ScrollDispatcher service to include itself as part of its collection of scrolling events that it\n * can be listened to through the service.\n */\nclass CdkScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n this.elementRef = elementRef;\n this.scrollDispatcher = scrollDispatcher;\n this.ngZone = ngZone;\n this.dir = dir;\n this._destroyed = new Subject();\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(this.elementRef.nativeElement, 'scroll')\n .pipe(takeUntil(this._destroyed))\n .subscribe(observer)));\n }\n ngOnInit() {\n this.scrollDispatcher.register(this);\n }\n ngOnDestroy() {\n this.scrollDispatcher.deregister(this);\n this._destroyed.next();\n this._destroyed.complete();\n }\n /** Returns observable that emits when a scroll event is fired on the host element. */\n elementScrolled() {\n return this._elementScrolled;\n }\n /** Gets the ElementRef for the viewport. */\n getElementRef() {\n return this.elementRef;\n }\n /**\n * Scrolls to the specified offsets. This is a normalized version of the browser's native scrollTo\n * method, since browsers are not consistent about what scrollLeft means in RTL. For this method\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param options specified the offsets to scroll to.\n */\n scrollTo(options) {\n const el = this.elementRef.nativeElement;\n const isRtl = this.dir && this.dir.value == 'rtl';\n // Rewrite start & end offsets as right or left offsets.\n if (options.left == null) {\n options.left = isRtl ? options.end : options.start;\n }\n if (options.right == null) {\n options.right = isRtl ? options.start : options.end;\n }\n // Rewrite the bottom offset as a top offset.\n if (options.bottom != null) {\n options.top =\n el.scrollHeight - el.clientHeight - options.bottom;\n }\n // Rewrite the right offset as a left offset.\n if (isRtl && getRtlScrollAxisType() != 0 /* RtlScrollAxisType.NORMAL */) {\n if (options.left != null) {\n options.right =\n el.scrollWidth - el.clientWidth - options.left;\n }\n if (getRtlScrollAxisType() == 2 /* RtlScrollAxisType.INVERTED */) {\n options.left = options.right;\n }\n else if (getRtlScrollAxisType() == 1 /* RtlScrollAxisType.NEGATED */) {\n options.left = options.right ? -options.right : options.right;\n }\n }\n else {\n if (options.right != null) {\n options.left =\n el.scrollWidth - el.clientWidth - options.right;\n }\n }\n this._applyScrollToOptions(options);\n }\n _applyScrollToOptions(options) {\n const el = this.elementRef.nativeElement;\n if (supportsScrollBehavior()) {\n el.scrollTo(options);\n }\n else {\n if (options.top != null) {\n el.scrollTop = options.top;\n }\n if (options.left != null) {\n el.scrollLeft = options.left;\n }\n }\n }\n /**\n * Measures the scroll offset relative to the specified edge of the viewport. This method can be\n * used instead of directly checking scrollLeft or scrollTop, since browsers are not consistent\n * about what scrollLeft means in RTL. The values returned by this method are normalized such that\n * left and right always refer to the left and right side of the scrolling container irrespective\n * of the layout direction. start and end refer to left and right in an LTR context and vice-versa\n * in an RTL context.\n * @param from The edge to measure from.\n */\n measureScrollOffset(from) {\n const LEFT = 'left';\n const RIGHT = 'right';\n const el = this.elementRef.nativeElement;\n if (from == 'top') {\n return el.scrollTop;\n }\n if (from == 'bottom') {\n return el.scrollHeight - el.clientHeight - el.scrollTop;\n }\n // Rewrite start & end as left or right offsets.\n const isRtl = this.dir && this.dir.value == 'rtl';\n if (from == 'start') {\n from = isRtl ? RIGHT : LEFT;\n }\n else if (from == 'end') {\n from = isRtl ? LEFT : RIGHT;\n }\n if (isRtl && getRtlScrollAxisType() == 2 /* RtlScrollAxisType.INVERTED */) {\n // For INVERTED, scrollLeft is (scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n else {\n return el.scrollLeft;\n }\n }\n else if (isRtl && getRtlScrollAxisType() == 1 /* RtlScrollAxisType.NEGATED */) {\n // For NEGATED, scrollLeft is -(scrollWidth - clientWidth) when scrolled all the way left and\n // 0 when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft + el.scrollWidth - el.clientWidth;\n }\n else {\n return -el.scrollLeft;\n }\n }\n else {\n // For NORMAL, as well as non-RTL contexts, scrollLeft is 0 when scrolled all the way left and\n // (scrollWidth - clientWidth) when scrolled all the way right.\n if (from == LEFT) {\n return el.scrollLeft;\n }\n else {\n return el.scrollWidth - el.clientWidth - el.scrollLeft;\n }\n }\n }\n}\nCdkScrollable.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollable, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkScrollable.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkScrollable, isStandalone: true, selector: \"[cdk-scrollable], [cdkScrollable]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollable, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdk-scrollable], [cdkScrollable]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Time in ms to throttle the resize events by default. */\nconst DEFAULT_RESIZE_TIME = 20;\n/**\n * Simple utility for getting the bounds of the browser viewport.\n * @docs-private\n */\nclass ViewportRuler {\n constructor(_platform, ngZone, document) {\n this._platform = _platform;\n /** Stream of viewport change events. */\n this._change = new Subject();\n /** Event listener that will be used to handle the viewport change events. */\n this._changeListener = (event) => {\n this._change.next(event);\n };\n this._document = document;\n ngZone.runOutsideAngular(() => {\n if (_platform.isBrowser) {\n const window = this._getWindow();\n // Note that bind the events ourselves, rather than going through something like RxJS's\n // `fromEvent` so that we can ensure that they're bound outside of the NgZone.\n window.addEventListener('resize', this._changeListener);\n window.addEventListener('orientationchange', this._changeListener);\n }\n // Clear the cached position so that the viewport is re-measured next time it is required.\n // We don't need to keep track of the subscription, because it is completed on destroy.\n this.change().subscribe(() => (this._viewportSize = null));\n });\n }\n ngOnDestroy() {\n if (this._platform.isBrowser) {\n const window = this._getWindow();\n window.removeEventListener('resize', this._changeListener);\n window.removeEventListener('orientationchange', this._changeListener);\n }\n this._change.complete();\n }\n /** Returns the viewport's width and height. */\n getViewportSize() {\n if (!this._viewportSize) {\n this._updateViewportSize();\n }\n const output = { width: this._viewportSize.width, height: this._viewportSize.height };\n // If we're not on a browser, don't cache the size since it'll be mocked out anyway.\n if (!this._platform.isBrowser) {\n this._viewportSize = null;\n }\n return output;\n }\n /** Gets a ClientRect for the viewport's bounds. */\n getViewportRect() {\n // Use the document element's bounding rect rather than the window scroll properties\n // (e.g. pageYOffset, scrollY) due to in issue in Chrome and IE where window scroll\n // properties and client coordinates (boundingClientRect, clientX/Y, etc.) are in different\n // conceptual viewports. Under most circumstances these viewports are equivalent, but they\n // can disagree when the page is pinch-zoomed (on devices that support touch).\n // See https://bugs.chromium.org/p/chromium/issues/detail?id=489206#c4\n // We use the documentElement instead of the body because, by default (without a css reset)\n // browsers typically give the document body an 8px margin, which is not included in\n // getBoundingClientRect().\n const scrollPosition = this.getViewportScrollPosition();\n const { width, height } = this.getViewportSize();\n return {\n top: scrollPosition.top,\n left: scrollPosition.left,\n bottom: scrollPosition.top + height,\n right: scrollPosition.left + width,\n height,\n width,\n };\n }\n /** Gets the (top, left) scroll position of the viewport. */\n getViewportScrollPosition() {\n // While we can get a reference to the fake document\n // during SSR, it doesn't have getBoundingClientRect.\n if (!this._platform.isBrowser) {\n return { top: 0, left: 0 };\n }\n // The top-left-corner of the viewport is determined by the scroll position of the document\n // body, normally just (scrollLeft, scrollTop). However, Chrome and Firefox disagree about\n // whether `document.body` or `document.documentElement` is the scrolled element, so reading\n // `scrollTop` and `scrollLeft` is inconsistent. However, using the bounding rect of\n // `document.documentElement` works consistently, where the `top` and `left` values will\n // equal negative the scroll position.\n const document = this._document;\n const window = this._getWindow();\n const documentElement = document.documentElement;\n const documentRect = documentElement.getBoundingClientRect();\n const top = -documentRect.top ||\n document.body.scrollTop ||\n window.scrollY ||\n documentElement.scrollTop ||\n 0;\n const left = -documentRect.left ||\n document.body.scrollLeft ||\n window.scrollX ||\n documentElement.scrollLeft ||\n 0;\n return { top, left };\n }\n /**\n * Returns a stream that emits whenever the size of the viewport changes.\n * This stream emits outside of the Angular zone.\n * @param throttleTime Time in milliseconds to throttle the stream.\n */\n change(throttleTime = DEFAULT_RESIZE_TIME) {\n return throttleTime > 0 ? this._change.pipe(auditTime(throttleTime)) : this._change;\n }\n /** Use defaultView of injected document if available or fallback to global window reference */\n _getWindow() {\n return this._document.defaultView || window;\n }\n /** Updates the cached viewport size. */\n _updateViewportSize() {\n const window = this._getWindow();\n this._viewportSize = this._platform.isBrowser\n ? { width: window.innerWidth, height: window.innerHeight }\n : { width: 0, height: 0 };\n }\n}\nViewportRuler.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ViewportRuler, deps: [{ token: i1.Platform }, { token: i0.NgZone }, { token: DOCUMENT, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nViewportRuler.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ViewportRuler, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ViewportRuler, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: i1.Platform }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nconst VIRTUAL_SCROLLABLE = new InjectionToken('VIRTUAL_SCROLLABLE');\n/**\n * Extending the {@link CdkScrollable} to be used as scrolling container for virtual scrolling.\n */\nclass CdkVirtualScrollable extends CdkScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n }\n /**\n * Measure the viewport size for the provided orientation.\n *\n * @param orientation The orientation to measure the size from.\n */\n measureViewportSize(orientation) {\n const viewportEl = this.elementRef.nativeElement;\n return orientation === 'horizontal' ? viewportEl.clientWidth : viewportEl.clientHeight;\n }\n}\nCdkVirtualScrollable.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollable, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualScrollable.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualScrollable, usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollable, decorators: [{\n type: Directive\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Checks if the given ranges are equal. */\nfunction rangesEqual(r1, r2) {\n return r1.start == r2.start && r1.end == r2.end;\n}\n/**\n * Scheduler to be used for scroll events. Needs to fall back to\n * something that doesn't rely on requestAnimationFrame on environments\n * that don't support it (e.g. server-side rendering).\n */\nconst SCROLL_SCHEDULER = typeof requestAnimationFrame !== 'undefined' ? animationFrameScheduler : asapScheduler;\n/** A viewport that virtualizes its scrolling with the help of `CdkVirtualForOf`. */\nclass CdkVirtualScrollViewport extends CdkVirtualScrollable {\n /** The direction the viewport scrolls. */\n get orientation() {\n return this._orientation;\n }\n set orientation(orientation) {\n if (this._orientation !== orientation) {\n this._orientation = orientation;\n this._calculateSpacerSize();\n }\n }\n /**\n * Whether rendered items should persist in the DOM after scrolling out of view. By default, items\n * will be removed.\n */\n get appendOnly() {\n return this._appendOnly;\n }\n set appendOnly(value) {\n this._appendOnly = coerceBooleanProperty(value);\n }\n constructor(elementRef, _changeDetectorRef, ngZone, _scrollStrategy, dir, scrollDispatcher, viewportRuler, scrollable) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n this.elementRef = elementRef;\n this._changeDetectorRef = _changeDetectorRef;\n this._scrollStrategy = _scrollStrategy;\n this.scrollable = scrollable;\n this._platform = inject(Platform);\n /** Emits when the viewport is detached from a CdkVirtualForOf. */\n this._detachedSubject = new Subject();\n /** Emits when the rendered range changes. */\n this._renderedRangeSubject = new Subject();\n this._orientation = 'vertical';\n this._appendOnly = false;\n // Note: we don't use the typical EventEmitter here because we need to subscribe to the scroll\n // strategy lazily (i.e. only if the user is actually listening to the events). We do this because\n // depending on how the strategy calculates the scrolled index, it may come at a cost to\n // performance.\n /** Emits when the index of the first element visible in the viewport changes. */\n this.scrolledIndexChange = new Observable((observer) => this._scrollStrategy.scrolledIndexChange.subscribe(index => Promise.resolve().then(() => this.ngZone.run(() => observer.next(index)))));\n /** A stream that emits whenever the rendered range changes. */\n this.renderedRangeStream = this._renderedRangeSubject;\n /**\n * The total size of all content (in pixels), including content that is not currently rendered.\n */\n this._totalContentSize = 0;\n /** A string representing the `style.width` property value to be used for the spacer element. */\n this._totalContentWidth = '';\n /** A string representing the `style.height` property value to be used for the spacer element. */\n this._totalContentHeight = '';\n /** The currently rendered range of indices. */\n this._renderedRange = { start: 0, end: 0 };\n /** The length of the data bound to this viewport (in number of items). */\n this._dataLength = 0;\n /** The size of the viewport (in pixels). */\n this._viewportSize = 0;\n /** The last rendered content offset that was set. */\n this._renderedContentOffset = 0;\n /**\n * Whether the last rendered content offset was to the end of the content (and therefore needs to\n * be rewritten as an offset to the start of the content).\n */\n this._renderedContentOffsetNeedsRewrite = false;\n /** Whether there is a pending change detection cycle. */\n this._isChangeDetectionPending = false;\n /** A list of functions to run after the next change detection cycle. */\n this._runAfterChangeDetection = [];\n /** Subscription to changes in the viewport size. */\n this._viewportChanges = Subscription.EMPTY;\n if (!_scrollStrategy && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('Error: cdk-virtual-scroll-viewport requires the \"itemSize\" property to be set.');\n }\n this._viewportChanges = viewportRuler.change().subscribe(() => {\n this.checkViewportSize();\n });\n if (!this.scrollable) {\n // No scrollable is provided, so the virtual-scroll-viewport needs to become a scrollable\n this.elementRef.nativeElement.classList.add('cdk-virtual-scrollable');\n this.scrollable = this;\n }\n }\n ngOnInit() {\n // Scrolling depends on the element dimensions which we can't get during SSR.\n if (!this._platform.isBrowser) {\n return;\n }\n if (this.scrollable === this) {\n super.ngOnInit();\n }\n // It's still too early to measure the viewport at this point. Deferring with a promise allows\n // the Viewport to be rendered with the correct size before we measure. We run this outside the\n // zone to avoid causing more change detection cycles. We handle the change detection loop\n // ourselves instead.\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._measureViewportSize();\n this._scrollStrategy.attach(this);\n this.scrollable\n .elementScrolled()\n .pipe(\n // Start off with a fake scroll event so we properly detect our initial position.\n startWith(null), \n // Collect multiple events into one until the next animation frame. This way if\n // there are multiple scroll events in the same frame we only need to recheck\n // our layout once.\n auditTime(0, SCROLL_SCHEDULER))\n .subscribe(() => this._scrollStrategy.onContentScrolled());\n this._markChangeDetectionNeeded();\n }));\n }\n ngOnDestroy() {\n this.detach();\n this._scrollStrategy.detach();\n // Complete all subjects\n this._renderedRangeSubject.complete();\n this._detachedSubject.complete();\n this._viewportChanges.unsubscribe();\n super.ngOnDestroy();\n }\n /** Attaches a `CdkVirtualScrollRepeater` to this viewport. */\n attach(forOf) {\n if (this._forOf && (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error('CdkVirtualScrollViewport is already attached.');\n }\n // Subscribe to the data stream of the CdkVirtualForOf to keep track of when the data length\n // changes. Run outside the zone to avoid triggering change detection, since we're managing the\n // change detection loop ourselves.\n this.ngZone.runOutsideAngular(() => {\n this._forOf = forOf;\n this._forOf.dataStream.pipe(takeUntil(this._detachedSubject)).subscribe(data => {\n const newLength = data.length;\n if (newLength !== this._dataLength) {\n this._dataLength = newLength;\n this._scrollStrategy.onDataLengthChanged();\n }\n this._doChangeDetection();\n });\n });\n }\n /** Detaches the current `CdkVirtualForOf`. */\n detach() {\n this._forOf = null;\n this._detachedSubject.next();\n }\n /** Gets the length of the data bound to this viewport (in number of items). */\n getDataLength() {\n return this._dataLength;\n }\n /** Gets the size of the viewport (in pixels). */\n getViewportSize() {\n return this._viewportSize;\n }\n // TODO(mmalerba): This is technically out of sync with what's really rendered until a render\n // cycle happens. I'm being careful to only call it after the render cycle is complete and before\n // setting it to something else, but its error prone and should probably be split into\n // `pendingRange` and `renderedRange`, the latter reflecting whats actually in the DOM.\n /** Get the current rendered range of items. */\n getRenderedRange() {\n return this._renderedRange;\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return this.getElementRef().nativeElement.getBoundingClientRect()[from];\n }\n /**\n * Sets the total size of all content (in pixels), including content that is not currently\n * rendered.\n */\n setTotalContentSize(size) {\n if (this._totalContentSize !== size) {\n this._totalContentSize = size;\n this._calculateSpacerSize();\n this._markChangeDetectionNeeded();\n }\n }\n /** Sets the currently rendered range of indices. */\n setRenderedRange(range) {\n if (!rangesEqual(this._renderedRange, range)) {\n if (this.appendOnly) {\n range = { start: 0, end: Math.max(this._renderedRange.end, range.end) };\n }\n this._renderedRangeSubject.next((this._renderedRange = range));\n this._markChangeDetectionNeeded(() => this._scrollStrategy.onContentRendered());\n }\n }\n /**\n * Gets the offset from the start of the viewport to the start of the rendered data (in pixels).\n */\n getOffsetToRenderedContentStart() {\n return this._renderedContentOffsetNeedsRewrite ? null : this._renderedContentOffset;\n }\n /**\n * Sets the offset from the start of the viewport to either the start or end of the rendered data\n * (in pixels).\n */\n setRenderedContentOffset(offset, to = 'to-start') {\n // In appendOnly, we always start from the top\n offset = this.appendOnly && to === 'to-start' ? 0 : offset;\n // For a horizontal viewport in a right-to-left language we need to translate along the x-axis\n // in the negative direction.\n const isRtl = this.dir && this.dir.value == 'rtl';\n const isHorizontal = this.orientation == 'horizontal';\n const axis = isHorizontal ? 'X' : 'Y';\n const axisDirection = isHorizontal && isRtl ? -1 : 1;\n let transform = `translate${axis}(${Number(axisDirection * offset)}px)`;\n this._renderedContentOffset = offset;\n if (to === 'to-end') {\n transform += ` translate${axis}(-100%)`;\n // The viewport should rewrite this as a `to-start` offset on the next render cycle. Otherwise\n // elements will appear to expand in the wrong direction (e.g. `mat-expansion-panel` would\n // expand upward).\n this._renderedContentOffsetNeedsRewrite = true;\n }\n if (this._renderedContentTransform != transform) {\n // We know this value is safe because we parse `offset` with `Number()` before passing it\n // into the string.\n this._renderedContentTransform = transform;\n this._markChangeDetectionNeeded(() => {\n if (this._renderedContentOffsetNeedsRewrite) {\n this._renderedContentOffset -= this.measureRenderedContentSize();\n this._renderedContentOffsetNeedsRewrite = false;\n this.setRenderedContentOffset(this._renderedContentOffset);\n }\n else {\n this._scrollStrategy.onRenderedOffsetChanged();\n }\n });\n }\n }\n /**\n * Scrolls to the given offset from the start of the viewport. Please note that this is not always\n * the same as setting `scrollTop` or `scrollLeft`. In a horizontal viewport with right-to-left\n * direction, this would be the equivalent of setting a fictional `scrollRight` property.\n * @param offset The offset to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToOffset(offset, behavior = 'auto') {\n const options = { behavior };\n if (this.orientation === 'horizontal') {\n options.start = offset;\n }\n else {\n options.top = offset;\n }\n this.scrollable.scrollTo(options);\n }\n /**\n * Scrolls to the offset for the given index.\n * @param index The index of the element to scroll to.\n * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`.\n */\n scrollToIndex(index, behavior = 'auto') {\n this._scrollStrategy.scrollToIndex(index, behavior);\n }\n /**\n * Gets the current scroll offset from the start of the scrollable (in pixels).\n * @param from The edge to measure the offset from. Defaults to 'top' in vertical mode and 'start'\n * in horizontal mode.\n */\n measureScrollOffset(from) {\n // This is to break the call cycle\n let measureScrollOffset;\n if (this.scrollable == this) {\n measureScrollOffset = (_from) => super.measureScrollOffset(_from);\n }\n else {\n measureScrollOffset = (_from) => this.scrollable.measureScrollOffset(_from);\n }\n return Math.max(0, measureScrollOffset(from ?? (this.orientation === 'horizontal' ? 'start' : 'top')) -\n this.measureViewportOffset());\n }\n /**\n * Measures the offset of the viewport from the scrolling container\n * @param from The edge to measure from.\n */\n measureViewportOffset(from) {\n let fromRect;\n const LEFT = 'left';\n const RIGHT = 'right';\n const isRtl = this.dir?.value == 'rtl';\n if (from == 'start') {\n fromRect = isRtl ? RIGHT : LEFT;\n }\n else if (from == 'end') {\n fromRect = isRtl ? LEFT : RIGHT;\n }\n else if (from) {\n fromRect = from;\n }\n else {\n fromRect = this.orientation === 'horizontal' ? 'left' : 'top';\n }\n const scrollerClientRect = this.scrollable.measureBoundingClientRectWithScrollOffset(fromRect);\n const viewportClientRect = this.elementRef.nativeElement.getBoundingClientRect()[fromRect];\n return viewportClientRect - scrollerClientRect;\n }\n /** Measure the combined size of all of the rendered items. */\n measureRenderedContentSize() {\n const contentEl = this._contentWrapper.nativeElement;\n return this.orientation === 'horizontal' ? contentEl.offsetWidth : contentEl.offsetHeight;\n }\n /**\n * Measure the total combined size of the given range. Throws if the range includes items that are\n * not rendered.\n */\n measureRangeSize(range) {\n if (!this._forOf) {\n return 0;\n }\n return this._forOf.measureRangeSize(range, this.orientation);\n }\n /** Update the viewport dimensions and re-render. */\n checkViewportSize() {\n // TODO: Cleanup later when add logic for handling content resize\n this._measureViewportSize();\n this._scrollStrategy.onDataLengthChanged();\n }\n /** Measure the viewport size. */\n _measureViewportSize() {\n this._viewportSize = this.scrollable.measureViewportSize(this.orientation);\n }\n /** Queue up change detection to run. */\n _markChangeDetectionNeeded(runAfter) {\n if (runAfter) {\n this._runAfterChangeDetection.push(runAfter);\n }\n // Use a Promise to batch together calls to `_doChangeDetection`. This way if we set a bunch of\n // properties sequentially we only have to run `_doChangeDetection` once at the end.\n if (!this._isChangeDetectionPending) {\n this._isChangeDetectionPending = true;\n this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => {\n this._doChangeDetection();\n }));\n }\n }\n /** Run change detection. */\n _doChangeDetection() {\n this._isChangeDetectionPending = false;\n // Apply the content transform. The transform can't be set via an Angular binding because\n // bypassSecurityTrustStyle is banned in Google. However the value is safe, it's composed of\n // string literals, a variable that can only be 'X' or 'Y', and user input that is run through\n // the `Number` function first to coerce it to a numeric value.\n this._contentWrapper.nativeElement.style.transform = this._renderedContentTransform;\n // Apply changes to Angular bindings. Note: We must call `markForCheck` to run change detection\n // from the root, since the repeated items are content projected in. Calling `detectChanges`\n // instead does not properly check the projected content.\n this.ngZone.run(() => this._changeDetectorRef.markForCheck());\n const runAfterChangeDetection = this._runAfterChangeDetection;\n this._runAfterChangeDetection = [];\n for (const fn of runAfterChangeDetection) {\n fn();\n }\n }\n /** Calculates the `style.width` and `style.height` for the spacer element. */\n _calculateSpacerSize() {\n this._totalContentHeight =\n this.orientation === 'horizontal' ? '' : `${this._totalContentSize}px`;\n this._totalContentWidth =\n this.orientation === 'horizontal' ? `${this._totalContentSize}px` : '';\n }\n}\nCdkVirtualScrollViewport.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollViewport, deps: [{ token: i0.ElementRef }, { token: i0.ChangeDetectorRef }, { token: i0.NgZone }, { token: VIRTUAL_SCROLL_STRATEGY, optional: true }, { token: i2.Directionality, optional: true }, { token: ScrollDispatcher }, { token: ViewportRuler }, { token: VIRTUAL_SCROLLABLE, optional: true }], target: i0.ɵɵFactoryTarget.Component });\nCdkVirtualScrollViewport.ɵcmp = i0.ɵɵngDeclareComponent({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualScrollViewport, isStandalone: true, selector: \"cdk-virtual-scroll-viewport\", inputs: { orientation: \"orientation\", appendOnly: \"appendOnly\" }, outputs: { scrolledIndexChange: \"scrolledIndexChange\" }, host: { properties: { \"class.cdk-virtual-scroll-orientation-horizontal\": \"orientation === \\\"horizontal\\\"\", \"class.cdk-virtual-scroll-orientation-vertical\": \"orientation !== \\\"horizontal\\\"\" }, classAttribute: \"cdk-virtual-scroll-viewport\" }, providers: [\n {\n provide: CdkScrollable,\n useFactory: (virtualScrollable, viewport) => virtualScrollable || viewport,\n deps: [[new Optional(), new Inject(VIRTUAL_SCROLLABLE)], CdkVirtualScrollViewport],\n },\n ], viewQueries: [{ propertyName: \"_contentWrapper\", first: true, predicate: [\"contentWrapper\"], descendants: true, static: true }], usesInheritance: true, ngImport: i0, template: \"\\n
\\n \\n
\\n\\n
\\n\", styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;transform:translateZ(0)}.cdk-virtual-scrollable{overflow:auto;will-change:scroll-position;contain:strict;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{height:1px;transform-origin:0 0;flex:0 0 auto}[dir=rtl] .cdk-virtual-scroll-spacer{transform-origin:100% 0}\"], changeDetection: i0.ChangeDetectionStrategy.OnPush, encapsulation: i0.ViewEncapsulation.None });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollViewport, decorators: [{\n type: Component,\n args: [{ selector: 'cdk-virtual-scroll-viewport', host: {\n 'class': 'cdk-virtual-scroll-viewport',\n '[class.cdk-virtual-scroll-orientation-horizontal]': 'orientation === \"horizontal\"',\n '[class.cdk-virtual-scroll-orientation-vertical]': 'orientation !== \"horizontal\"',\n }, encapsulation: ViewEncapsulation.None, changeDetection: ChangeDetectionStrategy.OnPush, standalone: true, providers: [\n {\n provide: CdkScrollable,\n useFactory: (virtualScrollable, viewport) => virtualScrollable || viewport,\n deps: [[new Optional(), new Inject(VIRTUAL_SCROLLABLE)], CdkVirtualScrollViewport],\n },\n ], template: \"\\n
\\n \\n
\\n\\n
\\n\", styles: [\"cdk-virtual-scroll-viewport{display:block;position:relative;transform:translateZ(0)}.cdk-virtual-scrollable{overflow:auto;will-change:scroll-position;contain:strict;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{height:1px;transform-origin:0 0;flex:0 0 auto}[dir=rtl] .cdk-virtual-scroll-spacer{transform-origin:100% 0}\"] }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.ChangeDetectorRef }, { type: i0.NgZone }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLL_STRATEGY]\n }] }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }, { type: ScrollDispatcher }, { type: ViewportRuler }, { type: CdkVirtualScrollable, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [VIRTUAL_SCROLLABLE]\n }] }]; }, propDecorators: { orientation: [{\n type: Input\n }], appendOnly: [{\n type: Input\n }], scrolledIndexChange: [{\n type: Output\n }], _contentWrapper: [{\n type: ViewChild,\n args: ['contentWrapper', { static: true }]\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/** Helper to extract the offset of a DOM Node in a certain direction. */\nfunction getOffset(orientation, direction, node) {\n const el = node;\n if (!el.getBoundingClientRect) {\n return 0;\n }\n const rect = el.getBoundingClientRect();\n if (orientation === 'horizontal') {\n return direction === 'start' ? rect.left : rect.right;\n }\n return direction === 'start' ? rect.top : rect.bottom;\n}\n/**\n * A directive similar to `ngForOf` to be used for rendering data inside a virtual scrolling\n * container.\n */\nclass CdkVirtualForOf {\n /** The DataSource to display. */\n get cdkVirtualForOf() {\n return this._cdkVirtualForOf;\n }\n set cdkVirtualForOf(value) {\n this._cdkVirtualForOf = value;\n if (isDataSource(value)) {\n this._dataSourceChanges.next(value);\n }\n else {\n // If value is an an NgIterable, convert it to an array.\n this._dataSourceChanges.next(new ArrayDataSource(isObservable(value) ? value : Array.from(value || [])));\n }\n }\n /**\n * The `TrackByFunction` to use for tracking changes. The `TrackByFunction` takes the index and\n * the item and produces a value to be used as the item's identity when tracking changes.\n */\n get cdkVirtualForTrackBy() {\n return this._cdkVirtualForTrackBy;\n }\n set cdkVirtualForTrackBy(fn) {\n this._needsUpdate = true;\n this._cdkVirtualForTrackBy = fn\n ? (index, item) => fn(index + (this._renderedRange ? this._renderedRange.start : 0), item)\n : undefined;\n }\n /** The template used to stamp out new elements. */\n set cdkVirtualForTemplate(value) {\n if (value) {\n this._needsUpdate = true;\n this._template = value;\n }\n }\n /**\n * The size of the cache used to store templates that are not being used for re-use later.\n * Setting the cache size to `0` will disable caching. Defaults to 20 templates.\n */\n get cdkVirtualForTemplateCacheSize() {\n return this._viewRepeater.viewCacheSize;\n }\n set cdkVirtualForTemplateCacheSize(size) {\n this._viewRepeater.viewCacheSize = coerceNumberProperty(size);\n }\n constructor(\n /** The view container to add items to. */\n _viewContainerRef, \n /** The template to use when stamping out new items. */\n _template, \n /** The set of available differs. */\n _differs, \n /** The strategy used to render items in the virtual scroll viewport. */\n _viewRepeater, \n /** The virtual scrolling viewport that these items are being rendered in. */\n _viewport, ngZone) {\n this._viewContainerRef = _viewContainerRef;\n this._template = _template;\n this._differs = _differs;\n this._viewRepeater = _viewRepeater;\n this._viewport = _viewport;\n /** Emits when the rendered view of the data changes. */\n this.viewChange = new Subject();\n /** Subject that emits when a new DataSource instance is given. */\n this._dataSourceChanges = new Subject();\n /** Emits whenever the data in the current DataSource changes. */\n this.dataStream = this._dataSourceChanges.pipe(\n // Start off with null `DataSource`.\n startWith(null), \n // Bundle up the previous and current data sources so we can work with both.\n pairwise(), \n // Use `_changeDataSource` to disconnect from the previous data source and connect to the\n // new one, passing back a stream of data changes which we run through `switchMap` to give\n // us a data stream that emits the latest data from whatever the current `DataSource` is.\n switchMap(([prev, cur]) => this._changeDataSource(prev, cur)), \n // Replay the last emitted data when someone subscribes.\n shareReplay(1));\n /** The differ used to calculate changes to the data. */\n this._differ = null;\n /** Whether the rendered data should be updated during the next ngDoCheck cycle. */\n this._needsUpdate = false;\n this._destroyed = new Subject();\n this.dataStream.subscribe(data => {\n this._data = data;\n this._onRenderedDataChange();\n });\n this._viewport.renderedRangeStream.pipe(takeUntil(this._destroyed)).subscribe(range => {\n this._renderedRange = range;\n if (this.viewChange.observers.length) {\n ngZone.run(() => this.viewChange.next(this._renderedRange));\n }\n this._onRenderedDataChange();\n });\n this._viewport.attach(this);\n }\n /**\n * Measures the combined size (width for horizontal orientation, height for vertical) of all items\n * in the specified range. Throws an error if the range includes items that are not currently\n * rendered.\n */\n measureRangeSize(range, orientation) {\n if (range.start >= range.end) {\n return 0;\n }\n if ((range.start < this._renderedRange.start || range.end > this._renderedRange.end) &&\n (typeof ngDevMode === 'undefined' || ngDevMode)) {\n throw Error(`Error: attempted to measure an item that isn't rendered.`);\n }\n // The index into the list of rendered views for the first item in the range.\n const renderedStartIndex = range.start - this._renderedRange.start;\n // The length of the range we're measuring.\n const rangeLen = range.end - range.start;\n // Loop over all the views, find the first and land node and compute the size by subtracting\n // the top of the first node from the bottom of the last one.\n let firstNode;\n let lastNode;\n // Find the first node by starting from the beginning and going forwards.\n for (let i = 0; i < rangeLen; i++) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n firstNode = lastNode = view.rootNodes[0];\n break;\n }\n }\n // Find the last node by starting from the end and going backwards.\n for (let i = rangeLen - 1; i > -1; i--) {\n const view = this._viewContainerRef.get(i + renderedStartIndex);\n if (view && view.rootNodes.length) {\n lastNode = view.rootNodes[view.rootNodes.length - 1];\n break;\n }\n }\n return firstNode && lastNode\n ? getOffset(orientation, 'end', lastNode) - getOffset(orientation, 'start', firstNode)\n : 0;\n }\n ngDoCheck() {\n if (this._differ && this._needsUpdate) {\n // TODO(mmalerba): We should differentiate needs update due to scrolling and a new portion of\n // this list being rendered (can use simpler algorithm) vs needs update due to data actually\n // changing (need to do this diff).\n const changes = this._differ.diff(this._renderedItems);\n if (!changes) {\n this._updateContext();\n }\n else {\n this._applyChanges(changes);\n }\n this._needsUpdate = false;\n }\n }\n ngOnDestroy() {\n this._viewport.detach();\n this._dataSourceChanges.next(undefined);\n this._dataSourceChanges.complete();\n this.viewChange.complete();\n this._destroyed.next();\n this._destroyed.complete();\n this._viewRepeater.detach();\n }\n /** React to scroll state changes in the viewport. */\n _onRenderedDataChange() {\n if (!this._renderedRange) {\n return;\n }\n this._renderedItems = this._data.slice(this._renderedRange.start, this._renderedRange.end);\n if (!this._differ) {\n // Use a wrapper function for the `trackBy` so any new values are\n // picked up automatically without having to recreate the differ.\n this._differ = this._differs.find(this._renderedItems).create((index, item) => {\n return this.cdkVirtualForTrackBy ? this.cdkVirtualForTrackBy(index, item) : item;\n });\n }\n this._needsUpdate = true;\n }\n /** Swap out one `DataSource` for another. */\n _changeDataSource(oldDs, newDs) {\n if (oldDs) {\n oldDs.disconnect(this);\n }\n this._needsUpdate = true;\n return newDs ? newDs.connect(this) : of();\n }\n /** Update the `CdkVirtualForOfContext` for all views. */\n _updateContext() {\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n view.detectChanges();\n }\n }\n /** Apply changes to the DOM. */\n _applyChanges(changes) {\n this._viewRepeater.applyChanges(changes, this._viewContainerRef, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record, currentIndex), record => record.item);\n // Update $implicit for any items that had an identity change.\n changes.forEachIdentityChange((record) => {\n const view = this._viewContainerRef.get(record.currentIndex);\n view.context.$implicit = record.item;\n });\n // Update the context variables on all items.\n const count = this._data.length;\n let i = this._viewContainerRef.length;\n while (i--) {\n const view = this._viewContainerRef.get(i);\n view.context.index = this._renderedRange.start + i;\n view.context.count = count;\n this._updateComputedContextProperties(view.context);\n }\n }\n /** Update the computed properties on the `CdkVirtualForOfContext`. */\n _updateComputedContextProperties(context) {\n context.first = context.index === 0;\n context.last = context.index === context.count - 1;\n context.even = context.index % 2 === 0;\n context.odd = !context.even;\n }\n _getEmbeddedViewArgs(record, index) {\n // Note that it's important that we insert the item directly at the proper index,\n // rather than inserting it and the moving it in place, because if there's a directive\n // on the same node that injects the `ViewContainerRef`, Angular will insert another\n // comment node which can throw off the move when it's being repeated for all items.\n return {\n templateRef: this._template,\n context: {\n $implicit: record.item,\n // It's guaranteed that the iterable is not \"undefined\" or \"null\" because we only\n // generate views for elements if the \"cdkVirtualForOf\" iterable has elements.\n cdkVirtualForOf: this._cdkVirtualForOf,\n index: -1,\n count: -1,\n first: false,\n last: false,\n odd: false,\n even: false,\n },\n index,\n };\n }\n}\nCdkVirtualForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }, { token: _VIEW_REPEATER_STRATEGY }, { token: CdkVirtualScrollViewport, skipSelf: true }, { token: i0.NgZone }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualForOf, isStandalone: true, selector: \"[cdkVirtualFor][cdkVirtualForOf]\", inputs: { cdkVirtualForOf: \"cdkVirtualForOf\", cdkVirtualForTrackBy: \"cdkVirtualForTrackBy\", cdkVirtualForTemplate: \"cdkVirtualForTemplate\", cdkVirtualForTemplateCacheSize: \"cdkVirtualForTemplateCacheSize\" }, providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }], ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualFor][cdkVirtualForOf]',\n providers: [{ provide: _VIEW_REPEATER_STRATEGY, useClass: _RecycleViewRepeaterStrategy }],\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }, { type: i2$1._RecycleViewRepeaterStrategy, decorators: [{\n type: Inject,\n args: [_VIEW_REPEATER_STRATEGY]\n }] }, { type: CdkVirtualScrollViewport, decorators: [{\n type: SkipSelf\n }] }, { type: i0.NgZone }]; }, propDecorators: { cdkVirtualForOf: [{\n type: Input\n }], cdkVirtualForTrackBy: [{\n type: Input\n }], cdkVirtualForTemplate: [{\n type: Input\n }], cdkVirtualForTemplateCacheSize: [{\n type: Input\n }] } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Provides a virtual scrollable for the element it is attached to.\n */\nclass CdkVirtualScrollableElement extends CdkVirtualScrollable {\n constructor(elementRef, scrollDispatcher, ngZone, dir) {\n super(elementRef, scrollDispatcher, ngZone, dir);\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return (this.getElementRef().nativeElement.getBoundingClientRect()[from] -\n this.measureScrollOffset(from));\n }\n}\nCdkVirtualScrollableElement.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollableElement, deps: [{ token: i0.ElementRef }, { token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualScrollableElement.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualScrollableElement, isStandalone: true, selector: \"[cdkVirtualScrollingElement]\", host: { classAttribute: \"cdk-virtual-scrollable\" }, providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableElement }], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollableElement, decorators: [{\n type: Directive,\n args: [{\n selector: '[cdkVirtualScrollingElement]',\n providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableElement }],\n standalone: true,\n host: {\n 'class': 'cdk-virtual-scrollable',\n },\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n/**\n * Provides as virtual scrollable for the global / window scrollbar.\n */\nclass CdkVirtualScrollableWindow extends CdkVirtualScrollable {\n constructor(scrollDispatcher, ngZone, dir) {\n super(new ElementRef(document.documentElement), scrollDispatcher, ngZone, dir);\n this._elementScrolled = new Observable((observer) => this.ngZone.runOutsideAngular(() => fromEvent(document, 'scroll').pipe(takeUntil(this._destroyed)).subscribe(observer)));\n }\n measureBoundingClientRectWithScrollOffset(from) {\n return this.getElementRef().nativeElement.getBoundingClientRect()[from];\n }\n}\nCdkVirtualScrollableWindow.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollableWindow, deps: [{ token: ScrollDispatcher }, { token: i0.NgZone }, { token: i2.Directionality, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nCdkVirtualScrollableWindow.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", type: CdkVirtualScrollableWindow, isStandalone: true, selector: \"cdk-virtual-scroll-viewport[scrollWindow]\", providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableWindow }], usesInheritance: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkVirtualScrollableWindow, decorators: [{\n type: Directive,\n args: [{\n selector: 'cdk-virtual-scroll-viewport[scrollWindow]',\n providers: [{ provide: VIRTUAL_SCROLLABLE, useExisting: CdkVirtualScrollableWindow }],\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: ScrollDispatcher }, { type: i0.NgZone }, { type: i2.Directionality, decorators: [{\n type: Optional\n }] }]; } });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\nclass CdkScrollableModule {\n}\nCdkScrollableModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollableModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCdkScrollableModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollableModule, imports: [CdkScrollable], exports: [CdkScrollable] });\nCdkScrollableModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollableModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: CdkScrollableModule, decorators: [{\n type: NgModule,\n args: [{\n exports: [CdkScrollable],\n imports: [CdkScrollable],\n }]\n }] });\n/**\n * @docs-primary-export\n */\nclass ScrollingModule {\n}\nScrollingModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollingModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nScrollingModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollingModule, imports: [BidiModule, CdkScrollableModule, CdkVirtualScrollViewport,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement], exports: [BidiModule, CdkScrollableModule, CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement] });\nScrollingModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollingModule, imports: [BidiModule,\n CdkScrollableModule,\n CdkVirtualScrollViewport, BidiModule, CdkScrollableModule] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.0-rc.0\", ngImport: i0, type: ScrollingModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [\n BidiModule,\n CdkScrollableModule,\n CdkVirtualScrollViewport,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement,\n ],\n exports: [\n BidiModule,\n CdkScrollableModule,\n CdkFixedSizeVirtualScroll,\n CdkVirtualForOf,\n CdkVirtualScrollViewport,\n CdkVirtualScrollableWindow,\n CdkVirtualScrollableElement,\n ],\n }]\n }] });\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * @license\n * Copyright Google LLC All Rights Reserved.\n *\n * Use of this source code is governed by an MIT-style license that can be\n * found in the LICENSE file at https://angular.io/license\n */\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { CdkFixedSizeVirtualScroll, CdkScrollable, CdkScrollableModule, CdkVirtualForOf, CdkVirtualScrollViewport, CdkVirtualScrollable, CdkVirtualScrollableElement, CdkVirtualScrollableWindow, DEFAULT_RESIZE_TIME, DEFAULT_SCROLL_TIME, FixedSizeVirtualScrollStrategy, ScrollDispatcher, ScrollingModule, VIRTUAL_SCROLLABLE, VIRTUAL_SCROLL_STRATEGY, ViewportRuler, _fixedSizeVirtualScrollStrategyFactory };\n","/**\n * @license Angular v15.2.9\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i0 from '@angular/core';\nimport { InjectionToken, Injectable, ɵɵinject, Inject, inject, Optional, EventEmitter, ɵfindLocaleData, ɵLocaleDataIndex, ɵgetLocaleCurrencyCode, ɵgetLocalePluralCase, LOCALE_ID, ɵregisterLocaleData, ɵstringify, Directive, Input, createNgModule, NgModuleRef, ɵRuntimeError, Host, Attribute, RendererStyleFlags2, ɵisPromise, ɵisSubscribable, Pipe, DEFAULT_CURRENCY_CODE, NgModule, Version, ɵɵdefineInjectable, ɵformatRuntimeError, Renderer2, ElementRef, Injector, PLATFORM_ID, NgZone } from '@angular/core';\n\nlet _DOM = null;\nfunction getDOM() {\n return _DOM;\n}\nfunction setRootDomAdapter(adapter) {\n if (!_DOM) {\n _DOM = adapter;\n }\n}\n/* tslint:disable:requireParameterType */\n/**\n * Provides DOM operations in an environment-agnostic way.\n *\n * @security Tread carefully! Interacting with the DOM directly is dangerous and\n * can introduce XSS risks.\n */\nclass DomAdapter {\n}\n\n/**\n * A DI Token representing the main rendering context.\n * In a browser and SSR this is the DOM Document.\n * When using SSR, that document is created by [Domino](https://github.com/angular/domino).\n *\n * @publicApi\n */\nconst DOCUMENT = new InjectionToken('DocumentToken');\n\n/**\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be\n * platform-agnostic.\n * This means that we can have different implementation of `PlatformLocation` for the different\n * platforms that Angular supports. For example, `@angular/platform-browser` provides an\n * implementation specific to the browser environment, while `@angular/platform-server` provides\n * one suitable for use with server-side rendering.\n *\n * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy}\n * when they need to interact with the DOM APIs like pushState, popState, etc.\n *\n * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly\n * by the {@link Router} in order to navigate between routes. Since all interactions between {@link\n * Router} /\n * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation`\n * class, they are all platform-agnostic.\n *\n * @publicApi\n */\nclass PlatformLocation {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PlatformLocation, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PlatformLocation, providedIn: 'platform', useFactory: useBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: useBrowserPlatformLocation\n }]\n }] });\nfunction useBrowserPlatformLocation() {\n return ɵɵinject(BrowserPlatformLocation);\n}\n/**\n * @description\n * Indicates when a location is initialized.\n *\n * @publicApi\n */\nconst LOCATION_INITIALIZED = new InjectionToken('Location Initialized');\n/**\n * `PlatformLocation` encapsulates all of the direct calls to platform APIs.\n * This class should not be used directly by an application developer. Instead, use\n * {@link Location}.\n *\n * @publicApi\n */\nclass BrowserPlatformLocation extends PlatformLocation {\n constructor(_doc) {\n super();\n this._doc = _doc;\n this._location = window.location;\n this._history = window.history;\n }\n getBaseHrefFromDOM() {\n return getDOM().getBaseHref(this._doc);\n }\n onPopState(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('popstate', fn, false);\n return () => window.removeEventListener('popstate', fn);\n }\n onHashChange(fn) {\n const window = getDOM().getGlobalEventTarget(this._doc, 'window');\n window.addEventListener('hashchange', fn, false);\n return () => window.removeEventListener('hashchange', fn);\n }\n get href() {\n return this._location.href;\n }\n get protocol() {\n return this._location.protocol;\n }\n get hostname() {\n return this._location.hostname;\n }\n get port() {\n return this._location.port;\n }\n get pathname() {\n return this._location.pathname;\n }\n get search() {\n return this._location.search;\n }\n get hash() {\n return this._location.hash;\n }\n set pathname(newPath) {\n this._location.pathname = newPath;\n }\n pushState(state, title, url) {\n if (supportsState()) {\n this._history.pushState(state, title, url);\n }\n else {\n this._location.hash = url;\n }\n }\n replaceState(state, title, url) {\n if (supportsState()) {\n this._history.replaceState(state, title, url);\n }\n else {\n this._location.hash = url;\n }\n }\n forward() {\n this._history.forward();\n }\n back() {\n this._history.back();\n }\n historyGo(relativePosition = 0) {\n this._history.go(relativePosition);\n }\n getState() {\n return this._history.state;\n }\n}\nBrowserPlatformLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserPlatformLocation, deps: [{ token: DOCUMENT }], target: i0.ɵɵFactoryTarget.Injectable });\nBrowserPlatformLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserPlatformLocation, providedIn: 'platform', useFactory: createBrowserPlatformLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: BrowserPlatformLocation, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'platform',\n // See #23917\n useFactory: createBrowserPlatformLocation,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [DOCUMENT]\n }] }]; } });\nfunction supportsState() {\n return !!window.history.pushState;\n}\nfunction createBrowserPlatformLocation() {\n return new BrowserPlatformLocation(ɵɵinject(DOCUMENT));\n}\n\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nfunction joinWithSlash(start, end) {\n if (start.length == 0) {\n return end;\n }\n if (end.length == 0) {\n return start;\n }\n let slashes = 0;\n if (start.endsWith('/')) {\n slashes++;\n }\n if (end.startsWith('/')) {\n slashes++;\n }\n if (slashes == 2) {\n return start + end.substring(1);\n }\n if (slashes == 1) {\n return start + end;\n }\n return start + '/' + end;\n}\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nfunction stripTrailingSlash(url) {\n const match = url.match(/#|\\?|$/);\n const pathEndIdx = match && match.index || url.length;\n const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0);\n return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx);\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nfunction normalizeQueryParams(params) {\n return params && params[0] !== '?' ? '?' + params : params;\n}\n\n/**\n * Enables the `Location` service to read route state from the browser's URL.\n * Angular provides two strategies:\n * `HashLocationStrategy` and `PathLocationStrategy`.\n *\n * Applications should use the `Router` or `Location` services to\n * interact with application route state.\n *\n * For instance, `HashLocationStrategy` produces URLs like\n * http://example.com#/foo,\n * and `PathLocationStrategy` produces\n * http://example.com/foo as an equivalent URL.\n *\n * See these two classes for more.\n *\n * @publicApi\n */\nclass LocationStrategy {\n historyGo(relativePosition) {\n throw new Error('Not implemented');\n }\n}\nLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LocationStrategy, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LocationStrategy, providedIn: 'root', useFactory: () => inject(PathLocationStrategy) });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root', useFactory: () => inject(PathLocationStrategy) }]\n }] });\n/**\n * A predefined [DI token](guide/glossary#di-token) for the base href\n * to be used with the `PathLocationStrategy`.\n * The base href is the URL prefix that should be preserved when generating\n * and recognizing URLs.\n *\n * @usageNotes\n *\n * The following example shows how to use this token to configure the root app injector\n * with a base href value, so that the DI framework can supply the dependency anywhere in the app.\n *\n * ```typescript\n * import {Component, NgModule} from '@angular/core';\n * import {APP_BASE_HREF} from '@angular/common';\n *\n * @NgModule({\n * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}]\n * })\n * class AppModule {}\n * ```\n *\n * @publicApi\n */\nconst APP_BASE_HREF = new InjectionToken('appBaseHref');\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the\n * browser's URL.\n *\n * If you're using `PathLocationStrategy`, you may provide a {@link APP_BASE_HREF}\n * or add a `` element to the document to override the default.\n *\n * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly,\n * the `` and/or `APP_BASE_HREF` should end with a `/`.\n *\n * Similarly, if you add `` to the document and call\n * `location.go('/foo')`, the browser's URL will become\n * `example.com/my/app/foo`.\n *\n * Note that when using `PathLocationStrategy`, neither the query nor\n * the fragment in the `` will be preserved, as outlined\n * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2).\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/path_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass PathLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, href) {\n super();\n this._platformLocation = _platformLocation;\n this._removeListenerFns = [];\n this._baseHref = href ?? this._platformLocation.getBaseHrefFromDOM() ??\n inject(DOCUMENT).location?.origin ?? '';\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n prepareExternalUrl(internal) {\n return joinWithSlash(this._baseHref, internal);\n }\n path(includeHash = false) {\n const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search);\n const hash = this._platformLocation.hash;\n return hash && includeHash ? `${pathname}${hash}` : pathname;\n }\n pushState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.pushState(state, title, externalUrl);\n }\n replaceState(state, title, url, queryParams) {\n const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams));\n this._platformLocation.replaceState(state, title, externalUrl);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n}\nPathLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PathLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nPathLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PathLocationStrategy, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PathLocationStrategy, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @description\n * A {@link LocationStrategy} used to configure the {@link Location} service to\n * represent its state in the\n * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax)\n * of the browser's URL.\n *\n * For instance, if you call `location.go('/foo')`, the browser's URL will become\n * `example.com#/foo`.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/location/ts/hash_location_component.ts region='LocationComponent'}\n *\n * @publicApi\n */\nclass HashLocationStrategy extends LocationStrategy {\n constructor(_platformLocation, _baseHref) {\n super();\n this._platformLocation = _platformLocation;\n this._baseHref = '';\n this._removeListenerFns = [];\n if (_baseHref != null) {\n this._baseHref = _baseHref;\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n while (this._removeListenerFns.length) {\n this._removeListenerFns.pop()();\n }\n }\n onPopState(fn) {\n this._removeListenerFns.push(this._platformLocation.onPopState(fn), this._platformLocation.onHashChange(fn));\n }\n getBaseHref() {\n return this._baseHref;\n }\n path(includeHash = false) {\n // the hash value is always prefixed with a `#`\n // and if it is empty then it will stay empty\n let path = this._platformLocation.hash;\n if (path == null)\n path = '#';\n return path.length > 0 ? path.substring(1) : path;\n }\n prepareExternalUrl(internal) {\n const url = joinWithSlash(this._baseHref, internal);\n return url.length > 0 ? ('#' + url) : url;\n }\n pushState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.pushState(state, title, url);\n }\n replaceState(state, title, path, queryParams) {\n let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams));\n if (url.length == 0) {\n url = this._platformLocation.pathname;\n }\n this._platformLocation.replaceState(state, title, url);\n }\n forward() {\n this._platformLocation.forward();\n }\n back() {\n this._platformLocation.back();\n }\n getState() {\n return this._platformLocation.getState();\n }\n historyGo(relativePosition = 0) {\n this._platformLocation.historyGo?.(relativePosition);\n }\n}\nHashLocationStrategy.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HashLocationStrategy, deps: [{ token: PlatformLocation }, { token: APP_BASE_HREF, optional: true }], target: i0.ɵɵFactoryTarget.Injectable });\nHashLocationStrategy.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HashLocationStrategy });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HashLocationStrategy, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: PlatformLocation }, { type: undefined, decorators: [{\n type: Optional\n }, {\n type: Inject,\n args: [APP_BASE_HREF]\n }] }]; } });\n\n/**\n * @description\n *\n * A service that applications can use to interact with a browser's URL.\n *\n * Depending on the `LocationStrategy` used, `Location` persists\n * to the URL's path or the URL's hash segment.\n *\n * @usageNotes\n *\n * It's better to use the `Router.navigate()` service to trigger route changes. Use\n * `Location` only if you need to interact with or create normalized URLs outside of\n * routing.\n *\n * `Location` is responsible for normalizing the URL against the application's base href.\n * A normalized URL is absolute from the URL host, includes the application's base href, and has no\n * trailing slash:\n * - `/my/app/user/123` is normalized\n * - `my/app/user/123` **is not** normalized\n * - `/my/app/user/123/` **is not** normalized\n *\n * ### Example\n *\n * \n *\n * @publicApi\n */\nclass Location {\n constructor(locationStrategy) {\n /** @internal */\n this._subject = new EventEmitter();\n /** @internal */\n this._urlChangeListeners = [];\n /** @internal */\n this._urlChangeSubscription = null;\n this._locationStrategy = locationStrategy;\n const baseHref = this._locationStrategy.getBaseHref();\n // Note: This class's interaction with base HREF does not fully follow the rules\n // outlined in the spec https://www.freesoft.org/CIE/RFC/1808/18.htm.\n // Instead of trying to fix individual bugs with more and more code, we should\n // investigate using the URL constructor and providing the base as a second\n // argument.\n // https://developer.mozilla.org/en-US/docs/Web/API/URL/URL#parameters\n this._basePath = _stripOrigin(stripTrailingSlash(_stripIndexHtml(baseHref)));\n this._locationStrategy.onPopState((ev) => {\n this._subject.emit({\n 'url': this.path(true),\n 'pop': true,\n 'state': ev.state,\n 'type': ev.type,\n });\n });\n }\n /** @nodoc */\n ngOnDestroy() {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeListeners = [];\n }\n /**\n * Normalizes the URL path for this location.\n *\n * @param includeHash True to include an anchor fragment in the path.\n *\n * @returns The normalized URL path.\n */\n // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is\n // removed.\n path(includeHash = false) {\n return this.normalize(this._locationStrategy.path(includeHash));\n }\n /**\n * Reports the current state of the location history.\n * @returns The current value of the `history.state` object.\n */\n getState() {\n return this._locationStrategy.getState();\n }\n /**\n * Normalizes the given path and compares to the current normalized path.\n *\n * @param path The given URL path.\n * @param query Query parameters.\n *\n * @returns True if the given URL path is equal to the current normalized path, false\n * otherwise.\n */\n isCurrentPathEqualTo(path, query = '') {\n return this.path() == this.normalize(path + normalizeQueryParams(query));\n }\n /**\n * Normalizes a URL path by stripping any trailing slashes.\n *\n * @param url String representing a URL.\n *\n * @returns The normalized URL string.\n */\n normalize(url) {\n return Location.stripTrailingSlash(_stripBasePath(this._basePath, _stripIndexHtml(url)));\n }\n /**\n * Normalizes an external URL path.\n * If the given URL doesn't begin with a leading slash (`'/'`), adds one\n * before normalizing. Adds a hash if `HashLocationStrategy` is\n * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use.\n *\n * @param url String representing a URL.\n *\n * @returns A normalized platform-specific URL.\n */\n prepareExternalUrl(url) {\n if (url && url[0] !== '/') {\n url = '/' + url;\n }\n return this._locationStrategy.prepareExternalUrl(url);\n }\n // TODO: rename this method to pushState\n /**\n * Changes the browser's URL to a normalized version of a given URL, and pushes a\n * new item onto the platform's history.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n *\n */\n go(path, query = '', state = null) {\n this._locationStrategy.pushState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Changes the browser's URL to a normalized version of the given URL, and replaces\n * the top item on the platform's history stack.\n *\n * @param path URL path to normalize.\n * @param query Query parameters.\n * @param state Location history state.\n */\n replaceState(path, query = '', state = null) {\n this._locationStrategy.replaceState(state, '', path, query);\n this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state);\n }\n /**\n * Navigates forward in the platform's history.\n */\n forward() {\n this._locationStrategy.forward();\n }\n /**\n * Navigates back in the platform's history.\n */\n back() {\n this._locationStrategy.back();\n }\n /**\n * Navigate to a specific page from session history, identified by its relative position to the\n * current page.\n *\n * @param relativePosition Position of the target page in the history relative to the current\n * page.\n * A negative value moves backwards, a positive value moves forwards, e.g. `location.historyGo(2)`\n * moves forward two pages and `location.historyGo(-2)` moves back two pages. When we try to go\n * beyond what's stored in the history session, we stay in the current page. Same behaviour occurs\n * when `relativePosition` equals 0.\n * @see https://developer.mozilla.org/en-US/docs/Web/API/History_API#Moving_to_a_specific_point_in_history\n */\n historyGo(relativePosition = 0) {\n this._locationStrategy.historyGo?.(relativePosition);\n }\n /**\n * Registers a URL change listener. Use to catch updates performed by the Angular\n * framework that are not detectible through \"popstate\" or \"hashchange\" events.\n *\n * @param fn The change handler function, which take a URL and a location history state.\n * @returns A function that, when executed, unregisters a URL change listener.\n */\n onUrlChange(fn) {\n this._urlChangeListeners.push(fn);\n if (!this._urlChangeSubscription) {\n this._urlChangeSubscription = this.subscribe(v => {\n this._notifyUrlChangeListeners(v.url, v.state);\n });\n }\n return () => {\n const fnIndex = this._urlChangeListeners.indexOf(fn);\n this._urlChangeListeners.splice(fnIndex, 1);\n if (this._urlChangeListeners.length === 0) {\n this._urlChangeSubscription?.unsubscribe();\n this._urlChangeSubscription = null;\n }\n };\n }\n /** @internal */\n _notifyUrlChangeListeners(url = '', state) {\n this._urlChangeListeners.forEach(fn => fn(url, state));\n }\n /**\n * Subscribes to the platform's `popState` events.\n *\n * Note: `Location.go()` does not trigger the `popState` event in the browser. Use\n * `Location.onUrlChange()` to subscribe to URL changes instead.\n *\n * @param value Event that is triggered when the state history changes.\n * @param exception The exception to throw.\n *\n * @see [onpopstate](https://developer.mozilla.org/en-US/docs/Web/API/WindowEventHandlers/onpopstate)\n *\n * @returns Subscribed events.\n */\n subscribe(onNext, onThrow, onReturn) {\n return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn });\n }\n}\n/**\n * Normalizes URL parameters by prepending with `?` if needed.\n *\n * @param params String of URL parameters.\n *\n * @returns The normalized URL parameters string.\n */\nLocation.normalizeQueryParams = normalizeQueryParams;\n/**\n * Joins two parts of a URL with a slash if needed.\n *\n * @param start URL string\n * @param end URL string\n *\n *\n * @returns The joined URL string.\n */\nLocation.joinWithSlash = joinWithSlash;\n/**\n * Removes a trailing slash from a URL string if needed.\n * Looks for the first occurrence of either `#`, `?`, or the end of the\n * line as `/` characters and removes the trailing slash if one exists.\n *\n * @param url URL string.\n *\n * @returns The URL string, modified if needed.\n */\nLocation.stripTrailingSlash = stripTrailingSlash;\nLocation.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: Location, deps: [{ token: LocationStrategy }], target: i0.ɵɵFactoryTarget.Injectable });\nLocation.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: Location, providedIn: 'root', useFactory: createLocation });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: Location, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n // See #23917\n useFactory: createLocation,\n }]\n }], ctorParameters: function () { return [{ type: LocationStrategy }]; } });\nfunction createLocation() {\n return new Location(ɵɵinject(LocationStrategy));\n}\nfunction _stripBasePath(basePath, url) {\n if (!basePath || !url.startsWith(basePath)) {\n return url;\n }\n const strippedUrl = url.substring(basePath.length);\n if (strippedUrl === '' || ['/', ';', '?', '#'].includes(strippedUrl[0])) {\n return strippedUrl;\n }\n return url;\n}\nfunction _stripIndexHtml(url) {\n return url.replace(/\\/index.html$/, '');\n}\nfunction _stripOrigin(baseHref) {\n // DO NOT REFACTOR! Previously, this check looked like this:\n // `/^(https?:)?\\/\\//.test(baseHref)`, but that resulted in\n // syntactically incorrect code after Closure Compiler minification.\n // This was likely caused by a bug in Closure Compiler, but\n // for now, the check is rewritten to use `new RegExp` instead.\n const isAbsoluteUrl = (new RegExp('^(https?:)?//')).test(baseHref);\n if (isAbsoluteUrl) {\n const [, pathname] = baseHref.split(/\\/\\/[^\\/]+/);\n return pathname;\n }\n return baseHref;\n}\n\n/** @internal */\nconst CURRENCIES_EN = { \"ADP\": [undefined, undefined, 0], \"AFN\": [undefined, \"؋\", 0], \"ALL\": [undefined, undefined, 0], \"AMD\": [undefined, \"֏\", 2], \"AOA\": [undefined, \"Kz\"], \"ARS\": [undefined, \"$\"], \"AUD\": [\"A$\", \"$\"], \"AZN\": [undefined, \"₼\"], \"BAM\": [undefined, \"KM\"], \"BBD\": [undefined, \"$\"], \"BDT\": [undefined, \"৳\"], \"BHD\": [undefined, undefined, 3], \"BIF\": [undefined, undefined, 0], \"BMD\": [undefined, \"$\"], \"BND\": [undefined, \"$\"], \"BOB\": [undefined, \"Bs\"], \"BRL\": [\"R$\"], \"BSD\": [undefined, \"$\"], \"BWP\": [undefined, \"P\"], \"BYN\": [undefined, undefined, 2], \"BYR\": [undefined, undefined, 0], \"BZD\": [undefined, \"$\"], \"CAD\": [\"CA$\", \"$\", 2], \"CHF\": [undefined, undefined, 2], \"CLF\": [undefined, undefined, 4], \"CLP\": [undefined, \"$\", 0], \"CNY\": [\"CN¥\", \"¥\"], \"COP\": [undefined, \"$\", 2], \"CRC\": [undefined, \"₡\", 2], \"CUC\": [undefined, \"$\"], \"CUP\": [undefined, \"$\"], \"CZK\": [undefined, \"Kč\", 2], \"DJF\": [undefined, undefined, 0], \"DKK\": [undefined, \"kr\", 2], \"DOP\": [undefined, \"$\"], \"EGP\": [undefined, \"E£\"], \"ESP\": [undefined, \"₧\", 0], \"EUR\": [\"€\"], \"FJD\": [undefined, \"$\"], \"FKP\": [undefined, \"£\"], \"GBP\": [\"£\"], \"GEL\": [undefined, \"₾\"], \"GHS\": [undefined, \"GH₵\"], \"GIP\": [undefined, \"£\"], \"GNF\": [undefined, \"FG\", 0], \"GTQ\": [undefined, \"Q\"], \"GYD\": [undefined, \"$\", 2], \"HKD\": [\"HK$\", \"$\"], \"HNL\": [undefined, \"L\"], \"HRK\": [undefined, \"kn\"], \"HUF\": [undefined, \"Ft\", 2], \"IDR\": [undefined, \"Rp\", 2], \"ILS\": [\"₪\"], \"INR\": [\"₹\"], \"IQD\": [undefined, undefined, 0], \"IRR\": [undefined, undefined, 0], \"ISK\": [undefined, \"kr\", 0], \"ITL\": [undefined, undefined, 0], \"JMD\": [undefined, \"$\"], \"JOD\": [undefined, undefined, 3], \"JPY\": [\"¥\", undefined, 0], \"KHR\": [undefined, \"៛\"], \"KMF\": [undefined, \"CF\", 0], \"KPW\": [undefined, \"₩\", 0], \"KRW\": [\"₩\", undefined, 0], \"KWD\": [undefined, undefined, 3], \"KYD\": [undefined, \"$\"], \"KZT\": [undefined, \"₸\"], \"LAK\": [undefined, \"₭\", 0], \"LBP\": [undefined, \"L£\", 0], \"LKR\": [undefined, \"Rs\"], \"LRD\": [undefined, \"$\"], \"LTL\": [undefined, \"Lt\"], \"LUF\": [undefined, undefined, 0], \"LVL\": [undefined, \"Ls\"], \"LYD\": [undefined, undefined, 3], \"MGA\": [undefined, \"Ar\", 0], \"MGF\": [undefined, undefined, 0], \"MMK\": [undefined, \"K\", 0], \"MNT\": [undefined, \"₮\", 2], \"MRO\": [undefined, undefined, 0], \"MUR\": [undefined, \"Rs\", 2], \"MXN\": [\"MX$\", \"$\"], \"MYR\": [undefined, \"RM\"], \"NAD\": [undefined, \"$\"], \"NGN\": [undefined, \"₦\"], \"NIO\": [undefined, \"C$\"], \"NOK\": [undefined, \"kr\", 2], \"NPR\": [undefined, \"Rs\"], \"NZD\": [\"NZ$\", \"$\"], \"OMR\": [undefined, undefined, 3], \"PHP\": [\"₱\"], \"PKR\": [undefined, \"Rs\", 2], \"PLN\": [undefined, \"zł\"], \"PYG\": [undefined, \"₲\", 0], \"RON\": [undefined, \"lei\"], \"RSD\": [undefined, undefined, 0], \"RUB\": [undefined, \"₽\"], \"RWF\": [undefined, \"RF\", 0], \"SBD\": [undefined, \"$\"], \"SEK\": [undefined, \"kr\", 2], \"SGD\": [undefined, \"$\"], \"SHP\": [undefined, \"£\"], \"SLE\": [undefined, undefined, 2], \"SLL\": [undefined, undefined, 0], \"SOS\": [undefined, undefined, 0], \"SRD\": [undefined, \"$\"], \"SSP\": [undefined, \"£\"], \"STD\": [undefined, undefined, 0], \"STN\": [undefined, \"Db\"], \"SYP\": [undefined, \"£\", 0], \"THB\": [undefined, \"฿\"], \"TMM\": [undefined, undefined, 0], \"TND\": [undefined, undefined, 3], \"TOP\": [undefined, \"T$\"], \"TRL\": [undefined, undefined, 0], \"TRY\": [undefined, \"₺\"], \"TTD\": [undefined, \"$\"], \"TWD\": [\"NT$\", \"$\", 2], \"TZS\": [undefined, undefined, 2], \"UAH\": [undefined, \"₴\"], \"UGX\": [undefined, undefined, 0], \"USD\": [\"$\"], \"UYI\": [undefined, undefined, 0], \"UYU\": [undefined, \"$\"], \"UYW\": [undefined, undefined, 4], \"UZS\": [undefined, undefined, 2], \"VEF\": [undefined, \"Bs\", 2], \"VND\": [\"₫\", undefined, 0], \"VUV\": [undefined, undefined, 0], \"XAF\": [\"FCFA\", undefined, 0], \"XCD\": [\"EC$\", \"$\"], \"XOF\": [\"F CFA\", undefined, 0], \"XPF\": [\"CFPF\", undefined, 0], \"XXX\": [\"¤\"], \"YER\": [undefined, undefined, 0], \"ZAR\": [undefined, \"R\"], \"ZMK\": [undefined, undefined, 0], \"ZMW\": [undefined, \"ZK\"], \"ZWD\": [undefined, undefined, 0] };\n\n/**\n * Format styles that can be used to represent numbers.\n * @see `getLocaleNumberFormat()`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberFormatStyle;\n(function (NumberFormatStyle) {\n NumberFormatStyle[NumberFormatStyle[\"Decimal\"] = 0] = \"Decimal\";\n NumberFormatStyle[NumberFormatStyle[\"Percent\"] = 1] = \"Percent\";\n NumberFormatStyle[NumberFormatStyle[\"Currency\"] = 2] = \"Currency\";\n NumberFormatStyle[NumberFormatStyle[\"Scientific\"] = 3] = \"Scientific\";\n})(NumberFormatStyle || (NumberFormatStyle = {}));\n/**\n * Plurality cases used for translating plurals to different languages.\n *\n * @see `NgPlural`\n * @see `NgPluralCase`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar Plural;\n(function (Plural) {\n Plural[Plural[\"Zero\"] = 0] = \"Zero\";\n Plural[Plural[\"One\"] = 1] = \"One\";\n Plural[Plural[\"Two\"] = 2] = \"Two\";\n Plural[Plural[\"Few\"] = 3] = \"Few\";\n Plural[Plural[\"Many\"] = 4] = \"Many\";\n Plural[Plural[\"Other\"] = 5] = \"Other\";\n})(Plural || (Plural = {}));\n/**\n * Context-dependant translation forms for strings.\n * Typically the standalone version is for the nominative form of the word,\n * and the format version is used for the genitive case.\n * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar FormStyle;\n(function (FormStyle) {\n FormStyle[FormStyle[\"Format\"] = 0] = \"Format\";\n FormStyle[FormStyle[\"Standalone\"] = 1] = \"Standalone\";\n})(FormStyle || (FormStyle = {}));\n/**\n * String widths available for translations.\n * The specific character widths are locale-specific.\n * Examples are given for the word \"Sunday\" in English.\n *\n * @publicApi\n */\nvar TranslationWidth;\n(function (TranslationWidth) {\n /** 1 character for `en-US`. For example: 'S' */\n TranslationWidth[TranslationWidth[\"Narrow\"] = 0] = \"Narrow\";\n /** 3 characters for `en-US`. For example: 'Sun' */\n TranslationWidth[TranslationWidth[\"Abbreviated\"] = 1] = \"Abbreviated\";\n /** Full length for `en-US`. For example: \"Sunday\" */\n TranslationWidth[TranslationWidth[\"Wide\"] = 2] = \"Wide\";\n /** 2 characters for `en-US`, For example: \"Su\" */\n TranslationWidth[TranslationWidth[\"Short\"] = 3] = \"Short\";\n})(TranslationWidth || (TranslationWidth = {}));\n/**\n * String widths available for date-time formats.\n * The specific character widths are locale-specific.\n * Examples are given for `en-US`.\n *\n * @see `getLocaleDateFormat()`\n * @see `getLocaleTimeFormat()`\n * @see `getLocaleDateTimeFormat()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n */\nvar FormatWidth;\n(function (FormatWidth) {\n /**\n * For `en-US`, 'M/d/yy, h:mm a'`\n * (Example: `6/15/15, 9:03 AM`)\n */\n FormatWidth[FormatWidth[\"Short\"] = 0] = \"Short\";\n /**\n * For `en-US`, `'MMM d, y, h:mm:ss a'`\n * (Example: `Jun 15, 2015, 9:03:01 AM`)\n */\n FormatWidth[FormatWidth[\"Medium\"] = 1] = \"Medium\";\n /**\n * For `en-US`, `'MMMM d, y, h:mm:ss a z'`\n * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`)\n */\n FormatWidth[FormatWidth[\"Long\"] = 2] = \"Long\";\n /**\n * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'`\n * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`)\n */\n FormatWidth[FormatWidth[\"Full\"] = 3] = \"Full\";\n})(FormatWidth || (FormatWidth = {}));\n/**\n * Symbols that can be used to replace placeholders in number patterns.\n * Examples are based on `en-US` values.\n *\n * @see `getLocaleNumberSymbol()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nvar NumberSymbol;\n(function (NumberSymbol) {\n /**\n * Decimal separator.\n * For `en-US`, the dot character.\n * Example: 2,345`.`67\n */\n NumberSymbol[NumberSymbol[\"Decimal\"] = 0] = \"Decimal\";\n /**\n * Grouping separator, typically for thousands.\n * For `en-US`, the comma character.\n * Example: 2`,`345.67\n */\n NumberSymbol[NumberSymbol[\"Group\"] = 1] = \"Group\";\n /**\n * List-item separator.\n * Example: \"one, two, and three\"\n */\n NumberSymbol[NumberSymbol[\"List\"] = 2] = \"List\";\n /**\n * Sign for percentage (out of 100).\n * Example: 23.4%\n */\n NumberSymbol[NumberSymbol[\"PercentSign\"] = 3] = \"PercentSign\";\n /**\n * Sign for positive numbers.\n * Example: +23\n */\n NumberSymbol[NumberSymbol[\"PlusSign\"] = 4] = \"PlusSign\";\n /**\n * Sign for negative numbers.\n * Example: -23\n */\n NumberSymbol[NumberSymbol[\"MinusSign\"] = 5] = \"MinusSign\";\n /**\n * Computer notation for exponential value (n times a power of 10).\n * Example: 1.2E3\n */\n NumberSymbol[NumberSymbol[\"Exponential\"] = 6] = \"Exponential\";\n /**\n * Human-readable format of exponential.\n * Example: 1.2x103\n */\n NumberSymbol[NumberSymbol[\"SuperscriptingExponent\"] = 7] = \"SuperscriptingExponent\";\n /**\n * Sign for permille (out of 1000).\n * Example: 23.4‰\n */\n NumberSymbol[NumberSymbol[\"PerMille\"] = 8] = \"PerMille\";\n /**\n * Infinity, can be used with plus and minus.\n * Example: ∞, +∞, -∞\n */\n NumberSymbol[NumberSymbol[\"Infinity\"] = 9] = \"Infinity\";\n /**\n * Not a number.\n * Example: NaN\n */\n NumberSymbol[NumberSymbol[\"NaN\"] = 10] = \"NaN\";\n /**\n * Symbol used between time units.\n * Example: 10:52\n */\n NumberSymbol[NumberSymbol[\"TimeSeparator\"] = 11] = \"TimeSeparator\";\n /**\n * Decimal separator for currency values (fallback to `Decimal`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyDecimal\"] = 12] = \"CurrencyDecimal\";\n /**\n * Group separator for currency values (fallback to `Group`).\n * Example: $2,345.67\n */\n NumberSymbol[NumberSymbol[\"CurrencyGroup\"] = 13] = \"CurrencyGroup\";\n})(NumberSymbol || (NumberSymbol = {}));\n/**\n * The value for each day of the week, based on the `en-US` locale\n *\n * @publicApi\n */\nvar WeekDay;\n(function (WeekDay) {\n WeekDay[WeekDay[\"Sunday\"] = 0] = \"Sunday\";\n WeekDay[WeekDay[\"Monday\"] = 1] = \"Monday\";\n WeekDay[WeekDay[\"Tuesday\"] = 2] = \"Tuesday\";\n WeekDay[WeekDay[\"Wednesday\"] = 3] = \"Wednesday\";\n WeekDay[WeekDay[\"Thursday\"] = 4] = \"Thursday\";\n WeekDay[WeekDay[\"Friday\"] = 5] = \"Friday\";\n WeekDay[WeekDay[\"Saturday\"] = 6] = \"Saturday\";\n})(WeekDay || (WeekDay = {}));\n/**\n * Retrieves the locale ID from the currently loaded locale.\n * The loaded locale could be, for example, a global one rather than a regional one.\n * @param locale A locale code, such as `fr-FR`.\n * @returns The locale code. For example, `fr`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleId(locale) {\n return ɵfindLocaleData(locale)[ɵLocaleDataIndex.LocaleId];\n}\n/**\n * Retrieves day period strings for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const amPmData = [\n data[ɵLocaleDataIndex.DayPeriodsFormat], data[ɵLocaleDataIndex.DayPeriodsStandalone]\n ];\n const amPm = getLastDefinedValue(amPmData, formStyle);\n return getLastDefinedValue(amPm, width);\n}\n/**\n * Retrieves days of the week for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example,`[Sunday, Monday, ... Saturday]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDayNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const daysData = [data[ɵLocaleDataIndex.DaysFormat], data[ɵLocaleDataIndex.DaysStandalone]];\n const days = getLastDefinedValue(daysData, formStyle);\n return getLastDefinedValue(days, width);\n}\n/**\n * Retrieves months of the year for the given locale, using the Gregorian calendar.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns An array of localized name strings.\n * For example, `[January, February, ...]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleMonthNames(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n const monthsData = [data[ɵLocaleDataIndex.MonthsFormat], data[ɵLocaleDataIndex.MonthsStandalone]];\n const months = getLastDefinedValue(monthsData, formStyle);\n return getLastDefinedValue(months, width);\n}\n/**\n * Retrieves Gregorian-calendar eras for the given locale.\n * @param locale A locale code for the locale format rules to use.\n * @param width The required character width.\n\n * @returns An array of localized era strings.\n * For example, `[AD, BC]` for `en-US`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleEraNames(locale, width) {\n const data = ɵfindLocaleData(locale);\n const erasData = data[ɵLocaleDataIndex.Eras];\n return getLastDefinedValue(erasData, width);\n}\n/**\n * Retrieves the first day of the week for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns A day index number, using the 0-based week-day index for `en-US`\n * (Sunday = 0, Monday = 1, ...).\n * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleFirstDayOfWeek(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.FirstDayOfWeek];\n}\n/**\n * Range of week days that are considered the week-end for the given locale.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The range of day values, `[startDay, endDay]`.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleWeekEndRange(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.WeekendRange];\n}\n/**\n * Retrieves a localized date-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.DateFormat], width);\n}\n/**\n * Retrieves a localized time-value formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n\n * @publicApi\n */\nfunction getLocaleTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n return getLastDefinedValue(data[ɵLocaleDataIndex.TimeFormat], width);\n}\n/**\n * Retrieves a localized date-time formatting string.\n *\n * @param locale A locale code for the locale format rules to use.\n * @param width The format type.\n * @returns The localized formatting string.\n * @see `FormatWidth`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleDateTimeFormat(locale, width) {\n const data = ɵfindLocaleData(locale);\n const dateTimeFormatData = data[ɵLocaleDataIndex.DateTimeFormat];\n return getLastDefinedValue(dateTimeFormatData, width);\n}\n/**\n * Retrieves a localized number symbol that can be used to replace placeholders in number formats.\n * @param locale The locale code.\n * @param symbol The symbol to localize.\n * @returns The character for the localized symbol.\n * @see `NumberSymbol`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberSymbol(locale, symbol) {\n const data = ɵfindLocaleData(locale);\n const res = data[ɵLocaleDataIndex.NumberSymbols][symbol];\n if (typeof res === 'undefined') {\n if (symbol === NumberSymbol.CurrencyDecimal) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Decimal];\n }\n else if (symbol === NumberSymbol.CurrencyGroup) {\n return data[ɵLocaleDataIndex.NumberSymbols][NumberSymbol.Group];\n }\n }\n return res;\n}\n/**\n * Retrieves a number format for a given locale.\n *\n * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00`\n * when used to format the number 12345.678 could result in \"12'345,678\". That would happen if the\n * grouping separator for your language is an apostrophe, and the decimal separator is a comma.\n *\n * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders\n * that stand for the decimal separator, and so on, and are NOT real characters.\n * You must NOT \"translate\" the placeholders. For example, don't change `.` to `,` even though in\n * your language the decimal point is written with a comma. The symbols should be replaced by the\n * local equivalents, using the appropriate `NumberSymbol` for your language.\n *\n * Here are the special characters used in number patterns:\n *\n * | Symbol | Meaning |\n * |--------|---------|\n * | . | Replaced automatically by the character used for the decimal point. |\n * | , | Replaced by the \"grouping\" (thousands) separator. |\n * | 0 | Replaced by a digit (or zero if there aren't enough digits). |\n * | # | Replaced by a digit (or nothing if there aren't enough). |\n * | ¤ | Replaced by a currency symbol, such as $ or USD. |\n * | % | Marks a percent format. The % symbol may change position, but must be retained. |\n * | E | Marks a scientific format. The E symbol may change position, but must be retained. |\n * | ' | Special characters used as literal characters are quoted with ASCII single quotes. |\n *\n * @param locale A locale code for the locale format rules to use.\n * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.)\n * @returns The localized format string.\n * @see `NumberFormatStyle`\n * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns)\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleNumberFormat(locale, type) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.NumberFormats][type];\n}\n/**\n * Retrieves the symbol used to represent the currency for the main country\n * corresponding to a given locale. For example, '$' for `en-US`.\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The localized symbol character,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencySymbol(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencySymbol] || null;\n}\n/**\n * Retrieves the name of the currency for the main country corresponding\n * to a given locale. For example, 'US Dollar' for `en-US`.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency name,\n * or `null` if the main country cannot be determined.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleCurrencyName(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.CurrencyName] || null;\n}\n/**\n * Retrieves the default currency code for the given locale.\n *\n * The default is defined as the first currency which is still in use.\n *\n * @param locale The code of the locale whose currency code we want.\n * @returns The code of the default currency for the given locale.\n *\n * @publicApi\n */\nfunction getLocaleCurrencyCode(locale) {\n return ɵgetLocaleCurrencyCode(locale);\n}\n/**\n * Retrieves the currency values for a given locale.\n * @param locale A locale code for the locale format rules to use.\n * @returns The currency values.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleCurrencies(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Currencies];\n}\n/**\n * @alias core/ɵgetLocalePluralCase\n * @publicApi\n */\nconst getLocalePluralCase = ɵgetLocalePluralCase;\nfunction checkFullData(data) {\n if (!data[ɵLocaleDataIndex.ExtraData]) {\n throw new Error(`Missing extra locale data for the locale \"${data[ɵLocaleDataIndex\n .LocaleId]}\". Use \"registerLocaleData\" to load new data. See the \"I18n guide\" on angular.io to know more.`);\n }\n}\n/**\n * Retrieves locale-specific rules used to determine which day period to use\n * when more than one period is defined for a locale.\n *\n * There is a rule for each defined day period. The\n * first rule is applied to the first day period and so on.\n * Fall back to AM/PM when no rules are available.\n *\n * A rule can specify a period as time range, or as a single time value.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @returns The rules for the locale, a single time value or array of *from-time, to-time*,\n * or null if no periods are available.\n *\n * @see `getLocaleExtraDayPeriods()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriodRules(locale) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const rules = data[ɵLocaleDataIndex.ExtraData][2 /* ɵExtraLocaleDataIndex.ExtraDayPeriodsRules */] || [];\n return rules.map((rule) => {\n if (typeof rule === 'string') {\n return extractTime(rule);\n }\n return [extractTime(rule[0]), extractTime(rule[1])];\n });\n}\n/**\n * Retrieves locale-specific day periods, which indicate roughly how a day is broken up\n * in different languages.\n * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight.\n *\n * This functionality is only available when you have loaded the full locale data.\n * See the [\"I18n guide\"](guide/i18n-common-format-data-locale).\n *\n * @param locale A locale code for the locale format rules to use.\n * @param formStyle The required grammatical form.\n * @param width The required character width.\n * @returns The translated day-period strings.\n * @see `getLocaleExtraDayPeriodRules()`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLocaleExtraDayPeriods(locale, formStyle, width) {\n const data = ɵfindLocaleData(locale);\n checkFullData(data);\n const dayPeriodsData = [\n data[ɵLocaleDataIndex.ExtraData][0 /* ɵExtraLocaleDataIndex.ExtraDayPeriodFormats */],\n data[ɵLocaleDataIndex.ExtraData][1 /* ɵExtraLocaleDataIndex.ExtraDayPeriodStandalone */]\n ];\n const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || [];\n return getLastDefinedValue(dayPeriods, width) || [];\n}\n/**\n * Retrieves the writing direction of a specified locale\n * @param locale A locale code for the locale format rules to use.\n * @publicApi\n * @returns 'rtl' or 'ltr'\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n */\nfunction getLocaleDirection(locale) {\n const data = ɵfindLocaleData(locale);\n return data[ɵLocaleDataIndex.Directionality];\n}\n/**\n * Retrieves the first value that is defined in an array, going backwards from an index position.\n *\n * To avoid repeating the same data (as when the \"format\" and \"standalone\" forms are the same)\n * add the first value to the locale data arrays, and add other values only if they are different.\n *\n * @param data The data array to retrieve from.\n * @param index A 0-based index into the array to start from.\n * @returns The value immediately before the given index position.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getLastDefinedValue(data, index) {\n for (let i = index; i > -1; i--) {\n if (typeof data[i] !== 'undefined') {\n return data[i];\n }\n }\n throw new Error('Locale data API: locale data undefined');\n}\n/**\n * Extracts the hours and minutes from a string like \"15:45\"\n */\nfunction extractTime(time) {\n const [h, m] = time.split(':');\n return { hours: +h, minutes: +m };\n}\n/**\n * Retrieves the currency symbol for a given currency code.\n *\n * For example, for the default `en-US` locale, the code `USD` can\n * be represented by the narrow symbol `$` or the wide symbol `US$`.\n *\n * @param code The currency code.\n * @param format The format, `wide` or `narrow`.\n * @param locale A locale code for the locale format rules to use.\n *\n * @returns The symbol, or the currency code if no symbol is available.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getCurrencySymbol(code, format, locale = 'en') {\n const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || [];\n const symbolNarrow = currency[1 /* ɵCurrencyIndex.SymbolNarrow */];\n if (format === 'narrow' && typeof symbolNarrow === 'string') {\n return symbolNarrow;\n }\n return currency[0 /* ɵCurrencyIndex.Symbol */] || code;\n}\n// Most currencies have cents, that's why the default is 2\nconst DEFAULT_NB_OF_CURRENCY_DIGITS = 2;\n/**\n * Reports the number of decimal digits for a given currency.\n * The value depends upon the presence of cents in that particular currency.\n *\n * @param code The currency code.\n * @returns The number of decimal digits, typically 0 or 2.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction getNumberOfCurrencyDigits(code) {\n let digits;\n const currency = CURRENCIES_EN[code];\n if (currency) {\n digits = currency[2 /* ɵCurrencyIndex.NbOfDigits */];\n }\n return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS;\n}\n\nconst ISO8601_DATE_REGEX = /^(\\d{4,})-?(\\d\\d)-?(\\d\\d)(?:T(\\d\\d)(?::?(\\d\\d)(?::?(\\d\\d)(?:\\.(\\d+))?)?)?(Z|([+-])(\\d\\d):?(\\d\\d))?)?$/;\n// 1 2 3 4 5 6 7 8 9 10 11\nconst NAMED_FORMATS = {};\nconst DATE_FORMATS_SPLIT = /((?:[^BEGHLMOSWYZabcdhmswyz']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|Y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|c{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\\s\\S]*)/;\nvar ZoneWidth;\n(function (ZoneWidth) {\n ZoneWidth[ZoneWidth[\"Short\"] = 0] = \"Short\";\n ZoneWidth[ZoneWidth[\"ShortGMT\"] = 1] = \"ShortGMT\";\n ZoneWidth[ZoneWidth[\"Long\"] = 2] = \"Long\";\n ZoneWidth[ZoneWidth[\"Extended\"] = 3] = \"Extended\";\n})(ZoneWidth || (ZoneWidth = {}));\nvar DateType;\n(function (DateType) {\n DateType[DateType[\"FullYear\"] = 0] = \"FullYear\";\n DateType[DateType[\"Month\"] = 1] = \"Month\";\n DateType[DateType[\"Date\"] = 2] = \"Date\";\n DateType[DateType[\"Hours\"] = 3] = \"Hours\";\n DateType[DateType[\"Minutes\"] = 4] = \"Minutes\";\n DateType[DateType[\"Seconds\"] = 5] = \"Seconds\";\n DateType[DateType[\"FractionalSeconds\"] = 6] = \"FractionalSeconds\";\n DateType[DateType[\"Day\"] = 7] = \"Day\";\n})(DateType || (DateType = {}));\nvar TranslationType;\n(function (TranslationType) {\n TranslationType[TranslationType[\"DayPeriods\"] = 0] = \"DayPeriods\";\n TranslationType[TranslationType[\"Days\"] = 1] = \"Days\";\n TranslationType[TranslationType[\"Months\"] = 2] = \"Months\";\n TranslationType[TranslationType[\"Eras\"] = 3] = \"Eras\";\n})(TranslationType || (TranslationType = {}));\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date according to locale rules.\n *\n * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch)\n * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime).\n * @param format The date-time components to include. See `DatePipe` for details.\n * @param locale A locale code for the locale format rules to use.\n * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`),\n * or a standard UTC/GMT or continental US time zone abbreviation.\n * If not specified, uses host system settings.\n *\n * @returns The formatted date string.\n *\n * @see `DatePipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatDate(value, format, locale, timezone) {\n let date = toDate(value);\n const namedFormat = getNamedFormat(locale, format);\n format = namedFormat || format;\n let parts = [];\n let match;\n while (format) {\n match = DATE_FORMATS_SPLIT.exec(format);\n if (match) {\n parts = parts.concat(match.slice(1));\n const part = parts.pop();\n if (!part) {\n break;\n }\n format = part;\n }\n else {\n parts.push(format);\n break;\n }\n }\n let dateTimezoneOffset = date.getTimezoneOffset();\n if (timezone) {\n dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n date = convertTimezoneToLocal(date, timezone, true);\n }\n let text = '';\n parts.forEach(value => {\n const dateFormatter = getDateFormatter(value);\n text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) :\n value === '\\'\\'' ? '\\'' :\n value.replace(/(^'|'$)/g, '').replace(/''/g, '\\'');\n });\n return text;\n}\n/**\n * Create a new Date object with the given date value, and the time set to midnight.\n *\n * We cannot use `new Date(year, month, date)` because it maps years between 0 and 99 to 1900-1999.\n * See: https://github.com/angular/angular/issues/40377\n *\n * Note that this function returns a Date object whose time is midnight in the current locale's\n * timezone. In the future we might want to change this to be midnight in UTC, but this would be a\n * considerable breaking change.\n */\nfunction createDate(year, month, date) {\n // The `newDate` is set to midnight (UTC) on January 1st 1970.\n // - In PST this will be December 31st 1969 at 4pm.\n // - In GMT this will be January 1st 1970 at 1am.\n // Note that they even have different years, dates and months!\n const newDate = new Date(0);\n // `setFullYear()` allows years like 0001 to be set correctly. This function does not\n // change the internal time of the date.\n // Consider calling `setFullYear(2019, 8, 20)` (September 20, 2019).\n // - In PST this will now be September 20, 2019 at 4pm\n // - In GMT this will now be September 20, 2019 at 1am\n newDate.setFullYear(year, month, date);\n // We want the final date to be at local midnight, so we reset the time.\n // - In PST this will now be September 20, 2019 at 12am\n // - In GMT this will now be September 20, 2019 at 12am\n newDate.setHours(0, 0, 0);\n return newDate;\n}\nfunction getNamedFormat(locale, format) {\n const localeId = getLocaleId(locale);\n NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {};\n if (NAMED_FORMATS[localeId][format]) {\n return NAMED_FORMATS[localeId][format];\n }\n let formatValue = '';\n switch (format) {\n case 'shortDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Short);\n break;\n case 'mediumDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Medium);\n break;\n case 'longDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Long);\n break;\n case 'fullDate':\n formatValue = getLocaleDateFormat(locale, FormatWidth.Full);\n break;\n case 'shortTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Short);\n break;\n case 'mediumTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium);\n break;\n case 'longTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Long);\n break;\n case 'fullTime':\n formatValue = getLocaleTimeFormat(locale, FormatWidth.Full);\n break;\n case 'short':\n const shortTime = getNamedFormat(locale, 'shortTime');\n const shortDate = getNamedFormat(locale, 'shortDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]);\n break;\n case 'medium':\n const mediumTime = getNamedFormat(locale, 'mediumTime');\n const mediumDate = getNamedFormat(locale, 'mediumDate');\n formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]);\n break;\n case 'long':\n const longTime = getNamedFormat(locale, 'longTime');\n const longDate = getNamedFormat(locale, 'longDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]);\n break;\n case 'full':\n const fullTime = getNamedFormat(locale, 'fullTime');\n const fullDate = getNamedFormat(locale, 'fullDate');\n formatValue =\n formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]);\n break;\n }\n if (formatValue) {\n NAMED_FORMATS[localeId][format] = formatValue;\n }\n return formatValue;\n}\nfunction formatDateTime(str, opt_values) {\n if (opt_values) {\n str = str.replace(/\\{([^}]+)}/g, function (match, key) {\n return (opt_values != null && key in opt_values) ? opt_values[key] : match;\n });\n }\n return str;\n}\nfunction padNumber(num, digits, minusSign = '-', trim, negWrap) {\n let neg = '';\n if (num < 0 || (negWrap && num <= 0)) {\n if (negWrap) {\n num = -num + 1;\n }\n else {\n num = -num;\n neg = minusSign;\n }\n }\n let strNum = String(num);\n while (strNum.length < digits) {\n strNum = '0' + strNum;\n }\n if (trim) {\n strNum = strNum.slice(strNum.length - digits);\n }\n return neg + strNum;\n}\nfunction formatFractionalSeconds(milliseconds, digits) {\n const strMs = padNumber(milliseconds, 3);\n return strMs.substring(0, digits);\n}\n/**\n * Returns a date formatter that transforms a date into its locale digit representation\n */\nfunction dateGetter(name, size, offset = 0, trim = false, negWrap = false) {\n return function (date, locale) {\n let part = getDatePart(name, date);\n if (offset > 0 || part > -offset) {\n part += offset;\n }\n if (name === DateType.Hours) {\n if (part === 0 && offset === -12) {\n part = 12;\n }\n }\n else if (name === DateType.FractionalSeconds) {\n return formatFractionalSeconds(part, size);\n }\n const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n return padNumber(part, size, localeMinus, trim, negWrap);\n };\n}\nfunction getDatePart(part, date) {\n switch (part) {\n case DateType.FullYear:\n return date.getFullYear();\n case DateType.Month:\n return date.getMonth();\n case DateType.Date:\n return date.getDate();\n case DateType.Hours:\n return date.getHours();\n case DateType.Minutes:\n return date.getMinutes();\n case DateType.Seconds:\n return date.getSeconds();\n case DateType.FractionalSeconds:\n return date.getMilliseconds();\n case DateType.Day:\n return date.getDay();\n default:\n throw new Error(`Unknown DateType value \"${part}\".`);\n }\n}\n/**\n * Returns a date formatter that transforms a date into its locale string representation\n */\nfunction dateStrGetter(name, width, form = FormStyle.Format, extended = false) {\n return function (date, locale) {\n return getDateTranslation(date, locale, name, width, form, extended);\n };\n}\n/**\n * Returns the locale translation of a date for a given form, type and width\n */\nfunction getDateTranslation(date, locale, name, width, form, extended) {\n switch (name) {\n case TranslationType.Months:\n return getLocaleMonthNames(locale, form, width)[date.getMonth()];\n case TranslationType.Days:\n return getLocaleDayNames(locale, form, width)[date.getDay()];\n case TranslationType.DayPeriods:\n const currentHours = date.getHours();\n const currentMinutes = date.getMinutes();\n if (extended) {\n const rules = getLocaleExtraDayPeriodRules(locale);\n const dayPeriods = getLocaleExtraDayPeriods(locale, form, width);\n const index = rules.findIndex(rule => {\n if (Array.isArray(rule)) {\n // morning, afternoon, evening, night\n const [from, to] = rule;\n const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes;\n const beforeTo = (currentHours < to.hours ||\n (currentHours === to.hours && currentMinutes < to.minutes));\n // We must account for normal rules that span a period during the day (e.g. 6am-9am)\n // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g.\n // 10pm - 5am) where `from` is greater (later!) than `to`.\n //\n // In the first case the current time must be BOTH after `from` AND before `to`\n // (e.g. 8am is after 6am AND before 10am).\n //\n // In the second case the current time must be EITHER after `from` OR before `to`\n // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is\n // after 10pm).\n if (from.hours < to.hours) {\n if (afterFrom && beforeTo) {\n return true;\n }\n }\n else if (afterFrom || beforeTo) {\n return true;\n }\n }\n else { // noon or midnight\n if (rule.hours === currentHours && rule.minutes === currentMinutes) {\n return true;\n }\n }\n return false;\n });\n if (index !== -1) {\n return dayPeriods[index];\n }\n }\n // if no rules for the day periods, we use am/pm by default\n return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1];\n case TranslationType.Eras:\n return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1];\n default:\n // This default case is not needed by TypeScript compiler, as the switch is exhaustive.\n // However Closure Compiler does not understand that and reports an error in typed mode.\n // The `throw new Error` below works around the problem, and the unexpected: never variable\n // makes sure tsc still checks this code is unreachable.\n const unexpected = name;\n throw new Error(`unexpected translation type ${unexpected}`);\n }\n}\n/**\n * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or\n * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30,\n * extended = +04:30)\n */\nfunction timeZoneGetter(width) {\n return function (date, locale, offset) {\n const zone = -1 * offset;\n const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign);\n const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60);\n switch (width) {\n case ZoneWidth.Short:\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.ShortGMT:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign);\n case ZoneWidth.Long:\n return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n case ZoneWidth.Extended:\n if (offset === 0) {\n return 'Z';\n }\n else {\n return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' +\n padNumber(Math.abs(zone % 60), 2, minusSign);\n }\n default:\n throw new Error(`Unknown zone width \"${width}\"`);\n }\n };\n}\nconst JANUARY = 0;\nconst THURSDAY = 4;\nfunction getFirstThursdayOfYear(year) {\n const firstDayOfYear = createDate(year, JANUARY, 1).getDay();\n return createDate(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear);\n}\nfunction getThursdayThisWeek(datetime) {\n return createDate(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay()));\n}\nfunction weekGetter(size, monthBased = false) {\n return function (date, locale) {\n let result;\n if (monthBased) {\n const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1;\n const today = date.getDate();\n result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7);\n }\n else {\n const thisThurs = getThursdayThisWeek(date);\n // Some days of a year are part of next year according to ISO 8601.\n // Compute the firstThurs from the year of this week's Thursday\n const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear());\n const diff = thisThurs.getTime() - firstThurs.getTime();\n result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week\n }\n return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n };\n}\n/**\n * Returns a date formatter that provides the week-numbering year for the input date.\n */\nfunction weekNumberingYearGetter(size, trim = false) {\n return function (date, locale) {\n const thisThurs = getThursdayThisWeek(date);\n const weekNumberingYear = thisThurs.getFullYear();\n return padNumber(weekNumberingYear, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign), trim);\n };\n}\nconst DATE_FORMATS = {};\n// Based on CLDR formats:\n// See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table\n// See also explanations: http://cldr.unicode.org/translation/date-time\n// TODO(ocombe): support all missing cldr formats: U, Q, D, F, e, j, J, C, A, v, V, X, x\nfunction getDateFormatter(format) {\n if (DATE_FORMATS[format]) {\n return DATE_FORMATS[format];\n }\n let formatter;\n switch (format) {\n // Era name (AD/BC)\n case 'G':\n case 'GG':\n case 'GGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated);\n break;\n case 'GGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide);\n break;\n case 'GGGGG':\n formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow);\n break;\n // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'y':\n formatter = dateGetter(DateType.FullYear, 1, 0, false, true);\n break;\n // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yy':\n formatter = dateGetter(DateType.FullYear, 2, 0, true, true);\n break;\n // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10)\n case 'yyy':\n formatter = dateGetter(DateType.FullYear, 3, 0, false, true);\n break;\n // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'yyyy':\n formatter = dateGetter(DateType.FullYear, 4, 0, false, true);\n break;\n // 1 digit representation of the week-numbering year, e.g. (AD 1 => 1, AD 199 => 199)\n case 'Y':\n formatter = weekNumberingYearGetter(1);\n break;\n // 2 digit representation of the week-numbering year, padded (00-99). (e.g. AD 2001 => 01, AD\n // 2010 => 10)\n case 'YY':\n formatter = weekNumberingYearGetter(2, true);\n break;\n // 3 digit representation of the week-numbering year, padded (000-999). (e.g. AD 1 => 001, AD\n // 2010 => 2010)\n case 'YYY':\n formatter = weekNumberingYearGetter(3);\n break;\n // 4 digit representation of the week-numbering year (e.g. AD 1 => 0001, AD 2010 => 2010)\n case 'YYYY':\n formatter = weekNumberingYearGetter(4);\n break;\n // Month of the year (1-12), numeric\n case 'M':\n case 'L':\n formatter = dateGetter(DateType.Month, 1, 1);\n break;\n case 'MM':\n case 'LL':\n formatter = dateGetter(DateType.Month, 2, 1);\n break;\n // Month of the year (January, ...), string, format\n case 'MMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated);\n break;\n case 'MMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide);\n break;\n case 'MMMMM':\n formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow);\n break;\n // Month of the year (January, ...), string, standalone\n case 'LLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'LLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'LLLLL':\n formatter =\n dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n // Week of the year (1, ... 52)\n case 'w':\n formatter = weekGetter(1);\n break;\n case 'ww':\n formatter = weekGetter(2);\n break;\n // Week of the month (1, ...)\n case 'W':\n formatter = weekGetter(1, true);\n break;\n // Day of the month (1-31)\n case 'd':\n formatter = dateGetter(DateType.Date, 1);\n break;\n case 'dd':\n formatter = dateGetter(DateType.Date, 2);\n break;\n // Day of the Week StandAlone (1, 1, Mon, Monday, M, Mo)\n case 'c':\n case 'cc':\n formatter = dateGetter(DateType.Day, 1);\n break;\n case 'ccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated, FormStyle.Standalone);\n break;\n case 'cccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide, FormStyle.Standalone);\n break;\n case 'ccccc':\n formatter =\n dateStrGetter(TranslationType.Days, TranslationWidth.Narrow, FormStyle.Standalone);\n break;\n case 'cccccc':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short, FormStyle.Standalone);\n break;\n // Day of the Week\n case 'E':\n case 'EE':\n case 'EEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated);\n break;\n case 'EEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide);\n break;\n case 'EEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow);\n break;\n case 'EEEEEE':\n formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short);\n break;\n // Generic period of the day (am-pm)\n case 'a':\n case 'aa':\n case 'aaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated);\n break;\n case 'aaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide);\n break;\n case 'aaaaa':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow);\n break;\n // Extended period of the day (midnight, at night, ...), standalone\n case 'b':\n case 'bb':\n case 'bbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true);\n break;\n case 'bbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true);\n break;\n case 'bbbbb':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true);\n break;\n // Extended period of the day (midnight, night, ...), standalone\n case 'B':\n case 'BB':\n case 'BBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true);\n break;\n case 'BBBB':\n formatter =\n dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true);\n break;\n case 'BBBBB':\n formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true);\n break;\n // Hour in AM/PM, (1-12)\n case 'h':\n formatter = dateGetter(DateType.Hours, 1, -12);\n break;\n case 'hh':\n formatter = dateGetter(DateType.Hours, 2, -12);\n break;\n // Hour of the day (0-23)\n case 'H':\n formatter = dateGetter(DateType.Hours, 1);\n break;\n // Hour in day, padded (00-23)\n case 'HH':\n formatter = dateGetter(DateType.Hours, 2);\n break;\n // Minute of the hour (0-59)\n case 'm':\n formatter = dateGetter(DateType.Minutes, 1);\n break;\n case 'mm':\n formatter = dateGetter(DateType.Minutes, 2);\n break;\n // Second of the minute (0-59)\n case 's':\n formatter = dateGetter(DateType.Seconds, 1);\n break;\n case 'ss':\n formatter = dateGetter(DateType.Seconds, 2);\n break;\n // Fractional second\n case 'S':\n formatter = dateGetter(DateType.FractionalSeconds, 1);\n break;\n case 'SS':\n formatter = dateGetter(DateType.FractionalSeconds, 2);\n break;\n case 'SSS':\n formatter = dateGetter(DateType.FractionalSeconds, 3);\n break;\n // Timezone ISO8601 short format (-0430)\n case 'Z':\n case 'ZZ':\n case 'ZZZ':\n formatter = timeZoneGetter(ZoneWidth.Short);\n break;\n // Timezone ISO8601 extended format (-04:30)\n case 'ZZZZZ':\n formatter = timeZoneGetter(ZoneWidth.Extended);\n break;\n // Timezone GMT short format (GMT+4)\n case 'O':\n case 'OO':\n case 'OOO':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'z':\n case 'zz':\n case 'zzz':\n formatter = timeZoneGetter(ZoneWidth.ShortGMT);\n break;\n // Timezone GMT long format (GMT+0430)\n case 'OOOO':\n case 'ZZZZ':\n // Should be location, but fallback to format O instead because we don't have the data yet\n case 'zzzz':\n formatter = timeZoneGetter(ZoneWidth.Long);\n break;\n default:\n return null;\n }\n DATE_FORMATS[format] = formatter;\n return formatter;\n}\nfunction timezoneToOffset(timezone, fallback) {\n // Support: IE 11 only, Edge 13-15+\n // IE/Edge do not \"understand\" colon (`:`) in timezone\n timezone = timezone.replace(/:/g, '');\n const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000;\n return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset;\n}\nfunction addDateMinutes(date, minutes) {\n date = new Date(date.getTime());\n date.setMinutes(date.getMinutes() + minutes);\n return date;\n}\nfunction convertTimezoneToLocal(date, timezone, reverse) {\n const reverseValue = reverse ? -1 : 1;\n const dateTimezoneOffset = date.getTimezoneOffset();\n const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset);\n return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset));\n}\n/**\n * Converts a value to date.\n *\n * Supported input formats:\n * - `Date`\n * - number: timestamp\n * - string: numeric (e.g. \"1234\"), ISO and date strings in a format supported by\n * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse).\n * Note: ISO strings without time return a date without timeoffset.\n *\n * Throws if unable to convert to a date.\n */\nfunction toDate(value) {\n if (isDate(value)) {\n return value;\n }\n if (typeof value === 'number' && !isNaN(value)) {\n return new Date(value);\n }\n if (typeof value === 'string') {\n value = value.trim();\n if (/^(\\d{4}(-\\d{1,2}(-\\d{1,2})?)?)$/.test(value)) {\n /* For ISO Strings without time the day, month and year must be extracted from the ISO String\n before Date creation to avoid time offset and errors in the new Date.\n If we only replace '-' with ',' in the ISO String (\"2015,01,01\"), and try to create a new\n date, some browsers (e.g. IE 9) will throw an invalid Date error.\n If we leave the '-' (\"2015-01-01\") and try to create a new Date(\"2015-01-01\") the timeoffset\n is applied.\n Note: ISO months are 0 for January, 1 for February, ... */\n const [y, m = 1, d = 1] = value.split('-').map((val) => +val);\n return createDate(y, m - 1, d);\n }\n const parsedNb = parseFloat(value);\n // any string that only contains numbers, like \"1234\" but not like \"1234hello\"\n if (!isNaN(value - parsedNb)) {\n return new Date(parsedNb);\n }\n let match;\n if (match = value.match(ISO8601_DATE_REGEX)) {\n return isoStringToDate(match);\n }\n }\n const date = new Date(value);\n if (!isDate(date)) {\n throw new Error(`Unable to convert \"${value}\" into a date`);\n }\n return date;\n}\n/**\n * Converts a date in ISO8601 to a Date.\n * Used instead of `Date.parse` because of browser discrepancies.\n */\nfunction isoStringToDate(match) {\n const date = new Date(0);\n let tzHour = 0;\n let tzMin = 0;\n // match[8] means that the string contains \"Z\" (UTC) or a timezone like \"+01:00\" or \"+0100\"\n const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear;\n const timeSetter = match[8] ? date.setUTCHours : date.setHours;\n // if there is a timezone defined like \"+01:00\" or \"+0100\"\n if (match[9]) {\n tzHour = Number(match[9] + match[10]);\n tzMin = Number(match[9] + match[11]);\n }\n dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3]));\n const h = Number(match[4] || 0) - tzHour;\n const m = Number(match[5] || 0) - tzMin;\n const s = Number(match[6] || 0);\n // The ECMAScript specification (https://www.ecma-international.org/ecma-262/5.1/#sec-15.9.1.11)\n // defines that `DateTime` milliseconds should always be rounded down, so that `999.9ms`\n // becomes `999ms`.\n const ms = Math.floor(parseFloat('0.' + (match[7] || 0)) * 1000);\n timeSetter.call(date, h, m, s, ms);\n return date;\n}\nfunction isDate(value) {\n return value instanceof Date && !isNaN(value.valueOf());\n}\n\nconst NUMBER_FORMAT_REGEXP = /^(\\d+)?\\.((\\d+)(-(\\d+))?)?$/;\nconst MAX_DIGITS = 22;\nconst DECIMAL_SEP = '.';\nconst ZERO_CHAR = '0';\nconst PATTERN_SEP = ';';\nconst GROUP_SEP = ',';\nconst DIGIT_CHAR = '#';\nconst CURRENCY_CHAR = '¤';\nconst PERCENT_CHAR = '%';\n/**\n * Transforms a number to a locale string based on a style and a format.\n */\nfunction formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) {\n let formattedText = '';\n let isZero = false;\n if (!isFinite(value)) {\n formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity);\n }\n else {\n let parsedNumber = parseNumber(value);\n if (isPercent) {\n parsedNumber = toPercent(parsedNumber);\n }\n let minInt = pattern.minInt;\n let minFraction = pattern.minFrac;\n let maxFraction = pattern.maxFrac;\n if (digitsInfo) {\n const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP);\n if (parts === null) {\n throw new Error(`${digitsInfo} is not a valid digit info`);\n }\n const minIntPart = parts[1];\n const minFractionPart = parts[3];\n const maxFractionPart = parts[5];\n if (minIntPart != null) {\n minInt = parseIntAutoRadix(minIntPart);\n }\n if (minFractionPart != null) {\n minFraction = parseIntAutoRadix(minFractionPart);\n }\n if (maxFractionPart != null) {\n maxFraction = parseIntAutoRadix(maxFractionPart);\n }\n else if (minFractionPart != null && minFraction > maxFraction) {\n maxFraction = minFraction;\n }\n }\n roundNumber(parsedNumber, minFraction, maxFraction);\n let digits = parsedNumber.digits;\n let integerLen = parsedNumber.integerLen;\n const exponent = parsedNumber.exponent;\n let decimals = [];\n isZero = digits.every(d => !d);\n // pad zeros for small numbers\n for (; integerLen < minInt; integerLen++) {\n digits.unshift(0);\n }\n // pad zeros for small numbers\n for (; integerLen < 0; integerLen++) {\n digits.unshift(0);\n }\n // extract decimals digits\n if (integerLen > 0) {\n decimals = digits.splice(integerLen, digits.length);\n }\n else {\n decimals = digits;\n digits = [0];\n }\n // format the integer digits with grouping separators\n const groups = [];\n if (digits.length >= pattern.lgSize) {\n groups.unshift(digits.splice(-pattern.lgSize, digits.length).join(''));\n }\n while (digits.length > pattern.gSize) {\n groups.unshift(digits.splice(-pattern.gSize, digits.length).join(''));\n }\n if (digits.length) {\n groups.unshift(digits.join(''));\n }\n formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol));\n // append the decimal digits\n if (decimals.length) {\n formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join('');\n }\n if (exponent) {\n formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent;\n }\n }\n if (value < 0 && !isZero) {\n formattedText = pattern.negPre + formattedText + pattern.negSuf;\n }\n else {\n formattedText = pattern.posPre + formattedText + pattern.posSuf;\n }\n return formattedText;\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as currency using locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param currency A string containing the currency symbol or its name,\n * such as \"$\" or \"Canadian Dollar\". Used in output string, but does not affect the operation\n * of the function.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217)\n * currency code, such as `USD` for the US dollar and `EUR` for the euro.\n * Used to determine the number of digits in the decimal part.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted currency value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatCurrency(value, locale, currency, currencyCode, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n pattern.minFrac = getNumberOfCurrencyDigits(currencyCode);\n pattern.maxFrac = pattern.minFrac;\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo);\n return res\n .replace(CURRENCY_CHAR, currency)\n // if we have 2 time the currency character, the second one is ignored\n .replace(CURRENCY_CHAR, '')\n // If there is a spacing between currency character and the value and\n // the currency character is suppressed by passing an empty string, the\n // spacing character would remain as part of the string. Then we\n // should remove it.\n .trim();\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as a percentage according to locale rules.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted percentage value.\n *\n * @see `formatNumber()`\n * @see `DecimalPipe`\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n * @publicApi\n *\n */\nfunction formatPercent(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true);\n return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign));\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a number as text, with group sizing, separator, and other\n * parameters based on the locale.\n *\n * @param value The number to format.\n * @param locale A locale code for the locale format rules to use.\n * @param digitsInfo Decimal representation options, specified by a string in the following format:\n * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details.\n *\n * @returns The formatted text string.\n * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n-overview)\n *\n * @publicApi\n */\nfunction formatNumber(value, locale, digitsInfo) {\n const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal);\n const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign));\n return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo);\n}\nfunction parseNumberFormat(format, minusSign = '-') {\n const p = {\n minInt: 1,\n minFrac: 0,\n maxFrac: 0,\n posPre: '',\n posSuf: '',\n negPre: '',\n negSuf: '',\n gSize: 0,\n lgSize: 0\n };\n const patternParts = format.split(PATTERN_SEP);\n const positive = patternParts[0];\n const negative = patternParts[1];\n const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ?\n positive.split(DECIMAL_SEP) :\n [\n positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1),\n positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1)\n ], integer = positiveParts[0], fraction = positiveParts[1] || '';\n p.posPre = integer.substring(0, integer.indexOf(DIGIT_CHAR));\n for (let i = 0; i < fraction.length; i++) {\n const ch = fraction.charAt(i);\n if (ch === ZERO_CHAR) {\n p.minFrac = p.maxFrac = i + 1;\n }\n else if (ch === DIGIT_CHAR) {\n p.maxFrac = i + 1;\n }\n else {\n p.posSuf += ch;\n }\n }\n const groups = integer.split(GROUP_SEP);\n p.gSize = groups[1] ? groups[1].length : 0;\n p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0;\n if (negative) {\n const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR);\n p.negPre = negative.substring(0, pos).replace(/'/g, '');\n p.negSuf = negative.slice(pos + trunkLen).replace(/'/g, '');\n }\n else {\n p.negPre = minusSign + p.posPre;\n p.negSuf = p.posSuf;\n }\n return p;\n}\n// Transforms a parsed number into a percentage by multiplying it by 100\nfunction toPercent(parsedNumber) {\n // if the number is 0, don't do anything\n if (parsedNumber.digits[0] === 0) {\n return parsedNumber;\n }\n // Getting the current number of decimals\n const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen;\n if (parsedNumber.exponent) {\n parsedNumber.exponent += 2;\n }\n else {\n if (fractionLen === 0) {\n parsedNumber.digits.push(0, 0);\n }\n else if (fractionLen === 1) {\n parsedNumber.digits.push(0);\n }\n parsedNumber.integerLen += 2;\n }\n return parsedNumber;\n}\n/**\n * Parses a number.\n * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/\n */\nfunction parseNumber(num) {\n let numStr = Math.abs(num) + '';\n let exponent = 0, digits, integerLen;\n let i, j, zeros;\n // Decimal point?\n if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) {\n numStr = numStr.replace(DECIMAL_SEP, '');\n }\n // Exponential form?\n if ((i = numStr.search(/e/i)) > 0) {\n // Work out the exponent.\n if (integerLen < 0)\n integerLen = i;\n integerLen += +numStr.slice(i + 1);\n numStr = numStr.substring(0, i);\n }\n else if (integerLen < 0) {\n // There was no decimal point or exponent so it is an integer.\n integerLen = numStr.length;\n }\n // Count the number of leading zeros.\n for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */\n }\n if (i === (zeros = numStr.length)) {\n // The digits are all zero.\n digits = [0];\n integerLen = 1;\n }\n else {\n // Count the number of trailing zeros\n zeros--;\n while (numStr.charAt(zeros) === ZERO_CHAR)\n zeros--;\n // Trailing zeros are insignificant so ignore them\n integerLen -= i;\n digits = [];\n // Convert string to array of digits without leading/trailing zeros.\n for (j = 0; i <= zeros; i++, j++) {\n digits[j] = Number(numStr.charAt(i));\n }\n }\n // If the number overflows the maximum allowed digits then use an exponent.\n if (integerLen > MAX_DIGITS) {\n digits = digits.splice(0, MAX_DIGITS - 1);\n exponent = integerLen - 1;\n integerLen = 1;\n }\n return { digits, exponent, integerLen };\n}\n/**\n * Round the parsed number to the specified number of decimal places\n * This function changes the parsedNumber in-place\n */\nfunction roundNumber(parsedNumber, minFrac, maxFrac) {\n if (minFrac > maxFrac) {\n throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`);\n }\n let digits = parsedNumber.digits;\n let fractionLen = digits.length - parsedNumber.integerLen;\n const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac);\n // The index of the digit to where rounding is to occur\n let roundAt = fractionSize + parsedNumber.integerLen;\n let digit = digits[roundAt];\n if (roundAt > 0) {\n // Drop fractional digits beyond `roundAt`\n digits.splice(Math.max(parsedNumber.integerLen, roundAt));\n // Set non-fractional digits beyond `roundAt` to 0\n for (let j = roundAt; j < digits.length; j++) {\n digits[j] = 0;\n }\n }\n else {\n // We rounded to zero so reset the parsedNumber\n fractionLen = Math.max(0, fractionLen);\n parsedNumber.integerLen = 1;\n digits.length = Math.max(1, roundAt = fractionSize + 1);\n digits[0] = 0;\n for (let i = 1; i < roundAt; i++)\n digits[i] = 0;\n }\n if (digit >= 5) {\n if (roundAt - 1 < 0) {\n for (let k = 0; k > roundAt; k--) {\n digits.unshift(0);\n parsedNumber.integerLen++;\n }\n digits.unshift(1);\n parsedNumber.integerLen++;\n }\n else {\n digits[roundAt - 1]++;\n }\n }\n // Pad out with zeros to get the required fraction length\n for (; fractionLen < Math.max(0, fractionSize); fractionLen++)\n digits.push(0);\n let dropTrailingZeros = fractionSize !== 0;\n // Minimal length = nb of decimals required + current nb of integers\n // Any number besides that is optional and can be removed if it's a trailing 0\n const minLen = minFrac + parsedNumber.integerLen;\n // Do any carrying, e.g. a digit was rounded up to 10\n const carry = digits.reduceRight(function (carry, d, i, digits) {\n d = d + carry;\n digits[i] = d < 10 ? d : d - 10; // d % 10\n if (dropTrailingZeros) {\n // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52)\n if (digits[i] === 0 && i >= minLen) {\n digits.pop();\n }\n else {\n dropTrailingZeros = false;\n }\n }\n return d >= 10 ? 1 : 0; // Math.floor(d / 10);\n }, 0);\n if (carry) {\n digits.unshift(carry);\n parsedNumber.integerLen++;\n }\n}\nfunction parseIntAutoRadix(text) {\n const result = parseInt(text);\n if (isNaN(result)) {\n throw new Error('Invalid integer literal when parsing ' + text);\n }\n return result;\n}\n\n/**\n * @publicApi\n */\nclass NgLocalization {\n}\nNgLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocalization, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocalization, providedIn: 'root', useFactory: (locale) => new NgLocaleLocalization(locale), deps: [{ token: LOCALE_ID }] });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocalization, decorators: [{\n type: Injectable,\n args: [{\n providedIn: 'root',\n useFactory: (locale) => new NgLocaleLocalization(locale),\n deps: [LOCALE_ID],\n }]\n }] });\n/**\n * Returns the plural category for a given value.\n * - \"=value\" when the case exists,\n * - the plural category otherwise\n */\nfunction getPluralCategory(value, cases, ngLocalization, locale) {\n let key = `=${value}`;\n if (cases.indexOf(key) > -1) {\n return key;\n }\n key = ngLocalization.getPluralCategory(value, locale);\n if (cases.indexOf(key) > -1) {\n return key;\n }\n if (cases.indexOf('other') > -1) {\n return 'other';\n }\n throw new Error(`No plural message found for value \"${value}\"`);\n}\n/**\n * Returns the plural case based on the locale\n *\n * @publicApi\n */\nclass NgLocaleLocalization extends NgLocalization {\n constructor(locale) {\n super();\n this.locale = locale;\n }\n getPluralCategory(value, locale) {\n const plural = getLocalePluralCase(locale || this.locale)(value);\n switch (plural) {\n case Plural.Zero:\n return 'zero';\n case Plural.One:\n return 'one';\n case Plural.Two:\n return 'two';\n case Plural.Few:\n return 'few';\n case Plural.Many:\n return 'many';\n default:\n return 'other';\n }\n }\n}\nNgLocaleLocalization.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocaleLocalization, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Injectable });\nNgLocaleLocalization.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocaleLocalization });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgLocaleLocalization, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n\n/**\n * Register global data to be used internally by Angular. See the\n * [\"I18n guide\"](guide/i18n-common-format-data-locale) to know how to import additional locale\n * data.\n *\n * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1\n *\n * @publicApi\n */\nfunction registerLocaleData(data, localeId, extraData) {\n return ɵregisterLocaleData(data, localeId, extraData);\n}\n\nfunction parseCookieValue(cookieStr, name) {\n name = encodeURIComponent(name);\n for (const cookie of cookieStr.split(';')) {\n const eqIndex = cookie.indexOf('=');\n const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)];\n if (cookieName.trim() === name) {\n return decodeURIComponent(cookieValue);\n }\n }\n return null;\n}\n\nconst WS_REGEXP = /\\s+/;\nconst EMPTY_ARRAY = [];\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n *\n * ...\n * ```\n *\n * @description\n *\n * Adds and removes CSS classes on an HTML element.\n *\n * The CSS classes are updated as follows, depending on the type of the expression evaluation:\n * - `string` - the CSS classes listed in the string (space delimited) are added,\n * - `Array` - the CSS classes declared as Array elements are added,\n * - `Object` - keys are CSS classes that get added when the expression given in the value\n * evaluates to a truthy value, otherwise they are removed.\n *\n * @publicApi\n */\nclass NgClass {\n constructor(\n // leaving references to differs in place since flex layout is extending NgClass...\n _iterableDiffers, _keyValueDiffers, _ngEl, _renderer) {\n this._iterableDiffers = _iterableDiffers;\n this._keyValueDiffers = _keyValueDiffers;\n this._ngEl = _ngEl;\n this._renderer = _renderer;\n this.initialClasses = EMPTY_ARRAY;\n this.stateMap = new Map();\n }\n set klass(value) {\n this.initialClasses = value != null ? value.trim().split(WS_REGEXP) : EMPTY_ARRAY;\n }\n set ngClass(value) {\n this.rawClass = typeof value === 'string' ? value.trim().split(WS_REGEXP) : value;\n }\n /*\n The NgClass directive uses the custom change detection algorithm for its inputs. The custom\n algorithm is necessary since inputs are represented as complex object or arrays that need to be\n deeply-compared.\n \n This algorithm is perf-sensitive since NgClass is used very frequently and its poor performance\n might negatively impact runtime performance of the entire change detection cycle. The design of\n this algorithm is making sure that:\n - there is no unnecessary DOM manipulation (CSS classes are added / removed from the DOM only when\n needed), even if references to bound objects change;\n - there is no memory allocation if nothing changes (even relatively modest memory allocation\n during the change detection cycle can result in GC pauses for some of the CD cycles).\n \n The algorithm works by iterating over the set of bound classes, staring with [class] binding and\n then going over [ngClass] binding. For each CSS class name:\n - check if it was seen before (this information is tracked in the state map) and if its value\n changed;\n - mark it as \"touched\" - names that are not marked are not present in the latest set of binding\n and we can remove such class name from the internal data structures;\n \n After iteration over all the CSS class names we've got data structure with all the information\n necessary to synchronize changes to the DOM - it is enough to iterate over the state map, flush\n changes to the DOM and reset internal data structures so those are ready for the next change\n detection cycle.\n */\n ngDoCheck() {\n // classes from the [class] binding\n for (const klass of this.initialClasses) {\n this._updateState(klass, true);\n }\n // classes from the [ngClass] binding\n const rawClass = this.rawClass;\n if (Array.isArray(rawClass) || rawClass instanceof Set) {\n for (const klass of rawClass) {\n this._updateState(klass, true);\n }\n }\n else if (rawClass != null) {\n for (const klass of Object.keys(rawClass)) {\n this._updateState(klass, Boolean(rawClass[klass]));\n }\n }\n this._applyStateDiff();\n }\n _updateState(klass, nextEnabled) {\n const state = this.stateMap.get(klass);\n if (state !== undefined) {\n if (state.enabled !== nextEnabled) {\n state.changed = true;\n state.enabled = nextEnabled;\n }\n state.touched = true;\n }\n else {\n this.stateMap.set(klass, { enabled: nextEnabled, changed: true, touched: true });\n }\n }\n _applyStateDiff() {\n for (const stateEntry of this.stateMap) {\n const klass = stateEntry[0];\n const state = stateEntry[1];\n if (state.changed) {\n this._toggleClass(klass, state.enabled);\n state.changed = false;\n }\n else if (!state.touched) {\n // A class that was previously active got removed from the new collection of classes -\n // remove from the DOM as well.\n if (state.enabled) {\n this._toggleClass(klass, false);\n }\n this.stateMap.delete(klass);\n }\n state.touched = false;\n }\n }\n _toggleClass(klass, enabled) {\n if (ngDevMode) {\n if (typeof klass !== 'string') {\n throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${ɵstringify(klass)}`);\n }\n }\n klass = klass.trim();\n if (klass.length > 0) {\n klass.split(WS_REGEXP).forEach(klass => {\n if (enabled) {\n this._renderer.addClass(this._ngEl.nativeElement, klass);\n }\n else {\n this._renderer.removeClass(this._ngEl.nativeElement, klass);\n }\n });\n }\n }\n}\nNgClass.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgClass, deps: [{ token: i0.IterableDiffers }, { token: i0.KeyValueDiffers }, { token: i0.ElementRef }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgClass.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgClass, isStandalone: true, selector: \"[ngClass]\", inputs: { klass: [\"class\", \"klass\"], ngClass: \"ngClass\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgClass, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngClass]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.IterableDiffers }, { type: i0.KeyValueDiffers }, { type: i0.ElementRef }, { type: i0.Renderer2 }]; }, propDecorators: { klass: [{\n type: Input,\n args: ['class']\n }], ngClass: [{\n type: Input,\n args: ['ngClass']\n }] } });\n\n/**\n * Instantiates a {@link Component} type and inserts its Host View into the current View.\n * `NgComponentOutlet` provides a declarative approach for dynamic component creation.\n *\n * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and\n * any existing component will be destroyed.\n *\n * @usageNotes\n *\n * ### Fine tune control\n *\n * You can control the component creation process by using the following optional attributes:\n *\n * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for\n * the Component. Defaults to the injector of the current view container.\n *\n * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content\n * section of the component, if it exists.\n *\n * * `ngComponentOutletNgModule`: Optional NgModule class reference to allow loading another\n * module dynamically, then loading a component from that module.\n *\n * * `ngComponentOutletNgModuleFactory`: Deprecated config option that allows providing optional\n * NgModule factory to allow loading another module dynamically, then loading a component from that\n * module. Use `ngComponentOutletNgModule` instead.\n *\n * ### Syntax\n *\n * Simple\n * ```\n * \n * ```\n *\n * Customized injector/content\n * ```\n * \n * \n * ```\n *\n * Customized NgModule reference\n * ```\n * \n * \n * ```\n *\n * ### A simple example\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'}\n *\n * A more complete example with additional options:\n *\n * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'}\n *\n * @publicApi\n * @ngModule CommonModule\n */\nclass NgComponentOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this.ngComponentOutlet = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n const { _viewContainerRef: viewContainerRef, ngComponentOutletNgModule: ngModule, ngComponentOutletNgModuleFactory: ngModuleFactory, } = this;\n viewContainerRef.clear();\n this._componentRef = undefined;\n if (this.ngComponentOutlet) {\n const injector = this.ngComponentOutletInjector || viewContainerRef.parentInjector;\n if (changes['ngComponentOutletNgModule'] || changes['ngComponentOutletNgModuleFactory']) {\n if (this._moduleRef)\n this._moduleRef.destroy();\n if (ngModule) {\n this._moduleRef = createNgModule(ngModule, getParentInjector(injector));\n }\n else if (ngModuleFactory) {\n this._moduleRef = ngModuleFactory.create(getParentInjector(injector));\n }\n else {\n this._moduleRef = undefined;\n }\n }\n this._componentRef = viewContainerRef.createComponent(this.ngComponentOutlet, {\n index: viewContainerRef.length,\n injector,\n ngModuleRef: this._moduleRef,\n projectableNodes: this.ngComponentOutletContent,\n });\n }\n }\n /** @nodoc */\n ngOnDestroy() {\n if (this._moduleRef)\n this._moduleRef.destroy();\n }\n}\nNgComponentOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgComponentOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgComponentOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgComponentOutlet, isStandalone: true, selector: \"[ngComponentOutlet]\", inputs: { ngComponentOutlet: \"ngComponentOutlet\", ngComponentOutletInjector: \"ngComponentOutletInjector\", ngComponentOutletContent: \"ngComponentOutletContent\", ngComponentOutletNgModule: \"ngComponentOutletNgModule\", ngComponentOutletNgModuleFactory: \"ngComponentOutletNgModuleFactory\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgComponentOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngComponentOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngComponentOutlet: [{\n type: Input\n }], ngComponentOutletInjector: [{\n type: Input\n }], ngComponentOutletContent: [{\n type: Input\n }], ngComponentOutletNgModule: [{\n type: Input\n }], ngComponentOutletNgModuleFactory: [{\n type: Input\n }] } });\n// Helper function that returns an Injector instance of a parent NgModule.\nfunction getParentInjector(injector) {\n const parentNgModule = injector.get(NgModuleRef);\n return parentNgModule.injector;\n}\n\nconst NG_DEV_MODE = typeof ngDevMode === 'undefined' || !!ngDevMode;\n/**\n * @publicApi\n */\nclass NgForOfContext {\n constructor($implicit, ngForOf, index, count) {\n this.$implicit = $implicit;\n this.ngForOf = ngForOf;\n this.index = index;\n this.count = count;\n }\n get first() {\n return this.index === 0;\n }\n get last() {\n return this.index === this.count - 1;\n }\n get even() {\n return this.index % 2 === 0;\n }\n get odd() {\n return !this.even;\n }\n}\n/**\n * A [structural directive](guide/structural-directives) that renders\n * a template for each item in a collection.\n * The directive is placed on an element, which becomes the parent\n * of the cloned templates.\n *\n * The `ngForOf` directive is generally used in the\n * [shorthand form](guide/structural-directives#asterisk) `*ngFor`.\n * In this form, the template to be rendered for each iteration is the content\n * of an anchor element containing the directive.\n *\n * The following example shows the shorthand syntax with some options,\n * contained in an `
  • ` element.\n *\n * ```\n *
  • ...
  • \n * ```\n *\n * The shorthand form expands into a long form that uses the `ngForOf` selector\n * on an `` element.\n * The content of the `` element is the `
  • ` element that held the\n * short-form directive.\n *\n * Here is the expanded version of the short-form example.\n *\n * ```\n * \n *
  • ...
  • \n *
    \n * ```\n *\n * Angular automatically expands the shorthand syntax as it compiles the template.\n * The context for each embedded view is logically merged to the current component\n * context according to its lexical position.\n *\n * When using the shorthand syntax, Angular allows only [one structural directive\n * on an element](guide/structural-directives#one-per-element).\n * If you want to iterate conditionally, for example,\n * put the `*ngIf` on a container element that wraps the `*ngFor` element.\n * For further discussion, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @usageNotes\n *\n * ### Local variables\n *\n * `NgForOf` provides exported values that can be aliased to local variables.\n * For example:\n *\n * ```\n *
  • \n * {{i}}/{{users.length}}. {{user}} default\n *
  • \n * ```\n *\n * The following exported values can be aliased to local variables:\n *\n * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`).\n * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is\n * more complex then a property access, for example when using the async pipe (`userStreams |\n * async`).\n * - `index: number`: The index of the current item in the iterable.\n * - `count: number`: The length of the iterable.\n * - `first: boolean`: True when the item is the first item in the iterable.\n * - `last: boolean`: True when the item is the last item in the iterable.\n * - `even: boolean`: True when the item has an even index in the iterable.\n * - `odd: boolean`: True when the item has an odd index in the iterable.\n *\n * ### Change propagation\n *\n * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM:\n *\n * * When an item is added, a new instance of the template is added to the DOM.\n * * When an item is removed, its template instance is removed from the DOM.\n * * When items are reordered, their respective templates are reordered in the DOM.\n *\n * Angular uses object identity to track insertions and deletions within the iterator and reproduce\n * those changes in the DOM. This has important implications for animations and any stateful\n * controls that are present, such as `` elements that accept user input. Inserted rows can\n * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state\n * such as user input.\n * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers).\n *\n * The identities of elements in the iterator can change while the data does not.\n * This can happen, for example, if the iterator is produced from an RPC to the server, and that\n * RPC is re-run. Even if the data hasn't changed, the second response produces objects with\n * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old\n * elements were deleted and all new elements inserted).\n *\n * To avoid this expensive operation, you can customize the default tracking algorithm.\n * by supplying the `trackBy` option to `NgForOf`.\n * `trackBy` takes a function that has two arguments: `index` and `item`.\n * If `trackBy` is given, Angular tracks changes by the return value of the function.\n *\n * @see [Structural Directives](guide/structural-directives)\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgForOf {\n /**\n * The value of the iterable expression, which can be used as a\n * [template input variable](guide/structural-directives#shorthand).\n */\n set ngForOf(ngForOf) {\n this._ngForOf = ngForOf;\n this._ngForOfDirty = true;\n }\n /**\n * Specifies a custom `TrackByFunction` to compute the identity of items in an iterable.\n *\n * If a custom `TrackByFunction` is not provided, `NgForOf` will use the item's [object\n * identity](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is)\n * as the key.\n *\n * `NgForOf` uses the computed key to associate items in an iterable with DOM elements\n * it produces for these items.\n *\n * A custom `TrackByFunction` is useful to provide good user experience in cases when items in an\n * iterable rendered using `NgForOf` have a natural identifier (for example, custom ID or a\n * primary key), and this iterable could be updated with new object instances that still\n * represent the same underlying entity (for example, when data is re-fetched from the server,\n * and the iterable is recreated and re-rendered, but most of the data is still the same).\n *\n * @see `TrackByFunction`\n */\n set ngForTrackBy(fn) {\n if (NG_DEV_MODE && fn != null && typeof fn !== 'function') {\n console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` +\n `See https://angular.io/api/common/NgForOf#change-propagation for more information.`);\n }\n this._trackByFn = fn;\n }\n get ngForTrackBy() {\n return this._trackByFn;\n }\n constructor(_viewContainer, _template, _differs) {\n this._viewContainer = _viewContainer;\n this._template = _template;\n this._differs = _differs;\n this._ngForOf = null;\n this._ngForOfDirty = true;\n this._differ = null;\n }\n /**\n * A reference to the template that is stamped out for each item in the iterable.\n * @see [template reference variable](guide/template-reference-variables)\n */\n set ngForTemplate(value) {\n // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1\n // The current type is too restrictive; a template that just uses index, for example,\n // should be acceptable.\n if (value) {\n this._template = value;\n }\n }\n /**\n * Applies the changes when needed.\n * @nodoc\n */\n ngDoCheck() {\n if (this._ngForOfDirty) {\n this._ngForOfDirty = false;\n // React on ngForOf changes only once all inputs have been initialized\n const value = this._ngForOf;\n if (!this._differ && value) {\n if (NG_DEV_MODE) {\n try {\n // CAUTION: this logic is duplicated for production mode below, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n catch {\n let errorMessage = `Cannot find a differ supporting object '${value}' of type '` +\n `${getTypeName(value)}'. NgFor only supports binding to Iterables, such as Arrays.`;\n if (typeof value === 'object') {\n errorMessage += ' Did you mean to use the keyvalue pipe?';\n }\n throw new ɵRuntimeError(-2200 /* RuntimeErrorCode.NG_FOR_MISSING_DIFFER */, errorMessage);\n }\n }\n else {\n // CAUTION: this logic is duplicated for development mode above, as the try-catch\n // is only present in development builds.\n this._differ = this._differs.find(value).create(this.ngForTrackBy);\n }\n }\n }\n if (this._differ) {\n const changes = this._differ.diff(this._ngForOf);\n if (changes)\n this._applyChanges(changes);\n }\n }\n _applyChanges(changes) {\n const viewContainer = this._viewContainer;\n changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => {\n if (item.previousIndex == null) {\n // NgForOf is never \"null\" or \"undefined\" here because the differ detected\n // that a new item needs to be inserted from the iterable. This implies that\n // there is an iterable value for \"_ngForOf\".\n viewContainer.createEmbeddedView(this._template, new NgForOfContext(item.item, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex);\n }\n else if (currentIndex == null) {\n viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex);\n }\n else if (adjustedPreviousIndex !== null) {\n const view = viewContainer.get(adjustedPreviousIndex);\n viewContainer.move(view, currentIndex);\n applyViewChange(view, item);\n }\n });\n for (let i = 0, ilen = viewContainer.length; i < ilen; i++) {\n const viewRef = viewContainer.get(i);\n const context = viewRef.context;\n context.index = i;\n context.count = ilen;\n context.ngForOf = this._ngForOf;\n }\n changes.forEachIdentityChange((record) => {\n const viewRef = viewContainer.get(record.currentIndex);\n applyViewChange(viewRef, record);\n });\n }\n /**\n * Asserts the correct type of the context for the template that `NgForOf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgForOf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgForOf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgForOf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: i0.IterableDiffers }], target: i0.ɵɵFactoryTarget.Directive });\nNgForOf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgForOf, isStandalone: true, selector: \"[ngFor][ngForOf]\", inputs: { ngForOf: \"ngForOf\", ngForTrackBy: \"ngForTrackBy\", ngForTemplate: \"ngForTemplate\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgForOf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngFor][ngForOf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: i0.IterableDiffers }]; }, propDecorators: { ngForOf: [{\n type: Input\n }], ngForTrackBy: [{\n type: Input\n }], ngForTemplate: [{\n type: Input\n }] } });\nfunction applyViewChange(view, record) {\n view.context.$implicit = record.item;\n}\nfunction getTypeName(type) {\n return type['name'] || typeof type;\n}\n\n/**\n * A structural directive that conditionally includes a template based on the value of\n * an expression coerced to Boolean.\n * When the expression evaluates to true, Angular renders the template\n * provided in a `then` clause, and when false or null,\n * Angular renders the template provided in an optional `else` clause. The default\n * template for the `else` clause is blank.\n *\n * A [shorthand form](guide/structural-directives#asterisk) of the directive,\n * `*ngIf=\"condition\"`, is generally used, provided\n * as an attribute of the anchor element for the inserted template.\n * Angular expands this into a more explicit version, in which the anchor element\n * is contained in an `` element.\n *\n * Simple form with shorthand syntax:\n *\n * ```\n *
    Content to render when condition is true.
    \n * ```\n *\n * Simple form with expanded syntax:\n *\n * ```\n *
    Content to render when condition is\n * true.
    \n * ```\n *\n * Form with an \"else\" block:\n *\n * ```\n *
    Content to render when condition is true.
    \n * Content to render when condition is false.\n * ```\n *\n * Shorthand form with \"then\" and \"else\" blocks:\n *\n * ```\n *
    \n * Content to render when condition is true.\n * Content to render when condition is false.\n * ```\n *\n * Form with storing the value locally:\n *\n * ```\n *
    {{value}}
    \n * Content to render when value is null.\n * ```\n *\n * @usageNotes\n *\n * The `*ngIf` directive is most commonly used to conditionally show an inline template,\n * as seen in the following example.\n * The default `else` template is blank.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfSimple'}\n *\n * ### Showing an alternative template using `else`\n *\n * To display a template when `expression` evaluates to false, use an `else` template\n * binding as shown in the following example.\n * The `else` binding points to an `` element labeled `#elseBlock`.\n * The template can be defined anywhere in the component view, but is typically placed right after\n * `ngIf` for readability.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfElse'}\n *\n * ### Using an external `then` template\n *\n * In the previous example, the then-clause template is specified inline, as the content of the\n * tag that contains the `ngIf` directive. You can also specify a template that is defined\n * externally, by referencing a labeled `` element. When you do this, you can\n * change which template to use at runtime, as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfThenElse'}\n *\n * ### Storing a conditional result in a variable\n *\n * You might want to show a set of properties from the same object. If you are waiting\n * for asynchronous data, the object can be undefined.\n * In this case, you can use `ngIf` and store the result of the condition in a local\n * variable as shown in the following example.\n *\n * {@example common/ngIf/ts/module.ts region='NgIfAs'}\n *\n * This code uses only one `AsyncPipe`, so only one subscription is created.\n * The conditional statement stores the result of `userStream|async` in the local variable `user`.\n * You can then bind the local `user` repeatedly.\n *\n * The conditional displays the data only if `userStream` returns a value,\n * so you don't need to use the\n * safe-navigation-operator (`?.`)\n * to guard against null values when accessing properties.\n * You can display an alternative template while waiting for the data.\n *\n * ### Shorthand syntax\n *\n * The shorthand syntax `*ngIf` expands into two separate template specifications\n * for the \"then\" and \"else\" clauses. For example, consider the following shorthand statement,\n * that is meant to show a loading page while waiting for data to be loaded.\n *\n * ```\n *
    \n * ...\n *
    \n *\n * \n *
    Loading...
    \n *
    \n * ```\n *\n * You can see that the \"else\" clause references the ``\n * with the `#loading` label, and the template for the \"then\" clause\n * is provided as the content of the anchor element.\n *\n * However, when Angular expands the shorthand syntax, it creates\n * another `` tag, with `ngIf` and `ngIfElse` directives.\n * The anchor element containing the template for the \"then\" clause becomes\n * the content of this unlabeled `` tag.\n *\n * ```\n * \n *
    \n * ...\n *
    \n *
    \n *\n * \n *
    Loading...
    \n *
    \n * ```\n *\n * The presence of the implicit template object has implications for the nesting of\n * structural directives. For more on this subject, see\n * [Structural Directives](guide/structural-directives#one-per-element).\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass NgIf {\n constructor(_viewContainer, templateRef) {\n this._viewContainer = _viewContainer;\n this._context = new NgIfContext();\n this._thenTemplateRef = null;\n this._elseTemplateRef = null;\n this._thenViewRef = null;\n this._elseViewRef = null;\n this._thenTemplateRef = templateRef;\n }\n /**\n * The Boolean expression to evaluate as the condition for showing a template.\n */\n set ngIf(condition) {\n this._context.$implicit = this._context.ngIf = condition;\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to true.\n */\n set ngIfThen(templateRef) {\n assertTemplate('ngIfThen', templateRef);\n this._thenTemplateRef = templateRef;\n this._thenViewRef = null; // clear previous view if any.\n this._updateView();\n }\n /**\n * A template to show if the condition expression evaluates to false.\n */\n set ngIfElse(templateRef) {\n assertTemplate('ngIfElse', templateRef);\n this._elseTemplateRef = templateRef;\n this._elseViewRef = null; // clear previous view if any.\n this._updateView();\n }\n _updateView() {\n if (this._context.$implicit) {\n if (!this._thenViewRef) {\n this._viewContainer.clear();\n this._elseViewRef = null;\n if (this._thenTemplateRef) {\n this._thenViewRef =\n this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context);\n }\n }\n }\n else {\n if (!this._elseViewRef) {\n this._viewContainer.clear();\n this._thenViewRef = null;\n if (this._elseTemplateRef) {\n this._elseViewRef =\n this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context);\n }\n }\n }\n }\n /**\n * Asserts the correct type of the context for the template that `NgIf` will render.\n *\n * The presence of this method is a signal to the Ivy template type-check compiler that the\n * `NgIf` structural directive renders its template with a specific context type.\n */\n static ngTemplateContextGuard(dir, ctx) {\n return true;\n }\n}\nNgIf.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgIf, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgIf.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgIf, isStandalone: true, selector: \"[ngIf]\", inputs: { ngIf: \"ngIf\", ngIfThen: \"ngIfThen\", ngIfElse: \"ngIfElse\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgIf, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngIf]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }]; }, propDecorators: { ngIf: [{\n type: Input\n }], ngIfThen: [{\n type: Input\n }], ngIfElse: [{\n type: Input\n }] } });\n/**\n * @publicApi\n */\nclass NgIfContext {\n constructor() {\n this.$implicit = null;\n this.ngIf = null;\n }\n}\nfunction assertTemplate(property, templateRef) {\n const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView);\n if (!isTemplateRefOrNull) {\n throw new Error(`${property} must be a TemplateRef, but received '${ɵstringify(templateRef)}'.`);\n }\n}\n\nclass SwitchView {\n constructor(_viewContainerRef, _templateRef) {\n this._viewContainerRef = _viewContainerRef;\n this._templateRef = _templateRef;\n this._created = false;\n }\n create() {\n this._created = true;\n this._viewContainerRef.createEmbeddedView(this._templateRef);\n }\n destroy() {\n this._created = false;\n this._viewContainerRef.clear();\n }\n enforceState(created) {\n if (created && !this._created) {\n this.create();\n }\n else if (!created && this._created) {\n this.destroy();\n }\n }\n}\n/**\n * @ngModule CommonModule\n *\n * @description\n * The `[ngSwitch]` directive on a container specifies an expression to match against.\n * The expressions to match are provided by `ngSwitchCase` directives on views within the container.\n * - Every view that matches is rendered.\n * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered.\n * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase`\n * or `ngSwitchDefault` directive are preserved at the location.\n *\n * @usageNotes\n * Define a container element for the directive, and specify the switch expression\n * to match against as an attribute:\n *\n * ```\n * \n * ```\n *\n * Within the container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * ### Usage Examples\n *\n * The following example shows how to use more than one case to display the same view:\n *\n * ```\n * \n * \n * ...\n * ...\n * ...\n * \n * ...\n * \n * ```\n *\n * The following example shows how cases can be nested:\n * ```\n * \n * ...\n * ...\n * ...\n * \n * \n * \n * \n * \n * ...\n * \n * ```\n *\n * @publicApi\n * @see `NgSwitchCase`\n * @see `NgSwitchDefault`\n * @see [Structural Directives](guide/structural-directives)\n *\n */\nclass NgSwitch {\n constructor() {\n this._defaultViews = [];\n this._defaultUsed = false;\n this._caseCount = 0;\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n set ngSwitch(newValue) {\n this._ngSwitch = newValue;\n if (this._caseCount === 0) {\n this._updateDefaultCases(true);\n }\n }\n /** @internal */\n _addCase() {\n return this._caseCount++;\n }\n /** @internal */\n _addDefault(view) {\n this._defaultViews.push(view);\n }\n /** @internal */\n _matchCase(value) {\n const matched = value == this._ngSwitch;\n this._lastCasesMatched = this._lastCasesMatched || matched;\n this._lastCaseCheckIndex++;\n if (this._lastCaseCheckIndex === this._caseCount) {\n this._updateDefaultCases(!this._lastCasesMatched);\n this._lastCaseCheckIndex = 0;\n this._lastCasesMatched = false;\n }\n return matched;\n }\n _updateDefaultCases(useDefault) {\n if (this._defaultViews.length > 0 && useDefault !== this._defaultUsed) {\n this._defaultUsed = useDefault;\n for (const defaultView of this._defaultViews) {\n defaultView.enforceState(useDefault);\n }\n }\n }\n}\nNgSwitch.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitch, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitch.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgSwitch, isStandalone: true, selector: \"[ngSwitch]\", inputs: { ngSwitch: \"ngSwitch\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitch, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitch]',\n standalone: true,\n }]\n }], propDecorators: { ngSwitch: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n * Provides a switch case expression to match against an enclosing `ngSwitch` expression.\n * When the expressions match, the given `NgSwitchCase` template is rendered.\n * If multiple match expressions match the switch expression value, all of them are displayed.\n *\n * @usageNotes\n *\n * Within a switch container, `*ngSwitchCase` statements specify the match expressions\n * as attributes. Include `*ngSwitchDefault` as the final case.\n *\n * ```\n * \n * ...\n * ...\n * ...\n * \n * ```\n *\n * Each switch-case statement contains an in-line HTML template or template reference\n * that defines the subtree to be selected if the value of the match expression\n * matches the value of the switch expression.\n *\n * Unlike JavaScript, which uses strict equality, Angular uses loose equality.\n * This means that the empty string, `\"\"` matches 0.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchDefault`\n *\n */\nclass NgSwitchCase {\n constructor(viewContainer, templateRef, ngSwitch) {\n this.ngSwitch = ngSwitch;\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchCase', 'NgSwitchCase');\n }\n ngSwitch._addCase();\n this._view = new SwitchView(viewContainer, templateRef);\n }\n /**\n * Performs case matching. For internal use only.\n * @nodoc\n */\n ngDoCheck() {\n this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase));\n }\n}\nNgSwitchCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitchCase, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgSwitchCase, isStandalone: true, selector: \"[ngSwitchCase]\", inputs: { ngSwitchCase: \"ngSwitchCase\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitchCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchCase]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; }, propDecorators: { ngSwitchCase: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that is rendered when no `NgSwitchCase` expressions\n * match the `NgSwitch` expression.\n * This statement should be the final case in an `NgSwitch`.\n *\n * @publicApi\n * @see `NgSwitch`\n * @see `NgSwitchCase`\n *\n */\nclass NgSwitchDefault {\n constructor(viewContainer, templateRef, ngSwitch) {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && !ngSwitch) {\n throwNgSwitchProviderNotFoundError('ngSwitchDefault', 'NgSwitchDefault');\n }\n ngSwitch._addDefault(new SwitchView(viewContainer, templateRef));\n }\n}\nNgSwitchDefault.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitchDefault, deps: [{ token: i0.ViewContainerRef }, { token: i0.TemplateRef }, { token: NgSwitch, host: true, optional: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgSwitchDefault.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgSwitchDefault, isStandalone: true, selector: \"[ngSwitchDefault]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgSwitchDefault, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngSwitchDefault]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }, { type: i0.TemplateRef }, { type: NgSwitch, decorators: [{\n type: Optional\n }, {\n type: Host\n }] }]; } });\nfunction throwNgSwitchProviderNotFoundError(attrName, directiveName) {\n throw new ɵRuntimeError(2000 /* RuntimeErrorCode.PARENT_NG_SWITCH_NOT_FOUND */, `An element with the \"${attrName}\" attribute ` +\n `(matching the \"${directiveName}\" directive) must be located inside an element with the \"ngSwitch\" attribute ` +\n `(matching \"NgSwitch\" directive)`);\n}\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n * ```\n * \n * there is nothing\n * there is one\n * there are a few\n * \n * ```\n *\n * @description\n *\n * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization.\n *\n * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees\n * that match the switch expression's pluralization category.\n *\n * To use this directive you must provide a container element that sets the `[ngPlural]` attribute\n * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their\n * expression:\n * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value\n * matches the switch expression exactly,\n * - otherwise, the view will be treated as a \"category match\", and will only display if exact\n * value matches aren't found and the value maps to its category for the defined locale.\n *\n * See http://cldr.unicode.org/index/cldr-spec/plural-rules\n *\n * @publicApi\n */\nclass NgPlural {\n constructor(_localization) {\n this._localization = _localization;\n this._caseViews = {};\n }\n set ngPlural(value) {\n this._updateView(value);\n }\n addCase(value, switchView) {\n this._caseViews[value] = switchView;\n }\n _updateView(switchValue) {\n this._clearViews();\n const cases = Object.keys(this._caseViews);\n const key = getPluralCategory(switchValue, cases, this._localization);\n this._activateView(this._caseViews[key]);\n }\n _clearViews() {\n if (this._activeView)\n this._activeView.destroy();\n }\n _activateView(view) {\n if (view) {\n this._activeView = view;\n this._activeView.create();\n }\n }\n}\nNgPlural.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgPlural, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Directive });\nNgPlural.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgPlural, isStandalone: true, selector: \"[ngPlural]\", inputs: { ngPlural: \"ngPlural\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgPlural, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPlural]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; }, propDecorators: { ngPlural: [{\n type: Input\n }] } });\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Creates a view that will be added/removed from the parent {@link NgPlural} when the\n * given expression matches the plural expression according to CLDR rules.\n *\n * @usageNotes\n * ```\n * \n * ...\n * ...\n * \n *```\n *\n * See {@link NgPlural} for more details and example.\n *\n * @publicApi\n */\nclass NgPluralCase {\n constructor(value, template, viewContainer, ngPlural) {\n this.value = value;\n const isANumber = !isNaN(Number(value));\n ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template));\n }\n}\nNgPluralCase.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgPluralCase, deps: [{ token: 'ngPluralCase', attribute: true }, { token: i0.TemplateRef }, { token: i0.ViewContainerRef }, { token: NgPlural, host: true }], target: i0.ɵɵFactoryTarget.Directive });\nNgPluralCase.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgPluralCase, isStandalone: true, selector: \"[ngPluralCase]\", ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgPluralCase, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngPluralCase]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Attribute,\n args: ['ngPluralCase']\n }] }, { type: i0.TemplateRef }, { type: i0.ViewContainerRef }, { type: NgPlural, decorators: [{\n type: Host\n }] }]; } });\n\n/**\n * @ngModule CommonModule\n *\n * @usageNotes\n *\n * Set the font of the containing element to the result of an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set the width of the containing element to a pixel value returned by an expression.\n *\n * ```\n * ...\n * ```\n *\n * Set a collection of style values using an expression that returns key-value pairs.\n *\n * ```\n * ...\n * ```\n *\n * @description\n *\n * An attribute directive that updates styles for the containing HTML element.\n * Sets one or more style properties, specified as colon-separated key-value pairs.\n * The key is a style name, with an optional `.` suffix\n * (such as 'top.px', 'font-style.em').\n * The value is an expression to be evaluated.\n * The resulting non-null value, expressed in the given unit,\n * is assigned to the given style property.\n * If the result of evaluation is null, the corresponding style is removed.\n *\n * @publicApi\n */\nclass NgStyle {\n constructor(_ngEl, _differs, _renderer) {\n this._ngEl = _ngEl;\n this._differs = _differs;\n this._renderer = _renderer;\n this._ngStyle = null;\n this._differ = null;\n }\n set ngStyle(values) {\n this._ngStyle = values;\n if (!this._differ && values) {\n this._differ = this._differs.find(values).create();\n }\n }\n ngDoCheck() {\n if (this._differ) {\n const changes = this._differ.diff(this._ngStyle);\n if (changes) {\n this._applyChanges(changes);\n }\n }\n }\n _setStyle(nameAndUnit, value) {\n const [name, unit] = nameAndUnit.split('.');\n const flags = name.indexOf('-') === -1 ? undefined : RendererStyleFlags2.DashCase;\n if (value != null) {\n this._renderer.setStyle(this._ngEl.nativeElement, name, unit ? `${value}${unit}` : value, flags);\n }\n else {\n this._renderer.removeStyle(this._ngEl.nativeElement, name, flags);\n }\n }\n _applyChanges(changes) {\n changes.forEachRemovedItem((record) => this._setStyle(record.key, null));\n changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue));\n changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue));\n }\n}\nNgStyle.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgStyle, deps: [{ token: i0.ElementRef }, { token: i0.KeyValueDiffers }, { token: i0.Renderer2 }], target: i0.ɵɵFactoryTarget.Directive });\nNgStyle.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgStyle, isStandalone: true, selector: \"[ngStyle]\", inputs: { ngStyle: \"ngStyle\" }, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgStyle, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngStyle]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ElementRef }, { type: i0.KeyValueDiffers }, { type: i0.Renderer2 }]; }, propDecorators: { ngStyle: [{\n type: Input,\n args: ['ngStyle']\n }] } });\n\n/**\n * @ngModule CommonModule\n *\n * @description\n *\n * Inserts an embedded view from a prepared `TemplateRef`.\n *\n * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`.\n * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding\n * by the local template `let` declarations.\n *\n * @usageNotes\n * ```\n * \n * ```\n *\n * Using the key `$implicit` in the context object will set its value as default.\n *\n * ### Example\n *\n * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'}\n *\n * @publicApi\n */\nclass NgTemplateOutlet {\n constructor(_viewContainerRef) {\n this._viewContainerRef = _viewContainerRef;\n this._viewRef = null;\n /**\n * A context object to attach to the {@link EmbeddedViewRef}. This should be an\n * object, the object's keys will be available for binding by the local template `let`\n * declarations.\n * Using the key `$implicit` in the context object will set its value as default.\n */\n this.ngTemplateOutletContext = null;\n /**\n * A string defining the template reference and optionally the context object for the template.\n */\n this.ngTemplateOutlet = null;\n /** Injector to be used within the embedded view. */\n this.ngTemplateOutletInjector = null;\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (changes['ngTemplateOutlet'] || changes['ngTemplateOutletInjector']) {\n const viewContainerRef = this._viewContainerRef;\n if (this._viewRef) {\n viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef));\n }\n if (this.ngTemplateOutlet) {\n const { ngTemplateOutlet: template, ngTemplateOutletContext: context, ngTemplateOutletInjector: injector } = this;\n this._viewRef = viewContainerRef.createEmbeddedView(template, context, injector ? { injector } : undefined);\n }\n else {\n this._viewRef = null;\n }\n }\n else if (this._viewRef && changes['ngTemplateOutletContext'] && this.ngTemplateOutletContext) {\n this._viewRef.context = this.ngTemplateOutletContext;\n }\n }\n}\nNgTemplateOutlet.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgTemplateOutlet, deps: [{ token: i0.ViewContainerRef }], target: i0.ɵɵFactoryTarget.Directive });\nNgTemplateOutlet.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgTemplateOutlet, isStandalone: true, selector: \"[ngTemplateOutlet]\", inputs: { ngTemplateOutletContext: \"ngTemplateOutletContext\", ngTemplateOutlet: \"ngTemplateOutlet\", ngTemplateOutletInjector: \"ngTemplateOutletInjector\" }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgTemplateOutlet, decorators: [{\n type: Directive,\n args: [{\n selector: '[ngTemplateOutlet]',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ViewContainerRef }]; }, propDecorators: { ngTemplateOutletContext: [{\n type: Input\n }], ngTemplateOutlet: [{\n type: Input\n }], ngTemplateOutletInjector: [{\n type: Input\n }] } });\n\n/**\n * A collection of Angular directives that are likely to be used in each and every Angular\n * application.\n */\nconst COMMON_DIRECTIVES = [\n NgClass,\n NgComponentOutlet,\n NgForOf,\n NgIf,\n NgTemplateOutlet,\n NgStyle,\n NgSwitch,\n NgSwitchCase,\n NgSwitchDefault,\n NgPlural,\n NgPluralCase,\n];\n\nfunction invalidPipeArgumentError(type, value) {\n return new ɵRuntimeError(2100 /* RuntimeErrorCode.INVALID_PIPE_ARGUMENT */, ngDevMode && `InvalidPipeArgument: '${value}' for pipe '${ɵstringify(type)}'`);\n}\n\nclass SubscribableStrategy {\n createSubscription(async, updateLatestValue) {\n return async.subscribe({\n next: updateLatestValue,\n error: (e) => {\n throw e;\n }\n });\n }\n dispose(subscription) {\n subscription.unsubscribe();\n }\n}\nclass PromiseStrategy {\n createSubscription(async, updateLatestValue) {\n return async.then(updateLatestValue, e => {\n throw e;\n });\n }\n dispose(subscription) { }\n}\nconst _promiseStrategy = new PromiseStrategy();\nconst _subscribableStrategy = new SubscribableStrategy();\n/**\n * @ngModule CommonModule\n * @description\n *\n * Unwraps a value from an asynchronous primitive.\n *\n * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has\n * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for\n * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid\n * potential memory leaks. When the reference of the expression changes, the `async` pipe\n * automatically unsubscribes from the old `Observable` or `Promise` and subscribes to the new one.\n *\n * @usageNotes\n *\n * ### Examples\n *\n * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the\n * promise.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'}\n *\n * It's also possible to use `async` with Observables. The example below binds the `time` Observable\n * to the view. The Observable continuously updates the view with the current time.\n *\n * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'}\n *\n * @publicApi\n */\nclass AsyncPipe {\n constructor(ref) {\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n this._strategy = null;\n // Assign `ref` into `this._ref` manually instead of declaring `_ref` in the constructor\n // parameter list, as the type of `this._ref` includes `null` unlike the type of `ref`.\n this._ref = ref;\n }\n ngOnDestroy() {\n if (this._subscription) {\n this._dispose();\n }\n // Clear the `ChangeDetectorRef` and its association with the view data, to mitigate\n // potential memory leaks in Observables that could otherwise cause the view data to\n // be retained.\n // https://github.com/angular/angular/issues/17624\n this._ref = null;\n }\n transform(obj) {\n if (!this._obj) {\n if (obj) {\n this._subscribe(obj);\n }\n return this._latestValue;\n }\n if (obj !== this._obj) {\n this._dispose();\n return this.transform(obj);\n }\n return this._latestValue;\n }\n _subscribe(obj) {\n this._obj = obj;\n this._strategy = this._selectStrategy(obj);\n this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value));\n }\n _selectStrategy(obj) {\n if (ɵisPromise(obj)) {\n return _promiseStrategy;\n }\n if (ɵisSubscribable(obj)) {\n return _subscribableStrategy;\n }\n throw invalidPipeArgumentError(AsyncPipe, obj);\n }\n _dispose() {\n // Note: `dispose` is only called if a subscription has been initialized before, indicating\n // that `this._strategy` is also available.\n this._strategy.dispose(this._subscription);\n this._latestValue = null;\n this._subscription = null;\n this._obj = null;\n }\n _updateLatestValue(async, value) {\n if (async === this._obj) {\n this._latestValue = value;\n // Note: `this._ref` is only cleared in `ngOnDestroy` so is known to be available when a\n // value is being updated.\n this._ref.markForCheck();\n }\n }\n}\nAsyncPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: AsyncPipe, deps: [{ token: i0.ChangeDetectorRef }], target: i0.ɵɵFactoryTarget.Pipe });\nAsyncPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: AsyncPipe, isStandalone: true, name: \"async\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: AsyncPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'async',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.ChangeDetectorRef }]; } });\n\n/**\n * Transforms text to all lower case.\n *\n * @see `UpperCasePipe`\n * @see `TitleCasePipe`\n * @usageNotes\n *\n * The following example defines a view that allows the user to enter\n * text, and then uses the pipe to convert the input text to all lower case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass LowerCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(LowerCasePipe, value);\n }\n return value.toLowerCase();\n }\n}\nLowerCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LowerCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nLowerCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: LowerCasePipe, isStandalone: true, name: \"lowercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LowerCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'lowercase',\n standalone: true,\n }]\n }] });\n//\n// Regex below matches any Unicode word and number compatible with ES5. In ES2018 the same result\n// can be achieved by using /[0-9\\p{L}]\\S*/gu and also known as Unicode Property Escapes\n// (https://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no\n// transpilation of this functionality down to ES5 without external tool, the only solution is\n// to use already transpiled form. Example can be found here -\n// https://mothereff.in/regexpu#input=var+regex+%3D+%2F%5B0-9%5Cp%7BL%7D%5D%5CS*%2Fgu%3B%0A%0A&unicodePropertyEscape=1\n//\nconst unicodeWordMatch = /(?:[0-9A-Za-z\\xAA\\xB5\\xBA\\xC0-\\xD6\\xD8-\\xF6\\xF8-\\u02C1\\u02C6-\\u02D1\\u02E0-\\u02E4\\u02EC\\u02EE\\u0370-\\u0374\\u0376\\u0377\\u037A-\\u037D\\u037F\\u0386\\u0388-\\u038A\\u038C\\u038E-\\u03A1\\u03A3-\\u03F5\\u03F7-\\u0481\\u048A-\\u052F\\u0531-\\u0556\\u0559\\u0560-\\u0588\\u05D0-\\u05EA\\u05EF-\\u05F2\\u0620-\\u064A\\u066E\\u066F\\u0671-\\u06D3\\u06D5\\u06E5\\u06E6\\u06EE\\u06EF\\u06FA-\\u06FC\\u06FF\\u0710\\u0712-\\u072F\\u074D-\\u07A5\\u07B1\\u07CA-\\u07EA\\u07F4\\u07F5\\u07FA\\u0800-\\u0815\\u081A\\u0824\\u0828\\u0840-\\u0858\\u0860-\\u086A\\u0870-\\u0887\\u0889-\\u088E\\u08A0-\\u08C9\\u0904-\\u0939\\u093D\\u0950\\u0958-\\u0961\\u0971-\\u0980\\u0985-\\u098C\\u098F\\u0990\\u0993-\\u09A8\\u09AA-\\u09B0\\u09B2\\u09B6-\\u09B9\\u09BD\\u09CE\\u09DC\\u09DD\\u09DF-\\u09E1\\u09F0\\u09F1\\u09FC\\u0A05-\\u0A0A\\u0A0F\\u0A10\\u0A13-\\u0A28\\u0A2A-\\u0A30\\u0A32\\u0A33\\u0A35\\u0A36\\u0A38\\u0A39\\u0A59-\\u0A5C\\u0A5E\\u0A72-\\u0A74\\u0A85-\\u0A8D\\u0A8F-\\u0A91\\u0A93-\\u0AA8\\u0AAA-\\u0AB0\\u0AB2\\u0AB3\\u0AB5-\\u0AB9\\u0ABD\\u0AD0\\u0AE0\\u0AE1\\u0AF9\\u0B05-\\u0B0C\\u0B0F\\u0B10\\u0B13-\\u0B28\\u0B2A-\\u0B30\\u0B32\\u0B33\\u0B35-\\u0B39\\u0B3D\\u0B5C\\u0B5D\\u0B5F-\\u0B61\\u0B71\\u0B83\\u0B85-\\u0B8A\\u0B8E-\\u0B90\\u0B92-\\u0B95\\u0B99\\u0B9A\\u0B9C\\u0B9E\\u0B9F\\u0BA3\\u0BA4\\u0BA8-\\u0BAA\\u0BAE-\\u0BB9\\u0BD0\\u0C05-\\u0C0C\\u0C0E-\\u0C10\\u0C12-\\u0C28\\u0C2A-\\u0C39\\u0C3D\\u0C58-\\u0C5A\\u0C5D\\u0C60\\u0C61\\u0C80\\u0C85-\\u0C8C\\u0C8E-\\u0C90\\u0C92-\\u0CA8\\u0CAA-\\u0CB3\\u0CB5-\\u0CB9\\u0CBD\\u0CDD\\u0CDE\\u0CE0\\u0CE1\\u0CF1\\u0CF2\\u0D04-\\u0D0C\\u0D0E-\\u0D10\\u0D12-\\u0D3A\\u0D3D\\u0D4E\\u0D54-\\u0D56\\u0D5F-\\u0D61\\u0D7A-\\u0D7F\\u0D85-\\u0D96\\u0D9A-\\u0DB1\\u0DB3-\\u0DBB\\u0DBD\\u0DC0-\\u0DC6\\u0E01-\\u0E30\\u0E32\\u0E33\\u0E40-\\u0E46\\u0E81\\u0E82\\u0E84\\u0E86-\\u0E8A\\u0E8C-\\u0EA3\\u0EA5\\u0EA7-\\u0EB0\\u0EB2\\u0EB3\\u0EBD\\u0EC0-\\u0EC4\\u0EC6\\u0EDC-\\u0EDF\\u0F00\\u0F40-\\u0F47\\u0F49-\\u0F6C\\u0F88-\\u0F8C\\u1000-\\u102A\\u103F\\u1050-\\u1055\\u105A-\\u105D\\u1061\\u1065\\u1066\\u106E-\\u1070\\u1075-\\u1081\\u108E\\u10A0-\\u10C5\\u10C7\\u10CD\\u10D0-\\u10FA\\u10FC-\\u1248\\u124A-\\u124D\\u1250-\\u1256\\u1258\\u125A-\\u125D\\u1260-\\u1288\\u128A-\\u128D\\u1290-\\u12B0\\u12B2-\\u12B5\\u12B8-\\u12BE\\u12C0\\u12C2-\\u12C5\\u12C8-\\u12D6\\u12D8-\\u1310\\u1312-\\u1315\\u1318-\\u135A\\u1380-\\u138F\\u13A0-\\u13F5\\u13F8-\\u13FD\\u1401-\\u166C\\u166F-\\u167F\\u1681-\\u169A\\u16A0-\\u16EA\\u16F1-\\u16F8\\u1700-\\u1711\\u171F-\\u1731\\u1740-\\u1751\\u1760-\\u176C\\u176E-\\u1770\\u1780-\\u17B3\\u17D7\\u17DC\\u1820-\\u1878\\u1880-\\u1884\\u1887-\\u18A8\\u18AA\\u18B0-\\u18F5\\u1900-\\u191E\\u1950-\\u196D\\u1970-\\u1974\\u1980-\\u19AB\\u19B0-\\u19C9\\u1A00-\\u1A16\\u1A20-\\u1A54\\u1AA7\\u1B05-\\u1B33\\u1B45-\\u1B4C\\u1B83-\\u1BA0\\u1BAE\\u1BAF\\u1BBA-\\u1BE5\\u1C00-\\u1C23\\u1C4D-\\u1C4F\\u1C5A-\\u1C7D\\u1C80-\\u1C88\\u1C90-\\u1CBA\\u1CBD-\\u1CBF\\u1CE9-\\u1CEC\\u1CEE-\\u1CF3\\u1CF5\\u1CF6\\u1CFA\\u1D00-\\u1DBF\\u1E00-\\u1F15\\u1F18-\\u1F1D\\u1F20-\\u1F45\\u1F48-\\u1F4D\\u1F50-\\u1F57\\u1F59\\u1F5B\\u1F5D\\u1F5F-\\u1F7D\\u1F80-\\u1FB4\\u1FB6-\\u1FBC\\u1FBE\\u1FC2-\\u1FC4\\u1FC6-\\u1FCC\\u1FD0-\\u1FD3\\u1FD6-\\u1FDB\\u1FE0-\\u1FEC\\u1FF2-\\u1FF4\\u1FF6-\\u1FFC\\u2071\\u207F\\u2090-\\u209C\\u2102\\u2107\\u210A-\\u2113\\u2115\\u2119-\\u211D\\u2124\\u2126\\u2128\\u212A-\\u212D\\u212F-\\u2139\\u213C-\\u213F\\u2145-\\u2149\\u214E\\u2183\\u2184\\u2C00-\\u2CE4\\u2CEB-\\u2CEE\\u2CF2\\u2CF3\\u2D00-\\u2D25\\u2D27\\u2D2D\\u2D30-\\u2D67\\u2D6F\\u2D80-\\u2D96\\u2DA0-\\u2DA6\\u2DA8-\\u2DAE\\u2DB0-\\u2DB6\\u2DB8-\\u2DBE\\u2DC0-\\u2DC6\\u2DC8-\\u2DCE\\u2DD0-\\u2DD6\\u2DD8-\\u2DDE\\u2E2F\\u3005\\u3006\\u3031-\\u3035\\u303B\\u303C\\u3041-\\u3096\\u309D-\\u309F\\u30A1-\\u30FA\\u30FC-\\u30FF\\u3105-\\u312F\\u3131-\\u318E\\u31A0-\\u31BF\\u31F0-\\u31FF\\u3400-\\u4DBF\\u4E00-\\uA48C\\uA4D0-\\uA4FD\\uA500-\\uA60C\\uA610-\\uA61F\\uA62A\\uA62B\\uA640-\\uA66E\\uA67F-\\uA69D\\uA6A0-\\uA6E5\\uA717-\\uA71F\\uA722-\\uA788\\uA78B-\\uA7CA\\uA7D0\\uA7D1\\uA7D3\\uA7D5-\\uA7D9\\uA7F2-\\uA801\\uA803-\\uA805\\uA807-\\uA80A\\uA80C-\\uA822\\uA840-\\uA873\\uA882-\\uA8B3\\uA8F2-\\uA8F7\\uA8FB\\uA8FD\\uA8FE\\uA90A-\\uA925\\uA930-\\uA946\\uA960-\\uA97C\\uA984-\\uA9B2\\uA9CF\\uA9E0-\\uA9E4\\uA9E6-\\uA9EF\\uA9FA-\\uA9FE\\uAA00-\\uAA28\\uAA40-\\uAA42\\uAA44-\\uAA4B\\uAA60-\\uAA76\\uAA7A\\uAA7E-\\uAAAF\\uAAB1\\uAAB5\\uAAB6\\uAAB9-\\uAABD\\uAAC0\\uAAC2\\uAADB-\\uAADD\\uAAE0-\\uAAEA\\uAAF2-\\uAAF4\\uAB01-\\uAB06\\uAB09-\\uAB0E\\uAB11-\\uAB16\\uAB20-\\uAB26\\uAB28-\\uAB2E\\uAB30-\\uAB5A\\uAB5C-\\uAB69\\uAB70-\\uABE2\\uAC00-\\uD7A3\\uD7B0-\\uD7C6\\uD7CB-\\uD7FB\\uF900-\\uFA6D\\uFA70-\\uFAD9\\uFB00-\\uFB06\\uFB13-\\uFB17\\uFB1D\\uFB1F-\\uFB28\\uFB2A-\\uFB36\\uFB38-\\uFB3C\\uFB3E\\uFB40\\uFB41\\uFB43\\uFB44\\uFB46-\\uFBB1\\uFBD3-\\uFD3D\\uFD50-\\uFD8F\\uFD92-\\uFDC7\\uFDF0-\\uFDFB\\uFE70-\\uFE74\\uFE76-\\uFEFC\\uFF21-\\uFF3A\\uFF41-\\uFF5A\\uFF66-\\uFFBE\\uFFC2-\\uFFC7\\uFFCA-\\uFFCF\\uFFD2-\\uFFD7\\uFFDA-\\uFFDC]|\\uD800[\\uDC00-\\uDC0B\\uDC0D-\\uDC26\\uDC28-\\uDC3A\\uDC3C\\uDC3D\\uDC3F-\\uDC4D\\uDC50-\\uDC5D\\uDC80-\\uDCFA\\uDE80-\\uDE9C\\uDEA0-\\uDED0\\uDF00-\\uDF1F\\uDF2D-\\uDF40\\uDF42-\\uDF49\\uDF50-\\uDF75\\uDF80-\\uDF9D\\uDFA0-\\uDFC3\\uDFC8-\\uDFCF]|\\uD801[\\uDC00-\\uDC9D\\uDCB0-\\uDCD3\\uDCD8-\\uDCFB\\uDD00-\\uDD27\\uDD30-\\uDD63\\uDD70-\\uDD7A\\uDD7C-\\uDD8A\\uDD8C-\\uDD92\\uDD94\\uDD95\\uDD97-\\uDDA1\\uDDA3-\\uDDB1\\uDDB3-\\uDDB9\\uDDBB\\uDDBC\\uDE00-\\uDF36\\uDF40-\\uDF55\\uDF60-\\uDF67\\uDF80-\\uDF85\\uDF87-\\uDFB0\\uDFB2-\\uDFBA]|\\uD802[\\uDC00-\\uDC05\\uDC08\\uDC0A-\\uDC35\\uDC37\\uDC38\\uDC3C\\uDC3F-\\uDC55\\uDC60-\\uDC76\\uDC80-\\uDC9E\\uDCE0-\\uDCF2\\uDCF4\\uDCF5\\uDD00-\\uDD15\\uDD20-\\uDD39\\uDD80-\\uDDB7\\uDDBE\\uDDBF\\uDE00\\uDE10-\\uDE13\\uDE15-\\uDE17\\uDE19-\\uDE35\\uDE60-\\uDE7C\\uDE80-\\uDE9C\\uDEC0-\\uDEC7\\uDEC9-\\uDEE4\\uDF00-\\uDF35\\uDF40-\\uDF55\\uDF60-\\uDF72\\uDF80-\\uDF91]|\\uD803[\\uDC00-\\uDC48\\uDC80-\\uDCB2\\uDCC0-\\uDCF2\\uDD00-\\uDD23\\uDE80-\\uDEA9\\uDEB0\\uDEB1\\uDF00-\\uDF1C\\uDF27\\uDF30-\\uDF45\\uDF70-\\uDF81\\uDFB0-\\uDFC4\\uDFE0-\\uDFF6]|\\uD804[\\uDC03-\\uDC37\\uDC71\\uDC72\\uDC75\\uDC83-\\uDCAF\\uDCD0-\\uDCE8\\uDD03-\\uDD26\\uDD44\\uDD47\\uDD50-\\uDD72\\uDD76\\uDD83-\\uDDB2\\uDDC1-\\uDDC4\\uDDDA\\uDDDC\\uDE00-\\uDE11\\uDE13-\\uDE2B\\uDE80-\\uDE86\\uDE88\\uDE8A-\\uDE8D\\uDE8F-\\uDE9D\\uDE9F-\\uDEA8\\uDEB0-\\uDEDE\\uDF05-\\uDF0C\\uDF0F\\uDF10\\uDF13-\\uDF28\\uDF2A-\\uDF30\\uDF32\\uDF33\\uDF35-\\uDF39\\uDF3D\\uDF50\\uDF5D-\\uDF61]|\\uD805[\\uDC00-\\uDC34\\uDC47-\\uDC4A\\uDC5F-\\uDC61\\uDC80-\\uDCAF\\uDCC4\\uDCC5\\uDCC7\\uDD80-\\uDDAE\\uDDD8-\\uDDDB\\uDE00-\\uDE2F\\uDE44\\uDE80-\\uDEAA\\uDEB8\\uDF00-\\uDF1A\\uDF40-\\uDF46]|\\uD806[\\uDC00-\\uDC2B\\uDCA0-\\uDCDF\\uDCFF-\\uDD06\\uDD09\\uDD0C-\\uDD13\\uDD15\\uDD16\\uDD18-\\uDD2F\\uDD3F\\uDD41\\uDDA0-\\uDDA7\\uDDAA-\\uDDD0\\uDDE1\\uDDE3\\uDE00\\uDE0B-\\uDE32\\uDE3A\\uDE50\\uDE5C-\\uDE89\\uDE9D\\uDEB0-\\uDEF8]|\\uD807[\\uDC00-\\uDC08\\uDC0A-\\uDC2E\\uDC40\\uDC72-\\uDC8F\\uDD00-\\uDD06\\uDD08\\uDD09\\uDD0B-\\uDD30\\uDD46\\uDD60-\\uDD65\\uDD67\\uDD68\\uDD6A-\\uDD89\\uDD98\\uDEE0-\\uDEF2\\uDFB0]|\\uD808[\\uDC00-\\uDF99]|\\uD809[\\uDC80-\\uDD43]|\\uD80B[\\uDF90-\\uDFF0]|[\\uD80C\\uD81C-\\uD820\\uD822\\uD840-\\uD868\\uD86A-\\uD86C\\uD86F-\\uD872\\uD874-\\uD879\\uD880-\\uD883][\\uDC00-\\uDFFF]|\\uD80D[\\uDC00-\\uDC2E]|\\uD811[\\uDC00-\\uDE46]|\\uD81A[\\uDC00-\\uDE38\\uDE40-\\uDE5E\\uDE70-\\uDEBE\\uDED0-\\uDEED\\uDF00-\\uDF2F\\uDF40-\\uDF43\\uDF63-\\uDF77\\uDF7D-\\uDF8F]|\\uD81B[\\uDE40-\\uDE7F\\uDF00-\\uDF4A\\uDF50\\uDF93-\\uDF9F\\uDFE0\\uDFE1\\uDFE3]|\\uD821[\\uDC00-\\uDFF7]|\\uD823[\\uDC00-\\uDCD5\\uDD00-\\uDD08]|\\uD82B[\\uDFF0-\\uDFF3\\uDFF5-\\uDFFB\\uDFFD\\uDFFE]|\\uD82C[\\uDC00-\\uDD22\\uDD50-\\uDD52\\uDD64-\\uDD67\\uDD70-\\uDEFB]|\\uD82F[\\uDC00-\\uDC6A\\uDC70-\\uDC7C\\uDC80-\\uDC88\\uDC90-\\uDC99]|\\uD835[\\uDC00-\\uDC54\\uDC56-\\uDC9C\\uDC9E\\uDC9F\\uDCA2\\uDCA5\\uDCA6\\uDCA9-\\uDCAC\\uDCAE-\\uDCB9\\uDCBB\\uDCBD-\\uDCC3\\uDCC5-\\uDD05\\uDD07-\\uDD0A\\uDD0D-\\uDD14\\uDD16-\\uDD1C\\uDD1E-\\uDD39\\uDD3B-\\uDD3E\\uDD40-\\uDD44\\uDD46\\uDD4A-\\uDD50\\uDD52-\\uDEA5\\uDEA8-\\uDEC0\\uDEC2-\\uDEDA\\uDEDC-\\uDEFA\\uDEFC-\\uDF14\\uDF16-\\uDF34\\uDF36-\\uDF4E\\uDF50-\\uDF6E\\uDF70-\\uDF88\\uDF8A-\\uDFA8\\uDFAA-\\uDFC2\\uDFC4-\\uDFCB]|\\uD837[\\uDF00-\\uDF1E]|\\uD838[\\uDD00-\\uDD2C\\uDD37-\\uDD3D\\uDD4E\\uDE90-\\uDEAD\\uDEC0-\\uDEEB]|\\uD839[\\uDFE0-\\uDFE6\\uDFE8-\\uDFEB\\uDFED\\uDFEE\\uDFF0-\\uDFFE]|\\uD83A[\\uDC00-\\uDCC4\\uDD00-\\uDD43\\uDD4B]|\\uD83B[\\uDE00-\\uDE03\\uDE05-\\uDE1F\\uDE21\\uDE22\\uDE24\\uDE27\\uDE29-\\uDE32\\uDE34-\\uDE37\\uDE39\\uDE3B\\uDE42\\uDE47\\uDE49\\uDE4B\\uDE4D-\\uDE4F\\uDE51\\uDE52\\uDE54\\uDE57\\uDE59\\uDE5B\\uDE5D\\uDE5F\\uDE61\\uDE62\\uDE64\\uDE67-\\uDE6A\\uDE6C-\\uDE72\\uDE74-\\uDE77\\uDE79-\\uDE7C\\uDE7E\\uDE80-\\uDE89\\uDE8B-\\uDE9B\\uDEA1-\\uDEA3\\uDEA5-\\uDEA9\\uDEAB-\\uDEBB]|\\uD869[\\uDC00-\\uDEDF\\uDF00-\\uDFFF]|\\uD86D[\\uDC00-\\uDF38\\uDF40-\\uDFFF]|\\uD86E[\\uDC00-\\uDC1D\\uDC20-\\uDFFF]|\\uD873[\\uDC00-\\uDEA1\\uDEB0-\\uDFFF]|\\uD87A[\\uDC00-\\uDFE0]|\\uD87E[\\uDC00-\\uDE1D]|\\uD884[\\uDC00-\\uDF4A])\\S*/g;\n/**\n * Transforms text to title case.\n * Capitalizes the first letter of each word and transforms the\n * rest of the word to lower case.\n * Words are delimited by any whitespace character, such as a space, tab, or line-feed character.\n *\n * @see `LowerCasePipe`\n * @see `UpperCasePipe`\n *\n * @usageNotes\n * The following example shows the result of transforming various strings into title case.\n *\n * \n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass TitleCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(TitleCasePipe, value);\n }\n return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.slice(1).toLowerCase()));\n }\n}\nTitleCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: TitleCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nTitleCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: TitleCasePipe, isStandalone: true, name: \"titlecase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: TitleCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'titlecase',\n standalone: true,\n }]\n }] });\n/**\n * Transforms text to all upper case.\n * @see `LowerCasePipe`\n * @see `TitleCasePipe`\n *\n * @ngModule CommonModule\n * @publicApi\n */\nclass UpperCasePipe {\n transform(value) {\n if (value == null)\n return null;\n if (typeof value !== 'string') {\n throw invalidPipeArgumentError(UpperCasePipe, value);\n }\n return value.toUpperCase();\n }\n}\nUpperCasePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: UpperCasePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nUpperCasePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: UpperCasePipe, isStandalone: true, name: \"uppercase\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: UpperCasePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'uppercase',\n standalone: true,\n }]\n }] });\n\n/**\n * The default date format of Angular date pipe, which corresponds to the following format:\n * `'MMM d,y'` (e.g. `Jun 15, 2015`)\n */\nconst DEFAULT_DATE_FORMAT = 'mediumDate';\n\n/**\n * Optionally-provided default timezone to use for all instances of `DatePipe` (such as `'+0430'`).\n * If the value isn't provided, the `DatePipe` will use the end-user's local system timezone.\n *\n * @deprecated use DATE_PIPE_DEFAULT_OPTIONS token to configure DatePipe\n */\nconst DATE_PIPE_DEFAULT_TIMEZONE = new InjectionToken('DATE_PIPE_DEFAULT_TIMEZONE');\n/**\n * DI token that allows to provide default configuration for the `DatePipe` instances in an\n * application. The value is an object which can include the following fields:\n * - `dateFormat`: configures the default date format. If not provided, the `DatePipe`\n * will use the 'mediumDate' as a value.\n * - `timezone`: configures the default timezone. If not provided, the `DatePipe` will\n * use the end-user's local system timezone.\n *\n * @see `DatePipeConfig`\n *\n * @usageNotes\n *\n * Various date pipe default values can be overwritten by providing this token with\n * the value that has this interface.\n *\n * For example:\n *\n * Override the default date format by providing a value using the token:\n * ```typescript\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {dateFormat: 'shortDate'}}\n * ]\n * ```\n *\n * Override the default timezone by providing a value using the token:\n * ```typescript\n * providers: [\n * {provide: DATE_PIPE_DEFAULT_OPTIONS, useValue: {timezone: '-1200'}}\n * ]\n * ```\n */\nconst DATE_PIPE_DEFAULT_OPTIONS = new InjectionToken('DATE_PIPE_DEFAULT_OPTIONS');\n// clang-format off\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a date value according to locale rules.\n *\n * `DatePipe` is executed only when it detects a pure change to the input value.\n * A pure change is either a change to a primitive input value\n * (such as `String`, `Number`, `Boolean`, or `Symbol`),\n * or a changed object reference (such as `Date`, `Array`, `Function`, or `Object`).\n *\n * Note that mutating a `Date` object does not cause the pipe to be rendered again.\n * To ensure that the pipe is executed, you must create a new `Date` object.\n *\n * Only the `en-US` locale data comes with Angular. To localize dates\n * in another language, you must import the corresponding locale data.\n * See the [I18n guide](guide/i18n-common-format-data-locale) for more information.\n *\n * The time zone of the formatted value can be specified either by passing it in as the second\n * parameter of the pipe, or by setting the default through the `DATE_PIPE_DEFAULT_OPTIONS`\n * injection token. The value that is passed in as the second parameter takes precedence over\n * the one defined using the injection token.\n *\n * @see `formatDate()`\n *\n *\n * @usageNotes\n *\n * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to\n * reformat the date on every change-detection cycle, treat the date as an immutable object\n * and change the reference when the pipe needs to run again.\n *\n * ### Pre-defined format options\n *\n * | Option | Equivalent to | Examples (given in `en-US` locale) |\n * |---------------|-------------------------------------|-------------------------------------------------|\n * | `'short'` | `'M/d/yy, h:mm a'` | `6/15/15, 9:03 AM` |\n * | `'medium'` | `'MMM d, y, h:mm:ss a'` | `Jun 15, 2015, 9:03:01 AM` |\n * | `'long'` | `'MMMM d, y, h:mm:ss a z'` | `June 15, 2015 at 9:03:01 AM GMT+1` |\n * | `'full'` | `'EEEE, MMMM d, y, h:mm:ss a zzzz'` | `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00` |\n * | `'shortDate'` | `'M/d/yy'` | `6/15/15` |\n * | `'mediumDate'`| `'MMM d, y'` | `Jun 15, 2015` |\n * | `'longDate'` | `'MMMM d, y'` | `June 15, 2015` |\n * | `'fullDate'` | `'EEEE, MMMM d, y'` | `Monday, June 15, 2015` |\n * | `'shortTime'` | `'h:mm a'` | `9:03 AM` |\n * | `'mediumTime'`| `'h:mm:ss a'` | `9:03:01 AM` |\n * | `'longTime'` | `'h:mm:ss a z'` | `9:03:01 AM GMT+1` |\n * | `'fullTime'` | `'h:mm:ss a zzzz'` | `9:03:01 AM GMT+01:00` |\n *\n * ### Custom format options\n *\n * You can construct a format string using symbols to specify the components\n * of a date-time value, as described in the following table.\n * Format details depend on the locale.\n * Fields marked with (*) are only available in the extra data set for the given locale.\n *\n * | Field type | Format | Description | Example Value |\n * |-------------------- |-------------|---------------------------------------------------------------|------------------------------------------------------------|\n * | Era | G, GG & GGG | Abbreviated | AD |\n * | | GGGG | Wide | Anno Domini |\n * | | GGGGG | Narrow | A |\n * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Week-numbering year | Y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 |\n * | | YY | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 |\n * | | YYY | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 |\n * | | YYYY | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 |\n * | Month | M | Numeric: 1 digit | 9, 12 |\n * | | MM | Numeric: 2 digits + zero padded | 09, 12 |\n * | | MMM | Abbreviated | Sep |\n * | | MMMM | Wide | September |\n * | | MMMMM | Narrow | S |\n * | Month standalone | L | Numeric: 1 digit | 9, 12 |\n * | | LL | Numeric: 2 digits + zero padded | 09, 12 |\n * | | LLL | Abbreviated | Sep |\n * | | LLLL | Wide | September |\n * | | LLLLL | Narrow | S |\n * | Week of year | w | Numeric: minimum digits | 1... 53 |\n * | | ww | Numeric: 2 digits + zero padded | 01... 53 |\n * | Week of month | W | Numeric: 1 digit | 1... 5 |\n * | Day of month | d | Numeric: minimum digits | 1 |\n * | | dd | Numeric: 2 digits + zero padded | 01 |\n * | Week day | E, EE & EEE | Abbreviated | Tue |\n * | | EEEE | Wide | Tuesday |\n * | | EEEEE | Narrow | T |\n * | | EEEEEE | Short | Tu |\n * | Week day standalone | c, cc | Numeric: 1 digit | 2 |\n * | | ccc | Abbreviated | Tue |\n * | | cccc | Wide | Tuesday |\n * | | ccccc | Narrow | T |\n * | | cccccc | Short | Tu |\n * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM |\n * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem |\n * | | aaaaa | Narrow | a/p |\n * | Period* | B, BB & BBB | Abbreviated | mid. |\n * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | BBBBB | Narrow | md |\n * | Period standalone* | b, bb & bbb | Abbreviated | mid. |\n * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night |\n * | | bbbbb | Narrow | md |\n * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 |\n * | | hh | Numeric: 2 digits + zero padded | 01, 12 |\n * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 |\n * | | HH | Numeric: 2 digits + zero padded | 00, 23 |\n * | Minute | m | Numeric: minimum digits | 8, 59 |\n * | | mm | Numeric: 2 digits + zero padded | 08, 59 |\n * | Second | s | Numeric: minimum digits | 0... 59 |\n * | | ss | Numeric: 2 digits + zero padded | 00... 59 |\n * | Fractional seconds | S | Numeric: 1 digit | 0... 9 |\n * | | SS | Numeric: 2 digits + zero padded | 00... 99 |\n * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 |\n * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 |\n * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 |\n * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 |\n * | | ZZZZ | Long localized GMT format | GMT-8:00 |\n * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 |\n * | | O, OO & OOO | Short localized GMT format | GMT-8 |\n * | | OOOO | Long localized GMT format | GMT-08:00 |\n *\n *\n * ### Format examples\n *\n * These examples transform a date into various formats,\n * assuming that `dateObj` is a JavaScript `Date` object for\n * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11,\n * given in the local time for the `en-US` locale.\n *\n * ```\n * {{ dateObj | date }} // output is 'Jun 15, 2015'\n * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM'\n * {{ dateObj | date:'shortTime' }} // output is '9:43 PM'\n * {{ dateObj | date:'mm:ss' }} // output is '43:11'\n * ```\n *\n * ### Usage example\n *\n * The following component uses a date pipe to display the current date in different formats.\n *\n * ```\n * @Component({\n * selector: 'date-pipe',\n * template: `
    \n *

    Today is {{today | date}}

    \n *

    Or if you prefer, {{today | date:'fullDate'}}

    \n *

    The time is {{today | date:'h:mm a z'}}

    \n *
    `\n * })\n * // Get the current date and time as a date-time value.\n * export class DatePipeComponent {\n * today: number = Date.now();\n * }\n * ```\n *\n * @publicApi\n */\n// clang-format on\nclass DatePipe {\n constructor(locale, defaultTimezone, defaultOptions) {\n this.locale = locale;\n this.defaultTimezone = defaultTimezone;\n this.defaultOptions = defaultOptions;\n }\n transform(value, format, timezone, locale) {\n if (value == null || value === '' || value !== value)\n return null;\n try {\n const _format = format ?? this.defaultOptions?.dateFormat ?? DEFAULT_DATE_FORMAT;\n const _timezone = timezone ?? this.defaultOptions?.timezone ?? this.defaultTimezone ?? undefined;\n return formatDate(value, _format, locale || this.locale, _timezone);\n }\n catch (error) {\n throw invalidPipeArgumentError(DatePipe, error.message);\n }\n }\n}\nDatePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: DatePipe, deps: [{ token: LOCALE_ID }, { token: DATE_PIPE_DEFAULT_TIMEZONE, optional: true }, { token: DATE_PIPE_DEFAULT_OPTIONS, optional: true }], target: i0.ɵɵFactoryTarget.Pipe });\nDatePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: DatePipe, isStandalone: true, name: \"date\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: DatePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'date',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_TIMEZONE]\n }, {\n type: Optional\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DATE_PIPE_DEFAULT_OPTIONS]\n }, {\n type: Optional\n }] }]; } });\n\nconst _INTERPOLATION_REGEXP = /#/g;\n/**\n * @ngModule CommonModule\n * @description\n *\n * Maps a value to a string that pluralizes the value according to locale rules.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'}\n *\n * @publicApi\n */\nclass I18nPluralPipe {\n constructor(_localization) {\n this._localization = _localization;\n }\n /**\n * @param value the number to be formatted\n * @param pluralMap an object that mimics the ICU format, see\n * https://unicode-org.github.io/icu/userguide/format_parse/messages/.\n * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by\n * default).\n */\n transform(value, pluralMap, locale) {\n if (value == null)\n return '';\n if (typeof pluralMap !== 'object' || pluralMap === null) {\n throw invalidPipeArgumentError(I18nPluralPipe, pluralMap);\n }\n const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale);\n return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString());\n }\n}\nI18nPluralPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nPluralPipe, deps: [{ token: NgLocalization }], target: i0.ɵɵFactoryTarget.Pipe });\nI18nPluralPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nPluralPipe, isStandalone: true, name: \"i18nPlural\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nPluralPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nPlural',\n pure: true,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: NgLocalization }]; } });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Generic selector that displays the string that matches the current value.\n *\n * If none of the keys of the `mapping` match the `value`, then the content\n * of the `other` key is returned when present, otherwise an empty string is returned.\n *\n * @usageNotes\n *\n * ### Example\n *\n * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'}\n *\n * @publicApi\n */\nclass I18nSelectPipe {\n /**\n * @param value a string to be internationalized.\n * @param mapping an object that indicates the text that should be displayed\n * for different values of the provided `value`.\n */\n transform(value, mapping) {\n if (value == null)\n return '';\n if (typeof mapping !== 'object' || typeof value !== 'string') {\n throw invalidPipeArgumentError(I18nSelectPipe, mapping);\n }\n if (mapping.hasOwnProperty(value)) {\n return mapping[value];\n }\n if (mapping.hasOwnProperty('other')) {\n return mapping['other'];\n }\n return '';\n }\n}\nI18nSelectPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nSelectPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nI18nSelectPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nSelectPipe, isStandalone: true, name: \"i18nSelect\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: I18nSelectPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'i18nSelect',\n pure: true,\n standalone: true,\n }]\n }] });\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Converts a value into its JSON-format representation. Useful for debugging.\n *\n * @usageNotes\n *\n * The following component uses a JSON pipe to convert an object\n * to JSON format, and displays the string in both formats for comparison.\n *\n * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'}\n *\n * @publicApi\n */\nclass JsonPipe {\n /**\n * @param value A value of any type to convert into a JSON-format string.\n */\n transform(value) {\n return JSON.stringify(value, null, 2);\n }\n}\nJsonPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: JsonPipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nJsonPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: JsonPipe, isStandalone: true, name: \"json\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: JsonPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'json',\n pure: false,\n standalone: true,\n }]\n }] });\n\nfunction makeKeyValuePair(key, value) {\n return { key: key, value: value };\n}\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms Object or Map into an array of key value pairs.\n *\n * The output array will be ordered by keys.\n * By default the comparator will be by Unicode point value.\n * You can optionally pass a compareFn if your keys are complex types.\n *\n * @usageNotes\n * ### Examples\n *\n * This examples show how an Object or a Map can be iterated by ngFor with the use of this\n * keyvalue pipe.\n *\n * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'}\n *\n * @publicApi\n */\nclass KeyValuePipe {\n constructor(differs) {\n this.differs = differs;\n this.keyValues = [];\n this.compareFn = defaultComparator;\n }\n transform(input, compareFn = defaultComparator) {\n if (!input || (!(input instanceof Map) && typeof input !== 'object')) {\n return null;\n }\n if (!this.differ) {\n // make a differ for whatever type we've been passed in\n this.differ = this.differs.find(input).create();\n }\n const differChanges = this.differ.diff(input);\n const compareFnChanged = compareFn !== this.compareFn;\n if (differChanges) {\n this.keyValues = [];\n differChanges.forEachItem((r) => {\n this.keyValues.push(makeKeyValuePair(r.key, r.currentValue));\n });\n }\n if (differChanges || compareFnChanged) {\n this.keyValues.sort(compareFn);\n this.compareFn = compareFn;\n }\n return this.keyValues;\n }\n}\nKeyValuePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: KeyValuePipe, deps: [{ token: i0.KeyValueDiffers }], target: i0.ɵɵFactoryTarget.Pipe });\nKeyValuePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: KeyValuePipe, isStandalone: true, name: \"keyvalue\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: KeyValuePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'keyvalue',\n pure: false,\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: i0.KeyValueDiffers }]; } });\nfunction defaultComparator(keyValueA, keyValueB) {\n const a = keyValueA.key;\n const b = keyValueB.key;\n // if same exit with 0;\n if (a === b)\n return 0;\n // make sure that undefined are at the end of the sort.\n if (a === undefined)\n return 1;\n if (b === undefined)\n return -1;\n // make sure that nulls are at the end of the sort.\n if (a === null)\n return 1;\n if (b === null)\n return -1;\n if (typeof a == 'string' && typeof b == 'string') {\n return a < b ? -1 : 1;\n }\n if (typeof a == 'number' && typeof b == 'number') {\n return a - b;\n }\n if (typeof a == 'boolean' && typeof b == 'boolean') {\n return a < b ? -1 : 1;\n }\n // `a` and `b` are of different types. Compare their string values.\n const aString = String(a);\n const bString = String(b);\n return aString == bString ? 0 : aString < bString ? -1 : 1;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Formats a value according to digit options and locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * @see `formatNumber()`\n *\n * @usageNotes\n *\n * ### digitsInfo\n *\n * The value's decimal representation is specified by the `digitsInfo`\n * parameter, written in the following format:
    \n *\n * ```\n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}\n * ```\n *\n * - `minIntegerDigits`:\n * The minimum number of integer digits before the decimal point.\n * Default is 1.\n *\n * - `minFractionDigits`:\n * The minimum number of digits after the decimal point.\n * Default is 0.\n *\n * - `maxFractionDigits`:\n * The maximum number of digits after the decimal point.\n * Default is 3.\n *\n * If the formatted value is truncated it will be rounded using the \"to-nearest\" method:\n *\n * ```\n * {{3.6 | number: '1.0-0'}}\n * \n *\n * {{-3.6 | number:'1.0-0'}}\n * \n * ```\n *\n * ### locale\n *\n * `locale` will format a value according to locale rules.\n * Locale determines group sizing and separator,\n * decimal point character, and other locale-specific configurations.\n *\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n *\n * See [Setting your app locale](guide/i18n-common-locale-id).\n *\n * ### Example\n *\n * The following code shows how the pipe transforms values\n * according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass DecimalPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n * @param value The value to be formatted.\n * @param digitsInfo Sets digit and decimal representation.\n * [See more](#digitsinfo).\n * @param locale Specifies what locale format rules to use.\n * [See more](#locale).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatNumber(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(DecimalPipe, error.message);\n }\n }\n}\nDecimalPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: DecimalPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nDecimalPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: DecimalPipe, isStandalone: true, name: \"number\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: DecimalPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'number',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a percentage\n * string, formatted according to locale rules that determine group sizing and\n * separator, decimal-point character, and other locale-specific\n * configurations.\n *\n * @see `formatPercent()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass PercentPipe {\n constructor(_locale) {\n this._locale = _locale;\n }\n /**\n *\n * @param value The number to be formatted as a percentage.\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
    \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `0`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `0`.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n try {\n const num = strToNumber(value);\n return formatPercent(num, locale, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(PercentPipe, error.message);\n }\n }\n}\nPercentPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PercentPipe, deps: [{ token: LOCALE_ID }], target: i0.ɵɵFactoryTarget.Pipe });\nPercentPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: PercentPipe, isStandalone: true, name: \"percent\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PercentPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'percent',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }]; } });\n/**\n * @ngModule CommonModule\n * @description\n *\n * Transforms a number to a currency string, formatted according to locale rules\n * that determine group sizing and separator, decimal-point character,\n * and other locale-specific configurations.\n *\n *\n * @see `getCurrencySymbol()`\n * @see `formatCurrency()`\n *\n * @usageNotes\n * The following code shows how the pipe transforms numbers\n * into text strings, according to various format specifications,\n * where the caller's default locale is `en-US`.\n *\n * \n *\n * @publicApi\n */\nclass CurrencyPipe {\n constructor(_locale, _defaultCurrencyCode = 'USD') {\n this._locale = _locale;\n this._defaultCurrencyCode = _defaultCurrencyCode;\n }\n /**\n *\n * @param value The number to be formatted as currency.\n * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code,\n * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be\n * configured using the `DEFAULT_CURRENCY_CODE` injection token.\n * @param display The format for the currency indicator. One of the following:\n * - `code`: Show the code (such as `USD`).\n * - `symbol`(default): Show the symbol (such as `$`).\n * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their\n * currency.\n * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the\n * locale has no narrow symbol, uses the standard symbol for the locale.\n * - String: Use the given string value instead of a code or a symbol.\n * For example, an empty string will suppress the currency & symbol.\n * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`.\n *\n * @param digitsInfo Decimal representation options, specified by a string\n * in the following format:
    \n * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}.\n * - `minIntegerDigits`: The minimum number of integer digits before the decimal point.\n * Default is `1`.\n * - `minFractionDigits`: The minimum number of digits after the decimal point.\n * Default is `2`.\n * - `maxFractionDigits`: The maximum number of digits after the decimal point.\n * Default is `2`.\n * If not provided, the number will be formatted with the proper amount of digits,\n * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies.\n * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none.\n * @param locale A locale code for the locale format rules to use.\n * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default.\n * See [Setting your app locale](guide/i18n-common-locale-id).\n */\n transform(value, currencyCode = this._defaultCurrencyCode, display = 'symbol', digitsInfo, locale) {\n if (!isValue(value))\n return null;\n locale = locale || this._locale;\n if (typeof display === 'boolean') {\n if ((typeof ngDevMode === 'undefined' || ngDevMode) && console && console.warn) {\n console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are \"code\", \"symbol\" or \"symbol-narrow\".`);\n }\n display = display ? 'symbol' : 'code';\n }\n let currency = currencyCode || this._defaultCurrencyCode;\n if (display !== 'code') {\n if (display === 'symbol' || display === 'symbol-narrow') {\n currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale);\n }\n else {\n currency = display;\n }\n }\n try {\n const num = strToNumber(value);\n return formatCurrency(num, locale, currency, currencyCode, digitsInfo);\n }\n catch (error) {\n throw invalidPipeArgumentError(CurrencyPipe, error.message);\n }\n }\n}\nCurrencyPipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CurrencyPipe, deps: [{ token: LOCALE_ID }, { token: DEFAULT_CURRENCY_CODE }], target: i0.ɵɵFactoryTarget.Pipe });\nCurrencyPipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: CurrencyPipe, isStandalone: true, name: \"currency\" });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CurrencyPipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'currency',\n standalone: true,\n }]\n }], ctorParameters: function () { return [{ type: undefined, decorators: [{\n type: Inject,\n args: [LOCALE_ID]\n }] }, { type: undefined, decorators: [{\n type: Inject,\n args: [DEFAULT_CURRENCY_CODE]\n }] }]; } });\nfunction isValue(value) {\n return !(value == null || value === '' || value !== value);\n}\n/**\n * Transforms a string into a number (if needed).\n */\nfunction strToNumber(value) {\n // Convert strings to numbers\n if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) {\n return Number(value);\n }\n if (typeof value !== 'number') {\n throw new Error(`${value} is not a number`);\n }\n return value;\n}\n\n/**\n * @ngModule CommonModule\n * @description\n *\n * Creates a new `Array` or `String` containing a subset (slice) of the elements.\n *\n * @usageNotes\n *\n * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()`\n * and `String.prototype.slice()`.\n *\n * When operating on an `Array`, the returned `Array` is always a copy even when all\n * the elements are being returned.\n *\n * When operating on a blank value, the pipe returns the blank value.\n *\n * ### List Example\n *\n * This `ngFor` example:\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'}\n *\n * produces the following:\n *\n * ```html\n *
  • b
  • \n *
  • c
  • \n * ```\n *\n * ### String Examples\n *\n * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'}\n *\n * @publicApi\n */\nclass SlicePipe {\n transform(value, start, end) {\n if (value == null)\n return null;\n if (!this.supports(value)) {\n throw invalidPipeArgumentError(SlicePipe, value);\n }\n return value.slice(start, end);\n }\n supports(obj) {\n return typeof obj === 'string' || Array.isArray(obj);\n }\n}\nSlicePipe.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: SlicePipe, deps: [], target: i0.ɵɵFactoryTarget.Pipe });\nSlicePipe.ɵpipe = i0.ɵɵngDeclarePipe({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: SlicePipe, isStandalone: true, name: \"slice\", pure: false });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: SlicePipe, decorators: [{\n type: Pipe,\n args: [{\n name: 'slice',\n pure: false,\n standalone: true,\n }]\n }] });\n\n/**\n * @module\n * @description\n * This module provides a set of common Pipes.\n */\n/**\n * A collection of Angular pipes that are likely to be used in each and every application.\n */\nconst COMMON_PIPES = [\n AsyncPipe,\n UpperCasePipe,\n LowerCasePipe,\n JsonPipe,\n SlicePipe,\n DecimalPipe,\n PercentPipe,\n TitleCasePipe,\n CurrencyPipe,\n DatePipe,\n I18nPluralPipe,\n I18nSelectPipe,\n KeyValuePipe,\n];\n\n// Note: This does not contain the location providers,\n// as they need some platform specific implementations to work.\n/**\n * Exports all the basic Angular directives and pipes,\n * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on.\n * Re-exported by `BrowserModule`, which is included automatically in the root\n * `AppModule` when you create a new app with the CLI `new` command.\n *\n * @publicApi\n */\nclass CommonModule {\n}\nCommonModule.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CommonModule, deps: [], target: i0.ɵɵFactoryTarget.NgModule });\nCommonModule.ɵmod = i0.ɵɵngDeclareNgModule({ minVersion: \"14.0.0\", version: \"15.2.9\", ngImport: i0, type: CommonModule, imports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] });\nCommonModule.ɵinj = i0.ɵɵngDeclareInjector({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CommonModule });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: CommonModule, decorators: [{\n type: NgModule,\n args: [{\n imports: [COMMON_DIRECTIVES, COMMON_PIPES],\n exports: [COMMON_DIRECTIVES, COMMON_PIPES],\n }]\n }] });\n\nconst PLATFORM_BROWSER_ID = 'browser';\nconst PLATFORM_SERVER_ID = 'server';\nconst PLATFORM_WORKER_APP_ID = 'browserWorkerApp';\nconst PLATFORM_WORKER_UI_ID = 'browserWorkerUi';\n/**\n * Returns whether a platform id represents a browser platform.\n * @publicApi\n */\nfunction isPlatformBrowser(platformId) {\n return platformId === PLATFORM_BROWSER_ID;\n}\n/**\n * Returns whether a platform id represents a server platform.\n * @publicApi\n */\nfunction isPlatformServer(platformId) {\n return platformId === PLATFORM_SERVER_ID;\n}\n/**\n * Returns whether a platform id represents a web worker app platform.\n * @publicApi\n */\nfunction isPlatformWorkerApp(platformId) {\n return platformId === PLATFORM_WORKER_APP_ID;\n}\n/**\n * Returns whether a platform id represents a web worker UI platform.\n * @publicApi\n */\nfunction isPlatformWorkerUi(platformId) {\n return platformId === PLATFORM_WORKER_UI_ID;\n}\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n/**\n * @publicApi\n */\nconst VERSION = new Version('15.2.9');\n\n/**\n * Defines a scroll position manager. Implemented by `BrowserViewportScroller`.\n *\n * @publicApi\n */\nclass ViewportScroller {\n}\n// De-sugared tree-shakable injection\n// See #23917\n/** @nocollapse */\nViewportScroller.ɵprov = ɵɵdefineInjectable({\n token: ViewportScroller,\n providedIn: 'root',\n factory: () => new BrowserViewportScroller(ɵɵinject(DOCUMENT), window)\n});\n/**\n * Manages the scroll position for a browser window.\n */\nclass BrowserViewportScroller {\n constructor(document, window) {\n this.document = document;\n this.window = window;\n this.offset = () => [0, 0];\n }\n /**\n * Configures the top offset used when scrolling to an anchor.\n * @param offset A position in screen coordinates (a tuple with x and y values)\n * or a function that returns the top offset position.\n *\n */\n setOffset(offset) {\n if (Array.isArray(offset)) {\n this.offset = () => offset;\n }\n else {\n this.offset = offset;\n }\n }\n /**\n * Retrieves the current scroll position.\n * @returns The position in screen coordinates.\n */\n getScrollPosition() {\n if (this.supportsScrolling()) {\n return [this.window.pageXOffset, this.window.pageYOffset];\n }\n else {\n return [0, 0];\n }\n }\n /**\n * Sets the scroll position.\n * @param position The new position in screen coordinates.\n */\n scrollToPosition(position) {\n if (this.supportsScrolling()) {\n this.window.scrollTo(position[0], position[1]);\n }\n }\n /**\n * Scrolls to an element and attempts to focus the element.\n *\n * Note that the function name here is misleading in that the target string may be an ID for a\n * non-anchor element.\n *\n * @param target The ID of an element or name of the anchor.\n *\n * @see https://html.spec.whatwg.org/#the-indicated-part-of-the-document\n * @see https://html.spec.whatwg.org/#scroll-to-fragid\n */\n scrollToAnchor(target) {\n if (!this.supportsScrolling()) {\n return;\n }\n const elSelected = findAnchorFromDocument(this.document, target);\n if (elSelected) {\n this.scrollToElement(elSelected);\n // After scrolling to the element, the spec dictates that we follow the focus steps for the\n // target. Rather than following the robust steps, simply attempt focus.\n //\n // @see https://html.spec.whatwg.org/#get-the-focusable-area\n // @see https://developer.mozilla.org/en-US/docs/Web/API/HTMLOrForeignElement/focus\n // @see https://html.spec.whatwg.org/#focusable-area\n elSelected.focus();\n }\n }\n /**\n * Disables automatic scroll restoration provided by the browser.\n */\n setHistoryScrollRestoration(scrollRestoration) {\n if (this.supportScrollRestoration()) {\n const history = this.window.history;\n if (history && history.scrollRestoration) {\n history.scrollRestoration = scrollRestoration;\n }\n }\n }\n /**\n * Scrolls to an element using the native offset and the specified offset set on this scroller.\n *\n * The offset can be used when we know that there is a floating header and scrolling naively to an\n * element (ex: `scrollIntoView`) leaves the element hidden behind the floating header.\n */\n scrollToElement(el) {\n const rect = el.getBoundingClientRect();\n const left = rect.left + this.window.pageXOffset;\n const top = rect.top + this.window.pageYOffset;\n const offset = this.offset();\n this.window.scrollTo(left - offset[0], top - offset[1]);\n }\n /**\n * We only support scroll restoration when we can get a hold of window.\n * This means that we do not support this behavior when running in a web worker.\n *\n * Lifting this restriction right now would require more changes in the dom adapter.\n * Since webworkers aren't widely used, we will lift it once RouterScroller is\n * battle-tested.\n */\n supportScrollRestoration() {\n try {\n if (!this.supportsScrolling()) {\n return false;\n }\n // The `scrollRestoration` property could be on the `history` instance or its prototype.\n const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) ||\n getScrollRestorationProperty(Object.getPrototypeOf(this.window.history));\n // We can write to the `scrollRestoration` property if it is a writable data field or it has a\n // setter function.\n return !!scrollRestorationDescriptor &&\n !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set);\n }\n catch {\n return false;\n }\n }\n supportsScrolling() {\n try {\n return !!this.window && !!this.window.scrollTo && 'pageXOffset' in this.window;\n }\n catch {\n return false;\n }\n }\n}\nfunction getScrollRestorationProperty(obj) {\n return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration');\n}\nfunction findAnchorFromDocument(document, target) {\n const documentResult = document.getElementById(target) || document.getElementsByName(target)[0];\n if (documentResult) {\n return documentResult;\n }\n // `getElementById` and `getElementsByName` won't pierce through the shadow DOM so we\n // have to traverse the DOM manually and do the lookup through the shadow roots.\n if (typeof document.createTreeWalker === 'function' && document.body &&\n (document.body.createShadowRoot || document.body.attachShadow)) {\n const treeWalker = document.createTreeWalker(document.body, NodeFilter.SHOW_ELEMENT);\n let currentNode = treeWalker.currentNode;\n while (currentNode) {\n const shadowRoot = currentNode.shadowRoot;\n if (shadowRoot) {\n // Note that `ShadowRoot` doesn't support `getElementsByName`\n // so we have to fall back to `querySelector`.\n const result = shadowRoot.getElementById(target) || shadowRoot.querySelector(`[name=\"${target}\"]`);\n if (result) {\n return result;\n }\n }\n currentNode = treeWalker.nextNode();\n }\n }\n return null;\n}\n/**\n * Provides an empty implementation of the viewport scroller.\n */\nclass NullViewportScroller {\n /**\n * Empty implementation\n */\n setOffset(offset) { }\n /**\n * Empty implementation\n */\n getScrollPosition() {\n return [0, 0];\n }\n /**\n * Empty implementation\n */\n scrollToPosition(position) { }\n /**\n * Empty implementation\n */\n scrollToAnchor(anchor) { }\n /**\n * Empty implementation\n */\n setHistoryScrollRestoration(scrollRestoration) { }\n}\n\n/**\n * A wrapper around the `XMLHttpRequest` constructor.\n *\n * @publicApi\n */\nclass XhrFactory {\n}\n\n// Converts a string that represents a URL into a URL class instance.\nfunction getUrl(src, win) {\n // Don't use a base URL is the URL is absolute.\n return isAbsoluteUrl(src) ? new URL(src) : new URL(src, win.location.href);\n}\n// Checks whether a URL is absolute (i.e. starts with `http://` or `https://`).\nfunction isAbsoluteUrl(src) {\n return /^https?:\\/\\//.test(src);\n}\n// Given a URL, extract the hostname part.\n// If a URL is a relative one - the URL is returned as is.\nfunction extractHostname(url) {\n return isAbsoluteUrl(url) ? (new URL(url)).hostname : url;\n}\nfunction isValidPath(path) {\n const isString = typeof path === 'string';\n if (!isString || path.trim() === '') {\n return false;\n }\n // Calling new URL() will throw if the path string is malformed\n try {\n const url = new URL(path);\n return true;\n }\n catch {\n return false;\n }\n}\nfunction normalizePath(path) {\n return path.endsWith('/') ? path.slice(0, -1) : path;\n}\nfunction normalizeSrc(src) {\n return src.startsWith('/') ? src.slice(1) : src;\n}\n\n/**\n * Noop image loader that does no transformation to the original src and just returns it as is.\n * This loader is used as a default one if more specific logic is not provided in an app config.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n */\nconst noopImageLoader = (config) => config.src;\n/**\n * Injection token that configures the image loader function.\n *\n * @see `ImageLoader`\n * @see `NgOptimizedImage`\n * @publicApi\n */\nconst IMAGE_LOADER = new InjectionToken('ImageLoader', {\n providedIn: 'root',\n factory: () => noopImageLoader,\n});\n/**\n * Internal helper function that makes it easier to introduce custom image loaders for the\n * `NgOptimizedImage` directive. It is enough to specify a URL builder function to obtain full DI\n * configuration for a given loader: a DI token corresponding to the actual loader function, plus DI\n * tokens managing preconnect check functionality.\n * @param buildUrlFn a function returning a full URL based on loader's configuration\n * @param exampleUrls example of full URLs for a given loader (used in error messages)\n * @returns a set of DI providers corresponding to the configured image loader\n */\nfunction createImageLoader(buildUrlFn, exampleUrls) {\n return function provideImageLoader(path) {\n if (!isValidPath(path)) {\n throwInvalidPathError(path, exampleUrls || []);\n }\n // The trailing / is stripped (if provided) to make URL construction (concatenation) easier in\n // the individual loader functions.\n path = normalizePath(path);\n const loaderFn = (config) => {\n if (isAbsoluteUrl(config.src)) {\n // Image loader functions expect an image file name (e.g. `my-image.png`)\n // or a relative path + a file name (e.g. `/a/b/c/my-image.png`) as an input,\n // so the final absolute URL can be constructed.\n // When an absolute URL is provided instead - the loader can not\n // build a final URL, thus the error is thrown to indicate that.\n throwUnexpectedAbsoluteUrlError(path, config.src);\n }\n return buildUrlFn(path, { ...config, src: normalizeSrc(config.src) });\n };\n const providers = [{ provide: IMAGE_LOADER, useValue: loaderFn }];\n return providers;\n };\n}\nfunction throwInvalidPathError(path, exampleUrls) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected an invalid path (\\`${path}\\`). ` +\n `To fix this, supply a path using one of the following formats: ${exampleUrls.join(' or ')}`);\n}\nfunction throwUnexpectedAbsoluteUrlError(path, url) {\n throw new ɵRuntimeError(2959 /* RuntimeErrorCode.INVALID_LOADER_ARGUMENTS */, ngDevMode &&\n `Image loader has detected a \\`\\` tag with an invalid \\`ngSrc\\` attribute: ${url}. ` +\n `This image loader expects \\`ngSrc\\` to be a relative URL - ` +\n `however the provided value is an absolute URL. ` +\n `To fix this, provide \\`ngSrc\\` as a path relative to the base URL ` +\n `configured for this loader (\\`${path}\\`).`);\n}\n\n/**\n * Function that generates an ImageLoader for [Cloudflare Image\n * Resizing](https://developers.cloudflare.com/images/image-resizing/) and turns it into an Angular\n * provider. Note: Cloudflare has multiple image products - this provider is specifically for\n * Cloudflare Image Resizing; it will not work with Cloudflare Images or Cloudflare Polish.\n *\n * @param path Your domain name, e.g. https://mysite.com\n * @returns Provider that provides an ImageLoader function\n *\n * @publicApi\n */\nconst provideCloudflareLoader = createImageLoader(createCloudflareUrl, ngDevMode ? ['https:///cdn-cgi/image//'] : undefined);\nfunction createCloudflareUrl(path, config) {\n let params = `format=auto`;\n if (config.width) {\n params += `,width=${config.width}`;\n }\n // Cloudflare image URLs format:\n // https://developers.cloudflare.com/images/image-resizing/url-format/\n return `${path}/cdn-cgi/image/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for Cloudinary.\n */\nconst cloudinaryLoaderInfo = {\n name: 'Cloudinary',\n testUrl: isCloudinaryUrl\n};\nconst CLOUDINARY_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.cloudinary\\.com\\/.+/;\n/**\n * Tests whether a URL is from Cloudinary CDN.\n */\nfunction isCloudinaryUrl(url) {\n return CLOUDINARY_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Cloudinary and turns it into an Angular provider.\n *\n * @param path Base URL of your Cloudinary images\n * This URL should match one of the following formats:\n * https://res.cloudinary.com/mysite\n * https://mysite.cloudinary.com\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the Cloudinary loader.\n *\n * @publicApi\n */\nconst provideCloudinaryLoader = createImageLoader(createCloudinaryUrl, ngDevMode ?\n [\n 'https://res.cloudinary.com/mysite', 'https://mysite.cloudinary.com',\n 'https://subdomain.mysite.com'\n ] :\n undefined);\nfunction createCloudinaryUrl(path, config) {\n // Cloudinary image URLformat:\n // https://cloudinary.com/documentation/image_transformations#transformation_url_structure\n // Example of a Cloudinary image URL:\n // https://res.cloudinary.com/mysite/image/upload/c_scale,f_auto,q_auto,w_600/marketing/tile-topics-m.png\n let params = `f_auto,q_auto`; // sets image format and quality to \"auto\"\n if (config.width) {\n params += `,w_${config.width}`;\n }\n return `${path}/image/upload/${params}/${config.src}`;\n}\n\n/**\n * Name and URL tester for ImageKit.\n */\nconst imageKitLoaderInfo = {\n name: 'ImageKit',\n testUrl: isImageKitUrl,\n};\nconst IMAGE_KIT_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imagekit\\.io\\/.+/;\n/**\n * Tests whether a URL is from ImageKit CDN.\n */\nfunction isImageKitUrl(url) {\n return IMAGE_KIT_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for ImageKit and turns it into an Angular provider.\n *\n * @param path Base URL of your ImageKit images\n * This URL should match one of the following formats:\n * https://ik.imagekit.io/myaccount\n * https://subdomain.mysite.com\n * @returns Set of providers to configure the ImageKit loader.\n *\n * @publicApi\n */\nconst provideImageKitLoader = createImageLoader(createImagekitUrl, ngDevMode ? ['https://ik.imagekit.io/mysite', 'https://subdomain.mysite.com'] : undefined);\nfunction createImagekitUrl(path, config) {\n // Example of an ImageKit image URL:\n // https://ik.imagekit.io/demo/tr:w-300,h-300/medium_cafe_B1iTdD0C.jpg\n const { src, width } = config;\n let urlSegments;\n if (width) {\n const params = `tr:w-${width}`;\n urlSegments = [path, params, src];\n }\n else {\n urlSegments = [path, src];\n }\n return urlSegments.join('/');\n}\n\n/**\n * Name and URL tester for Imgix.\n */\nconst imgixLoaderInfo = {\n name: 'Imgix',\n testUrl: isImgixUrl\n};\nconst IMGIX_LOADER_REGEX = /https?\\:\\/\\/[^\\/]+\\.imgix\\.net\\/.+/;\n/**\n * Tests whether a URL is from Imgix CDN.\n */\nfunction isImgixUrl(url) {\n return IMGIX_LOADER_REGEX.test(url);\n}\n/**\n * Function that generates an ImageLoader for Imgix and turns it into an Angular provider.\n *\n * @param path path to the desired Imgix origin,\n * e.g. https://somepath.imgix.net or https://images.mysite.com\n * @returns Set of providers to configure the Imgix loader.\n *\n * @publicApi\n */\nconst provideImgixLoader = createImageLoader(createImgixUrl, ngDevMode ? ['https://somepath.imgix.net/'] : undefined);\nfunction createImgixUrl(path, config) {\n const url = new URL(`${path}/${config.src}`);\n // This setting ensures the smallest allowable format is set.\n url.searchParams.set('auto', 'format');\n if (config.width) {\n url.searchParams.set('w', config.width.toString());\n }\n return url.href;\n}\n\n// Assembles directive details string, useful for error messages.\nfunction imgDirectiveDetails(ngSrc, includeNgSrc = true) {\n const ngSrcInfo = includeNgSrc ? `(activated on an element with the \\`ngSrc=\"${ngSrc}\"\\`) ` : '';\n return `The NgOptimizedImage directive ${ngSrcInfo}has detected that`;\n}\n\n/**\n * Asserts that the application is in development mode. Throws an error if the application is in\n * production mode. This assert can be used to make sure that there is no dev-mode code invoked in\n * the prod mode accidentally.\n */\nfunction assertDevMode(checkName) {\n if (!ngDevMode) {\n throw new ɵRuntimeError(2958 /* RuntimeErrorCode.UNEXPECTED_DEV_MODE_CHECK_IN_PROD_MODE */, `Unexpected invocation of the ${checkName} in the prod mode. ` +\n `Please make sure that the prod mode is enabled for production builds.`);\n }\n}\n\n/**\n * Observer that detects whether an image with `NgOptimizedImage`\n * is treated as a Largest Contentful Paint (LCP) element. If so,\n * asserts that the image has the `priority` attribute.\n *\n * Note: this is a dev-mode only class and it does not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n *\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript.\n */\nclass LCPImageObserver {\n constructor() {\n // Map of full image URLs -> original `ngSrc` values.\n this.images = new Map();\n // Keep track of images for which `console.warn` was produced.\n this.alreadyWarned = new Set();\n this.window = null;\n this.observer = null;\n assertDevMode('LCP checker');\n const win = inject(DOCUMENT).defaultView;\n if (typeof win !== 'undefined' && typeof PerformanceObserver !== 'undefined') {\n this.window = win;\n this.observer = this.initPerformanceObserver();\n }\n }\n /**\n * Inits PerformanceObserver and subscribes to LCP events.\n * Based on https://web.dev/lcp/#measure-lcp-in-javascript\n */\n initPerformanceObserver() {\n const observer = new PerformanceObserver((entryList) => {\n const entries = entryList.getEntries();\n if (entries.length === 0)\n return;\n // We use the latest entry produced by the `PerformanceObserver` as the best\n // signal on which element is actually an LCP one. As an example, the first image to load on\n // a page, by virtue of being the only thing on the page so far, is often a LCP candidate\n // and gets reported by PerformanceObserver, but isn't necessarily the LCP element.\n const lcpElement = entries[entries.length - 1];\n // Cast to `any` due to missing `element` on the `LargestContentfulPaint` type of entry.\n // See https://developer.mozilla.org/en-US/docs/Web/API/LargestContentfulPaint\n const imgSrc = lcpElement.element?.src ?? '';\n // Exclude `data:` and `blob:` URLs, since they are not supported by the directive.\n if (imgSrc.startsWith('data:') || imgSrc.startsWith('blob:'))\n return;\n const imgNgSrc = this.images.get(imgSrc);\n if (imgNgSrc && !this.alreadyWarned.has(imgSrc)) {\n this.alreadyWarned.add(imgSrc);\n logMissingPriorityWarning(imgSrc);\n }\n });\n observer.observe({ type: 'largest-contentful-paint', buffered: true });\n return observer;\n }\n registerImage(rewrittenSrc, originalNgSrc) {\n if (!this.observer)\n return;\n this.images.set(getUrl(rewrittenSrc, this.window).href, originalNgSrc);\n }\n unregisterImage(rewrittenSrc) {\n if (!this.observer)\n return;\n this.images.delete(getUrl(rewrittenSrc, this.window).href);\n }\n ngOnDestroy() {\n if (!this.observer)\n return;\n this.observer.disconnect();\n this.images.clear();\n this.alreadyWarned.clear();\n }\n}\nLCPImageObserver.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LCPImageObserver, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nLCPImageObserver.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LCPImageObserver, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: LCPImageObserver, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\nfunction logMissingPriorityWarning(ngSrc) {\n const directiveDetails = imgDirectiveDetails(ngSrc);\n console.warn(ɵformatRuntimeError(2955 /* RuntimeErrorCode.LCP_IMG_MISSING_PRIORITY */, `${directiveDetails} this image is the Largest Contentful Paint (LCP) ` +\n `element but was not marked \"priority\". This image should be marked ` +\n `\"priority\" in order to prioritize its loading. ` +\n `To fix this, add the \"priority\" attribute.`));\n}\n\n// Set of origins that are always excluded from the preconnect checks.\nconst INTERNAL_PRECONNECT_CHECK_BLOCKLIST = new Set(['localhost', '127.0.0.1', '0.0.0.0']);\n/**\n * Injection token to configure which origins should be excluded\n * from the preconnect checks. It can either be a single string or an array of strings\n * to represent a group of origins, for example:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST, useValue: 'https://your-domain.com'}\n * ```\n *\n * or:\n *\n * ```typescript\n * {provide: PRECONNECT_CHECK_BLOCKLIST,\n * useValue: ['https://your-domain-1.com', 'https://your-domain-2.com']}\n * ```\n *\n * @publicApi\n */\nconst PRECONNECT_CHECK_BLOCKLIST = new InjectionToken('PRECONNECT_CHECK_BLOCKLIST');\n/**\n * Contains the logic to detect whether an image, marked with the \"priority\" attribute\n * has a corresponding `` tag in the `document.head`.\n *\n * Note: this is a dev-mode only class, which should not appear in prod bundles,\n * thus there is no `ngDevMode` use in the code.\n */\nclass PreconnectLinkChecker {\n constructor() {\n this.document = inject(DOCUMENT);\n /**\n * Set of tags found on this page.\n * The `null` value indicates that there was no DOM query operation performed.\n */\n this.preconnectLinks = null;\n /*\n * Keep track of all already seen origin URLs to avoid repeating the same check.\n */\n this.alreadySeen = new Set();\n this.window = null;\n this.blocklist = new Set(INTERNAL_PRECONNECT_CHECK_BLOCKLIST);\n assertDevMode('preconnect link checker');\n const win = this.document.defaultView;\n if (typeof win !== 'undefined') {\n this.window = win;\n }\n const blocklist = inject(PRECONNECT_CHECK_BLOCKLIST, { optional: true });\n if (blocklist) {\n this.populateBlocklist(blocklist);\n }\n }\n populateBlocklist(origins) {\n if (Array.isArray(origins)) {\n deepForEach(origins, origin => {\n this.blocklist.add(extractHostname(origin));\n });\n }\n else {\n this.blocklist.add(extractHostname(origins));\n }\n }\n /**\n * Checks that a preconnect resource hint exists in the head for the\n * given src.\n *\n * @param rewrittenSrc src formatted with loader\n * @param originalNgSrc ngSrc value\n */\n assertPreconnect(rewrittenSrc, originalNgSrc) {\n if (!this.window)\n return;\n const imgUrl = getUrl(rewrittenSrc, this.window);\n if (this.blocklist.has(imgUrl.hostname) || this.alreadySeen.has(imgUrl.origin))\n return;\n // Register this origin as seen, so we don't check it again later.\n this.alreadySeen.add(imgUrl.origin);\n if (!this.preconnectLinks) {\n // Note: we query for preconnect links only *once* and cache the results\n // for the entire lifespan of an application, since it's unlikely that the\n // list would change frequently. This allows to make sure there are no\n // performance implications of making extra DOM lookups for each image.\n this.preconnectLinks = this.queryPreconnectLinks();\n }\n if (!this.preconnectLinks.has(imgUrl.origin)) {\n console.warn(ɵformatRuntimeError(2956 /* RuntimeErrorCode.PRIORITY_IMG_MISSING_PRECONNECT_TAG */, `${imgDirectiveDetails(originalNgSrc)} there is no preconnect tag present for this ` +\n `image. Preconnecting to the origin(s) that serve priority images ensures that these ` +\n `images are delivered as soon as possible. To fix this, please add the following ` +\n `element into the of the document:\\n` +\n ` `));\n }\n }\n queryPreconnectLinks() {\n const preconnectUrls = new Set();\n const selector = 'link[rel=preconnect]';\n const links = Array.from(this.document.querySelectorAll(selector));\n for (let link of links) {\n const url = getUrl(link.href, this.window);\n preconnectUrls.add(url.origin);\n }\n return preconnectUrls;\n }\n ngOnDestroy() {\n this.preconnectLinks?.clear();\n this.alreadySeen.clear();\n }\n}\nPreconnectLinkChecker.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreconnectLinkChecker, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreconnectLinkChecker.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreconnectLinkChecker, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreconnectLinkChecker, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }], ctorParameters: function () { return []; } });\n/**\n * Invokes a callback for each element in the array. Also invokes a callback\n * recursively for each nested array.\n */\nfunction deepForEach(input, fn) {\n for (let value of input) {\n Array.isArray(value) ? deepForEach(value, fn) : fn(value);\n }\n}\n\n/**\n * In SSR scenarios, a preload `` element is generated for priority images.\n * Having a large number of preload tags may negatively affect the performance,\n * so we warn developers (by throwing an error) if the number of preloaded images\n * is above a certain threshold. This const specifies this threshold.\n */\nconst DEFAULT_PRELOADED_IMAGES_LIMIT = 5;\n/**\n * Helps to keep track of priority images that already have a corresponding\n * preload tag (to avoid generating multiple preload tags with the same URL).\n *\n * This Set tracks the original src passed into the `ngSrc` input not the src after it has been\n * run through the specified `IMAGE_LOADER`.\n */\nconst PRELOADED_IMAGES = new InjectionToken('NG_OPTIMIZED_PRELOADED_IMAGES', { providedIn: 'root', factory: () => new Set() });\n\n/**\n * @description Contains the logic needed to track and add preload link tags to the `` tag. It\n * will also track what images have already had preload link tags added so as to not duplicate link\n * tags.\n *\n * In dev mode this service will validate that the number of preloaded images does not exceed the\n * configured default preloaded images limit: {@link DEFAULT_PRELOADED_IMAGES_LIMIT}.\n */\nclass PreloadLinkCreator {\n constructor() {\n this.preloadedImages = inject(PRELOADED_IMAGES);\n this.document = inject(DOCUMENT);\n }\n /**\n * @description Add a preload `` to the `` of the `index.html` that is served from the\n * server while using Angular Universal and SSR to kick off image loads for high priority images.\n *\n * The `sizes` (passed in from the user) and `srcset` (parsed and formatted from `ngSrcset`)\n * properties used to set the corresponding attributes, `imagesizes` and `imagesrcset`\n * respectively, on the preload `` tag so that the correctly sized image is preloaded from\n * the CDN.\n *\n * {@link https://web.dev/preload-responsive-images/#imagesrcset-and-imagesizes}\n *\n * @param renderer The `Renderer2` passed in from the directive\n * @param src The original src of the image that is set on the `ngSrc` input.\n * @param srcset The parsed and formatted srcset created from the `ngSrcset` input\n * @param sizes The value of the `sizes` attribute passed in to the `` tag\n */\n createPreloadLinkTag(renderer, src, srcset, sizes) {\n if (ngDevMode) {\n if (this.preloadedImages.size >= DEFAULT_PRELOADED_IMAGES_LIMIT) {\n throw new ɵRuntimeError(2961 /* RuntimeErrorCode.TOO_MANY_PRELOADED_IMAGES */, ngDevMode &&\n `The \\`NgOptimizedImage\\` directive has detected that more than ` +\n `${DEFAULT_PRELOADED_IMAGES_LIMIT} images were marked as priority. ` +\n `This might negatively affect an overall performance of the page. ` +\n `To fix this, remove the \"priority\" attribute from images with less priority.`);\n }\n }\n if (this.preloadedImages.has(src)) {\n return;\n }\n this.preloadedImages.add(src);\n const preload = renderer.createElement('link');\n renderer.setAttribute(preload, 'as', 'image');\n renderer.setAttribute(preload, 'href', src);\n renderer.setAttribute(preload, 'rel', 'preload');\n renderer.setAttribute(preload, 'fetchpriority', 'high');\n if (sizes) {\n renderer.setAttribute(preload, 'imageSizes', sizes);\n }\n if (srcset) {\n renderer.setAttribute(preload, 'imageSrcset', srcset);\n }\n renderer.appendChild(this.document.head, preload);\n }\n}\nPreloadLinkCreator.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreloadLinkCreator, deps: [], target: i0.ɵɵFactoryTarget.Injectable });\nPreloadLinkCreator.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreloadLinkCreator, providedIn: 'root' });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: PreloadLinkCreator, decorators: [{\n type: Injectable,\n args: [{ providedIn: 'root' }]\n }] });\n\n/**\n * When a Base64-encoded image is passed as an input to the `NgOptimizedImage` directive,\n * an error is thrown. The image content (as a string) might be very long, thus making\n * it hard to read an error message if the entire string is included. This const defines\n * the number of characters that should be included into the error message. The rest\n * of the content is truncated.\n */\nconst BASE64_IMG_MAX_LENGTH_IN_ERROR = 50;\n/**\n * RegExpr to determine whether a src in a srcset is using width descriptors.\n * Should match something like: \"100w, 200w\".\n */\nconst VALID_WIDTH_DESCRIPTOR_SRCSET = /^((\\s*\\d+w\\s*(,|$)){1,})$/;\n/**\n * RegExpr to determine whether a src in a srcset is using density descriptors.\n * Should match something like: \"1x, 2x, 50x\". Also supports decimals like \"1.5x, 1.50x\".\n */\nconst VALID_DENSITY_DESCRIPTOR_SRCSET = /^((\\s*\\d+(\\.\\d+)?x\\s*(,|$)){1,})$/;\n/**\n * Srcset values with a density descriptor higher than this value will actively\n * throw an error. Such densities are not permitted as they cause image sizes\n * to be unreasonably large and slow down LCP.\n */\nconst ABSOLUTE_SRCSET_DENSITY_CAP = 3;\n/**\n * Used only in error message text to communicate best practices, as we will\n * only throw based on the slightly more conservative ABSOLUTE_SRCSET_DENSITY_CAP.\n */\nconst RECOMMENDED_SRCSET_DENSITY_CAP = 2;\n/**\n * Used in generating automatic density-based srcsets\n */\nconst DENSITY_SRCSET_MULTIPLIERS = [1, 2];\n/**\n * Used to determine which breakpoints to use on full-width images\n */\nconst VIEWPORT_BREAKPOINT_CUTOFF = 640;\n/**\n * Used to determine whether two aspect ratios are similar in value.\n */\nconst ASPECT_RATIO_TOLERANCE = .1;\n/**\n * Used to determine whether the image has been requested at an overly\n * large size compared to the actual rendered image size (after taking\n * into account a typical device pixel ratio). In pixels.\n */\nconst OVERSIZED_IMAGE_TOLERANCE = 1000;\n/**\n * Used to limit automatic srcset generation of very large sources for\n * fixed-size images. In pixels.\n */\nconst FIXED_SRCSET_WIDTH_LIMIT = 1920;\nconst FIXED_SRCSET_HEIGHT_LIMIT = 1080;\n/** Info about built-in loaders we can test for. */\nconst BUILT_IN_LOADERS = [imgixLoaderInfo, imageKitLoaderInfo, cloudinaryLoaderInfo];\nconst defaultConfig = {\n breakpoints: [16, 32, 48, 64, 96, 128, 256, 384, 640, 750, 828, 1080, 1200, 1920, 2048, 3840],\n};\n/**\n * Injection token that configures the image optimized image functionality.\n *\n * @see `NgOptimizedImage`\n * @publicApi\n * @developerPreview\n */\nconst IMAGE_CONFIG = new InjectionToken('ImageConfig', { providedIn: 'root', factory: () => defaultConfig });\n/**\n * Directive that improves image loading performance by enforcing best practices.\n *\n * `NgOptimizedImage` ensures that the loading of the Largest Contentful Paint (LCP) image is\n * prioritized by:\n * - Automatically setting the `fetchpriority` attribute on the `` tag\n * - Lazy loading non-priority images by default\n * - Asserting that there is a corresponding preconnect link tag in the document head\n *\n * In addition, the directive:\n * - Generates appropriate asset URLs if a corresponding `ImageLoader` function is provided\n * - Automatically generates a srcset\n * - Requires that `width` and `height` are set\n * - Warns if `width` or `height` have been set incorrectly\n * - Warns if the image will be visually distorted when rendered\n *\n * @usageNotes\n * The `NgOptimizedImage` directive is marked as [standalone](guide/standalone-components) and can\n * be imported directly.\n *\n * Follow the steps below to enable and use the directive:\n * 1. Import it into the necessary NgModule or a standalone Component.\n * 2. Optionally provide an `ImageLoader` if you use an image hosting service.\n * 3. Update the necessary `` tags in templates and replace `src` attributes with `ngSrc`.\n * Using a `ngSrc` allows the directive to control when the `src` gets set, which triggers an image\n * download.\n *\n * Step 1: import the `NgOptimizedImage` directive.\n *\n * ```typescript\n * import { NgOptimizedImage } from '@angular/common';\n *\n * // Include it into the necessary NgModule\n * @NgModule({\n * imports: [NgOptimizedImage],\n * })\n * class AppModule {}\n *\n * // ... or a standalone Component\n * @Component({\n * standalone: true\n * imports: [NgOptimizedImage],\n * })\n * class MyStandaloneComponent {}\n * ```\n *\n * Step 2: configure a loader.\n *\n * To use the **default loader**: no additional code changes are necessary. The URL returned by the\n * generic loader will always match the value of \"src\". In other words, this loader applies no\n * transformations to the resource URL and the value of the `ngSrc` attribute will be used as is.\n *\n * To use an existing loader for a **third-party image service**: add the provider factory for your\n * chosen service to the `providers` array. In the example below, the Imgix loader is used:\n *\n * ```typescript\n * import {provideImgixLoader} from '@angular/common';\n *\n * // Call the function and add the result to the `providers` array:\n * providers: [\n * provideImgixLoader(\"https://my.base.url/\"),\n * ],\n * ```\n *\n * The `NgOptimizedImage` directive provides the following functions:\n * - `provideCloudflareLoader`\n * - `provideCloudinaryLoader`\n * - `provideImageKitLoader`\n * - `provideImgixLoader`\n *\n * If you use a different image provider, you can create a custom loader function as described\n * below.\n *\n * To use a **custom loader**: provide your loader function as a value for the `IMAGE_LOADER` DI\n * token.\n *\n * ```typescript\n * import {IMAGE_LOADER, ImageLoaderConfig} from '@angular/common';\n *\n * // Configure the loader using the `IMAGE_LOADER` token.\n * providers: [\n * {\n * provide: IMAGE_LOADER,\n * useValue: (config: ImageLoaderConfig) => {\n * return `https://example.com/${config.src}-${config.width}.jpg}`;\n * }\n * },\n * ],\n * ```\n *\n * Step 3: update `` tags in templates to use `ngSrc` instead of `src`.\n *\n * ```\n * \n * ```\n *\n * @publicApi\n */\nclass NgOptimizedImage {\n constructor() {\n this.imageLoader = inject(IMAGE_LOADER);\n this.config = processConfig(inject(IMAGE_CONFIG));\n this.renderer = inject(Renderer2);\n this.imgElement = inject(ElementRef).nativeElement;\n this.injector = inject(Injector);\n this.isServer = isPlatformServer(inject(PLATFORM_ID));\n this.preloadLinkChecker = inject(PreloadLinkCreator);\n // a LCP image observer - should be injected only in the dev mode\n this.lcpObserver = ngDevMode ? this.injector.get(LCPImageObserver) : null;\n /**\n * Calculate the rewritten `src` once and store it.\n * This is needed to avoid repetitive calculations and make sure the directive cleanup in the\n * `ngOnDestroy` does not rely on the `IMAGE_LOADER` logic (which in turn can rely on some other\n * instance that might be already destroyed).\n */\n this._renderedSrc = null;\n this._priority = false;\n this._disableOptimizedSrcset = false;\n this._fill = false;\n }\n /**\n * For responsive images: the intrinsic width of the image in pixels.\n * For fixed size images: the desired rendered width of the image in pixels.\n */\n set width(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'width');\n this._width = inputToInteger(value);\n }\n get width() {\n return this._width;\n }\n /**\n * For responsive images: the intrinsic height of the image in pixels.\n * For fixed size images: the desired rendered height of the image in pixels.* The intrinsic\n * height of the image in pixels.\n */\n set height(value) {\n ngDevMode && assertGreaterThanZero(this, value, 'height');\n this._height = inputToInteger(value);\n }\n get height() {\n return this._height;\n }\n /**\n * Indicates whether this image should have a high priority.\n */\n set priority(value) {\n this._priority = inputToBoolean(value);\n }\n get priority() {\n return this._priority;\n }\n /**\n * Disables automatic srcset generation for this image.\n */\n set disableOptimizedSrcset(value) {\n this._disableOptimizedSrcset = inputToBoolean(value);\n }\n get disableOptimizedSrcset() {\n return this._disableOptimizedSrcset;\n }\n /**\n * Sets the image to \"fill mode\", which eliminates the height/width requirement and adds\n * styles such that the image fills its containing element.\n *\n * @developerPreview\n */\n set fill(value) {\n this._fill = inputToBoolean(value);\n }\n get fill() {\n return this._fill;\n }\n /** @nodoc */\n ngOnInit() {\n if (ngDevMode) {\n assertNonEmptyInput(this, 'ngSrc', this.ngSrc);\n assertValidNgSrcset(this, this.ngSrcset);\n assertNoConflictingSrc(this);\n if (this.ngSrcset) {\n assertNoConflictingSrcset(this);\n }\n assertNotBase64Image(this);\n assertNotBlobUrl(this);\n if (this.fill) {\n assertEmptyWidthAndHeight(this);\n assertNonZeroRenderedHeight(this, this.imgElement, this.renderer);\n }\n else {\n assertNonEmptyWidthAndHeight(this);\n // Only check for distorted images when not in fill mode, where\n // images may be intentionally stretched, cropped or letterboxed.\n assertNoImageDistortion(this, this.imgElement, this.renderer);\n }\n assertValidLoadingInput(this);\n if (!this.ngSrcset) {\n assertNoComplexSizes(this);\n }\n assertNotMissingBuiltInLoader(this.ngSrc, this.imageLoader);\n assertNoNgSrcsetWithoutLoader(this, this.imageLoader);\n assertNoLoaderParamsWithoutLoader(this, this.imageLoader);\n if (this.priority) {\n const checker = this.injector.get(PreconnectLinkChecker);\n checker.assertPreconnect(this.getRewrittenSrc(), this.ngSrc);\n }\n else {\n // Monitor whether an image is an LCP element only in case\n // the `priority` attribute is missing. Otherwise, an image\n // has the necessary settings and no extra checks are required.\n if (this.lcpObserver !== null) {\n const ngZone = this.injector.get(NgZone);\n ngZone.runOutsideAngular(() => {\n this.lcpObserver.registerImage(this.getRewrittenSrc(), this.ngSrc);\n });\n }\n }\n }\n this.setHostAttributes();\n }\n setHostAttributes() {\n // Must set width/height explicitly in case they are bound (in which case they will\n // only be reflected and not found by the browser)\n if (this.fill) {\n if (!this.sizes) {\n this.sizes = '100vw';\n }\n }\n else {\n this.setHostAttribute('width', this.width.toString());\n this.setHostAttribute('height', this.height.toString());\n }\n this.setHostAttribute('loading', this.getLoadingBehavior());\n this.setHostAttribute('fetchpriority', this.getFetchPriority());\n // The `data-ng-img` attribute flags an image as using the directive, to allow\n // for analysis of the directive's performance.\n this.setHostAttribute('ng-img', 'true');\n // The `src` and `srcset` attributes should be set last since other attributes\n // could affect the image's loading behavior.\n const rewrittenSrc = this.getRewrittenSrc();\n this.setHostAttribute('src', rewrittenSrc);\n let rewrittenSrcset = undefined;\n if (this.sizes) {\n this.setHostAttribute('sizes', this.sizes);\n }\n if (this.ngSrcset) {\n rewrittenSrcset = this.getRewrittenSrcset();\n }\n else if (this.shouldGenerateAutomaticSrcset()) {\n rewrittenSrcset = this.getAutomaticSrcset();\n }\n if (rewrittenSrcset) {\n this.setHostAttribute('srcset', rewrittenSrcset);\n }\n if (this.isServer && this.priority) {\n this.preloadLinkChecker.createPreloadLinkTag(this.renderer, rewrittenSrc, rewrittenSrcset, this.sizes);\n }\n }\n /** @nodoc */\n ngOnChanges(changes) {\n if (ngDevMode) {\n assertNoPostInitInputChange(this, changes, [\n 'ngSrc',\n 'ngSrcset',\n 'width',\n 'height',\n 'priority',\n 'fill',\n 'loading',\n 'sizes',\n 'loaderParams',\n 'disableOptimizedSrcset',\n ]);\n }\n }\n callImageLoader(configWithoutCustomParams) {\n let augmentedConfig = configWithoutCustomParams;\n if (this.loaderParams) {\n augmentedConfig.loaderParams = this.loaderParams;\n }\n return this.imageLoader(augmentedConfig);\n }\n getLoadingBehavior() {\n if (!this.priority && this.loading !== undefined) {\n return this.loading;\n }\n return this.priority ? 'eager' : 'lazy';\n }\n getFetchPriority() {\n return this.priority ? 'high' : 'auto';\n }\n getRewrittenSrc() {\n // ImageLoaderConfig supports setting a width property. However, we're not setting width here\n // because if the developer uses rendered width instead of intrinsic width in the HTML width\n // attribute, the image requested may be too small for 2x+ screens.\n if (!this._renderedSrc) {\n const imgConfig = { src: this.ngSrc };\n // Cache calculated image src to reuse it later in the code.\n this._renderedSrc = this.callImageLoader(imgConfig);\n }\n return this._renderedSrc;\n }\n getRewrittenSrcset() {\n const widthSrcSet = VALID_WIDTH_DESCRIPTOR_SRCSET.test(this.ngSrcset);\n const finalSrcs = this.ngSrcset.split(',').filter(src => src !== '').map(srcStr => {\n srcStr = srcStr.trim();\n const width = widthSrcSet ? parseFloat(srcStr) : parseFloat(srcStr) * this.width;\n return `${this.callImageLoader({ src: this.ngSrc, width })} ${srcStr}`;\n });\n return finalSrcs.join(', ');\n }\n getAutomaticSrcset() {\n if (this.sizes) {\n return this.getResponsiveSrcset();\n }\n else {\n return this.getFixedSrcset();\n }\n }\n getResponsiveSrcset() {\n const { breakpoints } = this.config;\n let filteredBreakpoints = breakpoints;\n if (this.sizes?.trim() === '100vw') {\n // Since this is a full-screen-width image, our srcset only needs to include\n // breakpoints with full viewport widths.\n filteredBreakpoints = breakpoints.filter(bp => bp >= VIEWPORT_BREAKPOINT_CUTOFF);\n }\n const finalSrcs = filteredBreakpoints.map(bp => `${this.callImageLoader({ src: this.ngSrc, width: bp })} ${bp}w`);\n return finalSrcs.join(', ');\n }\n getFixedSrcset() {\n const finalSrcs = DENSITY_SRCSET_MULTIPLIERS.map(multiplier => `${this.callImageLoader({\n src: this.ngSrc,\n width: this.width * multiplier\n })} ${multiplier}x`);\n return finalSrcs.join(', ');\n }\n shouldGenerateAutomaticSrcset() {\n return !this._disableOptimizedSrcset && !this.srcset && this.imageLoader !== noopImageLoader &&\n !(this.width > FIXED_SRCSET_WIDTH_LIMIT || this.height > FIXED_SRCSET_HEIGHT_LIMIT);\n }\n /** @nodoc */\n ngOnDestroy() {\n if (ngDevMode) {\n if (!this.priority && this._renderedSrc !== null && this.lcpObserver !== null) {\n this.lcpObserver.unregisterImage(this._renderedSrc);\n }\n }\n }\n setHostAttribute(name, value) {\n this.renderer.setAttribute(this.imgElement, name, value);\n }\n}\nNgOptimizedImage.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgOptimizedImage, deps: [], target: i0.ɵɵFactoryTarget.Directive });\nNgOptimizedImage.ɵdir = i0.ɵɵngDeclareDirective({ minVersion: \"14.0.0\", version: \"15.2.9\", type: NgOptimizedImage, isStandalone: true, selector: \"img[ngSrc]\", inputs: { ngSrc: \"ngSrc\", ngSrcset: \"ngSrcset\", sizes: \"sizes\", width: \"width\", height: \"height\", loading: \"loading\", priority: \"priority\", loaderParams: \"loaderParams\", disableOptimizedSrcset: \"disableOptimizedSrcset\", fill: \"fill\", src: \"src\", srcset: \"srcset\" }, host: { properties: { \"style.position\": \"fill ? \\\"absolute\\\" : null\", \"style.width\": \"fill ? \\\"100%\\\" : null\", \"style.height\": \"fill ? \\\"100%\\\" : null\", \"style.inset\": \"fill ? \\\"0px\\\" : null\" } }, usesOnChanges: true, ngImport: i0 });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: NgOptimizedImage, decorators: [{\n type: Directive,\n args: [{\n standalone: true,\n selector: 'img[ngSrc]',\n host: {\n '[style.position]': 'fill ? \"absolute\" : null',\n '[style.width]': 'fill ? \"100%\" : null',\n '[style.height]': 'fill ? \"100%\" : null',\n '[style.inset]': 'fill ? \"0px\" : null'\n }\n }]\n }], propDecorators: { ngSrc: [{\n type: Input\n }], ngSrcset: [{\n type: Input\n }], sizes: [{\n type: Input\n }], width: [{\n type: Input\n }], height: [{\n type: Input\n }], loading: [{\n type: Input\n }], priority: [{\n type: Input\n }], loaderParams: [{\n type: Input\n }], disableOptimizedSrcset: [{\n type: Input\n }], fill: [{\n type: Input\n }], src: [{\n type: Input\n }], srcset: [{\n type: Input\n }] } });\n/***** Helpers *****/\n/**\n * Convert input value to integer.\n */\nfunction inputToInteger(value) {\n return typeof value === 'string' ? parseInt(value, 10) : value;\n}\n/**\n * Convert input value to boolean.\n */\nfunction inputToBoolean(value) {\n return value != null && `${value}` !== 'false';\n}\n/**\n * Sorts provided config breakpoints and uses defaults.\n */\nfunction processConfig(config) {\n let sortedBreakpoints = {};\n if (config.breakpoints) {\n sortedBreakpoints.breakpoints = config.breakpoints.sort((a, b) => a - b);\n }\n return Object.assign({}, defaultConfig, config, sortedBreakpoints);\n}\n/***** Assert functions *****/\n/**\n * Verifies that there is no `src` set on a host element.\n */\nfunction assertNoConflictingSrc(dir) {\n if (dir.src) {\n throw new ɵRuntimeError(2950 /* RuntimeErrorCode.UNEXPECTED_SRC_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`src\\` and \\`ngSrc\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`src\\` itself based on the value of \\`ngSrc\\`. ` +\n `To fix this, please remove the \\`src\\` attribute.`);\n }\n}\n/**\n * Verifies that there is no `srcset` set on a host element.\n */\nfunction assertNoConflictingSrcset(dir) {\n if (dir.srcset) {\n throw new ɵRuntimeError(2951 /* RuntimeErrorCode.UNEXPECTED_SRCSET_ATTR */, `${imgDirectiveDetails(dir.ngSrc)} both \\`srcset\\` and \\`ngSrcset\\` have been set. ` +\n `Supplying both of these attributes breaks lazy loading. ` +\n `The NgOptimizedImage directive sets \\`srcset\\` itself based on the value of ` +\n `\\`ngSrcset\\`. To fix this, please remove the \\`srcset\\` attribute.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Base64-encoded image.\n */\nfunction assertNotBase64Image(dir) {\n let ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('data:')) {\n if (ngSrc.length > BASE64_IMG_MAX_LENGTH_IN_ERROR) {\n ngSrc = ngSrc.substring(0, BASE64_IMG_MAX_LENGTH_IN_ERROR) + '...';\n }\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`ngSrc\\` is a Base64-encoded string ` +\n `(${ngSrc}). NgOptimizedImage does not support Base64-encoded strings. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a standard \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the 'sizes' only includes responsive values.\n */\nfunction assertNoComplexSizes(dir) {\n let sizes = dir.sizes;\n if (sizes?.match(/((\\)|,)\\s|^)\\d+px/)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc, false)} \\`sizes\\` was set to a string including ` +\n `pixel values. For automatic \\`srcset\\` generation, \\`sizes\\` must only include responsive ` +\n `values, such as \\`sizes=\"50vw\"\\` or \\`sizes=\"(min-width: 768px) 50vw, 100vw\"\\`. ` +\n `To fix this, modify the \\`sizes\\` attribute, or provide your own \\`ngSrcset\\` value directly.`);\n }\n}\n/**\n * Verifies that the `ngSrc` is not a Blob URL.\n */\nfunction assertNotBlobUrl(dir) {\n const ngSrc = dir.ngSrc.trim();\n if (ngSrc.startsWith('blob:')) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrc\\` was set to a blob URL (${ngSrc}). ` +\n `Blob URLs are not supported by the NgOptimizedImage directive. ` +\n `To fix this, disable the NgOptimizedImage directive for this element ` +\n `by removing \\`ngSrc\\` and using a regular \\`src\\` attribute instead.`);\n }\n}\n/**\n * Verifies that the input is set to a non-empty string.\n */\nfunction assertNonEmptyInput(dir, name, value) {\n const isString = typeof value === 'string';\n const isEmptyString = isString && value.trim() === '';\n if (!isString || isEmptyString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${name}\\` has an invalid value ` +\n `(\\`${value}\\`). To fix this, change the value to a non-empty string.`);\n }\n}\n/**\n * Verifies that the `ngSrcset` is in a valid format, e.g. \"100w, 200w\" or \"1x, 2x\".\n */\nfunction assertValidNgSrcset(dir, value) {\n if (value == null)\n return;\n assertNonEmptyInput(dir, 'ngSrcset', value);\n const stringVal = value;\n const isValidWidthDescriptor = VALID_WIDTH_DESCRIPTOR_SRCSET.test(stringVal);\n const isValidDensityDescriptor = VALID_DENSITY_DESCRIPTOR_SRCSET.test(stringVal);\n if (isValidDensityDescriptor) {\n assertUnderDensityCap(dir, stringVal);\n }\n const isValidSrcset = isValidWidthDescriptor || isValidDensityDescriptor;\n if (!isValidSrcset) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`ngSrcset\\` has an invalid value (\\`${value}\\`). ` +\n `To fix this, supply \\`ngSrcset\\` using a comma-separated list of one or more width ` +\n `descriptors (e.g. \"100w, 200w\") or density descriptors (e.g. \"1x, 2x\").`);\n }\n}\nfunction assertUnderDensityCap(dir, value) {\n const underDensityCap = value.split(',').every(num => num === '' || parseFloat(num) <= ABSOLUTE_SRCSET_DENSITY_CAP);\n if (!underDensityCap) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` contains an unsupported image density:` +\n `\\`${value}\\`. NgOptimizedImage generally recommends a max image density of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}x but supports image densities up to ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x. The human eye cannot distinguish between image densities ` +\n `greater than ${RECOMMENDED_SRCSET_DENSITY_CAP}x - which makes them unnecessary for ` +\n `most use cases. Images that will be pinch-zoomed are typically the primary use case for ` +\n `${ABSOLUTE_SRCSET_DENSITY_CAP}x images. Please remove the high density descriptor and try again.`);\n }\n}\n/**\n * Creates a `RuntimeError` instance to represent a situation when an input is set after\n * the directive has initialized.\n */\nfunction postInitInputChangeError(dir, inputName) {\n let reason;\n if (inputName === 'width' || inputName === 'height') {\n reason = `Changing \\`${inputName}\\` may result in different attribute value ` +\n `applied to the underlying image element and cause layout shifts on a page.`;\n }\n else {\n reason = `Changing the \\`${inputName}\\` would have no effect on the underlying ` +\n `image element, because the resource loading has already occurred.`;\n }\n return new ɵRuntimeError(2953 /* RuntimeErrorCode.UNEXPECTED_INPUT_CHANGE */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` was updated after initialization. ` +\n `The NgOptimizedImage directive will not react to this input change. ${reason} ` +\n `To fix this, either switch \\`${inputName}\\` to a static value ` +\n `or wrap the image element in an *ngIf that is gated on the necessary value.`);\n}\n/**\n * Verify that none of the listed inputs has changed.\n */\nfunction assertNoPostInitInputChange(dir, changes, inputs) {\n inputs.forEach(input => {\n const isUpdated = changes.hasOwnProperty(input);\n if (isUpdated && !changes[input].isFirstChange()) {\n if (input === 'ngSrc') {\n // When the `ngSrc` input changes, we detect that only in the\n // `ngOnChanges` hook, thus the `ngSrc` is already set. We use\n // `ngSrc` in the error message, so we use a previous value, but\n // not the updated one in it.\n dir = { ngSrc: changes[input].previousValue };\n }\n throw postInitInputChangeError(dir, input);\n }\n });\n}\n/**\n * Verifies that a specified input is a number greater than 0.\n */\nfunction assertGreaterThanZero(dir, inputValue, inputName) {\n const validNumber = typeof inputValue === 'number' && inputValue > 0;\n const validString = typeof inputValue === 'string' && /^\\d+$/.test(inputValue.trim()) && parseInt(inputValue) > 0;\n if (!validNumber && !validString) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} \\`${inputName}\\` has an invalid value ` +\n `(\\`${inputValue}\\`). To fix this, provide \\`${inputName}\\` ` +\n `as a number greater than 0.`);\n }\n}\n/**\n * Verifies that the rendered image is not visually distorted. Effectively this is checking:\n * - Whether the \"width\" and \"height\" attributes reflect the actual dimensions of the image.\n * - Whether image styling is \"correct\" (see below for a longer explanation).\n */\nfunction assertNoImageDistortion(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const computedStyle = window.getComputedStyle(img);\n let renderedWidth = parseFloat(computedStyle.getPropertyValue('width'));\n let renderedHeight = parseFloat(computedStyle.getPropertyValue('height'));\n const boxSizing = computedStyle.getPropertyValue('box-sizing');\n if (boxSizing === 'border-box') {\n const paddingTop = computedStyle.getPropertyValue('padding-top');\n const paddingRight = computedStyle.getPropertyValue('padding-right');\n const paddingBottom = computedStyle.getPropertyValue('padding-bottom');\n const paddingLeft = computedStyle.getPropertyValue('padding-left');\n renderedWidth -= parseFloat(paddingRight) + parseFloat(paddingLeft);\n renderedHeight -= parseFloat(paddingTop) + parseFloat(paddingBottom);\n }\n const renderedAspectRatio = renderedWidth / renderedHeight;\n const nonZeroRenderedDimensions = renderedWidth !== 0 && renderedHeight !== 0;\n const intrinsicWidth = img.naturalWidth;\n const intrinsicHeight = img.naturalHeight;\n const intrinsicAspectRatio = intrinsicWidth / intrinsicHeight;\n const suppliedWidth = dir.width;\n const suppliedHeight = dir.height;\n const suppliedAspectRatio = suppliedWidth / suppliedHeight;\n // Tolerance is used to account for the impact of subpixel rendering.\n // Due to subpixel rendering, the rendered, intrinsic, and supplied\n // aspect ratios of a correctly configured image may not exactly match.\n // For example, a `width=4030 height=3020` image might have a rendered\n // size of \"1062w, 796.48h\". (An aspect ratio of 1.334... vs. 1.333...)\n const inaccurateDimensions = Math.abs(suppliedAspectRatio - intrinsicAspectRatio) > ASPECT_RATIO_TOLERANCE;\n const stylingDistortion = nonZeroRenderedDimensions &&\n Math.abs(intrinsicAspectRatio - renderedAspectRatio) > ASPECT_RATIO_TOLERANCE;\n if (inaccurateDimensions) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the image does not match ` +\n `the aspect ratio indicated by the width and height attributes. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nSupplied width and height attributes: ` +\n `${suppliedWidth}w x ${suppliedHeight}h (aspect-ratio: ${suppliedAspectRatio}). ` +\n `\\nTo fix this, update the width and height attributes.`));\n }\n else if (stylingDistortion) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the aspect ratio of the rendered image ` +\n `does not match the image's intrinsic aspect ratio. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h ` +\n `(aspect-ratio: ${intrinsicAspectRatio}). \\nRendered image size: ` +\n `${renderedWidth}w x ${renderedHeight}h (aspect-ratio: ` +\n `${renderedAspectRatio}). \\nThis issue can occur if \"width\" and \"height\" ` +\n `attributes are added to an image without updating the corresponding ` +\n `image styling. To fix this, adjust image styling. In most cases, ` +\n `adding \"height: auto\" or \"width: auto\" to the image styling will fix ` +\n `this issue.`));\n }\n else if (!dir.ngSrcset && nonZeroRenderedDimensions) {\n // If `ngSrcset` hasn't been set, sanity check the intrinsic size.\n const recommendedWidth = RECOMMENDED_SRCSET_DENSITY_CAP * renderedWidth;\n const recommendedHeight = RECOMMENDED_SRCSET_DENSITY_CAP * renderedHeight;\n const oversizedWidth = (intrinsicWidth - recommendedWidth) >= OVERSIZED_IMAGE_TOLERANCE;\n const oversizedHeight = (intrinsicHeight - recommendedHeight) >= OVERSIZED_IMAGE_TOLERANCE;\n if (oversizedWidth || oversizedHeight) {\n console.warn(ɵformatRuntimeError(2960 /* RuntimeErrorCode.OVERSIZED_IMAGE */, `${imgDirectiveDetails(dir.ngSrc)} the intrinsic image is significantly ` +\n `larger than necessary. ` +\n `\\nRendered image size: ${renderedWidth}w x ${renderedHeight}h. ` +\n `\\nIntrinsic image size: ${intrinsicWidth}w x ${intrinsicHeight}h. ` +\n `\\nRecommended intrinsic image size: ${recommendedWidth}w x ${recommendedHeight}h. ` +\n `\\nNote: Recommended intrinsic image size is calculated assuming a maximum DPR of ` +\n `${RECOMMENDED_SRCSET_DENSITY_CAP}. To improve loading time, resize the image ` +\n `or consider using the \"ngSrcset\" and \"sizes\" attributes.`));\n }\n }\n });\n}\n/**\n * Verifies that a specified input is set.\n */\nfunction assertNonEmptyWidthAndHeight(dir) {\n let missingAttributes = [];\n if (dir.width === undefined)\n missingAttributes.push('width');\n if (dir.height === undefined)\n missingAttributes.push('height');\n if (missingAttributes.length > 0) {\n throw new ɵRuntimeError(2954 /* RuntimeErrorCode.REQUIRED_INPUT_MISSING */, `${imgDirectiveDetails(dir.ngSrc)} these required attributes ` +\n `are missing: ${missingAttributes.map(attr => `\"${attr}\"`).join(', ')}. ` +\n `Including \"width\" and \"height\" attributes will prevent image-related layout shifts. ` +\n `To fix this, include \"width\" and \"height\" attributes on the image tag or turn on ` +\n `\"fill\" mode with the \\`fill\\` attribute.`);\n }\n}\n/**\n * Verifies that width and height are not set. Used in fill mode, where those attributes don't make\n * sense.\n */\nfunction assertEmptyWidthAndHeight(dir) {\n if (dir.width || dir.height) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the attributes \\`height\\` and/or \\`width\\` are present ` +\n `along with the \\`fill\\` attribute. Because \\`fill\\` mode causes an image to fill its containing ` +\n `element, the size attributes have no effect and should be removed.`);\n }\n}\n/**\n * Verifies that the rendered image has a nonzero height. If the image is in fill mode, provides\n * guidance that this can be caused by the containing element's CSS position property.\n */\nfunction assertNonZeroRenderedHeight(dir, img, renderer) {\n const removeListenerFn = renderer.listen(img, 'load', () => {\n removeListenerFn();\n const renderedHeight = img.clientHeight;\n if (dir.fill && renderedHeight === 0) {\n console.warn(ɵformatRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the height of the fill-mode image is zero. ` +\n `This is likely because the containing element does not have the CSS 'position' ` +\n `property set to one of the following: \"relative\", \"fixed\", or \"absolute\". ` +\n `To fix this problem, make sure the container element has the CSS 'position' ` +\n `property defined and the height of the element is not zero.`));\n }\n });\n}\n/**\n * Verifies that the `loading` attribute is set to a valid input &\n * is not used on priority images.\n */\nfunction assertValidLoadingInput(dir) {\n if (dir.loading && dir.priority) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `was used on an image that was marked \"priority\". ` +\n `Setting \\`loading\\` on priority images is not allowed ` +\n `because these images will always be eagerly loaded. ` +\n `To fix this, remove the “loading” attribute from the priority image.`);\n }\n const validInputs = ['auto', 'eager', 'lazy'];\n if (typeof dir.loading === 'string' && !validInputs.includes(dir.loading)) {\n throw new ɵRuntimeError(2952 /* RuntimeErrorCode.INVALID_INPUT */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loading\\` attribute ` +\n `has an invalid value (\\`${dir.loading}\\`). ` +\n `To fix this, provide a valid value (\"lazy\", \"eager\", or \"auto\").`);\n }\n}\n/**\n * Warns if NOT using a loader (falling back to the generic loader) and\n * the image appears to be hosted on one of the image CDNs for which\n * we do have a built-in image loader. Suggests switching to the\n * built-in loader.\n *\n * @param ngSrc Value of the ngSrc attribute\n * @param imageLoader ImageLoader provided\n */\nfunction assertNotMissingBuiltInLoader(ngSrc, imageLoader) {\n if (imageLoader === noopImageLoader) {\n let builtInLoaderName = '';\n for (const loader of BUILT_IN_LOADERS) {\n if (loader.testUrl(ngSrc)) {\n builtInLoaderName = loader.name;\n break;\n }\n }\n if (builtInLoaderName) {\n console.warn(ɵformatRuntimeError(2962 /* RuntimeErrorCode.MISSING_BUILTIN_LOADER */, `NgOptimizedImage: It looks like your images may be hosted on the ` +\n `${builtInLoaderName} CDN, but your app is not using Angular's ` +\n `built-in loader for that CDN. We recommend switching to use ` +\n `the built-in by calling \\`provide${builtInLoaderName}Loader()\\` ` +\n `in your \\`providers\\` and passing it your instance's base URL. ` +\n `If you don't want to use the built-in loader, define a custom ` +\n `loader function using IMAGE_LOADER to silence this warning.`));\n }\n }\n}\n/**\n * Warns if ngSrcset is present and no loader is configured (i.e. the default one is being used).\n */\nfunction assertNoNgSrcsetWithoutLoader(dir, imageLoader) {\n if (dir.ngSrcset && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`ngSrcset\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which would result in the same image being used for all configured sizes. ` +\n `To fix this, provide a loader or remove the \\`ngSrcset\\` attribute from the image.`));\n }\n}\n/**\n * Warns if loaderParams is present and no loader is configured (i.e. the default one is being\n * used).\n */\nfunction assertNoLoaderParamsWithoutLoader(dir, imageLoader) {\n if (dir.loaderParams && imageLoader === noopImageLoader) {\n console.warn(ɵformatRuntimeError(2963 /* RuntimeErrorCode.MISSING_NECESSARY_LOADER */, `${imgDirectiveDetails(dir.ngSrc)} the \\`loaderParams\\` attribute is present but ` +\n `no image loader is configured (i.e. the default one is being used), ` +\n `which means that the loaderParams data will not be consumed and will not affect the URL. ` +\n `To fix this, provide a custom loader or remove the \\`loaderParams\\` attribute from the image.`));\n }\n}\n\n// These exports represent the set of symbols exposed as a public API.\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of the common package.\n */\n\n/**\n * @module\n * @description\n * Entry point for all public APIs of this package.\n */\n// This file only reexports content of the `src` folder. Keep it that way.\n\n// This file is not used to build this module. It is only used during editing\n\n/**\n * Generated bundle index. Do not edit.\n */\n\nexport { APP_BASE_HREF, AsyncPipe, BrowserPlatformLocation, CommonModule, CurrencyPipe, DATE_PIPE_DEFAULT_OPTIONS, DATE_PIPE_DEFAULT_TIMEZONE, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, IMAGE_CONFIG, IMAGE_LOADER, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf as NgFor, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgOptimizedImage, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PRECONNECT_CHECK_BLOCKLIST, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, XhrFactory, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, provideCloudflareLoader, provideCloudinaryLoader, provideImageKitLoader, provideImgixLoader, registerLocaleData, DomAdapter as ɵDomAdapter, NullViewportScroller as ɵNullViewportScroller, PLATFORM_BROWSER_ID as ɵPLATFORM_BROWSER_ID, PLATFORM_SERVER_ID as ɵPLATFORM_SERVER_ID, PLATFORM_WORKER_APP_ID as ɵPLATFORM_WORKER_APP_ID, PLATFORM_WORKER_UI_ID as ɵPLATFORM_WORKER_UI_ID, getDOM as ɵgetDOM, parseCookieValue as ɵparseCookieValue, setRootDomAdapter as ɵsetRootDomAdapter };\n","/**\n * @license Angular v15.2.9\n * (c) 2010-2022 Google LLC. https://angular.io/\n * License: MIT\n */\n\nimport * as i1 from '@angular/common';\nimport { DOCUMENT, ɵparseCookieValue, XhrFactory as XhrFactory$1 } from '@angular/common';\nimport * as i0 from '@angular/core';\nimport { Injectable, InjectionToken, inject, Inject, PLATFORM_ID, makeEnvironmentProviders, NgModule } from '@angular/core';\nimport { of, Observable } from 'rxjs';\nimport { concatMap, filter, map } from 'rxjs/operators';\n\n/**\n * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a\n * `HttpResponse`.\n *\n * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the\n * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the\n * `HttpBackend`.\n *\n * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain.\n *\n * @publicApi\n */\nclass HttpHandler {\n}\n/**\n * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend.\n *\n * Interceptors sit between the `HttpClient` interface and the `HttpBackend`.\n *\n * When injected, `HttpBackend` dispatches requests directly to the backend, without going\n * through the interceptor chain.\n *\n * @publicApi\n */\nclass HttpBackend {\n}\n\n/**\n * Represents the header configuration options for an HTTP request.\n * Instances are immutable. Modifying methods return a cloned\n * instance with the change. The original object is never changed.\n *\n * @publicApi\n */\nclass HttpHeaders {\n /** Constructs a new HTTP header object with the given values.*/\n constructor(headers) {\n /**\n * Internal map of lowercased header names to the normalized\n * form of the name (the form seen first).\n */\n this.normalizedNames = new Map();\n /**\n * Queued updates to be materialized the next initialization.\n */\n this.lazyUpdate = null;\n if (!headers) {\n this.headers = new Map();\n }\n else if (typeof headers === 'string') {\n this.lazyInit = () => {\n this.headers = new Map();\n headers.split('\\n').forEach(line => {\n const index = line.indexOf(':');\n if (index > 0) {\n const name = line.slice(0, index);\n const key = name.toLowerCase();\n const value = line.slice(index + 1).trim();\n this.maybeSetNormalizedName(name, key);\n if (this.headers.has(key)) {\n this.headers.get(key).push(value);\n }\n else {\n this.headers.set(key, [value]);\n }\n }\n });\n };\n }\n else {\n this.lazyInit = () => {\n if (typeof ngDevMode === 'undefined' || ngDevMode) {\n assertValidHeaders(headers);\n }\n this.headers = new Map();\n Object.entries(headers).forEach(([name, values]) => {\n let headerValues;\n if (typeof values === 'string') {\n headerValues = [values];\n }\n else if (typeof values === 'number') {\n headerValues = [values.toString()];\n }\n else {\n headerValues = values.map((value) => value.toString());\n }\n if (headerValues.length > 0) {\n const key = name.toLowerCase();\n this.headers.set(key, headerValues);\n this.maybeSetNormalizedName(name, key);\n }\n });\n };\n }\n }\n /**\n * Checks for existence of a given header.\n *\n * @param name The header name to check for existence.\n *\n * @returns True if the header exists, false otherwise.\n */\n has(name) {\n this.init();\n return this.headers.has(name.toLowerCase());\n }\n /**\n * Retrieves the first value of a given header.\n *\n * @param name The header name.\n *\n * @returns The value string if the header exists, null otherwise\n */\n get(name) {\n this.init();\n const values = this.headers.get(name.toLowerCase());\n return values && values.length > 0 ? values[0] : null;\n }\n /**\n * Retrieves the names of the headers.\n *\n * @returns A list of header names.\n */\n keys() {\n this.init();\n return Array.from(this.normalizedNames.values());\n }\n /**\n * Retrieves a list of values for a given header.\n *\n * @param name The header name from which to retrieve values.\n *\n * @returns A string of values if the header exists, null otherwise.\n */\n getAll(name) {\n this.init();\n return this.headers.get(name.toLowerCase()) || null;\n }\n /**\n * Appends a new value to the existing set of values for a header\n * and returns them in a clone of the original instance.\n *\n * @param name The header name for which to append the values.\n * @param value The value to append.\n *\n * @returns A clone of the HTTP headers object with the value appended to the given header.\n */\n append(name, value) {\n return this.clone({ name, value, op: 'a' });\n }\n /**\n * Sets or modifies a value for a given header in a clone of the original instance.\n * If the header already exists, its value is replaced with the given value\n * in the returned object.\n *\n * @param name The header name.\n * @param value The value or values to set or override for the given header.\n *\n * @returns A clone of the HTTP headers object with the newly set header value.\n */\n set(name, value) {\n return this.clone({ name, value, op: 's' });\n }\n /**\n * Deletes values for a given header in a clone of the original instance.\n *\n * @param name The header name.\n * @param value The value or values to delete for the given header.\n *\n * @returns A clone of the HTTP headers object with the given value deleted.\n */\n delete(name, value) {\n return this.clone({ name, value, op: 'd' });\n }\n maybeSetNormalizedName(name, lcName) {\n if (!this.normalizedNames.has(lcName)) {\n this.normalizedNames.set(lcName, name);\n }\n }\n init() {\n if (!!this.lazyInit) {\n if (this.lazyInit instanceof HttpHeaders) {\n this.copyFrom(this.lazyInit);\n }\n else {\n this.lazyInit();\n }\n this.lazyInit = null;\n if (!!this.lazyUpdate) {\n this.lazyUpdate.forEach(update => this.applyUpdate(update));\n this.lazyUpdate = null;\n }\n }\n }\n copyFrom(other) {\n other.init();\n Array.from(other.headers.keys()).forEach(key => {\n this.headers.set(key, other.headers.get(key));\n this.normalizedNames.set(key, other.normalizedNames.get(key));\n });\n }\n clone(update) {\n const clone = new HttpHeaders();\n clone.lazyInit =\n (!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this;\n clone.lazyUpdate = (this.lazyUpdate || []).concat([update]);\n return clone;\n }\n applyUpdate(update) {\n const key = update.name.toLowerCase();\n switch (update.op) {\n case 'a':\n case 's':\n let value = update.value;\n if (typeof value === 'string') {\n value = [value];\n }\n if (value.length === 0) {\n return;\n }\n this.maybeSetNormalizedName(update.name, key);\n const base = (update.op === 'a' ? this.headers.get(key) : undefined) || [];\n base.push(...value);\n this.headers.set(key, base);\n break;\n case 'd':\n const toDelete = update.value;\n if (!toDelete) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n let existing = this.headers.get(key);\n if (!existing) {\n return;\n }\n existing = existing.filter(value => toDelete.indexOf(value) === -1);\n if (existing.length === 0) {\n this.headers.delete(key);\n this.normalizedNames.delete(key);\n }\n else {\n this.headers.set(key, existing);\n }\n }\n break;\n }\n }\n /**\n * @internal\n */\n forEach(fn) {\n this.init();\n Array.from(this.normalizedNames.keys())\n .forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key)));\n }\n}\n/**\n * Verifies that the headers object has the right shape: the values\n * must be either strings, numbers or arrays. Throws an error if an invalid\n * header value is present.\n */\nfunction assertValidHeaders(headers) {\n for (const [key, value] of Object.entries(headers)) {\n if (!(typeof value === 'string' || typeof value === 'number') && !Array.isArray(value)) {\n throw new Error(`Unexpected value of the \\`${key}\\` header provided. ` +\n `Expecting either a string, a number or an array, but got: \\`${value}\\`.`);\n }\n }\n}\n\n/**\n * Provides encoding and decoding of URL parameter and query-string values.\n *\n * Serializes and parses URL parameter keys and values to encode and decode them.\n * If you pass URL query parameters without encoding,\n * the query parameters can be misinterpreted at the receiving end.\n *\n *\n * @publicApi\n */\nclass HttpUrlEncodingCodec {\n /**\n * Encodes a key name for a URL parameter or query-string.\n * @param key The key name.\n * @returns The encoded key name.\n */\n encodeKey(key) {\n return standardEncoding(key);\n }\n /**\n * Encodes the value of a URL parameter or query-string.\n * @param value The value.\n * @returns The encoded value.\n */\n encodeValue(value) {\n return standardEncoding(value);\n }\n /**\n * Decodes an encoded URL parameter or query-string key.\n * @param key The encoded key name.\n * @returns The decoded key name.\n */\n decodeKey(key) {\n return decodeURIComponent(key);\n }\n /**\n * Decodes an encoded URL parameter or query-string value.\n * @param value The encoded value.\n * @returns The decoded value.\n */\n decodeValue(value) {\n return decodeURIComponent(value);\n }\n}\nfunction paramParser(rawParams, codec) {\n const map = new Map();\n if (rawParams.length > 0) {\n // The `window.location.search` can be used while creating an instance of the `HttpParams` class\n // (e.g. `new HttpParams({ fromString: window.location.search })`). The `window.location.search`\n // may start with the `?` char, so we strip it if it's present.\n const params = rawParams.replace(/^\\?/, '').split('&');\n params.forEach((param) => {\n const eqIdx = param.indexOf('=');\n const [key, val] = eqIdx == -1 ?\n [codec.decodeKey(param), ''] :\n [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))];\n const list = map.get(key) || [];\n list.push(val);\n map.set(key, list);\n });\n }\n return map;\n}\n/**\n * Encode input string with standard encodeURIComponent and then un-encode specific characters.\n */\nconst STANDARD_ENCODING_REGEX = /%(\\d[a-f0-9])/gi;\nconst STANDARD_ENCODING_REPLACEMENTS = {\n '40': '@',\n '3A': ':',\n '24': '$',\n '2C': ',',\n '3B': ';',\n '3D': '=',\n '3F': '?',\n '2F': '/',\n};\nfunction standardEncoding(v) {\n return encodeURIComponent(v).replace(STANDARD_ENCODING_REGEX, (s, t) => STANDARD_ENCODING_REPLACEMENTS[t] ?? s);\n}\nfunction valueToString(value) {\n return `${value}`;\n}\n/**\n * An HTTP request/response body that represents serialized parameters,\n * per the MIME type `application/x-www-form-urlencoded`.\n *\n * This class is immutable; all mutation operations return a new instance.\n *\n * @publicApi\n */\nclass HttpParams {\n constructor(options = {}) {\n this.updates = null;\n this.cloneFrom = null;\n this.encoder = options.encoder || new HttpUrlEncodingCodec();\n if (!!options.fromString) {\n if (!!options.fromObject) {\n throw new Error(`Cannot specify both fromString and fromObject.`);\n }\n this.map = paramParser(options.fromString, this.encoder);\n }\n else if (!!options.fromObject) {\n this.map = new Map();\n Object.keys(options.fromObject).forEach(key => {\n const value = options.fromObject[key];\n // convert the values to strings\n const values = Array.isArray(value) ? value.map(valueToString) : [valueToString(value)];\n this.map.set(key, values);\n });\n }\n else {\n this.map = null;\n }\n }\n /**\n * Reports whether the body includes one or more values for a given parameter.\n * @param param The parameter name.\n * @returns True if the parameter has one or more values,\n * false if it has no value or is not present.\n */\n has(param) {\n this.init();\n return this.map.has(param);\n }\n /**\n * Retrieves the first value for a parameter.\n * @param param The parameter name.\n * @returns The first value of the given parameter,\n * or `null` if the parameter is not present.\n */\n get(param) {\n this.init();\n const res = this.map.get(param);\n return !!res ? res[0] : null;\n }\n /**\n * Retrieves all values for a parameter.\n * @param param The parameter name.\n * @returns All values in a string array,\n * or `null` if the parameter not present.\n */\n getAll(param) {\n this.init();\n return this.map.get(param) || null;\n }\n /**\n * Retrieves all the parameters for this body.\n * @returns The parameter names in a string array.\n */\n keys() {\n this.init();\n return Array.from(this.map.keys());\n }\n /**\n * Appends a new value to existing values for a parameter.\n * @param param The parameter name.\n * @param value The new value to add.\n * @return A new body with the appended value.\n */\n append(param, value) {\n return this.clone({ param, value, op: 'a' });\n }\n /**\n * Constructs a new body with appended values for the given parameter name.\n * @param params parameters and values\n * @return A new body with the new value.\n */\n appendAll(params) {\n const updates = [];\n Object.keys(params).forEach(param => {\n const value = params[param];\n if (Array.isArray(value)) {\n value.forEach(_value => {\n updates.push({ param, value: _value, op: 'a' });\n });\n }\n else {\n updates.push({ param, value: value, op: 'a' });\n }\n });\n return this.clone(updates);\n }\n /**\n * Replaces the value for a parameter.\n * @param param The parameter name.\n * @param value The new value.\n * @return A new body with the new value.\n */\n set(param, value) {\n return this.clone({ param, value, op: 's' });\n }\n /**\n * Removes a given value or all values from a parameter.\n * @param param The parameter name.\n * @param value The value to remove, if provided.\n * @return A new body with the given value removed, or with all values\n * removed if no value is specified.\n */\n delete(param, value) {\n return this.clone({ param, value, op: 'd' });\n }\n /**\n * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are\n * separated by `&`s.\n */\n toString() {\n this.init();\n return this.keys()\n .map(key => {\n const eKey = this.encoder.encodeKey(key);\n // `a: ['1']` produces `'a=1'`\n // `b: []` produces `''`\n // `c: ['1', '2']` produces `'c=1&c=2'`\n return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value))\n .join('&');\n })\n // filter out empty values because `b: []` produces `''`\n // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't\n .filter(param => param !== '')\n .join('&');\n }\n clone(update) {\n const clone = new HttpParams({ encoder: this.encoder });\n clone.cloneFrom = this.cloneFrom || this;\n clone.updates = (this.updates || []).concat(update);\n return clone;\n }\n init() {\n if (this.map === null) {\n this.map = new Map();\n }\n if (this.cloneFrom !== null) {\n this.cloneFrom.init();\n this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key)));\n this.updates.forEach(update => {\n switch (update.op) {\n case 'a':\n case 's':\n const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || [];\n base.push(valueToString(update.value));\n this.map.set(update.param, base);\n break;\n case 'd':\n if (update.value !== undefined) {\n let base = this.map.get(update.param) || [];\n const idx = base.indexOf(valueToString(update.value));\n if (idx !== -1) {\n base.splice(idx, 1);\n }\n if (base.length > 0) {\n this.map.set(update.param, base);\n }\n else {\n this.map.delete(update.param);\n }\n }\n else {\n this.map.delete(update.param);\n break;\n }\n }\n });\n this.cloneFrom = this.updates = null;\n }\n }\n}\n\n/**\n * A token used to manipulate and access values stored in `HttpContext`.\n *\n * @publicApi\n */\nclass HttpContextToken {\n constructor(defaultValue) {\n this.defaultValue = defaultValue;\n }\n}\n/**\n * Http context stores arbitrary user defined values and ensures type safety without\n * actually knowing the types. It is backed by a `Map` and guarantees that keys do not clash.\n *\n * This context is mutable and is shared between cloned requests unless explicitly specified.\n *\n * @usageNotes\n *\n * ### Usage Example\n *\n * ```typescript\n * // inside cache.interceptors.ts\n * export const IS_CACHE_ENABLED = new HttpContextToken(() => false);\n *\n * export class CacheInterceptor implements HttpInterceptor {\n *\n * intercept(req: HttpRequest, delegate: HttpHandler): Observable> {\n * if (req.context.get(IS_CACHE_ENABLED) === true) {\n * return ...;\n * }\n * return delegate.handle(req);\n * }\n * }\n *\n * // inside a service\n *\n * this.httpClient.get('/api/weather', {\n * context: new HttpContext().set(IS_CACHE_ENABLED, true)\n * }).subscribe(...);\n * ```\n *\n * @publicApi\n */\nclass HttpContext {\n constructor() {\n this.map = new Map();\n }\n /**\n * Store a value in the context. If a value is already present it will be overwritten.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n * @param value The value to store.\n *\n * @returns A reference to itself for easy chaining.\n */\n set(token, value) {\n this.map.set(token, value);\n return this;\n }\n /**\n * Retrieve the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns The stored value or default if one is defined.\n */\n get(token) {\n if (!this.map.has(token)) {\n this.map.set(token, token.defaultValue());\n }\n return this.map.get(token);\n }\n /**\n * Delete the value associated with the given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns A reference to itself for easy chaining.\n */\n delete(token) {\n this.map.delete(token);\n return this;\n }\n /**\n * Checks for existence of a given token.\n *\n * @param token The reference to an instance of `HttpContextToken`.\n *\n * @returns True if the token exists, false otherwise.\n */\n has(token) {\n return this.map.has(token);\n }\n /**\n * @returns a list of tokens currently stored in the context.\n */\n keys() {\n return this.map.keys();\n }\n}\n\n/**\n * Determine whether the given HTTP method may include a body.\n */\nfunction mightHaveBody(method) {\n switch (method) {\n case 'DELETE':\n case 'GET':\n case 'HEAD':\n case 'OPTIONS':\n case 'JSONP':\n return false;\n default:\n return true;\n }\n}\n/**\n * Safely assert whether the given value is an ArrayBuffer.\n *\n * In some execution environments ArrayBuffer is not defined.\n */\nfunction isArrayBuffer(value) {\n return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer;\n}\n/**\n * Safely assert whether the given value is a Blob.\n *\n * In some execution environments Blob is not defined.\n */\nfunction isBlob(value) {\n return typeof Blob !== 'undefined' && value instanceof Blob;\n}\n/**\n * Safely assert whether the given value is a FormData instance.\n *\n * In some execution environments FormData is not defined.\n */\nfunction isFormData(value) {\n return typeof FormData !== 'undefined' && value instanceof FormData;\n}\n/**\n * Safely assert whether the given value is a URLSearchParams instance.\n *\n * In some execution environments URLSearchParams is not defined.\n */\nfunction isUrlSearchParams(value) {\n return typeof URLSearchParams !== 'undefined' && value instanceof URLSearchParams;\n}\n/**\n * An outgoing HTTP request with an optional typed body.\n *\n * `HttpRequest` represents an outgoing request, including URL, method,\n * headers, body, and other request configuration options. Instances should be\n * assumed to be immutable. To modify a `HttpRequest`, the `clone`\n * method should be used.\n *\n * @publicApi\n */\nclass HttpRequest {\n constructor(method, url, third, fourth) {\n this.url = url;\n /**\n * The request body, or `null` if one isn't set.\n *\n * Bodies are not enforced to be immutable, as they can include a reference to any\n * user-defined data type. However, interceptors should take care to preserve\n * idempotence by treating them as such.\n */\n this.body = null;\n /**\n * Whether this request should be made in a way that exposes progress events.\n *\n * Progress events are expensive (change detection runs on each event) and so\n * they should only be requested if the consumer intends to monitor them.\n */\n this.reportProgress = false;\n /**\n * Whether this request should be sent with outgoing credentials (cookies).\n */\n this.withCredentials = false;\n /**\n * The expected response type of the server.\n *\n * This is used to parse the response appropriately before returning it to\n * the requestee.\n */\n this.responseType = 'json';\n this.method = method.toUpperCase();\n // Next, need to figure out which argument holds the HttpRequestInit\n // options, if any.\n let options;\n // Check whether a body argument is expected. The only valid way to omit\n // the body argument is to use a known no-body method like GET.\n if (mightHaveBody(this.method) || !!fourth) {\n // Body is the third argument, options are the fourth.\n this.body = (third !== undefined) ? third : null;\n options = fourth;\n }\n else {\n // No body required, options are the third argument. The body stays null.\n options = third;\n }\n // If options have been passed, interpret them.\n if (options) {\n // Normalize reportProgress and withCredentials.\n this.reportProgress = !!options.reportProgress;\n this.withCredentials = !!options.withCredentials;\n // Override default response type of 'json' if one is provided.\n if (!!options.responseType) {\n this.responseType = options.responseType;\n }\n // Override headers if they're provided.\n if (!!options.headers) {\n this.headers = options.headers;\n }\n if (!!options.context) {\n this.context = options.context;\n }\n if (!!options.params) {\n this.params = options.params;\n }\n }\n // If no headers have been passed in, construct a new HttpHeaders instance.\n if (!this.headers) {\n this.headers = new HttpHeaders();\n }\n // If no context have been passed in, construct a new HttpContext instance.\n if (!this.context) {\n this.context = new HttpContext();\n }\n // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance.\n if (!this.params) {\n this.params = new HttpParams();\n this.urlWithParams = url;\n }\n else {\n // Encode the parameters to a string in preparation for inclusion in the URL.\n const params = this.params.toString();\n if (params.length === 0) {\n // No parameters, the visible URL is just the URL given at creation time.\n this.urlWithParams = url;\n }\n else {\n // Does the URL already have query parameters? Look for '?'.\n const qIdx = url.indexOf('?');\n // There are 3 cases to handle:\n // 1) No existing parameters -> append '?' followed by params.\n // 2) '?' exists and is followed by existing query string ->\n // append '&' followed by params.\n // 3) '?' exists at the end of the url -> append params directly.\n // This basically amounts to determining the character, if any, with\n // which to join the URL and parameters.\n const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : '');\n this.urlWithParams = url + sep + params;\n }\n }\n }\n /**\n * Transform the free-form body into a serialized format suitable for\n * transmission to the server.\n */\n serializeBody() {\n // If no body is present, no need to serialize it.\n if (this.body === null) {\n return null;\n }\n // Check whether the body is already in a serialized form. If so,\n // it can just be returned directly.\n if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) ||\n isUrlSearchParams(this.body) || typeof this.body === 'string') {\n return this.body;\n }\n // Check whether the body is an instance of HttpUrlEncodedParams.\n if (this.body instanceof HttpParams) {\n return this.body.toString();\n }\n // Check whether the body is an object or array, and serialize with JSON if so.\n if (typeof this.body === 'object' || typeof this.body === 'boolean' ||\n Array.isArray(this.body)) {\n return JSON.stringify(this.body);\n }\n // Fall back on toString() for everything else.\n return this.body.toString();\n }\n /**\n * Examine the body and attempt to infer an appropriate MIME type\n * for it.\n *\n * If no such type can be inferred, this method will return `null`.\n */\n detectContentTypeHeader() {\n // An empty body has no content type.\n if (this.body === null) {\n return null;\n }\n // FormData bodies rely on the browser's content type assignment.\n if (isFormData(this.body)) {\n return null;\n }\n // Blobs usually have their own content type. If it doesn't, then\n // no type can be inferred.\n if (isBlob(this.body)) {\n return this.body.type || null;\n }\n // Array buffers have unknown contents and thus no type can be inferred.\n if (isArrayBuffer(this.body)) {\n return null;\n }\n // Technically, strings could be a form of JSON data, but it's safe enough\n // to assume they're plain strings.\n if (typeof this.body === 'string') {\n return 'text/plain';\n }\n // `HttpUrlEncodedParams` has its own content-type.\n if (this.body instanceof HttpParams) {\n return 'application/x-www-form-urlencoded;charset=UTF-8';\n }\n // Arrays, objects, boolean and numbers will be encoded as JSON.\n if (typeof this.body === 'object' || typeof this.body === 'number' ||\n typeof this.body === 'boolean') {\n return 'application/json';\n }\n // No type could be inferred.\n return null;\n }\n clone(update = {}) {\n // For method, url, and responseType, take the current value unless\n // it is overridden in the update hash.\n const method = update.method || this.method;\n const url = update.url || this.url;\n const responseType = update.responseType || this.responseType;\n // The body is somewhat special - a `null` value in update.body means\n // whatever current body is present is being overridden with an empty\n // body, whereas an `undefined` value in update.body implies no\n // override.\n const body = (update.body !== undefined) ? update.body : this.body;\n // Carefully handle the boolean options to differentiate between\n // `false` and `undefined` in the update args.\n const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials;\n const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress;\n // Headers and params may be appended to if `setHeaders` or\n // `setParams` are used.\n let headers = update.headers || this.headers;\n let params = update.params || this.params;\n // Pass on context if needed\n const context = update.context ?? this.context;\n // Check whether the caller has asked to add headers.\n if (update.setHeaders !== undefined) {\n // Set every requested header.\n headers =\n Object.keys(update.setHeaders)\n .reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers);\n }\n // Check whether the caller has asked to set params.\n if (update.setParams) {\n // Set every requested param.\n params = Object.keys(update.setParams)\n .reduce((params, param) => params.set(param, update.setParams[param]), params);\n }\n // Finally, construct the new HttpRequest using the pieces from above.\n return new HttpRequest(method, url, body, {\n params,\n headers,\n context,\n reportProgress,\n responseType,\n withCredentials,\n });\n }\n}\n\n/**\n * Type enumeration for the different kinds of `HttpEvent`.\n *\n * @publicApi\n */\nvar HttpEventType;\n(function (HttpEventType) {\n /**\n * The request was sent out over the wire.\n */\n HttpEventType[HttpEventType[\"Sent\"] = 0] = \"Sent\";\n /**\n * An upload progress event was received.\n */\n HttpEventType[HttpEventType[\"UploadProgress\"] = 1] = \"UploadProgress\";\n /**\n * The response status code and headers were received.\n */\n HttpEventType[HttpEventType[\"ResponseHeader\"] = 2] = \"ResponseHeader\";\n /**\n * A download progress event was received.\n */\n HttpEventType[HttpEventType[\"DownloadProgress\"] = 3] = \"DownloadProgress\";\n /**\n * The full response including the body was received.\n */\n HttpEventType[HttpEventType[\"Response\"] = 4] = \"Response\";\n /**\n * A custom event from an interceptor or a backend.\n */\n HttpEventType[HttpEventType[\"User\"] = 5] = \"User\";\n})(HttpEventType || (HttpEventType = {}));\n/**\n * Base class for both `HttpResponse` and `HttpHeaderResponse`.\n *\n * @publicApi\n */\nclass HttpResponseBase {\n /**\n * Super-constructor for all responses.\n *\n * The single parameter accepted is an initialization hash. Any properties\n * of the response passed there will override the default values.\n */\n constructor(init, defaultStatus = 200 /* HttpStatusCode.Ok */, defaultStatusText = 'OK') {\n // If the hash has values passed, use them to initialize the response.\n // Otherwise use the default values.\n this.headers = init.headers || new HttpHeaders();\n this.status = init.status !== undefined ? init.status : defaultStatus;\n this.statusText = init.statusText || defaultStatusText;\n this.url = init.url || null;\n // Cache the ok value to avoid defining a getter.\n this.ok = this.status >= 200 && this.status < 300;\n }\n}\n/**\n * A partial HTTP response which only includes the status and header data,\n * but no response body.\n *\n * `HttpHeaderResponse` is a `HttpEvent` available on the response\n * event stream, only when progress events are requested.\n *\n * @publicApi\n */\nclass HttpHeaderResponse extends HttpResponseBase {\n /**\n * Create a new `HttpHeaderResponse` with the given parameters.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.ResponseHeader;\n }\n /**\n * Copy this `HttpHeaderResponse`, overriding its contents with the\n * given parameter hash.\n */\n clone(update = {}) {\n // Perform a straightforward initialization of the new HttpHeaderResponse,\n // overriding the current parameters with new ones if given.\n return new HttpHeaderResponse({\n headers: update.headers || this.headers,\n status: update.status !== undefined ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A full HTTP response, including a typed response body (which may be `null`\n * if one was not returned).\n *\n * `HttpResponse` is a `HttpEvent` available on the response event\n * stream.\n *\n * @publicApi\n */\nclass HttpResponse extends HttpResponseBase {\n /**\n * Construct a new `HttpResponse`.\n */\n constructor(init = {}) {\n super(init);\n this.type = HttpEventType.Response;\n this.body = init.body !== undefined ? init.body : null;\n }\n clone(update = {}) {\n return new HttpResponse({\n body: (update.body !== undefined) ? update.body : this.body,\n headers: update.headers || this.headers,\n status: (update.status !== undefined) ? update.status : this.status,\n statusText: update.statusText || this.statusText,\n url: update.url || this.url || undefined,\n });\n }\n}\n/**\n * A response that represents an error or failure, either from a\n * non-successful HTTP status, an error while executing the request,\n * or some other failure which occurred during the parsing of the response.\n *\n * Any error returned on the `Observable` response stream will be\n * wrapped in an `HttpErrorResponse` to provide additional context about\n * the state of the HTTP layer when the error occurred. The error property\n * will contain either a wrapped Error object or the error response returned\n * from the server.\n *\n * @publicApi\n */\nclass HttpErrorResponse extends HttpResponseBase {\n constructor(init) {\n // Initialize with a default status of 0 / Unknown Error.\n super(init, 0, 'Unknown Error');\n this.name = 'HttpErrorResponse';\n /**\n * Errors are never okay, even when the status code is in the 2xx success range.\n */\n this.ok = false;\n // If the response was successful, then this was a parse error. Otherwise, it was\n // a protocol-level failure of some sort. Either the request failed in transit\n // or the server returned an unsuccessful status code.\n if (this.status >= 200 && this.status < 300) {\n this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`;\n }\n else {\n this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`;\n }\n this.error = init.error || null;\n }\n}\n\n/**\n * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and\n * the given `body`. This function clones the object and adds the body.\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n *\n */\nfunction addBody(options, body) {\n return {\n body,\n headers: options.headers,\n context: options.context,\n observe: options.observe,\n params: options.params,\n reportProgress: options.reportProgress,\n responseType: options.responseType,\n withCredentials: options.withCredentials,\n };\n}\n/**\n * Performs HTTP requests.\n * This service is available as an injectable class, with methods to perform HTTP requests.\n * Each request method has multiple signatures, and the return type varies based on\n * the signature that is called (mainly the values of `observe` and `responseType`).\n *\n * Note that the `responseType` *options* value is a String that identifies the\n * single data type of the response.\n * A single overload version of the method handles each response type.\n * The value of `responseType` cannot be a union, as the combined signature could imply.\n\n *\n * @usageNotes\n * Sample HTTP requests for the [Tour of Heroes](/tutorial/tour-of-heroes/toh-pt0) application.\n *\n * ### HTTP Request Example\n *\n * ```\n * // GET heroes whose name contains search term\n * searchHeroes(term: string): observable{\n *\n * const params = new HttpParams({fromString: 'name=term'});\n * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params});\n * }\n * ```\n *\n * Alternatively, the parameter string can be used without invoking HttpParams\n * by directly joining to the URL.\n * ```\n * this.httpClient.request('GET', this.heroesUrl + '?' + 'name=term', {responseType:'json'});\n * ```\n *\n *\n * ### JSONP Example\n * ```\n * requestJsonp(url, callback = 'callback') {\n * return this.httpClient.jsonp(this.heroesURL, callback);\n * }\n * ```\n *\n * ### PATCH Example\n * ```\n * // PATCH one of the heroes' name\n * patchHero (id: number, heroName: string): Observable<{}> {\n * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42\n * return this.httpClient.patch(url, {name: heroName}, httpOptions)\n * .pipe(catchError(this.handleError('patchHero')));\n * }\n * ```\n *\n * @see [HTTP Guide](guide/http)\n * @see [HTTP Request](api/common/http/HttpRequest)\n *\n * @publicApi\n */\nclass HttpClient {\n constructor(handler) {\n this.handler = handler;\n }\n /**\n * Constructs an observable for a generic HTTP request that, when subscribed,\n * fires the request through the chain of registered interceptors and on to the\n * server.\n *\n * You can pass an `HttpRequest` directly as the only parameter. In this case,\n * the call returns an observable of the raw `HttpEvent` stream.\n *\n * Alternatively you can pass an HTTP method as the first parameter,\n * a URL string as the second, and an options hash containing the request body as the third.\n * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the\n * type of returned observable.\n * * The `responseType` value determines how a successful response body is parsed.\n * * If `responseType` is the default `json`, you can pass a type interface for the resulting\n * object as a type parameter to the call.\n *\n * The `observe` value determines the return type, according to what you are interested in\n * observing.\n * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including\n * progress events by default.\n * * An `observe` value of response returns an observable of `HttpResponse`,\n * where the `T` parameter depends on the `responseType` and any optionally provided type\n * parameter.\n * * An `observe` value of body returns an observable of `` with the same `T` body type.\n *\n */\n request(first, url, options = {}) {\n let req;\n // First, check whether the primary argument is an instance of `HttpRequest`.\n if (first instanceof HttpRequest) {\n // It is. The other arguments must be undefined (per the signatures) and can be\n // ignored.\n req = first;\n }\n else {\n // It's a string, so it represents a URL. Construct a request based on it,\n // and incorporate the remaining arguments (assuming `GET` unless a method is\n // provided.\n // Figure out the headers.\n let headers = undefined;\n if (options.headers instanceof HttpHeaders) {\n headers = options.headers;\n }\n else {\n headers = new HttpHeaders(options.headers);\n }\n // Sort out parameters.\n let params = undefined;\n if (!!options.params) {\n if (options.params instanceof HttpParams) {\n params = options.params;\n }\n else {\n params = new HttpParams({ fromObject: options.params });\n }\n }\n // Construct the request.\n req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), {\n headers,\n context: options.context,\n params,\n reportProgress: options.reportProgress,\n // By default, JSON is assumed to be returned for all calls.\n responseType: options.responseType || 'json',\n withCredentials: options.withCredentials,\n });\n }\n // Start with an Observable.of() the initial request, and run the handler (which\n // includes all interceptors) inside a concatMap(). This way, the handler runs\n // inside an Observable chain, which causes interceptors to be re-run on every\n // subscription (this also makes retries re-run the handler, including interceptors).\n const events$ = of(req).pipe(concatMap((req) => this.handler.handle(req)));\n // If coming via the API signature which accepts a previously constructed HttpRequest,\n // the only option is to get the event stream. Otherwise, return the event stream if\n // that is what was requested.\n if (first instanceof HttpRequest || options.observe === 'events') {\n return events$;\n }\n // The requested stream contains either the full response or the body. In either\n // case, the first step is to filter the event stream to extract a stream of\n // responses(s).\n const res$ = events$.pipe(filter((event) => event instanceof HttpResponse));\n // Decide which stream to return.\n switch (options.observe || 'body') {\n case 'body':\n // The requested stream is the body. Map the response stream to the response\n // body. This could be done more simply, but a misbehaving interceptor might\n // transform the response body into a different format and ignore the requested\n // responseType. Guard against this by validating that the response is of the\n // requested type.\n switch (req.responseType) {\n case 'arraybuffer':\n return res$.pipe(map((res) => {\n // Validate that the body is an ArrayBuffer.\n if (res.body !== null && !(res.body instanceof ArrayBuffer)) {\n throw new Error('Response is not an ArrayBuffer.');\n }\n return res.body;\n }));\n case 'blob':\n return res$.pipe(map((res) => {\n // Validate that the body is a Blob.\n if (res.body !== null && !(res.body instanceof Blob)) {\n throw new Error('Response is not a Blob.');\n }\n return res.body;\n }));\n case 'text':\n return res$.pipe(map((res) => {\n // Validate that the body is a string.\n if (res.body !== null && typeof res.body !== 'string') {\n throw new Error('Response is not a string.');\n }\n return res.body;\n }));\n case 'json':\n default:\n // No validation needed for JSON responses, as they can be of any type.\n return res$.pipe(map((res) => res.body));\n }\n case 'response':\n // The response stream was requested directly, so return it.\n return res$;\n default:\n // Guard against new future observe types being added.\n throw new Error(`Unreachable: unhandled observe type ${options.observe}}`);\n }\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `DELETE` request to execute on the server. See the individual overloads for\n * details on the return type.\n *\n * @param url The endpoint URL.\n * @param options The HTTP options to send with the request.\n *\n */\n delete(url, options = {}) {\n return this.request('DELETE', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `GET` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n get(url, options = {}) {\n return this.request('GET', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `HEAD` request to execute on the server. The `HEAD` method returns\n * meta information about the resource without transferring the\n * resource itself. See the individual overloads for\n * details on the return type.\n */\n head(url, options = {}) {\n return this.request('HEAD', url, options);\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes a request with the special method\n * `JSONP` to be dispatched via the interceptor pipeline.\n * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain\n * API endpoints that don't support newer,\n * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol.\n * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the\n * requests even if the API endpoint is not located on the same domain (origin) as the client-side\n * application making the request.\n * The endpoint API must support JSONP callback for JSONP requests to work.\n * The resource API returns the JSON response wrapped in a callback function.\n * You can pass the callback function name as one of the query parameters.\n * Note that JSONP requests can only be used with `GET` requests.\n *\n * @param url The resource URL.\n * @param callbackParam The callback function name.\n *\n */\n jsonp(url, callbackParam) {\n return this.request('JSONP', url, {\n params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'),\n observe: 'body',\n responseType: 'json',\n });\n }\n /**\n * Constructs an `Observable` that, when subscribed, causes the configured\n * `OPTIONS` request to execute on the server. This method allows the client\n * to determine the supported HTTP methods and other capabilities of an endpoint,\n * without implying a resource action. See the individual overloads for\n * details on the return type.\n */\n options(url, options = {}) {\n return this.request('OPTIONS', url, options);\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PATCH` request to execute on the server. See the individual overloads for\n * details on the return type.\n */\n patch(url, body, options = {}) {\n return this.request('PATCH', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `POST` request to execute on the server. The server responds with the location of\n * the replaced resource. See the individual overloads for\n * details on the return type.\n */\n post(url, body, options = {}) {\n return this.request('POST', url, addBody(options, body));\n }\n /**\n * Constructs an observable that, when subscribed, causes the configured\n * `PUT` request to execute on the server. The `PUT` method replaces an existing resource\n * with a new set of values.\n * See the individual overloads for details on the return type.\n */\n put(url, body, options = {}) {\n return this.request('PUT', url, addBody(options, body));\n }\n}\nHttpClient.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpClient, deps: [{ token: HttpHandler }], target: i0.ɵɵFactoryTarget.Injectable });\nHttpClient.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpClient });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpClient, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpHandler }]; } });\n\nfunction interceptorChainEndFn(req, finalHandlerFn) {\n return finalHandlerFn(req);\n}\n/**\n * Constructs a `ChainedInterceptorFn` which adapts a legacy `HttpInterceptor` to the\n * `ChainedInterceptorFn` interface.\n */\nfunction adaptLegacyInterceptorToChain(chainTailFn, interceptor) {\n return (initialRequest, finalHandlerFn) => interceptor.intercept(initialRequest, {\n handle: (downstreamRequest) => chainTailFn(downstreamRequest, finalHandlerFn),\n });\n}\n/**\n * Constructs a `ChainedInterceptorFn` which wraps and invokes a functional interceptor in the given\n * injector.\n */\nfunction chainedInterceptorFn(chainTailFn, interceptorFn, injector) {\n // clang-format off\n return (initialRequest, finalHandlerFn) => injector.runInContext(() => interceptorFn(initialRequest, downstreamRequest => chainTailFn(downstreamRequest, finalHandlerFn)));\n // clang-format on\n}\n/**\n * A multi-provider token that represents the array of registered\n * `HttpInterceptor` objects.\n *\n * @publicApi\n */\nconst HTTP_INTERCEPTORS = new InjectionToken('HTTP_INTERCEPTORS');\n/**\n * A multi-provided token of `HttpInterceptorFn`s.\n */\nconst HTTP_INTERCEPTOR_FNS = new InjectionToken('HTTP_INTERCEPTOR_FNS');\n/**\n * Creates an `HttpInterceptorFn` which lazily initializes an interceptor chain from the legacy\n * class-based interceptors and runs the request through it.\n */\nfunction legacyInterceptorFnFactory() {\n let chain = null;\n return (req, handler) => {\n if (chain === null) {\n const interceptors = inject(HTTP_INTERCEPTORS, { optional: true }) ?? [];\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `interceptors` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n chain = interceptors.reduceRight(adaptLegacyInterceptorToChain, interceptorChainEndFn);\n }\n return chain(req, handler);\n };\n}\nclass HttpInterceptorHandler extends HttpHandler {\n constructor(backend, injector) {\n super();\n this.backend = backend;\n this.injector = injector;\n this.chain = null;\n }\n handle(initialRequest) {\n if (this.chain === null) {\n const dedupedInterceptorFns = Array.from(new Set(this.injector.get(HTTP_INTERCEPTOR_FNS)));\n // Note: interceptors are wrapped right-to-left so that final execution order is\n // left-to-right. That is, if `dedupedInterceptorFns` is the array `[a, b, c]`, we want to\n // produce a chain that is conceptually `c(b(a(end)))`, which we build from the inside\n // out.\n this.chain = dedupedInterceptorFns.reduceRight((nextSequencedFn, interceptorFn) => chainedInterceptorFn(nextSequencedFn, interceptorFn, this.injector), interceptorChainEndFn);\n }\n return this.chain(initialRequest, downstreamRequest => this.backend.handle(downstreamRequest));\n }\n}\nHttpInterceptorHandler.ɵfac = i0.ɵɵngDeclareFactory({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpInterceptorHandler, deps: [{ token: HttpBackend }, { token: i0.EnvironmentInjector }], target: i0.ɵɵFactoryTarget.Injectable });\nHttpInterceptorHandler.ɵprov = i0.ɵɵngDeclareInjectable({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpInterceptorHandler });\ni0.ɵɵngDeclareClassMetadata({ minVersion: \"12.0.0\", version: \"15.2.9\", ngImport: i0, type: HttpInterceptorHandler, decorators: [{\n type: Injectable\n }], ctorParameters: function () { return [{ type: HttpBackend }, { type: i0.EnvironmentInjector }]; } });\n\n// Every request made through JSONP needs a callback name that's unique across the\n// whole page. Each request is assigned an id and the callback name is constructed\n// from that. The next id to be assigned is tracked in a global variable here that\n// is shared among all applications on the page.\nlet nextRequestId = 0;\n/**\n * When a pending